diff --git a/.vscode/ftp-kr.sync.cache.json b/.vscode/ftp-kr.sync.cache.json
index 92edc8a1..ff94d1b2 100644
--- a/.vscode/ftp-kr.sync.cache.json
+++ b/.vscode/ftp-kr.sync.cache.json
@@ -64,7 +64,7 @@
},
"custom-script.php": {
"type": "-",
- "size": 1916,
+ "size": 1917,
"lmtime": 0,
"modified": true
},
@@ -98,7 +98,7 @@
},
"google-merchant_id-1.xml": {
"type": "-",
- "size": 17843650,
+ "size": 17970012,
"lmtime": 0,
"modified": true
},
diff --git a/modules/cookiesplus/.htaccess b/modules/cookiesplus/.htaccess
new file mode 100644
index 00000000..3576e0c8
--- /dev/null
+++ b/modules/cookiesplus/.htaccess
@@ -0,0 +1,14 @@
+# Apache 2.2
+
+
+ order allow,deny
+ deny from all
+
+
+
+# Apache 2.4
+
+
+ Require all denied
+
+
diff --git a/modules/cookiesplus/CHANGELOG.md b/modules/cookiesplus/CHANGELOG.md
new file mode 100644
index 00000000..43affc8f
--- /dev/null
+++ b/modules/cookiesplus/CHANGELOG.md
@@ -0,0 +1,15 @@
+CHANGELOG
+=========
+
+1.6.0
+-----
+
+ * Added support for Google Consent Mode V2
+
+1.5.9
+-----
+
+ * User.agents for bot list updated
+ * Auto configure for 'ps_facebook' module
+ * Removed JS from PHP
+ * Identify the theme to set the correcty icon library on the installation
\ No newline at end of file
diff --git a/modules/cookiesplus/COOKIES.gif b/modules/cookiesplus/COOKIES.gif
new file mode 100644
index 00000000..eed463bf
Binary files /dev/null and b/modules/cookiesplus/COOKIES.gif differ
diff --git a/modules/cookiesplus/LICENSE.txt b/modules/cookiesplus/LICENSE.txt
new file mode 100644
index 00000000..ad9477c5
--- /dev/null
+++ b/modules/cookiesplus/LICENSE.txt
@@ -0,0 +1,32 @@
+Copyright (c) 2024 idnovate.com
+idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+
+This source file is the exclusive property of the copyright holder
+and is protected by copyright laws and international treaty provisions.
+
+You may not resell, distribute, or transfer this source file to any third party
+without the prior written consent of the copyright holder.
+
+This source file may not be reverse-engineered, decompiled, disassembled, or modified in any way.
+
+This license is effective until terminated. The license will terminate automatically
+without notice from the copyright holder if you fail to comply with any provision of this license.
+
+Upon termination of this license, you must immediately cease all use of this source file
+and destroy all copies of this source file in your possession.
+
+This license constitutes the entire agreement between you and the copyright holder
+and supersedes all prior agreements, whether written or oral, relating to this source file.
+
+This license shall be governed by and construed in accordance with the laws of the country
+in which the copyright holder resides, without giving effect to any principles of conflicts of law.
+
+Any disputes arising under or in connection with this license shall be resolved in the courts of the country in which the copyright holder resides.
+
+THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+PERFORMANCE OF THIS SOFTWARE.
diff --git a/modules/cookiesplus/classes/CookiesPlusCookie.php b/modules/cookiesplus/classes/CookiesPlusCookie.php
new file mode 100644
index 00000000..c0b496c8
--- /dev/null
+++ b/modules/cookiesplus/classes/CookiesPlusCookie.php
@@ -0,0 +1,3945 @@
+ 'cookiesplus_cookie',
+ 'primary' => 'id_cookiesplus_cookie',
+ 'multilang' => true,
+ 'fields' => [
+ 'id_cookiesplus_cookie' => ['type' => self::TYPE_INT, 'validate' => 'isUnsignedId', 'copy_post' => false],
+ 'id_shop' => ['type' => self::TYPE_INT, 'validate' => 'isUnsignedId', 'copy_post' => false],
+ 'active' => ['type' => self::TYPE_BOOL, 'validate' => 'isBool'],
+ 'id_cookiesplus_finality' => ['type' => self::TYPE_INT, 'validate' => 'isUnsignedId', 'required' => true],
+ 'name' => ['type' => self::TYPE_STRING, 'required' => true],
+ 'provider' => ['type' => self::TYPE_STRING],
+ 'provider_url' => ['type' => self::TYPE_STRING],
+ 'purpose' => ['type' => self::TYPE_STRING, 'validate' => 'isAnything', 'lang' => true],
+ 'expiry' => ['type' => self::TYPE_STRING, 'validate' => 'isAnything', 'lang' => true],
+ ],
+ ];
+
+ public function __construct($id = null, $id_lang = null, $id_shop = null, $translator = null)
+ {
+ global $_FIELDS;
+
+ $module = Module::getInstanceByName($this->module_name);
+
+ $_FIELDS[get_class($this) . '_' . md5('id_cookiesplus_finality')] = $module->l('Cookie finality');
+ $_FIELDS[get_class($this) . '_' . md5('name')] = $module->l('Cookie name');
+
+ parent::__construct($id, $id_lang, $id_shop, $translator);
+ }
+
+ public function add($autodate = true, $null_values = false)
+ {
+ $this->id_shop = ($this->id_shop) ?: Context::getContext()->shop->id;
+
+ return parent::add($autodate, $null_values);
+ }
+
+ public function update($null_values = false)
+ {
+ $result = parent::update($null_values);
+
+ if (Tools::getValue('back') && (int) Tools::getvalue('id_cookiesplus_finality')) {
+ Tools::redirectAdmin(Context::getContext()->link->getAdminLink('AdminCookiesPlusFinalities') . '&updatecookiesplus_finality=&conf=4&id_cookiesplus_finality=' . (int) Tools::getvalue('id_cookiesplus_finality'));
+ }
+
+ return $result;
+ }
+
+ public static function getCookiesPlusCookies($id_cookiesplus_finality, $id_lang = null, $only_active = false, $id_shop = null)
+ {
+ if ($id_shop === null) {
+ $id_shop = (int) Context::getContext()->shop->id;
+ }
+
+ $query = '
+ SELECT *
+ FROM ' . _DB_PREFIX_ . 'cookiesplus_cookie cc '
+ . 'LEFT JOIN ' . _DB_PREFIX_ . 'cookiesplus_cookie_lang ccl on cc.`id_cookiesplus_cookie` = ccl.`id_cookiesplus_cookie`
+ WHERE
+ `id_cookiesplus_finality` = ' . (int) $id_cookiesplus_finality . '
+ AND ccl.`id_lang` = ' . ($id_lang ? (int) $id_lang : (int) Context::getContext()->language->id) .
+ ($only_active ? ' AND cc.`active` = 1' : '') .
+ ' AND cc.`id_shop` = ' . $id_shop .
+ ' ORDER BY cc.`name`;
+ ';
+
+ return Db::getInstance()->executeS($query);
+ }
+
+ public static function getDefaultValues($cookiesPlusFinality)
+ {
+ /*
+ array(
+ 'active' => 0,
+ 'modules' => array(),
+ 'name' => '',
+ 'provider' => Tools::getHttpHost(),
+ 'provider_url' => '',
+ 'purpose' => array(
+ 'en' => '',
+ 'es' => '',
+ 'ag' => '',
+ 'cb' => '',
+ 'mx' => '',
+ 'fr' => '',
+ 'qc' => '',
+ 'pl' => '',
+ 'ro' => '',
+ 'pt' => '',
+ 'br' => '',
+ 'sk' => '',
+ 'nl' => '',
+ 'de' => '',
+ 'gr' => '',
+ 'it' => '',
+ 'si' => '',
+ 'da' => '',
+ 'no' => '',
+ 'cs' => '',
+ 'hu' => '',
+ ),
+ 'expiry' => array(
+ 'en' => '',
+ 'es' => '',
+ 'ag' => '',
+ 'cb' => '',
+ 'mx' => '',
+ 'fr' => '',
+ 'qc' => '',
+ 'pl' => '',
+ 'ro' => '',
+ 'pt' => '',
+ 'br' => '',
+ 'sk' => '',
+ 'nl' => '',
+ 'de' => '',
+ 'gr' => '',
+ 'it' => '',
+ 'si' => '',
+ 'da' => '',
+ 'no' => '',
+ 'cs' => '',
+ 'hu' => '',
+ 'sv' => '',
+ )
+ ),
+ */
+ $cookiesPlusCookieDefaultValues = [
+ CookiesPlusFinality::NECESSARY_COOKIE => [
+ [
+ 'active' => 1,
+ 'name' => 'cookiesplus',
+ 'provider' => Tools::getHttpHost(),
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => 'Stores your cookie preferences.',
+ 'es' => 'Almacena las preferencias sobre cookies.',
+ 'ag' => 'Almacena las preferencias sobre cookies.',
+ 'cb' => 'Almacena las preferencias sobre cookies.',
+ 'mx' => 'Almacena las preferencias sobre cookies.',
+ 'fr' => 'Conserver vos préférences en matière de cookies.',
+ 'qc' => 'Conserver vos préférences en matière de cookies.',
+ 'pl' => 'Zapamiętuje preferencje dotyczące plików cookie.',
+ 'ro' => 'Reține preferințele dvs. legate de modulele cookie.',
+ 'pt' => 'Guarda as suas preferências quanto aos cookies.',
+ 'br' => 'Guarda as suas preferências quanto aos cookies.',
+ 'sk' => 'ukladá vaše preferencie týkajúce sa súborov cookie.',
+ 'nl' => 'Slaat uw cookie-voorkeuren op.',
+ 'de' => 'Speichert Ihre Cookie-Einstellungen.',
+ 'gr' => 'Αποθηκεύει τις προτιμήσεις σας για τα cookies.',
+ 'it' => 'Ricorda le tue preferenze in fatto di cookie.',
+ 'si' => 'shranjuje vaše nastavitve piškotkov..',
+ 'da' => 'Gemmer dine cookiepræferencer.',
+ 'no' => 'Lagrer informasjonskapselpreferansene dine.',
+ 'cs' => 'ukládá vaše preference týkající se cookies.',
+ 'hu' => 'A cookie-kkal kapcsolatos beállításokat tárolja.',
+ 'sv' => 'Sparar dina inställningar för kakor.',
+ ],
+ 'expiry' => [
+ 'en' => '1 year',
+ 'es' => '1 año',
+ 'ag' => '1 año',
+ 'cb' => '1 año',
+ 'mx' => '1 año',
+ 'fr' => '1 année',
+ 'qc' => '1 année',
+ 'pl' => '1 rok',
+ 'ro' => '1 an',
+ 'pt' => '1 ano',
+ 'br' => '1 ano',
+ 'sk' => '1 rok',
+ 'nl' => '1 jaar',
+ 'de' => '1 Jahr',
+ 'gr' => '1 χρόνος',
+ 'it' => '1 anno',
+ 'si' => '1 leto',
+ 'da' => '1 år',
+ 'no' => '1 år',
+ 'cs' => '1 rok',
+ 'hu' => '1 év',
+ 'sv' => '1 år',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'name' => 'PHP_SESSID',
+ 'provider' => Tools::getHttpHost(),
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => 'This cookie is native to PHP and enables websites to store serialised state data. It is used to establish a user session and to pass state data via a temporary cookie, which is commonly referred to as a session cookie.',
+ 'es' => 'Esta cookie es nativa de PHP y permite a los sitios web almacenar datos de estado serializados. Se utiliza para establecer una sesión de usuario y para pasar datos de estado a través de una cookie temporal, que comúnmente se conoce como cookie de sesión.',
+ 'ag' => 'Esta cookie es nativa de PHP y permite a los sitios web almacenar datos de estado serializados. Se utiliza para establecer una sesión de usuario y para pasar datos de estado a través de una cookie temporal, que comúnmente se conoce como cookie de sesión.',
+ 'cb' => 'Esta cookie es nativa de PHP y permite a los sitios web almacenar datos de estado serializados. Se utiliza para establecer una sesión de usuario y para pasar datos de estado a través de una cookie temporal, que comúnmente se conoce como cookie de sesión.',
+ 'mx' => 'Esta cookie es nativa de PHP y permite a los sitios web almacenar datos de estado serializados. Se utiliza para establecer una sesión de usuario y para pasar datos de estado a través de una cookie temporal, que comúnmente se conoce como cookie de sesión.',
+ 'fr' => 'Ce cookie est natif de PHP et permet aux sites Web de stocker des données d\'état sérialisées. Il est utilisé pour établir une session utilisateur et pour transmettre des données d\'état via un cookie temporaire, couramment appelé cookie de session.',
+ 'qc' => 'Ce cookie est natif de PHP et permet aux sites Web de stocker des données d\'état sérialisées. Il est utilisé pour établir une session utilisateur et pour transmettre des données d\'état via un cookie temporaire, couramment appelé cookie de session.',
+ 'pl' => 'Ten plik cookie pochodzi z języka PHP i umożliwia witrynom przechowywanie zserializowanych danych stanu. Służy do ustanowienia sesji użytkownika i przekazywania danych o stanie za pośrednictwem tymczasowego pliku cookie, który jest powszechnie nazywany plikiem cookie sesji.',
+ 'ro' => 'Acest cookie este originar din PHP și permite site-urilor web să stocheze date de stare serializate. Este utilizat pentru a stabili o sesiune de utilizator și pentru a transmite date de stare printr-un cookie temporar, care este denumit în mod obișnuit un cookie de sesiune.',
+ 'pt' => 'Este cookie é nativo do PHP e permite que sites armazenem dados de estado serializados. Ele é usado para estabelecer uma sessão de usuário e para passar dados de estado por meio de um cookie temporário, comumente referido como um cookie de sessão.',
+ 'br' => 'Este cookie é nativo do PHP e permite que sites armazenem dados de estado serializados. Ele é usado para estabelecer uma sessão de usuário e para passar dados de estado por meio de um cookie temporário, comumente referido como um cookie de sessão.',
+ 'sk' => 'Tento súbor cookie je pôvodom z jazyka PHP a umožňuje webovým serverom ukladať údaje o sériovom stave. Používa sa na vytvorenie relácie používateľa a na odovzdanie údajov o stave prostredníctvom dočasného súboru cookie, ktorý sa bežne označuje ako súbor cookie relácie.',
+ 'nl' => 'Deze cookie is eigen aan PHP en stelt websites in staat om geserialiseerde statusgegevens op te slaan. Het wordt gebruikt om een gebruikerssessie tot stand te brengen en om statusgegevens door te geven via een tijdelijke cookie, die gewoonlijk een sessiecookie wordt genoemd.',
+ 'de' => 'Dieses Cookie stammt ursprünglich aus PHP und ermöglicht es Websites, serialisierte Statusdaten zu speichern. Es wird verwendet, um eine Benutzersitzung einzurichten und Statusdaten über ein temporäres Cookie zu übergeben, das üblicherweise als Sitzungscookie bezeichnet wird.',
+ 'gr' => 'Αυτό το cookie είναι εγγενές στην PHP και επιτρέπει στους ιστότοπους να αποθηκεύουν σειριακά δεδομένα κατάστασης. Χρησιμοποιείται για τον καθορισμό μιας περιόδου λειτουργίας χρήστη και για τη διαβίβαση δεδομένων κατάστασης μέσω ενός προσωρινού cookie, το οποίο συνήθως αναφέρεται ως cookie περιόδου λειτουργίας.',
+ 'it' => 'Questo cookie è nativo di PHP e consente ai siti Web di memorizzare dati di stato serializzati. Viene utilizzato per stabilire una sessione utente e per trasmettere i dati sullo stato tramite un cookie temporaneo, comunemente denominato cookie di sessione.',
+ 'si' => 'Ta piškotek je izvorni jezik PHP in spletnim mestom omogoča shranjevanje serializiranih podatkov o državi. Uporablja se za vzpostavitev uporabniške seje in posredovanje podatkov o stanju prek začasnega piškotka, ki ga običajno imenujemo piškotek seje.',
+ 'da' => 'Denne cookie er hjemmehørende i PHP og gør det muligt for websteder at gemme serielle statusdata. Det bruges til at etablere en brugersession og til at overføre tilstandsdata via en midlertidig cookie, der almindeligvis kaldes en session-cookie.',
+ 'no' => 'Denne informasjonskapselen er innfødt i PHP og gjør det mulig for nettsteder å lagre serielle tilstandsdata. Den brukes til å etablere en brukersession og til å overføre tilstandsdata via en midlertidig informasjonskapsel, som ofte blir referert til som en økt-informasjonskapsel.',
+ 'cs' => 'Tento soubor cookie je původem z PHP a umožňuje webovým serverům ukládat údaje o stavu serializace. Používá se k navázání relace uživatele a k předávání údajů o stavu prostřednictvím dočasného souboru cookie, který se běžně označuje jako soubor cookie relace.',
+ 'hu' => 'Ez a süti natív a PHP-ben, és lehetővé teszi a webhelyek számára a sorosított állapotadatok tárolását. Felhasználói munkamenet létrehozására és állapotadatok átadására szolgál ideiglenes cookie-n keresztül, amelyet általában munkamenet-süti néven emlegetnek.',
+ 'sv' => '',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ 'active' => 1,
+ 'name' => 'PrestaShop-#',
+ 'provider' => Tools::getHttpHost(),
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => 'This cookie helps keep user sessions open while they are visiting a website, and help them make orders and many more operations such as: cookie add date, selected language, used currency, last product category visited, last seen products, client identification, name, first name, encrypted password, email linked to the account, shopping cart identification.',
+ 'es' => 'Esta cookie permite conservar abiertas las sesiones del usuario durante su visita y le permite pasar un pedido o toda una serie de funcionamientos como: fecha de adición de la cookie, idioma seleccionado, divisa utilizada, última categoría de producto visitado, productos recientemente vistos, acuerdo de utilización de servicios del sitio, identificador del cliente, identificador de conexión, apellido, nombre, estado conectado, su contraseña cifrada, e-mail relacionado con la cuenta del cliente y el identificador del carrito.',
+ 'ag' => 'Esta cookie permite conservar abiertas las sesiones del usuario durante su visita y le permite pasar un pedido o toda una serie de funcionamientos como: fecha de adición de la cookie, idioma seleccionado, divisa utilizada, última categoría de producto visitado, productos recientemente vistos, acuerdo de utilización de servicios del sitio, identificador del cliente, identificador de conexión, apellido, nombre, estado conectado, su contraseña cifrada, e-mail relacionado con la cuenta del cliente y el identificador del carrito.',
+ 'cb' => 'Esta cookie permite conservar abiertas las sesiones del usuario durante su visita y le permite pasar un pedido o toda una serie de funcionamientos como: fecha de adición de la cookie, idioma seleccionado, divisa utilizada, última categoría de producto visitado, productos recientemente vistos, acuerdo de utilización de servicios del sitio, identificador del cliente, identificador de conexión, apellido, nombre, estado conectado, su contraseña cifrada, e-mail relacionado con la cuenta del cliente y el identificador del carrito.',
+ 'mx' => 'Esta cookie permite conservar abiertas las sesiones del usuario durante su visita y le permite pasar un pedido o toda una serie de funcionamientos como: fecha de adición de la cookie, idioma seleccionado, divisa utilizada, última categoría de producto visitado, productos recientemente vistos, acuerdo de utilización de servicios del sitio, identificador del cliente, identificador de conexión, apellido, nombre, estado conectado, su contraseña cifrada, e-mail relacionado con la cuenta del cliente y el identificador del carrito.',
+ 'fr' => 'Ce cookie permet de garder les sessions de l\'utilisateur ouvertes pendant leur visite, et lui permettre de passer commande ou tout un ensemble de fonctionnement tels que : date d\'ajout du cookie, langue sélectionnée, devise utilisée, dernière catégorie de produit visité, produits récemment vus, accord d\'utilisation de services du site, Identifiant client, identifiant de connexion, nom, prénom, état connecté, votre mot de passe chiffré, e-mail lié au compte client, l\'identifiant du panier.',
+ 'qc' => 'Ce cookie permet de garder les sessions de l\'utilisateur ouvertes pendant leur visite, et lui permettre de passer commande ou tout un ensemble de fonctionnement tels que : date d\'ajout du cookie, langue sélectionnée, devise utilisée, dernière catégorie de produit visité, produits récemment vus, accord d\'utilisation de services du site, Identifiant client, identifiant de connexion, nom, prénom, état connecté, votre mot de passe chiffré, e-mail lié au compte client, l\'identifiant du panier.',
+ 'pl' => 'Ten plik cookie pomaga utrzymać otwarte sesje użytkownika podczas odwiedzania strony internetowej i pomaga im w składaniu zamówień i wielu innych operacjach, takich jak: data dodania pliku cookie, wybrany język, używana waluta, ostatnia odwiedzana kategoria produktów, ostatnio oglądane produkty, identyfikacja klienta, imię, imię, zaszyfrowane hasło, adres e-mail powiązany z kontem, identyfikacja koszyka.',
+ 'ro' => 'Acest cookie ajută la menținerea sesiunilor utilizatorului deschise în timp ce vizitează un site web și îi ajută să facă comenzi și multe alte operațiuni, cum ar fi: data adăugării cookie-ului, limba selectată, moneda utilizată, ultima categorie de produse vizitate, ultimele produse văzute, identificarea clientului, numele, prenume, parolă criptată, e-mail conectat la cont, identificare coș de cumpărături.',
+ 'pt' => 'Este cookie ajuda a manter as sessões do usuário abertas enquanto eles estão visitando um site, e os ajuda a fazer pedidos e muitas outras operações, como: data de adição do cookie, idioma selecionado, moeda usada, última categoria de produto visitada, produtos vistos pela última vez, identificação do cliente, nome, nome, senha criptografada, e-mail vinculado à conta, identificação do carrinho de compras.',
+ 'br' => 'Este cookie ajuda a manter as sessões do usuário abertas enquanto eles estão visitando um site, e os ajuda a fazer pedidos e muitas outras operações, como: data de adição do cookie, idioma selecionado, moeda usada, última categoria de produto visitada, produtos vistos pela última vez, identificação do cliente, nome, nome, senha criptografada, e-mail vinculado à conta, identificação do carrinho de compras.',
+ 'sk' => 'Tento súbor cookie pomáha udržiavať relácie používateľa otvorené pri návšteve webových stránok a pomáha im pri objednávaní a mnohých ďalších operáciách, ako napríklad: dátum pridania súboru cookie, zvolený jazyk, použitá mena, posledná navštívená kategória produktu, naposledy zobrazené produkty, identifikácia klienta, meno, krstné meno, šifrované heslo, e-mail prepojený s účtom, identifikácia nákupného košíka.',
+ 'nl' => 'Deze cookie helpt gebruikerssessies open te houden terwijl ze een website bezoeken, en helpt hen bij het plaatsen van bestellingen en veel meer bewerkingen zoals: datum toevoegen van cookies, geselecteerde taal, gebruikte valuta, laatst bezochte productcategorie, laatst geziene producten, klantidentificatie, naam, voornaam, gecodeerd wachtwoord, e-mailadres dat aan het account is gekoppeld, identificatie van het winkelwagentje.',
+ 'de' => 'Mit diesem Cookie können Benutzersitzungen während des Besuchs einer Website geöffnet bleiben und Bestellungen und viele weitere Vorgänge ausführen, z. B.: Datum des Hinzufügens des Cookies, ausgewählte Sprache, verwendete Währung, zuletzt besuchte Produktkategorie, zuletzt gesehene Produkte, Kundenidentifikation, Name, Vorname, verschlüsseltes Passwort, mit dem Konto verknüpfte E-Mail, Warenkorbidentifikation.',
+ 'gr' => 'Αυτό το cookie βοηθά στη διατήρηση ανοικτών περιόδων σύνδεσης χρηστών κατά την επίσκεψή τους σε έναν ιστότοπο και τους βοηθά να κάνουν παραγγελίες και πολλές άλλες λειτουργίες όπως: ημερομηνία προσθήκης cookie, επιλεγμένη γλώσσα, χρησιμοποιημένο νόμισμα, τελευταία κατηγορία προϊόντων που επισκεφτήκατε, προϊόντα που είδατε τελευταία, αναγνώριση πελάτη, όνομα όνομα, κρυπτογραφημένος κωδικός πρόσβασης, διεύθυνση ηλεκτρονικού ταχυδρομείου που συνδέεται με τον λογαριασμό, αναγνώριση καλαθιού αγορών.',
+ 'it' => 'Questo cookie aiuta a mantenere aperte le sessioni dell\'utente mentre sta visitando un sito web e lo aiuta a effettuare ordini e molte altre operazioni come: data di aggiunta del cookie, lingua selezionata, valuta utilizzata, ultima categoria di prodotto visitata, prodotti visti per ultimi, identificazione del cliente, nome, nome, password crittografata, e-mail collegata all\'account, identificazione del carrello.',
+ 'si' => 'Ta piškotek pomaga, da uporabniške seje ostanejo odprte med obiskom spletnega mesta, in jim pomaga pri naročanju ter številnih drugih operacijah, kot so: datum dodajanja piškotkov, izbrani jezik, uporabljena valuta, zadnja obiskana kategorija izdelkov, zadnji vidni izdelki, identifikacija stranke, ime, ime, šifrirano geslo, e-pošta, povezana z računom, identifikacija košarice.',
+ 'da' => 'Denne cookie hjælper med at holde brugersessioner åbne, mens de besøger et websted, og hjælper dem med at foretage ordrer og mange flere handlinger såsom: tilføjelsesdato for cookie, valgt sprog, brugt valuta, sidst besøgte produktkategori, sidst set produkter, klientidentifikation, navn, fornavn, krypteret adgangskode, e-mail knyttet til kontoen, indkøbskurvidentifikation.',
+ 'no' => 'Denne informasjonskapselen hjelper med å holde brukersesjonene åpne mens de besøker et nettsted, og hjelper dem med å bestille og mange flere operasjoner, for eksempel: informasjonskapsel legge til dato, valgt språk, brukt valuta, sist besøkte produktkategori, sist sett produkter, klientidentifikasjon, navn, fornavn, kryptert passord, e-post tilknyttet kontoen, handlekurvidentifikasjon.',
+ 'cs' => 'Tento soubor cookie pomáhá udržovat relace uživatelů otevřené, když navštěvují web, a pomáhá jim provádět objednávky a mnoho dalších operací, jako jsou: datum přidání souboru cookie, vybraný jazyk, použitá měna, poslední navštívená kategorie produktů, naposledy viděné produkty, identifikace klienta, jméno, křestní jméno, šifrované heslo, e-mail propojený s účtem, identifikace nákupního košíku.',
+ 'hu' => 'Ez a süti segít nyitva tartani a felhasználói munkameneteket, amíg ők egy webhelyet látogatnak, és segít nekik megrendeléseket és még sok más műveletet végrehajtani, például: süti hozzáadásának dátuma, kiválasztott nyelv, használt pénznem, utoljára látogatott termékkategória, utoljára látott termékek, kliens azonosító, név, keresztnév, titkosított jelszó, a fiókhoz kapcsolódó e-mail, kosár azonosító.',
+ 'sv' => 'Denna cookie hjälper till att hålla användarsessioner öppna medan de besöker en webbplats och hjälper dem att göra beställningar och många fler operationer, såsom: cookie-tilläggsdatum, valt språk, använd valuta, senast besökta produktkategori, senast sett produkter, klientidentifiering, namn, förnamn, krypterat lösenord, e-post länkad till kontot, identifiering av kundvagn.',
+ ],
+ 'expiry' => [
+ 'en' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' hours',
+ 'es' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' horas',
+ 'ag' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' horas',
+ 'cb' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' horas',
+ 'mx' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' horas',
+ 'fr' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' heures',
+ 'qc' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' heures',
+ 'pl' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' godziny',
+ 'ro' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' ore',
+ 'pt' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' horas',
+ 'br' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' horas',
+ 'sk' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' hodín',
+ 'nl' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' uren',
+ 'de' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' Std',
+ 'gr' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' ώρες',
+ 'it' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' ore',
+ 'si' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' ure',
+ 'da' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' timer',
+ 'no' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' timer',
+ 'cs' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' hodin',
+ 'hu' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' órák',
+ 'hu' => Configuration::get('PS_COOKIE_LIFETIME_FO') . ' timmar',
+ ],
+ ],
+ [
+ /* Crisp chat */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => '__cfduid',
+ 'provider' => '',
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => 'Technical cookies required by CDN provider Cloudflare.',
+ 'es' => 'Cookies técnicas requeridas por el proveedor de CDN Cloudflare.',
+ 'ag' => 'Cookies técnicas requeridas por el proveedor de CDN Cloudflare.',
+ 'cb' => 'Cookies técnicas requeridas por el proveedor de CDN Cloudflare.',
+ 'mx' => 'Cookies técnicas requeridas por el proveedor de CDN Cloudflare.',
+ 'fr' => 'Cookies techniques requis par le fournisseur de CDN Cloudflare.',
+ 'qc' => 'Cookies techniques requis par le fournisseur de CDN Cloudflare.',
+ 'pl' => 'Techniczne pliki cookie wymagane przez dostawcę CDN Cloudflare.',
+ 'ro' => 'Cookie-uri tehnice solicitate de furnizorul CDN Cloudflare.',
+ 'pt' => 'Cookies técnicos exigidos pelo provedor de CDN Cloudflare.',
+ 'br' => 'Cookies técnicos exigidos pelo provedor de CDN Cloudflare.',
+ 'sk' => 'Technické súbory cookie požadované poskytovateľom CDN Cloudflare.',
+ 'nl' => 'Technische cookies vereist door CDN-provider Cloudflare.',
+ 'de' => 'Technische Cookies, die vom CDN-Anbieter Cloudflare.',
+ 'gr' => 'Απαιτούνται τεχνικά cookie από τον πάροχο CDN Cloudflare.',
+ 'it' => 'Cookie tecnici richiesti dal provider di CDN Cloudflare.',
+ 'si' => 'Tehnični piškotki, ki jih potrebuje ponudnik CDN Cloudflare.',
+ 'da' => 'Tekniske cookies krævet af CDN-udbyder Cloudflare.',
+ 'no' => 'Tekniske informasjonskapsler som kreves av CDN-leverandøren Cloudflare.',
+ 'cs' => 'Technické soubory cookie vyžadované poskytovatelem CDN Cloudflare.',
+ 'hu' => 'A Cloudflare CDN-szolgáltató által megkövetelt technikai cookie-k annak biztosítására.',
+ 'sv' => 'Tekniska kakor krävs av CDN-leverantören Cloudflare.',
+ ],
+ 'expiry' => [
+ 'en' => '30 days',
+ 'es' => '30 días',
+ 'ag' => '30 días',
+ 'cb' => '30 días',
+ 'mx' => '30 días',
+ 'fr' => '30 jours',
+ 'qc' => '30 jours',
+ 'pl' => '30 dni',
+ 'ro' => '30 de zile',
+ 'pt' => '30 dias',
+ 'br' => '30 dias',
+ 'sk' => '30 dní',
+ 'nl' => '30 dagen',
+ 'de' => '30 Tage',
+ 'gr' => '30 μέρες',
+ 'it' => '30 giorni',
+ 'si' => '30 dni',
+ 'da' => '30 dage',
+ 'no' => '30 dager',
+ 'cs' => '30 dager',
+ 'hu' => '30 nap',
+ 'sv' => '30 dagar',
+ ],
+ ],
+ [
+ /* Crisp chat */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'crisp-client/session',
+ 'provider' => 'Crisp Chat',
+ 'provider_url' => 'https://help.crisp.chat/en/article/crisp-chatbox-cookie-and-ip-policy-1147xor/',
+ 'purpose' => [
+ 'en' => 'Used to make the Crisp Chat consistant when going to your website. Without this cookie, the customer would have a new chat session everytime he switchs to a new page.',
+ 'es' => 'Se utiliza para hacer que Crisp Chat sea coherente al visitar su sitio web Sin esta cookie, el cliente tendría una nueva sesión de chat cada vez que cambia a una nueva página.',
+ 'ag' => 'Se utiliza para hacer que Crisp Chat sea coherente al visitar su sitio web Sin esta cookie, el cliente tendría una nueva sesión de chat cada vez que cambia a una nueva página.',
+ 'cb' => 'Se utiliza para hacer que Crisp Chat sea coherente al visitar su sitio web Sin esta cookie, el cliente tendría una nueva sesión de chat cada vez que cambia a una nueva página.',
+ 'mx' => 'Se utiliza para hacer que Crisp Chat sea coherente al visitar su sitio web Sin esta cookie, el cliente tendría una nueva sesión de chat cada vez que cambia a una nueva página.',
+ 'fr' => 'Utilisé pour rendre le Crisp Chat cohérent lorsque vous accédez à votre site Web. Sans ce cookie, le client aurait une nouvelle session de chat à chaque fois qu\'il passe à une nouvelle page.',
+ 'qc' => 'Utilisé pour rendre le Crisp Chat cohérent lorsque vous accédez à votre site Web. Sans ce cookie, le client aurait une nouvelle session de chat à chaque fois qu\'il passe à une nouvelle page.',
+ 'pl' => 'Służy do zapewnienia spójności Crisp Chat podczas odwiedzania Twojej witryny. Bez tego pliku cookie klient miałby nową sesję czatu za każdym razem, gdy przełączy się na nową stronę.',
+ 'ro' => 'Folosit pentru a face Crisp Chat consecvent atunci când accesați site-ul dvs. web. Fără acest cookie, clientul ar avea o nouă sesiune de chat de fiecare dată când trece la o pagină nouă.',
+ 'pt' => 'Usado para tornar o Crisp Chat consistente ao acessar seu site. Sem este cookie, o cliente teria uma nova sessão de chat cada vez que mudasse para uma nova página.',
+ 'br' => 'Usado para tornar o Crisp Chat consistente ao acessar seu site. Sem este cookie, o cliente teria uma nova sessão de chat cada vez que mudasse para uma nova página.',
+ 'sk' => 'Používa sa na zabezpečenie konzistencie Crisp Chat, keď idete na svoj web. Bez tohto súboru cookie by zákazník mal novú chatovú reláciu zakaždým, keď prejde na novú stránku.',
+ 'nl' => 'Wordt gebruikt om de Crisp Chat consistent te maken wanneer u naar uw website gaat. Zonder deze cookie zou de klant een nieuwe chatsessie hebben elke keer dat hij naar een nieuwe pagina overschakelt.',
+ 'de' => 'Wird verwendet, um den Crisp Chat beim Aufrufen Ihrer Website konsistent zu machen. Ohne dieses Cookie würde der Kunde jedes Mal eine neue Chat-Sitzung haben, wenn er zu einer neuen Seite wechselt.',
+ 'gr' => 'Χρησιμοποιήθηκε για να κάνει το Crisp Chat συνεπές όταν μεταβαίνετε στον ιστότοπό σας. Χωρίς αυτό το cookie, ο πελάτης θα έχει μια νέα συνεδρία συνομιλίας κάθε φορά που αλλάζει σε μια νέα σελίδα.',
+ 'it' => 'Utilizzato per rendere coerente Crisp Chat quando si visita il tuo sito web. Senza questo cookie, il cliente avrebbe una nuova sessione di chat ogni volta che passa a una nuova pagina.',
+ 'si' => 'Uporablja se za uskladitev + jasnega + klepeta pri obisku vašega spletnega mesta. Brez tega piškotka bi imel kupec novo sejo klepeta vsakič, ko preklopi na novo stran.',
+ 'da' => 'Bruges til at gøre Crisp Chat konsekvent, når du går til dit websted. Uden denne cookie ville kunden have en ny chat-session hver gang han skifter til en ny side.',
+ 'no' => 'Brukes til å gjøre Crisp Chat konsekvent når du går til nettstedet ditt. Uten denne informasjonskapselen ville kunden ha en ny chat-økt hver gang han bytter til en ny side.',
+ 'cs' => 'Slouží k zajištění konzistence Crisp Chat při přechodu na váš web. Bez tohoto cookie by zákazník měl novou relaci chatu pokaždé, když přepne na novou stránku.',
+ 'hu' => 'Arra szolgál, hogy a Crisp Chat konzisztens legyen, amikor webhelyére megy. E süti nélkül az ügyfél minden alkalommal új csevegést folytat, amikor új oldalra vált.',
+ 'sv' => 'Används för att göra Crisp Chat konsekvent när du går till din webbplats. Utan denna cookie skulle kunden ha en ny chattperiod varje gång han byter till en ny sida.',
+ ],
+ 'expiry' => [
+ 'en' => '6 months',
+ 'es' => '6 meses',
+ 'ag' => '6 meses',
+ 'cb' => '6 meses',
+ 'mx' => '6 meses',
+ 'fr' => '6 mois',
+ 'qc' => '6 mois',
+ 'pl' => '6 miesiące',
+ 'ro' => '6 luni',
+ 'pt' => '6 meses',
+ 'br' => '6 meses',
+ 'sk' => '6 mesiace',
+ 'nl' => '6 maanden',
+ 'de' => '6 Monate',
+ 'gr' => '6 μήνες',
+ 'it' => '6 mesi',
+ 'si' => '6 meseca',
+ 'da' => '6 mdr.',
+ 'no' => '6 måneder',
+ 'cs' => '6 měsíců',
+ 'hu' => '6 hónap',
+ 'sv' => '6 månader',
+ ],
+ ],
+ [
+ /* Youtube */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'rc::a',
+ 'provider' => 'Google',
+ 'provider_url' => 'https://policies.google.com/privacy',
+ 'purpose' => [
+ 'en' => 'This cookie is used to distinguish between humans and bots. This is beneficial for the website, in order to make valid reports on the use of their website.',
+ 'es' => 'Esta cookie se utiliza para distinguir entre humanos y bots. Esto es beneficioso para la web con el objeto de elaborar informes válidos sobre el uso de su web.',
+ 'ag' => 'Esta cookie se utiliza para distinguir entre humanos y bots. Esto es beneficioso para la web con el objeto de elaborar informes válidos sobre el uso de su web.',
+ 'cb' => 'Esta cookie se utiliza para distinguir entre humanos y bots. Esto es beneficioso para la web con el objeto de elaborar informes válidos sobre el uso de su web.',
+ 'mx' => 'Esta cookie se utiliza para distinguir entre humanos y bots. Esto es beneficioso para la web con el objeto de elaborar informes válidos sobre el uso de su web.',
+ 'fr' => 'Ce cookie est utilisé pour distinguer les humains des robots. Ceci est bénéfique pour le site web afin de créer des rapports valides sur l\'utilisation du leur site.',
+ 'qc' => 'Ce cookie est utilisé pour distinguer les humains des robots. Ceci est bénéfique pour le site web afin de créer des rapports valides sur l\'utilisation du leur site.',
+ 'pl' => 'Ten plik cookie służy do odróżniania ludzi od robotów. Jest to korzystne dla witryny internetowej, aby tworzyć prawidłowe raporty na temat korzystania z jej witryny.',
+ 'ro' => 'Acest cookie este utilizat pentru a distinge oamenii de roboți. Acest lucru este benefic pentru site-ul web pentru a crea rapoarte valabile cu privire la utilizarea site-ului lor.',
+ 'pt' => 'Este cookie é usado para distinguir humanos de robôs. Isso é benéfico para o site criar relatórios válidos sobre o uso de seu site.',
+ 'br' => 'Este cookie é usado para distinguir humanos de robôs. Isso é benéfico para o site criar relatórios válidos sobre o uso de seu site.',
+ 'sk' => 'Tento súbor cookie sa používa na odlíšenie ľudí od robotov. To je prospešné pre webovú stránku, pretože vytvára platné správy o používaní svojej webovej stránky.',
+ 'nl' => 'Deze cookie wordt gebruikt om onderscheid te maken tussen mensen en bots. Dit is gunstig voor de website om juiste rapporten over het gebruik van de website te maken.',
+ 'de' => 'Dieser Cookie wird verwendet, um zwischen Menschen und Bots zu unterscheiden. Dies ist vorteilhaft für die webseite, um gültige Berichte über die Nutzung ihrer webseite zu erstellen.',
+ 'gr' => 'Αυτό το cookie χρησιμοποιείται για να διακρίνει τους ανθρώπους από τα ρομπότ. Αυτό είναι ωφέλιμο για τον ιστότοπο να δημιουργεί έγκυρες αναφορές σχετικά με τη χρήση του ιστότοπού τους.',
+ 'it' => 'Questo cookie è usato per distinguere tra umani e robot. Questo è utile per il sito web, al fine di rendere validi rapporti sull\'uso del sito.',
+ 'si' => '',
+ 'da' => 'Benyttes til at bestemme, om brugeren er en virkelig person eller en software-robot - Dette muliggør skabelsen af valide rapporter om brugen af hjemmesiden.',
+ 'no' => 'Denne informasjonskapselen brukes til å skille mennesker fra roboter. Dette er gunstig for nettstedet å lage gyldige rapporter om bruken av nettstedet deres.',
+ 'cs' => 'Tento soubor cookie se používá k odlišení lidí od robotů. To je pro web přínosné pro vytváření platných zpráv o používání jejich stránek.',
+ 'hu' => 'Ezt a sütit használják az emberek és a robotok megkülönböztetésére. Ez hasznos a weboldal számára, hogy érvényes jelentéseket készítsen a webhelyük használatáról.',
+ 'sv' => 'Denna cookie används för att skilja mellan människor och bots. Detta är fördelaktigt för webbplatsen för att göra giltiga rapporter om användningen av deras webbplats.',
+ ],
+ 'expiry' => [
+ 'en' => 'Persistent',
+ 'es' => 'Persistente',
+ 'ag' => 'Persistente',
+ 'cb' => 'Persistente',
+ 'mx' => 'Persistente',
+ 'fr' => 'Persistant',
+ 'qc' => 'Persistant',
+ 'pl' => 'Trwały',
+ 'ro' => 'Persistent',
+ 'pt' => 'Persistente',
+ 'br' => 'Persistente',
+ 'sk' => 'Vytrvalý',
+ 'nl' => 'Aanhoudend',
+ 'de' => 'Hartnäckig',
+ 'gr' => 'Επίμονος',
+ 'it' => 'Persistente',
+ 'si' => 'Vztrajno',
+ 'da' => 'Vedholdende',
+ 'no' => 'Vedvarende',
+ 'cs' => 'Trvalý',
+ 'hu' => 'Kitartó',
+ 'sv' => 'Beständig',
+ ],
+ ],
+ [
+ /* Youtube */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'rc::c',
+ 'provider' => 'Google',
+ 'provider_url' => 'https://policies.google.com/privacy',
+ 'purpose' => [
+ 'en' => 'This cookie is used to distinguish between humans and bots.',
+ 'es' => 'Esta cookie se utiliza para distinguir entre humanos y bots.',
+ 'ag' => 'Esta cookie se utiliza para distinguir entre humanos y bots.',
+ 'cb' => 'Esta cookie se utiliza para distinguir entre humanos y bots.',
+ 'mx' => 'Esta cookie se utiliza para distinguir entre humanos y bots.',
+ 'fr' => 'Ce cookie est utilisé pour distinguer les humains des robots.',
+ 'qc' => 'Ce cookie est utilisé pour distinguer les humains des robots.',
+ 'pl' => 'Ten plik cookie służy do rozróżniania ludzi i botów.',
+ 'ro' => 'Acest cookie este utilizat pentru a distinge între oameni și roboți..',
+ 'pt' => 'Este cookie é usado para distinguir entre humanos e bots.',
+ 'br' => 'Este cookie é usado para distinguir entre humanos e bots.',
+ 'sk' => 'Tento súbor cookie sa používa na rozlíšenie ľudí a robotov.',
+ 'nl' => 'Deze cookie wordt gebruikt om onderscheid te maken tussen mensen en bots.',
+ 'de' => 'Dieser Cookie wird verwendet, um zwischen Menschen und Bots zu unterscheiden.',
+ 'gr' => 'Αυτό το cookie χρησιμοποιείται για τη διάκριση μεταξύ ανθρώπων και ρομπότ.',
+ 'it' => 'Questo cookie è usato per distinguere tra umani e robot.',
+ 'si' => 'Tento súbor cookie sa používa na rozlíšenie ľudí a robotov.',
+ 'da' => 'Benyttes til at bestemme, om brugeren er en virkelig person eller en robot.',
+ 'no' => 'Denne informasjonskapselen brukes til å skille mellom mennesker og roboter.',
+ 'cs' => 'Tento soubor cookie se používá k rozlišení mezi lidmi a roboty.',
+ 'hu' => 'Ezt a sütit használják az emberek és a botok megkülönböztetésére.',
+ 'sv' => 'Denna cookie används för att skilja mellan människor och bots.',
+ ],
+ 'expiry' => [
+ 'en' => 'Persistent',
+ 'es' => 'Persistente',
+ 'ag' => 'Persistente',
+ 'cb' => 'Persistente',
+ 'mx' => 'Persistente',
+ 'fr' => 'Persistant',
+ 'qc' => 'Persistant',
+ 'pl' => 'Trwały',
+ 'ro' => 'Persistent',
+ 'pt' => 'Persistente',
+ 'br' => 'Persistente',
+ 'sk' => 'Vytrvalý',
+ 'nl' => 'Aanhoudend',
+ 'de' => 'Hartnäckig',
+ 'gr' => 'Επίμονος',
+ 'it' => 'Persistente',
+ 'si' => 'Vztrajno',
+ 'da' => 'Vedholdende',
+ 'no' => 'Vedvarende',
+ 'cs' => 'Trvalý',
+ 'hu' => 'Kitartó',
+ 'sv' => 'Beständig',
+ ],
+ ],
+ [
+ /* Crisp chat */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'crisp-client/domain-detect',
+ 'provider' => 'Crisp Chat',
+ 'provider_url' => 'https://help.crisp.chat/en/article/crisp-chatbox-cookie-and-ip-policy-1147xor/',
+ 'purpose' => [
+ 'en' => 'Disables features for Crisp Chat that are having too many visitors at the same time',
+ 'es' => 'Desactiva las funciones de Crisp Chat que tienen demasiados visitantes al mismo tiempo',
+ 'ag' => 'Desactiva las funciones de Crisp Chat que tienen demasiados visitantes al mismo tiempo',
+ 'cb' => 'Desactiva las funciones de Crisp Chat que tienen demasiados visitantes al mismo tiempo',
+ 'mx' => 'Desactiva las funciones de Crisp Chat que tienen demasiados visitantes al mismo tiempo',
+ 'fr' => 'Désactive les fonctionnalités pour Crisp Chat qui ont trop de visiteurs en même temps',
+ 'qc' => 'Désactive les fonctionnalités pour Crisp Chat qui ont trop de visiteurs en même temps',
+ 'pl' => 'Wyłącza funkcje Crisp Chat, które mają zbyt wielu odwiedzających w tym samym czasie',
+ 'ro' => 'Dezactivează funcțiile pentru Crisp Chat care au prea mulți vizitatori în același timp',
+ 'pt' => 'Desativa recursos do Crisp Chat que estão recebendo muitos visitantes ao mesmo tempo',
+ 'br' => 'Desativa recursos do Crisp Chat que estão recebendo muitos visitantes ao mesmo tempo',
+ 'sk' => 'Zakáže funkcie pre Crisp Chat, ktoré majú príliš veľa návštevníkov súčasne',
+ 'nl' => 'Schakelt functies uit voor Crisp Chat die te veel bezoekers tegelijkertijd hebben',
+ 'de' => 'Deaktiviert Funktionen für Crisp Chat, die zu viele Besucher gleichzeitig haben',
+ 'gr' => 'Απενεργοποιεί τις λειτουργίες για Crisp Chat που έχουν πάρα πολλούς επισκέπτες ταυτόχρονα',
+ 'it' => 'Disabilita le funzionalità per Crisp Chat che hanno troppi visitatori contemporaneamente',
+ 'si' => 'Onemogoči funkcije za Crisp Chat, ki imajo hkrati preveč obiskovalcev',
+ 'da' => 'Deaktiverer funktioner til Crisp Chat, der har for mange besøgende på samme tid',
+ 'no' => 'Deaktiver funksjoner for Crisp Chat som har for mange besøkende samtidig',
+ 'cs' => 'Zakáže funkce pro Crisp Chat, které mají příliš mnoho návštěvníků současně',
+ 'hu' => 'Letiltja azokat a Crisp Chat funkciókat, amelyek túl sok látogatóval rendelkeznek egyszerre',
+ 'sv' => 'Inaktiverar funktioner för Crisp Chat som har för många besökare samtidigt',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'laravel_session',
+ 'provider' => Tools::getHttpHost(),
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => 'Cookie used to identify a session instance for the user.',
+ 'es' => 'Cookie utilizada para identificar una instancia de sesión para el usuario.',
+ 'ag' => 'Cookie utilizada para identificar una instancia de sesión para el usuario.',
+ 'cb' => 'Cookie utilizada para identificar una instancia de sesión para el usuario.',
+ 'mx' => 'Cookie utilizada para identificar una instancia de sesión para el usuario.',
+ 'fr' => 'Cookie utilisé pour identifier une instance de session pour l\'utilisateur.',
+ 'qc' => 'Cookie utilisé pour identifier une instance de session pour l\'utilisateur.',
+ 'pl' => 'Plik cookie używany do identyfikacji instancji sesji dla użytkownika.',
+ 'ro' => 'Cookie folosit pentru a identifica o instanță de sesiune pentru utilizator.',
+ 'pt' => 'Cookie usado para identificar uma instância de sessão para o usuário.',
+ 'br' => 'Cookie usado para identificar uma instância de sessão para o usuário.',
+ 'sk' => 'Cookie používaný na identifikáciu inštancie relácie pre používateľa.',
+ 'nl' => 'Cookie dat wordt gebruikt om een sessie-instantie voor de gebruiker te identificeren.',
+ 'de' => 'Cookie zur Identifizierung einer Sitzungsinstanz für den Benutzer.',
+ 'gr' => 'Το cookie χρησιμοποιείται για την αναγνώριση μιας παρουσίας περιόδου σύνδεσης για τον χρήστη.',
+ 'it' => 'Cookie utilizzato per identificare un\'istanza di sessione per l\'utente.',
+ 'si' => 'Cookie používaný na identifikáciu inštancie relácie pre používateľa.',
+ 'da' => 'Cookie bruges til at identificere en sessionsforekomst for brugeren.',
+ 'no' => 'Informasjonskapsel brukes til å identifisere en øktforekomst for brukeren.',
+ 'cs' => 'Cookie slouží k identifikaci instance relace pro uživatele.',
+ 'hu' => 'A cookie azonosítja a munkamenet példányát a felhasználó számára.',
+ 'sv' => 'Cookie används för att identifiera en sessionsinstans för användaren.',
+ ],
+ 'expiry' => [
+ 'en' => '1 day',
+ 'es' => '1 día',
+ 'ag' => '1 día',
+ 'cb' => '1 día',
+ 'mx' => '1 día',
+ 'fr' => '1 jour',
+ 'qc' => '1 jour',
+ 'pl' => '1 dzień',
+ 'ro' => '1 zi',
+ 'pt' => '1 dia',
+ 'br' => '1 dia',
+ 'sk' => '1 deň',
+ 'nl' => '1 dag',
+ 'de' => '1 Tag',
+ 'gr' => '1 μέρα',
+ 'it' => '1 giorno',
+ 'si' => '1 dan',
+ 'da' => '1 dag',
+ 'no' => '1 dag',
+ 'cs' => '1 den',
+ 'hu' => '1 nap',
+ 'sv' => '1 dag',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'CONSENT',
+ 'provider' => 'youtube.com',
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => 'Used to detect if the visitor has accepted the marketing category in the cookie banner. This cookie is necessary for GDPR-compliance of the website.',
+ 'es' => 'Utilizada para detectar si el visitante ha aceptado la categoría de marketing en el banner de cookies. Esta cookie es necesaria para que la web cumpla con el RGPD.',
+ 'ag' => 'Utilizada para detectar si el visitante ha aceptado la categoría de marketing en el banner de cookies. Esta cookie es necesaria para que la web cumpla con el RGPD.',
+ 'cb' => 'Utilizada para detectar si el visitante ha aceptado la categoría de marketing en el banner de cookies. Esta cookie es necesaria para que la web cumpla con el RGPD.',
+ 'mx' => 'Utilizada para detectar si el visitante ha aceptado la categoría de marketing en el banner de cookies. Esta cookie es necesaria para que la web cumpla con el RGPD.',
+ 'fr' => 'Utilisé pour détecter si le visiteur a accepté la catégorie marketing dans la bannière de cookie. Ce cookie est nécessaire pour la conformité du site Web avec le RGPD.',
+ 'qc' => 'Utilisé pour détecter si le visiteur a accepté la catégorie marketing dans la bannière de cookie. Ce cookie est nécessaire pour la conformité du site Web avec le RGPD.',
+ 'pl' => '',
+ 'ro' => '',
+ 'pt' => '',
+ 'br' => '',
+ 'sk' => '',
+ 'nl' => '',
+ 'de' => 'Wird verwendet, um festzu stellen, ob der Besucher die Marketingkategorie im Cookie-Banner akzeptierthat. Dieser Cookie ist notwendig für die Einhaltung der DSGVO der Webseite.',
+ 'gr' => '',
+ 'it' => 'Utilizzato per rilevare se il visitatore ha accettato la categoria di marketing nel banner dei cookie. Questo cookie è necessario per la conformità GDPR del sito web.',
+ 'si' => '',
+ 'da' => 'Viser, hvorvidt den besøgende hartilvalgt cookies i marketin gkategorien. Cookien er nødvendig for overholdelsen af GDPR-regu lativet.',
+ 'no' => '',
+ 'cs' => '',
+ 'hu' => '',
+ 'sv' => '',
+ ],
+ 'expiry' => [
+ 'en' => '2 years',
+ 'es' => '2 años',
+ 'ag' => '2 años',
+ 'cb' => '2 años',
+ 'mx' => '2 años',
+ 'fr' => '2 années',
+ 'qc' => '2 années',
+ 'pl' => '2 lata',
+ 'ro' => '2 ani',
+ 'pt' => '2 anos',
+ 'br' => '2 anos',
+ 'sk' => '2 roky',
+ 'nl' => '2 jaar',
+ 'de' => '2 Jahre',
+ 'gr' => '2 χρόνια',
+ 'it' => '2 anni',
+ 'si' => '2 leti',
+ 'da' => '2 år',
+ 'no' => '2 år',
+ 'cs' => '2 roky',
+ 'hu' => '2 év',
+ 'sv' => '2 år',
+ ],
+ ],
+ [
+ /* Advanced popup creator */
+ 'active' => 0,
+ 'modules' => ['advancedpopupcreator'],
+ 'name' => 'apc_popup_session',
+ 'provider' => Tools::getHttpHost(),
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => 'Used to know if it is a new browser session.',
+ 'es' => 'Utilizada para saber si se trata de una nueva sesión de navegador.',
+ 'ag' => 'Utilizada para saber si se trata de una nueva sesión de navegador.',
+ 'cb' => 'Utilizada para saber si se trata de una nueva sesión de navegador.',
+ 'mx' => 'Utilizada para saber si se trata de una nueva sesión de navegador.',
+ 'fr' => 'Utilisé pour savoir s\'il s\'agit d\'une nouvelle session de navigateur.',
+ 'qc' => 'Utilisé pour savoir s\'il s\'agit d\'une nouvelle session de navigateur.',
+ 'pl' => 'Kiedyś wiedzieć, czy jest to nowa sesja przeglądarki.',
+ 'ro' => '',
+ 'pt' => '',
+ 'br' => '',
+ 'sk' => '',
+ 'nl' => '',
+ 'de' => 'Wird verwendet, um zu wissen, ob es sich um eine neue Browsersitzung handelt.',
+ 'gr' => '',
+ 'it' => 'Utilizzato per sapere se si tratta di una nuova sessione del browser.',
+ 'si' => '',
+ 'da' => '',
+ 'no' => '',
+ 'cs' => '',
+ 'hu' => '',
+ 'sv' => '',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ ],
+ CookiesPlusFinality::STATISTIC_COOKIE => [
+ [
+ 'active' => 0,
+ 'modules' => [
+ 'gapi',
+ 'ganalytics',
+ 'ps_googleanalytics',
+ ],
+ 'name' => '_ga',
+ 'provider' => 'Google',
+ 'provider_url' => 'https://policies.google.com/privacy',
+ 'purpose' => [
+ 'en' => 'Registers a unique ID that is used to generate statistical data on how the visitor uses the website.',
+ 'es' => 'Registra una identificación única que se utiliza para generar datos estadísticos acerca de cómo utiliza el visitante el sitio web.',
+ 'ag' => 'Registra una identificación única que se utiliza para generar datos estadísticos acerca de cómo utiliza el visitante el sitio web.',
+ 'cb' => 'Registra una identificación única que se utiliza para generar datos estadísticos acerca de cómo utiliza el visitante el sitio web.',
+ 'mx' => 'Registra una identificación única que se utiliza para generar datos estadísticos acerca de cómo utiliza el visitante el sitio web.',
+ 'fr' => 'Enregistre un identifiant unique utilisé pour générer des données statistiques sur la façon dont le visiteur utilise le site.',
+ 'qc' => 'Enregistre un identifiant unique utilisé pour générer des données statistiques sur la façon dont le visiteur utilise le site.',
+ 'pl' => 'Rejestruje unikalny identyfikator, który służy do generowania danych statystycznych dotyczących sposobu, w jaki odwiedzający korzysta ze strony internetowej.',
+ 'ro' => 'Înregistrează un ID unic care este utilizat pentru a genera date statistice despre modul în care vizitatorul folosește site-ul web.',
+ 'pt' => 'Registra um ID exclusivo que é usado para gerar dados estatísticos sobre como o visitante usa o site.',
+ 'br' => 'Registra um ID exclusivo que é usado para gerar dados estatísticos sobre como o visitante usa o site.',
+ 'sk' => 'Registruje jedinečné ID, ktoré sa používa na generovanie štatistických údajov o tom, ako návštevník používa webovú stránku.',
+ 'nl' => 'Registreert een uniek ID die wordt gebruikt om statistische gegevens te genereren over hoe de bezoeker de website gebruikt.',
+ 'de' => 'Registriert eine eindeutige ID, die verwendet wird, um statistische Daten dazu, wie der Besucher die Website nutzt, zu generieren.',
+ 'gr' => 'Καταγράφει ένα μοναδικό αναγνωριστικό που χρησιμοποιείται για τη δημιουργία στατιστικών δεδομένων σχετικά με τον τρόπο με τον οποίο ο επισκέπτης χρησιμοποιεί τον ιστότοπο.',
+ 'it' => 'Registra un ID univoco utilizzato per generare dati statistici su come il visitatore utilizza il sito internet.',
+ 'si' => 'Registrira enolični ID, ki se uporablja za ustvarjanje statističnih podatkov o tem, kako obiskovalec uporablja spletno mesto.',
+ 'da' => 'Registrerer et unikt ID, der anvendes til at føre statistik over hvordan den besøgende bruger hjemmesiden.',
+ 'no' => 'Registrerer en unik ID som brukes til å generere statistiske data om hvordan den besøkende bruker nettstedet.',
+ 'cs' => 'Zaregistruje jedinečné ID, které se používá ke generování statistických údajů o tom, jak návštěvník používá web.',
+ 'hu' => 'Nyilvántartásba vesz egy egyedi azonosítót, amely statisztikai adatok előállítására szolgál arra vonatkozóan, hogy a látogató hogyan használja a weboldalt.',
+ 'sv' => 'Registrerar ett unikt ID som används för att generera statistisk information om hur besökaren använder webbplatsen.',
+ ],
+ 'expiry' => [
+ 'en' => '2 years',
+ 'es' => '2 años',
+ 'ag' => '2 años',
+ 'cb' => '2 años',
+ 'mx' => '2 años',
+ 'fr' => '2 années',
+ 'qc' => '2 années',
+ 'pl' => '2 lata',
+ 'ro' => '2 ani',
+ 'pt' => '2 anos',
+ 'br' => '2 anos',
+ 'sk' => '2 roky',
+ 'nl' => '2 jaar',
+ 'de' => '2 Jahre',
+ 'gr' => '2 χρόνια',
+ 'it' => '2 anni',
+ 'si' => '2 leti',
+ 'da' => '2 år',
+ 'no' => '2 år',
+ 'cs' => '2 roky',
+ 'hu' => '2 év',
+ 'sv' => '2 år',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [
+ 'gapi',
+ 'ganalytics',
+ 'ps_googleanalytics',
+ ],
+ 'name' => '_gat',
+ 'provider' => 'Google',
+ 'provider_url' => 'https://policies.google.com/privacy',
+ 'purpose' => [
+ 'en' => 'Used by Google Analytics to throttle request rate',
+ 'es' => 'Utilizado por Google Analytics para controlar la tasa de peticiones',
+ 'ag' => 'Utilizado por Google Analytics para controlar la tasa de peticiones',
+ 'cb' => 'Utilizado por Google Analytics para controlar la tasa de peticiones',
+ 'mx' => 'Utilizado por Google Analytics para controlar la tasa de peticiones',
+ 'fr' => 'Utilisé par Google Analytics pour diminuer radicalement le taux de requêtes',
+ 'qc' => 'Utilisé par Google Analytics pour diminuer radicalement le taux de requêtes',
+ 'pl' => 'Używany przez Google Analytics do ograniczania liczby żądań',
+ 'ro' => 'Folosit de Google Analytics pentru a restrânge rata solicitării',
+ 'pt' => 'Usado pelo Google Analytics para controlar a taxa de solicitação',
+ 'br' => 'Usado pelo Google Analytics para controlar a taxa de solicitação',
+ 'sk' => 'Používa program Google Analytics na obmedzenie rýchlosti požiadaviek',
+ 'nl' => 'Gebruikt door Google Analytics om verzoeksnelheid te vertragen',
+ 'de' => 'Wird von Google Analytics verwendet, um die Anforderungsrate einzuschränken',
+ 'gr' => 'Χρησιμοποιείται από το Google Analytics για να ρυθμίσει το ρυθμό αιτημάτων',
+ 'it' => 'Utilizzato da Google Analytics per limitare la frequenza delle richieste',
+ 'si' => 'Uporablja Google Analytics za zmanjšanje stopnje zahtev',
+ 'da' => 'Anvendes af Google Analytics til at drosle hastigheden på antallet af forespørgsler til serveren',
+ 'no' => 'Brukes av Google Analytics for å begrense forespørselsfrekvensen',
+ 'cs' => 'Používá Google Analytics k omezení rychlosti požadavků',
+ 'hu' => 'A Google Analytics használja a kérelmek arányának csökkentésére',
+ 'sv' => 'Används av Google Analytics för att strypa begäran',
+ ],
+ 'expiry' => [
+ 'en' => '1 day',
+ 'es' => '1 día',
+ 'ag' => '1 día',
+ 'cb' => '1 día',
+ 'mx' => '1 día',
+ 'fr' => '1 jour',
+ 'qc' => '1 jour',
+ 'pl' => '1 dzień',
+ 'ro' => '1 zi',
+ 'pt' => '1 dia',
+ 'br' => '1 dia',
+ 'sk' => '1 deň',
+ 'nl' => '1 dag',
+ 'de' => '1 Tag',
+ 'gr' => '1 μέρα',
+ 'it' => '1 giorno',
+ 'si' => '1 dan',
+ 'da' => '1 dag',
+ 'no' => '1 dag',
+ 'cs' => '1 den',
+ 'hu' => '1 nap',
+ 'sv' => '1 dag',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [
+ 'gapi',
+ 'ganalytics',
+ 'ps_googleanalytics',
+ ],
+ 'name' => '_gid',
+ 'provider' => 'Google',
+ 'provider_url' => 'https://policies.google.com/privacy',
+ 'purpose' => [
+ 'en' => 'Registers a unique ID that is used to generate statistical data on how the visitor uses the website.',
+ 'es' => 'Registra una identificación única que se utiliza para generar datos estadísticos acerca de cómo utiliza el visitante el sitio web.',
+ 'ag' => 'Registra una identificación única que se utiliza para generar datos estadísticos acerca de cómo utiliza el visitante el sitio web.',
+ 'cb' => 'Registra una identificación única que se utiliza para generar datos estadísticos acerca de cómo utiliza el visitante el sitio web.',
+ 'mx' => 'Registra una identificación única que se utiliza para generar datos estadísticos acerca de cómo utiliza el visitante el sitio web.',
+ 'fr' => 'Enregistre un identifiant unique utilisé pour générer des données statistiques sur la façon dont le visiteur utilise le site.',
+ 'qc' => 'Enregistre un identifiant unique utilisé pour générer des données statistiques sur la façon dont le visiteur utilise le site.',
+ 'pl' => 'Rejestruje unikalny identyfikator, który służy do generowania danych statystycznych dotyczących sposobu, w jaki odwiedzający korzysta ze strony internetowej.',
+ 'ro' => 'Înregistrează un ID unic care este utilizat pentru a genera date statistice despre modul în care vizitatorul folosește site-ul web.',
+ 'pt' => 'Registra um ID exclusivo que é usado para gerar dados estatísticos sobre como o visitante usa o site.',
+ 'br' => 'Registra um ID exclusivo que é usado para gerar dados estatísticos sobre como o visitante usa o site.',
+ 'sk' => 'Registruje jedinečné ID, ktoré sa používa na generovanie štatistických údajov o tom, ako návštevník používa webovú stránku.',
+ 'nl' => 'Registreert een uniek ID die wordt gebruikt om statistische gegevens te genereren over hoe de bezoeker de website gebruikt.',
+ 'de' => 'Registriert eine eindeutige ID, die verwendet wird, um statistische Daten dazu, wie der Besucher die Website nutzt, zu generieren.',
+ 'gr' => 'Καταγράφει ένα μοναδικό αναγνωριστικό που χρησιμοποιείται για τη δημιουργία στατιστικών δεδομένων σχετικά με τον τρόπο με τον οποίο ο επισκέπτης χρησιμοποιεί τον ιστότοπο.',
+ 'it' => 'Registra un ID univoco utilizzato per generare dati statistici su come il visitatore utilizza il sito internet.',
+ 'si' => 'Registrira enolični ID, ki se uporablja za ustvarjanje statističnih podatkov o tem, kako obiskovalec uporablja spletno mesto.',
+ 'da' => 'Registrerer et unikt ID, der anvendes til at føre statistik over hvordan den besøgende bruger hjemmesiden.',
+ 'no' => 'Registrerer en unik ID som brukes til å generere statistiske data om hvordan den besøkende bruker nettstedet.',
+ 'cs' => 'Registrerer en unik ID som brukes til å generere statistiske data om hvordan den besøkende bruker nettstedet.',
+ 'hu' => 'Nyilvántartásba vesz egy egyedi azonosítót, amely statisztikai adatok előállítására szolgál arra vonatkozóan, hogy a látogató hogyan használja a weboldalt.',
+ 'sv' => 'Registrerar ett unikt ID som används för att generera statistisk information om hur besökaren använder webbplatsen.',
+ ],
+ 'expiry' => [
+ 'en' => '1 day',
+ 'es' => '1 día',
+ 'ag' => '1 día',
+ 'cb' => '1 día',
+ 'mx' => '1 día',
+ 'fr' => '1 jour',
+ 'qc' => '1 jour',
+ 'pl' => '1 dzień',
+ 'ro' => '1 zi',
+ 'pt' => '1 dia',
+ 'br' => '1 dia',
+ 'sk' => '1 deň',
+ 'nl' => '1 dag',
+ 'de' => '1 Tag',
+ 'gr' => '1 μέρα',
+ 'it' => '1 giorno',
+ 'si' => '1 dan',
+ 'da' => '1 dag',
+ 'no' => '1 dag',
+ 'cs' => '1 den',
+ 'hu' => '1 nap',
+ 'sv' => '1 dag',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [
+ 'gapi',
+ 'ganalytics',
+ 'ps_googleanalytics',
+ ],
+ 'name' => '_gd#',
+ 'provider' => 'Google',
+ 'provider_url' => 'https://policies.google.com/privacy',
+ 'purpose' => [
+ 'en' => 'This is a Google Analytics Session cookie used to generate statistical data on how you use the website which is removed when you quit your browser.',
+ 'es' => 'Se trata de una cookie de sesión de Google Analytics que se utiliza para generar datos estadísticos sobre cómo utiliza el sitio web que se elimina cuando sale de su navegador.',
+ 'ag' => 'Se trata de una cookie de sesión de Google Analytics que se utiliza para generar datos estadísticos sobre cómo utiliza el sitio web que se elimina cuando sale de su navegador.',
+ 'cb' => 'Se trata de una cookie de sesión de Google Analytics que se utiliza para generar datos estadísticos sobre cómo utiliza el sitio web que se elimina cuando sale de su navegador.',
+ 'mx' => 'Se trata de una cookie de sesión de Google Analytics que se utiliza para generar datos estadísticos sobre cómo utiliza el sitio web que se elimina cuando sale de su navegador.',
+ 'fr' => 'Il s\'agit d\'un cookie de session Google Analytics utilisé pour générer des données statistiques sur la façon dont vous utilisez le site Web, qui est supprimé lorsque vous quittez votre navigateur.',
+ 'qc' => 'Il s\'agit d\'un cookie de session Google Analytics utilisé pour générer des données statistiques sur la façon dont vous utilisez le site Web, qui est supprimé lorsque vous quittez votre navigateur.',
+ 'pl' => 'To jest sesyjny plik cookie Google Analytics służący do generowania danych statystycznych o sposobie korzystania ze strony internetowej, który jest usuwany po zamknięciu przeglądarki.',
+ 'ro' => 'Acesta este un cookie de sesiune Google Analytics utilizat pentru a genera date statistice despre modul în care utilizați site-ul web, care este eliminat atunci când părăsiți browserul.',
+ 'pt' => 'Este é um cookie de sessão do Google Analytics usado para gerar dados estatísticos sobre como você usa o site, que são removidos quando você fecha o navegador.',
+ 'br' => 'Este é um cookie de sessão do Google Analytics usado para gerar dados estatísticos sobre como você usa o site, que são removidos quando você fecha o navegador.',
+ 'sk' => 'Toto je súbor cookie relácie Google Analytics, ktorý sa používa na generovanie štatistických údajov o tom, ako používate webovú stránku, ktorá sa odstráni po ukončení prehliadača.',
+ 'nl' => 'Dit is een Google Analytics-sessiecookie die wordt gebruikt om statistische gegevens te genereren over hoe u de website gebruikt en die wordt verwijderd wanneer u uw browser afsluit.',
+ 'de' => 'Dies ist ein Google Analytics-Sitzungscookie, mit dem statistische Daten zur Nutzung der Website generiert werden, die beim Beenden Ihres Browsers entfernt werden.',
+ 'gr' => 'Αυτό είναι ένα cookie περιόδου σύνδεσης του Google Analytics που χρησιμοποιείται για τη δημιουργία στατιστικών δεδομένων σχετικά με τον τρόπο χρήσης του ιστότοπου που καταργείται όταν κλείσετε το πρόγραμμα περιήγησής σας.',
+ 'it' => 'Si tratta di un cookie di sessione di Google Analytics utilizzato per generare dati statistici su come utilizzi il sito web che vengono rimossi quando chiudi il browser.',
+ 'si' => 'Toto je súbor cookie relácie Google Analytics, ktorý sa používa na generovanie štatistických údajov o tom, ako používate webovú stránku, ktorá sa odstráni po ukončení prehliadača.',
+ 'da' => 'Dette er en Google Analytics Session-cookie, der bruges til at generere statistiske data om, hvordan du bruger det websted, der fjernes, når du lukker din browser.',
+ 'no' => 'Dette er en Google Analytics Session-informasjonskapsel som brukes til å generere statistiske data om hvordan du bruker nettstedet som fjernes når du avslutter nettleseren.',
+ 'cs' => 'Toto je soubor cookie relace Google Analytics, který se používá ke generování statistických údajů o tom, jak používáte web, který se odstraní, když opustíte prohlížeč.',
+ 'hu' => 'Ez egy Google Analytics Munkamenet cookie, amelyet statisztikai adatok előállítására használnak a webhely használatáról, amelyet eltávolítunk, amikor kilép a böngészőből.',
+ 'sv' => 'Detta är en Google Analytics Session-cookie som används för att generera statistisk information om hur du använder webbplatsen som tas bort när du avslutar din webbläsare.',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [
+ 'gapi',
+ 'ganalytics',
+ 'ps_googleanalytics',
+ ],
+ 'name' => 'collect',
+ 'provider' => 'Google',
+ 'provider_url' => 'https://policies.google.com/privacy',
+ 'purpose' => [
+ 'en' => 'It is used to send data to Google Analytics about the visitor\'s device and its behavior. Track the visitor across devices and marketing channels.',
+ 'es' => 'Se utiliza para enviar datos a Google Analytics sobre el dispositivo del visitante y su comportamiento. Rastrea al visitante a través de dispositivos y canales de marketing.',
+ 'ag' => 'Se utiliza para enviar datos a Google Analytics sobre el dispositivo del visitante y su comportamiento. Rastrea al visitante a través de dispositivos y canales de marketing.',
+ 'cb' => 'Se utiliza para enviar datos a Google Analytics sobre el dispositivo del visitante y su comportamiento. Rastrea al visitante a través de dispositivos y canales de marketing.',
+ 'mx' => 'Se utiliza para enviar datos a Google Analytics sobre el dispositivo del visitante y su comportamiento. Rastrea al visitante a través de dispositivos y canales de marketing.',
+ 'fr' => 'Il est utilisé pour envoyer des données à Google Analytics sur l\'appareil du visiteur et son comportement. Suivez le visiteur à travers les appareils et les canaux marketing.',
+ 'qc' => 'Il est utilisé pour envoyer des données à Google Analytics sur l\'appareil du visiteur et son comportement. Suivez le visiteur à travers les appareils et les canaux marketing.',
+ 'pl' => 'Służy do wysyłania danych do Google Analytics o urządzeniu odwiedzającego i jego zachowaniu. Śledź odwiedzającego na różnych urządzeniach i kanałach marketingowych.',
+ 'ro' => 'Este folosit pentru a trimite date către Google Analytics despre dispozitivul vizitatorului și comportamentul acestuia. Urmăriți vizitatorul pe dispozitive și canale de marketing.',
+ 'pt' => 'Ele é usado para enviar dados ao Google Analytics sobre o dispositivo do visitante e seu comportamento. Rastreie o visitante em dispositivos e canais de marketing.',
+ 'br' => 'Ele é usado para enviar dados ao Google Analytics sobre o dispositivo do visitante e seu comportamento. Rastreie o visitante em dispositivos e canais de marketing.',
+ 'sk' => 'Používa sa na zasielanie údajov do služby Google Analytics o zariadení návštevníka a jeho správaní. Sledujte návštevníka naprieč zariadeniami a marketingovými kanálmi.',
+ 'nl' => 'Het wordt gebruikt om gegevens naar Google Analytics te sturen over het apparaat van de bezoeker en zijn gedrag. Volg de bezoeker op verschillende apparaten en marketingkanalen.',
+ 'de' => 'Es wird verwendet, um Daten über das Gerät des Besuchers und sein Verhalten an Google Analytics zu senden. Verfolgen Sie den Besucher über Geräte und Marketingkanäle hinweg.',
+ 'gr' => 'Χρησιμοποιείται για την αποστολή δεδομένων στο Google Analytics σχετικά με τη συσκευή του επισκέπτη και τη συμπεριφορά του. Παρακολουθήστε τον επισκέπτη σε διάφορες συσκευές και κανάλια μάρκετινγκ.',
+ 'it' => 'Viene utilizzato per inviare dati a Google Analytics sul dispositivo del visitatore e sul suo comportamento. Tieni traccia del visitatore su dispositivi e canali di marketing.',
+ 'si' => 'Uporablja se za pošiljanje podatkov v Google Analytics o obiskovalčevi napravi in njenem vedenju. Sledite obiskovalcu po napravah in tržnih kanalih.',
+ 'da' => 'Det bruges til at sende data til Google Analytics om den besøgendes enhed og dens adfærd. Spor den besøgende på tværs af enheder og marketingkanaler.',
+ 'no' => 'Den brukes til å sende data til Google Analytics om den besøkendes enhet og dens oppførsel. Spor den besøkende på tvers av enheter og markedsføringskanaler.',
+ 'cs' => 'Používá se k odesílání údajů do Google Analytics o zařízení návštěvníka a jeho chování. Sledujte návštěvníka napříč zařízeními a marketingovými kanály.',
+ 'hu' => 'Arra szolgál, hogy adatokat küldjön a Google Analytics számára a látogató eszközéről és viselkedéséről. Kövesse nyomon a látogatót eszközök és marketing csatornák között.',
+ 'sv' => 'Den används för att skicka data till Google Analytics om besökarens enhet och dess beteende. Spåra besökaren över enheter och marknadsföringskanaler.',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [
+ 'gapi',
+ 'ganalytics',
+ 'ps_googleanalytics',
+ ],
+ 'name' => 'r/collect',
+ 'provider' => 'Google',
+ 'provider_url' => 'https://policies.google.com/privacy',
+ 'purpose' => [
+ 'en' => 'It is used to send data to Google Analytics about the visitor\'s device and its behavior. Track the visitor across devices and marketing channels.',
+ 'es' => 'Se utiliza para enviar datos a Google Analytics sobre el dispositivo del visitante y su comportamiento. Rastrea al visitante a través de dispositivos y canales de marketing.',
+ 'ag' => 'Se utiliza para enviar datos a Google Analytics sobre el dispositivo del visitante y su comportamiento. Rastrea al visitante a través de dispositivos y canales de marketing.',
+ 'cb' => 'Se utiliza para enviar datos a Google Analytics sobre el dispositivo del visitante y su comportamiento. Rastrea al visitante a través de dispositivos y canales de marketing.',
+ 'mx' => 'Se utiliza para enviar datos a Google Analytics sobre el dispositivo del visitante y su comportamiento. Rastrea al visitante a través de dispositivos y canales de marketing.',
+ 'fr' => 'Il est utilisé pour envoyer des données à Google Analytics sur l\'appareil du visiteur et son comportement. Suivez le visiteur à travers les appareils et les canaux marketing.',
+ 'qc' => 'Il est utilisé pour envoyer des données à Google Analytics sur l\'appareil du visiteur et son comportement. Suivez le visiteur à travers les appareils et les canaux marketing.',
+ 'pl' => 'Służy do wysyłania danych do Google Analytics o urządzeniu odwiedzającego i jego zachowaniu. Śledź odwiedzającego na różnych urządzeniach i kanałach marketingowych.',
+ 'ro' => 'Este folosit pentru a trimite date către Google Analytics despre dispozitivul vizitatorului și comportamentul acestuia. Urmăriți vizitatorul pe dispozitive și canale de marketing.',
+ 'pt' => 'Ele é usado para enviar dados ao Google Analytics sobre o dispositivo do visitante e seu comportamento. Rastreie o visitante em dispositivos e canais de marketing.',
+ 'br' => 'Ele é usado para enviar dados ao Google Analytics sobre o dispositivo do visitante e seu comportamento. Rastreie o visitante em dispositivos e canais de marketing.',
+ 'sk' => 'Používa sa na zasielanie údajov do služby Google Analytics o zariadení návštevníka a jeho správaní. Sledujte návštevníka naprieč zariadeniami a marketingovými kanálmi.',
+ 'nl' => 'Het wordt gebruikt om gegevens naar Google Analytics te sturen over het apparaat van de bezoeker en zijn gedrag. Volg de bezoeker op verschillende apparaten en marketingkanalen.',
+ 'de' => 'Es wird verwendet, um Daten über das Gerät des Besuchers und sein Verhalten an Google Analytics zu senden. Verfolgen Sie den Besucher über Geräte und Marketingkanäle hinweg.',
+ 'gr' => 'Χρησιμοποιείται για την αποστολή δεδομένων στο Google Analytics σχετικά με τη συσκευή του επισκέπτη και τη συμπεριφορά του. Παρακολουθήστε τον επισκέπτη σε διάφορες συσκευές και κανάλια μάρκετινγκ.',
+ 'it' => 'Viene utilizzato per inviare dati a Google Analytics sul dispositivo del visitatore e sul suo comportamento. Tieni traccia del visitatore su dispositivi e canali di marketing.',
+ 'si' => 'Uporablja se za pošiljanje podatkov v Google Analytics o obiskovalčevi napravi in njenem vedenju. Sledite obiskovalcu po napravah in tržnih kanalih.',
+ 'da' => 'Det bruges til at sende data til Google Analytics om den besøgendes enhed og dens adfærd. Spor den besøgende på tværs af enheder og marketingkanaler.',
+ 'no' => 'Den brukes til å sende data til Google Analytics om den besøkendes enhet og dens oppførsel. Spor den besøkende på tvers av enheter og markedsføringskanaler.',
+ 'cs' => 'Používá se k odesílání údajů do Google Analytics o zařízení návštěvníka a jeho chování. Sledujte návštěvníka napříč zařízeními a marketingovými kanály.',
+ 'hu' => 'Arra szolgál, hogy adatokat küldjön a Google Analytics számára a látogató eszközéről és viselkedéséről. Kövesse nyomon a látogatót eszközök és marketing csatornák között.',
+ 'sv' => 'Den används för att skicka data till Google Analytics om besökarens enhet och dess beteende. Spåra besökaren över enheter och marknadsföringskanaler.',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => '_gat_gtag_UA_*',
+ 'provider' => 'Google',
+ 'provider_url' => 'https://policies.google.com/privacy',
+ 'purpose' => [
+ 'en' => 'Used to throttle request rate.',
+ 'es' => 'Se utiliza para acelerar la tasa de solicitudes.',
+ 'ag' => 'Se utiliza para acelerar la tasa de solicitudes.',
+ 'cb' => 'Se utiliza para acelerar la tasa de solicitudes.',
+ 'mx' => 'Se utiliza para acelerar la tasa de solicitudes.',
+ 'fr' => 'Utilisé pour limiter le taux de demande.',
+ 'qc' => 'Utilisé pour limiter le taux de demande.',
+ 'pl' => 'Służy do ograniczania szybkości żądań.',
+ 'ro' => 'Folosit pentru a limita rata de solicitare.',
+ 'pt' => 'Usado para controlar a taxa de solicitação.',
+ 'br' => 'Usado para controlar a taxa de solicitação.',
+ 'sk' => 'Používa sa na obmedzenie rýchlosti požiadaviek.',
+ 'nl' => 'Wordt gebruikt om de verzoeksnelheid te vertragen.',
+ 'de' => 'Wird verwendet, um die Anforderungsrate zu drosseln.',
+ 'gr' => 'Χρησιμοποιείται για να ρυθμίσει το ρυθμό αιτήματος.',
+ 'it' => 'Utilizzato per limitare la frequenza delle richieste.',
+ 'si' => 'Uporablja se za stopnjo plina.',
+ 'da' => 'Bruges til at reducere anmodningshastigheden.',
+ 'no' => 'Brukes til å begrense forespørselsfrekvensen.',
+ 'cs' => 'Slouží k omezení rychlosti požadavku.',
+ 'hu' => 'A fojtószelep kérési arányához használják.',
+ 'sv' => 'Används för att strypa begäran.',
+ ],
+ 'expiry' => [
+ 'en' => '1 minute',
+ 'es' => '1 minuto',
+ 'ag' => '1 minuto',
+ 'cb' => '1 minuto',
+ 'mx' => '1 minuto',
+ 'fr' => '1 minute',
+ 'qc' => '1 minute',
+ 'pl' => '1 minuta',
+ 'ro' => '1 minut',
+ 'pt' => '1 minuto',
+ 'br' => '1 minuto',
+ 'sk' => '1 minútu',
+ 'nl' => '1 minuut',
+ 'de' => '1 Minute',
+ 'gr' => '1 λεπτό',
+ 'it' => '1 minuto',
+ 'si' => '1 minuto',
+ 'da' => '1 minut',
+ 'no' => '1 minutt',
+ 'cs' => '1 minuta',
+ 'hu' => '1 perc',
+ 'sv' => '1 minut',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [
+ 'gapi',
+ 'ganalytics',
+ 'ps_googleanalytics',
+ ],
+ 'name' => '_ga_#',
+ 'provider' => 'Google',
+ 'provider_url' => 'https://policies.google.com/privacy',
+ 'purpose' => [
+ 'en' => 'Used by Google Analytics to collect data on the number of times a user has visited the website as well as
+dates for the first and most recent visit.',
+ 'es' => 'Recopila datos sobre el número de veces que un usuario ha visitado el sitio web además de las fechas de la primera visita y de la más reciente. Utilizada por Google Analytics.',
+ 'ag' => 'Recopila datos sobre el número de veces que un usuario ha visitado el sitio web además de las fechas de la primera visita y de la más reciente. Utilizada por Google Analytics.',
+ 'cb' => 'Recopila datos sobre el número de veces que un usuario ha visitado el sitio web además de las fechas de la primera visita y de la más reciente. Utilizada por Google Analytics.',
+ 'mx' => 'Recopila datos sobre el número de veces que un usuario ha visitado el sitio web además de las fechas de la primera visita y de la más reciente. Utilizada por Google Analytics.',
+ 'fr' => 'Utilisé par Google Analytics our recueillir des données sur le nombre de fois qu\'un utilisateur a visité le site web ainsi que les dates de la première et de la plus récente visite.',
+ 'qc' => 'Utilisé par Google Analytics our recueillir des données sur le nombre de fois qu\'un utilisateur a visité le site web ainsi que les dates de la première et de la plus récente visite.',
+ 'pl' => 'Używany przez Google Analytics do zbierania danych o tym, ile razy użytkownik odwiedził witrynę, a także
+daty pierwszej i ostatniej wizyty.',
+ 'ro' => '',
+ 'pt' => '',
+ 'br' => '',
+ 'sk' => '',
+ 'nl' => '',
+ 'de' => 'Sammelt Daten dazu, wie oft ein Benutzer eine Website besucht hat, sowie Daten für den ersten und letzten Besuch. Von Google Analytics verwendet.',
+ 'gr' => '',
+ 'it' => 'Utilizzato da Google Analytics per raccogliere dati sul numero di volte che un utente ha visitato il sito internet, oltre che le dati per la prima visita e la visita più recente.',
+ 'si' => '',
+ 'da' => '',
+ 'no' => '',
+ 'cs' => '',
+ 'hu' => '',
+ 'sv' => '',
+ ],
+ 'expiry' => [
+ 'en' => '2 years',
+ 'es' => '2 años',
+ 'ag' => '2 años',
+ 'cb' => '2 años',
+ 'mx' => '2 años',
+ 'fr' => '2 années',
+ 'qc' => '2 années',
+ 'pl' => '2 lata',
+ 'ro' => '2 ani',
+ 'pt' => '2 anos',
+ 'br' => '2 anos',
+ 'sk' => '2 roky',
+ 'nl' => '2 jaar',
+ 'de' => '2 Jahre',
+ 'gr' => '2 χρόνια',
+ 'it' => '2 anni',
+ 'si' => '2 leti',
+ 'da' => '2 år',
+ 'no' => '2 år',
+ 'cs' => '2 roky',
+ 'hu' => '2 év',
+ 'sv' => '2 år',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => ['smartsupp'],
+ 'name' => 'ssupp.vid',
+ 'provider' => 'Smartsupp',
+ 'provider_url' => 'https://www.smartsupp.com/help/privacy/',
+ 'purpose' => [
+ 'en' => 'Necessary for the functionality of the website\'s chat-box function.',
+ 'es' => 'Necesaria para la funcionalidad del chat en la web.',
+ 'ag' => 'Necesaria para la funcionalidad del chat en la web.',
+ 'cb' => 'Necesaria para la funcionalidad del chat en la web.',
+ 'mx' => 'Necesaria para la funcionalidad del chat en la web.',
+ 'fr' => 'Nécessaire pour la fonctionnalité de la boîte de dialogue du site Web.',
+ 'qc' => 'Nécessaire pour la fonctionnalité de la boîte de dialogue du site Web.',
+ 'pl' => 'Niezbędne do funkcjonowania czatu w sieci.',
+ 'ro' => 'Necesar pentru funcționalitatea chat-ului pe web.',
+ 'pt' => 'Necessário para a funcionalidade do chat na web.',
+ 'br' => 'Necessário para a funcionalidade do chat na web.',
+ 'sk' => 'Nevyhnutné pre funkčnosť četu na webe.',
+ 'nl' => 'Noodzakelijk voor de functionaliteit van de chatboxfunctie van de website.',
+ 'de' => 'Notwendig für die Funktionalität der Chat-Box-Funktion der Webseite.',
+ 'gr' => 'Απαραίτητο για τη λειτουργικότητα της συνομιλίας στον Ιστό.',
+ 'it' => 'Necessario per la corretta funzionalità della chat-box del sito web.',
+ 'si' => 'Potrebno za funkcionalnost klepeta v spletu.',
+ 'da' => 'Nødvendig for chatboks-funktionen på hjemmesiden.',
+ 'no' => 'Nødvendig for funksjonaliteten til chatten på nettet.',
+ 'cs' => 'Nezbytné pro funkčnost chatu na webu.',
+ 'hu' => 'Szükséges a webes csevegés funkcionalitásához.',
+ 'sv' => 'Nödvändigt för funktionaliteten i webbplatsens chattboxfunktion.',
+ ],
+ 'expiry' => [
+ 'en' => '6 months',
+ 'es' => '6 meses',
+ 'ag' => '6 meses',
+ 'cb' => '6 meses',
+ 'mx' => '6 meses',
+ 'fr' => '6 mois',
+ 'qc' => '6 mois',
+ 'pl' => '6 miesiące',
+ 'ro' => '6 luni',
+ 'pt' => '6 meses',
+ 'br' => '6 meses',
+ 'sk' => '6 mesiace',
+ 'nl' => '6 maanden',
+ 'de' => '6 Monate',
+ 'gr' => '6 μήνες',
+ 'it' => '6 mesi',
+ 'si' => '6 meseca',
+ 'da' => '6 mdr.',
+ 'no' => '6 måneder',
+ 'cs' => '6 měsíců',
+ 'hu' => '6 hónap',
+ 'sv' => '6 månader',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => ['smartsupp'],
+ 'name' => 'ssupp.chatid',
+ 'provider' => 'Smartsupp',
+ 'provider_url' => 'https://www.smartsupp.com/help/privacy/',
+ 'purpose' => [
+ 'en' => 'Conversation ID from live chat service provided by Smartsupp',
+ 'es' => 'ID de conversación del servicio de chat en vivo proporcionado por Smartsupp',
+ 'ag' => 'ID de conversación del servicio de chat en vivo proporcionado por Smartsupp',
+ 'cb' => 'ID de conversación del servicio de chat en vivo proporcionado por Smartsupp',
+ 'mx' => 'ID de conversación del servicio de chat en vivo proporcionado por Smartsupp',
+ 'fr' => 'ID de conversation du service de chat en direct fourni par Smartsupp',
+ 'qc' => 'ID de conversation du service de chat en direct fourni par Smartsupp',
+ 'pl' => 'Identyfikator rozmowy z usługi czatu na żywo dostarczanej przez Smartsupp',
+ 'ro' => 'ID-ul conversației din serviciul de chat live furnizat de Smartsupp',
+ 'pt' => 'ID da conversa do serviço de chat ao vivo fornecido pela Smartsupp',
+ 'br' => 'ID da conversa do serviço de chat ao vivo fornecido pela Smartsupp',
+ 'sk' => 'ID konverzácie zo služby živého chatu poskytované spoločnosťou Smartsupp',
+ 'nl' => 'Gesprek-ID van live chatservice aangeboden door Smartsupp',
+ 'de' => 'Gesprächs-ID vom Live-Chat-Dienst von Smartsupp',
+ 'gr' => 'Αναγνωριστικό συνομιλίας από την υπηρεσία ζωντανής συνομιλίας που παρέχεται από το Smartsupp',
+ 'it' => 'ID conversazione dal servizio di chat dal vivo fornito da Smartsupp',
+ 'si' => 'ID pogovora iz storitve klepeta v živo, ki jo nudi Smartsupp',
+ 'da' => 'Samtale-id fra live chat-tjeneste leveret af Smartsupp',
+ 'no' => 'Samtale-ID fra live chat-tjeneste levert av Smartsupp',
+ 'cs' => 'ID konverzace ze služby živého chatu poskytované společností Smartsupp',
+ 'hu' => 'Beszélgetési azonosító a Smartsupp által biztosított élő chat szolgáltatásból',
+ 'sv' => 'Konversations-ID från livechatttjänst från Smartsupp',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => ['smartsupp'],
+ 'name' => 'ssupp.group',
+ 'provider' => 'Smartsupp',
+ 'provider_url' => 'https://www.smartsupp.com/help/privacy/',
+ 'purpose' => [
+ 'en' => 'Last group of visitor from live chat service provided by Smartsupp.',
+ 'es' => 'Último grupo de visitantes del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'ag' => 'Último grupo de visitantes del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'cb' => 'Último grupo de visitantes del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'mx' => 'Último grupo de visitantes del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'fr' => 'Dernier groupe de visiteurs du service de chat en direct fourni par Smartsupp.',
+ 'qc' => 'Dernier groupe de visiteurs du service de chat en direct fourni par Smartsupp.',
+ 'pl' => 'Ostatnia grupa gości z usługi czatu na żywo dostarczonej przez Smartsupp.',
+ 'ro' => 'Ultimul grup de vizitatori din serviciul de chat live furnizat de Smartsupp.',
+ 'pt' => 'Último grupo de visitantes do serviço de chat ao vivo fornecido pela Smartsupp.',
+ 'br' => 'Último grupo de visitantes do serviço de chat ao vivo fornecido pela Smartsupp.',
+ 'sk' => 'Posledná skupina návštevníkov zo služby živého chatu poskytovanej spoločnosťou Smartsupp.',
+ 'nl' => 'Laatste groep bezoekers van de live chatservice van Smartsupp.',
+ 'de' => 'Letzte Besuchergruppe des Live-Chat-Dienstes von Smartsupp.',
+ 'gr' => 'Τελευταία ομάδα επισκεπτών από την υπηρεσία ζωντανής συνομιλίας που παρέχεται από το Smartsupp.',
+ 'it' => 'Ultimo gruppo di visitatori dal servizio di live chat fornito da Smartsupp.',
+ 'si' => 'Zadnja skupina obiskovalcev storitve klepeta v živo, ki jo ponuja Smartsupp.',
+ 'da' => 'Sidste gruppe af besøgende fra live chat service leveret af Smartsupp.',
+ 'no' => 'Siste gruppe besøkende fra live chat-tjenesten levert av Smartsupp.',
+ 'cs' => 'Poslední skupina návštěvníků ze služby živého chatu poskytovaná společností Smartsupp.',
+ 'hu' => 'Utolsó látogatócsoport a Smartsupp által biztosított élő chat szolgáltatásból.',
+ 'sv' => 'Den senaste gruppen besökare från livechatttjänsten från Smartsupp.',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => ['smartsupp'],
+ 'name' => 'ssupp.visits',
+ 'provider' => 'Smartsupp',
+ 'provider_url' => 'https://www.smartsupp.com/help/privacy/',
+ 'purpose' => [
+ 'en' => 'Number of previous visits, necessary to track for automatic messages from live chat service provided by Smartsupp.',
+ 'es' => 'Número de visitas previas, necesario para rastrear mensajes automáticos del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'ag' => 'Número de visitas previas, necesario para rastrear mensajes automáticos del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'cb' => 'Número de visitas previas, necesario para rastrear mensajes automáticos del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'mx' => 'Número de visitas previas, necesario para rastrear mensajes automáticos del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'fr' => 'Nombre de visites précédentes, nécessaires pour suivre les messages automatiques du service de chat en direct fourni par Smartsupp.',
+ 'qc' => 'Nombre de visites précédentes, nécessaires pour suivre les messages automatiques du service de chat en direct fourni par Smartsupp.',
+ 'pl' => 'Liczba poprzednich wizyt, niezbędna do śledzenia automatycznych wiadomości z usługi czatu na żywo dostarczanej przez Smartsupp.',
+ 'ro' => 'Numărul de vizite anterioare, necesar pentru a urmări mesajele automate din serviciul de chat live furnizat de Smartsupp.',
+ 'pt' => 'Número de visitas anteriores, necessário para rastrear mensagens automáticas do serviço de chat ao vivo fornecido pela Smartsupp.',
+ 'br' => 'Número de visitas anteriores, necessário para rastrear mensagens automáticas do serviço de chat ao vivo fornecido pela Smartsupp.',
+ 'sk' => 'Počet predchádzajúcich návštev, ktoré je potrebné sledovať pre automatické správy zo služby živého chatu poskytovanej spoločnosťou Smartsupp.',
+ 'nl' => 'Aantal eerdere bezoeken, nodig om bij te houden voor automatische berichten van de live chatservice van Smartsupp.',
+ 'de' => 'Anzahl der vorherigen Besuche, die erforderlich sind, um automatische Nachrichten vom Live-Chat-Dienst von Smartsupp zu verfolgen.',
+ 'gr' => 'Αριθμός προηγούμενων επισκέψεων, απαραίτητος για την παρακολούθηση αυτόματων μηνυμάτων από την υπηρεσία ζωντανής συνομιλίας που παρέχεται από το Smartsupp.',
+ 'it' => 'Numero di visite precedenti, necessario per tenere traccia dei messaggi automatici dal servizio di live chat fornito da Smartsupp.',
+ 'si' => 'Število prejšnjih obiskov, potrebnih za sledenje samodejnim sporočilom iz storitve klepeta v živo, ki jo ponuja Smartsupp.',
+ 'da' => 'Antal tidligere besøg, der er nødvendige for at spore for automatiske meddelelser fra live chat-tjeneste leveret af Smartsupp.',
+ 'no' => 'Antall tidligere besøk, nødvendig for å spore for automatiske meldinger fra live chat-tjenesten levert av Smartsupp.',
+ 'cs' => 'Počet předchozích návštěv, které je nutné sledovat pro automatické zprávy ze služby živého chatu poskytované společností Smartsupp.',
+ 'hu' => 'Az előző látogatások száma, amely szükséges a Smartsupp által biztosított élő chat szolgáltatás automatikus üzeneteinek nyomon követéséhez.',
+ 'sv' => 'Antal tidigare besök, nödvändigt för att spåra efter automatiska meddelanden från livechatttjänsten från Smartsupp.',
+ ],
+ 'expiry' => [
+ 'en' => '6 months',
+ 'es' => '6 meses',
+ 'ag' => '6 meses',
+ 'cb' => '6 meses',
+ 'mx' => '6 meses',
+ 'fr' => '6 mois',
+ 'qc' => '6 mois',
+ 'pl' => '6 miesiące',
+ 'ro' => '6 luni',
+ 'pt' => '6 meses',
+ 'br' => '6 meses',
+ 'sk' => '6 mesiace',
+ 'nl' => '6 maanden',
+ 'de' => '6 Monate',
+ 'gr' => '6 μήνες',
+ 'it' => '6 mesi',
+ 'si' => '6 meseca',
+ 'da' => '6 mdr.',
+ 'no' => '6 måneder',
+ 'cs' => '6 měsíců',
+ 'hu' => '6 hónap',
+ 'sv' => '6 månader',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'yt-player-headers-readable',
+ 'provider' => 'youtube.com',
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => 'Used to determine the optimal video quality based on the visitor\'s device and network settings.',
+ 'es' => 'Utilizada para determinar la calidad óptima del video basada en el dispositivo del visitante y en los ajustes de la red.',
+ 'ag' => 'Utilizada para determinar la calidad óptima del video basada en el dispositivo del visitante y en los ajustes de la red.',
+ 'cb' => 'Utilizada para determinar la calidad óptima del video basada en el dispositivo del visitante y en los ajustes de la red.',
+ 'mx' => 'Utilizada para determinar la calidad óptima del video basada en el dispositivo del visitante y en los ajustes de la red.',
+ 'fr' => 'Utilisé pour déterminer la qualité vidéo optimale en fonction du périphériqu e du visiteur et des paramètres réseau.',
+ 'qc' => 'Utilisé pour déterminer la qualité vidéo optimale en fonction du périphériqu e du visiteur et des paramètres réseau.',
+ 'pl' => '',
+ 'ro' => '',
+ 'pt' => '',
+ 'br' => '',
+ 'sk' => '',
+ 'nl' => '',
+ 'de' => 'Wird verwendet, um basierend auf den Geräte-und Netzwerkeinstellungen des Besuchers die optimale Videoqualität zuermitteln.',
+ 'gr' => '',
+ 'it' => 'Utilizzato per determinare la qualità video ottimale in base al dispositivo del visitatore e alle impostazioni di rete.',
+ 'si' => '',
+ 'da' => 'Bestemmer den optimale video kvalitet ud fraden besøgendes platform og netværkshastighed.',
+ 'no' => '',
+ 'cs' => '',
+ 'hu' => '',
+ 'sv' => '',
+ ],
+ 'expiry' => [
+ 'en' => 'Persistent',
+ 'es' => 'Persistente',
+ 'ag' => 'Persistente',
+ 'cb' => 'Persistente',
+ 'mx' => 'Persistente',
+ 'fr' => 'Persistant',
+ 'qc' => 'Persistant',
+ 'pl' => 'Trwały',
+ 'ro' => 'Persistent',
+ 'pt' => 'Persistente',
+ 'br' => 'Persistente',
+ 'sk' => 'Vytrvalý',
+ 'nl' => 'Aanhoudend',
+ 'de' => 'Hartnäckig',
+ 'gr' => 'Επίμονος',
+ 'it' => 'Persistente',
+ 'si' => 'Vztrajno',
+ 'da' => 'Vedholdende',
+ 'no' => 'Vedvarende',
+ 'cs' => 'Trvalý',
+ 'hu' => 'Kitartó',
+ 'sv' => 'Beständig',
+ ],
+ ],
+ [
+ /* Tawk.to */
+ 'active' => 0,
+ 'modules' => ['tawkto', 'tawktoconfig'],
+ 'name' => 'TawkConnectionTime',
+ 'provider' => Tools::getHttpHost(),
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => 'Allows the website to recognise the visitor, in order to optimize the chat-box functionality.',
+ 'es' => 'Permite a la web reconocer al visitante con el objeto de optimizar la función de chat.',
+ 'ag' => 'Permite a la web reconocer al visitante con el objeto de optimizar la función de chat.',
+ 'cb' => 'Permite a la web reconocer al visitante con el objeto de optimizar la función de chat.',
+ 'mx' => 'Permite a la web reconocer al visitante con el objeto de optimizar la función de chat.',
+ 'fr' => 'Permet au site Web de reconnaître le visiteur afin d’optimiser la fonctionnalité de la boîte de dialogue.',
+ 'qc' => 'Permet au site Web de reconnaître le visiteur afin d’optimiser la fonctionnalité de la boîte de dialogue.',
+ 'pl' => 'Umożliwia witrynie ponowne rozpoznanie osoby odwiedzającej, aby zoptymalizować funkcjonalność pola czatu.',
+ 'ro' => '',
+ 'pt' => '',
+ 'br' => '',
+ 'sk' => '',
+ 'nl' => '',
+ 'de' => 'Ermöglicht der Webseite, den Besucher zu erkennen, um die Chat-Box-Funktionalität zu optimieren.',
+ 'gr' => '',
+ 'it' => 'Consente al sito web di riconoscere il visitatore al fine di ottimizzare la funzionalità della chat-box.',
+ 'si' => '',
+ 'da' => '',
+ 'no' => '',
+ 'cs' => '',
+ 'hu' => '',
+ 'sv' => '',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ ],
+ CookiesPlusFinality::MARKETING_COOKIE => [
+ [
+ 'active' => 0,
+ 'modules' => [
+ 'pspixel',
+ 'facebookconversionpixel',
+ 'ps_facebook',
+ ],
+ 'name' => 'fr',
+ 'provider' => 'Facebook',
+ 'provider_url' => 'https://www.facebook.com/policies/cookies/',
+ 'purpose' => [
+ 'en' => 'Used by Facebook to deliver a series of advertisement products such as real time bidding from third party advertisers.',
+ 'es' => 'Utilizada por Facebook para proporcionar una serie de productos publicitarios como pujas en tiempo real de terceros anunciantes.',
+ 'ag' => 'Utilizada por Facebook para proporcionar una serie de productos publicitarios como pujas en tiempo real de terceros anunciantes.',
+ 'cb' => 'Utilizada por Facebook para proporcionar una serie de productos publicitarios como pujas en tiempo real de terceros anunciantes.',
+ 'mx' => 'Utilizada por Facebook para proporcionar una serie de productos publicitarios como pujas en tiempo real de terceros anunciantes.',
+ 'fr' => 'Utilisé par Facebook pour fournir une série de produits publicitaires tels que les offres en temps réel d\'annonceurs tiers.',
+ 'qc' => 'Utilisé par Facebook pour fournir une série de produits publicitaires tels que les offres en temps réel d\'annonceurs tiers.',
+ 'pl' => 'Używany przez Facebooka do dostarczania serii produktów reklamowych, takich jak licytowanie w czasie rzeczywistym od reklamodawców zewnętrznych.',
+ 'ro' => 'Folosit de Facebook pentru a livra o serie de produse publicitare, cum ar fi licitarea în timp real de la agenții de publicitate terți.',
+ 'pt' => 'Usado pelo Facebook para entregar uma série de produtos de publicidade, como lances em tempo real de anunciantes terceiros.',
+ 'br' => 'Usado pelo Facebook para entregar uma série de produtos de publicidade, como lances em tempo real de anunciantes terceiros.',
+ 'sk' => 'Používa Facebook na dodanie radu reklamných produktov, ako napríklad ponúkanie cien v reálnom čase od inzerentov tretích strán.',
+ 'nl' => 'Gebruikt door Facebook om een reeks advertentieproducten te leveren, zoals realtime bieden van externe adverteerders.',
+ 'de' => 'Wird von Facebook genutzt, um eine Reihe von Werbeprodukten anzuzeigen, zum Beispiel Echtzeitgebote dritter Werbetreibender.',
+ 'gr' => 'Χρησιμοποιείται από το Facebook για την παράδοση μιας σειράς διαφημιστικών προϊόντων, όπως η υποβολή προσφορών σε πραγματικό χρόνο από διαφημιστές τρίτων.',
+ 'it' => 'Utilizzato da Facebook per fornire una serie di prodotti pubblicitari come offerte in tempo reale da inserzionisti terzi.',
+ 'si' => 'Facebook uporablja Facebook za zagotavljanje vrste oglasnih izdelkov, kot so ponudbe v realnem času od neodvisnih oglaševalcev.',
+ 'da' => 'Anvendes af Facebook til at levere forskellige reklame-tjenester, herunder realtids-bud fra tredjeparts-annoncører.',
+ 'no' => 'Brukt av Facebook for å levere en serie reklameprodukter som for eksempel sanntidsbud fra tredjepartsannonsører.',
+ 'cs' => 'Používá Facebook k poskytování řady reklamních produktů, jako je nabízení cen v reálném čase od inzerentů třetích stran.',
+ 'hu' => 'A Facebook egy sor olyan reklámtermék szállítására használja, mint például valós idejű ajánlattétel harmadik fél hirdetőitől.',
+ 'sv' => 'Används av Facebook för att leverera en serie reklamprodukter såsom budgivning i realtid från tredjepartsannonsörer.',
+ ],
+ 'expiry' => [
+ 'en' => '3 months',
+ 'es' => '3 meses',
+ 'ag' => '3 meses',
+ 'cb' => '3 meses',
+ 'mx' => '3 meses',
+ 'fr' => '3 mois',
+ 'qc' => '3 mois',
+ 'pl' => '3 miesiące',
+ 'ro' => '3 luni',
+ 'pt' => '3 meses',
+ 'br' => '3 meses',
+ 'sk' => '3 mesiace',
+ 'nl' => '3 maanden',
+ 'de' => '3 Monate',
+ 'gr' => '3 μήνες',
+ 'it' => '3 mesi',
+ 'si' => '3 meseca',
+ 'da' => '3 mdr.',
+ 'no' => '3 måneder',
+ 'cs' => '3 měsíců',
+ 'hu' => '3 hónap',
+ 'sv' => '3 månader',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [
+ 'pspixel',
+ 'facebookconversionpixel',
+ 'cartsguru',
+ 'ps_facebook',
+ ],
+ 'name' => '_fbp',
+ 'provider' => 'Facebook',
+ 'provider_url' => 'https://www.facebook.com/policies/cookies/',
+ 'purpose' => [
+ 'en' => 'Used by Facebook to deliver a series of advertisement products such as real time bidding from third party advertisers.',
+ 'es' => 'Utilizada por Facebook para proporcionar una serie de productos publicitarios como pujas en tiempo real de terceros anunciantes.',
+ 'ag' => 'Utilizada por Facebook para proporcionar una serie de productos publicitarios como pujas en tiempo real de terceros anunciantes.',
+ 'cb' => 'Utilizada por Facebook para proporcionar una serie de productos publicitarios como pujas en tiempo real de terceros anunciantes.',
+ 'mx' => 'Utilizada por Facebook para proporcionar una serie de productos publicitarios como pujas en tiempo real de terceros anunciantes.',
+ 'fr' => 'Utilisé par Facebook pour fournir une série de produits publicitaires tels que les offres en temps réel d\'annonceurs tiers.',
+ 'qc' => 'Utilisé par Facebook pour fournir une série de produits publicitaires tels que les offres en temps réel d\'annonceurs tiers.',
+ 'pl' => 'Używany przez Facebooka do dostarczania serii produktów reklamowych, takich jak licytowanie w czasie rzeczywistym od reklamodawców zewnętrznych.',
+ 'ro' => 'Folosit de Facebook pentru a livra o serie de produse publicitare, cum ar fi licitarea în timp real de la agenții de publicitate terți.',
+ 'pt' => 'Usado pelo Facebook para entregar uma série de produtos de publicidade, como lances em tempo real de anunciantes terceiros.',
+ 'br' => 'Usado pelo Facebook para entregar uma série de produtos de publicidade, como lances em tempo real de anunciantes terceiros.',
+ 'sk' => 'Používa Facebook na dodanie radu reklamných produktov, ako napríklad ponúkanie cien v reálnom čase od inzerentov tretích strán.',
+ 'nl' => 'Gebruikt door Facebook om een reeks advertentieproducten te leveren, zoals realtime bieden van externe adverteerders.',
+ 'de' => 'Wird von Facebook genutzt, um eine Reihe von Werbeprodukten anzuzeigen, zum Beispiel Echtzeitgebote dritter Werbetreibender.',
+ 'gr' => 'Χρησιμοποιείται από το Facebook για την παράδοση μιας σειράς διαφημιστικών προϊόντων, όπως η υποβολή προσφορών σε πραγματικό χρόνο από διαφημιστές τρίτων.',
+ 'it' => 'Utilizzato da Facebook per fornire una serie di prodotti pubblicitari come offerte in tempo reale da inserzionisti terzi.',
+ 'si' => 'Facebook uporablja Facebook za zagotavljanje vrste oglasnih izdelkov, kot so ponudbe v realnem času od neodvisnih oglaševalcev.',
+ 'da' => 'Anvendes af Facebook til at levere forskellige reklame-tjenester, herunder realtids-bud fra tredjeparts-annoncører.',
+ 'no' => 'Brukt av Facebook for å levere en serie reklameprodukter som for eksempel sanntidsbud fra tredjepartsannonsører.',
+ 'cs' => 'Používá Facebook k poskytování řady reklamních produktů, jako je nabízení cen v reálném čase od inzerentů třetích stran.',
+ 'hu' => 'A Facebook egy sor olyan reklámtermék szállítására használja, mint például valós idejű ajánlattétel harmadik fél hirdetőitől.',
+ 'sv' => 'Används av Facebook för att leverera en serie reklamprodukter såsom budgivning i realtid från tredjepartsannonsörer.',
+ ],
+ 'expiry' => [
+ 'en' => '3 months',
+ 'es' => '3 meses',
+ 'ag' => '3 meses',
+ 'cb' => '3 meses',
+ 'mx' => '3 meses',
+ 'fr' => '3 mois',
+ 'qc' => '3 mois',
+ 'pl' => '3 miesiące',
+ 'ro' => '3 luni',
+ 'pt' => '3 meses',
+ 'br' => '3 meses',
+ 'sk' => '3 mesiace',
+ 'nl' => '3 maanden',
+ 'de' => '3 Monate',
+ 'gr' => '3 μήνες',
+ 'it' => '3 mesi',
+ 'si' => '3 meseca',
+ 'da' => '3 mdr.',
+ 'no' => '3 måneder',
+ 'cs' => '3 měsíců',
+ 'hu' => '3 hónap',
+ 'sv' => '3 månader',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [
+ 'pspixel',
+ 'facebookconversionpixel',
+ 'ps_facebook',
+ ],
+ 'name' => 'tr',
+ 'provider' => 'Facebook',
+ 'provider_url' => 'https://www.facebook.com/policies/cookies/',
+ 'purpose' => [
+ 'en' => 'Used by Facebook to deliver a series of advertisement products such as real time bidding from third party advertisers.',
+ 'es' => 'Utilizada por Facebook para proporcionar una serie de productos publicitarios como pujas en tiempo real de terceros anunciantes.',
+ 'ag' => 'Utilizada por Facebook para proporcionar una serie de productos publicitarios como pujas en tiempo real de terceros anunciantes.',
+ 'cb' => 'Utilizada por Facebook para proporcionar una serie de productos publicitarios como pujas en tiempo real de terceros anunciantes.',
+ 'mx' => 'Utilizada por Facebook para proporcionar una serie de productos publicitarios como pujas en tiempo real de terceros anunciantes.',
+ 'fr' => 'Utilisé par Facebook pour fournir une série de produits publicitaires tels que les offres en temps réel d\'annonceurs tiers.',
+ 'qc' => 'Utilisé par Facebook pour fournir une série de produits publicitaires tels que les offres en temps réel d\'annonceurs tiers.',
+ 'pl' => 'Używany przez Facebooka do dostarczania serii produktów reklamowych, takich jak licytowanie w czasie rzeczywistym od reklamodawców zewnętrznych.',
+ 'ro' => 'Folosit de Facebook pentru a livra o serie de produse publicitare, cum ar fi licitarea în timp real de la agenții de publicitate terți.',
+ 'pt' => 'Usado pelo Facebook para entregar uma série de produtos de publicidade, como lances em tempo real de anunciantes terceiros.',
+ 'br' => 'Usado pelo Facebook para entregar uma série de produtos de publicidade, como lances em tempo real de anunciantes terceiros.',
+ 'sk' => 'Používa Facebook na dodanie radu reklamných produktov, ako napríklad ponúkanie cien v reálnom čase od inzerentov tretích strán.',
+ 'nl' => 'Gebruikt door Facebook om een reeks advertentieproducten te leveren, zoals realtime bieden van externe adverteerders.',
+ 'de' => 'Wird von Facebook genutzt, um eine Reihe von Werbeprodukten anzuzeigen, zum Beispiel Echtzeitgebote dritter Werbetreibender.',
+ 'gr' => 'Χρησιμοποιείται από το Facebook για την παράδοση μιας σειράς διαφημιστικών προϊόντων, όπως η υποβολή προσφορών σε πραγματικό χρόνο από διαφημιστές τρίτων.',
+ 'it' => 'Utilizzato da Facebook per fornire una serie di prodotti pubblicitari come offerte in tempo reale da inserzionisti terzi.',
+ 'si' => 'Facebook uporablja Facebook za zagotavljanje vrste oglasnih izdelkov, kot so ponudbe v realnem času od neodvisnih oglaševalcev.',
+ 'da' => 'Anvendes af Facebook til at levere forskellige reklame-tjenester, herunder realtids-bud fra tredjeparts-annoncører.',
+ 'no' => 'Brukt av Facebook for å levere en serie reklameprodukter som for eksempel sanntidsbud fra tredjepartsannonsører.',
+ 'cs' => 'Používá Facebook k poskytování řady reklamních produktů, jako je nabízení cen v reálném čase od inzerentů třetích stran.',
+ 'hu' => 'A Facebook egy sor olyan reklámtermék szállítására használja, mint például valós idejű ajánlattétel harmadik fél hirdetőitől.',
+ 'sv' => 'Används av Facebook för att leverera en serie reklamprodukter såsom budgivning i realtid från tredjepartsannonsörer.',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ /* Kelkoo */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'kk_leadtag',
+ 'provider' => 'Kelkoo',
+ 'provider_url' => 'https://www.kelkoo.co.uk/company-pages/cookie-policy/',
+ 'purpose' => [
+ 'en' => 'Product price comparison.',
+ 'es' => 'Comparación de precios de productos.',
+ 'ag' => 'Comparación de precios de productos.',
+ 'cb' => 'Comparación de precios de productos.',
+ 'mx' => 'Comparación de precios de productos.',
+ 'fr' => 'Comparaison des prix des produits.',
+ 'qc' => 'Comparaison des prix des produits.',
+ 'pl' => 'Porównanie cen produktów.',
+ 'ro' => 'Compararea prețului produsului.',
+ 'pt' => 'Comparação de preços do produto.',
+ 'br' => 'Comparação de preços do produto.',
+ 'sk' => 'Porovnanie cien výrobkov.',
+ 'nl' => 'Productprijsvergelijking.',
+ 'de' => 'Produktpreisvergleich.',
+ 'gr' => 'Σύγκριση τιμών προϊόντος.',
+ 'it' => 'Confronto dei prezzi dei prodotti.',
+ 'si' => 'Primerjava cen izdelkov.',
+ 'da' => 'Produkt prissammenligning.',
+ 'no' => 'Produktprissammenligning.',
+ 'cs' => 'Porovnání cen produktů.',
+ 'hu' => 'Termékár-összehasonlítás.',
+ 'sv' => 'Produktjämförelse.',
+ ],
+ 'expiry' => [
+ 'en' => '1 year',
+ 'es' => '1 año',
+ 'ag' => '1 año',
+ 'cb' => '1 año',
+ 'mx' => '1 año',
+ 'fr' => '1 année',
+ 'qc' => '1 année',
+ 'pl' => '1 rok',
+ 'ro' => '1 an',
+ 'pt' => '1 ano',
+ 'br' => '1 ano',
+ 'sk' => '1 rok',
+ 'nl' => '1 jaar',
+ 'de' => '1 Jahr',
+ 'gr' => '1 χρόνος',
+ 'it' => '1 anno',
+ 'si' => '1 leto',
+ 'da' => '1 år',
+ 'no' => '1 år',
+ 'cs' => '1 rok',
+ 'hu' => '1 év',
+ 'sv' => '1 år',
+ ],
+ ],
+ [
+ /* Adform */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'uid',
+ 'provider' => 'adform.net',
+ 'provider_url' => 'https://site.adform.com/privacy-center/adform-cookies/',
+ 'purpose' => [
+ 'en' => 'Registers a unique user ID that recognises the user\'s browser when visiting websites that use the same ad network. The purpose is to optimise display of ads based on the user\'s movements and various ad providers\' bids for displaying user ads.',
+ 'es' => 'Registra una identificación de usuario única que reconoce el navegador del usuario al visitar sitios web que usan la misma red publicitaria. El propósito es optimizar la visualización de anuncios según los movimientos del usuario y diversas campañas publicitarias de los proveedores para mostrar anuncios al usuario.',
+ 'ag' => 'Registra una identificación de usuario única que reconoce el navegador del usuario al visitar sitios web que usan la misma red publicitaria. El propósito es optimizar la visualización de anuncios según los movimientos del usuario y diversas campañas publicitarias de los proveedores para mostrar anuncios al usuario.',
+ 'cb' => 'Registra una identificación de usuario única que reconoce el navegador del usuario al visitar sitios web que usan la misma red publicitaria. El propósito es optimizar la visualización de anuncios según los movimientos del usuario y diversas campañas publicitarias de los proveedores para mostrar anuncios al usuario.',
+ 'mx' => 'Registra una identificación de usuario única que reconoce el navegador del usuario al visitar sitios web que usan la misma red publicitaria. El propósito es optimizar la visualización de anuncios según los movimientos del usuario y diversas campañas publicitarias de los proveedores para mostrar anuncios al usuario.',
+ 'fr' => 'Enregistre un identifiant utilisateur unique qui reconnaît le navigateur de l\'utilisateur lors de la visite de sites utilisant le même réseau de publicité. L\'objectif étant d\'optimiser l\'affichage des annonces publicitaires en fonction des mouvements de l\'utilisateur et des offres des différents fournisseurs de pubs.',
+ 'qc' => 'Enregistre un identifiant utilisateur unique qui reconnaît le navigateur de l\'utilisateur lors de la visite de sites utilisant le même réseau de publicité. L\'objectif étant d\'optimiser l\'affichage des annonces publicitaires en fonction des mouvements de l\'utilisateur et des offres des différents fournisseurs de pubs.',
+ 'pl' => 'Rejestruje unikalny identyfikator użytkownika, który rozpoznaje przeglądarkę użytkownika podczas odwiedzania witryn internetowych korzystających z tej samej sieci reklamowej. Celem jest optymalizacja wyświetlania reklam na podstawie ruchów użytkownika i ofert różnych dostawców reklam za wyświetlanie reklam użytkownika.',
+ 'ro' => 'Înregistrează un ID de utilizator unic care recunoaște browserul utilizatorului atunci când vizitează site-uri web care utilizează aceeași rețea publicitară. Scopul este de a optimiza afișarea anunțurilor pe baza mișcărilor utilizatorului și a diverselor oferte de furnizori de anunțuri pentru afișarea anunțurilor utilizatorilor.',
+ 'pt' => 'Registra uma ID de usuário exclusiva que reconhece o navegador do usuário ao visitar sites que usam a mesma rede de anunciantes. O objetivo é otimizar a exibição de anúncios com base nos movimentos do usuário e vários lances de fornecedores de anúncios para exibir os anúncios do usuário.',
+ 'br' => 'Registra uma ID de usuário exclusiva que reconhece o navegador do usuário ao visitar sites que usam a mesma rede de anunciantes. O objetivo é otimizar a exibição de anúncios com base nos movimentos do usuário e vários lances de fornecedores de anúncios para exibir os anúncios do usuário.',
+ 'sk' => 'Zaregistruje jedinečné ID používateľa, ktoré rozpozná prehliadač používateľa pri návšteve webových stránok, ktoré používajú rovnakú reklamnú sieť. Účelom je optimalizovať zobrazovanie reklám na základe pohybov používateľov a ponúk rôznych poskytovateľov reklám na zobrazovanie reklám používateľov.',
+ 'nl' => 'Registreert een uniek gebruikers-ID dat de browser van de gebruiker herkent wanneer websites worden bezocht die hetzelfde advertentienetwerk gebruiken. Het doel is om de weergave van advertenties te optimaliseren op basis van de bewegingen van de gebruiker en de biedingen van verschillende advertentieproviders voor het weergeven van gebruikersadvertenties.',
+ 'de' => 'Registriert eine eindeutige Benutzer-ID, die der Browser des Benutzers bei einem Besuch von Websites erkennt, die das gleiche Werbenetzwerk verwenden. Der Zweck ist die Optimierung der Anzeige von Werbung auf Basis von Bewegungen des Benutzers und verschiedener Angebote von Werbeträgern für die Anzeige von Benutzerwerbung.',
+ 'gr' => 'Καταγράφει ένα μοναδικό αναγνωριστικό χρήστη που αναγνωρίζει το πρόγραμμα περιήγησης του χρήστη όταν επισκέπτεται ιστότοπους που χρησιμοποιούν το ίδιο δίκτυο διαφημίσεων. Ο σκοπός είναι η βελτιστοποίηση της προβολής των διαφημίσεων με βάση τις κινήσεις του χρήστη και διάφορες προσφορές παρόχων διαφημίσεων για την προβολή διαφημίσεων χρήστη.',
+ 'it' => 'Registra un ID utente univoco che riconosce il browser dell\'utente durante la visita di siti internet che utilizzano la stessa rete pubblicitaria. Lo scopo è di ottimizzare la visualizzazione di annunci pubblicitari sulla base dei movimenti dell\'utente e dei parametri di visualizzazione degli annunci agli utenti da parte dei fornitori di pubblicità.',
+ 'si' => 'Registrira edinstven ID uporabnika, ki prepozna brskalnik uporabnika med obiskom spletnih mest, ki uporabljajo isto oglaševalsko omrežje. Namen je optimizirati prikaz oglasov na podlagi uporabnikovih gibanj in ponudb različnih ponudnikov oglasov za prikaz uporabniških oglasov.',
+ 'da' => 'Registerer et unikt bruger-ID, som genkender brugerens browser ved besøg på hjemmesider, der anvender samme annoncenetværk. Formålet er at optimere visning af annoncer ud fra brugerens adfærd kombineret med forskellige annoncørers bud på at vise annoncer for brugeren.',
+ 'no' => 'Registrerer en unik bruker-ID som gjenkjenner brukerens nettleser når du besøker nettsteder som bruker samme annonsenettverk. Hensikten er å optimalisere visning av annonser basert på brukerens bevegelser og ulike annonseleverandører for å vise brukerannonser.',
+ 'cs' => 'Zaregistruje jedinečné ID uživatele, které rozpozná prohlížeč uživatele při návštěvě webových stránek, které používají stejnou reklamní síť. Účelem je optimalizovat zobrazování reklam na základě pohybu uživatele a nabídek různých poskytovatelů reklam pro zobrazování reklam uživatele.',
+ 'hu' => 'Egyedi felhasználói azonosítót regisztrál, amely felismeri a felhasználó böngészőjét, amikor ugyanazon hirdetési hálózatot használó webhelyeket látogat. A cél a hirdetések megjelenítésének optimalizálása a felhasználó mozgása és a különböző hirdetési szolgáltatók felhasználói hirdetések megjelenítésére vonatkozó ajánlatai alapján.',
+ 'sv' => 'Registrerar ett unikt användar-ID som känner igen användarens webbläsare när man besöker webbplatser som använder samma annonsnätverk. Syftet är att optimera visningen av annonser baserat på användarens rörelser och olika annonsleverantörers bud för att visa användarannonser.',
+ ],
+ 'expiry' => [
+ 'en' => '2 months',
+ 'es' => '2 meses',
+ 'ag' => '2 meses',
+ 'cb' => '2 meses',
+ 'mx' => '2 meses',
+ 'fr' => '2 mois',
+ 'qc' => '2 mois',
+ 'pl' => '2 miesiące',
+ 'ro' => '2 luni',
+ 'pt' => '2 meses',
+ 'br' => '2 meses',
+ 'sk' => '2 mesiace',
+ 'nl' => '2 maanden',
+ 'de' => '2 Monate',
+ 'gr' => '2 μήνες',
+ 'it' => '2 mesi',
+ 'si' => '2 meseca',
+ 'da' => '2 mdr.',
+ 'no' => '2 måneder',
+ 'cs' => '2 měsíců',
+ 'hu' => '2 hónap',
+ 'sv' => '2 månader',
+ ],
+ ],
+ [
+ /* Adform */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'C',
+ 'provider' => 'adform.net',
+ 'provider_url' => 'https://site.adform.com/privacy-center/adform-cookies/',
+ 'purpose' => [
+ 'en' => 'Used to check if the user\'s browser supports cookies.',
+ 'es' => 'Utilizada para comprobar si el navegador del usuario admite cookies.',
+ 'ag' => 'Utilizada para comprobar si el navegador del usuario admite cookies.',
+ 'cb' => 'Utilizada para comprobar si el navegador del usuario admite cookies.',
+ 'mx' => 'Utilizada para comprobar si el navegador del usuario admite cookies.',
+ 'fr' => 'Utilisé pour vérifier si le navigateur de l\'utilisateur accepte les cookies.',
+ 'qc' => 'Utilisé pour vérifier si le navigateur de l\'utilisateur accepte les cookies.',
+ 'pl' => 'Służy do sprawdzenia, czy przeglądarka użytkownika obsługuje pliki cookies.',
+ 'ro' => 'Folosit pentru a verifica dacă browserul utilizatorului acceptă cookie-uri.',
+ 'pt' => 'Usado para verificar se o navegador do usuário oferece suporte a cookies.',
+ 'br' => 'Usado para verificar se o navegador do usuário oferece suporte a cookies.',
+ 'sk' => 'Slúži na kontrolu, či prehliadač používateľa podporuje súbory cookie.',
+ 'nl' => 'Gebruikt om te controleren of de browser van de gebruiker cookies ondersteunt.',
+ 'de' => 'Verwendet, um zu überprüfen, ob der Browser des Benutzers Cookies unterstützt.',
+ 'gr' => 'Χρησιμοποιείται για να ελέγξει αν το πρόγραμμα περιήγησης του χρήστη υποστηρίζει cookie.',
+ 'it' => 'Utilizzato per verificare se il browser dell\'utente supporta i cookie.',
+ 'si' => 'Uporablja se za preverjanje, ali uporabniški brskalnik podpira piškotke.',
+ 'da' => 'Anvendes til at tjekke om brugerens browser understøtter cookies.',
+ 'no' => 'Brukes til å sjekke om brukerens nettleser støtter informasjonskapsler.',
+ 'cs' => 'Slouží ke kontrole, zda prohlížeč uživatele podporuje soubory cookie.',
+ 'hu' => 'Annak ellenőrzésére szolgál, hogy a felhasználó böngészője támogatja-e a sütiket.',
+ 'sv' => 'Används för att kontrollera om användarens webbläsare stöder cookies.',
+ ],
+ 'expiry' => [
+ 'en' => '30 days',
+ 'es' => '30 días',
+ 'ag' => '30 días',
+ 'cb' => '30 días',
+ 'mx' => '30 días',
+ 'fr' => '30 jours',
+ 'qc' => '30 jours',
+ 'pl' => '30 dni',
+ 'ro' => '30 de zile',
+ 'pt' => '30 dias',
+ 'br' => '30 dias',
+ 'sk' => '30 dní',
+ 'nl' => '30 dagen',
+ 'de' => '30 Tage',
+ 'gr' => '30 μέρες',
+ 'it' => '30 giorni',
+ 'si' => '30 dni',
+ 'da' => '30 dage',
+ 'no' => '30 dager',
+ 'cs' => '30 dager',
+ 'hu' => '30 nap',
+ 'sv' => '30 dagar',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => ['criteoonetag'],
+ 'name' => 'uid',
+ 'provider' => 'Criteo',
+ 'provider_url' => 'https://www.criteo.com/privacy/corporate-privacy-policy/',
+ 'purpose' => [
+ 'en' => 'Collects visitor data related to the user\'s visits to the website, such as the number of visits, average time spent on the website and what pages have been loaded, with the purpose of displaying targeted ads.',
+ 'es' => 'Recopila datos de visitantes relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo promedio que pasa en el sitio web y las páginas que se han cargado, con el propósito de mostrar anuncios dirigidos.',
+ 'ag' => 'Recopila datos de visitantes relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo promedio que pasa en el sitio web y las páginas que se han cargado, con el propósito de mostrar anuncios dirigidos.',
+ 'cb' => 'Recopila datos de visitantes relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo promedio que pasa en el sitio web y las páginas que se han cargado, con el propósito de mostrar anuncios dirigidos.',
+ 'mx' => 'Recopila datos de visitantes relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo promedio que pasa en el sitio web y las páginas que se han cargado, con el propósito de mostrar anuncios dirigidos.',
+ 'fr' => 'Collecte des données des visiteurs liées aux visites de l\'utilisateur sur le site Web, telles que le nombre de visites, le temps moyen passé sur le site Web et les pages chargées, dans le but d\'afficher des publicités ciblées.',
+ 'qc' => 'Collecte des données des visiteurs liées aux visites de l\'utilisateur sur le site Web, telles que le nombre de visites, le temps moyen passé sur le site Web et les pages chargées, dans le but d\'afficher des publicités ciblées.',
+ 'pl' => 'Gromadzi dane o odwiedzających związane z wizytami użytkownika w serwisie, takie jak liczba odwiedzin, średni czas spędzony w serwisie i jakie strony zostały wczytane, w celu wyświetlania ukierunkowanych reklam.',
+ 'ro' => 'Colectează date despre vizitatori legate de vizitele utilizatorului pe site, cum ar fi numărul de vizite, timpul mediu petrecut pe site și ce pagini au fost încărcate, cu scopul de a afișa reclame direcționate.',
+ 'pt' => 'Coleta dados do visitante relacionados às visitas do usuário ao site, como número de visitas, tempo médio de permanência no site e quais páginas foram carregadas, com o objetivo de exibir anúncios direcionados.',
+ 'br' => 'Coleta dados do visitante relacionados às visitas do usuário ao site, como número de visitas, tempo médio de permanência no site e quais páginas foram carregadas, com o objetivo de exibir anúncios direcionados.',
+ 'sk' => 'Zhromažďuje údaje o návštevníkoch súvisiace s návštevami webových stránok používateľom, napríklad počet návštev, priemerný čas strávený na webových stránkach a načítané stránky, aby sa zobrazili cielené reklamy.',
+ 'nl' => 'Verzamelt bezoekersgegevens met betrekking tot de bezoeken van de gebruiker aan de website, zoals het aantal bezoeken, de gemiddelde tijd die op de website is doorgebracht en welke pagina\'s zijn geladen, met als doel gerichte advertenties weer te geven.',
+ 'de' => 'Sammelt Besucherdaten im Zusammenhang mit den Besuchen des Benutzers auf der Website, z. B. die Anzahl der Besuche, die durchschnittliche Zeit, die auf der Website verbracht wurde, und die Seiten, die geladen wurden, um zielgerichtete Anzeigen anzuzeigen.',
+ 'gr' => 'Συλλέγει δεδομένα επισκεπτών που σχετίζονται με τις επισκέψεις του χρήστη στον ιστότοπο, όπως ο αριθμός των επισκέψεων, ο μέσος χρόνος που αφιερώνεται στον ιστότοπο και ποιες σελίδες έχουν φορτωθεί, με σκοπό την προβολή στοχευμένων διαφημίσεων.',
+ 'it' => 'Raccoglie i dati dei visitatori relativi alle visite dell\'utente al sito web, come il numero di visite, il tempo medio trascorso sul sito web e quali pagine sono state caricate, con lo scopo di visualizzare annunci mirati.',
+ 'si' => 'Zbira podatke o obiskovalcih, povezane z obiski uporabnika na spletnem mestu, kot so število obiskov, povprečni čas, ki ga je preživel na spletnem mestu in katere strani so bile naložene, z namenom prikazovanja ciljanih oglasov.',
+ 'da' => 'Indsamler besøgsdata relateret til brugerens besøg på webstedet, såsom antallet af besøg, den gennemsnitlige tid brugt på webstedet og hvilke sider der er blevet indlæst med det formål at vise målrettede annoncer.',
+ 'no' => 'Samler inn besøksdata relatert til brukerens besøk på nettstedet, for eksempel antall besøk, gjennomsnittlig tid brukt på nettstedet og hvilke sider som er lastet inn, med det formål å vise målrettede annonser.',
+ 'cs' => 'Shromažďuje údaje o návštěvnících související s návštěvami uživatele na webu, jako je počet návštěv, průměrný čas strávený na webu a jaké stránky byly načteny, za účelem zobrazení cílených reklam.',
+ 'hu' => 'Célzott hirdetések megjelenítésének céljából gyűjti a látogatóknak a felhasználó webhelyre tett látogatásával kapcsolatos adatokat, például a látogatások számát, a webhelyen eltöltött átlagos időt és az oldalakat.',
+ 'sv' => 'Samlar in besökardata relaterade till användarens besök på webbplatsen, till exempel antalet besök, genomsnittlig tid på webbplatsen och vilka sidor som har laddats, i syfte att visa riktade annonser.',
+ ],
+ 'expiry' => [
+ 'en' => '30 days',
+ 'es' => '30 días',
+ 'ag' => '30 días',
+ 'cb' => '30 días',
+ 'mx' => '30 días',
+ 'fr' => '30 jours',
+ 'qc' => '30 jours',
+ 'pl' => '30 dni',
+ 'ro' => '30 de zile',
+ 'pt' => '30 dias',
+ 'br' => '30 dias',
+ 'sk' => '30 dní',
+ 'nl' => '30 dagen',
+ 'de' => '30 Tage',
+ 'gr' => '30 μέρες',
+ 'it' => '30 giorni',
+ 'si' => '30 dni',
+ 'da' => '30 dage',
+ 'no' => '30 dager',
+ 'cs' => '30 dager',
+ 'hu' => '30 nap',
+ 'sv' => '30 dagar',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => ['cartsguru'],
+ 'name' => 'trkcg_fid',
+ 'provider' => 'Carts Guru',
+ 'provider_url' => 'https://www.carts.guru/privacy-policy/website-privacy-policy',
+ 'purpose' => [
+ 'en' => 'Identify the user ID for remarketing services',
+ 'es' => 'Identifica el ID de usuario para servicios de remarketing',
+ 'ag' => 'Identifica el ID de usuario para servicios de remarketing',
+ 'cb' => 'Identifica el ID de usuario para servicios de remarketing',
+ 'mx' => 'Identifica el ID de usuario para servicios de remarketing',
+ 'fr' => 'Identifiez l\'ID utilisateur des services de remarketing',
+ 'qc' => 'Identifiez l\'ID utilisateur des services de remarketing',
+ 'pl' => 'Zidentyfikuj identyfikator użytkownika usług remarketingowych',
+ 'ro' => 'Identificați ID-ul de utilizator pentru serviciile de remarketing',
+ 'pt' => 'Identifique o ID do usuário para serviços de remarketing',
+ 'br' => 'Identifique o ID do usuário para serviços de remarketing',
+ 'sk' => 'Identifikujte ID používateľa pre remarketingové služby',
+ 'nl' => 'Identificeer de gebruikers-ID voor remarketingdiensten',
+ 'de' => 'Identifizieren Sie die Benutzer-ID für Remarketing-Dienste',
+ 'gr' => 'Προσδιορίστε το αναγνωριστικό χρήστη για υπηρεσίες επαναληπτικού μάρκετινγκ',
+ 'it' => 'Identifica l\'ID utente per i servizi di remarketing',
+ 'si' => 'Določite ID uporabnika za storitve ponovnega trženja',
+ 'da' => 'Identificer bruger-ID til remarketingtjenester',
+ 'no' => 'Identifiser bruker-ID for remarketingtjenester',
+ 'cs' => 'Identifikujte ID uživatele pro remarketingové služby',
+ 'hu' => 'Azonosítsa a remarketingszolgáltatások felhasználói azonosítóját',
+ 'sv' => 'Identifiera användar-ID för remarketingtjänster',
+ ],
+ 'expiry' => [
+ 'en' => '30 days',
+ 'es' => '30 días',
+ 'ag' => '30 días',
+ 'cb' => '30 días',
+ 'mx' => '30 días',
+ 'fr' => '30 jours',
+ 'qc' => '30 jours',
+ 'pl' => '30 dni',
+ 'ro' => '30 de zile',
+ 'pt' => '30 dias',
+ 'br' => '30 dias',
+ 'sk' => '30 dní',
+ 'nl' => '30 dagen',
+ 'de' => '30 Tage',
+ 'gr' => '30 μέρες',
+ 'it' => '30 giorni',
+ 'si' => '30 dni',
+ 'da' => '30 dage',
+ 'no' => '30 dager',
+ 'cs' => '30 dager',
+ 'hu' => '30 nap',
+ 'sv' => '30 dagar',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => ['cartsguru'],
+ 'name' => 'trkcg_sid',
+ 'provider' => 'Carts Guru',
+ 'provider_url' => 'https://www.carts.guru/privacy-policy/website-privacy-policy',
+ 'purpose' => [
+ 'en' => 'Identify the session for remarketing services',
+ 'es' => 'Identifica la sesión para servicios de remarketing',
+ 'ag' => 'Identifica la sesión para servicios de remarketing',
+ 'cb' => 'Identifica la sesión para servicios de remarketing',
+ 'mx' => 'Identifica la sesión para servicios de remarketing',
+ 'fr' => 'Identifier la session pour les services de remarketing',
+ 'qc' => 'Identifier la session pour les services de remarketing',
+ 'pl' => 'Zidentyfikuj sesję dla usług remarketingowych',
+ 'ro' => 'Identificați sesiunea pentru serviciile de remarketing',
+ 'pt' => 'Identifique a sessão para serviços de remarketing',
+ 'br' => 'Identifique a sessão para serviços de remarketing',
+ 'sk' => 'Identifikujte reláciu pre remarketingové služby',
+ 'nl' => 'Identificeer de sessie voor remarketingdiensten',
+ 'de' => 'Identifizieren Sie die Sitzung für Remarketing-Dienste',
+ 'gr' => 'Προσδιορίστε την περίοδο σύνδεσης για υπηρεσίες επαναληπτικού μάρκετινγκ',
+ 'it' => 'Identifica la sessione per i servizi di remarketing',
+ 'si' => 'Določite sejo za storitve ponovnega trženja',
+ 'da' => 'Identificer sessionen til remarketingtjenester',
+ 'no' => 'Identifiser økten for remarketingtjenester',
+ 'cs' => 'Určete relaci pro remarketingové služby',
+ 'hu' => 'Azonosítsa a munkamenetet a remarketingszolgáltatásokhoz',
+ 'sv' => 'Identifiera sessionen för remarketingtjänster',
+ ],
+ 'expiry' => [
+ 'en' => '30 minutes',
+ 'es' => '30 minutos',
+ 'ag' => '30 minutos',
+ 'cb' => '30 minutos',
+ 'mx' => '30 minutos',
+ 'fr' => '30 minutes',
+ 'qc' => '30 minutes',
+ 'pl' => '30 minut',
+ 'ro' => '30 minute',
+ 'pt' => '30 minutos',
+ 'br' => '30 minutos',
+ 'sk' => '30 minút',
+ 'nl' => '30 minuten',
+ 'de' => '30 Minuten',
+ 'gr' => '30 λεπτά',
+ 'it' => '30 minuti',
+ 'si' => '30 minut',
+ 'da' => '30 minutter',
+ 'no' => '30 minutter',
+ 'cs' => '30 minut',
+ 'hu' => '30 perc',
+ 'sv' => '30 minuter',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => ['sendinblue'],
+ 'name' => 'sib_cuid',
+ 'provider' => 'Sendinblue',
+ 'provider_url' => 'https://sendinblue.com/legal/privacypolicy/',
+ 'purpose' => [
+ 'en' => 'Collects information on the user\'s website navigation and preferences - This is used to target potential newsletter based upon this information.',
+ 'es' => 'Recoge información de la navegación del usuario en la web y sus preferencias. Se usa para dirigir un bolentín potencial a raíz de esta información.',
+ 'ag' => 'Recoge información de la navegación del usuario en la web y sus preferencias. Se usa para dirigir un bolentín potencial a raíz de esta información.',
+ 'cb' => 'Recoge información de la navegación del usuario en la web y sus preferencias. Se usa para dirigir un bolentín potencial a raíz de esta información.',
+ 'mx' => 'Recoge información de la navegación del usuario en la web y sus preferencias. Se usa para dirigir un bolentín potencial a raíz de esta información.',
+ 'fr' => 'Collecte les informations sur la navigation et les préférences des utilisateurs sur le site web – Cela est utilisé pour cibler une éventuelle newsletter en fonction de ces informations.',
+ 'qc' => 'Collecte les informations sur la navigation et les préférences des utilisateurs sur le site web – Cela est utilisé pour cibler une éventuelle newsletter en fonction de ces informations.',
+ 'pl' => 'Zbiera informacje o nawigacji i preferencjach użytkownika w witrynie - służy do kierowania potencjalnego newslettera na podstawie tych informacji.',
+ 'ro' => 'Colectează informații despre navigarea și preferințele site-ului utilizatorului - Acesta este utilizat pentru a viza potențialul buletin informativ pe baza acestor informații.',
+ 'pt' => 'Coleta informações sobre a navegação e as preferências do usuário no site - Isso é usado para direcionar o boletim informativo potencial com base nessas informações.',
+ 'br' => 'Coleta informações sobre a navegação e as preferências do usuário no site - Isso é usado para direcionar o boletim informativo potencial com base nessas informações.',
+ 'sk' => 'Zhromažďuje informácie o navigácii a preferenciách na webových stránkach používateľa - používa sa na zacielenie potenciálneho bulletinu na základe týchto informácií.',
+ 'nl' => 'Verzamelt informatie over de navigatie en voorkeuren van de websitebezoeker - Dit wordt gebruikt om potentiële nieuwsbrief te targeten op basis van deze informatie.',
+ 'de' => 'Sammelt Informationen über die Navigation und die Präferenzen der Benutzer auf der Website - Dies wird verwendet, um potenzielle Newsletter auf der Grundlage dieser Informationen auszurichten.',
+ 'gr' => 'Συλλέγει πληροφορίες σχετικά με την πλοήγηση και τις προτιμήσεις του ιστότοπου του χρήστη - Χρησιμοποιείται για τη στόχευση πιθανών ενημερωτικών δελτίων βάσει αυτών των πληροφοριών.',
+ 'it' => 'Raccoglie informazioni sulla navigazione dell\'utente sul sito e sulle sue preferenze - Viene utilizzato per indirizzare potenziali newsletter sulla base di queste informazioni.',
+ 'si' => 'Zbira informacije o navigaciji in nastavitvah uporabnikovega spletnega mesta - to se uporablja za ciljanje potencialnih novic na podlagi teh informacij.',
+ 'da' => 'Indsamler data om brugerens navigation og præferencer på hjemmesiden - Benyttes til at målrette potentielle nyhedsbreve baseret på disse data.',
+ 'no' => 'Samler informasjon om brukerens nettstednavigasjon og preferanser - Dette brukes til å målrette potensielt nyhetsbrev basert på denne informasjonen.',
+ 'cs' => 'Shromažďuje informace o navigaci a preferencích na webových stránkách uživatele - používá se k zacílení potenciálního zpravodaje na základě těchto informací.',
+ 'hu' => 'Információt gyűjt a felhasználó webhelyének navigációjáról és preferenciáiról - Ez arra szolgál, hogy ezen információk alapján megcélozza a lehetséges hírleveleket.',
+ 'sv' => 'Samlar in information om användarens webbplatsnavigering och preferenser - Detta används för att rikta dig till potentiellt nyhetsbrev baserat på denna information.',
+ ],
+ 'expiry' => [
+ 'en' => '1 year',
+ 'es' => '1 año',
+ 'ag' => '1 año',
+ 'cb' => '1 año',
+ 'mx' => '1 año',
+ 'fr' => '1 année',
+ 'qc' => '1 année',
+ 'pl' => '1 rok',
+ 'ro' => '1 an',
+ 'pt' => '1 ano',
+ 'br' => '1 ano',
+ 'sk' => '1 rok',
+ 'nl' => '1 jaar',
+ 'de' => '1 Jahr',
+ 'gr' => '1 χρόνος',
+ 'it' => '1 anno',
+ 'si' => '1 leto',
+ 'da' => '1 år',
+ 'no' => '1 år',
+ 'cs' => '1 rok',
+ 'hu' => '1 év',
+ 'sv' => '1 år',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'IDE',
+ 'provider' => 'doubleclick.net',
+ 'provider_url' => 'http://doubleclick.net/',
+ 'purpose' => [
+ 'en' => 'Used by Google DoubleClick to register and report the website user\'s actions after viewing or clicking one of the advertiser\'s ads with the purpose of measuring the efficacy of an ad and to present targeted ads to the user.',
+ 'es' => 'Utilizada por Google DoubleClick para registrar e informar sobre las acciones del usuario en el sitio web tras visualizar o hacer clic en uno de los anuncios del anunciante con el propósito de medir la eficacia de un anuncio y presentar anuncios específicos para el usuario.',
+ 'ag' => 'Utilizada por Google DoubleClick para registrar e informar sobre las acciones del usuario en el sitio web tras visualizar o hacer clic en uno de los anuncios del anunciante con el propósito de medir la eficacia de un anuncio y presentar anuncios específicos para el usuario.',
+ 'cb' => 'Utilizada por Google DoubleClick para registrar e informar sobre las acciones del usuario en el sitio web tras visualizar o hacer clic en uno de los anuncios del anunciante con el propósito de medir la eficacia de un anuncio y presentar anuncios específicos para el usuario.',
+ 'mx' => 'Utilizada por Google DoubleClick para registrar e informar sobre las acciones del usuario en el sitio web tras visualizar o hacer clic en uno de los anuncios del anunciante con el propósito de medir la eficacia de un anuncio y presentar anuncios específicos para el usuario.',
+ 'fr' => 'Utilisé par Google DoubleClick pour enregistrer et signaler les actions de l\'utilisateur du site après qu\'il ait vu ou cliqué sur une des pubs de l\'annonceur dans le but de mesurer l\'efficacité et de présenter des annonces publicitaires ciblées à l\'utilisateur.',
+ 'qc' => 'Utilisé par Google DoubleClick pour enregistrer et signaler les actions de l\'utilisateur du site après qu\'il ait vu ou cliqué sur une des pubs de l\'annonceur dans le but de mesurer l\'efficacité et de présenter des annonces publicitaires ciblées à l\'utilisateur.',
+ 'pl' => 'Używany przez Google DoubleClick do rejestrowania i raportowania działań użytkownika serwisu internetowego po obejrzeniu lub kliknięciu jednej z reklam ogłoszeniodawcy w celu pomiaru skuteczności reklamy i przedstawienia użytkownikowi ukierunkowanych reklam.',
+ 'ro' => 'Folosit de Google DoubleClick pentru a înregistra și a raporta acțiunile utilizatorului site-ului web după ce a vizionat sau a făcut clic pe unul dintre anunțurile agentului de publicitate, cu scopul de a măsura eficiența unui anunț și de a prezenta utilizatorului anunțuri direcționate.',
+ 'pt' => 'Usado pelo Google DoubleClick para registrar e relatar as ações do usuário do site após visualizar ou clicar em um dos anúncios do anunciante com o objetivo de medir a eficácia de um anúncio e apresentar anúncios direcionados ao usuário.',
+ 'br' => 'Usado pelo Google DoubleClick para registrar e relatar as ações do usuário do site após visualizar ou clicar em um dos anúncios do anunciante com o objetivo de medir a eficácia de um anúncio e apresentar anúncios direcionados ao usuário.',
+ 'sk' => 'Používa Google DoubleClick na registráciu a hlásenie akcií používateľa webových stránok po zobrazení alebo kliknutí na jednu z reklám inzerenta na účely merania účinnosti reklamy a na predstavenie používateľovi cielených reklám.',
+ 'nl' => 'Gebruikt door Google DoubleClick om de acties van de websitegebruiker te registreren en te rapporteren na het bekijken of klikken op een van de advertenties van de adverteerder met het doel de effectiviteit van een advertentie te meten en om gerichte advertenties aan de gebruiker te presenteren.',
+ 'de' => 'Verwendet von Google DoubleClick, um die Handlungen des Benutzers auf der Webseite nach der Anzeige oder dem Klicken auf eine der Anzeigen des Anbieters zu registrieren und zu melden, mit dem Zweck der Messung der Wirksamkeit einer Werbung und der Anzeige zielgerichteter Werbung für den Benutzer.',
+ 'gr' => 'Χρησιμοποιείται από το Google DoubleClick για να εγγραφεί και να αναφέρει τις ενέργειες του χρήστη του ιστότοπου μετά την προβολή ή κλικ σε μία από τις διαφημίσεις του διαφημιζόμενου με σκοπό τη μέτρηση της αποτελεσματικότητας μιας διαφήμισης και την παρουσίαση στοχευμένων διαφημίσεων στον χρήστη.',
+ 'it' => 'Utilizzato da Google DoubleClick per registrare e produrre resoconti sulle azioni dell\'utente sul sito dopo aver visualizzato o cliccato una delle pubblicità dell\'inserzionista al fine di misurare l\'efficacia di una pubblicità e presentare pubblicità mirata all\'utente.',
+ 'si' => 'Google DoubleClick ga uporablja za registracijo in poročanje o dejanjih uporabnika spletnega mesta po ogledu ali kliku enega od oglasov oglaševalca z namenom merjenja učinkovitosti oglasa in predstavitve ciljnih oglasov uporabniku.',
+ 'da' => 'Anvendes af Google DoubleClick til at registrere og rapportere om hjemmesidebrugerens handlinger efter at have set eller klikket på en af annoncørens annoncer. Formålet er at måle effekten af en annonce samt at målrette annoncer til brugeren.',
+ 'no' => 'Brukt av Google DoubleClick til å registrere og rapportere handlingene til brukeren av nettstedet etter å ha sett eller klikket på en av annonsørens annonser med det formål å måle effektiviteten til en annonse og presentere målrettede annonser for brukeren.',
+ 'cs' => 'Používá Google DoubleClick k registraci a hlášení akcí uživatele webových stránek po zobrazení nebo kliknutí na jednu z reklam inzerenta za účelem měření účinnosti reklamy a k zobrazení cílených reklam uživateli.',
+ 'hu' => 'A Google DoubleClick használja arra, hogy regisztrálja és jelentse a webhely felhasználójának műveleteit, miután megnézte vagy rákattintott a hirdető egyik hirdetésére, a hirdetés hatékonyságának mérése és célzott hirdetések bemutatása céljából.',
+ 'sv' => 'Används av Google DoubleClick för att registrera och rapportera webbplatsanvändarens åtgärder efter att ha visat eller klickat på en av annonsörens annonser i syfte att mäta effektiviteten i en annons och att presentera riktade annonser för användaren.',
+ ],
+ 'expiry' => [
+ 'en' => '1 year',
+ 'es' => '1 año',
+ 'ag' => '1 año',
+ 'cb' => '1 año',
+ 'mx' => '1 año',
+ 'fr' => '1 année',
+ 'qc' => '1 année',
+ 'pl' => '1 rok',
+ 'ro' => '1 an',
+ 'pt' => '1 ano',
+ 'br' => '1 ano',
+ 'sk' => '1 rok',
+ 'nl' => '1 jaar',
+ 'de' => '1 Jahr',
+ 'gr' => '1 χρόνος',
+ 'it' => '1 anno',
+ 'si' => '1 leto',
+ 'da' => '1 år',
+ 'no' => '1 år',
+ 'cs' => '1 rok',
+ 'hu' => '1 év',
+ 'sv' => '1 år',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'NID',
+ 'provider' => 'Google',
+ 'provider_url' => 'https://policies.google.com/privacy',
+ 'purpose' => [
+ 'en' => 'Registers a unique ID that identifies a returning user\'s device. The ID is used for targeted ads.',
+ 'es' => 'Registra una identificación única que identifica el dispositivo de un usuario que vuelve. La identificación se utiliza para los anuncios específicos.',
+ 'ag' => 'Registra una identificación única que identifica el dispositivo de un usuario que vuelve. La identificación se utiliza para los anuncios específicos.',
+ 'cb' => 'Registra una identificación única que identifica el dispositivo de un usuario que vuelve. La identificación se utiliza para los anuncios específicos.',
+ 'mx' => 'Registra una identificación única que identifica el dispositivo de un usuario que vuelve. La identificación se utiliza para los anuncios específicos.',
+ 'fr' => 'Enregistre un identifiant qui identifie l\'appareil de l\'utilisateur récurrent. Cet identifiant est utilisé pour des annonces ciblées.',
+ 'qc' => 'Enregistre un identifiant qui identifie l\'appareil de l\'utilisateur récurrent. Cet identifiant est utilisé pour des annonces ciblées.',
+ 'pl' => 'Rejestruje unikalny identyfikator, który identyfikuje urządzenie powracającego użytkownika. Identyfikator służy do kierowanych reklam.',
+ 'ro' => 'Înregistrează un ID unic care identifică dispozitivul unui utilizator care se întoarce. ID-ul este utilizat pentru reclame direcționate.',
+ 'pt' => 'Registra um ID exclusivo que identifica o dispositivo de um usuário recorrente. O ID é usado para anúncios direcionados.',
+ 'br' => 'Registra um ID exclusivo que identifica o dispositivo de um usuário recorrente. O ID é usado para anúncios direcionados.',
+ 'sk' => 'Zaregistruje jedinečný identifikátor, ktorý identifikuje zariadenie vracajúceho sa používateľa. ID sa používa pre cielené reklamy.',
+ 'nl' => 'Registreert een uniek ID die het apparaat van een terugkerende gebruiker identificeert. Het ID wordt gebruikt voor gerichte advertenties.',
+ 'de' => 'Registriert eine eindeutige ID, die das Gerät eines wiederkehrenden Benutzers identifiziert. Die ID wird für gezielte Werbung genutzt.',
+ 'gr' => 'Καταγράφει ένα μοναδικό αναγνωριστικό που προσδιορίζει τη συσκευή ενός χρήστη που επιστρέφει. Το αναγνωριστικό χρησιμοποιείται για στοχευμένες διαφημίσεις.',
+ 'it' => 'Registra un ID univoco che identifica il dispositivo dell\'utente che ritorna sul sito. L\'ID viene utilizzato per pubblicità mirate.',
+ 'si' => 'Registrira enolični ID, ki identificira napravo, ki se vrača. ID se uporablja za ciljne oglase.',
+ 'da' => 'Registrerer et unikt ID, der identificerer brugerens enhed ved tilbagevendende besøg. ID\'et anvendes til at målrette annoncer.',
+ 'no' => 'Registrerer en unik ID som identifiserer enheten til en bruker som returnerer. ID-en brukes til målrettede annonser.',
+ 'cs' => 'Zaregistruje jedinečné ID, které identifikuje zařízení vracejícího se uživatele. ID se používá pro cílené reklamy.',
+ 'hu' => 'Egyedi azonosítót regisztrál, amely azonosítja a visszatérő felhasználó eszközét. Az azonosítót célzott hirdetésekhez használják.',
+ 'sv' => 'Registrerar ett unikt ID som identifierar en återvändares enhet. ID används för riktade annonser.',
+ ],
+ 'expiry' => [
+ 'en' => '6 months',
+ 'es' => '6 meses',
+ 'ag' => '6 meses',
+ 'cb' => '6 meses',
+ 'mx' => '6 meses',
+ 'fr' => '6 mois',
+ 'qc' => '6 mois',
+ 'pl' => '6 miesiące',
+ 'ro' => '6 luni',
+ 'pt' => '6 meses',
+ 'br' => '6 meses',
+ 'sk' => '6 mesiace',
+ 'nl' => '6 maanden',
+ 'de' => '6 Monate',
+ 'gr' => '6 μήνες',
+ 'it' => '6 mesi',
+ 'si' => '6 meseca',
+ 'da' => '6 mdr.',
+ 'no' => '6 måneder',
+ 'cs' => '6 měsíců',
+ 'hu' => '6 hónap',
+ 'sv' => '6 månader',
+ ],
+ ],
+ [
+ /* Smartlook */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'SL_C_#_KEY',
+ 'provider' => 'Smartlook',
+ 'provider_url' => 'https://help.smartlook.com/en/articles/3244452-privacy-policy',
+ 'purpose' => [
+ 'en' => 'Collects statistical data related to the user\'s website visits, such as the number of visits, average time spent on the website and what pages have been loaded. The purpose is to segment the website\'s users according to factors such as demographics and geographical location, in order to enable media and marketing agencies to structure and understand their target groups to enable customised online advertising.',
+ 'es' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'ag' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'cb' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'mx' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'fr' => 'Recueille des données statistiques liées aux visites du site web de l\'utilisateur, telles que le nombre de visites, le temps moyen passé sur le site et quelles pages ont été chargées. L’objectif étant de segmenter les utilisateurs du site en fonction de facteurs tels que la démographie et la situation géographique, afin de permettre aux médias et aux agences de marketing de structurer et de comprendre leurs groupes cibles et pour être en mesure d\'afficher une publicité en ligne personnalisée.',
+ 'qc' => 'Recueille des données statistiques liées aux visites du site web de l\'utilisateur, telles que le nombre de visites, le temps moyen passé sur le site et quelles pages ont été chargées. L’objectif étant de segmenter les utilisateurs du site en fonction de facteurs tels que la démographie et la situation géographique, afin de permettre aux médias et aux agences de marketing de structurer et de comprendre leurs groupes cibles et pour être en mesure d\'afficher une publicité en ligne personnalisée.',
+ 'pl' => 'Zbiera dane statystyczne dotyczące odwiedzin serwisu przez użytkownika, takie jak liczba odwiedzin, średni czas spędzony w serwisie oraz jakie strony zostały wczytane. Celem jest segmentacja użytkowników witryny internetowej według czynników, takich jak dane demograficzne i położenie geograficzne, aby umożliwić agencjom medialnym i marketingowym ustrukturyzowanie i zrozumienie ich grup docelowych w celu umożliwienia dostosowanej reklamy online.',
+ 'ro' => 'Colectează date statistice legate de vizitele site-ului utilizatorului, cum ar fi numărul de vizite, timpul mediu petrecut pe site și ce pagini au fost încărcate. Scopul este de a segmenta utilizatorii site-ului în funcție de factori precum demografia și locația geografică, pentru a permite agențiilor media și de marketing să își structureze și să înțeleagă grupurile țintă pentru a permite publicitate online personalizată.',
+ 'pt' => 'Coleta dados estatísticos relativos às visitas do usuário ao site, como número de visitas, tempo médio de permanência no site e quais páginas foram carregadas. O objetivo é segmentar os usuários do site de acordo com fatores como dados demográficos e localização geográfica, a fim de permitir que as agências de mídia e marketing estruturem e entendam seus públicos-alvo para possibilitar a publicidade online personalizada.',
+ 'br' => 'Coleta dados estatísticos relativos às visitas do usuário ao site, como número de visitas, tempo médio de permanência no site e quais páginas foram carregadas. O objetivo é segmentar os usuários do site de acordo com fatores como dados demográficos e localização geográfica, a fim de permitir que as agências de mídia e marketing estruturem e entendam seus públicos-alvo para possibilitar a publicidade online personalizada.',
+ 'sk' => 'Zhromažďuje štatistické údaje týkajúce sa návštev webových stránok používateľa, ako napríklad počet návštev, priemerný čas strávený na webových stránkach a načítané stránky. Účelom je segmentovať používateľov webových stránok podľa faktorov, ako sú demografické údaje a geografické umiestnenie, aby mohli mediálne a marketingové agentúry štruktúrovať a porozumieť svojim cieľovým skupinám a umožniť tak prispôsobenú online reklamu.',
+ 'nl' => 'Verzamelt statistische gegevens met betrekking tot de websitebezoeken van de gebruiker, zoals het aantal bezoeken, de gemiddelde tijd die op de website is doorgebracht en welke pagina\'s zijn geladen. Het doel is om de gebruikers van de website te segmenteren op basis van factoren zoals demografie en geografische locatie, zodat media- en marketingbureaus hun doelgroepen kunnen structureren en begrijpen om aangepaste online advertenties mogelijk te maken.',
+ 'de' => 'Erfasst statistische Daten zu Website-Besuchen des Benutzers, wie z. B. die Anzahl der Besuche, durchschnittliche Verweildauer auf der Website und welche Seiten geladen wurden. Der Zweck ist die Segmentierung der Benutzer der Website nach Faktoren wie Demografie und geografische Lage, damit Medien- und Marketing-Agenturen ihre Zielgruppen strukturieren und verstehen können, um maßgeschneiderte Online-Werbung zu ermöglichen.',
+ 'gr' => 'Συλλέγει στατιστικά δεδομένα που σχετίζονται με τις επισκέψεις στον ιστότοπο του χρήστη, όπως ο αριθμός των επισκέψεων, ο μέσος χρόνος που αφιερώνεται στον ιστότοπο και ποιες σελίδες έχουν φορτωθεί. Ο σκοπός είναι η τμηματοποίηση των χρηστών του ιστότοπου σύμφωνα με παράγοντες όπως τα δημογραφικά στοιχεία και η γεωγραφική θέση, προκειμένου να δοθεί η δυνατότητα στα μέσα ενημέρωσης και στα γραφεία μάρκετινγκ να δομήσουν και να κατανοήσουν τις ομάδες-στόχους τους ώστε να επιτρέψουν προσαρμοσμένες διαδικτυακές διαφημίσεις.',
+ 'it' => 'Raccoglie dati statistici relativi alle visite del sito internet da parte dell\'utente, come ad esempio il numero di visite, il tempo medio speso sul sito e quali pagine sono state caricate. Lo scopo è di suddividere gli utenti del sito internet a seconda di fattori demografici e geografici, allo scopo di consentire ai media e alle agenzie marketing di strutturare e comprendere i loro gruppi target per effettuare pubblicità online personalizzate.',
+ 'si' => 'Zbira statistične podatke, povezane z obiski uporabnikovega spletnega mesta, kot so število obiskov, povprečni čas, ki ga je preživel na spletnem mestu in katere strani so bile naložene. Namen je segmentirati uporabnike spletnega mesta glede na dejavnike, kot so demografski podatki in geografski položaj, da se medijem in marketinškim agencijam omogoči, da strukturirajo in razumejo svoje ciljne skupine, da omogočijo prilagojeno spletno oglaševanje.',
+ 'da' => 'Indsamler statistik om brugerens besøg på hjemmesiden såsom antallet af besøg, den gennemsnitlige tid på hjemmesiden og hvilke sider der er læst. Formålet er at segmentere hjemmesidens brugere efter faktorer såsom demografi og geografi for at gøre det muligt for medier og marketingbureauer at strukturere og forstå deres målgrupper med henblik på at tilpasse online annoncering.',
+ 'no' => 'Samler inn statistiske data relatert til brukerens nettstedsbesøk, for eksempel antall besøk, gjennomsnittlig tid brukt på nettstedet og hvilke sider som er lastet inn. Hensikten er å segmentere nettstedets brukere i henhold til faktorer som demografi og geografisk beliggenhet, for å gjøre media- og markedsføringsbyråer i stand til å strukturere og forstå sine målgrupper for å muliggjøre tilpasset annonsering på nettet.',
+ 'cs' => 'Shromažďuje statistické údaje související s návštěvami webových stránek uživatele, například počet návštěv, průměrný čas strávený na webu a jaké stránky byly načteny. Účelem je segmentovat uživatele webu podle faktorů, jako jsou demografické údaje a zeměpisné umístění, aby mediální a marketingové agentury mohly strukturovat a porozumět jejich cílovým skupinám a umožnit tak přizpůsobenou online reklamu.',
+ 'hu' => 'Gyűjti a felhasználó webhelylátogatásaira vonatkozó statisztikai adatokat, például a látogatások számát, a webhelyen töltött átlagos időt és a betöltött oldalakat. A cél a weboldal felhasználói szegmentálása olyan tényezők szerint, mint a demográfia és a földrajzi elhelyezkedés, annak érdekében, hogy a média és a marketing ügynökségek strukturálhassák és megértsék célcsoportjaikat a testreszabott online hirdetések lehetővé tétele érdekében.',
+ 'sv' => 'Samlar in statistiska data relaterade till användarens webbplatsbesök, till exempel antalet besök, genomsnittlig tid på webbplatsen och vilka sidor som har laddats. Syftet är att segmentera webbplatsens användare efter faktorer som demografi och geografisk plats för att göra det möjligt för media och marknadsföringsbyråer att strukturera och förstå sina målgrupper för att möjliggöra skräddarsydd onlineannonsering.',
+ ],
+ 'expiry' => [
+ 'en' => '13 months',
+ 'es' => '13 meses',
+ 'ag' => '13 meses',
+ 'cb' => '13 meses',
+ 'mx' => '13 meses',
+ 'fr' => '13 mois',
+ 'qc' => '13 mois',
+ 'pl' => '13 miesiące',
+ 'ro' => '13 luni',
+ 'pt' => '13 meses',
+ 'br' => '13 meses',
+ 'sk' => '13 mesiace',
+ 'nl' => '13 maanden',
+ 'de' => '13 Monate',
+ 'gr' => '13 μήνες',
+ 'it' => '13 mesi',
+ 'si' => '13 meseca',
+ 'da' => '13 mdr.',
+ 'no' => '13 måneder',
+ 'cs' => '13 měsíců',
+ 'hu' => '13 hónap',
+ 'sv' => '13 månader',
+ 'sv' => '13 månader',
+ ],
+ ],
+ [
+ /* Smartlook */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'SL_C_#_SID',
+ 'provider' => 'Smartlook',
+ 'provider_url' => 'https://help.smartlook.com/en/articles/3244452-privacy-policy',
+ 'purpose' => [
+ 'en' => 'Collects statistical data related to the user\'s website visits, such as the number of visits, average time spent on the website and what pages have been loaded. The purpose is to segment the website\'s users according to factors such as demographics and geographical location, in order to enable media and marketing agencies to structure and understand their target groups to enable customised online advertising.',
+ 'es' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'ag' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'cb' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'mx' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'fr' => 'Recueille des données statistiques liées aux visites du site web de l\'utilisateur, telles que le nombre de visites, le temps moyen passé sur le site et quelles pages ont été chargées. L’objectif étant de segmenter les utilisateurs du site en fonction de facteurs tels que la démographie et la situation géographique, afin de permettre aux médias et aux agences de marketing de structurer et de comprendre leurs groupes cibles et pour être en mesure d\'afficher une publicité en ligne personnalisée.',
+ 'qc' => 'Recueille des données statistiques liées aux visites du site web de l\'utilisateur, telles que le nombre de visites, le temps moyen passé sur le site et quelles pages ont été chargées. L’objectif étant de segmenter les utilisateurs du site en fonction de facteurs tels que la démographie et la situation géographique, afin de permettre aux médias et aux agences de marketing de structurer et de comprendre leurs groupes cibles et pour être en mesure d\'afficher une publicité en ligne personnalisée.',
+ 'pl' => 'Zbiera dane statystyczne dotyczące odwiedzin serwisu przez użytkownika, takie jak liczba odwiedzin, średni czas spędzony w serwisie oraz jakie strony zostały wczytane. Celem jest segmentacja użytkowników witryny internetowej według czynników, takich jak dane demograficzne i położenie geograficzne, aby umożliwić agencjom medialnym i marketingowym ustrukturyzowanie i zrozumienie ich grup docelowych w celu umożliwienia dostosowanej reklamy online.',
+ 'ro' => 'Colectează date statistice legate de vizitele site-ului utilizatorului, cum ar fi numărul de vizite, timpul mediu petrecut pe site și ce pagini au fost încărcate. Scopul este de a segmenta utilizatorii site-ului în funcție de factori precum demografia și locația geografică, pentru a permite agențiilor media și de marketing să își structureze și să înțeleagă grupurile țintă pentru a permite publicitate online personalizată.',
+ 'pt' => 'Coleta dados estatísticos relativos às visitas do usuário ao site, como número de visitas, tempo médio de permanência no site e quais páginas foram carregadas. O objetivo é segmentar os usuários do site de acordo com fatores como dados demográficos e localização geográfica, a fim de permitir que as agências de mídia e marketing estruturem e entendam seus públicos-alvo para possibilitar a publicidade online personalizada.',
+ 'br' => 'Coleta dados estatísticos relativos às visitas do usuário ao site, como número de visitas, tempo médio de permanência no site e quais páginas foram carregadas. O objetivo é segmentar os usuários do site de acordo com fatores como dados demográficos e localização geográfica, a fim de permitir que as agências de mídia e marketing estruturem e entendam seus públicos-alvo para possibilitar a publicidade online personalizada.',
+ 'sk' => 'Zhromažďuje štatistické údaje týkajúce sa návštev webových stránok používateľa, ako napríklad počet návštev, priemerný čas strávený na webových stránkach a načítané stránky. Účelom je segmentovať používateľov webových stránok podľa faktorov, ako sú demografické údaje a geografické umiestnenie, aby mohli mediálne a marketingové agentúry štruktúrovať a porozumieť svojim cieľovým skupinám a umožniť tak prispôsobenú online reklamu.',
+ 'nl' => 'Verzamelt statistische gegevens met betrekking tot de websitebezoeken van de gebruiker, zoals het aantal bezoeken, de gemiddelde tijd die op de website is doorgebracht en welke pagina\'s zijn geladen. Het doel is om de gebruikers van de website te segmenteren op basis van factoren zoals demografie en geografische locatie, zodat media- en marketingbureaus hun doelgroepen kunnen structureren en begrijpen om aangepaste online advertenties mogelijk te maken.',
+ 'de' => 'Erfasst statistische Daten zu Website-Besuchen des Benutzers, wie z. B. die Anzahl der Besuche, durchschnittliche Verweildauer auf der Website und welche Seiten geladen wurden. Der Zweck ist die Segmentierung der Benutzer der Website nach Faktoren wie Demografie und geografische Lage, damit Medien- und Marketing-Agenturen ihre Zielgruppen strukturieren und verstehen können, um maßgeschneiderte Online-Werbung zu ermöglichen.',
+ 'gr' => 'Συλλέγει στατιστικά δεδομένα που σχετίζονται με τις επισκέψεις στον ιστότοπο του χρήστη, όπως ο αριθμός των επισκέψεων, ο μέσος χρόνος που αφιερώνεται στον ιστότοπο και ποιες σελίδες έχουν φορτωθεί. Ο σκοπός είναι η τμηματοποίηση των χρηστών του ιστότοπου σύμφωνα με παράγοντες όπως τα δημογραφικά στοιχεία και η γεωγραφική θέση, προκειμένου να δοθεί η δυνατότητα στα μέσα ενημέρωσης και στα γραφεία μάρκετινγκ να δομήσουν και να κατανοήσουν τις ομάδες-στόχους τους ώστε να επιτρέψουν προσαρμοσμένες διαδικτυακές διαφημίσεις.',
+ 'it' => 'Raccoglie dati statistici relativi alle visite del sito internet da parte dell\'utente, come ad esempio il numero di visite, il tempo medio speso sul sito e quali pagine sono state caricate. Lo scopo è di suddividere gli utenti del sito internet a seconda di fattori demografici e geografici, allo scopo di consentire ai media e alle agenzie marketing di strutturare e comprendere i loro gruppi target per effettuare pubblicità online personalizzate.',
+ 'si' => 'Zbira statistične podatke, povezane z obiski uporabnikovega spletnega mesta, kot so število obiskov, povprečni čas, ki ga je preživel na spletnem mestu in katere strani so bile naložene. Namen je segmentirati uporabnike spletnega mesta glede na dejavnike, kot so demografski podatki in geografski položaj, da se medijem in marketinškim agencijam omogoči, da strukturirajo in razumejo svoje ciljne skupine, da omogočijo prilagojeno spletno oglaševanje.',
+ 'da' => 'Indsamler statistik om brugerens besøg på hjemmesiden såsom antallet af besøg, den gennemsnitlige tid på hjemmesiden og hvilke sider der er læst. Formålet er at segmentere hjemmesidens brugere efter faktorer såsom demografi og geografi for at gøre det muligt for medier og marketingbureauer at strukturere og forstå deres målgrupper med henblik på at tilpasse online annoncering.',
+ 'no' => 'Samler inn statistiske data relatert til brukerens nettstedsbesøk, for eksempel antall besøk, gjennomsnittlig tid brukt på nettstedet og hvilke sider som er lastet inn. Hensikten er å segmentere nettstedets brukere i henhold til faktorer som demografi og geografisk beliggenhet, for å gjøre media- og markedsføringsbyråer i stand til å strukturere og forstå sine målgrupper for å muliggjøre tilpasset annonsering på nettet.',
+ 'cs' => 'Shromažďuje statistické údaje související s návštěvami webových stránek uživatele, například počet návštěv, průměrný čas strávený na webu a jaké stránky byly načteny. Účelem je segmentovat uživatele webu podle faktorů, jako jsou demografické údaje a zeměpisné umístění, aby mediální a marketingové agentury mohly strukturovat a porozumět jejich cílovým skupinám a umožnit tak přizpůsobenou online reklamu.',
+ 'hu' => 'Gyűjti a felhasználó webhelylátogatásaira vonatkozó statisztikai adatokat, például a látogatások számát, a webhelyen töltött átlagos időt és a betöltött oldalakat. A cél a weboldal felhasználói szegmentálása olyan tényezők szerint, mint a demográfia és a földrajzi elhelyezkedés, annak érdekében, hogy a média és a marketing ügynökségek strukturálhassák és megértsék célcsoportjaikat a testreszabott online hirdetések lehetővé tétele érdekében.',
+ 'sv' => 'Samlar in statistiska data relaterade till användarens webbplatsbesök, till exempel antalet besök, genomsnittlig tid på webbplatsen och vilka sidor som har laddats. Syftet är att segmentera webbplatsens användare efter faktorer som demografi och geografisk plats för att göra det möjligt för media och marknadsföringsbyråer att strukturera och förstå sina målgrupper för att möjliggöra skräddarsydd onlineannonsering.',
+ ],
+ 'expiry' => [
+ 'en' => '13 months',
+ 'es' => '13 meses',
+ 'ag' => '13 meses',
+ 'cb' => '13 meses',
+ 'mx' => '13 meses',
+ 'fr' => '13 mois',
+ 'qc' => '13 mois',
+ 'pl' => '13 miesiące',
+ 'ro' => '13 luni',
+ 'pt' => '13 meses',
+ 'br' => '13 meses',
+ 'sk' => '13 mesiace',
+ 'nl' => '13 maanden',
+ 'de' => '13 Monate',
+ 'gr' => '13 μήνες',
+ 'it' => '13 mesi',
+ 'si' => '13 meseca',
+ 'da' => '13 mdr.',
+ 'no' => '13 måneder',
+ 'cs' => '13 měsíců',
+ 'hu' => '13 hónap',
+ 'sv' => '13 månader',
+ ],
+ ],
+ [
+ /* Smartlook */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'SL_C_#_VID',
+ 'provider' => 'Smartlook',
+ 'provider_url' => 'https://help.smartlook.com/en/articles/3244452-privacy-policy',
+ 'purpose' => [
+ 'en' => 'Collects statistical data related to the user\'s website visits, such as the number of visits, average time spent on the website and what pages have been loaded. The purpose is to segment the website\'s users according to factors such as demographics and geographical location, in order to enable media and marketing agencies to structure and understand their target groups to enable customised online advertising.',
+ 'es' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'ag' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'cb' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'mx' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'fr' => 'Recueille des données statistiques liées aux visites du site web de l\'utilisateur, telles que le nombre de visites, le temps moyen passé sur le site et quelles pages ont été chargées. L’objectif étant de segmenter les utilisateurs du site en fonction de facteurs tels que la démographie et la situation géographique, afin de permettre aux médias et aux agences de marketing de structurer et de comprendre leurs groupes cibles et pour être en mesure d\'afficher une publicité en ligne personnalisée.',
+ 'qc' => 'Recueille des données statistiques liées aux visites du site web de l\'utilisateur, telles que le nombre de visites, le temps moyen passé sur le site et quelles pages ont été chargées. L’objectif étant de segmenter les utilisateurs du site en fonction de facteurs tels que la démographie et la situation géographique, afin de permettre aux médias et aux agences de marketing de structurer et de comprendre leurs groupes cibles et pour être en mesure d\'afficher une publicité en ligne personnalisée.',
+ 'pl' => 'Zbiera dane statystyczne dotyczące odwiedzin serwisu przez użytkownika, takie jak liczba odwiedzin, średni czas spędzony w serwisie oraz jakie strony zostały wczytane. Celem jest segmentacja użytkowników witryny internetowej według czynników, takich jak dane demograficzne i położenie geograficzne, aby umożliwić agencjom medialnym i marketingowym ustrukturyzowanie i zrozumienie ich grup docelowych w celu umożliwienia dostosowanej reklamy online.',
+ 'ro' => 'Colectează date statistice legate de vizitele site-ului utilizatorului, cum ar fi numărul de vizite, timpul mediu petrecut pe site și ce pagini au fost încărcate. Scopul este de a segmenta utilizatorii site-ului în funcție de factori precum demografia și locația geografică, pentru a permite agențiilor media și de marketing să își structureze și să înțeleagă grupurile țintă pentru a permite publicitate online personalizată.',
+ 'pt' => 'Coleta dados estatísticos relativos às visitas do usuário ao site, como número de visitas, tempo médio de permanência no site e quais páginas foram carregadas. O objetivo é segmentar os usuários do site de acordo com fatores como dados demográficos e localização geográfica, a fim de permitir que as agências de mídia e marketing estruturem e entendam seus públicos-alvo para possibilitar a publicidade online personalizada.',
+ 'br' => 'Coleta dados estatísticos relativos às visitas do usuário ao site, como número de visitas, tempo médio de permanência no site e quais páginas foram carregadas. O objetivo é segmentar os usuários do site de acordo com fatores como dados demográficos e localização geográfica, a fim de permitir que as agências de mídia e marketing estruturem e entendam seus públicos-alvo para possibilitar a publicidade online personalizada.',
+ 'sk' => 'Zhromažďuje štatistické údaje týkajúce sa návštev webových stránok používateľa, ako napríklad počet návštev, priemerný čas strávený na webových stránkach a načítané stránky. Účelom je segmentovať používateľov webových stránok podľa faktorov, ako sú demografické údaje a geografické umiestnenie, aby mohli mediálne a marketingové agentúry štruktúrovať a porozumieť svojim cieľovým skupinám a umožniť tak prispôsobenú online reklamu.',
+ 'nl' => 'Verzamelt statistische gegevens met betrekking tot de websitebezoeken van de gebruiker, zoals het aantal bezoeken, de gemiddelde tijd die op de website is doorgebracht en welke pagina\'s zijn geladen. Het doel is om de gebruikers van de website te segmenteren op basis van factoren zoals demografie en geografische locatie, zodat media- en marketingbureaus hun doelgroepen kunnen structureren en begrijpen om aangepaste online advertenties mogelijk te maken.',
+ 'de' => 'Erfasst statistische Daten zu Website-Besuchen des Benutzers, wie z. B. die Anzahl der Besuche, durchschnittliche Verweildauer auf der Website und welche Seiten geladen wurden. Der Zweck ist die Segmentierung der Benutzer der Website nach Faktoren wie Demografie und geografische Lage, damit Medien- und Marketing-Agenturen ihre Zielgruppen strukturieren und verstehen können, um maßgeschneiderte Online-Werbung zu ermöglichen.',
+ 'gr' => 'Συλλέγει στατιστικά δεδομένα που σχετίζονται με τις επισκέψεις στον ιστότοπο του χρήστη, όπως ο αριθμός των επισκέψεων, ο μέσος χρόνος που αφιερώνεται στον ιστότοπο και ποιες σελίδες έχουν φορτωθεί. Ο σκοπός είναι η τμηματοποίηση των χρηστών του ιστότοπου σύμφωνα με παράγοντες όπως τα δημογραφικά στοιχεία και η γεωγραφική θέση, προκειμένου να δοθεί η δυνατότητα στα μέσα ενημέρωσης και στα γραφεία μάρκετινγκ να δομήσουν και να κατανοήσουν τις ομάδες-στόχους τους ώστε να επιτρέψουν προσαρμοσμένες διαδικτυακές διαφημίσεις.',
+ 'it' => 'Raccoglie dati statistici relativi alle visite del sito internet da parte dell\'utente, come ad esempio il numero di visite, il tempo medio speso sul sito e quali pagine sono state caricate. Lo scopo è di suddividere gli utenti del sito internet a seconda di fattori demografici e geografici, allo scopo di consentire ai media e alle agenzie marketing di strutturare e comprendere i loro gruppi target per effettuare pubblicità online personalizzate.',
+ 'si' => 'Zbira statistične podatke, povezane z obiski uporabnikovega spletnega mesta, kot so število obiskov, povprečni čas, ki ga je preživel na spletnem mestu in katere strani so bile naložene. Namen je segmentirati uporabnike spletnega mesta glede na dejavnike, kot so demografski podatki in geografski položaj, da se medijem in marketinškim agencijam omogoči, da strukturirajo in razumejo svoje ciljne skupine, da omogočijo prilagojeno spletno oglaševanje.',
+ 'da' => 'Indsamler statistik om brugerens besøg på hjemmesiden såsom antallet af besøg, den gennemsnitlige tid på hjemmesiden og hvilke sider der er læst. Formålet er at segmentere hjemmesidens brugere efter faktorer såsom demografi og geografi for at gøre det muligt for medier og marketingbureauer at strukturere og forstå deres målgrupper med henblik på at tilpasse online annoncering.',
+ 'no' => 'Samler inn statistiske data relatert til brukerens nettstedsbesøk, for eksempel antall besøk, gjennomsnittlig tid brukt på nettstedet og hvilke sider som er lastet inn. Hensikten er å segmentere nettstedets brukere i henhold til faktorer som demografi og geografisk beliggenhet, for å gjøre media- og markedsføringsbyråer i stand til å strukturere og forstå sine målgrupper for å muliggjøre tilpasset annonsering på nettet.',
+ 'cs' => 'Shromažďuje statistické údaje související s návštěvami webových stránek uživatele, například počet návštěv, průměrný čas strávený na webu a jaké stránky byly načteny. Účelem je segmentovat uživatele webu podle faktorů, jako jsou demografické údaje a zeměpisné umístění, aby mediální a marketingové agentury mohly strukturovat a porozumět jejich cílovým skupinám a umožnit tak přizpůsobenou online reklamu.',
+ 'hu' => 'Gyűjti a felhasználó webhelylátogatásaira vonatkozó statisztikai adatokat, például a látogatások számát, a webhelyen töltött átlagos időt és a betöltött oldalakat. A cél a weboldal felhasználói szegmentálása olyan tényezők szerint, mint a demográfia és a földrajzi elhelyezkedés, annak érdekében, hogy a média és a marketing ügynökségek strukturálhassák és megértsék célcsoportjaikat a testreszabott online hirdetések lehetővé tétele érdekében.',
+ 'sv' => 'Samlar in statistiska data relaterade till användarens webbplatsbesök, till exempel antalet besök, genomsnittlig tid på webbplatsen och vilka sidor som har laddats. Syftet är att segmentera webbplatsens användare efter faktorer som demografi och geografisk plats för att göra det möjligt för media och marknadsföringsbyråer att strukturera och förstå sina målgrupper för att möjliggöra skräddarsydd onlineannonsering.',
+ ],
+ 'expiry' => [
+ 'en' => '13 months',
+ 'es' => '13 meses',
+ 'ag' => '13 meses',
+ 'cb' => '13 meses',
+ 'mx' => '13 meses',
+ 'fr' => '13 mois',
+ 'qc' => '13 mois',
+ 'pl' => '13 miesiące',
+ 'ro' => '13 luni',
+ 'pt' => '13 meses',
+ 'br' => '13 meses',
+ 'sk' => '13 mesiace',
+ 'nl' => '13 maanden',
+ 'de' => '13 Monate',
+ 'gr' => '13 μήνες',
+ 'it' => '13 mesi',
+ 'si' => '13 meseca',
+ 'da' => '13 mdr.',
+ 'no' => '13 måneder',
+ 'cs' => '13 měsíců',
+ 'hu' => '13 hónap',
+ 'sv' => '13 månader',
+ ],
+ ],
+ [
+ /* Smartlook */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'SL_L_#_KEY',
+ 'provider' => 'Smartlook',
+ 'provider_url' => 'https://help.smartlook.com/en/articles/3244452-privacy-policy',
+ 'purpose' => [
+ 'en' => 'Collects statistical data related to the user\'s website visits, such as the number of visits, average time spent on the website and what pages have been loaded. The purpose is to segment the website\'s users according to factors such as demographics and geographical location, in order to enable media and marketing agencies to structure and understand their target groups to enable customised online advertising.',
+ 'es' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'ag' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'cb' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'mx' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'fr' => 'Recueille des données statistiques liées aux visites du site web de l\'utilisateur, telles que le nombre de visites, le temps moyen passé sur le site et quelles pages ont été chargées. L’objectif étant de segmenter les utilisateurs du site en fonction de facteurs tels que la démographie et la situation géographique, afin de permettre aux médias et aux agences de marketing de structurer et de comprendre leurs groupes cibles et pour être en mesure d\'afficher une publicité en ligne personnalisée.',
+ 'qc' => 'Recueille des données statistiques liées aux visites du site web de l\'utilisateur, telles que le nombre de visites, le temps moyen passé sur le site et quelles pages ont été chargées. L’objectif étant de segmenter les utilisateurs du site en fonction de facteurs tels que la démographie et la situation géographique, afin de permettre aux médias et aux agences de marketing de structurer et de comprendre leurs groupes cibles et pour être en mesure d\'afficher une publicité en ligne personnalisée.',
+ 'pl' => 'Zbiera dane statystyczne dotyczące odwiedzin serwisu przez użytkownika, takie jak liczba odwiedzin, średni czas spędzony w serwisie oraz jakie strony zostały wczytane. Celem jest segmentacja użytkowników witryny internetowej według czynników, takich jak dane demograficzne i położenie geograficzne, aby umożliwić agencjom medialnym i marketingowym ustrukturyzowanie i zrozumienie ich grup docelowych w celu umożliwienia dostosowanej reklamy online.',
+ 'ro' => 'Colectează date statistice legate de vizitele site-ului utilizatorului, cum ar fi numărul de vizite, timpul mediu petrecut pe site și ce pagini au fost încărcate. Scopul este de a segmenta utilizatorii site-ului în funcție de factori precum demografia și locația geografică, pentru a permite agențiilor media și de marketing să își structureze și să înțeleagă grupurile țintă pentru a permite publicitate online personalizată.',
+ 'pt' => 'Coleta dados estatísticos relativos às visitas do usuário ao site, como número de visitas, tempo médio de permanência no site e quais páginas foram carregadas. O objetivo é segmentar os usuários do site de acordo com fatores como dados demográficos e localização geográfica, a fim de permitir que as agências de mídia e marketing estruturem e entendam seus públicos-alvo para possibilitar a publicidade online personalizada.',
+ 'br' => 'Coleta dados estatísticos relativos às visitas do usuário ao site, como número de visitas, tempo médio de permanência no site e quais páginas foram carregadas. O objetivo é segmentar os usuários do site de acordo com fatores como dados demográficos e localização geográfica, a fim de permitir que as agências de mídia e marketing estruturem e entendam seus públicos-alvo para possibilitar a publicidade online personalizada.',
+ 'sk' => 'Zhromažďuje štatistické údaje týkajúce sa návštev webových stránok používateľa, ako napríklad počet návštev, priemerný čas strávený na webových stránkach a načítané stránky. Účelom je segmentovať používateľov webových stránok podľa faktorov, ako sú demografické údaje a geografické umiestnenie, aby mohli mediálne a marketingové agentúry štruktúrovať a porozumieť svojim cieľovým skupinám a umožniť tak prispôsobenú online reklamu.',
+ 'nl' => 'Verzamelt statistische gegevens met betrekking tot de websitebezoeken van de gebruiker, zoals het aantal bezoeken, de gemiddelde tijd die op de website is doorgebracht en welke pagina\'s zijn geladen. Het doel is om de gebruikers van de website te segmenteren op basis van factoren zoals demografie en geografische locatie, zodat media- en marketingbureaus hun doelgroepen kunnen structureren en begrijpen om aangepaste online advertenties mogelijk te maken.',
+ 'de' => 'Erfasst statistische Daten zu Website-Besuchen des Benutzers, wie z. B. die Anzahl der Besuche, durchschnittliche Verweildauer auf der Website und welche Seiten geladen wurden. Der Zweck ist die Segmentierung der Benutzer der Website nach Faktoren wie Demografie und geografische Lage, damit Medien- und Marketing-Agenturen ihre Zielgruppen strukturieren und verstehen können, um maßgeschneiderte Online-Werbung zu ermöglichen.',
+ 'gr' => 'Συλλέγει στατιστικά δεδομένα που σχετίζονται με τις επισκέψεις στον ιστότοπο του χρήστη, όπως ο αριθμός των επισκέψεων, ο μέσος χρόνος που αφιερώνεται στον ιστότοπο και ποιες σελίδες έχουν φορτωθεί. Ο σκοπός είναι η τμηματοποίηση των χρηστών του ιστότοπου σύμφωνα με παράγοντες όπως τα δημογραφικά στοιχεία και η γεωγραφική θέση, προκειμένου να δοθεί η δυνατότητα στα μέσα ενημέρωσης και στα γραφεία μάρκετινγκ να δομήσουν και να κατανοήσουν τις ομάδες-στόχους τους ώστε να επιτρέψουν προσαρμοσμένες διαδικτυακές διαφημίσεις.',
+ 'it' => 'Raccoglie dati statistici relativi alle visite del sito internet da parte dell\'utente, come ad esempio il numero di visite, il tempo medio speso sul sito e quali pagine sono state caricate. Lo scopo è di suddividere gli utenti del sito internet a seconda di fattori demografici e geografici, allo scopo di consentire ai media e alle agenzie marketing di strutturare e comprendere i loro gruppi target per effettuare pubblicità online personalizzate.',
+ 'si' => 'Zbira statistične podatke, povezane z obiski uporabnikovega spletnega mesta, kot so število obiskov, povprečni čas, ki ga je preživel na spletnem mestu in katere strani so bile naložene. Namen je segmentirati uporabnike spletnega mesta glede na dejavnike, kot so demografski podatki in geografski položaj, da se medijem in marketinškim agencijam omogoči, da strukturirajo in razumejo svoje ciljne skupine, da omogočijo prilagojeno spletno oglaševanje.',
+ 'da' => 'Indsamler statistik om brugerens besøg på hjemmesiden såsom antallet af besøg, den gennemsnitlige tid på hjemmesiden og hvilke sider der er læst. Formålet er at segmentere hjemmesidens brugere efter faktorer såsom demografi og geografi for at gøre det muligt for medier og marketingbureauer at strukturere og forstå deres målgrupper med henblik på at tilpasse online annoncering.',
+ 'no' => 'Samler inn statistiske data relatert til brukerens nettstedsbesøk, for eksempel antall besøk, gjennomsnittlig tid brukt på nettstedet og hvilke sider som er lastet inn. Hensikten er å segmentere nettstedets brukere i henhold til faktorer som demografi og geografisk beliggenhet, for å gjøre media- og markedsføringsbyråer i stand til å strukturere og forstå sine målgrupper for å muliggjøre tilpasset annonsering på nettet.',
+ 'cs' => 'Shromažďuje statistické údaje související s návštěvami webových stránek uživatele, například počet návštěv, průměrný čas strávený na webu a jaké stránky byly načteny. Účelem je segmentovat uživatele webu podle faktorů, jako jsou demografické údaje a zeměpisné umístění, aby mediální a marketingové agentury mohly strukturovat a porozumět jejich cílovým skupinám a umožnit tak přizpůsobenou online reklamu.',
+ 'hu' => 'Gyűjti a felhasználó webhelylátogatásaira vonatkozó statisztikai adatokat, például a látogatások számát, a webhelyen töltött átlagos időt és a betöltött oldalakat. A cél a weboldal felhasználói szegmentálása olyan tényezők szerint, mint a demográfia és a földrajzi elhelyezkedés, annak érdekében, hogy a média és a marketing ügynökségek strukturálhassák és megértsék célcsoportjaikat a testreszabott online hirdetések lehetővé tétele érdekében.',
+ 'sv' => 'Samlar in statistiska data relaterade till användarens webbplatsbesök, till exempel antalet besök, genomsnittlig tid på webbplatsen och vilka sidor som har laddats. Syftet är att segmentera webbplatsens användare efter faktorer som demografi och geografisk plats för att göra det möjligt för media och marknadsföringsbyråer att strukturera och förstå sina målgrupper för att möjliggöra skräddarsydd onlineannonsering.',
+ ],
+ 'expiry' => [
+ 'en' => '13 months',
+ 'es' => '13 meses',
+ 'ag' => '13 meses',
+ 'cb' => '13 meses',
+ 'mx' => '13 meses',
+ 'fr' => '13 mois',
+ 'qc' => '13 mois',
+ 'pl' => '13 miesiące',
+ 'ro' => '13 luni',
+ 'pt' => '13 meses',
+ 'br' => '13 meses',
+ 'sk' => '13 mesiace',
+ 'nl' => '13 maanden',
+ 'de' => '13 Monate',
+ 'gr' => '13 μήνες',
+ 'it' => '13 mesi',
+ 'si' => '13 meseca',
+ 'da' => '13 mdr.',
+ 'no' => '13 måneder',
+ 'cs' => '13 měsíců',
+ 'hu' => '13 hónap',
+ 'sv' => '13 månader',
+ ],
+ ],
+ [
+ /* Smartlook */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'SL_L_#_SID',
+ 'provider' => 'Smartlook',
+ 'provider_url' => 'https://help.smartlook.com/en/articles/3244452-privacy-policy',
+ 'purpose' => [
+ 'en' => 'Collects statistical data related to the user\'s website visits, such as the number of visits, average time spent on the website and what pages have been loaded. The purpose is to segment the website\'s users according to factors such as demographics and geographical location, in order to enable media and marketing agencies to structure and understand their target groups to enable customised online advertising.',
+ 'es' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'ag' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'cb' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'mx' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'fr' => 'Recueille des données statistiques liées aux visites du site web de l\'utilisateur, telles que le nombre de visites, le temps moyen passé sur le site et quelles pages ont été chargées. L’objectif étant de segmenter les utilisateurs du site en fonction de facteurs tels que la démographie et la situation géographique, afin de permettre aux médias et aux agences de marketing de structurer et de comprendre leurs groupes cibles et pour être en mesure d\'afficher une publicité en ligne personnalisée.',
+ 'qc' => 'Recueille des données statistiques liées aux visites du site web de l\'utilisateur, telles que le nombre de visites, le temps moyen passé sur le site et quelles pages ont été chargées. L’objectif étant de segmenter les utilisateurs du site en fonction de facteurs tels que la démographie et la situation géographique, afin de permettre aux médias et aux agences de marketing de structurer et de comprendre leurs groupes cibles et pour être en mesure d\'afficher une publicité en ligne personnalisée.',
+ 'pl' => 'Zbiera dane statystyczne dotyczące odwiedzin serwisu przez użytkownika, takie jak liczba odwiedzin, średni czas spędzony w serwisie oraz jakie strony zostały wczytane. Celem jest segmentacja użytkowników witryny internetowej według czynników, takich jak dane demograficzne i położenie geograficzne, aby umożliwić agencjom medialnym i marketingowym ustrukturyzowanie i zrozumienie ich grup docelowych w celu umożliwienia dostosowanej reklamy online.',
+ 'ro' => 'Colectează date statistice legate de vizitele site-ului utilizatorului, cum ar fi numărul de vizite, timpul mediu petrecut pe site și ce pagini au fost încărcate. Scopul este de a segmenta utilizatorii site-ului în funcție de factori precum demografia și locația geografică, pentru a permite agențiilor media și de marketing să își structureze și să înțeleagă grupurile țintă pentru a permite publicitate online personalizată.',
+ 'pt' => 'Coleta dados estatísticos relativos às visitas do usuário ao site, como número de visitas, tempo médio de permanência no site e quais páginas foram carregadas. O objetivo é segmentar os usuários do site de acordo com fatores como dados demográficos e localização geográfica, a fim de permitir que as agências de mídia e marketing estruturem e entendam seus públicos-alvo para possibilitar a publicidade online personalizada.',
+ 'br' => 'Coleta dados estatísticos relativos às visitas do usuário ao site, como número de visitas, tempo médio de permanência no site e quais páginas foram carregadas. O objetivo é segmentar os usuários do site de acordo com fatores como dados demográficos e localização geográfica, a fim de permitir que as agências de mídia e marketing estruturem e entendam seus públicos-alvo para possibilitar a publicidade online personalizada.',
+ 'sk' => 'Zhromažďuje štatistické údaje týkajúce sa návštev webových stránok používateľa, ako napríklad počet návštev, priemerný čas strávený na webových stránkach a načítané stránky. Účelom je segmentovať používateľov webových stránok podľa faktorov, ako sú demografické údaje a geografické umiestnenie, aby mohli mediálne a marketingové agentúry štruktúrovať a porozumieť svojim cieľovým skupinám a umožniť tak prispôsobenú online reklamu.',
+ 'nl' => 'Verzamelt statistische gegevens met betrekking tot de websitebezoeken van de gebruiker, zoals het aantal bezoeken, de gemiddelde tijd die op de website is doorgebracht en welke pagina\'s zijn geladen. Het doel is om de gebruikers van de website te segmenteren op basis van factoren zoals demografie en geografische locatie, zodat media- en marketingbureaus hun doelgroepen kunnen structureren en begrijpen om aangepaste online advertenties mogelijk te maken.',
+ 'de' => 'Erfasst statistische Daten zu Website-Besuchen des Benutzers, wie z. B. die Anzahl der Besuche, durchschnittliche Verweildauer auf der Website und welche Seiten geladen wurden. Der Zweck ist die Segmentierung der Benutzer der Website nach Faktoren wie Demografie und geografische Lage, damit Medien- und Marketing-Agenturen ihre Zielgruppen strukturieren und verstehen können, um maßgeschneiderte Online-Werbung zu ermöglichen.',
+ 'gr' => 'Συλλέγει στατιστικά δεδομένα που σχετίζονται με τις επισκέψεις στον ιστότοπο του χρήστη, όπως ο αριθμός των επισκέψεων, ο μέσος χρόνος που αφιερώνεται στον ιστότοπο και ποιες σελίδες έχουν φορτωθεί. Ο σκοπός είναι η τμηματοποίηση των χρηστών του ιστότοπου σύμφωνα με παράγοντες όπως τα δημογραφικά στοιχεία και η γεωγραφική θέση, προκειμένου να δοθεί η δυνατότητα στα μέσα ενημέρωσης και στα γραφεία μάρκετινγκ να δομήσουν και να κατανοήσουν τις ομάδες-στόχους τους ώστε να επιτρέψουν προσαρμοσμένες διαδικτυακές διαφημίσεις.',
+ 'it' => 'Raccoglie dati statistici relativi alle visite del sito internet da parte dell\'utente, come ad esempio il numero di visite, il tempo medio speso sul sito e quali pagine sono state caricate. Lo scopo è di suddividere gli utenti del sito internet a seconda di fattori demografici e geografici, allo scopo di consentire ai media e alle agenzie marketing di strutturare e comprendere i loro gruppi target per effettuare pubblicità online personalizzate.',
+ 'si' => 'Zbira statistične podatke, povezane z obiski uporabnikovega spletnega mesta, kot so število obiskov, povprečni čas, ki ga je preživel na spletnem mestu in katere strani so bile naložene. Namen je segmentirati uporabnike spletnega mesta glede na dejavnike, kot so demografski podatki in geografski položaj, da se medijem in marketinškim agencijam omogoči, da strukturirajo in razumejo svoje ciljne skupine, da omogočijo prilagojeno spletno oglaševanje.',
+ 'da' => 'Indsamler statistik om brugerens besøg på hjemmesiden såsom antallet af besøg, den gennemsnitlige tid på hjemmesiden og hvilke sider der er læst. Formålet er at segmentere hjemmesidens brugere efter faktorer såsom demografi og geografi for at gøre det muligt for medier og marketingbureauer at strukturere og forstå deres målgrupper med henblik på at tilpasse online annoncering.',
+ 'no' => 'Samler inn statistiske data relatert til brukerens nettstedsbesøk, for eksempel antall besøk, gjennomsnittlig tid brukt på nettstedet og hvilke sider som er lastet inn. Hensikten er å segmentere nettstedets brukere i henhold til faktorer som demografi og geografisk beliggenhet, for å gjøre media- og markedsføringsbyråer i stand til å strukturere og forstå sine målgrupper for å muliggjøre tilpasset annonsering på nettet.',
+ 'cs' => 'Shromažďuje statistické údaje související s návštěvami webových stránek uživatele, například počet návštěv, průměrný čas strávený na webu a jaké stránky byly načteny. Účelem je segmentovat uživatele webu podle faktorů, jako jsou demografické údaje a zeměpisné umístění, aby mediální a marketingové agentury mohly strukturovat a porozumět jejich cílovým skupinám a umožnit tak přizpůsobenou online reklamu.',
+ 'hu' => 'Gyűjti a felhasználó webhelylátogatásaira vonatkozó statisztikai adatokat, például a látogatások számát, a webhelyen töltött átlagos időt és a betöltött oldalakat. A cél a weboldal felhasználói szegmentálása olyan tényezők szerint, mint a demográfia és a földrajzi elhelyezkedés, annak érdekében, hogy a média és a marketing ügynökségek strukturálhassák és megértsék célcsoportjaikat a testreszabott online hirdetések lehetővé tétele érdekében.',
+ 'sv' => 'Samlar in statistiska data relaterade till användarens webbplatsbesök, till exempel antalet besök, genomsnittlig tid på webbplatsen och vilka sidor som har laddats. Syftet är att segmentera webbplatsens användare efter faktorer som demografi och geografisk plats för att göra det möjligt för media och marknadsföringsbyråer att strukturera och förstå sina målgrupper för att möjliggöra skräddarsydd onlineannonsering.',
+ ],
+ 'expiry' => [
+ 'en' => '13 months',
+ 'es' => '13 meses',
+ 'ag' => '13 meses',
+ 'cb' => '13 meses',
+ 'mx' => '13 meses',
+ 'fr' => '13 mois',
+ 'qc' => '13 mois',
+ 'pl' => '13 miesiące',
+ 'ro' => '13 luni',
+ 'pt' => '13 meses',
+ 'br' => '13 meses',
+ 'sk' => '13 mesiace',
+ 'nl' => '13 maanden',
+ 'de' => '13 Monate',
+ 'gr' => '13 μήνες',
+ 'it' => '13 mesi',
+ 'si' => '13 meseca',
+ 'da' => '13 mdr.',
+ 'no' => '13 måneder',
+ 'cs' => '13 měsíců',
+ 'hu' => '13 hónap',
+ 'sv' => '13 månader',
+ ],
+ ],
+ [
+ /* Smartlook */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'SL_L_#_VID',
+ 'provider' => 'Smartlook',
+ 'provider_url' => 'https://help.smartlook.com/en/articles/3244452-privacy-policy',
+ 'purpose' => [
+ 'en' => 'Collects statistical data related to the user\'s website visits, such as the number of visits, average time spent on the website and what pages have been loaded. The purpose is to segment the website\'s users according to factors such as demographics and geographical location, in order to enable media and marketing agencies to structure and understand their target groups to enable customised online advertising.',
+ 'es' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'ag' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'cb' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'mx' => 'Recopila datos estadísticos relacionados con las visitas del usuario al sitio web, como el número de visitas, el tiempo medio pasado en el sitio web y qué páginas se han cargado. El propósito es segmentar los usuarios del sitio web según factores como factores demográficos y ubicación geográfica para permitir a las agencias multimedia y de marketing estructurar y comprender sus grupos objetos para habilitar la publicidad online personalizada.',
+ 'fr' => 'Recueille des données statistiques liées aux visites du site web de l\'utilisateur, telles que le nombre de visites, le temps moyen passé sur le site et quelles pages ont été chargées. L’objectif étant de segmenter les utilisateurs du site en fonction de facteurs tels que la démographie et la situation géographique, afin de permettre aux médias et aux agences de marketing de structurer et de comprendre leurs groupes cibles et pour être en mesure d\'afficher une publicité en ligne personnalisée.',
+ 'qc' => 'Recueille des données statistiques liées aux visites du site web de l\'utilisateur, telles que le nombre de visites, le temps moyen passé sur le site et quelles pages ont été chargées. L’objectif étant de segmenter les utilisateurs du site en fonction de facteurs tels que la démographie et la situation géographique, afin de permettre aux médias et aux agences de marketing de structurer et de comprendre leurs groupes cibles et pour être en mesure d\'afficher une publicité en ligne personnalisée.',
+ 'pl' => 'Zbiera dane statystyczne dotyczące odwiedzin serwisu przez użytkownika, takie jak liczba odwiedzin, średni czas spędzony w serwisie oraz jakie strony zostały wczytane. Celem jest segmentacja użytkowników witryny internetowej według czynników, takich jak dane demograficzne i położenie geograficzne, aby umożliwić agencjom medialnym i marketingowym ustrukturyzowanie i zrozumienie ich grup docelowych w celu umożliwienia dostosowanej reklamy online.',
+ 'ro' => 'Colectează date statistice legate de vizitele site-ului utilizatorului, cum ar fi numărul de vizite, timpul mediu petrecut pe site și ce pagini au fost încărcate. Scopul este de a segmenta utilizatorii site-ului în funcție de factori precum demografia și locația geografică, pentru a permite agențiilor media și de marketing să își structureze și să înțeleagă grupurile țintă pentru a permite publicitate online personalizată.',
+ 'pt' => 'Coleta dados estatísticos relativos às visitas do usuário ao site, como número de visitas, tempo médio de permanência no site e quais páginas foram carregadas. O objetivo é segmentar os usuários do site de acordo com fatores como dados demográficos e localização geográfica, a fim de permitir que as agências de mídia e marketing estruturem e entendam seus públicos-alvo para possibilitar a publicidade online personalizada.',
+ 'br' => 'Coleta dados estatísticos relativos às visitas do usuário ao site, como número de visitas, tempo médio de permanência no site e quais páginas foram carregadas. O objetivo é segmentar os usuários do site de acordo com fatores como dados demográficos e localização geográfica, a fim de permitir que as agências de mídia e marketing estruturem e entendam seus públicos-alvo para possibilitar a publicidade online personalizada.',
+ 'sk' => 'Zhromažďuje štatistické údaje týkajúce sa návštev webových stránok používateľa, ako napríklad počet návštev, priemerný čas strávený na webových stránkach a načítané stránky. Účelom je segmentovať používateľov webových stránok podľa faktorov, ako sú demografické údaje a geografické umiestnenie, aby mohli mediálne a marketingové agentúry štruktúrovať a porozumieť svojim cieľovým skupinám a umožniť tak prispôsobenú online reklamu.',
+ 'nl' => 'Verzamelt statistische gegevens met betrekking tot de websitebezoeken van de gebruiker, zoals het aantal bezoeken, de gemiddelde tijd die op de website is doorgebracht en welke pagina\'s zijn geladen. Het doel is om de gebruikers van de website te segmenteren op basis van factoren zoals demografie en geografische locatie, zodat media- en marketingbureaus hun doelgroepen kunnen structureren en begrijpen om aangepaste online advertenties mogelijk te maken.',
+ 'de' => 'Erfasst statistische Daten zu Website-Besuchen des Benutzers, wie z. B. die Anzahl der Besuche, durchschnittliche Verweildauer auf der Website und welche Seiten geladen wurden. Der Zweck ist die Segmentierung der Benutzer der Website nach Faktoren wie Demografie und geografische Lage, damit Medien- und Marketing-Agenturen ihre Zielgruppen strukturieren und verstehen können, um maßgeschneiderte Online-Werbung zu ermöglichen.',
+ 'gr' => 'Συλλέγει στατιστικά δεδομένα που σχετίζονται με τις επισκέψεις στον ιστότοπο του χρήστη, όπως ο αριθμός των επισκέψεων, ο μέσος χρόνος που αφιερώνεται στον ιστότοπο και ποιες σελίδες έχουν φορτωθεί. Ο σκοπός είναι η τμηματοποίηση των χρηστών του ιστότοπου σύμφωνα με παράγοντες όπως τα δημογραφικά στοιχεία και η γεωγραφική θέση, προκειμένου να δοθεί η δυνατότητα στα μέσα ενημέρωσης και στα γραφεία μάρκετινγκ να δομήσουν και να κατανοήσουν τις ομάδες-στόχους τους ώστε να επιτρέψουν προσαρμοσμένες διαδικτυακές διαφημίσεις.',
+ 'it' => 'Raccoglie dati statistici relativi alle visite del sito internet da parte dell\'utente, come ad esempio il numero di visite, il tempo medio speso sul sito e quali pagine sono state caricate. Lo scopo è di suddividere gli utenti del sito internet a seconda di fattori demografici e geografici, allo scopo di consentire ai media e alle agenzie marketing di strutturare e comprendere i loro gruppi target per effettuare pubblicità online personalizzate.',
+ 'si' => 'Zbira statistične podatke, povezane z obiski uporabnikovega spletnega mesta, kot so število obiskov, povprečni čas, ki ga je preživel na spletnem mestu in katere strani so bile naložene. Namen je segmentirati uporabnike spletnega mesta glede na dejavnike, kot so demografski podatki in geografski položaj, da se medijem in marketinškim agencijam omogoči, da strukturirajo in razumejo svoje ciljne skupine, da omogočijo prilagojeno spletno oglaševanje.',
+ 'da' => 'Indsamler statistik om brugerens besøg på hjemmesiden såsom antallet af besøg, den gennemsnitlige tid på hjemmesiden og hvilke sider der er læst. Formålet er at segmentere hjemmesidens brugere efter faktorer såsom demografi og geografi for at gøre det muligt for medier og marketingbureauer at strukturere og forstå deres målgrupper med henblik på at tilpasse online annoncering.',
+ 'no' => 'Samler inn statistiske data relatert til brukerens nettstedsbesøk, for eksempel antall besøk, gjennomsnittlig tid brukt på nettstedet og hvilke sider som er lastet inn. Hensikten er å segmentere nettstedets brukere i henhold til faktorer som demografi og geografisk beliggenhet, for å gjøre media- og markedsføringsbyråer i stand til å strukturere og forstå sine målgrupper for å muliggjøre tilpasset annonsering på nettet.',
+ 'cs' => 'Shromažďuje statistické údaje související s návštěvami webových stránek uživatele, například počet návštěv, průměrný čas strávený na webu a jaké stránky byly načteny. Účelem je segmentovat uživatele webu podle faktorů, jako jsou demografické údaje a zeměpisné umístění, aby mediální a marketingové agentury mohly strukturovat a porozumět jejich cílovým skupinám a umožnit tak přizpůsobenou online reklamu.',
+ 'hu' => 'Gyűjti a felhasználó webhelylátogatásaira vonatkozó statisztikai adatokat, például a látogatások számát, a webhelyen töltött átlagos időt és a betöltött oldalakat. A cél a weboldal felhasználói szegmentálása olyan tényezők szerint, mint a demográfia és a földrajzi elhelyezkedés, annak érdekében, hogy a média és a marketing ügynökségek strukturálhassák és megértsék célcsoportjaikat a testreszabott online hirdetések lehetővé tétele érdekében.',
+ 'sv' => 'Samlar in statistiska data relaterade till användarens webbplatsbesök, till exempel antalet besök, genomsnittlig tid på webbplatsen och vilka sidor som har laddats. Syftet är att segmentera webbplatsens användare efter faktorer som demografi och geografisk plats för att göra det möjligt för media och marknadsföringsbyråer att strukturera och förstå sina målgrupper för att möjliggöra skräddarsydd onlineannonsering.',
+ ],
+ 'expiry' => [
+ 'en' => '13 months',
+ 'es' => '13 meses',
+ 'ag' => '13 meses',
+ 'cb' => '13 meses',
+ 'mx' => '13 meses',
+ 'fr' => '13 mois',
+ 'qc' => '13 mois',
+ 'pl' => '13 miesiące',
+ 'ro' => '13 luni',
+ 'pt' => '13 meses',
+ 'br' => '13 meses',
+ 'sk' => '13 mesiace',
+ 'nl' => '13 maanden',
+ 'de' => '13 Monate',
+ 'gr' => '13 μήνες',
+ 'it' => '13 mesi',
+ 'si' => '13 meseca',
+ 'da' => '13 mdr.',
+ 'no' => '13 måneder',
+ 'cs' => '13 měsíců',
+ 'hu' => '13 hónap',
+ 'sv' => '13 månader',
+ ],
+ ],
+ [
+ /* Youtube */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'VISITOR_INFO1_LIVE',
+ 'provider' => ' youtube.com',
+ 'provider_url' => 'https://policies.google.com/technologies/cookies',
+ 'purpose' => [
+ 'en' => 'Tries to estimate the users\' bandwidth on pages with integrated YouTube videos.',
+ 'es' => 'Intenta calcular el ancho de banda del usuario en páginas con vídeos de YouTube integrados.',
+ 'ag' => 'Intenta calcular el ancho de banda del usuario en páginas con vídeos de YouTube integrados.',
+ 'cb' => 'Intenta calcular el ancho de banda del usuario en páginas con vídeos de YouTube integrados.',
+ 'mx' => 'Intenta calcular el ancho de banda del usuario en páginas con vídeos de YouTube integrados.',
+ 'fr' => 'Tente d\'estimer la bande passante des utilisateurs sur des pages avec des vidéos YouTube intégrées.',
+ 'qc' => 'Tente d\'estimer la bande passante des utilisateurs sur des pages avec des vidéos YouTube intégrées.',
+ 'pl' => 'Próbuje oszacować przepustowość użytkowników na stronach ze zintegrowanymi filmami z YouTube.',
+ 'ro' => 'Încearcă să estimeze lățimea de bandă a utilizatorilor pe paginile cu videoclipuri YouTube integrate.',
+ 'pt' => 'Tenta estimar a largura de banda dos usuários em páginas com vídeos integrados do YouTube.',
+ 'br' => 'Tenta estimar a largura de banda dos usuários em páginas com vídeos integrados do YouTube.',
+ 'sk' => 'Pokúša sa odhadnúť šírku pásma používateľov na stránkach s integrovanými videami YouTube.',
+ 'nl' => 'Probeert de bandbreedte van gebruikers te schatten op pagina\'s met geïntegreerde YouTube-video\'s.',
+ 'de' => 'Versucht, die Benutzerbandbreite auf Seiten mit integrierten YouTube-Videos zu schätzen.',
+ 'gr' => 'Προσπαθεί να εκτιμήσει το εύρος ζώνης των χρηστών σε σελίδες με ενσωματωμένα βίντεο YouTube.',
+ 'it' => 'Prova a stimare la velocità della connessione dell\'utente su pagine con video YouTube integrati.',
+ 'si' => 'Poskuša oceniti pasovno širino uporabnikov na straneh z integriranimi videoposnetki v YouTubu.',
+ 'da' => 'Forsøger at estimere brugernes båndbredde på sider med integreret YouTube-video.',
+ 'no' => 'Prøver å estimere brukernes båndbredde på sider med integrerte YouTube-videoer.',
+ 'cs' => 'Pokouší se odhadnout šířku pásma uživatelů na stránkách s integrovanými videi YouTube.',
+ 'hu' => 'Megpróbálja megbecsülni a felhasználók sávszélességét az integrált YouTube videókat tartalmazó oldalakon.',
+ 'sv' => 'Försöker uppskatta användarnas bandbredd på sidor med integrerade YouTube-videor.',
+ ],
+ 'expiry' => [
+ 'en' => '179 days',
+ 'es' => '179 días',
+ 'ag' => '179 días',
+ 'cb' => '179 días',
+ 'mx' => '179 días',
+ 'fr' => '179 jours',
+ 'qc' => '179 jours',
+ 'pl' => '179 dni',
+ 'ro' => '179 de zile',
+ 'pt' => '179 dias',
+ 'br' => '179 dias',
+ 'sk' => '179 dní',
+ 'nl' => '179 dagen',
+ 'de' => '179 Tage',
+ 'gr' => '179 μέρες',
+ 'it' => '179 giorni',
+ 'si' => '179 dni',
+ 'da' => '179 dage',
+ 'no' => '179 dager',
+ 'cs' => '179 dager',
+ 'hu' => '179 nap',
+ 'sv' => '179 dagar',
+ ],
+ ],
+ [
+ /* Youtube */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'YSC',
+ 'provider' => ' youtube.com',
+ 'provider_url' => 'https://policies.google.com/technologies/cookies',
+ 'purpose' => [
+ 'en' => 'Registers a unique ID to keep statistics of what videos from YouTube the user has seen.',
+ 'es' => 'Registra una identificación única para mantener estadísticas de qué vídeos de YouTube ha visto el usuario.',
+ 'ag' => 'Registra una identificación única para mantener estadísticas de qué vídeos de YouTube ha visto el usuario.',
+ 'cb' => 'Registra una identificación única para mantener estadísticas de qué vídeos de YouTube ha visto el usuario.',
+ 'mx' => 'Registra una identificación única para mantener estadísticas de qué vídeos de YouTube ha visto el usuario.',
+ 'fr' => 'Enregistre un identifiant unique pour conserver des statistiques sur les vidéos de YouTube vues par l\'utilisateur.',
+ 'qc' => 'Enregistre un identifiant unique pour conserver des statistiques sur les vidéos de YouTube vues par l\'utilisateur.',
+ 'pl' => 'Rejestruje unikalny identyfikator, aby prowadzić statystyki dotyczące filmów wideo z YouTube, które widział użytkownik.',
+ 'ro' => 'Înregistrează un ID unic pentru a păstra statistici despre videoclipurile de pe YouTube pe care le-a văzut utilizatorul.',
+ 'pt' => 'Registra um ID único para manter estatísticas de quais vídeos do YouTube o usuário viu.',
+ 'br' => 'Registra um ID único para manter estatísticas de quais vídeos do YouTube o usuário viu.',
+ 'sk' => 'Zaregistruje jedinečný identifikátor, ktorý umožňuje štatistiku videí, ktoré používateľ YouTube videl.',
+ 'nl' => 'Registreert een unieke ID om statistieken bij te houden van welke video\'s van YouTube de gebruiker heeft gezien.',
+ 'de' => 'Registriert eine eindeutige ID, um Statistiken der Videos von YouTube, die der Benutzer gesehen hat, zu behalten.',
+ 'gr' => 'Καταχωρεί ένα μοναδικό αναγνωριστικό για να διατηρεί στατιστικά στοιχεία για τα βίντεο από το YouTube που έχει δει ο χρήστης.',
+ 'it' => 'Registra un ID univoco per statistiche legate a quali video YouTube sono stati visualizzati dall\'utente.',
+ 'si' => 'Registrira enolični ID, da vodi statistiko o tem, katere videoposnetke iz YouTuba je uporabnik videl.',
+ 'da' => 'Registrerer et unikt ID for at føre statistik over hvilke videoer fra YouTube brugeren har set.',
+ 'no' => 'Registrerer en unik ID for å føre statistikk over hvilke videoer fra YouTube brukeren har sett.',
+ 'cs' => 'Zaregistruje jedinečné ID, které udržuje statistiky o tom, jaká videa z YouTube uživatel viděl.',
+ 'hu' => 'Egyedi azonosítót regisztrál, hogy statisztikákat készítsen arról, hogy a YouTube milyen videókat látott a felhasználó.',
+ 'sv' => 'Registrerar ett unikt ID för att hålla statistik över vilka videor från YouTube användaren har sett.',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ /* Youtube */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'yt-remote-cast-installed',
+ 'provider' => ' youtube.com',
+ 'provider_url' => 'https://policies.google.com/technologies/cookies',
+ 'purpose' => [
+ 'en' => 'Stores the user\'s video player preferences using embedded YouTube video',
+ 'es' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'ag' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'cb' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'mx' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'fr' => 'Stocke les préférences de lecture vidéo de l\'utilisateur pour les vidéos YouTube incorporées.',
+ 'qc' => 'Stocke les préférences de lecture vidéo de l\'utilisateur pour les vidéos YouTube incorporées.',
+ 'pl' => 'Przechowuje preferencje odtwarzacza wideo użytkownika za pomocą osadzonego wideo YouTube.',
+ 'ro' => 'Stochează preferințele playerului video ale utilizatorului utilizând videoclipuri YouTube încorporate.',
+ 'pt' => 'Armazena as preferências do player de vídeo do usuário usando o vídeo do YouTube incorporado.',
+ 'br' => 'Armazena as preferências do player de vídeo do usuário usando o vídeo do YouTube incorporado.',
+ 'sk' => 'Ukladá predvoľby prehrávača videa používateľa pomocou vloženého videa YouTube.',
+ 'nl' => 'Bewaart de voorkeuren van de videospeler van de gebruiker met ingesloten YouTube-video',
+ 'de' => 'Registriert eine eindeutige ID, um Statistiken der Videos von YouTube, die der Benutzer gesehen hat, zu behalten.',
+ 'gr' => 'Αποθηκεύει τις προτιμήσεις του προγράμματος αναπαραγωγής βίντεο του χρήστη χρησιμοποιώντας ενσωματωμένο βίντεο YouTube.',
+ 'it' => 'Memorizza le preferenze del lettore video dell\'utente usando il video YouTube incorporato',
+ 'si' => 'Shrani nastavitve uporabnikovega video predvajalnika z uporabo vdelanega videoposnetka YouTube.',
+ 'da' => 'Gemmer brugerens video-afspiller-præferencer ved afspilning af en indlejret YouTube video.',
+ 'no' => 'Lagrer brukerens videospillerinnstillinger ved hjelp av innebygd YouTube-video.',
+ 'cs' => 'Ukládá předvolby přehrávače videa uživatele pomocí vloženého videa YouTube.',
+ 'hu' => 'A felhasználó videólejátszójának beállításait tárolja a beágyazott YouTube-videók segítségével.',
+ 'sv' => 'Lagrar användarens videospelarinställningar med inbäddad YouTube-video',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ /* Youtube */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'yt-remote-connected-devices',
+ 'provider' => ' youtube.com',
+ 'provider_url' => 'https://policies.google.com/technologies/cookies',
+ 'purpose' => [
+ 'en' => 'Stores the user\'s video player preferences using embedded YouTube video',
+ 'es' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'ag' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'cb' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'mx' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'fr' => 'Stocke les préférences de lecture vidéo de l\'utilisateur pour les vidéos YouTube incorporées.',
+ 'qc' => 'Stocke les préférences de lecture vidéo de l\'utilisateur pour les vidéos YouTube incorporées.',
+ 'pl' => 'Przechowuje preferencje odtwarzacza wideo użytkownika za pomocą osadzonego wideo YouTube.',
+ 'ro' => 'Stochează preferințele playerului video ale utilizatorului utilizând videoclipuri YouTube încorporate.',
+ 'pt' => 'Armazena as preferências do player de vídeo do usuário usando o vídeo do YouTube incorporado.',
+ 'br' => 'Armazena as preferências do player de vídeo do usuário usando o vídeo do YouTube incorporado.',
+ 'sk' => 'Ukladá predvoľby prehrávača videa používateľa pomocou vloženého videa YouTube.',
+ 'nl' => 'Bewaart de voorkeuren van de videospeler van de gebruiker met ingesloten YouTube-video',
+ 'de' => 'Registriert eine eindeutige ID, um Statistiken der Videos von YouTube, die der Benutzer gesehen hat, zu behalten.',
+ 'gr' => 'Αποθηκεύει τις προτιμήσεις του προγράμματος αναπαραγωγής βίντεο του χρήστη χρησιμοποιώντας ενσωματωμένο βίντεο YouTube.',
+ 'it' => 'Memorizza le preferenze del lettore video dell\'utente usando il video YouTube incorporato',
+ 'si' => 'Shrani nastavitve uporabnikovega video predvajalnika z uporabo vdelanega videoposnetka YouTube.',
+ 'da' => 'Gemmer brugerens video-afspiller-præferencer ved afspilning af en indlejret YouTube video.',
+ 'no' => 'Lagrer brukerens videospillerinnstillinger ved hjelp av innebygd YouTube-video.',
+ 'cs' => 'Ukládá předvolby přehrávače videa uživatele pomocí vloženého videa YouTube.',
+ 'hu' => 'A felhasználó videólejátszójának beállításait tárolja a beágyazott YouTube-videók segítségével.',
+ 'sv' => 'Lagrar användarens videospelarinställningar med inbäddad YouTube-video',
+ ],
+ 'expiry' => [
+ 'en' => 'Persistent',
+ 'es' => 'Persistente',
+ 'ag' => 'Persistente',
+ 'cb' => 'Persistente',
+ 'mx' => 'Persistente',
+ 'fr' => 'Persistant',
+ 'qc' => 'Persistant',
+ 'pl' => 'Trwały',
+ 'ro' => 'Persistent',
+ 'pt' => 'Persistente',
+ 'br' => 'Persistente',
+ 'sk' => 'Vytrvalý',
+ 'nl' => 'Aanhoudend',
+ 'de' => 'Hartnäckig',
+ 'gr' => 'Επίμονος',
+ 'it' => 'Persistente',
+ 'si' => 'Vztrajno',
+ 'da' => 'Vedholdende',
+ 'no' => 'Vedvarende',
+ 'cs' => 'Trvalý',
+ 'hu' => 'Kitartó',
+ 'sv' => 'Beständig',
+ ],
+ ],
+ [
+ /* Youtube */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'yt-remote-device-id',
+ 'provider' => ' youtube.com',
+ 'provider_url' => 'https://policies.google.com/technologies/cookies',
+ 'purpose' => [
+ 'en' => 'Stores the user\'s video player preferences using embedded YouTube video',
+ 'es' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'ag' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'cb' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'mx' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'fr' => 'Stocke les préférences de lecture vidéo de l\'utilisateur pour les vidéos YouTube incorporées.',
+ 'qc' => 'Stocke les préférences de lecture vidéo de l\'utilisateur pour les vidéos YouTube incorporées.',
+ 'pl' => 'Przechowuje preferencje odtwarzacza wideo użytkownika za pomocą osadzonego wideo YouTube.',
+ 'ro' => 'Stochează preferințele playerului video ale utilizatorului utilizând videoclipuri YouTube încorporate.',
+ 'pt' => 'Armazena as preferências do player de vídeo do usuário usando o vídeo do YouTube incorporado.',
+ 'br' => 'Armazena as preferências do player de vídeo do usuário usando o vídeo do YouTube incorporado.',
+ 'sk' => 'Ukladá predvoľby prehrávača videa používateľa pomocou vloženého videa YouTube.',
+ 'nl' => 'Bewaart de voorkeuren van de videospeler van de gebruiker met ingesloten YouTube-video',
+ 'de' => 'Registriert eine eindeutige ID, um Statistiken der Videos von YouTube, die der Benutzer gesehen hat, zu behalten.',
+ 'gr' => 'Αποθηκεύει τις προτιμήσεις του προγράμματος αναπαραγωγής βίντεο του χρήστη χρησιμοποιώντας ενσωματωμένο βίντεο YouTube.',
+ 'it' => 'Memorizza le preferenze del lettore video dell\'utente usando il video YouTube incorporato',
+ 'si' => 'Shrani nastavitve uporabnikovega video predvajalnika z uporabo vdelanega videoposnetka YouTube.',
+ 'da' => 'Gemmer brugerens video-afspiller-præferencer ved afspilning af en indlejret YouTube video.',
+ 'no' => 'Lagrer brukerens videospillerinnstillinger ved hjelp av innebygd YouTube-video.',
+ 'cs' => 'Ukládá předvolby přehrávače videa uživatele pomocí vloženého videa YouTube.',
+ 'hu' => 'A felhasználó videólejátszójának beállításait tárolja a beágyazott YouTube-videók segítségével.',
+ 'sv' => 'Lagrar användarens videospelarinställningar med inbäddad YouTube-video',
+ ],
+ 'expiry' => [
+ 'en' => 'Persistent',
+ 'es' => 'Persistente',
+ 'ag' => 'Persistente',
+ 'cb' => 'Persistente',
+ 'mx' => 'Persistente',
+ 'fr' => 'Persistant',
+ 'qc' => 'Persistant',
+ 'pl' => 'Trwały',
+ 'ro' => 'Persistent',
+ 'pt' => 'Persistente',
+ 'br' => 'Persistente',
+ 'sk' => 'Vytrvalý',
+ 'nl' => 'Aanhoudend',
+ 'de' => 'Hartnäckig',
+ 'gr' => 'Επίμονος',
+ 'it' => 'Persistente',
+ 'si' => 'Vztrajno',
+ 'da' => 'Vedholdende',
+ 'no' => 'Vedvarende',
+ 'cs' => 'Trvalý',
+ 'hu' => 'Kitartó',
+ 'sv' => 'Beständig',
+ ],
+ ],
+ [
+ /* Youtube */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'yt-remote-fast-check-period',
+ 'provider' => ' youtube.com',
+ 'provider_url' => 'https://policies.google.com/technologies/cookies',
+ 'purpose' => [
+ 'en' => 'Stores the user\'s video player preferences using embedded YouTube video',
+ 'es' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'ag' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'cb' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'mx' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'fr' => 'Stocke les préférences de lecture vidéo de l\'utilisateur pour les vidéos YouTube incorporées.',
+ 'qc' => 'Stocke les préférences de lecture vidéo de l\'utilisateur pour les vidéos YouTube incorporées.',
+ 'pl' => 'Przechowuje preferencje odtwarzacza wideo użytkownika za pomocą osadzonego wideo YouTube.',
+ 'ro' => 'Stochează preferințele playerului video ale utilizatorului utilizând videoclipuri YouTube încorporate.',
+ 'pt' => 'Armazena as preferências do player de vídeo do usuário usando o vídeo do YouTube incorporado.',
+ 'br' => 'Armazena as preferências do player de vídeo do usuário usando o vídeo do YouTube incorporado.',
+ 'sk' => 'Ukladá predvoľby prehrávača videa používateľa pomocou vloženého videa YouTube.',
+ 'nl' => 'Bewaart de voorkeuren van de videospeler van de gebruiker met ingesloten YouTube-video',
+ 'de' => 'Registriert eine eindeutige ID, um Statistiken der Videos von YouTube, die der Benutzer gesehen hat, zu behalten.',
+ 'gr' => 'Αποθηκεύει τις προτιμήσεις του προγράμματος αναπαραγωγής βίντεο του χρήστη χρησιμοποιώντας ενσωματωμένο βίντεο YouTube.',
+ 'it' => 'Memorizza le preferenze del lettore video dell\'utente usando il video YouTube incorporato',
+ 'si' => 'Shrani nastavitve uporabnikovega video predvajalnika z uporabo vdelanega videoposnetka YouTube.',
+ 'da' => 'Gemmer brugerens video-afspiller-præferencer ved afspilning af en indlejret YouTube video.',
+ 'no' => 'Lagrer brukerens videospillerinnstillinger ved hjelp av innebygd YouTube-video.',
+ 'cs' => 'Ukládá předvolby přehrávače videa uživatele pomocí vloženého videa YouTube.',
+ 'hu' => 'A felhasználó videólejátszójának beállításait tárolja a beágyazott YouTube-videók segítségével.',
+ 'sv' => 'Lagrar användarens videospelarinställningar med inbäddad YouTube-video.',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ /* Youtube */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'yt-remote-session-app',
+ 'provider' => ' youtube.com',
+ 'provider_url' => 'https://policies.google.com/technologies/cookies',
+ 'purpose' => [
+ 'en' => 'Stores the user\'s video player preferences using embedded YouTube video',
+ 'es' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'ag' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'cb' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'mx' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'fr' => 'Stocke les préférences de lecture vidéo de l\'utilisateur pour les vidéos YouTube incorporées.',
+ 'qc' => 'Stocke les préférences de lecture vidéo de l\'utilisateur pour les vidéos YouTube incorporées.',
+ 'pl' => 'Przechowuje preferencje odtwarzacza wideo użytkownika za pomocą osadzonego wideo YouTube.',
+ 'ro' => 'Stochează preferințele playerului video ale utilizatorului utilizând videoclipuri YouTube încorporate.',
+ 'pt' => 'Armazena as preferências do player de vídeo do usuário usando o vídeo do YouTube incorporado.',
+ 'br' => 'Armazena as preferências do player de vídeo do usuário usando o vídeo do YouTube incorporado.',
+ 'sk' => 'Ukladá predvoľby prehrávača videa používateľa pomocou vloženého videa YouTube.',
+ 'nl' => 'Bewaart de voorkeuren van de videospeler van de gebruiker met ingesloten YouTube-video',
+ 'de' => 'Registriert eine eindeutige ID, um Statistiken der Videos von YouTube, die der Benutzer gesehen hat, zu behalten.',
+ 'gr' => 'Αποθηκεύει τις προτιμήσεις του προγράμματος αναπαραγωγής βίντεο του χρήστη χρησιμοποιώντας ενσωματωμένο βίντεο YouTube.',
+ 'it' => 'Memorizza le preferenze del lettore video dell\'utente usando il video YouTube incorporato',
+ 'si' => 'Shrani nastavitve uporabnikovega video predvajalnika z uporabo vdelanega videoposnetka YouTube.',
+ 'da' => 'Gemmer brugerens video-afspiller-præferencer ved afspilning af en indlejret YouTube video.',
+ 'no' => 'Lagrer brukerens videospillerinnstillinger ved hjelp av innebygd YouTube-video.',
+ 'cs' => 'Ukládá předvolby přehrávače videa uživatele pomocí vloženého videa YouTube.',
+ 'hu' => 'A felhasználó videólejátszójának beállításait tárolja a beágyazott YouTube-videók segítségével.',
+ 'sv' => 'Lagrar användarens videospelarinställningar med inbäddad YouTube-video',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ /* Youtube */
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'yt-remote-session-name',
+ 'provider' => ' youtube.com',
+ 'provider_url' => 'https://policies.google.com/technologies/cookies',
+ 'purpose' => [
+ 'en' => 'Stores the user\'s video player preferences using embedded YouTube video',
+ 'es' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'ag' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'cb' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'mx' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'fr' => 'Stocke les préférences de lecture vidéo de l\'utilisateur pour les vidéos YouTube incorporées.',
+ 'qc' => 'Stocke les préférences de lecture vidéo de l\'utilisateur pour les vidéos YouTube incorporées.',
+ 'pl' => 'Przechowuje preferencje odtwarzacza wideo użytkownika za pomocą osadzonego wideo YouTube.',
+ 'ro' => 'Stochează preferințele playerului video ale utilizatorului utilizând videoclipuri YouTube încorporate.',
+ 'pt' => 'Armazena as preferências do player de vídeo do usuário usando o vídeo do YouTube incorporado.',
+ 'br' => 'Armazena as preferências do player de vídeo do usuário usando o vídeo do YouTube incorporado.',
+ 'sk' => 'Ukladá predvoľby prehrávača videa používateľa pomocou vloženého videa YouTube.',
+ 'nl' => 'Bewaart de voorkeuren van de videospeler van de gebruiker met ingesloten YouTube-video',
+ 'de' => 'Registriert eine eindeutige ID, um Statistiken der Videos von YouTube, die der Benutzer gesehen hat, zu behalten.',
+ 'gr' => 'Αποθηκεύει τις προτιμήσεις του προγράμματος αναπαραγωγής βίντεο του χρήστη χρησιμοποιώντας ενσωματωμένο βίντεο YouTube.',
+ 'it' => 'Memorizza le preferenze del lettore video dell\'utente usando il video YouTube incorporato',
+ 'si' => 'Shrani nastavitve uporabnikovega video predvajalnika z uporabo vdelanega videoposnetka YouTube.',
+ 'da' => 'Gemmer brugerens video-afspiller-præferencer ved afspilning af en indlejret YouTube video.',
+ 'no' => 'Lagrer brukerens videospillerinnstillinger ved hjelp av innebygd YouTube-video.',
+ 'cs' => 'Ukládá předvolby přehrávače videa uživatele pomocí vloženého videa YouTube.',
+ 'hu' => 'A felhasználó videólejátszójának beállításait tárolja a beágyazott YouTube-videók segítségével.',
+ 'sv' => 'Lagrar användarens videospelarinställningar med inbäddad YouTube-video',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'ads/ga-audiences',
+ 'provider' => 'Google',
+ 'provider_url' => 'https://policies.google.com/privacy',
+ 'purpose' => [
+ 'en' => 'These cookies are used by Google AdWords to re-engage visitors that are likely to convert to customers based on the visitor’s online behaviour across websites.',
+ 'es' => 'Google AdWords utiliza estas cookies para volver a atraer a los visitantes que probablemente se conviertan en clientes en función del comportamiento en línea del visitante en los sitios web.',
+ 'ag' => 'Google AdWords utiliza estas cookies para volver a atraer a los visitantes que probablemente se conviertan en clientes en función del comportamiento en línea del visitante en los sitios web.',
+ 'cb' => 'Google AdWords utiliza estas cookies para volver a atraer a los visitantes que probablemente se conviertan en clientes en función del comportamiento en línea del visitante en los sitios web.',
+ 'mx' => 'Google AdWords utiliza estas cookies para volver a atraer a los visitantes que probablemente se conviertan en clientes en función del comportamiento en línea del visitante en los sitios web.',
+ 'fr' => 'Ces cookies sont utilisés par Google AdWords pour réengager les visiteurs susceptibles de se convertir en clients en fonction du comportement en ligne du visiteur sur les sites Web.',
+ 'qc' => 'Ces cookies sont utilisés par Google AdWords pour réengager les visiteurs susceptibles de se convertir en clients en fonction du comportement en ligne du visiteur sur les sites Web.',
+ 'pl' => 'Te pliki cookie są używane przez Google AdWords do ponownego angażowania użytkowników, którzy mogą przekształcić się w klientów na podstawie zachowania użytkownika online w różnych witrynach.',
+ 'ro' => 'Aceste cookie-uri sunt utilizate de Google AdWords pentru a re-atrage vizitatori care ar putea converti la clienți pe baza comportamentului online al vizitatorului pe site-uri web.',
+ 'pt' => 'Esses cookies são usados pelo Google AdWords para reconquistar visitantes que provavelmente se converterão em clientes com base no comportamento online do visitante nos sites.',
+ 'br' => 'Esses cookies são usados pelo Google AdWords para reconquistar visitantes que provavelmente se converterão em clientes com base no comportamento online do visitante nos sites.',
+ 'sk' => 'Tieto cookies používa Google AdWords na opätovné zapojenie návštevníkov, u ktorých je pravdepodobné, že sa prevedú na zákazníkov na základe online správania návštevníka na rôznych webových stránkach.',
+ 'nl' => 'Deze cookies worden door Google AdWords gebruikt om bezoekers opnieuw aan te spreken die waarschijnlijk in klanten zullen worden omgezet op basis van het online gedrag van de bezoeker op verschillende websites.',
+ 'de' => 'Diese Cookies werden von Google AdWords verwendet, um Besucher wieder einzubeziehen, die aufgrund des Online-Verhaltens des Besuchers auf verschiedenen Websites wahrscheinlich zu Kunden werden.',
+ 'gr' => 'Αυτά τα cookie χρησιμοποιούνται από το Google AdWords για να προσελκύσουν εκ νέου επισκέπτες που είναι πιθανό να μετατρέψουν σε πελάτες βάσει της διαδικτυακής συμπεριφοράς του επισκέπτη σε ιστότοπους.',
+ 'it' => 'Questi cookie vengono utilizzati da Google AdWords per coinvolgere nuovamente i visitatori che potrebbero convertirsi in clienti in base al comportamento online del visitatore sui siti web.',
+ 'si' => 'Tieto cookies používa Google AdWords na opätovné zapojenie návštevníkov, u ktorých je pravdepodobné, že sa prevedú na zákazníkov na základe online správania návštevníka na rôznych webových stránkach.',
+ 'da' => 'Disse cookies bruges af Google AdWords til at engagere besøgende igen, som sandsynligvis konverterer til kunder baseret på den besøgendes online adfærd på tværs af websteder.',
+ 'no' => 'Disse informasjonskapslene brukes av Google AdWords for å engasjere besøkende som sannsynligvis kan konvertere til kunder, basert på den besøkendes online atferd på tvers av nettsteder.',
+ 'cs' => 'Tyto soubory cookie používá Google AdWords k opětovnému zapojení návštěvníků, u nichž je pravděpodobné, že se převedou na zákazníky na základě online chování návštěvníka na různých webech.',
+ 'hu' => 'Ezeket a cookie-kat a Google AdWords arra használja, hogy újból bevonja azokat a látogatókat, akik valószínűleg a látogatók webhelyeken keresztüli online viselkedése alapján vásárlóvá válnak.',
+ 'sv' => 'Dessa cookies används av Google AdWords för att återanvända besökare som sannolikt kommer att konvertera till kunder baserat på besökarens onlinebeteende över webbplatser.',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'yt-player-headers-readable',
+ 'provider' => 'youtube.com',
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => 'Used to determine the optimal video quality based on the visitor\'s device and network settings.',
+ 'es' => 'Utilizada para determinar la calidad óptima del video basada en el dispositivo del visitante y en los ajustes de la red.',
+ 'ag' => '',
+ 'cb' => '',
+ 'mx' => '',
+ 'fr' => 'Utilisé pour déterminer la qualité vidéo optimale en fonction du périphériqu e du visiteur et des paramètres réseau.',
+ 'qc' => '',
+ 'pl' => '',
+ 'ro' => '',
+ 'pt' => '',
+ 'br' => '',
+ 'sk' => '',
+ 'nl' => '',
+ 'de' => 'Wird verwendet, um basierend auf den Geräte-und Netzwerkeinstellungen des Besuchers die optimale Videoqualität zuermitteln.',
+ 'gr' => '',
+ 'it' => 'Utilizzato per determinare la qualità video ottimale in base al dispositivo del visitatore e alle impostazioni di rete.',
+ 'si' => '',
+ 'da' => 'Bestemmer den optimale video kvalitet ud fraden besøgendes platform og netværkshastighed.',
+ 'no' => '',
+ 'cs' => '',
+ 'hu' => '',
+ 'sv' => '',
+ ],
+ 'expiry' => [
+ 'en' => 'Persistent',
+ 'es' => 'Persistente',
+ 'ag' => 'Persistente',
+ 'cb' => 'Persistente',
+ 'mx' => 'Persistente',
+ 'fr' => 'Persistant',
+ 'qc' => 'Persistant',
+ 'pl' => 'Trwały',
+ 'ro' => 'Persistent',
+ 'pt' => 'Persistente',
+ 'br' => 'Persistente',
+ 'sk' => 'Vytrvalý',
+ 'nl' => 'Aanhoudend',
+ 'de' => 'Hartnäckig',
+ 'gr' => 'Επίμονος',
+ 'it' => 'Persistente',
+ 'si' => 'Vztrajno',
+ 'da' => 'Vedholdende',
+ 'no' => 'Vedvarende',
+ 'cs' => 'Trvalý',
+ 'hu' => 'Kitartó',
+ 'sv' => 'Beständig',
+ ],
+ ],
+ ],
+ CookiesPlusFinality::PREFERENCE_COOKIE => [
+ [
+ 'active' => 0,
+ 'modules' => ['smartsupp'],
+ 'name' => 'ssupp.opened',
+ 'provider' => 'Smartsupp',
+ 'provider_url' => 'https://www.smartsupp.com/help/privacy/',
+ 'purpose' => [
+ 'en' => 'Check if chat box is opened from live chat service provided by Smartsupp.',
+ 'es' => 'Comprueba si el cuadro de chat está abierto desde el servicio de chat en vivo proporcionado por Smartsupp.',
+ 'ag' => 'Comprueba si el cuadro de chat está abierto desde el servicio de chat en vivo proporcionado por Smartsupp.',
+ 'cb' => 'Comprueba si el cuadro de chat está abierto desde el servicio de chat en vivo proporcionado por Smartsupp.',
+ 'mx' => 'Comprueba si el cuadro de chat está abierto desde el servicio de chat en vivo proporcionado por Smartsupp.',
+ 'fr' => 'Vérifie si la boîte de discussion est ouverte à partir du service de chat en direct fourni par Smartsupp.',
+ 'qc' => 'Vérifie si la boîte de discussion est ouverte à partir du service de chat en direct fourni par Smartsupp.',
+ 'pl' => 'Sprawdza, czy okno czatu jest otwierane z usługi czatu na żywo dostarczanej przez Smartsupp.',
+ 'ro' => 'Verifică dacă caseta de chat este deschisă din serviciul de chat live furnizat de Smartsupp.',
+ 'pt' => 'Verifica se a caixa de bate-papo é aberta a partir do serviço de bate-papo ao vivo fornecido pela Smartsupp.',
+ 'br' => 'Verifica se a caixa de bate-papo é aberta a partir do serviço de bate-papo ao vivo fornecido pela Smartsupp.',
+ 'sk' => 'Skontroluje, či je okno chatu otvorené zo služby živého chatu poskytovanej spoločnosťou Smartsupp.',
+ 'nl' => 'Controleert of de chatbox wordt geopend vanuit de live chatservice van Smartsupp.',
+ 'de' => 'Überprüft, ob das Chatfeld über den von Smartsupp bereitgestellten Live-Chat-Dienst geöffnet ist.',
+ 'gr' => 'Ελέγχει εάν έχει ανοίξει το πλαίσιο συνομιλίας από την υπηρεσία ζωντανής συνομιλίας που παρέχεται από το Smartsupp.',
+ 'it' => 'Controlla se la casella di chat è aperta dal servizio di chat dal vivo fornito da Smartsupp.',
+ 'si' => 'Preveri, ali se polje za klepet odpre s storitvijo klepeta v živo, ki jo nudi Smartsupp.',
+ 'da' => 'Kontrollerer, om chatfeltet åbnes fra live chat-tjenesten leveret af Smartsupp.',
+ 'no' => 'Sjekker om chat-boksen åpnes fra live chat-tjenesten levert av Smartsupp.',
+ 'cs' => 'Zkontroluje, zda je okno chatu otevřeno ze služby živého chatu poskytované společností Smartsupp.',
+ 'hu' => 'Ellenőrzi, hogy a csevegőmező nyitva van-e a Smartsupp által biztosított élő csevegési szolgáltatásból.',
+ 'sv' => 'Kontrollera om chattrutan öppnas från livechatttjänsten från Smartsupp.',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => ['smartsupp'],
+ 'name' => 'ssupp.barclicked',
+ 'provider' => 'Smartsupp',
+ 'provider_url' => 'https://www.smartsupp.com/help/privacy/',
+ 'purpose' => [
+ 'en' => 'Needed for automatic messages from live chat service provided by Smartsupp.',
+ 'es' => 'Necesario para mensajes automáticos del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'ag' => 'Necesario para mensajes automáticos del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'cb' => 'Necesario para mensajes automáticos del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'mx' => 'Necesario para mensajes automáticos del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'fr' => 'Nécessaire pour les messages automatiques du service de chat en direct fourni par Smartsupp.',
+ 'qc' => 'Nécessaire pour les messages automatiques du service de chat en direct fourni par Smartsupp.',
+ 'pl' => 'Potrzebne do automatycznych wiadomości z usługi czatu na żywo dostarczanej przez Smartsupp.',
+ 'ro' => 'Este necesar pentru mesaje automate din serviciul de chat live furnizat de Smartsupp.',
+ 'pt' => 'Necessário para mensagens automáticas do serviço de chat ao vivo fornecido pela Smartsupp.',
+ 'br' => 'Necessário para mensagens automáticas do serviço de chat ao vivo fornecido pela Smartsupp.',
+ 'sk' => 'Potrebné pre automatické správy zo služby živého chatu poskytované spoločnosťou Smartsupp.',
+ 'nl' => 'Nodig voor automatische berichten van de live chatservice van Smartsupp.',
+ 'de' => 'Wird für automatische Nachrichten vom Live-Chat-Dienst von Smartsupp benötigt.',
+ 'gr' => 'Απαιτείται για αυτόματα μηνύματα από την υπηρεσία ζωντανής συνομιλίας που παρέχεται από το Smartsupp.',
+ 'it' => 'Necessario per i messaggi automatici dal servizio di live chat fornito da Smartsupp.',
+ 'si' => 'Potrebno za samodejna sporočila iz storitve klepeta v živo, ki jo ponuja Smartsupp.',
+ 'da' => 'Nødvendigt til automatiske meddelelser fra live chat-tjeneste leveret af Smartsupp.',
+ 'no' => 'Nødvendig for automatiske meldinger fra live chat-tjenesten levert av Smartsupp.',
+ 'cs' => 'Potřebné pro automatické zprávy ze služby živého chatu poskytované společností Smartsupp.',
+ 'hu' => 'Szükséges a Smartsupp által biztosított élő chat szolgáltatás automatikus üzeneteihez.',
+ 'sv' => 'Behövs för automatiska meddelanden från chattjänsten som tillhandahålls av Smartsupp.',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => ['smartsupp'],
+ 'name' => 'ssupp.message',
+ 'provider' => 'Smartsupp',
+ 'provider_url' => 'https://www.smartsupp.com/help/privacy/',
+ 'purpose' => [
+ 'en' => 'Stores content in text area from live chat service provided by Smartsupp.',
+ 'es' => 'Almacena contenido en el área de texto del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'ag' => 'Almacena contenido en el área de texto del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'cb' => 'Almacena contenido en el área de texto del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'mx' => 'Almacena contenido en el área de texto del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'fr' => 'Stocke le contenu dans la zone de texte du service de chat en direct fourni par Smartsupp.',
+ 'qc' => 'Stocke le contenu dans la zone de texte du service de chat en direct fourni par Smartsupp.',
+ 'pl' => 'Przechowuje zawartość w obszarze tekstowym z usługi czatu na żywo dostarczanej przez Smartsupp.',
+ 'ro' => 'Stochează conținut în zona de text din serviciul de chat live furnizat de Smartsupp.',
+ 'pt' => 'Armazena conteúdo na área de texto do serviço de chat ao vivo fornecido pela Smartsupp.',
+ 'br' => 'Armazena conteúdo na área de texto do serviço de chat ao vivo fornecido pela Smartsupp.',
+ 'sk' => 'Ukladá obsah do textovej oblasti zo služby živého chatu poskytovanej spoločnosťou Smartsupp.',
+ 'nl' => 'Slaat inhoud op in het tekstgedeelte van de live chatservice van Smartsupp.',
+ 'de' => 'Speichert Inhalte im Textbereich des von Smartsupp bereitgestellten Live-Chat-Dienstes.',
+ 'gr' => 'Αποθηκεύει περιεχόμενο στην περιοχή κειμένου από την υπηρεσία ζωντανής συνομιλίας που παρέχεται από το Smartsupp.',
+ 'it' => 'Memorizza il contenuto nell\'area di testo dal servizio di chat dal vivo fornito da Smartsupp.',
+ 'si' => 'Shrani vsebino v besedilno območje iz storitve klepeta v živo, ki jo ponuja Smartsupp.',
+ 'da' => 'Gemmer indhold i tekstområdet fra live chat-tjeneste leveret af Smartsupp.',
+ 'no' => 'Lagrer innhold i tekstområdet fra live chat-tjenesten levert av Smartsupp.',
+ 'cs' => 'Ukládá obsah do textové oblasti ze služby živého chatu poskytované společností Smartsupp.',
+ 'hu' => 'A szöveges területen tárolja a Smartsupp által biztosított élő csevegőszolgáltatás tartalmát.',
+ 'sv' => 'Lagrar innehåll i textområdet från livechatttjänsten från Smartsupp.',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => ['smartsupp'],
+ 'name' => 'ssupp.unreaded',
+ 'provider' => 'Smartsupp',
+ 'provider_url' => 'https://www.smartsupp.com/help/privacy/',
+ 'purpose' => [
+ 'en' => 'Number of unread messages from live chat service provided by Smartsupp.',
+ 'es' => 'Número de mensajes no leídos del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'ag' => 'Número de mensajes no leídos del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'cb' => 'Número de mensajes no leídos del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'mx' => 'Número de mensajes no leídos del servicio de chat en vivo proporcionado por Smartsupp.',
+ 'fr' => 'Nombre de messages non lus du service de chat en direct fourni par Smartsupp.',
+ 'qc' => 'Nombre de messages non lus du service de chat en direct fourni par Smartsupp.',
+ 'pl' => 'Liczba nieprzeczytanych wiadomości z usługi czatu na żywo świadczonej przez Smartsupp.',
+ 'ro' => 'Numărul de mesaje necitite din serviciul de chat live furnizat de Smartsupp.',
+ 'pt' => 'Número de mensagens não lidas do serviço de chat ao vivo fornecido pela Smartsupp.',
+ 'br' => 'Número de mensagens não lidas do serviço de chat ao vivo fornecido pela Smartsupp.',
+ 'sk' => 'Počet neprečítaných správ zo služby živého chatu poskytovaných spoločnosťou Smartsupp.',
+ 'nl' => 'Aantal ongelezen berichten van live chatservice geleverd door Smartsupp.',
+ 'de' => 'Anzahl der ungelesenen Nachrichten vom Live-Chat-Dienst von Smartsupp.',
+ 'gr' => 'Αριθμός μη αναγνωσμένων μηνυμάτων από την υπηρεσία ζωντανής συνομιλίας που παρέχεται από το Smartsupp.',
+ 'it' => 'Numero di messaggi non letti dal servizio di chat dal vivo fornito da Smartsupp.',
+ 'si' => 'Število neprebranih sporočil iz storitve klepeta v živo, ki jo nudi Smartsupp.',
+ 'da' => 'Antal ulæste beskeder fra live chat-tjeneste leveret af Smartsupp.',
+ 'no' => 'Antall uleste meldinger fra live chat-tjenesten levert av Smartsupp.',
+ 'cs' => 'Počet nepřečtených zpráv ze služby živého chatu poskytovaných Smartsupp.',
+ 'hu' => 'A Smartsupp által biztosított élő csevegőszolgáltatás olvasatlan üzeneteinek száma.',
+ 'sv' => 'Antal olästa meddelanden från chattjänsten från Smartsupp.',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'DEVICE_INFO',
+ 'provider' => 'youtube.com',
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => 'Used to track user\'s interaction with embedded content.',
+ 'es' => 'Se usa para rastrear la interacción del usuario con el contenido integrado.',
+ 'ag' => 'Se usa para rastrear la interacción del usuario con el contenido integrado.',
+ 'cb' => 'Se usa para rastrear la interacción del usuario con el contenido integrado.',
+ 'mx' => 'Se usa para rastrear la interacción del usuario con el contenido integrado.',
+ 'fr' => 'Utilisé pour suivre l\'interaction de l\'utilisateur avec le contenu intégré.',
+ 'qc' => 'Utilisé pour suivre l\'interaction de l\'utilisateur avec le contenu intégré.',
+ 'pl' => '',
+ 'ro' => '',
+ 'pt' => '',
+ 'br' => '',
+ 'sk' => '',
+ 'nl' => '',
+ 'de' => 'Wird verwendet, um die Interaktion der Nutzer mit eingebetteten Inhalten zu verfolgen.',
+ 'gr' => '',
+ 'it' => 'Utilizzato per tracciare l\'interazione dell\'utente con i contenuti incorporati',
+ 'si' => '',
+ 'da' => 'Benyttes til indsamling data omhandlen debrugerens interaktion med indlejret indhold.',
+ 'no' => '',
+ 'cs' => '',
+ 'hu' => '',
+ 'sv' => '',
+ ],
+ 'expiry' => [
+ 'en' => '180 days',
+ 'es' => '180 días',
+ 'ag' => '180 días',
+ 'cb' => '180 días',
+ 'mx' => '180 días',
+ 'fr' => '180 jours',
+ 'qc' => '180 jours',
+ 'pl' => '180 dni',
+ 'ro' => '180 de zile',
+ 'pt' => '180 dias',
+ 'br' => '180 dias',
+ 'sk' => '180 dní',
+ 'nl' => '180 dagen',
+ 'de' => '180 Tage',
+ 'gr' => '180 μέρες',
+ 'it' => '180 giorni',
+ 'si' => '180 dni',
+ 'da' => '180 dage',
+ 'no' => '180 dager',
+ 'cs' => '180 dager',
+ 'hu' => '180 nap',
+ 'sv' => '180 dagar',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'LAST_RESULT_ENTRY_KEY',
+ 'provider' => 'youtube.com',
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => '',
+ 'es' => '',
+ 'ag' => '',
+ 'cb' => '',
+ 'mx' => '',
+ 'fr' => '',
+ 'qc' => '',
+ 'pl' => '',
+ 'ro' => '',
+ 'pt' => '',
+ 'br' => '',
+ 'sk' => '',
+ 'nl' => '',
+ 'de' => '',
+ 'gr' => '',
+ 'it' => '',
+ 'si' => '',
+ 'da' => '',
+ 'no' => '',
+ 'cs' => '',
+ 'hu' => '',
+ 'sv' => '',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'TESTCOOKIESENABLED',
+ 'provider' => 'youtube.com',
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => '',
+ 'es' => '',
+ 'ag' => '',
+ 'cb' => '',
+ 'mx' => '',
+ 'fr' => '',
+ 'qc' => '',
+ 'pl' => '',
+ 'ro' => '',
+ 'pt' => '',
+ 'br' => '',
+ 'sk' => '',
+ 'nl' => '',
+ 'de' => '',
+ 'gr' => '',
+ 'it' => '',
+ 'si' => '',
+ 'da' => '',
+ 'no' => '',
+ 'cs' => '',
+ 'hu' => '',
+ 'sv' => '',
+ ],
+ 'expiry' => [
+ 'en' => '1 day',
+ 'es' => '1 día',
+ 'ag' => '1 día',
+ 'cb' => '1 día',
+ 'mx' => '1 día',
+ 'fr' => '1 jour',
+ 'qc' => '1 jour',
+ 'pl' => '1 dzień',
+ 'ro' => '1 zi',
+ 'pt' => '1 dia',
+ 'br' => '1 dia',
+ 'sk' => '1 deň',
+ 'nl' => '1 dag',
+ 'de' => '1 Tag',
+ 'gr' => '1 μέρα',
+ 'it' => '1 giorno',
+ 'si' => '1 dan',
+ 'da' => '1 dag',
+ 'no' => '1 dag',
+ 'cs' => '1 den',
+ 'hu' => '1 nap',
+ 'sv' => '1 dag',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'VISITOR_INFO1_LIVE',
+ 'provider' => 'youtube.com',
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => 'Tries to estimate the users\' bandwidth on pages with integrated YouTube videos.',
+ 'es' => 'Intenta calcular el ancho de banda del usuario en páginas con vídeos de YouTube integrados.',
+ 'ag' => 'Intenta calcular el ancho de banda del usuario en páginas con vídeos de YouTube integrados.',
+ 'cb' => 'Intenta calcular el ancho de banda del usuario en páginas con vídeos de YouTube integrados.',
+ 'mx' => 'Intenta calcular el ancho de banda del usuario en páginas con vídeos de YouTube integrados.',
+ 'fr' => 'Tente d\'estimer la bande passante des utilisateurs sur des pages avec des vidéos YouTube intégrées',
+ 'qc' => 'Tente d\'estimer la bande passante des utilisateurs sur des pages avec des vidéos YouTube intégrées',
+ 'pl' => '',
+ 'ro' => '',
+ 'pt' => '',
+ 'br' => '',
+ 'sk' => '',
+ 'nl' => '',
+ 'de' => 'Versucht, die Benutzerbandbreite auf Seiten mit integrierten YouTube-Videos zu schätzen.',
+ 'gr' => '',
+ 'it' => 'Prova a stimare la velocità della connession e dell\'u ente su pagine con video YouTube integrati.',
+ 'si' => '',
+ 'da' => 'Forsøger at estimere brugernes båndbredde på sider med integreret YouTube-video.',
+ 'no' => '',
+ 'cs' => '',
+ 'hu' => '',
+ 'sv' => '',
+ ],
+ 'expiry' => [
+ 'en' => '180 days',
+ 'es' => '180 días',
+ 'ag' => '180 días',
+ 'cb' => '180 días',
+ 'mx' => '180 días',
+ 'fr' => '180 jours',
+ 'qc' => '180 jours',
+ 'pl' => '180 dni',
+ 'ro' => '180 de zile',
+ 'pt' => '180 dias',
+ 'br' => '180 dias',
+ 'sk' => '180 dní',
+ 'nl' => '180 dagen',
+ 'de' => '180 Tage',
+ 'gr' => '180 μέρες',
+ 'it' => '180 giorni',
+ 'si' => '180 dni',
+ 'da' => '180 dage',
+ 'no' => '180 dager',
+ 'cs' => '180 dager',
+ 'hu' => '180 nap',
+ 'sv' => '180 dagar',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'YSC',
+ 'provider' => 'youtube.com',
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => 'Registers a unique ID to keep statistics of what videos from YouTube the user has seen.',
+ 'es' => 'Registra una identificación única para mantener estadísticas de qué vídeos de YouTube ha visto el usuario.',
+ 'ag' => 'Registra una identificación única para mantener estadísticas de qué vídeos de YouTube ha visto el usuario.',
+ 'cb' => 'Registra una identificación única para mantener estadísticas de qué vídeos de YouTube ha visto el usuario.',
+ 'mx' => 'Registra una identificación única para mantener estadísticas de qué vídeos de YouTube ha visto el usuario.',
+ 'fr' => 'Tente d\'estimer la bande passante des utilisateurs sur des pages avec des vidéos YouTube intégrées.',
+ 'qc' => 'Tente d\'estimer la bande passante des utilisateurs sur des pages avec des vidéos YouTube intégrées.',
+ 'pl' => '',
+ 'ro' => '',
+ 'pt' => '',
+ 'br' => '',
+ 'sk' => '',
+ 'nl' => '',
+ 'de' => 'Registriert eine eindeutige ID, um Statistiken der Videos von YouTube, die der Benutzer gesehen hat, zu behalten.',
+ 'gr' => '',
+ 'it' => 'Registra un ID univoco per statistiche legate a quali video YouTube sono stati visualizzati dall\'utente.',
+ 'si' => '',
+ 'da' => 'Registrerer et unikt ID for at føre statistik over hvilke videoer fra YouTube brugeren har set.',
+ 'no' => '',
+ 'cs' => '',
+ 'hu' => '',
+ 'sv' => '',
+ ],
+ 'expiry' => [
+ 'en' => 'Session',
+ 'es' => 'Sesión',
+ 'ag' => 'Sesión',
+ 'cb' => 'Sesión',
+ 'mx' => 'Sesión',
+ 'fr' => 'Session',
+ 'qc' => 'Session',
+ 'pl' => 'Sesja',
+ 'ro' => 'Sesiune',
+ 'pt' => 'Sessão',
+ 'br' => 'Sessão',
+ 'sk' => 'Session',
+ 'nl' => 'Sessie',
+ 'de' => 'Session',
+ 'gr' => 'Συνεδρία',
+ 'it' => 'Sessione',
+ 'si' => 'Seja',
+ 'da' => 'Session',
+ 'no' => 'Økt',
+ 'cs' => 'Zasedání',
+ 'hu' => 'Ülés',
+ 'sv' => 'Session',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'ytidb::LAST_RESULT_ENTRY_KEY',
+ 'provider' => 'youtube.com',
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => 'It records the user\'s video player preferences when viewing embedded YouTube videos.',
+ 'es' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'ag' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'cb' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'mx' => 'Registra las preferencias del reproductor de vídeo del usuario al ver vídeos incrustados de YouTube.',
+ 'fr' => 'Stocke les préférences de lecture vidéo de l\'utilisateur pour les vidéos YouTube incorporées.',
+ 'qc' => 'Stocke les préférences de lecture vidéo de l\'utilisateur pour les vidéos YouTube incorporées.',
+ 'pl' => '',
+ 'ro' => '',
+ 'pt' => '',
+ 'br' => '',
+ 'sk' => '',
+ 'nl' => '',
+ 'de' => 'Speichert die Benutzereinstellungen beim Abruf eines auf anderen Webseiten integrierten Youtube-Videos.',
+ 'gr' => '',
+ 'it' => 'Memorizza le preferenze del lettore video dell\'u tente usando il video YouTube incorporato.',
+ 'si' => '',
+ 'da' => 'Gemmer brugerens video-afspiller-præferencer ved afspilning af en indlejret YouTube video.',
+ 'no' => '',
+ 'cs' => '',
+ 'hu' => '',
+ 'sv' => '',
+ ],
+ 'expiry' => [
+ 'en' => 'Persistent',
+ 'es' => 'Persistente',
+ 'ag' => 'Persistente',
+ 'cb' => 'Persistente',
+ 'mx' => 'Persistente',
+ 'fr' => 'Persistant',
+ 'qc' => 'Persistant',
+ 'pl' => 'Trwały',
+ 'ro' => 'Persistent',
+ 'pt' => 'Persistente',
+ 'br' => 'Persistente',
+ 'sk' => 'Vytrvalý',
+ 'nl' => 'Aanhoudend',
+ 'de' => 'Hartnäckig',
+ 'gr' => 'Επίμονος',
+ 'it' => 'Persistente',
+ 'si' => 'Vztrajno',
+ 'da' => 'Vedholdende',
+ 'no' => 'Vedvarende',
+ 'cs' => 'Trvalý',
+ 'hu' => 'Kitartó',
+ 'sv' => 'Beständig',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'modules' => [],
+ 'name' => 'YtIdbMeta#databases',
+ 'provider' => 'youtube.com',
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => '',
+ 'es' => '',
+ 'ag' => '',
+ 'cb' => '',
+ 'mx' => '',
+ 'fr' => '',
+ 'qc' => '',
+ 'pl' => '',
+ 'ro' => '',
+ 'pt' => '',
+ 'br' => '',
+ 'sk' => '',
+ 'nl' => '',
+ 'de' => '',
+ 'gr' => '',
+ 'it' => '',
+ 'si' => '',
+ 'da' => '',
+ 'no' => '',
+ 'cs' => '',
+ 'hu' => '',
+ 'sv' => '',
+ ],
+ 'expiry' => [
+ 'en' => 'Persistent',
+ 'es' => 'Persistente',
+ 'ag' => 'Persistente',
+ 'cb' => 'Persistente',
+ 'mx' => 'Persistente',
+ 'fr' => 'Persistant',
+ 'qc' => 'Persistant',
+ 'pl' => 'Trwały',
+ 'ro' => 'Persistent',
+ 'pt' => 'Persistente',
+ 'br' => 'Persistente',
+ 'sk' => 'Vytrvalý',
+ 'nl' => 'Aanhoudend',
+ 'de' => 'Hartnäckig',
+ 'gr' => 'Επίμονος',
+ 'it' => 'Persistente',
+ 'si' => 'Vztrajno',
+ 'da' => 'Vedholdende',
+ 'no' => 'Vedvarende',
+ 'cs' => 'Trvalý',
+ 'hu' => 'Kitartó',
+ 'sv' => 'Beständig',
+ ],
+ ],
+ [
+ /* Tawk.to */
+ 'active' => 0,
+ 'modules' => ['tawkto', 'tawktoconfig'],
+ 'name' => 'twk_uuid_#',
+ 'provider' => Tools::getHttpHost(),
+ 'provider_url' => '',
+ 'purpose' => [
+ 'en' => '',
+ 'es' => '',
+ 'ag' => '',
+ 'cb' => '',
+ 'mx' => '',
+ 'fr' => '',
+ 'qc' => '',
+ 'pl' => '',
+ 'ro' => '',
+ 'pt' => '',
+ 'br' => '',
+ 'sk' => '',
+ 'nl' => '',
+ 'de' => '',
+ 'gr' => '',
+ 'it' => '',
+ 'si' => '',
+ 'da' => '',
+ 'no' => '',
+ 'cs' => '',
+ 'hu' => '',
+ 'sv' => '',
+ ],
+ 'expiry' => [
+ 'en' => '180 days',
+ 'es' => '180 días',
+ 'ag' => '180 días',
+ 'cb' => '180 días',
+ 'mx' => '180 días',
+ 'fr' => '180 jours',
+ 'qc' => '180 jours',
+ 'pl' => '180 dni',
+ 'ro' => '180 de zile',
+ 'pt' => '180 dias',
+ 'br' => '180 dias',
+ 'sk' => '180 dní',
+ 'nl' => '180 dagen',
+ 'de' => '180 Tage',
+ 'gr' => '180 μέρες',
+ 'it' => '180 giorni',
+ 'si' => '180 dni',
+ 'da' => '180 dage',
+ 'no' => '180 dager',
+ 'cs' => '180 dager',
+ 'hu' => '180 nap',
+ 'sv' => '180 dagar',
+ ],
+ ],
+ ],
+ CookiesPlusFinality::PERFORMANCE_COOKIE => [
+ [
+ 'active' => 0,
+ 'name' => 'AWSALB',
+ 'modules' => ['smartsupp'],
+ 'provider' => 'Smartsupp',
+ 'provider_url' => 'https://www.smartsupp.com/help/privacy/',
+ 'purpose' => [
+ 'en' => 'Generated by AWS (Amazon Web Services), needed for sending the requests to the server correctly',
+ 'es' => 'Generado por AWS (Amazon Web Services), necesario para enviar correctamente las solicitudes al servidor.',
+ 'ag' => 'Generado por AWS (Amazon Web Services), necesario para enviar correctamente las solicitudes al servidor.',
+ 'cb' => 'Generado por AWS (Amazon Web Services), necesario para enviar correctamente las solicitudes al servidor.',
+ 'mx' => 'Generado por AWS (Amazon Web Services), necesario para enviar correctamente las solicitudes al servidor.',
+ 'fr' => 'Généré par AWS (Amazon Web Services), nécessaire pour envoyer correctement les requêtes au serveur.',
+ 'qc' => 'Généré par AWS (Amazon Web Services), nécessaire pour envoyer correctement les requêtes au serveur.',
+ 'pl' => 'Wygenerowane przez AWS (Amazon Web Services), potrzebne do prawidłowego wysyłania żądań do serwera.',
+ 'ro' => 'Generat de AWS (Amazon Web Services), necesar pentru trimiterea corectă a cererilor către server.',
+ 'pt' => 'Gerado pela AWS (Amazon Web Services), necessário para o envio correto das solicitações ao servidor.',
+ 'br' => 'Gerado pela AWS (Amazon Web Services), necessário para o envio correto das solicitações ao servidor.',
+ 'sk' => 'Generované AWS (Amazon Web Services), potrebné na správne odoslanie požiadaviek na server.',
+ 'nl' => 'Gegenereerd door AWS (Amazon Web Services), nodig om de verzoeken correct naar de server te sturen.',
+ 'de' => 'Wird von AWS (Amazon Web Services) generiert und wird zum korrekten Senden der Anforderungen an den Server benötigt.',
+ 'gr' => 'Δημιουργήθηκε από AWS (Amazon Web Services), που απαιτείται για την σωστή αποστολή των αιτημάτων στον διακομιστή.',
+ 'it' => 'Generato da AWS (Amazon Web Services), necessario per inviare correttamente le richieste al server.',
+ 'si' => 'Ustvari AWS (Amazon Web Services), potreben za pravilno pošiljanje zahtev na strežnik.',
+ 'da' => 'Genereret af AWS (Amazon Web Services), der er nødvendigt for at sende anmodningerne korrekt til serveren.',
+ 'no' => 'Generert av AWS (Amazon Web Services), nødvendig for å sende forespørslene til serveren riktig.',
+ 'cs' => 'Generováno AWS (Amazon Web Services), potřebné pro správné odesílání požadavků na server.',
+ 'hu' => 'Az AWS (Amazon Web Services) által generált, a kérések szerverre történő megfelelő elküldéséhez szükséges.',
+ 'sv' => 'Genereras av AWS (Amazon Web Services), behövs för att skicka förfrågningarna till servern korrekt',
+ ],
+ 'expiry' => [
+ 'en' => '7 days',
+ 'es' => '7 días',
+ 'ag' => '7 días',
+ 'cb' => '7 días',
+ 'mx' => '7 días',
+ 'fr' => '7 jours',
+ 'qc' => '7 jours',
+ 'pl' => '7 dni',
+ 'ro' => '7 de zile',
+ 'pt' => '7 dias',
+ 'br' => '7 dias',
+ 'sk' => '7 dní',
+ 'nl' => '7 dagen',
+ 'de' => '7 Tage',
+ 'gr' => '7 μέρες',
+ 'it' => '7 giorni',
+ 'si' => '7 dni',
+ 'da' => '7 dage',
+ 'no' => '7 dager',
+ 'cs' => '7 dager',
+ 'hu' => '7 nap',
+ 'sv' => '7 dagar',
+ ],
+ ],
+ [
+ 'active' => 0,
+ 'name' => 'AWSALBCORS',
+ 'modules' => ['smartsupp'],
+ 'provider' => 'Smartsupp',
+ 'provider_url' => 'https://www.smartsupp.com/help/privacy/',
+ 'purpose' => [
+ 'en' => 'Generated by AWS (Amazon Web Services), needed for sending the requests to the server correctly',
+ 'es' => 'Generado por AWS (Amazon Web Services), necesario para enviar correctamente las solicitudes al servidor.',
+ 'ag' => 'Generado por AWS (Amazon Web Services), necesario para enviar correctamente las solicitudes al servidor.',
+ 'cb' => 'Generado por AWS (Amazon Web Services), necesario para enviar correctamente las solicitudes al servidor.',
+ 'mx' => 'Generado por AWS (Amazon Web Services), necesario para enviar correctamente las solicitudes al servidor.',
+ 'fr' => 'Généré par AWS (Amazon Web Services), nécessaire pour envoyer correctement les requêtes au serveur.',
+ 'qc' => 'Généré par AWS (Amazon Web Services), nécessaire pour envoyer correctement les requêtes au serveur.',
+ 'pl' => 'Wygenerowane przez AWS (Amazon Web Services), potrzebne do prawidłowego wysyłania żądań do serwera.',
+ 'ro' => 'Generat de AWS (Amazon Web Services), necesar pentru trimiterea corectă a cererilor către server.',
+ 'pt' => 'Gerado pela AWS (Amazon Web Services), necessário para o envio correto das solicitações ao servidor.',
+ 'br' => 'Gerado pela AWS (Amazon Web Services), necessário para o envio correto das solicitações ao servidor.',
+ 'sk' => 'Generované AWS (Amazon Web Services), potrebné na správne odoslanie požiadaviek na server.',
+ 'nl' => 'Gegenereerd door AWS (Amazon Web Services), nodig om de verzoeken correct naar de server te sturen.',
+ 'de' => 'Wird von AWS (Amazon Web Services) generiert und wird zum korrekten Senden der Anforderungen an den Server benötigt.',
+ 'gr' => 'Δημιουργήθηκε από AWS (Amazon Web Services), που απαιτείται για την σωστή αποστολή των αιτημάτων στον διακομιστή.',
+ 'it' => 'Generato da AWS (Amazon Web Services), necessario per inviare correttamente le richieste al server.',
+ 'si' => 'Ustvari AWS (Amazon Web Services), potreben za pravilno pošiljanje zahtev na strežnik.',
+ 'da' => 'Genereret af AWS (Amazon Web Services), der er nødvendigt for at sende anmodningerne korrekt til serveren.',
+ 'no' => 'Generert av AWS (Amazon Web Services), nødvendig for å sende forespørslene til serveren riktig.',
+ 'cs' => 'Generováno AWS (Amazon Web Services), potřebné pro správné odesílání požadavků na server.',
+ 'hu' => 'Az AWS (Amazon Web Services) által generált, a kérések szerverre történő megfelelő elküldéséhez szükséges.',
+ 'sv' => 'Genereras av AWS (Amazon Web Services), behövs för att skicka förfrågningarna till servern korrekt',
+ ],
+ 'expiry' => [
+ 'en' => '7 days',
+ 'es' => '7 días',
+ 'ag' => '7 días',
+ 'cb' => '7 días',
+ 'mx' => '7 días',
+ 'fr' => '7 jours',
+ 'qc' => '7 jours',
+ 'pl' => '7 dni',
+ 'ro' => '7 de zile',
+ 'pt' => '7 dias',
+ 'br' => '7 dias',
+ 'sk' => '7 dní',
+ 'nl' => '7 dagen',
+ 'de' => '7 Tage',
+ 'gr' => '7 μέρες',
+ 'it' => '7 giorni',
+ 'si' => '7 dni',
+ 'da' => '7 dage',
+ 'no' => '7 dager',
+ 'cs' => '7 dager',
+ 'hu' => '7 nap',
+ 'sv' => '7 dagar',
+ ],
+ ],
+ ],
+ ];
+
+ if (isset($cookiesPlusCookieDefaultValues[$cookiesPlusFinality])) {
+ return $cookiesPlusCookieDefaultValues[$cookiesPlusFinality];
+ }
+
+ return [];
+ }
+
+ public static function getCookiePurposeCallback($value)
+ {
+ return Tools::strlen($value) > 100 ? Tools::substr($value, 0, 100) . '...' : $value;
+ }
+}
diff --git a/modules/cookiesplus/classes/CookiesPlusFinality.php b/modules/cookiesplus/classes/CookiesPlusFinality.php
new file mode 100644
index 00000000..a71cb827
--- /dev/null
+++ b/modules/cookiesplus/classes/CookiesPlusFinality.php
@@ -0,0 +1,500 @@
+ 'cookiesplus_finality',
+ 'primary' => 'id_cookiesplus_finality',
+ 'multilang' => true,
+ 'fields' => [
+ 'id_cookiesplus_finality' => ['type' => self::TYPE_INT, 'validate' => 'isUnsignedId', 'copy_post' => false],
+ 'id_shop' => ['type' => self::TYPE_INT, 'validate' => 'isUnsignedId', 'copy_post' => false],
+ 'active' => ['type' => self::TYPE_BOOL, 'validate' => 'isBool'],
+ 'technical' => ['type' => self::TYPE_BOOL, 'required' => true],
+ 'modules' => ['type' => self::TYPE_STRING],
+ 'name' => ['type' => self::TYPE_STRING, 'validate' => 'isAnything', 'required' => true, 'lang' => true],
+ 'description' => ['type' => self::TYPE_STRING, 'validate' => 'isAnything', 'required' => true, 'lang' => true],
+ 'js_script' => ['type' => self::TYPE_HTML],
+ 'js_not_script' => ['type' => self::TYPE_HTML],
+ 'position' => ['type' => self::TYPE_INT],
+ ],
+ ];
+
+ public function add($autodate = true, $null_values = false)
+ {
+ $this->id_shop = ($this->id_shop) ?: Context::getContext()->shop->id;
+
+ return parent::add($autodate, $null_values);
+ }
+
+ public static function getCookiesPlusFinalities($id_lang = null, $only_active = false, $include_technical_cookies = true)
+ {
+ $cacheKey = 'CookiesPlus::getCookiesPlusFinalities_' . $id_lang . '_' . $only_active . '_' . $include_technical_cookies . '_' . Context::getContext()->shop->id;
+
+ if (!Cache::isStored($cacheKey)) {
+ $query = 'SELECT *
+ FROM ' . _DB_PREFIX_ . 'cookiesplus_finality cf '
+ . 'LEFT JOIN ' . _DB_PREFIX_ . 'cookiesplus_finality_lang cfl on cf.`id_cookiesplus_finality` = cfl.`id_cookiesplus_finality`
+ WHERE
+ cfl.`id_lang` = ' . ($id_lang ? (int) $id_lang : (int) Context::getContext()->language->id) .
+ ($only_active ? ' AND cf.`active` = 1' : '') .
+ ($include_technical_cookies ? '' : ' AND cf.`technical` = 0') .
+ ' AND cf.`id_shop` = ' . Context::getContext()->shop->id . '
+ ORDER BY `position`;'
+ ;
+
+ $result = Db::getInstance()->executeS($query);
+ Cache::store($cacheKey, $result);
+
+ return $result;
+ }
+
+ return Cache::retrieve($cacheKey);
+ }
+
+ public static function getDefaultValues($cookiesPlusFinality)
+ {
+ $cookiesPlusFinalityDefaultValues = [
+ CookiesPlusFinality::NECESSARY_COOKIE => [
+ 'name' => [
+ 'en' => 'Necessary cookies',
+ 'es' => 'Cookies necesarias',
+ 'ag' => 'Cookies necesarias',
+ 'cb' => 'Cookies necesarias',
+ 'mx' => 'Cookies necesarias',
+ 'fr' => 'Cookies nécessaires',
+ 'qc' => 'Cookies nécessaires',
+ 'pl' => 'Niezbędne',
+ 'ro' => 'Necesare',
+ 'pt' => 'Cookies necessários',
+ 'br' => 'Cookies necessários',
+ 'sk' => 'Potrebné',
+ 'nl' => 'Noodzakelijk',
+ 'de' => 'Notwendig',
+ 'gr' => 'Αναγκαία',
+ 'it' => 'Cookie necessari',
+ 'sv' => 'Nödvändig',
+ 'da' => 'Nødvendig',
+ 'no' => 'Nødvendig',
+ 'cs' => 'Nutné',
+ 'hu' => 'Elengedhetetlen',
+ 'si' => 'Zahtevano',
+ ],
+ 'description' => [
+ 'en' => 'Necessary cookies help make a website usable by enabling basic functions like page navigation and access to secure areas of the website. The website cannot function properly without these cookies.',
+ 'es' => 'Las cookies necesarias ayudan a hacer una página web utilizable activando funciones básicas como la navegación en la página y el acceso a áreas seguras de la página web. La página web no puede funcionar adecuadamente sin estas cookies.',
+ 'ag' => 'Las cookies necesarias ayudan a hacer una página web utilizable activando funciones básicas como la navegación en la página y el acceso a áreas seguras de la página web. La página web no puede funcionar adecuadamente sin estas cookies.',
+ 'cb' => 'Las cookies necesarias ayudan a hacer una página web utilizable activando funciones básicas como la navegación en la página y el acceso a áreas seguras de la página web. La página web no puede funcionar adecuadamente sin estas cookies.',
+ 'mx' => 'Las cookies necesarias ayudan a hacer una página web utilizable activando funciones básicas como la navegación en la página y el acceso a áreas seguras de la página web. La página web no puede funcionar adecuadamente sin estas cookies.',
+ 'fr' => 'Les cookies nécessaires contribuent à rendre un site web utilisable en activant des fonctions de base comme la navigation de page et l\'accès aux zones sécurisées du site web. Le site web ne peut pas fonctionner correctement sans ces cookies.',
+ 'qc' => 'Les cookies nécessaires contribuent à rendre un site web utilisable en activant des fonctions de base comme la navigation de page et l\'accès aux zones sécurisées du site web. Le site web ne peut pas fonctionner correctement sans ces cookies.',
+ 'pl' => 'Niezbędne pliki cookie przyczyniają się do użyteczności strony poprzez umożliwianie podstawowych funkcji takich jak nawigacja na stronie i dostęp do bezpiecznych obszarów strony internetowej. Strona internetowa nie może funkcjonować poprawnie bez tych ciasteczek.',
+ 'ro' => 'Cookie-urile necesare ajută la a face un site utilizabil prin activarea funcţiilor de bază, precum navigarea în pagină şi accesul la zonele securizate de pe site. Site-ul nu poate funcţiona corespunzător fără aceste cookie-uri.',
+ 'pt' => 'Os cookies necessários ajudam a tornar um website útil, permitindo funções básicas, como a navegação e o acesso à página para proteger áreas do website. O website pode não funcionar corretamente sem estes cookies.',
+ 'br' => 'Os cookies necessários ajudam a tornar um website útil, permitindo funções básicas, como a navegação e o acesso à página para proteger áreas do website. O website pode não funcionar corretamente sem estes cookies.',
+ 'sk' => 'Potrebné súbory cookie pomáhajú vytvárať použiteľné webové stránky tak, že umožňujú základné funkcie, ako je navigácia stránky a prístup k chráneným oblastiam webových stránok. Webové stránky nemôžu riadne fungovať bez týchto súborov cookies.',
+ 'nl' => 'Noodzakelijke cookies helpen een website bruikbaarder te maken, door basisfuncties als paginanavigatie en toegang tot beveiligde gedeelten van de website mogelijk te maken. Zonder deze cookies kan de website niet naar behoren werken.',
+ 'de' => 'Notwendige Cookies helfen dabei, eine Webseite nutzbar zu machen, indem sie Grundfunktionen wie Seitennavigation und Zugriff auf sichere Bereiche der Webseite ermöglichen. Die Webseite kann ohne diese Cookies nicht richtig funktionieren.',
+ 'gr' => 'Τα απαραίτητα cookies βοηθούν στο να γίνει χρηστική μία ιστοσελίδα, επιτρέποντας βασικές λειτουργίες όπως την πλοήγηση και την πρόσβαση σε ασφαλείς περιοχές της ιστοσελίδας. Η ιστοσελίδα δεν μπορεί να λειτουργήσει σωστά χωρίς αυτά τα cookies.',
+ 'it' => 'I cookie necessari contribuiscono a rendere fruibile il sito web abilitandone funzionalità di base quali la navigazione sulle pagine e l\'accesso alle aree protette del sito. Il sito web non è in grado di funzionare correttamente senza questi cookie.',
+ 'sv' => 'Nödvändiga cookies låter dig använda webbplatsen genom att aktivera grundläggande funktioner, såsom sidnavigering och åtkomst till säkra områden på webbplatsen. Webbplatsen fungerar inte korrekt utan dessa cookies.',
+ 'da' => 'Nødvendige cookies hjælper med at gøre en hjemmeside brugbar ved at aktivere grundlæggende funktioner såsom side-navigation og adgang til sikre områder af hjemmesiden. Hjemmesiden kan ikke fungere ordentligt uden disse cookies.',
+ 'no' => 'Nødvendige cookies bidra til å gjøre en nettside brukbart ved at grunnleggende funksjoner som side navigasjon og tilgang til sikre områder av nettstedet. Nettstedet kan ikke fungere optimalt uten disse informasjonskapslene.',
+ 'cs' => 'Nutné cookies pomáhají, aby byla webová stránka použitelná tak, že umožní základní funkce jako navigace stránky a přístup k zabezpečeným sekcím webové stránky. Webová stránka nemůže správně fungovat bez těchto cookies.',
+ 'hu' => 'Az elengedhetetlen sütik segítenek használhatóvá tenni a weboldalunkat azáltal, hogy engedélyeznek olyan alapvető funkciókat, mint az oldalon való navigáció és a weboldal biztonságos területeihez való hozzáférés. A weboldal ezen sütik nélkül nem tud megfelelően működni.',
+ 'si' => 'Zahtevani piškotki naredijo spletno stran uporabno, saj omogočajo osnovne funkcije, kot so navigacija po strani in dostop do varnih območij spletne strani. Spletna stran brez teh piškotkov ne deluje pravilno.',
+ ],
+ 'technical' => 1,
+ 'active' => 1,
+ 'modules' => [],
+ 'cookies' => CookiesPlusCookie::getDefaultValues(CookiesPlusFinality::NECESSARY_COOKIE),
+ 'position' => 0,
+ ],
+ CookiesPlusFinality::PREFERENCE_COOKIE => [
+ 'name' => [
+ 'en' => 'Preference cookies',
+ 'es' => 'Cookies de preferencias',
+ 'ag' => 'Cookies de preferencias',
+ 'cb' => 'Cookies de preferencias',
+ 'mx' => 'Cookies de preferencias',
+ 'fr' => 'Cookies de préférences',
+ 'qc' => 'Cookies de préférences',
+ 'pl' => 'Preferencje',
+ 'ro' => 'Preferinţe',
+ 'pt' => 'Cookies de preferência',
+ 'br' => 'Cookies de preferência',
+ 'sk' => 'Preferencie',
+ 'nl' => 'Voorkeuren',
+ 'de' => 'Präferenzen',
+ 'gr' => 'Προτιμήσεις',
+ 'it' => 'Cookie di preferenza',
+ 'sv' => 'Inställningar',
+ 'da' => 'Præferencer',
+ 'no' => 'Egenskaper',
+ 'cs' => 'Preferenční',
+ 'hu' => 'Beállítások',
+ 'si' => 'Nastavitve',
+ ],
+ 'description' => [
+ 'en' => 'Preference cookies enable a website to remember information that changes the way the website behaves or looks, like your preferred language or the region that you are in.',
+ 'es' => 'Las cookies de preferencias permiten a la página web recordar información que cambia la forma en que la página se comporta o el aspecto que tiene, como su idioma preferido o la región en la que usted se encuentra.',
+ 'ag' => 'Las cookies de preferencias permiten a la página web recordar información que cambia la forma en que la página se comporta o el aspecto que tiene, como su idioma preferido o la región en la que usted se encuentra.',
+ 'cb' => 'Las cookies de preferencias permiten a la página web recordar información que cambia la forma en que la página se comporta o el aspecto que tiene, como su idioma preferido o la región en la que usted se encuentra.',
+ 'mx' => 'Las cookies de preferencias permiten a la página web recordar información que cambia la forma en que la página se comporta o el aspecto que tiene, como su idioma preferido o la región en la que usted se encuentra.',
+ 'fr' => 'Les cookies de préférences permettent à un site web de retenir des informations qui modifient la manière dont le site se comporte ou s’affiche, comme votre langue préférée ou la région dans laquelle vous vous situez.',
+ 'qc' => 'Les cookies de préférences permettent à un site web de retenir des informations qui modifient la manière dont le site se comporte ou s’affiche, comme votre langue préférée ou la région dans laquelle vous vous situez.',
+ 'pl' => 'Pliki cookie dotyczące preferencji umożliwiają stronie zapamiętanie informacji, które zmieniają wygląd lub funkcjonowanie strony, np. preferowany język lub region, w którym znajduje się użytkownik.',
+ 'ro' => 'Cookie-urile de preferinţă permit unui site să îşi amintească informaţii care se modifică după modul în care se comportă sau arată site-ul, precum limba dvs. preferată sau regiunea în care vă aflaţi.',
+ 'pt' => 'Os cookies de preferência permitem que um website memorize as informações que mudam o comportamento ou o aspeto do website, como o seu idioma preferido ou a região em que se você encontra.',
+ 'br' => 'Os cookies de preferência permitem que um website memorize as informações que mudam o comportamento ou o aspeto do website, como o seu idioma preferido ou a região em que se você encontra.',
+ 'sk' => 'Preferenčné súbory cookies umožňujú internetovej stránke zapamätať si informácie, ktoré zmenia spôsob, akým sa webová stránka chová alebo vyzerá, ako napr. váš preferovaný jazyk alebo región, v ktorom sa práve nachádzate.',
+ 'nl' => 'Voorkeurscookies zorgen ervoor dat een website informatie kan onthouden die van invloed is op het gedrag en de vormgeving van de website, zoals de taal van uw voorkeur of de regio waar u woont.',
+ 'de' => 'Präferenz-Cookies ermöglichen einer Webseite sich an Informationen zu erinnern, die die Art beeinflussen, wie sich eine Webseite verhält oder aussieht, wie z. B. Ihre bevorzugte Sprache oder die Region in der Sie sich befinden.',
+ 'gr' => 'Τα cookies προτίμησης επιτρέπουν σε μια ιστοσελίδα να θυμάται πληροφορίες που αλλάζουν τον τρόπο που συμπεριφέρεται η ιστοσελίδα ή την εμφάνισή της, όπως την προτιμώμενη γλώσσα ή την περιοχή στην οποία βρίσκεστε',
+ 'it' => 'I cookie di preferenza consentono al sito web di memorizzare informazioni che ne influenzano il comportamento o l\'aspetto, quali la lingua preferita o la località nella quale ti trovi.',
+ 'sv' => 'Cookies för inställningar låter en webbplats komma ihåg information som ändrar hur webbplatsen fungerar eller visas. Detta kan t.ex. vara föredraget språk eller regionen du befinner dig i.',
+ 'da' => 'Præference cookies gør det muligt for en hjemmeside at huske oplysninger, der ændrer den måde hjemmesiden ser ud eller opfører sig på. F.eks. dit foretrukne sprog, eller den region, du befinder dig i.',
+ 'no' => 'Preferanse-cookies gjør et nettsted for å huske informasjon og endrer måten nettsiden oppfører seg eller ser ut, ting som ditt foretrukne språk eller den regionen du befinner deg i.',
+ 'cs' => 'Preferenční cookies umožňují, aby si webová stránka zapamatovala informace, které mění, jak se webová stránka chová nebo jak vypadá. Je to například preferovaný jazyk nebo region, kde se nacházíte.',
+ 'hu' => 'A preferenciális sütik használatával olyan információkat tudunk megjegyezni, amelyek megváltoztatják a weboldal magatartását, illetve kinézetét, erre példa lehet az Ön által előnyben részesített nyelv vagy a régió, amelyben tartózkodik.',
+ 'si' => 'Piškotki za namestitve pomagajo spletni strani, da si ta zapomni informacije, ki spremenijo, na kakšen način se spletna stran obnaša ali izgleda, kot vaš priljubljeni jezik ali regijo, v kateri ste.',
+ ],
+ 'technical' => 0,
+ 'active' => 0,
+ 'modules' => [],
+ 'cookies' => CookiesPlusCookie::getDefaultValues(CookiesPlusFinality::PREFERENCE_COOKIE),
+ 'position' => 1,
+ ],
+ CookiesPlusFinality::STATISTIC_COOKIE => [
+ 'name' => [
+ 'en' => 'Statistic cookies',
+ 'es' => 'Cookies estadísticas',
+ 'ag' => 'Cookies estadísticas',
+ 'cb' => 'Cookies estadísticas',
+ 'mx' => 'Cookies estadísticas',
+ 'fr' => 'Cookies statistiques',
+ 'qc' => 'Cookies statistiques',
+ 'pl' => 'Statystyka',
+ 'ro' => 'Statistici',
+ 'pt' => 'Cookies de estatística',
+ 'br' => 'Cookies de estatística',
+ 'sk' => 'Štatistiky',
+ 'nl' => 'Statistieken',
+ 'de' => 'Statistiken',
+ 'gr' => 'Στατιστικά',
+ 'it' => 'Cookie statistici',
+ 'sv' => 'Statistik',
+ 'da' => 'Statistik',
+ 'no' => 'Statistikk',
+ 'cs' => 'Statistické',
+ 'hu' => 'Statisztikai',
+ 'si' => 'Statistika',
+ ],
+ 'description' => [
+ 'en' => 'Statistic cookies help website owners to understand how visitors interact with websites by collecting and reporting information anonymously.',
+ 'es' => 'Las cookies estadísticas ayudan a los propietarios de páginas web a comprender cómo interactúan los visitantes con las páginas web reuniendo y proporcionando información de forma anónima.',
+ 'ag' => 'Las cookies estadísticas ayudan a los propietarios de páginas web a comprender cómo interactúan los visitantes con las páginas web reuniendo y proporcionando información de forma anónima.',
+ 'cb' => 'Las cookies estadísticas ayudan a los propietarios de páginas web a comprender cómo interactúan los visitantes con las páginas web reuniendo y proporcionando información de forma anónima.',
+ 'mx' => 'Las cookies estadísticas ayudan a los propietarios de páginas web a comprender cómo interactúan los visitantes con las páginas web reuniendo y proporcionando información de forma anónima.',
+ 'fr' => 'Les cookies statistiques aident les propriétaires du site web, par la collecte et la communication d\'informations de manière anonyme, à comprendre comment les visiteurs interagissent avec les sites web.',
+ 'qc' => 'Les cookies statistiques aident les propriétaires du site web, par la collecte et la communication d\'informations de manière anonyme, à comprendre comment les visiteurs interagissent avec les sites web.',
+ 'pl' => 'Statystyczne pliki cookie pomagają właścicielem stron internetowych zrozumieć, w jaki sposób różni użytkownicy zachowują się na stronie, gromadząc i zgłaszając anonimowe informacje.',
+ 'ro' => 'Cookie-urile de statistică îi ajută pe proprietarii unui site să înţeleagă modul în care vizitatorii interacţionează cu site-urile prin colectarea şi raportarea informaţiilor în mod anonim.',
+ 'pt' => 'Os cookies de estatística ajudam os proprietários de websites a entenderem como os visitantes interagem com os websites, recolhendo e divulgando informações de forma anónima.',
+ 'br' => 'Os cookies de estatística ajudam os proprietários de websites a entenderem como os visitantes interagem com os websites, recolhendo e divulgando informações de forma anónima.',
+ 'sk' => 'Štatistické súbory cookies pomáhajú majiteľom webových stránok, aby pochopili, ako komunikovať s návštevníkmi webových stránok prostredníctvom zberu a hlásenia informácií anonymne.',
+ 'nl' => 'Statistische cookies helpen eigenaren van websites begrijpen hoe bezoekers hun website gebruiken, door anoniem gegevens te verzamelen en te rapporteren.',
+ 'de' => 'Statistik-Cookies helfen Webseiten-Besitzern zu verstehen, wie Besucher mit Webseiten interagieren, indem Informationen anonym gesammelt und gemeldet werden.',
+ 'gr' => 'Τα Cookies στατιστικών βοηθούν τους ιδιοκτήτες ιστοχώρου να κατανοήσουν πώς αλληλεπιδρούν οι επισκέπτες με τις σελίδες συλλέγοντας και αναφέροντας πληροφορίες ανώνυμα.',
+ 'it' => 'I cookie statistici aiutano i proprietari del sito web a capire come i visitatori interagiscono con i siti raccogliendo e trasmettendo informazioni in forma anonima.',
+ 'sv' => 'Cookies för statistik hjälper en webbplatsägare att förstå hur besökare interagerar med webbplatser genom att samla och rapportera in information anonymt.',
+ 'da' => 'Statistiske cookies giver hjemmesideejere indsigt i brugernes interaktion med hjemmesiden, ved at indsamle og rapportere oplysninger anonymt.',
+ 'no' => 'Statistikk-cookies hjelper eiere til å forstå hvordan besøkende kommuniserer med nettsteder ved å samle inn og rapportere informasjon anonymt.',
+ 'cs' => 'Statistické cookies pomáhají majitelům webových stránek, aby porozuměli, jak návštěvníci používají webové stránky. Anonymně sbírají a sdělují informace.',
+ 'hu' => 'Az adatok névtelen formában való gyűjtésén és jelentésén keresztül a statisztikai sütik segítenek a weboldal tulajdonosának abban, hogy megértse, hogyan lépnek interakcióba a látogatók a weboldallal.',
+ 'si' => 'Piškotki za statistiko pomagajo lastnikom spletnih strani razumeti, kako obiskovalci uporabljajo spletno stran tako, da anonimno zbirajo in javljajo informacije.',
+ ],
+ 'technical' => 0,
+ 'active' => 0,
+ 'modules' => [
+ 'gapi',
+ 'ganalytics',
+ 'ps_googleanalytics',
+ ],
+ 'cookies' => CookiesPlusCookie::getDefaultValues(CookiesPlusFinality::STATISTIC_COOKIE),
+ 'position' => 2,
+ ],
+ CookiesPlusFinality::MARKETING_COOKIE => [
+ 'name' => [
+ 'en' => 'Marketing cookies',
+ 'es' => 'Cookies de marketing',
+ 'ag' => 'Cookies de marketing',
+ 'cb' => 'Cookies de marketing',
+ 'mx' => 'Cookies de marketing',
+ 'fr' => 'Cookies marketing',
+ 'qc' => 'Cookies marketing',
+ 'pl' => 'Marketing',
+ 'ro' => 'Marketing',
+ 'pt' => 'Cookies de marketing',
+ 'br' => 'Cookies de marketing',
+ 'sk' => 'Marketing',
+ 'nl' => 'Marketing',
+ 'de' => 'Marketing',
+ 'gr' => 'Εμπορικής προώθησης',
+ 'it' => 'Cookie di marketing',
+ 'sv' => 'Marknadsföring',
+ 'da' => 'Marketing',
+ 'no' => 'Markedsføring',
+ 'cs' => 'Marketingové',
+ 'hu' => 'Marketing',
+ 'si' => 'Trženje',
+ ],
+ 'description' => [
+ 'en' => 'Marketing cookies are used to track visitors across websites. The intention is to display ads that are relevant and engaging for the individual user and thereby more valuable for publishers and third party advertisers.',
+ 'es' => 'Las cookies de marketing se utilizan para rastrear a los visitantes en las páginas web. La intención es mostrar anuncios relevantes y atractivos para el usuario individual, y por lo tanto, más valiosos para los editores y terceros anunciantes.',
+ 'ag' => 'Las cookies de marketing se utilizan para rastrear a los visitantes en las páginas web. La intención es mostrar anuncios relevantes y atractivos para el usuario individual, y por lo tanto, más valiosos para los editores y terceros anunciantes.',
+ 'cb' => 'Las cookies de marketing se utilizan para rastrear a los visitantes en las páginas web. La intención es mostrar anuncios relevantes y atractivos para el usuario individual, y por lo tanto, más valiosos para los editores y terceros anunciantes.',
+ 'mx' => 'Las cookies de marketing se utilizan para rastrear a los visitantes en las páginas web. La intención es mostrar anuncios relevantes y atractivos para el usuario individual, y por lo tanto, más valiosos para los editores y terceros anunciantes.',
+ 'fr' => 'Les cookies marketing sont utilisés pour effectuer le suivi des visiteurs au travers des sites web. Le but est d\'afficher des publicités qui sont pertinentes et intéressantes pour l\'utilisateur individuel et donc plus précieuses pour les éditeurs et annonceurs tiers.',
+ 'qc' => 'Les cookies marketing sont utilisés pour effectuer le suivi des visiteurs au travers des sites web. Le but est d\'afficher des publicités qui sont pertinentes et intéressantes pour l\'utilisateur individuel et donc plus précieuses pour les éditeurs et annonceurs tiers.',
+ 'pl' => 'Marketingowe pliki cookie stosowane są w celu śledzenia użytkowników na stronach internetowych. Celem jest wyświetlanie reklam, które są istotne i interesujące dla poszczególnych użytkowników i tym samym bardziej cenne dla wydawców i reklamodawców strony trzeciej.',
+ 'ro' => 'Cookie-urile de marketing sunt utilizate pentru a-i urmări pe utilizatori de la un site la altul. Intenţia este de a afişa anunţuri relevante şi antrenante pentru utilizatorii individuali, aşadar ele sunt mai valoroase pentru agenţiile de puiblicitate şi părţile terţe care se ocupă de publicitate.',
+ 'pt' => 'Os cookies de marketing são utilizados para seguir os visitantes pelos websites. A intenção é exibir anúncios que sejam relevantes e apelativos para o utilizador individual e, logo, mais valiosos para os editores e anunciantes independentes.',
+ 'br' => 'Os cookies de marketing são utilizados para seguir os visitantes pelos websites. A intenção é exibir anúncios que sejam relevantes e apelativos para o utilizador individual e, logo, mais valiosos para os editores e anunciantes independentes.',
+ 'sk' => 'Marketingové súbory cookies sa používajú na sledovanie návštevníkov na webových stránkach. Zámerom je zobrazovať reklamy, ktoré sú relevantné a pútavé pre jednotlivých užívateľov, a tým cennejšie pre vydavateľov a inzerentov tretích strán.',
+ 'nl' => 'Marketingcookies worden gebruikt om bezoekers te volgen wanneer ze verschillende websites bezoeken. Hun doel is advertenties weergeven die zijn toegesneden op en relevant zijn voor de individuele gebruiker. Deze advertenties worden zo waardevoller voor uitgevers en externe adverteerders.',
+ 'de' => 'Marketing-Cookies werden verwendet, um Besuchern auf Webseiten zu folgen. Die Absicht ist, Anzeigen zu zeigen, die relevant und ansprechend für den einzelnen Benutzer sind und daher wertvoller für Publisher und werbetreibende Drittparteien sind.',
+ 'gr' => 'Τα cookies Εμπορικής Προώθησης χρησιμοποιούνται για την παρακολούθηση των επισκεπτών στους ιστότοπους. Η πρόθεση είναι να εμφανίσουμε διαφημίσεις που είναι σχετικές και ελκυστικές για τους χρήστες και ως εκ τούτου πιο πολύτιμες για τρίτους εκδότες και διαφημιστές.',
+ 'it' => 'I cookie di marketing vengono utilizzati per tracciare i visitatori sui siti web. La finalità è quella di presentare annunci pubblicitari che siano rilevanti e coinvolgenti per il singolo utente e quindi di maggior valore per editori e inserzionisti di terze parti.',
+ 'sv' => 'Cookies för marknadsföring används för att spåra besökare på webbplatser. Avsikten är att visa annonser som är relevanta och engagerande för enskilda användare, och därmed mer värdefull för utgivare och tredjepartsannonsörer.',
+ 'da' => 'Marketing cookies bruges til at spore brugere på tværs af websites. Hensigten er at vise annoncer, der er relevante og engagerende for den enkelte bruger, og dermed mere værdifulde for udgivere og tredjeparts-annoncører.',
+ 'no' => 'Markedsførings-cookies brukes til å spore besøkende på nettsteder. Hensikten er å vise annonser som er relevante og engasjerende for den enkelte bruker og dermed mer verdifull for utgivere og tredjeparts annonsører.',
+ 'cs' => 'Marketingové cookies jsou používány pro sledování návštěvníků na webových stránkách. Záměrem je zobrazit reklamu, která je relevantní a zajímavá pro jednotlivého uživatele a tímto hodnotnější pro vydavatele a inzerenty třetích stran.',
+ 'hu' => 'A marketingsütiket a látogatók weboldal-tevékenységének nyomon követésére használjuk. A cél az, hogy releváns hirdetéseket tegyünk közzé az egyéni felhasználók számára, valamint aktivitásra buzdítsuk őket, ez pedig még értékesebbé teszi weboldalunkat a tartalmakat közzétevő és a harmadik fél hirdetők számára.',
+ 'si' => 'Piškotki za trženje se uporabljajo za sledenje uporabnikom prek spletnih strani. Namen je prikazovanje oglasov, ki so primerni in zanimivi za posameznega uporabnika in zato več vredni za založnike in oglaševalce tujih strani.',
+ ],
+ 'technical' => 0,
+ 'active' => 0,
+ 'modules' => ['pspixel', 'facebookconversionpixel', 'criteoonetag', 'cartsguru', 'sendinblue'],
+ 'cookies' => CookiesPlusCookie::getDefaultValues(CookiesPlusFinality::MARKETING_COOKIE),
+ 'position' => 3,
+ ],
+ /*CookiesPlusFinality::UNCLASSIFIED_COOKIE => array(
+ 'name' => array(
+ 'en' => 'Unclassified cookies',
+ 'es' => 'Cookies no clasificadas',
+ 'ag' => 'Cookies no clasificadas',
+ 'cb' => 'Cookies no clasificadas',
+ 'mx' => 'Cookies no clasificadas',
+ 'fr' => 'Cookies non classés',
+ 'qc' => 'Cookies non classés',
+ 'pl' => 'Nieklasyfikowane',
+ 'ro' => 'Neclasificate',
+ 'pt' => 'Cookies não classificados',
+ 'br' => 'Cookies não classificados',
+ 'sk' => 'Nezaradené',
+ 'nl' => 'Niet geclassificeerd',
+ 'de' => 'Nicht klassifiziert',
+ 'gr' => 'Αταξινόμητα',
+ 'it' => 'Cookie non classificati',
+ 'sv' => 'Oklassificerade',
+ 'da' => 'Uklassificeret',
+ 'no' => 'Uklassifisert',
+ 'cs' => 'Neklasifikované',
+ 'hu' => 'Besorolással nem rendelkező'
+
+ ),
+ 'description' => array(
+ 'en' => 'Unclassified cookies are cookies that we are in the process of classifying, together with the providers of individual cookies.',
+ 'es' => 'Las cookies no clasificadas son cookies para las que todavía estamos en proceso de clasificar, junto con los proveedores de cookies individuales.',
+ 'ag' => 'Las cookies no clasificadas son cookies para las que todavía estamos en proceso de clasificar, junto con los proveedores de cookies individuales.',
+ 'cb' => 'Las cookies no clasificadas son cookies para las que todavía estamos en proceso de clasificar, junto con los proveedores de cookies individuales.',
+ 'mx' => 'Las cookies no clasificadas son cookies para las que todavía estamos en proceso de clasificar, junto con los proveedores de cookies individuales.',
+ 'fr' => 'Les cookies non classés sont les cookies qui sont en cours de classification, ainsi que les fournisseurs de cookies individuels.',
+ 'qc' => 'Les cookies non classés sont les cookies qui sont en cours de classification, ainsi que les fournisseurs de cookies individuels.',
+ 'pl' => 'Nieklasyfikowane pliki cookie, to pliki, które są w procesie klasyfikowania, wraz z dostawcami poszczególnych ciasteczek.',
+ 'ro' => 'Cookie-urile neclasificate sunt cookie-uri în curs de clasificare, împreună cu furnizorii de cookie-uri individuale.',
+ 'pt' => 'Os cookies não classificados são cookies que estão em processo de classificação, juntamente com os fornecedores de cookies individuais.',
+ 'br' => 'Os cookies não classificados são cookies que estão em processo de classificação, juntamente com os fornecedores de cookies individuais.',
+ 'sk' => 'Nezaradené súbory cookies sú cookies, ktoré práve zaraďujeme, spoločne s poskytovateľmi jednotlivých súborov cookies.',
+ 'nl' => 'Niet-geclassificeerde cookies zijn cookies die we nog aan het classificeren zijn, samen met de aanbieders van afzonderlijke cookies.',
+ 'de' => 'Nicht klassifizierte Cookies sind Cookies, die wir gerade versuchen zu klassifizieren, zusammen mit Anbietern von individuellen Cookies.',
+ 'gr' => 'Τα αταξινόμητα cookies είναι τα cookies που είναι σε στάδιο ταξινόμησης, από κοινού με τους παρόχους μεμονωμένων cookies.',
+ 'it' => 'I cookie non classificati sono i cookie che sono in fase di classificazione, insieme ai fornitori di cookie individuali.',
+ 'sv' => 'Oklassificerade cookies är cookies som håller på att klassificeras tillsammans med utfärdarna av enskilda cookies.',
+ 'da' => 'Uklassificerede cookies er cookies, som vi er i færd med at klassificere sammen med udbyderne af de enkelte cookies.',
+ 'no' => 'Uklassifiserte cookies er informasjonskapsler som vi er i ferd med å klassifisere, sammen med leverandørene av enkelte cookies.',
+ 'cs' => 'Neklasifikované cookies jsou cookies, které máme v procesu klasifikování společně s poskytovateli jednotlivých cookies.',
+ 'hu' => 'A besorolással nem rendelkező sütik olyan sütik, amelyek még besorolás alatt állnak, az egyéni sütik szolgáltatóival együtt.'
+ ),
+ 'technical' => 0,
+ 'active' => 0,
+ 'modules' => array(),
+ 'cookies' => CookiesPlusCookie::getDefaultValues(CookiesPlusFinality::UNCLASSIFIED_COOKIE)
+ ),*/
+ /*CookiesPlusFinality::PERFORMANCE_COOKIE => array(
+ 'name' => array(
+ 'en' => 'Performance cookies',
+ 'es' => 'Cookies de rendimiento',
+ 'ag' => 'Cookies de rendimiento',
+ 'cb' => 'Cookies de rendimiento',
+ 'mx' => 'Cookies de rendimiento',
+ 'fr' => 'Cookies de performance',
+ 'qc' => 'Cookies de performance',
+ 'pl' => 'Wydajnościowe pliki cookie',
+ 'ro' => 'Cookie-uri de performanță',
+ 'pt' => 'Cookies de desempenho',
+ 'br' => 'Cookies de desempenho',
+ 'sk' => 'Výkonové cookies',
+ 'nl' => 'Prestatiecookies',
+ 'de' => 'Leistungscookies',
+ 'gr' => 'Cookies απόδοσης',
+ 'it' => 'Cookie di prestazione',
+ 'sv' => 'Izvedbeni piškotki',
+ 'da' => 'Performance-cookies',
+ 'no' => 'Ytelse informasjonskapsler',
+ 'cs' => 'Výkonnostní cookies',
+ 'hu' => 'Teljesítmény-sütik'
+ ),
+ 'description' => array(
+ 'en' => 'Cookies used specifically for gathering data on how visitors use a website, which pages of a website are visited most often, or if they get error messages on web pages. These cookies monitor only the performance of the site as the user interacts with it. These cookies don’t collect identifiable information on visitors, which means all the data collected is anonymous and only used to improve the functionality of a website.',
+ 'es' => 'Cookies que se utilizan específicamente para recopilar datos sobre cómo los visitantes utilizan un sitio web, qué páginas de un sitio web se visitan con más frecuencia o si reciben mensajes de error en las páginas web. Estas cookies controlan solo el rendimiento del sitio cuando el usuario interactúa con él. Estas cookies no recopilan información identificable sobre los visitantes, lo que significa que todos los datos recopilados son anónimos y solo se utilizan para mejorar la funcionalidad de un sitio web.',
+ 'ag' => 'Cookies que se utilizan específicamente para recopilar datos sobre cómo los visitantes utilizan un sitio web, qué páginas de un sitio web se visitan con más frecuencia o si reciben mensajes de error en las páginas web. Estas cookies controlan solo el rendimiento del sitio cuando el usuario interactúa con él. Estas cookies no recopilan información identificable sobre los visitantes, lo que significa que todos los datos recopilados son anónimos y solo se utilizan para mejorar la funcionalidad de un sitio web.',
+ 'cb' => 'Cookies que se utilizan específicamente para recopilar datos sobre cómo los visitantes utilizan un sitio web, qué páginas de un sitio web se visitan con más frecuencia o si reciben mensajes de error en las páginas web. Estas cookies controlan solo el rendimiento del sitio cuando el usuario interactúa con él. Estas cookies no recopilan información identificable sobre los visitantes, lo que significa que todos los datos recopilados son anónimos y solo se utilizan para mejorar la funcionalidad de un sitio web.',
+ 'mx' => 'Cookies que se utilizan específicamente para recopilar datos sobre cómo los visitantes utilizan un sitio web, qué páginas de un sitio web se visitan con más frecuencia o si reciben mensajes de error en las páginas web. Estas cookies controlan solo el rendimiento del sitio cuando el usuario interactúa con él. Estas cookies no recopilan información identificable sobre los visitantes, lo que significa que todos los datos recopilados son anónimos y solo se utilizan para mejorar la funcionalidad de un sitio web.',
+ 'fr' => 'Cookies utilisés spécifiquement pour collecter des données sur la façon dont les visiteurs utilisent un site Web, quelles pages d\'un site Web sont visitées le plus souvent ou s\'ils reçoivent des messages d\'erreur sur les pages Web. Ces cookies surveillent uniquement les performances du site lorsque l\'utilisateur interagit avec lui. Ces cookies ne collectent pas d\'informations identifiables sur les visiteurs, ce qui signifie que toutes les données collectées sont anonymes et utilisées uniquement pour améliorer la fonctionnalité d\'un site Web.',
+ 'qc' => 'Cookies utilisés spécifiquement pour collecter des données sur la façon dont les visiteurs utilisent un site Web, quelles pages d\'un site Web sont visitées le plus souvent ou s\'ils reçoivent des messages d\'erreur sur les pages Web. Ces cookies surveillent uniquement les performances du site lorsque l\'utilisateur interagit avec lui. Ces cookies ne collectent pas d\'informations identifiables sur les visiteurs, ce qui signifie que toutes les données collectées sont anonymes et utilisées uniquement pour améliorer la fonctionnalité d\'un site Web.',
+ 'pl' => 'Pliki cookie używane specjalnie do gromadzenia danych o tym, w jaki sposób odwiedzający korzystają ze strony internetowej, które strony witryny są odwiedzane najczęściej lub czy otrzymują komunikaty o błędach na stronach internetowych. Te pliki cookie monitorują tylko działanie witryny w trakcie interakcji użytkownika z nią. Te pliki cookie nie zbierają informacji umożliwiających identyfikację odwiedzających, co oznacza, że wszystkie gromadzone dane są anonimowe i służą wyłącznie do poprawy funkcjonalności strony internetowej.',
+ 'ro' => 'Cookie-urile utilizate în mod special pentru colectarea datelor despre modul în care vizitatorii folosesc un site web, ce pagini ale unui site web sunt vizitate cel mai des sau dacă primesc mesaje de eroare pe paginile web. Aceste cookie-uri monitorizează doar performanța site-ului pe măsură ce utilizatorul interacționează cu acesta. Aceste cookie-uri nu colectează informații de identificare ale vizitatorilor, ceea ce înseamnă că toate datele colectate sunt anonime și sunt utilizate numai pentru a îmbunătăți funcționalitatea unui site web.',
+ 'pt' => 'Cookies usados especificamente para coletar dados sobre como os visitantes usam um site, quais páginas de um site são visitadas com mais frequência ou se eles recebem mensagens de erro em páginas da web. Esses cookies monitoram apenas o desempenho do site à medida que o usuário interage com ele. Esses cookies não coletam informações identificáveis sobre os visitantes, o que significa que todos os dados coletados são anônimos e usados apenas para melhorar a funcionalidade de um site.',
+ 'br' => 'Cookies usados especificamente para coletar dados sobre como os visitantes usam um site, quais páginas de um site são visitadas com mais frequência ou se eles recebem mensagens de erro em páginas da web. Esses cookies monitoram apenas o desempenho do site à medida que o usuário interage com ele. Esses cookies não coletam informações identificáveis sobre os visitantes, o que significa que todos os dados coletados são anônimos e usados apenas para melhorar a funcionalidade de um site.',
+ 'sk' => 'Súbory cookie používané špeciálne na zhromažďovanie údajov o tom, ako návštevníci používajú webovú stránku, ktoré stránky webovej stránky sú navštevované najčastejšie alebo či sa im na webových stránkach zobrazujú chybové správy. Tieto súbory cookie monitorujú iba výkonnosť stránok pri interakcii používateľa s nimi. Tieto súbory cookie nezhromažďujú identifikovateľné informácie o návštevníkoch, čo znamená, že všetky zhromaždené údaje sú anonymné a slúžia iba na zlepšenie funkčnosti webových stránok.',
+ 'nl' => 'Cookies die specifiek worden gebruikt voor het verzamelen van gegevens over hoe bezoekers een website gebruiken, welke pagina\'s van een website het vaakst worden bezocht of of ze foutmeldingen krijgen op webpagina\'s. Deze cookies controleren alleen de prestaties van de site terwijl de gebruiker ermee communiceert. Deze cookies verzamelen geen identificeerbare informatie over bezoekers, wat betekent dat alle verzamelde gegevens anoniem zijn en alleen worden gebruikt om de functionaliteit van een website te verbeteren.',
+ 'de' => 'Cookies, die speziell zum Sammeln von Daten darüber verwendet werden, wie Besucher eine Website nutzen, welche Seiten einer Website am häufigsten besucht werden oder ob sie auf Webseiten Fehlermeldungen erhalten. Diese Cookies überwachen nur die Leistung der Website, während der Benutzer mit ihr interagiert. Diese Cookies sammeln keine identifizierbaren Informationen über Besucher. Dies bedeutet, dass alle gesammelten Daten anonym sind und nur zur Verbesserung der Funktionalität einer Website verwendet werden.',
+ 'gr' => 'Cookies που χρησιμοποιούνται ειδικά για τη συλλογή δεδομένων σχετικά με τον τρόπο με τον οποίο οι επισκέπτες χρησιμοποιούν έναν ιστότοπο, ποιες σελίδες ενός ιστότοπου επισκέπτονται συχνότερα ή αν λαμβάνουν μηνύματα σφάλματος σε ιστοσελίδες. Αυτά τα cookie παρακολουθούν μόνο την απόδοση του ιστότοπου καθώς ο χρήστης αλληλεπιδρά με αυτόν. Αυτά τα cookie δεν συλλέγουν αναγνωρίσιμες πληροφορίες για τους επισκέπτες, πράγμα που σημαίνει ότι όλα τα δεδομένα που συλλέγονται είναι ανώνυμα και χρησιμοποιούνται μόνο για τη βελτίωση της λειτουργικότητας ενός ιστότοπου.',
+ 'it' => 'Cookie utilizzati specificamente per raccogliere dati su come i visitatori utilizzano un sito web, quali pagine di un sito web vengono visitate più spesso o se ricevono messaggi di errore sulle pagine web. Questi cookie monitorano solo le prestazioni del sito mentre l\'utente interagisce con esso. Questi cookie non raccolgono informazioni identificabili sui visitatori, il che significa che tutti i dati raccolti sono anonimi e utilizzati solo per migliorare la funzionalità di un sito web.',
+ 'sv' => 'Piškotki, ki se uporabljajo posebej za zbiranje podatkov o tem, kako obiskovalci uporabljajo spletno mesto, katere strani spletnega mesta so najpogosteje obiskane ali če na spletnih straneh dobijo sporočila o napakah. Ti piškotki spremljajo samo delovanje strani, saj uporabnik z njo sodeluje. Ti piškotki ne zbirajo prepoznavnih podatkov o obiskovalcih, kar pomeni, da so vsi zbrani podatki anonimni in se uporabljajo samo za izboljšanje funkcionalnosti spletnega mesta.',
+ 'da' => 'Cookies, der specifikt bruges til at indsamle data om, hvordan besøgende bruger et websted, hvilke sider på et websted der besøges oftest, eller hvis de får fejlmeddelelser på websider. Disse cookies overvåger kun webstedets ydeevne, da brugeren interagerer med det. Disse cookies indsamler ikke identificerbare oplysninger om besøgende, hvilket betyder, at alle de indsamlede data er anonyme og kun bruges til at forbedre funktionaliteten på et websted.',
+ 'no' => 'Informasjonskapsler som brukes spesielt for å samle inn data om hvordan besøkende bruker et nettsted, hvilke sider på et nettsted som besøkes oftest, eller hvis de får feilmeldinger på websider. Disse informasjonskapslene overvåker bare ytelsen til nettstedet når brukeren kommuniserer med det. Disse informasjonskapslene samler ikke inn identifiserbar informasjon om besøkende, noe som betyr at all innsamlet data er anonym og kun brukes til å forbedre funksjonaliteten til et nettsted.',
+ 'cs' => 'Soubory cookie používané konkrétně pro shromažďování údajů o tom, jak návštěvníci používají web, které stránky webu jsou navštěvovány nejčastěji, nebo zda se jim na webových stránkách zobrazují chybové zprávy. Tyto soubory cookie sledují pouze výkonnost webu při interakci uživatele s ním. Tyto soubory cookie neshromažďují identifikovatelné informace o návštěvnících, což znamená, že všechna shromážděná data jsou anonymní a slouží pouze ke zlepšení funkčnosti webových stránek.',
+ 'hu' => 'A cookie-k kifejezetten arra szolgálnak, hogy adatokat gyűjtsenek arról, hogy a látogatók hogyan használnak egy webhelyet, a webhely mely oldalait látogatják meg leggyakrabban, vagy ha hibaüzeneteket kapnak a weboldalakon. Ezek a sütik csak a webhely teljesítményét figyelik, miközben a felhasználó interakcióba lép vele. Ezek a cookie-k nem gyűjtenek azonosítható információkat a látogatókról, ami azt jelenti, hogy az összes összegyűjtött adat névtelen és csak egy weboldal funkcionalitásának javítására szolgál.'
+ ),
+ 'technical' => 0,
+ 'active' => 0,
+ 'modules' => array(),
+ 'cookies' => CookiesPlusCookie::getDefaultValues(CookiesPlusFinality::PERFORMANCE_COOKIE)
+ ),*/
+ ];
+
+ if (isset($cookiesPlusFinalityDefaultValues[$cookiesPlusFinality])) {
+ return $cookiesPlusFinalityDefaultValues[$cookiesPlusFinality];
+ }
+
+ return [];
+ }
+
+ public static function getFinalityNameCallback($value)
+ {
+ $cookiesPlusFinality = new CookiesPlusFinality($value);
+
+ return $cookiesPlusFinality->name[(int) Context::getContext()->language->id];
+ }
+
+ public static function getFinalityDescriptionCallback($value)
+ {
+ return Tools::strlen($value) > 200 ? Tools::substr($value, 0, 200) . '...' : $value;
+ }
+
+ public function updatePosition($way, $position)
+ {
+ $res = Db::getInstance()->executeS(
+ 'SELECT `id_cookiesplus_finality`, `position`
+ FROM `' . _DB_PREFIX_ . 'cookiesplus_finality`
+ ORDER BY `position` ASC;'
+ );
+
+ if (!$res) {
+ return false;
+ }
+
+ foreach ($res as $obj) {
+ if ((int) $obj['id_cookiesplus_finality'] == (int) $this->id) {
+ $moved = $obj;
+ }
+ }
+
+ if (!isset($moved)) {
+ return false;
+ }
+
+ // < and > statements rather than BETWEEN operator
+ // since BETWEEN is treated differently according to databases
+ return Db::getInstance()->execute('
+ UPDATE `' . _DB_PREFIX_ . 'cookiesplus_finality`
+ SET `position`= `position` ' . ($way ? '- 1' : '+ 1') . '
+ WHERE `position`
+ ' . ($way
+ ? '> ' . (int) $moved['position'] . ' AND `position` <= ' . (int) $position
+ : '< ' . (int) $moved['position'] . ' AND `position` >= ' . (int) $position))
+ && Db::getInstance()->execute('
+ UPDATE `' . _DB_PREFIX_ . 'cookiesplus_finality`
+ SET `position` = ' . (int) $position . '
+ WHERE `id_cookiesplus_finality` = ' . (int) $moved['id_cookiesplus_finality']);
+ }
+
+ public static function getHigherPosition()
+ {
+ $sql = 'SELECT MAX(`position`)
+ FROM `' . _DB_PREFIX_ . 'cookiesplus_finality`';
+
+ $position = DB::getInstance()->getValue($sql);
+
+ return (is_numeric($position)) ? $position : -1;
+ }
+}
diff --git a/modules/cookiesplus/classes/CookiesPlusIdnovateValidation.php b/modules/cookiesplus/classes/CookiesPlusIdnovateValidation.php
new file mode 100644
index 00000000..3b8dd461
--- /dev/null
+++ b/modules/cookiesplus/classes/CookiesPlusIdnovateValidation.php
@@ -0,0 +1,46 @@
+ 'cookiesplus_user_consent',
+ 'primary' => 'id_cookiesplus_user_consent',
+ 'fields' => [
+ 'id_cookiesplus_user_consent' => ['type' => self::TYPE_INT, 'validate' => 'isUnsignedId', 'copy_post' => false],
+ 'id_shop' => ['type' => self::TYPE_INT, 'validate' => 'isUnsignedId', 'copy_post' => false],
+ 'hash' => ['type' => self::TYPE_STRING, 'required' => true],
+ 'data' => ['type' => self::TYPE_STRING, 'required' => true],
+ 'date' => ['type' => self::TYPE_STRING, 'required' => true],
+ 'ip' => ['type' => self::TYPE_STRING, 'required' => true],
+ 'date_add' => ['type' => self::TYPE_DATE, 'validate' => 'isDate', 'copy_post' => false],
+ ],
+ ];
+
+ public function add($autodate = true, $null_values = false)
+ {
+ $this->id_shop = ($this->id_shop) ?: Context::getContext()->shop->id;
+
+ return parent::add($autodate, $null_values);
+ }
+
+ public static function getCookiesPlusUserConsentExpired($shopId)
+ {
+ if (!Configuration::get('C_P_EXPIRY')) {
+ return [];
+ }
+
+ $query = "SHOW TABLES LIKE '" . _DB_PREFIX_ . "cookiesplus_user_consent'";
+
+ if (Db::getInstance()->executeS($query)) {
+ $query = 'SELECT `id_cookiesplus_user_consent`
+ FROM ' . _DB_PREFIX_ . 'cookiesplus_user_consent
+ WHERE id_shop = ' . (int) $shopId . '
+ AND `date_add` < NOW() - INTERVAL ' . Configuration::get('C_P_EXPIRY') * 24 . ' HOUR;'
+ ;
+
+ return Db::getInstance()->executeS($query);
+ }
+
+ return [];
+ }
+
+ public static function getCookiesPlusUserConsentDataByHash($hash)
+ {
+ $query = 'SELECT `data`
+ FROM `' . _DB_PREFIX_ . "cookiesplus_user_consent`
+ WHERE `hash` = '" . pSQL($hash) . "'";
+
+ return Db::getInstance()->getValue($query);
+ }
+}
diff --git a/modules/cookiesplus/classes/HTMLTemplateCookiesPlusModule.php b/modules/cookiesplus/classes/HTMLTemplateCookiesPlusModule.php
new file mode 100644
index 00000000..def2ba12
--- /dev/null
+++ b/modules/cookiesplus/classes/HTMLTemplateCookiesPlusModule.php
@@ -0,0 +1,134 @@
+cookiesPlusData = $cookiesPlusData;
+ $this->smarty = $smarty;
+ $this->context = Context::getContext();
+
+ $this->shop = new Shop((int) Context::getContext()->shop->id);
+ }
+
+ /**
+ * Returns the template's HTML footer
+ *
+ * @return string HTML footer
+ *
+ * @throws SmartyException
+ */
+ public function getFooter()
+ {
+ $shop_address = $this->getShopAddress();
+ $this->smarty->assign([
+ 'available_in_your_account' => false,
+ 'shop_address' => $shop_address,
+ 'shop_fax' => Configuration::get('PS_SHOP_FAX'),
+ 'shop_phone' => Configuration::get('PS_SHOP_PHONE'),
+ 'shop_details' => Configuration::get('PS_SHOP_DETAILS'),
+ 'free_text' => '',
+ ]);
+
+ return $this->smarty->fetch($this->getTemplate('footer'));
+ }
+
+ /**
+ * Returns the template's HTML content
+ *
+ * @return string HTML content
+ *
+ * @throws SmartyException
+ */
+ public function getContent()
+ {
+ // Generate smarty data
+ $this->smarty->assign([
+ 'info' => $this->cookiesPlusData['info'],
+ 'finalities' => $this->cookiesPlusData['cookiesPlusFinalities'],
+ ]);
+
+ // Generate templates after, to be able to reuse data above
+ $this->smarty->assign([
+ 'style' => $this->smarty->fetch($this->getCookiesPlusTemplate('style')),
+ 'info' => $this->smarty->fetch($this->getCookiesPlusTemplate('info')),
+ 'finalities' => $this->smarty->fetch($this->getCookiesPlusTemplate('finalities')),
+ ]);
+
+ return $this->smarty->fetch($this->getCookiesPlusTemplate('consent'));
+ }
+
+ /**
+ * Returns the template filename
+ *
+ * @return string filename
+ */
+ public function getFilename()
+ {
+ return _PS_MODULE_DIR_ . 'cookiesplus/consent/' . $this->cookiesPlusData['info']['consent_hash'] . '.pdf';
+ }
+
+ /**
+ * Returns the template filename
+ *
+ * @return string filename
+ */
+ public function getBulkFilename()
+ {
+ return _PS_MODULE_DIR_ . 'cookiesplus/consent/' . $this->cookiesPlusData['info']['consent_hash'] . '.pdf';
+ }
+
+ /**
+ * If the template is not present in the theme directory, it will return the default template
+ * in _PS_PDF_DIR_ directory
+ *
+ * @param string $template_name
+ *
+ * @return string
+ */
+ protected function getCookiesPlusTemplate($template_name)
+ {
+ return _PS_MODULE_DIR_ . 'cookiesplus/views/templates/front/pdf/' . $template_name . '.tpl';
+ }
+}
diff --git a/modules/cookiesplus/classes/index.php b/modules/cookiesplus/classes/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/classes/index.php
@@ -0,0 +1,32 @@
+
+
+ cookiesplus
+
+
+
+
+
+
+ 1
+ 0
+
+
\ No newline at end of file
diff --git a/modules/cookiesplus/controllers/admin/AdminCookiesPlusAppearanceController.php b/modules/cookiesplus/controllers/admin/AdminCookiesPlusAppearanceController.php
new file mode 100644
index 00000000..2def6cef
--- /dev/null
+++ b/modules/cookiesplus/controllers/admin/AdminCookiesPlusAppearanceController.php
@@ -0,0 +1,1086 @@
+bootstrap = true;
+ $this->tabClassName = 'AdminCookiesPlusAppearance';
+
+ parent::__construct();
+
+ if (Shop::isFeatureActive() && (Shop::getContext() == Shop::CONTEXT_ALL || Shop::getContext() == Shop::CONTEXT_GROUP)) {
+ $this->isShopSelected = false;
+ }
+
+ $this->shopLinkType = 'shop';
+ }
+
+ public function setMedia($isNewTheme = false)
+ {
+ parent::setMedia($isNewTheme);
+
+ // Codemirror
+ $this->addCSS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/lib/codemirror.css');
+ $this->addCSS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/theme/monokai.css');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/lib/codemirror.js');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/addon/display/autorefresh.js');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/mode/css/css.js');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/mode/javascript/javascript.js');
+
+ // Tabs
+ if (version_compare(_PS_VERSION_, '1.6', '<')) {
+ $this->addCSS(_MODULE_DIR_ . $this->module->name . '/views/css/tabs.css');
+ }
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/views/js/tabs.js');
+
+ $this->addCSS(_MODULE_DIR_ . $this->module->name . '/views/css/cookiesplus-back.css');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/views/js/cookiesplus-back.js');
+ }
+
+ public function initContent()
+ {
+ if (!$this->isShopSelected && !$this->display) {
+ $this->errors[] = $this->l('You have to select a shop.');
+
+ parent::initContent();
+
+ return;
+ }
+
+ if (version_compare($this->module->version, $this->module->getDatabaseVersion(), '>')) {
+ return $this->errors[] = $this->l('Upgrade available');
+ }
+
+ if ($this->isShopSelected
+ && (
+ (version_compare(_PS_VERSION_, '1.5.0.13', '<')
+ && !Module::isInstalled($this->module->name))
+ || (version_compare(_PS_VERSION_, '1.5.0.13', '>=')
+ && !Module::isEnabled($this->module->name))
+ )
+ ) {
+ $this->warnings[] = $this->l('Module is not enabled in this shop.');
+ }
+
+ if ($warnings = $this->module->getWarnings(false)) {
+ $this->warnings[] = $warnings;
+ }
+
+ if (((bool) Tools::isSubmit('submitCookiesPlusModuleUpdate')) == true) {
+ Configuration::deleteByName('C_P_UPDATE');
+ }
+
+ if (((bool) Tools::isSubmit('submitCookiesPlusModule')) == true) {
+ $fields = $this->getConfigFormValues();
+
+ $colorFields = [
+ 'C_P_BACKGROUND_COLOR',
+ 'C_P_FONT_COLOR',
+ 'C_P_ACCEPT_BACKGROUND_COLOR',
+ 'C_P_ACCEPT_BORDER_COLOR',
+ 'C_P_ACCEPT_FONT_COLOR',
+ 'C_P_MORE_INFO_BACKGROUND_COLOR',
+ 'C_P_MORE_INFO_BORDER_COLOR',
+ 'C_P_MORE_INFO_FONT_COLOR',
+ 'C_P_REJECT_BACKGROUND_COLOR',
+ 'C_P_REJECT_BORDER_COLOR',
+ 'C_P_REJECT_FONT_COLOR',
+ 'C_P_SAVE_BACKGROUND_COLOR',
+ 'C_P_SAVE_BORDER_COLOR',
+ 'C_P_SAVE_FONT_COLOR',
+ ];
+
+ foreach ($colorFields as $colorField) {
+ if ($fields[$colorField]) {
+ $_POST[$colorField] = $fields[$colorField] = strpos($fields[$colorField], '#') !== 0 ? '#' . $fields[$colorField] : $fields[$colorField];
+ if (!preg_match('/#([a-f0-9]{3}){1,2}\b/i', $fields[$colorField])) {
+ $this->errors[] = sprintf($this->l('Property %s is not valid'), $fields[$colorField]);
+ }
+ }
+ }
+
+ if (!count($this->errors)) {
+ foreach (array_keys($fields) as $key) {
+ Configuration::updateValue($key, $fields[$key], true);
+ }
+
+ $this->confirmations[] = $this->l('Settings saved successfully');
+ }
+ }
+
+ $this->content .= $this->renderGlobalConfigForm();
+ $this->content .= $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/disclaimer.tpl');
+
+ if (version_compare(_PS_VERSION_, '1.6', '>=')) {
+ $module = $this->module;
+
+ $default_iso_code = 'en';
+ $local_path = $module->getLocalPath();
+
+ $readme = null;
+ if (file_exists($local_path . '/readme_' . $this->context->language->iso_code . '.pdf')) {
+ $readme = 'readme_' . $this->context->language->iso_code . '.pdf';
+ } elseif (file_exists($local_path . '/readme_' . $default_iso_code . '.pdf')) {
+ $readme = 'readme_' . $default_iso_code . '.pdf';
+ }
+
+ $this->context->smarty->assign([
+ 'support_id' => $module->addons_id_product,
+ 'readme' => $readme,
+ 'this_path' => $module->getPathUri(),
+ ]);
+
+ if (file_exists($local_path . '/views/templates/admin/company/information_' . $this->context->language->iso_code . '.tpl')) {
+ $this->content .= $this->context->smarty->fetch($local_path . '/views/templates/admin/company/information_' . $this->context->language->iso_code . '.tpl');
+ } elseif (file_exists($local_path . '/views/templates/admin/company/information_' . $default_iso_code . '.tpl')) {
+ $this->content .= $this->context->smarty->fetch($local_path . '/views/templates/admin/company/information_' . $default_iso_code . '.tpl');
+ }
+ }
+
+ parent::initContent();
+ }
+
+ public function initToolbar()
+ {
+ parent::initToolbar();
+
+ unset($this->toolbar_btn['new']);
+ }
+
+ public function initPageHeaderToolbar()
+ {
+ parent::initPageHeaderToolbar();
+
+ if (empty($this->display)) {
+ /*$this->page_header_toolbar_btn['desc-module-new'] = array(
+ 'href' => 'index.php?controller='.$this->tabClassName.'&add'.$this->table.'&token='.Tools::getAdminTokenLite($this->tabClassName),
+ 'desc' => $this->l('New'),
+ 'icon' => 'process-icon-new'
+ );*/
+ $this->page_header_toolbar_btn['desc-module-translate'] = [
+ 'href' => '#',
+ 'desc' => $this->l('Translate'),
+ 'modal_target' => '#moduleTradLangSelect',
+ 'icon' => 'process-icon-flag',
+ ];
+
+ $this->page_header_toolbar_btn['desc-module-hook'] = [
+ 'href' => 'index.php?tab=AdminModulesPositions&token=' . Tools::getAdminTokenLite('AdminModulesPositions') . '&show_modules=' . Module::getModuleIdByName($this->module->name),
+ 'desc' => $this->l('Manage hooks'),
+ 'icon' => 'process-icon-anchor',
+ ];
+ }
+
+ if (!$this->isShopSelected) {
+ unset($this->page_header_toolbar_btn['desc-module-new']);
+ }
+
+ $this->context->smarty->clearAssign('help_link', '');
+ }
+
+ public function initModal()
+ {
+ parent::initModal();
+
+ $languages = Language::getLanguages(false);
+ $translateLinks = [];
+
+ if (version_compare(_PS_VERSION_, '1.7.2.1', '>=')) {
+ $module = Module::getInstanceByName($this->module->name);
+ $isNewTranslateSystem = $module->isUsingNewTranslationSystem();
+ $link = Context::getContext()->link;
+ foreach ($languages as $lang) {
+ if ($isNewTranslateSystem) {
+ $translateLinks[$lang['iso_code']] = $link->getAdminLink('AdminTranslationSf', true, [
+ 'lang' => $lang['iso_code'],
+ 'type' => 'modules',
+ 'selected' => $module->name,
+ 'locale' => $lang['locale'],
+ ]);
+ } else {
+ $translateLinks[$lang['iso_code']] = $link->getAdminLink('AdminTranslations', true, [], [
+ 'type' => 'modules',
+ 'module' => $module->name,
+ 'lang' => $lang['iso_code'],
+ ]);
+ }
+ }
+ }
+
+ $this->context->smarty->assign([
+ 'trad_link' => 'index.php?tab=AdminTranslations&token=' . Tools::getAdminTokenLite('AdminTranslations') . '&type=modules&module=' . $this->module->name . '&lang=',
+ 'module_languages' => $languages,
+ 'module_name' => $this->module->name,
+ 'translateLinks' => $translateLinks,
+ ]);
+
+ $modal_content = $this->context->smarty->fetch('controllers/modules/modal_translation.tpl');
+
+ $this->modals[] = [
+ 'modal_id' => 'moduleTradLangSelect',
+ 'modal_class' => 'modal-sm',
+ 'modal_title' => $this->l('Translate this module'),
+ 'modal_content' => $modal_content,
+ ];
+ }
+
+ protected function renderGlobalConfigForm()
+ {
+ $helper = new HelperForm();
+ $helper->show_toolbar = false;
+ $helper->module = $this->module;
+ $helper->default_form_language = $this->context->language->id;
+ $helper->allow_employee_form_lang = Configuration::get('PS_BO_ALLOW_EMPLOYEE_FORM_LANG', 0);
+ $helper->identifier = $this->identifier;
+ $helper->currentIndex = self::$currentIndex;
+ $helper->submit_action = 'submitCookiesPlusModule';
+ $helper->token = Tools::getAdminTokenLite($this->tabClassName);
+
+ $helper->tpl_vars = [
+ 'fields_value' => array_merge($this->getConfigFormValues(), $this->getConfigFormTPLs()),
+ 'languages' => $this->context->controller->getLanguages(),
+ 'id_language' => $this->context->language->id,
+ ];
+
+ return $helper->generateForm($this->getConfigForm());
+ }
+
+ protected function getConfigForm()
+ {
+ $fields_form = [];
+
+ if (Configuration::get('C_P_UPDATE')) {
+ $fieldsFormIndex = 0;
+ $fields_form[$fieldsFormIndex]['form'] = [
+ 'legend' => [
+ 'title' => $this->l('Warning'),
+ 'icon' => 'icon-warning',
+ ],
+ 'input' => [
+ [
+ 'col' => 12,
+ 'type' => 'html',
+ 'label' => '',
+ 'name' => $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/C_P_UPDATE_MSG.tpl'),
+ ],
+ ],
+ 'submit' => [
+ 'title' => $this->l('Understood'),
+ 'type' => 'submit',
+ 'name' => 'submitCookiesPlusModuleUpdate',
+ ],
+ ];
+
+ return $fields_form;
+ }
+
+ $cms = CMS::listCms($this->context->language->id);
+ $dummyElement = [
+ 'id_cms' => 0,
+ 'meta_title' => $this->l('- Do not display any link -'),
+ ];
+
+ array_unshift($cms, $dummyElement);
+
+ $fieldsFormIndex = 0;
+ $fields_form[$fieldsFormIndex]['form'] = [
+ 'legend' => [
+ 'title' => $this->l('Banner\'s appearance'),
+ 'icon' => 'icon-pencil',
+ ],
+ 'input' => [
+ /*[
+ 'type' => (version_compare(_PS_VERSION_, '1.6', '>=')) ? 'switch' : 'radio',
+ 'label' => $this->l('Banner title'),
+ 'name' => 'C_P_DISPLAY_TITLE',
+ 'class' => 't',
+ 'is_bool' => true,
+ 'values' => [
+ [
+ 'id' => 'C_P_DISPLAY_TITLE_on',
+ 'value' => 1,
+ 'label' => $this->l('Yes'), ],
+ [
+ 'id' => 'C_P_DISPLAY_TITLE_off',
+ 'value' => 0,
+ 'label' => $this->l('No'), ],
+ ],
+ ],
+ [
+ 'cols' => 90,
+ 'rows' => 5,
+ 'type' => 'textarea',
+ 'label' => $this->l('Banner title'),
+ 'name' => 'C_P_TITLE',
+ 'lang' => true,
+ 'autoload_rte' => version_compare(_PS_VERSION_, '1.6', '>=') ? '' : true,
+ 'class' => version_compare(_PS_VERSION_, '1.6', '>=') ? 'cp_tiny' : 't',
+ ],
+ [
+ 'col' => 8,
+ 'type' => 'html',
+ 'label' => '',
+ 'name' => $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/C_P_TITLE_MSG.tpl'),
+ ],*/
+ [
+ 'cols' => 90,
+ 'rows' => 5,
+ 'col' => 8,
+ 'type' => 'textarea',
+ 'label' => $this->l('Banner body text'),
+ 'name' => 'C_P_TEXT_BASIC',
+ 'lang' => true,
+ 'required' => true,
+ 'autoload_rte' => version_compare(_PS_VERSION_, '1.6', '>=') ? '' : true,
+ 'class' => version_compare(_PS_VERSION_, '1.6', '>=') ? 'cp_tiny' : 't',
+ ],
+
+ [
+ 'col' => 6,
+ 'type' => 'html',
+ 'label' => '',
+ 'name' => $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/C_P_DISPLAY_TEXT.tpl'),
+ ],
+ [
+ 'type' => 'select',
+ 'label' => $this->l('Display a link to the cookies policy CMS'),
+ 'name' => 'C_P_CMS_PAGE',
+ 'class' => 't',
+ 'options' => [
+ 'query' => $cms,
+ 'id' => 'id_cms',
+ 'name' => 'meta_title',
+ ],
+ ],
+ [
+ 'col' => 6,
+ 'type' => 'html',
+ 'label' => '',
+ 'name' => $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/C_P_DISPLAY_LINK.tpl'),
+ ],
+ /*array(
+ 'col' => 5,
+ 'type' => 'text',
+ 'label' => $this->l('"Accept only selected cookies" button padding'),
+ 'name' => 'C_P_SAVE_PADDING',
+ 'desc' => $this->l('Example').':'.' 10px 10px 5px 10px 5px 20px 5px 0.5rem 1rem'
+ ),*/
+ [
+ 'type' => (version_compare(_PS_VERSION_, '1.6', '>=')) ? 'switch' : 'radio',
+ 'label' => $this->l('Display the date when the cookie information was updated'),
+ 'name' => 'C_P_DISPLAY_DATE',
+ 'class' => 't',
+ 'is_bool' => true,
+ 'values' => [
+ [
+ 'id' => 'C_P_DISPLAY_DATE_on',
+ 'value' => 1,
+ 'label' => $this->l('Yes'), ],
+ [
+ 'id' => 'C_P_DISPLAY_DATE_off',
+ 'value' => 0,
+ 'label' => $this->l('No'), ],
+ ],
+ ],
+ [
+ 'col' => 6,
+ 'type' => 'html',
+ 'label' => '',
+ 'name' => $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/C_P_DISPLAY_DATE.tpl'),
+ ],
+ [
+ 'type' => 'color',
+ 'label' => $this->l('Background color'),
+ 'name' => 'C_P_BACKGROUND_COLOR',
+ 'size' => 20,
+ ],
+ [
+ 'type' => 'color',
+ 'label' => $this->l('Font color'),
+ 'name' => 'C_P_FONT_COLOR',
+ 'size' => 20,
+ ],
+ [
+ 'col' => 8,
+ 'type' => 'html',
+ 'label' => $this->l('Position'),
+ 'name' => $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/C_P_POSITION.tpl'),
+ ],
+ [
+ 'col' => 8,
+ 'type' => 'html',
+ 'label' => $this->l('Width'),
+ 'name' => $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/C_P_WIDTH.tpl'),
+ ],
+ [
+ 'type' => (version_compare(_PS_VERSION_, '1.6', '>=')) ? 'switch' : 'radio',
+ 'label' => $this->l('Display overlay'),
+ 'name' => 'C_P_OVERLAY',
+ 'class' => 't',
+ 'is_bool' => true,
+ 'values' => [
+ [
+ 'id' => 'C_P_OVERLAY_on',
+ 'value' => 1,
+ 'label' => $this->l('Yes'), ],
+ [
+ 'id' => 'C_P_OVERLAY_off',
+ 'value' => 0,
+ 'label' => $this->l('No'), ],
+ ],
+ ],
+ [
+ 'type' => 'select',
+ 'label' => $this->l('Overlay opacity'),
+ 'name' => 'C_P_OVERLAY_OPACITY',
+ 'class' => 't',
+ 'col' => '2',
+ 'options' => [
+ 'query' => [
+ [
+ 'id' => '1',
+ 'name' => '1 (darkest)',
+ ],
+ [
+ 'id' => '0.9',
+ 'name' => '0.9',
+ ],
+ [
+ 'id' => '0.8',
+ 'name' => '0.8',
+ ],
+ [
+ 'id' => '0.7',
+ 'name' => '0.7',
+ ],
+ [
+ 'id' => '0.6',
+ 'name' => '0.6',
+ ],
+ [
+ 'id' => '0.5',
+ 'name' => '0.5',
+ ],
+ [
+ 'id' => '0.4',
+ 'name' => '0.4',
+ ],
+ [
+ 'id' => '0.3',
+ 'name' => '0.3',
+ ],
+ [
+ 'id' => '0.2',
+ 'name' => '0.2',
+ ],
+ [
+ 'id' => '0.1',
+ 'name' => '0.1',
+ ],
+ [
+ 'id' => '0',
+ 'name' => '0 (lightest)',
+ ],
+ ],
+ 'id' => 'id',
+ 'name' => 'name',
+ ],
+ ],
+ [
+ 'col' => 8,
+ 'type' => 'html',
+ 'label' => '',
+ 'name' => $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/C_P_OVERLAY_MSG.tpl'),
+ ],
+ ],
+ 'submit' => [
+ 'title' => $this->l('Save'),
+ 'type' => 'submit',
+ 'name' => 'submitCookiesPlusModule',
+ ],
+ ];
+
+ ++$fieldsFormIndex;
+ $fields_form[$fieldsFormIndex]['form'] = [
+ 'legend' => [
+ 'title' => $this->l('Button settings'),
+ 'icon' => 'icon-pencil',
+ ],
+ 'input' => [
+ [
+ 'type' => 'html',
+ 'name' => 'html',
+ 'html_content' => '' . $this->l('Button "Accept cookies"') . '',
+ ],
+ [
+ 'type' => 'color',
+ 'label' => $this->l('Background color'),
+ 'name' => 'C_P_ACCEPT_BACKGROUND_COLOR',
+ 'size' => 20,
+ ],
+ [
+ 'type' => 'color',
+ 'label' => $this->l('Border color'),
+ 'name' => 'C_P_ACCEPT_BORDER_COLOR',
+ 'size' => 20,
+ ],
+ [
+ 'type' => 'color',
+ 'label' => $this->l('Font color'),
+ 'name' => 'C_P_ACCEPT_FONT_COLOR',
+ 'size' => 20,
+ ],
+ [
+ 'type' => 'select',
+ 'label' => $this->l('Font size'),
+ 'name' => 'C_P_ACCEPT_FONT_SIZE',
+ 'class' => 't fixed-width-sm',
+ 'options' => [
+ 'query' => [
+ [
+ 'id' => '10px',
+ 'name' => '10px',
+ ],
+ [
+ 'id' => '12px',
+ 'name' => '12px',
+ ],
+ [
+ 'id' => '14px',
+ 'name' => '14px',
+ ],
+ [
+ 'id' => '16px',
+ 'name' => '16px',
+ ],
+ [
+ 'id' => '18px',
+ 'name' => '18px',
+ ],
+ [
+ 'id' => '20px',
+ 'name' => '20px',
+ ],
+ [
+ 'id' => '22px',
+ 'name' => '22px',
+ ],
+ [
+ 'id' => '24px',
+ 'name' => '24px',
+ ],
+ ],
+ 'id' => 'id',
+ 'name' => 'name',
+ ],
+ ],
+ /*array(
+ 'col' => 2,
+ 'type' => 'text',
+ 'label' => $this->l('"Accept all cookies" button padding'),
+ 'name' => 'C_P_ACCEPT_PADDING',
+ 'desc' => $this->l('Example').':'.' 10px 10px 5px 10px 5px 20px 5px 0.5rem 1rem'
+ ),*/
+ /*array(
+ 'type' => version_compare(_PS_VERSION_, '1.6', '>=') ? 'switch' : 'radio',
+ 'label' => $this->l('Display "Configure" button'),
+ 'name' => 'C_P_MORE_INFO_DISPLAY',
+ 'class' => 't',
+ 'is_bool' => true,
+ 'values' => array(
+ array(
+ 'id' => 'C_P_MORE_INFO_DISPLAY_on',
+ 'value' => 1,
+ 'label' => $this->l('Enabled')
+ ),
+ array(
+ 'id' => 'C_P_MORE_INFO_DISPLAY_off',
+ 'value' => 0,
+ 'label' => $this->l('Disabled')
+ )
+ )
+ ),*/
+ [
+ 'type' => 'html',
+ 'name' => 'html',
+ 'html_content' => '',
+ ],
+
+ [
+ 'type' => 'html',
+ 'name' => 'html',
+ 'html_content' => '' . $this->l('Button "Reject cookies"') . '',
+ ],
+ [
+ 'type' => version_compare(_PS_VERSION_, '1.6', '>=') ? 'switch' : 'radio',
+ 'label' => $this->l('Display the button in the first layer'),
+ 'name' => 'C_P_REJECT_DISPLAY',
+ 'class' => 't',
+ 'is_bool' => true,
+ 'values' => [
+ [
+ 'id' => 'C_P_REJECT_DISPLAY_on',
+ 'value' => 1,
+ 'label' => $this->l('Yes'),
+ ],
+ [
+ 'id' => 'C_P_REJECT_DISPLAY_off',
+ 'value' => 0,
+ 'label' => $this->l('No'),
+ ],
+ ],
+ ],
+ [
+ 'type' => 'color',
+ 'label' => $this->l('Background color'),
+ 'name' => 'C_P_REJECT_BACKGROUND_COLOR',
+ 'size' => 20,
+ ],
+ [
+ 'type' => 'color',
+ 'label' => $this->l('Border color'),
+ 'name' => 'C_P_REJECT_BORDER_COLOR',
+ 'size' => 20,
+ ],
+ [
+ 'type' => 'color',
+ 'label' => $this->l('Font color'),
+ 'name' => 'C_P_REJECT_FONT_COLOR',
+ 'size' => 20,
+ ],
+ [
+ 'type' => 'select',
+ 'label' => $this->l('Font size'),
+ 'name' => 'C_P_REJECT_FONT_SIZE',
+ 'class' => 't fixed-width-sm',
+ 'options' => [
+ 'query' => [
+ [
+ 'id' => '10px',
+ 'name' => '10px',
+ ],
+ [
+ 'id' => '12px',
+ 'name' => '12px',
+ ],
+ [
+ 'id' => '14px',
+ 'name' => '14px',
+ ],
+ [
+ 'id' => '16px',
+ 'name' => '16px',
+ ],
+ [
+ 'id' => '18px',
+ 'name' => '18px',
+ ],
+ [
+ 'id' => '20px',
+ 'name' => '20px',
+ ],
+ [
+ 'id' => '22px',
+ 'name' => '22px',
+ ],
+ [
+ 'id' => '24px',
+ 'name' => '24px',
+ ],
+ ],
+ 'id' => 'id',
+ 'name' => 'name',
+ ],
+ ],
+ /*array(
+ 'col' => 2,
+ 'type' => 'text',
+ 'label' => $this->l('"Accept only essential cookies" button padding'),
+ 'name' => 'C_P_REJECT_PADDING',
+ 'desc' => $this->l('Example').':'.' 10px 10px 5px 10px 5px 20px 5px 0.5rem 1rem'
+ ),*/
+ [
+ 'type' => 'html',
+ 'name' => 'html',
+ 'html_content' => '',
+ ],
+ [
+ 'type' => 'html',
+ 'name' => 'html',
+ 'html_content' => '' . $this->l('Button "Customize"') . '',
+ ],
+ [
+ 'type' => 'color',
+ 'label' => $this->l('Background color'),
+ 'name' => 'C_P_MORE_INFO_BACKGROUND_COLOR',
+ 'size' => 20,
+ ],
+ [
+ 'type' => 'color',
+ 'label' => $this->l('Border color'),
+ 'name' => 'C_P_MORE_INFO_BORDER_COLOR',
+ 'size' => 20,
+ ],
+ [
+ 'type' => 'color',
+ 'label' => $this->l('Font color'),
+ 'name' => 'C_P_MORE_INFO_FONT_COLOR',
+ 'size' => 20,
+ ],
+ [
+ 'type' => 'select',
+ 'label' => $this->l('Font size'),
+ 'name' => 'C_P_MORE_INFO_FONT_SIZE',
+ 'class' => 't fixed-width-sm',
+ 'options' => [
+ 'query' => [
+ [
+ 'id' => '10px',
+ 'name' => '10px',
+ ],
+ [
+ 'id' => '12px',
+ 'name' => '12px',
+ ],
+ [
+ 'id' => '14px',
+ 'name' => '14px',
+ ],
+ [
+ 'id' => '16px',
+ 'name' => '16px',
+ ],
+ [
+ 'id' => '18px',
+ 'name' => '18px',
+ ],
+ [
+ 'id' => '20px',
+ 'name' => '20px',
+ ],
+ [
+ 'id' => '22px',
+ 'name' => '22px',
+ ],
+ [
+ 'id' => '24px',
+ 'name' => '24px',
+ ],
+ ],
+ 'id' => 'id',
+ 'name' => 'name',
+ ],
+ ],
+ /*array(
+ 'col' => 2,
+ 'type' => 'text',
+ 'label' => $this->l('"Configure" button padding'),
+ 'name' => 'C_P_MORE_INFO_PADDING',
+ 'desc' => $this->l('Example').':'.' 10px 10px 5px 10px 5px 20px 5px 0.5rem 1rem'
+ ),*/
+ /*array(
+ 'type' => version_compare(_PS_VERSION_, '1.6', '>=') ? 'switch' : 'radio',
+ 'label' => $this->l('Display "Accept only essential cookies" button'),
+ 'name' => 'C_P_REJECT_DISPLAY',
+ 'class' => 't',
+ 'is_bool' => true,
+ 'values' => array(
+ array(
+ 'id' => 'C_P_REJECT_DISPLAY_on',
+ 'value' => 1,
+ 'label' => $this->l('Enabled')
+ ),
+ array(
+ 'id' => 'C_P_REJECT_DISPLAY_off',
+ 'value' => 0,
+ 'label' => $this->l('Disabled')
+ )
+ )
+ ),*/
+ [
+ 'type' => 'html',
+ 'name' => 'html',
+ 'html_content' => '',
+ ],
+ [
+ 'type' => 'html',
+ 'name' => 'html',
+ 'html_content' => '' . $this->l('Button "Save my preferences" (displayed in the 2nd layer)') . '',
+ ],
+ [
+ 'type' => 'color',
+ 'label' => $this->l('Background color'),
+ 'name' => 'C_P_SAVE_BACKGROUND_COLOR',
+ 'size' => 20,
+ ],
+ [
+ 'type' => 'color',
+ 'label' => $this->l('Border color'),
+ 'name' => 'C_P_SAVE_BORDER_COLOR',
+ 'size' => 20,
+ ],
+ [
+ 'type' => 'color',
+ 'label' => $this->l('Font color'),
+ 'name' => 'C_P_SAVE_FONT_COLOR',
+ 'size' => 20,
+ ],
+ [
+ 'type' => 'select',
+ 'label' => $this->l('Font size'),
+ 'name' => 'C_P_SAVE_FONT_SIZE',
+ 'class' => 't fixed-width-sm',
+ 'options' => [
+ 'query' => [
+ [
+ 'id' => '10px',
+ 'name' => '10px',
+ ],
+ [
+ 'id' => '12px',
+ 'name' => '12px',
+ ],
+ [
+ 'id' => '14px',
+ 'name' => '14px',
+ ],
+ [
+ 'id' => '16px',
+ 'name' => '16px',
+ ],
+ [
+ 'id' => '18px',
+ 'name' => '18px',
+ ],
+ [
+ 'id' => '20px',
+ 'name' => '20px',
+ ],
+ [
+ 'id' => '22px',
+ 'name' => '22px',
+ ],
+ [
+ 'id' => '24px',
+ 'name' => '24px',
+ ],
+ ],
+ 'id' => 'id',
+ 'name' => 'name',
+ ],
+ ],
+ [
+ 'type' => 'html',
+ 'name' => 'html',
+ 'html_content' => '',
+ ],
+ [
+ 'type' => (version_compare(_PS_VERSION_, '1.6', '>=')) ? 'switch' : 'radio',
+ 'label' => $this->l('Display icons in the buttons'),
+ 'name' => 'C_P_ICONS',
+ 'class' => 't',
+ 'is_bool' => true,
+ 'values' => [
+ [
+ 'id' => 'C_P_ICONS_on',
+ 'value' => 1,
+ 'label' => $this->l('Yes'), ],
+ [
+ 'id' => 'C_P_ICONS_off',
+ 'value' => 0,
+ 'label' => $this->l('No'), ],
+ ],
+ ],
+ [
+ 'type' => (version_compare(_PS_VERSION_, '1.6', '>=')) ? 'switch' : 'radio',
+ 'label' => $this->l('Display the cookies finalities disabled by default in the 2nd layer (when customizing the consent)'),
+ 'name' => 'C_P_DEFAULT_CONSENT',
+ 'class' => 't',
+ 'is_bool' => true,
+ 'values' => [
+ [
+ 'id' => 'C_P_DEFAULT_CONSENT_on',
+ 'value' => 1,
+ 'label' => $this->l('Yes'), ],
+ [
+ 'id' => 'C_P_DEFAULT_CONSENT_off',
+ 'value' => 0,
+ 'label' => $this->l('No'), ],
+ ],
+ 'desc' => $this->l('Deactivating this option may potentially be in violation of the law')
+ ],
+ ],
+ 'submit' => [
+ 'title' => $this->l('Save'),
+ 'type' => 'submit',
+ 'name' => 'submitCookiesPlusModule',
+ ],
+ ];
+
+ ++$fieldsFormIndex;
+ $fields_form[$fieldsFormIndex]['form'] = [
+ 'legend' => [
+ 'title' => $this->l('Icon always visible'),
+ 'icon' => 'icon-pencil',
+ ],
+ 'input' => [
+ [
+ 'type' => (version_compare(_PS_VERSION_, '1.6', '>=')) ? 'switch' : 'radio',
+ 'label' => $this->l('Display an icon'),
+ 'name' => 'C_P_TAB_ENABLED',
+ 'class' => 't',
+ 'is_bool' => true,
+ 'values' => [
+ [
+ 'id' => 'C_P_TAB_ENABLED_on',
+ 'value' => 1,
+ 'label' => $this->l('Yes'), ],
+ [
+ 'id' => 'C_P_TAB_ENABLED_off',
+ 'value' => 0,
+ 'label' => $this->l('No'), ],
+ ],
+ 'desc' => $this->l('Display a small icon that enables your customers to check or update their given consent.')
+ ],
+ [
+ 'col' => 8,
+ 'type' => 'html',
+ 'label' => $this->l('Position'),
+ 'name' => $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/C_P_TAB_POSITION.tpl'),
+ ],
+ [
+ 'type' => 'color',
+ 'label' => $this->l('Background color'),
+ 'name' => 'C_P_TAB_BACKGROUND_COLOR',
+ 'size' => 20,
+ ],
+ [
+ 'type' => 'color',
+ 'label' => $this->l('Font color'),
+ 'name' => 'C_P_TAB_FONT_COLOR',
+ 'size' => 20,
+ ],
+ ],
+ 'submit' => [
+ 'title' => $this->l('Save'),
+ 'type' => 'submit',
+ 'name' => 'submitCookiesPlusModule',
+ ],
+ ];
+
+ return $fields_form;
+ }
+
+ protected function getConfigFormValues()
+ {
+ $fields = [];
+
+ $configFields = [
+ 'C_P_CMS_PAGE',
+ 'C_P_POSITION',
+ 'C_P_WIDTH',
+ 'C_P_MODE',
+ 'C_P_OVERLAY',
+ 'C_P_OVERLAY_OPACITY',
+ 'C_P_BACKGROUND_COLOR',
+ 'C_P_FONT_COLOR',
+ 'C_P_BUTTON_POSITION',
+ 'C_P_ACCEPT_DISPLAY',
+ 'C_P_ACCEPT_BACKGROUND_COLOR',
+ 'C_P_ACCEPT_BORDER_COLOR',
+ 'C_P_ACCEPT_FONT_COLOR',
+ 'C_P_ACCEPT_FONT_SIZE',
+ 'C_P_ACCEPT_PADDING',
+ 'C_P_MORE_INFO_DISPLAY',
+ 'C_P_MORE_INFO_BACKGROUND_COLOR',
+ 'C_P_MORE_INFO_BORDER_COLOR',
+ 'C_P_MORE_INFO_FONT_COLOR',
+ 'C_P_MORE_INFO_FONT_SIZE',
+ 'C_P_MORE_INFO_PADDING',
+ 'C_P_REJECT_DISPLAY',
+ 'C_P_REJECT_BACKGROUND_COLOR',
+ 'C_P_REJECT_BORDER_COLOR',
+ 'C_P_REJECT_FONT_COLOR',
+ 'C_P_REJECT_FONT_SIZE',
+ 'C_P_REJECT_PADDING',
+ 'C_P_SAVE_BACKGROUND_COLOR',
+ 'C_P_SAVE_BORDER_COLOR',
+ 'C_P_SAVE_FONT_COLOR',
+ 'C_P_SAVE_FONT_SIZE',
+ 'C_P_SAVE_PADDING',
+ 'C_P_DISPLAY_TITLE',
+ 'C_P_DISPLAY_DATE',
+ 'C_P_TITLE',
+ 'C_P_ICONS',
+ 'C_P_DEFAULT_CONSENT',
+ 'C_P_TAB_ENABLED',
+ 'C_P_TAB_POSITION',
+ 'C_P_TAB_BACKGROUND_COLOR',
+ 'C_P_TAB_FONT_COLOR',
+ ];
+
+ foreach ($configFields as $field) {
+ $fields[$field] = Tools::getValue($field, Configuration::get($field));
+ }
+
+ $configFields = [
+ 'C_P_TITLE',
+ 'C_P_TEXT_BASIC',
+ ];
+
+ $languages = Language::getLanguages(false);
+ foreach ($languages as $lang) {
+ foreach ($configFields as $field) {
+ $fields[$field][$lang['id_lang']] = Tools::getValue(
+ $field . '_' . $lang['id_lang'],
+ Configuration::get($field, $lang['id_lang'])
+ );
+ }
+ }
+
+ return $fields;
+ }
+
+ protected function getConfigFormTPLs()
+ {
+ $fields = [];
+
+ $this->context->smarty->assign([
+ 'this_path' => $this->module->getPathUri(),
+ 'support_id' => $this->module->addons_id_product,
+ 'C_P_POSITION' => Configuration::get('C_P_POSITION'),
+ 'C_P_WIDTH' => Configuration::get('C_P_WIDTH'),
+ 'C_P_TAB_POSITION' => Configuration::get('C_P_TAB_POSITION'),
+ ]);
+
+ return $fields;
+ }
+}
diff --git a/modules/cookiesplus/controllers/admin/AdminCookiesPlusConfigurationController.php b/modules/cookiesplus/controllers/admin/AdminCookiesPlusConfigurationController.php
new file mode 100644
index 00000000..905fa850
--- /dev/null
+++ b/modules/cookiesplus/controllers/admin/AdminCookiesPlusConfigurationController.php
@@ -0,0 +1,632 @@
+bootstrap = true;
+ $this->tabClassName = 'AdminCookiesPlusConfiguration';
+
+ parent::__construct();
+
+ if (Shop::isFeatureActive() && (Shop::getContext() == Shop::CONTEXT_ALL || Shop::getContext() == Shop::CONTEXT_GROUP)) {
+ $this->isShopSelected = false;
+ }
+
+ $this->shopLinkType = 'shop';
+ }
+
+ public function setMedia($isNewTheme = false)
+ {
+ parent::setMedia($isNewTheme);
+
+ // CodeMirror
+ $this->addCSS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/lib/codemirror.css');
+ $this->addCSS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/theme/monokai.css');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/lib/codemirror.js');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/addon/display/autorefresh.js');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/mode/css/css.js');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/mode/javascript/javascript.js');
+
+ // Shepherd
+ if (version_compare(_PS_VERSION_, '1.6', '<')) {
+ Configuration::updateValue('C_P_SHEPHERD', 1);
+ }
+
+ if (!Configuration::get('C_P_SHEPHERD')) {
+ Configuration::updateValue('C_P_SHEPHERD', 1);
+
+ $this->context->smarty->assign([
+ 'C_P_SHEPHERD_STEP1_1' => $this->l('A new menu has been added to configure the Cookies module.') . '\n\r' . $this->l('Please check all the options before enable it.'),
+ ]);
+
+ echo $this->context->smarty->fetch($this->module->getLocalPath() . 'lib/shepherd/shepherd.tpl');
+
+ $this->addCSS(_MODULE_DIR_ . $this->module->name . '/lib/shepherd/shepherd.css');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/shepherd/shepherd.js');
+ }
+
+ // Tabs
+ if (version_compare(_PS_VERSION_, '1.6', '<')) {
+ $this->addCSS(_MODULE_DIR_ . $this->module->name . '/views/css/tabs.css');
+ }
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/views/js/tabs.js');
+
+ $this->addCSS(_MODULE_DIR_ . $this->module->name . '/views/css/cookiesplus-back.css');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/views/js/cookiesplus-back.js');
+ }
+
+ public function initContent()
+ {
+ if (!$this->isShopSelected && !$this->display) {
+ $this->errors[] = $this->l('You have to select a shop.');
+
+ parent::initContent();
+
+ return;
+ }
+
+ if (version_compare($this->module->version, $this->module->getDatabaseVersion(), '>')) {
+ return $this->errors[] = $this->l('Upgrade available');
+ }
+
+ if ($this->isShopSelected
+ && (
+ (version_compare(_PS_VERSION_, '1.5.0.13', '<')
+ && !Module::isInstalled($this->module->name))
+ || (version_compare(_PS_VERSION_, '1.5.0.13', '>=')
+ && !Module::isEnabled($this->module->name))
+ )
+ ) {
+ $this->warnings[] = $this->l('Module is not enabled in this shop.');
+ }
+
+ if ($warnings = $this->module->getWarnings(false)) {
+ $this->warnings[] = $warnings;
+ }
+
+ if (((bool) Tools::isSubmit('submitCookiesPlusModuleUpdate')) == true) {
+ Configuration::deleteByName('C_P_UPDATE');
+ }
+
+ if (((bool) Tools::isSubmit('submitCookiesPlusModule')) == true) {
+ $fields = $this->getConfigFormValues();
+
+ if (!Tools::getValue('C_P_EXPIRY')) {
+ $this->errors[] = $this->l('You have to introduce the cookie expiry time');
+ } elseif (Tools::getValue('C_P_EXPIRY') <= 0
+ || !Validate::isUnsignedInt(Tools::getValue('C_P_EXPIRY'))) {
+ $this->errors[] = $this->l('You have to introduce a correct value for cookie expiry time');
+ }
+
+ foreach (explode('|', Tools::getValue('C_P_IPS')) as $ip) {
+ if ($ip && !filter_var($ip, FILTER_VALIDATE_IP)) {
+ $this->errors[] = sprintf($this->l('Property %s is not valid'), $ip);
+ }
+ }
+
+ if (!count($this->errors)) {
+ foreach (array_keys($fields) as $key) {
+ if ($key === 'C_P_BOTS'
+ || $key === 'C_P_IPS') {
+ $fields[$key] = trim(preg_replace('/\|+/', '|', $fields[$key]), '|');
+ Configuration::updateValue($key, $fields[$key]);
+ } else {
+ Configuration::updateValue($key, $fields[$key], true);
+ }
+ }
+
+ $this->confirmations[] = $this->l('Settings saved successfully');
+ }
+ }
+
+ $this->content .= $this->renderGlobalConfigForm();
+ $this->content .= $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/disclaimer.tpl');
+
+ if (version_compare(_PS_VERSION_, '1.6', '>=')) {
+ $module = $this->module;
+
+ $default_iso_code = 'en';
+ $local_path = $module->getLocalPath();
+
+ $readme = null;
+ if (file_exists($local_path . '/readme_' . $this->context->language->iso_code . '.pdf')) {
+ $readme = 'readme_' . $this->context->language->iso_code . '.pdf';
+ } elseif (file_exists($local_path . '/readme_' . $default_iso_code . '.pdf')) {
+ $readme = 'readme_' . $default_iso_code . '.pdf';
+ }
+
+ $this->context->smarty->assign([
+ 'support_id' => $module->addons_id_product,
+ 'readme' => $readme,
+ 'this_path' => $module->getPathUri(),
+ ]);
+
+ if (file_exists($local_path . '/views/templates/admin/company/information_' . $this->context->language->iso_code . '.tpl')) {
+ $this->content .= $this->context->smarty->fetch($local_path . '/views/templates/admin/company/information_' . $this->context->language->iso_code . '.tpl');
+ } elseif (file_exists($local_path . '/views/templates/admin/company/information_' . $default_iso_code . '.tpl')) {
+ $this->content .= $this->context->smarty->fetch($local_path . '/views/templates/admin/company/information_' . $default_iso_code . '.tpl');
+ }
+ }
+
+ parent::initContent();
+ }
+
+ public function initToolbar()
+ {
+ parent::initToolbar();
+
+ unset($this->toolbar_btn['new']);
+ }
+
+ public function initPageHeaderToolbar()
+ {
+ parent::initPageHeaderToolbar();
+
+ if (empty($this->display)) {
+ /*$this->page_header_toolbar_btn['desc-module-new'] = array(
+ 'href' => 'index.php?controller='.$this->tabClassName.'&add'.$this->table.'&token='.Tools::getAdminTokenLite($this->tabClassName),
+ 'desc' => $this->l('New'),
+ 'icon' => 'process-icon-new'
+ );*/
+ $this->page_header_toolbar_btn['desc-module-translate'] = [
+ 'href' => '#',
+ 'desc' => $this->l('Translate'),
+ 'modal_target' => '#moduleTradLangSelect',
+ 'icon' => 'process-icon-flag',
+ ];
+
+ $this->page_header_toolbar_btn['desc-module-hook'] = [
+ 'href' => 'index.php?tab=AdminModulesPositions&token=' . Tools::getAdminTokenLite('AdminModulesPositions') . '&show_modules=' . Module::getModuleIdByName($this->module->name),
+ 'desc' => $this->l('Manage hooks'),
+ 'icon' => 'process-icon-anchor',
+ ];
+ }
+
+ if (!$this->isShopSelected) {
+ unset($this->page_header_toolbar_btn['desc-module-new']);
+ }
+
+ $this->context->smarty->clearAssign('help_link', '');
+ }
+
+ public function initModal()
+ {
+ parent::initModal();
+
+ $languages = Language::getLanguages(false);
+ $translateLinks = [];
+
+ if (version_compare(_PS_VERSION_, '1.7.2.1', '>=')) {
+ $module = Module::getInstanceByName($this->module->name);
+ $isNewTranslateSystem = $module->isUsingNewTranslationSystem();
+ $link = Context::getContext()->link;
+ foreach ($languages as $lang) {
+ if ($isNewTranslateSystem) {
+ $translateLinks[$lang['iso_code']] = $link->getAdminLink('AdminTranslationSf', true, [
+ 'lang' => $lang['iso_code'],
+ 'type' => 'modules',
+ 'selected' => $module->name,
+ 'locale' => $lang['locale'],
+ ]);
+ } else {
+ $translateLinks[$lang['iso_code']] = $link->getAdminLink('AdminTranslations', true, [], [
+ 'type' => 'modules',
+ 'module' => $module->name,
+ 'lang' => $lang['iso_code'],
+ ]);
+ }
+ }
+ }
+
+ $this->context->smarty->assign([
+ 'trad_link' => 'index.php?tab=AdminTranslations&token=' . Tools::getAdminTokenLite('AdminTranslations') . '&type=modules&module=' . $this->module->name . '&lang=',
+ 'module_languages' => $languages,
+ 'module_name' => $this->module->name,
+ 'translateLinks' => $translateLinks,
+ ]);
+
+ $modal_content = $this->context->smarty->fetch('controllers/modules/modal_translation.tpl');
+
+ $this->modals[] = [
+ 'modal_id' => 'moduleTradLangSelect',
+ 'modal_class' => 'modal-sm',
+ 'modal_title' => $this->l('Translate this module'),
+ 'modal_content' => $modal_content,
+ ];
+ }
+
+ protected function renderGlobalConfigForm()
+ {
+ $helper = new HelperForm();
+ $helper->show_toolbar = false;
+ $helper->module = $this->module;
+ $helper->default_form_language = $this->context->language->id;
+ $helper->allow_employee_form_lang = Configuration::get('PS_BO_ALLOW_EMPLOYEE_FORM_LANG', 0);
+ $helper->identifier = $this->identifier;
+ $helper->currentIndex = self::$currentIndex;
+ $helper->submit_action = 'submitCookiesPlusModule';
+ $helper->token = Tools::getAdminTokenLite($this->tabClassName);
+
+ $helper->tpl_vars = [
+ 'fields_value' => array_merge($this->getConfigFormValues(), $this->getConfigFormTPLs()),
+ 'languages' => $this->context->controller->getLanguages(),
+ 'id_language' => $this->context->language->id,
+ ];
+
+ return $helper->generateForm($this->getConfigForm());
+ }
+
+ protected function getConfigForm()
+ {
+ $fields_form = [];
+
+ if (Configuration::get('C_P_UPDATE')) {
+ $fieldsFormIndex = 0;
+ $fields_form[$fieldsFormIndex]['form'] = [
+ 'legend' => [
+ 'title' => $this->l('Warning'),
+ 'icon' => 'icon-warning',
+ ],
+ 'input' => [
+ [
+ 'col' => 12,
+ 'type' => 'html',
+ 'label' => '',
+ 'name' => $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/C_P_UPDATE_MSG.tpl'),
+ ],
+ ],
+ 'submit' => [
+ 'title' => $this->l('Understood'),
+ 'type' => 'submit',
+ 'name' => 'submitCookiesPlusModuleUpdate',
+ ],
+ ];
+
+ return $fields_form;
+ }
+
+ $fieldsFormIndex = 0;
+ $fields_form[$fieldsFormIndex]['form'] = [
+ 'legend' => [
+ 'title' => $this->l('Module settings'),
+ 'icon' => 'icon-cogs',
+ ],
+ 'input' => [
+ [
+ 'type' => (version_compare(_PS_VERSION_, '1.6', '>=')) ? 'switch' : 'radio',
+ 'label' => $this->l('Enable module'),
+ 'name' => 'C_P_ENABLE',
+ 'class' => 't',
+ 'is_bool' => true,
+ 'values' => [
+ [
+ 'id' => 'C_P_ENABLE_on',
+ 'value' => 1,
+ 'label' => $this->l('Yes'), ],
+ [
+ 'id' => 'C_P_ENABLE_off',
+ 'value' => 0,
+ 'label' => $this->l('No'), ],
+ ],
+ ],
+ [
+ 'col' => 6,
+ 'type' => 'text',
+ 'label' => $this->l('Cookie lifetime'),
+ 'desc' => $this->l('The cookie consent will be stored during this time (or until customer delete cookies)') . ' ' . $this->l('Once the consent is expired, the banner will be displayed again to ask for the consent.'),
+ 'suffix' => $this->l('days'),
+ 'name' => 'C_P_EXPIRY',
+ 'class' => 't fixed-width-xl',
+ 'required' => true,
+ ],
+ [
+ 'type' => (version_compare(_PS_VERSION_, '1.6', '>=')) ? 'switch' : 'radio',
+ 'label' => $this->l('Enable module only for the specified IPs (DEBUG mode)'),
+ 'name' => 'C_P_DEBUG',
+ 'class' => 't',
+ 'is_bool' => true,
+ 'values' => [
+ [
+ 'id' => 'C_P_DEBUG_on',
+ 'value' => 1,
+ 'label' => $this->l('Yes'), ],
+ [
+ 'id' => 'C_P_DEBUG_off',
+ 'value' => 0,
+ 'label' => $this->l('No'), ],
+ ],
+ 'desc' => $this->l('Display the banner only for the specified IPs'),
+ ],
+ [
+ 'cols' => 113,
+ 'rows' => 4,
+ 'type' => 'textarea',
+ 'label' => $this->l('Display only for these IPs'),
+ 'desc' => $this->l('Cookies (and modules) will only be blocked and cookies notice will only be displayed for these IPs') . ' ' . $this->l('Separate each IP with a "|" (pipe) character'),
+ 'name' => 'C_P_IPS_DEBUG',
+ 'class' => 't',
+ ],
+ [
+ 'type' => (version_compare(_PS_VERSION_, '1.6', '>=')) ? 'switch' : 'radio',
+ 'label' => $this->l('Reload page when user gives consent'),
+ 'desc' => $this->l('If disabled, the consent will be sent dinamically and the page will not be reloaded.') . ' ' . $this->l('The blocked scripts are loaded "on the fly", without losing referrers nor bounces.'),
+ 'name' => 'C_P_REFRESH',
+ 'class' => 't',
+ 'is_bool' => true,
+ 'values' => [
+ [
+ 'id' => 'C_P_REFRESH_on',
+ 'value' => 1,
+ 'label' => $this->l('Yes'), ],
+ [
+ 'id' => 'C_P_REFRESH_off',
+ 'value' => 0,
+ 'label' => $this->l('No'), ],
+ ],
+ ],
+ [
+ 'type' => (version_compare(_PS_VERSION_, '1.6', '>=')) ? 'switch' : 'radio',
+ 'label' => $this->l('Display notice to customers outside the EU'),
+ 'desc' => Configuration::get('PS_GEOLOCATION_ENABLED') ? '' : $this->l('Geolocation must be enabled to enable this option'),
+ 'name' => 'C_P_GEO',
+ 'class' => 't',
+ 'disabled' => !Configuration::get('PS_GEOLOCATION_ENABLED'),
+ 'is_bool' => true,
+ 'values' => [
+ [
+ 'id' => 'C_P_GEO_on',
+ 'value' => 1,
+ 'label' => $this->l('Yes'), ],
+ [
+ 'id' => 'C_P_GEO_off',
+ 'value' => 0,
+ 'label' => $this->l('No'), ],
+ ],
+ ],
+ [
+ 'cols' => 113,
+ 'rows' => 4,
+ 'type' => 'textarea',
+ 'label' => $this->l('Don\'t apply restrictions for these user agents (SEO)'),
+ 'desc' => $this->l('Cookies (and modules) will not be blocked and cookies notice will not be displayed for these user agents') . ' ' . $this->l('Separate each user agent with a "|" (pipe) character'),
+ 'name' => 'C_P_BOTS',
+ 'class' => 't',
+ ],
+ [
+ 'cols' => 113,
+ 'rows' => 4,
+ 'type' => 'textarea',
+ 'label' => $this->l('Don\'t apply restrictions for these IPs'),
+ 'desc' => $this->l('Cookies (and modules) will not be blocked for these IPs') . ' ' . $this->l('Separate each IP with a "|" (pipe) character'),
+ 'name' => 'C_P_IPS',
+ 'class' => 't',
+ ],
+ ],
+ 'submit' => [
+ 'title' => $this->l('Save'),
+ 'type' => 'submit',
+ 'name' => 'submitCookiesPlusModule',
+ ],
+ ];
+
+ /*
+ $fieldsFormIndex++;
+ $fields_form[$fieldsFormIndex]['form'] = array(
+ 'legend' => array(
+ 'title' => $this->l('Appearance'),
+ 'icon' => 'icon-pencil',
+ ),
+ 'input' => array(
+ array(
+ 'col' => 12,
+ 'type' => 'free',
+ 'label' => '',
+ 'name' => 'C_P_MENU',
+ 'class' => 't',
+ 'lang' => true,
+ ),
+ ),
+ );
+
+ $fieldsFormIndex++;
+ $fields_form[$fieldsFormIndex]['form'] = array(
+ 'legend' => array(
+ 'title' => $this->l('Cookie finalities'),
+ 'icon' => 'icon-pencil',
+ ),
+ 'input' => array(
+ array(
+ 'col' => 12,
+ 'type' => 'free',
+ 'label' => '',
+ 'name' => 'C_P_MENU',
+ 'class' => 't',
+ 'lang' => true,
+ ),
+ ),
+ );
+
+ $fieldsFormIndex++;
+ $fields_form[$fieldsFormIndex]['form'] = array(
+ 'legend' => array(
+ 'title' => $this->l('Cookies'),
+ 'icon' => 'icon-pencil',
+ ),
+ 'input' => array(
+ array(
+ 'col' => 12,
+ 'type' => 'free',
+ 'label' => '',
+ 'name' => 'C_P_MENU',
+ 'class' => 't',
+ 'lang' => true,
+ ),
+ ),
+ );
+ */
+ ++$fieldsFormIndex;
+ $fields_form[$fieldsFormIndex]['form'] = [
+ 'legend' => [
+ 'title' => $this->l('Advanced'),
+ 'icon' => 'icon-magic',
+ ],
+ 'input' => [
+ [
+ 'col' => 12,
+ 'type' => 'html',
+ 'label' => '',
+ 'name' => $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/C_P_WARNING.tpl'),
+ ],
+ /*array(
+ 'type' => 'text',
+ 'label' => 'C_P_HOOK_EXECUTED',
+ 'name' => 'C_P_HOOK_EXECUTED',
+ 'col' => 1
+ ),
+ array(
+ 'type' => 'text',
+ 'label' => 'C_P_HOOK_POSITION',
+ 'name' => 'C_P_HOOK_POSITION',
+ 'col' => 1
+ ),*/
+ [
+ 'type' => 'textarea',
+ 'label' => 'CSS',
+ 'name' => 'C_P_CSS',
+ 'cols' => 100,
+ 'rows' => 10,
+ 'class' => 't codemirror codemirror-css',
+ ],
+ [
+ 'type' => 'textarea',
+ 'label' => 'JS',
+ 'name' => 'C_P_JS',
+ 'cols' => 100,
+ 'rows' => 10,
+ 'class' => 't codemirror codemirror-js',
+ ],
+ [
+ 'type' => 'select',
+ 'label' => 'Icons library',
+ 'name' => 'C_P_MATERIAL_ICONS_LIBRARY',
+ 'class' => 't',
+ 'options' => [
+ 'query' => [
+ [
+ 'id' => '1',
+ 'name' => 'Material Icons',
+ ],
+ [
+ 'id' => '2',
+ 'name' => 'Fontello',
+ ],
+ [
+ 'id' => '3',
+ 'name' => 'Font Awesome',
+ ],
+ ],
+ 'id' => 'id',
+ 'name' => 'name',
+ ],
+ ],
+ [
+ 'type' => (version_compare(_PS_VERSION_, '1.6', '>=')) ? 'switch' : 'radio',
+ 'label' => 'Add Material Icons CSS library',
+ 'name' => 'C_P_MATERIAL_ICONS',
+ 'class' => 't',
+ 'is_bool' => true,
+ 'values' => [
+ [
+ 'id' => 'C_P_MATERIAL_ICONS_on',
+ 'value' => 1,
+ 'label' => 'Yes',
+ ],
+ [
+ 'id' => 'C_P_MATERIAL_ICONS_off',
+ 'value' => 0,
+ 'label' => 'No',
+ ],
+ ],
+ ],
+ ],
+ 'submit' => [
+ 'title' => $this->l('Save'),
+ 'type' => 'submit',
+ 'name' => 'submitCookiesPlusModule',
+ ],
+ ];
+
+ return $fields_form;
+ }
+
+ protected function getConfigFormValues()
+ {
+ $fields = [];
+
+ $configFields = [
+ 'C_P_HOOK_EXECUTED',
+ 'C_P_HOOK_POSITION',
+ 'C_P_CSS',
+ 'C_P_JS',
+ 'C_P_MATERIAL_ICONS',
+ 'C_P_MATERIAL_ICONS_LIBRARY',
+ 'C_P_ENABLE',
+ 'C_P_REFRESH',
+ 'C_P_GEO',
+ 'C_P_DEBUG',
+ 'C_P_EXPIRY',
+ 'C_P_BOTS',
+ 'C_P_IPS',
+ 'C_P_IPS_DEBUG',
+ ];
+
+ foreach ($configFields as $field) {
+ $fields[$field] = Tools::getValue($field, Configuration::get($field));
+ }
+
+ return $fields;
+ }
+
+ protected function getConfigFormTPLs()
+ {
+ $fields = [];
+
+ $this->context->smarty->assign([
+ 'this_path' => $this->module->getPathUri(),
+ 'support_id' => $this->module->addons_id_product,
+ ]);
+
+ /*$fields['C_P_MENU'] =
+ $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/C_P_MENU.tpl');*/
+
+ return $fields;
+ }
+}
diff --git a/modules/cookiesplus/controllers/admin/AdminCookiesPlusCookiesController.php b/modules/cookiesplus/controllers/admin/AdminCookiesPlusCookiesController.php
new file mode 100644
index 00000000..5bb85485
--- /dev/null
+++ b/modules/cookiesplus/controllers/admin/AdminCookiesPlusCookiesController.php
@@ -0,0 +1,475 @@
+bootstrap = true;
+ $this->table = 'cookiesplus_cookie';
+ $this->className = 'CookiesPlusCookie';
+ $this->tabClassName = 'AdminCookiesPlusCookies';
+ $this->lang = true;
+ $this->addRowAction('edit');
+ $this->addRowAction('delete');
+
+ parent::__construct();
+
+ $this->bulk_actions = [
+ 'delete' => [
+ 'text' => $this->l('Delete selected'),
+ 'confirm' => $this->l('Delete selected items?'),
+ 'icon' => 'icon-trash',
+ ],
+ ];
+
+ $this->context = Context::getContext();
+
+ $this->default_form_language = $this->context->language->id;
+
+ $cookiesPlusFinalitiesArray = [];
+ $cookiesPlusFinalities = CookiesPlusFinality::getCookiesPlusFinalities($this->context->language->id);
+ foreach ($cookiesPlusFinalities as $cookiesPlusFinality) {
+ $cookiesPlusFinalitiesArray[$cookiesPlusFinality['id_cookiesplus_finality']] = $cookiesPlusFinality['name'];
+ }
+
+ $this->fields_list = [
+ 'active' => [
+ 'title' => $this->l('Enabled'),
+ 'active' => 'active',
+ 'type' => 'bool',
+ ],
+ 'name' => [
+ 'title' => $this->l('Cookie name'),
+ 'filter_key' => 'a!name',
+ ],
+ 'id_cookiesplus_finality' => [
+ 'title' => $this->l('Cookie finality'),
+ 'callback' => 'getFinalityNameCallback',
+ 'callback_object' => 'CookiesPlusFinality',
+ 'type' => 'select',
+ 'list' => $cookiesPlusFinalitiesArray,
+ 'filter_key' => 'a!id_cookiesplus_finality',
+ ],
+ 'provider' => [
+ 'title' => $this->l('Provider'),
+ ],
+ 'purpose' => [
+ 'title' => $this->l('Purpose'),
+ 'callback' => 'getCookiePurposeCallback',
+ 'callback_object' => 'CookiesPlusCookie',
+ ],
+ 'expiry' => [
+ 'title' => $this->l('Expiry'),
+ ],
+ ];
+
+ if (Shop::isFeatureActive() && (Shop::getContext() == Shop::CONTEXT_ALL || Shop::getContext() == Shop::CONTEXT_GROUP)) {
+ $this->isShopSelected = false;
+ }
+
+ $this->shopLinkType = 'shop';
+ }
+
+ public function setMedia($isNewTheme = false)
+ {
+ parent::setMedia($isNewTheme);
+
+ $this->addJqueryPlugin(['typewatch', 'fancybox', 'autocomplete']);
+ $this->addJqueryUI(['ui.datepicker', 'ui.button', 'ui.sortable', 'ui.droppable']);
+
+ $this->addCSS(_MODULE_DIR_ . $this->module->name . '/views/css/cookiesplus-back.css');
+
+ if ($this->display) {
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/views/js/cookiesplus-back.js');
+
+ $this->addCSS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/lib/codemirror.css');
+ $this->addCSS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/theme/monokai.css');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/lib/codemirror.js');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/addon/display/autorefresh.js');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/mode/css/css.js');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/mode/javascript/javascript.js');
+ }
+ }
+
+ public function initContent()
+ {
+ if (!$this->isShopSelected && !$this->display) {
+ $this->errors[] = $this->l('You have to select a shop.');
+
+ parent::initContent();
+
+ return;
+ }
+
+ if (version_compare($this->module->version, $this->module->getDatabaseVersion(), '>')) {
+ return $this->errors[] = $this->l('Upgrade available');
+ }
+
+ if ($this->isShopSelected
+ && (
+ (version_compare(_PS_VERSION_, '1.5.0.13', '<')
+ && !Module::isInstalled($this->module->name))
+ || (version_compare(_PS_VERSION_, '1.5.0.13', '>=')
+ && !Module::isEnabled($this->module->name))
+ )
+ ) {
+ $this->warnings[] = $this->l('Module is not enabled in this shop.');
+ }
+
+ if ($warnings = $this->module->getWarnings(false)) {
+ $this->warnings[] = $warnings;
+ }
+
+ if (Tools::isSubmit('submitCookiesPlusRevokeCookies')) {
+ Configuration::updateValue('C_P_REVOKE_CONSENT', date('Y-m-d H:i:s', time()));
+ $this->confirmations[] = $this->l('Revoke consent updated');
+ }
+
+ $this->content .= $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/cookies.tpl');
+
+ parent::initContent();
+
+ $this->content .= $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/disclaimer.tpl');
+
+ if (!$this->display) {
+ if (version_compare(_PS_VERSION_, '1.6', '>=')) {
+ $module = $this->module;
+
+ $default_iso_code = 'en';
+ $local_path = $module->getLocalPath();
+
+ $readme = null;
+ if (file_exists($local_path . '/readme_' . $this->context->language->iso_code . '.pdf')) {
+ $readme = 'readme_' . $this->context->language->iso_code . '.pdf';
+ } elseif (file_exists($local_path . '/readme_' . $default_iso_code . '.pdf')) {
+ $readme = 'readme_' . $default_iso_code . '.pdf';
+ }
+
+ $this->context->smarty->assign([
+ 'support_id' => $module->addons_id_product,
+ 'readme' => $readme,
+ 'this_path' => $module->getPathUri(),
+ ]);
+
+ if (file_exists($local_path . '/views/templates/admin/company/information_' . $this->context->language->iso_code . '.tpl')) {
+ $this->content .= $this->context->smarty->fetch($local_path . '/views/templates/admin/company/information_' . $this->context->language->iso_code . '.tpl');
+ } elseif (file_exists($local_path . '/views/templates/admin/company/information_' . $default_iso_code . '.tpl')) {
+ $this->content .= $this->context->smarty->fetch($local_path . '/views/templates/admin/company/information_' . $default_iso_code . '.tpl');
+ }
+ }
+ }
+ }
+
+ public function initProcess()
+ {
+ parent::initProcess();
+ if (Tools::isSubmit('activecookiesplus_cookie') && $this->id_object) {
+ $this->toggleProperty('active', $this->id_object);
+ if (!$this->errors) {
+ // Remove toggle from URL
+ Tools::redirectAdmin(Context::getContext()->link->getAdminLink($this->tabClassName));
+ }
+ }
+ }
+
+ public function toggleProperty($property, $id)
+ {
+ if (version_compare(_PS_VERSION_, '1.7', '<')) {
+ if ($this->tabAccess['edit'] !== '1') {
+ $this->errors[] = $this->l('You do not have permission to edit this.');
+
+ return;
+ }
+ } else {
+ if (!$this->access('edit')) {
+ $this->errors[] = $this->l('You do not have permission to edit this.');
+
+ return;
+ }
+ }
+
+ $object = new $this->className($id);
+ if (!Validate::isLoadedObject($object)) {
+ $this->errors[] = $this->l('An error occurred while updating an object.');
+ }
+
+ $object->$property = !$object->$property;
+ if (!$object->save()) {
+ $this->errors[] = $this->l('An error occurred while updating an object.');
+ }
+ }
+
+ public function initToolbar()
+ {
+ parent::initToolbar();
+
+ if (!$this->isShopSelected) {
+ unset($this->toolbar_btn['new']);
+ }
+ }
+
+ public function initPageHeaderToolbar()
+ {
+ parent::initPageHeaderToolbar();
+
+ if (empty($this->display)) {
+ $this->page_header_toolbar_btn['desc-module-new'] = [
+ 'href' => 'index.php?controller=' . $this->tabClassName . '&add' . $this->table . '&token=' . Tools::getAdminTokenLite($this->tabClassName),
+ 'desc' => $this->l('New'),
+ 'icon' => 'process-icon-new',
+ ];
+ }
+
+ if (!$this->isShopSelected) {
+ unset($this->page_header_toolbar_btn['desc-module-new']);
+ }
+
+ $this->context->smarty->clearAssign('help_link', '');
+ }
+
+ public function initModal()
+ {
+ parent::initModal();
+
+ $languages = Language::getLanguages(false);
+ $translateLinks = [];
+
+ if (version_compare(_PS_VERSION_, '1.7.2.1', '>=')) {
+ $module = Module::getInstanceByName($this->module->name);
+ $isNewTranslateSystem = $module->isUsingNewTranslationSystem();
+ $link = Context::getContext()->link;
+ foreach ($languages as $lang) {
+ if ($isNewTranslateSystem) {
+ $translateLinks[$lang['iso_code']] = $link->getAdminLink('AdminTranslationSf', true, [
+ 'lang' => $lang['iso_code'],
+ 'type' => 'modules',
+ 'selected' => $module->name,
+ 'locale' => $lang['locale'],
+ ]);
+ } else {
+ $translateLinks[$lang['iso_code']] = $link->getAdminLink('AdminTranslations', true, [], [
+ 'type' => 'modules',
+ 'module' => $module->name,
+ 'lang' => $lang['iso_code'],
+ ]);
+ }
+ }
+ }
+
+ $this->context->smarty->assign([
+ 'trad_link' => 'index.php?tab=AdminTranslations&token=' . Tools::getAdminTokenLite('AdminTranslations') . '&type=modules&module=' . $this->module->name . '&lang=',
+ 'module_languages' => $languages,
+ 'module_name' => $this->module->name,
+ 'translateLinks' => $translateLinks,
+ ]);
+
+ $modal_content = $this->context->smarty->fetch('controllers/modules/modal_translation.tpl');
+
+ $this->modals[] = [
+ 'modal_id' => 'moduleTradLangSelect',
+ 'modal_class' => 'modal-sm',
+ 'modal_title' => $this->l('Translate this module'),
+ 'modal_content' => $modal_content,
+ ];
+ }
+
+ public function renderList()
+ {
+ $this->context->smarty->assign([
+ 'revokeConsentDate' => Tools::displayDate(date('Y-m-d H:i:s', strtotime(Configuration::get('C_P_REVOKE_CONSENT'))), null, true),
+ ]);
+
+ $this->content .= $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/revoke-consent.tpl');
+
+ return parent::renderList();
+ }
+
+ public function renderForm()
+ {
+ if (!$this->isShopSelected && $this->display === 'add') {
+ $this->errors[] = $this->l('You have to select a shop.');
+
+ return parent::renderForm();
+ }
+
+ $this->context->smarty->assign([
+ 'revokeConsentDate' => Tools::displayDate(date('Y-m-d H:i:s', strtotime(Configuration::get('C_P_REVOKE_CONSENT'))), null, true),
+ ]);
+
+ $this->content .= $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/revoke-consent.tpl');
+
+ $this->multiple_fieldsets = true;
+ $this->default_form_language = $this->context->language->id;
+
+ $cookiesPlusFinalities = CookiesPlusFinality::getCookiesPlusFinalities($this->context->language->id);
+
+ $dummyElement = [
+ 'id_cookiesplus_finality' => '',
+ 'name' => $this->l('-- Choose --'),
+ ];
+ array_unshift($cookiesPlusFinalities, $dummyElement);
+
+ $fieldsFormIndex = 0;
+ $this->fields_form[$fieldsFormIndex]['form'] = [
+ 'legend' => [
+ 'title' => $this->l('Configure cookie'),
+ 'icon' => 'icon-cogs',
+ ],
+ 'input' => [
+ [
+ 'type' => 'hidden',
+ 'name' => 'id_cookiesplus_cookie',
+ ],
+ [
+ 'type' => (version_compare(_PS_VERSION_, '1.6', '>=')) ? 'switch' : 'radio',
+ 'label' => $this->l('Enabled'),
+ 'name' => 'active',
+ 'class' => 't',
+ 'col' => 8,
+ 'is_bool' => true,
+ 'values' => [
+ [
+ 'id' => 'active_on',
+ 'value' => 1,
+ 'label' => $this->l('Enabled'),
+ ],
+ [
+ 'id' => 'active_off',
+ 'value' => 0,
+ 'label' => $this->l('Disabled'),
+ ],
+ ],
+ ],
+ [
+ 'type' => 'select',
+ 'label' => $this->l('Cookie finality'),
+ 'name' => 'id_cookiesplus_finality',
+ 'required' => true,
+ 'options' => [
+ 'query' => $cookiesPlusFinalities,
+ 'id' => 'id_cookiesplus_finality',
+ 'name' => 'name',
+ ],
+ ],
+ [
+ 'type' => 'text',
+ 'label' => $this->l('Cookie name'),
+ 'name' => 'name',
+ 'required' => true,
+ ],
+ [
+ 'type' => 'text',
+ 'label' => $this->l('Provider'),
+ 'name' => 'provider',
+ ],
+ [
+ 'type' => 'text',
+ 'label' => $this->l('Provider URL'),
+ 'name' => 'provider_url',
+ ],
+ [
+ 'type' => 'textarea',
+ 'label' => $this->l('Purpose'),
+ 'name' => 'purpose',
+ 'lang' => true,
+ ],
+ [
+ 'type' => 'text',
+ 'label' => $this->l('Expiry'),
+ 'name' => 'expiry',
+ 'lang' => true,
+ ],
+ ],
+ 'submit' => [
+ 'title' => $this->l('Save'),
+ 'type' => 'submit',
+ ],
+ 'buttons' => [
+ 'save-and-stay' => [
+ 'title' => $this->l('Save and stay'),
+ 'name' => 'submitAdd' . $this->table . 'AndStay',
+ 'type' => 'submit',
+ 'class' => 'btn btn-default pull-right',
+ 'icon' => 'process-icon-save',
+ ],
+ ],
+ ];
+
+ $this->content .= parent::renderForm();
+ }
+
+ public function processSave()
+ {
+ $result = parent::processSave();
+
+ if (Tools::getValue('back') && (int) Tools::getvalue('id_cookiesplus_finality')) {
+ $this->redirect_after = Context::getContext()->link->getAdminLink('AdminCookiesPlusFinalities') . '&updatecookiesplus_finality=&conf=4&id_cookiesplus_finality=' . (int) Tools::getValue('id_cookiesplus_finality');
+ }
+
+ return $result;
+ }
+
+ public function displayDeleteLink($token = null, $id = null, $name = null)
+ {
+ $tpl = $this->createTemplate('helpers/list/list_action_delete.tpl');
+
+ $tpl->assign([
+ 'href' => self::$currentIndex . '&' . $this->identifier . '=' . $id . '&delete' . $this->table . '&token=' . ($token != null ? $token : $this->token),
+ 'confirm' => $this->l('Delete the selected item?') . $name,
+ 'action' => $this->l('Delete'),
+ 'id' => $id,
+ ]);
+
+ return $tpl->fetch();
+ }
+
+ private function _createTemplate($tpl_name)
+ {
+ if ($this->override_folder) {
+ if ($this->context->controller instanceof ModuleAdminController) {
+ $override_tpl_path = $this->context->controller->getTemplatePath() . $tpl_name;
+ } elseif ($this->module) {
+ $override_tpl_path = _PS_MODULE_DIR_ . $this->module->name . '/views/templates/admin/' . $tpl_name;
+ } elseif (file_exists($this->context->smarty->getTemplateDir(1) . DIRECTORY_SEPARATOR . $this->override_folder . $this->base_folder . $tpl_name)) {
+ $override_tpl_path = $this->context->smarty->getTemplateDir(1) . DIRECTORY_SEPARATOR . $this->override_folder . $this->base_folder . $tpl_name;
+ } elseif (file_exists($this->context->smarty->getTemplateDir(0) . DIRECTORY_SEPARATOR . 'controllers' . DIRECTORY_SEPARATOR . $this->override_folder . $this->base_folder . $tpl_name)) {
+ $override_tpl_path = $this->context->smarty->getTemplateDir(0) . 'controllers' . DIRECTORY_SEPARATOR . $this->override_folder . $this->base_folder . $tpl_name;
+ }
+ } elseif ($this->module) {
+ $override_tpl_path = _PS_MODULE_DIR_ . $this->module->name . '/views/templates/admin/' . $tpl_name;
+ }
+ if (isset($override_tpl_path) && file_exists($override_tpl_path)) {
+ return $this->context->smarty->createTemplate($override_tpl_path, $this->context->smarty);
+ } else {
+ return $this->context->smarty->createTemplate($tpl_name, $this->context->smarty);
+ }
+ }
+}
diff --git a/modules/cookiesplus/controllers/admin/AdminCookiesPlusFBController.php b/modules/cookiesplus/controllers/admin/AdminCookiesPlusFBController.php
new file mode 100644
index 00000000..40093aef
--- /dev/null
+++ b/modules/cookiesplus/controllers/admin/AdminCookiesPlusFBController.php
@@ -0,0 +1,312 @@
+bootstrap = true;
+ $this->tabClassName = 'AdminCookiesPlusFB';
+
+ parent::__construct();
+
+ if (Shop::isFeatureActive() && (Shop::getContext() == Shop::CONTEXT_ALL || Shop::getContext() == Shop::CONTEXT_GROUP)) {
+ $this->isShopSelected = false;
+ }
+
+ $this->shopLinkType = 'shop';
+ }
+
+ public function initContent()
+ {
+ if (!$this->isShopSelected && !$this->display) {
+ $this->errors[] = $this->l('You have to select a shop.');
+
+ parent::initContent();
+
+ return;
+ }
+
+ if (version_compare($this->module->version, $this->module->getDatabaseVersion(), '>')) {
+ return $this->errors[] = $this->l('Upgrade available');
+ }
+
+ if ($this->isShopSelected
+ && (
+ (version_compare(_PS_VERSION_, '1.5.0.13', '<')
+ && !Module::isInstalled($this->module->name))
+ || (version_compare(_PS_VERSION_, '1.5.0.13', '>=')
+ && !Module::isEnabled($this->module->name))
+ )
+ ) {
+ $this->warnings[] = $this->l('Module is not enabled in this shop.');
+ }
+
+ if ($warnings = $this->module->getWarnings(false)) {
+ $this->warnings[] = $warnings;
+ }
+
+ if (((bool) Tools::isSubmit('submitCookiesPlusModule')) == true) {
+ if (Tools::getValue('C_P_FB_ENABLE') && !Tools::getValue('fbConfiguration')) {
+ $this->errors[] = $this->l('You have to define the needed consents to fire the Facebook Pixel.');
+ }
+
+ if (!count($this->errors)) {
+ $fields = $this->getConfigFormValues();
+ foreach (array_keys($fields) as $key) {
+ Configuration::updateValue($key, $fields[$key], true);
+ }
+
+ if ($key === 'C_P_FB_CONSENT') {
+ $value = json_encode(Tools::getValue('fbConfiguration'));
+ Configuration::updateValue($key, $value);
+ } else {
+ Configuration::updateValue($key, $fields[$key], true);
+ }
+
+ $this->confirmations[] = $this->l('Settings saved successfully');
+ }
+ }
+
+ $this->content .= $this->renderGlobalConfigForm();
+ $this->content .= $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/disclaimer.tpl');
+
+ if (version_compare(_PS_VERSION_, '1.6', '>=')) {
+ $module = $this->module;
+
+ $default_iso_code = 'en';
+ $local_path = $module->getLocalPath();
+
+ $readme = null;
+ if (file_exists($local_path . '/readme_' . $this->context->language->iso_code . '.pdf')) {
+ $readme = 'readme_' . $this->context->language->iso_code . '.pdf';
+ } elseif (file_exists($local_path . '/readme_' . $default_iso_code . '.pdf')) {
+ $readme = 'readme_' . $default_iso_code . '.pdf';
+ }
+
+ $this->context->smarty->assign([
+ 'support_id' => $module->addons_id_product,
+ 'readme' => $readme,
+ 'this_path' => $module->getPathUri(),
+ ]);
+
+ if (file_exists($local_path . '/views/templates/admin/company/information_' . $this->context->language->iso_code . '.tpl')) {
+ $this->content .= $this->context->smarty->fetch($local_path . '/views/templates/admin/company/information_' . $this->context->language->iso_code . '.tpl');
+ } elseif (file_exists($local_path . '/views/templates/admin/company/information_' . $default_iso_code . '.tpl')) {
+ $this->content .= $this->context->smarty->fetch($local_path . '/views/templates/admin/company/information_' . $default_iso_code . '.tpl');
+ }
+ }
+
+ parent::initContent();
+ }
+
+ public function initToolbar()
+ {
+ parent::initToolbar();
+
+ unset($this->toolbar_btn['new']);
+ }
+
+ public function initPageHeaderToolbar()
+ {
+ parent::initPageHeaderToolbar();
+
+ if (empty($this->display)) {
+ /*$this->page_header_toolbar_btn['desc-module-new'] = array(
+ 'href' => 'index.php?controller='.$this->tabClassName.'&add'.$this->table.'&token='.Tools::getAdminTokenLite($this->tabClassName),
+ 'desc' => $this->l('New'),
+ 'icon' => 'process-icon-new'
+ );*/
+ $this->page_header_toolbar_btn['desc-module-translate'] = [
+ 'href' => '#',
+ 'desc' => $this->l('Translate'),
+ 'modal_target' => '#moduleTradLangSelect',
+ 'icon' => 'process-icon-flag',
+ ];
+
+ $this->page_header_toolbar_btn['desc-module-hook'] = [
+ 'href' => 'index.php?tab=AdminModulesPositions&token=' . Tools::getAdminTokenLite('AdminModulesPositions') . '&show_modules=' . Module::getModuleIdByName($this->module->name),
+ 'desc' => $this->l('Manage hooks'),
+ 'icon' => 'process-icon-anchor',
+ ];
+ }
+
+ if (!$this->isShopSelected) {
+ unset($this->page_header_toolbar_btn['desc-module-new']);
+ }
+
+ $this->context->smarty->clearAssign('help_link', '');
+ }
+
+ public function initModal()
+ {
+ parent::initModal();
+
+ $languages = Language::getLanguages(false);
+ $translateLinks = [];
+
+ if (version_compare(_PS_VERSION_, '1.7.2.1', '>=')) {
+ $module = Module::getInstanceByName($this->module->name);
+ $isNewTranslateSystem = $module->isUsingNewTranslationSystem();
+ $link = Context::getContext()->link;
+ foreach ($languages as $lang) {
+ if ($isNewTranslateSystem) {
+ $translateLinks[$lang['iso_code']] = $link->getAdminLink('AdminTranslationSf', true, [
+ 'lang' => $lang['iso_code'],
+ 'type' => 'modules',
+ 'selected' => $module->name,
+ 'locale' => $lang['locale'],
+ ]);
+ } else {
+ $translateLinks[$lang['iso_code']] = $link->getAdminLink('AdminTranslations', true, [], [
+ 'type' => 'modules',
+ 'module' => $module->name,
+ 'lang' => $lang['iso_code'],
+ ]);
+ }
+ }
+ }
+
+ $this->context->smarty->assign([
+ 'trad_link' => 'index.php?tab=AdminTranslations&token=' . Tools::getAdminTokenLite('AdminTranslations') . '&type=modules&module=' . $this->module->name . '&lang=',
+ 'module_languages' => $languages,
+ 'module_name' => $this->module->name,
+ 'translateLinks' => $translateLinks,
+ ]);
+
+ $modal_content = $this->context->smarty->fetch('controllers/modules/modal_translation.tpl');
+
+ $this->modals[] = [
+ 'modal_id' => 'moduleTradLangSelect',
+ 'modal_class' => 'modal-sm',
+ 'modal_title' => $this->l('Translate this module'),
+ 'modal_content' => $modal_content,
+ ];
+ }
+
+ protected function renderGlobalConfigForm()
+ {
+ $helper = new HelperForm();
+ $helper->show_toolbar = false;
+ $helper->module = $this->module;
+ $helper->default_form_language = $this->context->language->id;
+ $helper->allow_employee_form_lang = Configuration::get('PS_BO_ALLOW_EMPLOYEE_FORM_LANG', 0);
+ $helper->identifier = $this->identifier;
+ $helper->currentIndex = self::$currentIndex;
+ $helper->submit_action = 'submitCookiesPlusModule';
+ $helper->token = Tools::getAdminTokenLite($this->tabClassName);
+
+ $helper->tpl_vars = [
+ 'fields_value' => array_merge($this->getConfigFormValues(), $this->getConfigFormTPLs()),
+ 'languages' => $this->context->controller->getLanguages(),
+ 'id_language' => $this->context->language->id,
+ ];
+
+ return $helper->generateForm($this->getConfigForm());
+ }
+
+ protected function getConfigForm()
+ {
+ $fields_form = [];
+
+ $fieldsFormIndex = 0;
+ $fields_form[$fieldsFormIndex]['form'] = [
+ 'legend' => [
+ 'title' => $this->l('Facebook Pixel settings'),
+ 'icon' => 'icon-cogs',
+ ],
+ 'input' => [
+ [
+ 'col' => 12,
+ 'type' => 'html',
+ 'label' => '',
+ 'name' => $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/C_P_FB.tpl'),
+ ],
+ [
+ 'type' => (version_compare(_PS_VERSION_, '1.6', '>=')) ? 'switch' : 'radio',
+ 'label' => $this->l('Enable integration with the Facebook Pixel'),
+ 'name' => 'C_P_FB_ENABLE',
+ 'class' => 't',
+ 'is_bool' => true,
+ 'values' => [
+ [
+ 'id' => 'C_P_FB_ENABLE_on',
+ 'value' => 1,
+ 'label' => $this->l('Yes'), ],
+ [
+ 'id' => 'C_P_FB_ENABLE_off',
+ 'value' => 0,
+ 'label' => $this->l('No'), ],
+ ],
+ ],
+ [
+ 'col' => 8,
+ 'type' => 'html',
+ 'label' => 'Cookie finalities needed to include the Facebook Pixel in the page',
+ 'name' => $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/C_P_FB_CONSENT.tpl'),
+ ],
+ ],
+ 'submit' => [
+ 'title' => $this->l('Save'),
+ 'type' => 'submit',
+ 'name' => 'submitCookiesPlusModule',
+ ],
+ ];
+
+ return $fields_form;
+ }
+
+ protected function getConfigFormValues()
+ {
+ $fields = [];
+
+ $configFields = [
+ 'C_P_FB_ENABLE',
+ 'C_P_FB_CONSENT',
+ ];
+
+ foreach ($configFields as $field) {
+ $fields[$field] = Tools::getValue($field, Configuration::get($field));
+ }
+
+ return $fields;
+ }
+
+ protected function getConfigFormTPLs()
+ {
+ $fields = [];
+ $this->context->smarty->assign([
+ 'cookiesPlusFinalities' => CookiesPlusFinality::getCookiesPlusFinalities((int) $this->context->language->id, false, false),
+ 'fieldName' => 'fbConfiguration',
+ 'values' => json_decode(Configuration::get('C_P_FB_CONSENT'), true),
+ ]);
+
+ return $fields;
+ }
+}
diff --git a/modules/cookiesplus/controllers/admin/AdminCookiesPlusFinalitiesController.php b/modules/cookiesplus/controllers/admin/AdminCookiesPlusFinalitiesController.php
new file mode 100644
index 00000000..f2fec394
--- /dev/null
+++ b/modules/cookiesplus/controllers/admin/AdminCookiesPlusFinalitiesController.php
@@ -0,0 +1,610 @@
+bootstrap = true;
+ $this->table = 'cookiesplus_finality';
+ $this->className = 'CookiesPlusFinality';
+ $this->tabClassName = 'AdminCookiesPlusFinalities';
+ $this->lang = true;
+ $this->addRowAction('edit');
+ $this->addRowAction('delete');
+
+ parent::__construct();
+
+ $this->bulk_actions = [
+ 'delete' => [
+ 'text' => $this->l('Delete selected'),
+ 'confirm' => $this->l('Delete selected items?'),
+ 'icon' => 'icon-trash',
+ ],
+ ];
+
+ $this->context = Context::getContext();
+
+ $this->default_form_language = $this->context->language->id;
+ $this->position_identifier = 'position';
+
+ $this->fields_list = [
+ 'id_cookiesplus_finality' => [
+ 'title' => $this->l('ID'),
+ 'search' => false,
+ ],
+ 'active' => [
+ 'title' => $this->l('Enabled'),
+ 'active' => 'active',
+ 'type' => 'bool',
+ 'search' => false,
+ ],
+ 'name' => [
+ 'title' => $this->l('Cookie finality name'),
+ 'filter_key' => 'b!name',
+ 'search' => false,
+ ],
+ 'description' => [
+ 'title' => $this->l('Cookie finality description'),
+ 'callback' => 'getFinalityDescriptionCallback',
+ 'callback_object' => 'CookiesPlusFinality',
+ 'search' => false,
+ ],
+ 'technical' => [
+ 'title' => $this->l('Technical'),
+ 'align' => 'text-center',
+ 'active' => 'technical',
+ 'type' => 'bool',
+ 'search' => false,
+ ],
+ 'position' => [
+ 'title' => $this->l('Position'),
+ 'align' => 'center',
+ 'class' => 'fixed-width-sm',
+ 'position' => 'position',
+ 'search' => false,
+ ],
+ ];
+
+ if (Shop::isFeatureActive() && (Shop::getContext() == Shop::CONTEXT_ALL || Shop::getContext() == Shop::CONTEXT_GROUP)) {
+ $this->isShopSelected = false;
+ }
+
+ $this->shopLinkType = 'shop';
+ }
+
+ public function setMedia($isNewTheme = false)
+ {
+ parent::setMedia($isNewTheme);
+
+ $this->addJqueryPlugin(['typewatch', 'fancybox', 'autocomplete']);
+ $this->addJqueryUI(['ui.datepicker', 'ui.button', 'ui.sortable', 'ui.droppable']);
+
+ // Tabs
+ /*if (version_compare(_PS_VERSION_, '1.6', '<')) {
+ $this->addCSS(_MODULE_DIR_.$this->module->name.'/views/css/tabs.css');
+ }
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/views/js/tabs.js');
+ */
+ $this->addCSS(_MODULE_DIR_ . $this->module->name . '/views/css/cookiesplus-back.css');
+
+ if ($this->display) {
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/views/js/cookiesplus-back.js');
+
+ $this->addCSS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/lib/codemirror.css');
+ $this->addCSS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/theme/monokai.css');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/lib/codemirror.js');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/addon/display/autorefresh.js');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/mode/css/css.js');
+ $this->addJS(_MODULE_DIR_ . $this->module->name . '/lib/CodeMirror/mode/javascript/javascript.js');
+ }
+ }
+
+ public function initContent()
+ {
+ if (!$this->isShopSelected && !$this->display) {
+ $this->errors[] = $this->l('You have to select a shop.');
+
+ parent::initContent();
+
+ return;
+ }
+
+ if (version_compare($this->module->version, $this->module->getDatabaseVersion(), '>')) {
+ return $this->errors[] = $this->l('Upgrade available');
+ }
+
+ if ($this->isShopSelected
+ && (
+ (version_compare(_PS_VERSION_, '1.5.0.13', '<')
+ && !Module::isInstalled($this->module->name))
+ || (version_compare(_PS_VERSION_, '1.5.0.13', '>=')
+ && !Module::isEnabled($this->module->name))
+ )
+ ) {
+ $this->warnings[] = $this->l('Module is not enabled in this shop.');
+ }
+
+ if ($warnings = $this->module->getWarnings(false)) {
+ $this->warnings[] = $warnings;
+ }
+
+ if (Tools::isSubmit('submitCookiesPlusRevokeCookies')) {
+ Configuration::updateValue('C_P_REVOKE_CONSENT', date('Y-m-d H:i:s', time()));
+ $this->confirmations[] = $this->l('Revoke consent updated');
+ }
+
+ parent::initContent();
+
+ $this->content .= $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/disclaimer.tpl');
+
+ if (!$this->display) {
+ if (version_compare(_PS_VERSION_, '1.6', '>=')) {
+ $default_iso_code = 'en';
+ $local_path = $this->module->getLocalPath();
+
+ $readme = null;
+ if (file_exists($local_path . '/readme_' . $this->context->language->iso_code . '.pdf')) {
+ $readme = 'readme_' . $this->context->language->iso_code . '.pdf';
+ } elseif (file_exists($local_path . '/readme_' . $default_iso_code . '.pdf')) {
+ $readme = 'readme_' . $default_iso_code . '.pdf';
+ }
+
+ $this->context->smarty->assign([
+ 'support_id' => $this->module->addons_id_product,
+ 'readme' => $readme,
+ 'this_path' => $this->module->getPathUri(),
+ ]);
+
+ if (file_exists($local_path . '/views/templates/admin/company/information_' . $this->context->language->iso_code . '.tpl')) {
+ $this->content .= $this->context->smarty->fetch($local_path . '/views/templates/admin/company/information_' . $this->context->language->iso_code . '.tpl');
+ } elseif (file_exists($local_path . '/views/templates/admin/company/information_' . $default_iso_code . '.tpl')) {
+ $this->content .= $this->context->smarty->fetch($local_path . '/views/templates/admin/company/information_' . $default_iso_code . '.tpl');
+ }
+ }
+
+ $this->context->smarty->assign([
+ 'content' => $this->content,
+ ]);
+ }
+ }
+
+ public function initProcess()
+ {
+ parent::initProcess();
+
+ if (Tools::isSubmit('activecookiesplus_finality') && $this->id_object) {
+ $this->toggleProperty('active', $this->id_object);
+ if (!$this->errors) {
+ // Remove toggle from URL
+ Tools::redirectAdmin(Context::getContext()->link->getAdminLink($this->tabClassName));
+ }
+ }
+
+ if (Tools::isSubmit('technicalcookiesplus_finality') && $this->id_object) {
+ $this->toggleProperty('technical', $this->id_object);
+ if (!$this->errors) {
+ // Remove toggle from URL
+ Tools::redirectAdmin(Context::getContext()->link->getAdminLink($this->tabClassName));
+ }
+ }
+ }
+
+ public function toggleProperty($property, $id)
+ {
+ if (version_compare(_PS_VERSION_, '1.7', '<')) {
+ if ($this->tabAccess['edit'] !== '1') {
+ $this->errors[] = $this->l('You do not have permission to edit this.');
+
+ return;
+ }
+ } else {
+ if (!$this->access('edit')) {
+ $this->errors[] = $this->l('You do not have permission to edit this.');
+
+ return;
+ }
+ }
+
+ $object = new $this->className($id);
+ if (!Validate::isLoadedObject($object)) {
+ $this->errors[] = $this->l('An error occurred while updating an object.');
+ }
+
+ $object->$property = !$object->$property;
+ if (!$object->save()) {
+ $this->errors[] = $this->l('An error occurred while updating an object.');
+ }
+ }
+
+ public function initToolbar()
+ {
+ parent::initToolbar();
+
+ if (!$this->isShopSelected) {
+ unset($this->toolbar_btn['new']);
+ }
+ }
+
+ public function initPageHeaderToolbar()
+ {
+ parent::initPageHeaderToolbar();
+
+ if (empty($this->display)) {
+ $this->page_header_toolbar_btn['desc-module-new'] = [
+ 'href' => 'index.php?controller=' . $this->tabClassName . '&add' . $this->table . '&token=' . Tools::getAdminTokenLite($this->tabClassName),
+ 'desc' => $this->l('New'),
+ 'icon' => 'process-icon-new',
+ ];
+ }
+
+ if (!$this->isShopSelected) {
+ unset($this->page_header_toolbar_btn['desc-module-new']);
+ }
+
+ $this->context->smarty->clearAssign('help_link', '');
+ }
+
+ public function initModal()
+ {
+ parent::initModal();
+
+ $languages = Language::getLanguages(false);
+ $translateLinks = [];
+
+ if (version_compare(_PS_VERSION_, '1.7.2.1', '>=')) {
+ $module = Module::getInstanceByName($this->module->name);
+ $isNewTranslateSystem = $module->isUsingNewTranslationSystem();
+ $link = Context::getContext()->link;
+ foreach ($languages as $lang) {
+ if ($isNewTranslateSystem) {
+ $translateLinks[$lang['iso_code']] = $link->getAdminLink('AdminTranslationSf', true, [
+ 'lang' => $lang['iso_code'],
+ 'type' => 'modules',
+ 'selected' => $module->name,
+ 'locale' => $lang['locale'],
+ ]);
+ } else {
+ $translateLinks[$lang['iso_code']] = $link->getAdminLink('AdminTranslations', true, [], [
+ 'type' => 'modules',
+ 'module' => $module->name,
+ 'lang' => $lang['iso_code'],
+ ]);
+ }
+ }
+ }
+
+ $this->context->smarty->assign([
+ 'trad_link' => 'index.php?tab=AdminTranslations&token=' . Tools::getAdminTokenLite('AdminTranslations') . '&type=modules&module=' . $this->module->name . '&lang=',
+ 'module_languages' => $languages,
+ 'module_name' => $this->module->name,
+ 'translateLinks' => $translateLinks,
+ ]);
+
+ $modal_content = $this->context->smarty->fetch('controllers/modules/modal_translation.tpl');
+
+ $this->modals[] = [
+ 'modal_id' => 'moduleTradLangSelect',
+ 'modal_class' => 'modal-sm',
+ 'modal_title' => $this->l('Translate this module'),
+ 'modal_content' => $modal_content,
+ ];
+ }
+
+ public function renderList()
+ {
+ // Redirect if no object created
+ /*if ($this->isShopSelected && !LoyaltyEditPointsAssignment::getNbObjects()) {
+ $this->redirect_after = 'index.php?controller='.$this->tabClassName.'&add'.$this->table.'&token='.Tools::getAdminTokenLite($this->tabClassName);
+ $this->redirect();
+ }*/
+ $this->content .= $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/cookie-finalities.tpl');
+
+ $this->context->smarty->assign([
+ 'revokeConsentDate' => Tools::displayDate(date('Y-m-d H:i:s', strtotime(Configuration::get('C_P_REVOKE_CONSENT'))), null, true),
+ ]);
+
+ $this->content .= $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/revoke-consent.tpl');
+
+ return parent::renderList();
+ }
+
+ public function renderForm()
+ {
+ if (!$this->isShopSelected && $this->display === 'add') {
+ $this->errors[] = $this->l('You have to select a shop.');
+
+ return parent::renderForm();
+ }
+
+ $this->context->smarty->assign([
+ 'revokeConsentDate' => Tools::displayDate(date('Y-m-d H:i:s', strtotime(Configuration::get('C_P_REVOKE_CONSENT'))), null, true),
+ ]);
+
+ $this->content .= $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/revoke-consent.tpl');
+
+ $object = $this->loadObject(true);
+
+ $this->multiple_fieldsets = true;
+ $this->default_form_language = $this->context->language->id;
+
+ // Modules blocked
+ $modules = $this->module->getModuleList();
+ $selectedModules = (array) json_decode($object->modules);
+ foreach ($modules as &$module) {
+ if (in_array($module['id_module'], $selectedModules)) {
+ $module['checked'] = true;
+ } else {
+ $module['checked'] = false;
+ }
+
+ $module['sortDisplayName'] = strtolower($module['displayName']);
+ }
+ unset($module);
+
+ array_multisort(
+ array_column(
+ $modules,
+ 'checked'
+ ),
+ SORT_DESC,
+ array_column(
+ $modules,
+ 'sortDisplayName'
+ ),
+ SORT_ASC,
+ $modules
+ );
+
+ $this->context->smarty->assign([
+ 'allModules' => $modules,
+ 'fieldName' => 'modules',
+ ]);
+
+ $fieldsFormIndex = 0;
+ $this->fields_form[$fieldsFormIndex]['form'] = [
+ 'legend' => [
+ 'title' => $this->l('Cookie finality'),
+ 'icon' => 'icon-cogs',
+ ],
+ 'input' => [
+ [
+ 'type' => 'hidden',
+ 'name' => 'id_cookiesplus_finality',
+ ],
+ [
+ 'type' => 'hidden',
+ 'name' => 'position',
+ ],
+ [
+ 'type' => (version_compare(_PS_VERSION_, '1.6', '>=')) ? 'switch' : 'radio',
+ 'label' => $this->l('Enabled'),
+ 'name' => 'active',
+ 'class' => 't',
+ 'col' => 8,
+ 'is_bool' => true,
+ 'values' => [
+ [
+ 'id' => 'active_on',
+ 'value' => 1,
+ 'label' => $this->l('Yes'),
+ ],
+ [
+ 'id' => 'active_off',
+ 'value' => 0,
+ 'label' => $this->l('No'),
+ ],
+ ],
+ ],
+ [
+ 'type' => (version_compare(_PS_VERSION_, '1.6', '>=')) ? 'switch' : 'radio',
+ 'label' => $this->l('This is a Technical finality'),
+ 'name' => 'technical',
+ 'class' => 't',
+ 'col' => 8,
+ 'is_bool' => true,
+ 'values' => [
+ [
+ 'id' => 'technical_on',
+ 'value' => 1,
+ 'label' => $this->l('Yes'),
+ ],
+ [
+ 'id' => 'technical_off',
+ 'value' => 0,
+ 'label' => $this->l('No'),
+ ],
+ ],
+ 'desc' => $this->l('Technical cookies can not be disabled. They are installed automatically.'),
+ ],
+ [
+ 'type' => 'text',
+ 'label' => $this->l('Cookie finality name'),
+ 'name' => 'name',
+ 'required' => true,
+ 'lang' => true,
+ ],
+ [
+ 'type' => 'textarea',
+ 'label' => $this->l('Cookie finality description'),
+ 'name' => 'description',
+ 'required' => true,
+ 'lang' => true,
+ 'autoload_rte' => true,
+ 'cols' => 60,
+ 'rows' => 30,
+ ],
+ [
+ 'type' => 'html',
+ 'col' => 8,
+ 'label' => $this->l('Cookies from this finality'),
+ 'name' => $this->context->smarty->fetch($this->module->getLocalPath() . 'views/templates/admin/cookies-list.tpl') . $this->module->getCookiesPlusCookiesList(),
+ ],
+ [
+ 'type' => 'html',
+ 'name' => 'html',
+ 'html_content' => (Module::isInstalled('litespeedcache') || Module::isInstalled('stadvancedcache') || Module::isInstalled('jprestaspeedpack') || Module::isInstalled('pagecache')) ? '
' . $this->l('If you are using a cache module please clear cache when you make any modification.') . '
This store asks you to accept cookies for performance, social media and advertising purposes. Social media and advertising cookies of third parties are used to offer you social media functionalities and personalized ads. Do you accept these cookies and the processing of personal data involved?
Esta tienda te pide que aceptes cookies para fines de rendimiento, redes sociales y publicidad. Las redes sociales y las cookies publicitarias de terceros se utilizan para ofrecerte funciones de redes sociales y anuncios personalizados. ¿Aceptas estas cookies y el procesamiento de datos personales involucrados?
';
+
+ // French
+ $langCode = 'fr';
+ $cookiesDefault['title'][$langCode] = 'Vos paramètres de cookies';
+ $cookiesDefault['text'][$langCode] = '
Ce magasin vous demande d\'accepter les cookies afin d\'optimiser les performances, les fonctionnalités des réseaux sociaux et la pertinence de la publicité. Les cookies tiers liés aux réseaux sociaux et à la publicité sont utilisés pour vous offrir des fonctionnalités optimisées sur les réseaux sociaux, ainsi que des publicités personnalisées. Acceptez-vous ces cookies ainsi que les implications associées à l\'utilisation de vos données personnelles ?
Ce magasin vous demande d\'accepter les cookies afin d\'optimiser les performances, les fonctionnalités des réseaux sociaux et la pertinence de la publicité. Les cookies tiers liés aux réseaux sociaux et à la publicité sont utilisés pour vous offrir des fonctionnalités optimisées sur les réseaux sociaux, ainsi que des publicités personnalisées. Acceptez-vous ces cookies ainsi que les implications associées à l\'utilisation de vos données personnelles ?
Niniejsza witryna wykorzystuje pliki cookies w celu świadczenia usług na najwyższym poziomie i w sposób dostosowany do indywidualnych potrzeb. Korzystanie z witryny bez zmiany ustawień dotyczących cookies oznacza, że będą one zamieszczane w urządzeniu końcowym. Jeśli nie akceptujesz opuść tę stronę internetową.
Acest magazin vă solicită să acceptați cookie-uri pentru performanță, media și publicitate. Mediile sociale și cookie-urile de publicitate ale unor terțe părți sunt utilizate pentru a vă oferi funcții de social media și anunțuri personalizate. Acceptați aceste cookie-uri și procesarea datelor personale implicate?
Esta loja pede-te para aceitares cookies para efeitos de desempenho, redes sociais e publicidade. Os cookies de publicidade e de redes sociais de terceiros são utilizados para te oferecer funcionalidades sociais e anúncios personalizados. Aceitas estes cookies e o processamento de dados pessoais envolvidos?
Náš obchod používa súbory cookie za účelom zabezpečenia nevyhnutnej funkcionality stránok, sociálnych médií a marketingu. Súhlasíte s týmito súbormi cookies a spracovaním príslušných osobných údajov?
Deze winkel vraagt je om cookies te accepteren voor betere prestaties en voor sociale-media- en advertentiedoeleinden. Er worden sociale-media- en advertentiecookies van derden gebruikt om je sociale-mediafunctionaliteit en persoonlijke advertenties te bieden. Accepteer je deze cookies en de bijbehorende verwerking van je persoonsgegevens?
Für eine optimal Performance, eine reibungslose Verwendung sozialer Medien und aus Werbezwecken empfiehlt dir dieser Laden, der Verwendung von Cookies zuzustimmen. Durch Cookies von sozialen Medien und Werbecookies von Drittparteien hast du Zugriff auf Social-Media-Funktionen und erhältst personalisierte Werbung. Stimmst du der Verwendung dieser Cookies und der damit verbundenen Verarbeitung deiner persönlichen Daten zu?
Αυτό το κατάστημα σου ζητά να αποδεχτείς τα cookies για σκοπούς απόδοσης, κοινωνικής δικτύωσης και διαφήμισης. Τα cookies κοινωνικής δικτύωσης και διαφήμισης παρέχονται από τρίτα μέρη για να σου προσφέρουν λειτουργίες κοινωνικής δικτύωσης και εξατομικευμένες διαφημίσεις. Αποδέχεσαι αυτά τα cookies και την συνεπαγόμενη επεξεργασία προσωπικών δεδομένων;
';
+
+ // Italian
+ $langCode = 'it';
+ $cookiesDefault['title'][$langCode] = 'Impostazioni dei cookie';
+ $cookiesDefault['text'][$langCode] = '
Questo negozio richiede di accettare i cookie per scopi legati a prestazioni, social media e annunci pubblicitari. I cookie di terze parti per social media e a scopo pubblicitario vengono utilizzati per offrire funzionalità social e annunci pubblicitari personalizzati. Accetti i cookie e l\'elaborazione dei dati personali interessati?
Denna butik ber dig att godkänna cookies för anpassning av prestanda, sociala medier och marknadsföring. Tredjepartscookies för sociala medier och marknadsföring används för att erbjuda anpassade annonser och funktioner för sociala medier. Godkänner du dessa cookies och behandlingen av berörda personuppgifter?
';
+
+ // Dansk
+ $langCode = 'da';
+ $cookiesDefault['title'][$langCode] = 'Dine indstillinger for cookies';
+ $cookiesDefault['text'][$langCode] = '
Denne butik beder dig om at acceptere cookies til performance, sociale medier og reklameformål. Sociale medier og tredjeparts annoncecookies bruges til at tilbyde dig funktionaliteter og tilpassede annoncer på sociale medier. Vil du acceptere disse cookies og behandlingen af implicerede personoplysninger?
';
+
+ // Norsk
+ $langCode = 'no';
+ $cookiesDefault['title'][$langCode] = 'Dine innstillinger for informasjonskapsler';
+ $cookiesDefault['text'][$langCode] = '
Denne butikken spør om du godtar informasjonskapsler for ytelsesformål, sosiale medier og annonsering. Informasjonskapsler for sosiale medier og annonsering fra tredjeparter brukes for å tilby deg funksjoner på sosiale medier og tilpassede annonser. Godtar du disse informasjonskapslene og den involverte behandlingen av personopplysningene dine?
Společnost tento obchod žádá o tvůj souhlas s používáním souborů cookie pro účely výkonu, sociálních médií a reklamy. Sociální média a reklamní soubory cookie třetích stran používáme k tomu, abychom ti mohli nabízet funkce sociálních médií a přizpůsobenou reklamu. Další informace nebo doplnění nastavení získáš kliknutím na tlačítko „Více informací“ nebo otevřením nabídky „Nastavení souborů cookie“ v dolní části webové stránky. Podrobnější informace o souborech cookie a zpracování tvých osobních údajů najdeš v našich Zásadách ochrany osobních údajů a používání souborů cookie. Souhlasíš s používáním souborů cookie a zpracováním souvisejících osobních údajů?
Ez a bolt a megfelelő teljesítmény és a közösségimédia-funkciók biztosításához, valamint a hirdetések megjelenítéséhez kéri a cookie-k elfogadását. A harmadik felek közösségimédia- és hirdetési cookie-jai használatával biztosítunk közösségimédia-funkciókat, és jelenítünk meg személyre szabott reklámokat. Ha több információra van szükséged, vagy kiegészítenéd a beállításaidat, kattints a További információ gombra, vagy keresd fel a webhely alsó részéről elérhető Cookie-beállítások területet. A cookie-kkal kapcsolatos további információért, valamint a személyes adatok feldolgozásának ismertetéséért tekintsd meg Adatvédelmi és cookie-kra vonatkozó szabályzatunkat. Elfogadod ezeket a cookie-kat és az érintett személyes adatok feldolgozását?
';
+
+ $cookiesDefault['cookie'][CookiesPlusFinality::NECESSARY_COOKIE] = CookiesPlusFinality::getDefaultValues(CookiesPlusFinality::NECESSARY_COOKIE);
+ $cookiesDefault['cookie'][CookiesPlusFinality::PREFERENCE_COOKIE] = CookiesPlusFinality::getDefaultValues(CookiesPlusFinality::PREFERENCE_COOKIE);
+ $cookiesDefault['cookie'][CookiesPlusFinality::STATISTIC_COOKIE] = CookiesPlusFinality::getDefaultValues(CookiesPlusFinality::STATISTIC_COOKIE);
+ $cookiesDefault['cookie'][CookiesPlusFinality::MARKETING_COOKIE] = CookiesPlusFinality::getDefaultValues(CookiesPlusFinality::MARKETING_COOKIE);
+ // $cookiesDefault['cookie'][CookiesPlusFinality::UNCLASSIFIED_COOKIE] = CookiesPlusFinality::getDefaultValues(CookiesPlusFinality::UNCLASSIFIED_COOKIE);
+ // $cookiesDefault['cookie'][CookiesPlusFinality::PERFORMANCE_COOKIE] = CookiesPlusFinality::getDefaultValues(CookiesPlusFinality::PERFORMANCE_COOKIE);
+
+ $fields = [];
+ $languages = Language::getLanguages(false);
+ foreach ($languages as $lang) {
+ $languageCode = strtok($lang['language_code'], '-');
+
+ $fields['C_P_TITLE'][$lang['id_lang']] = (isset($cookiesDefault['title'][$languageCode]) && $cookiesDefault['title'][$languageCode]) ? $cookiesDefault['title'][$languageCode] : $cookiesDefault['title']['en'];
+ $fields['C_P_TEXT_BASIC'][$lang['id_lang']] = (isset($cookiesDefault['text'][$languageCode]) && $cookiesDefault['text'][$languageCode]) ? $cookiesDefault['text'][$languageCode] : $cookiesDefault['text']['en'];
+ }
+
+ Configuration::updateValue('C_P_TITLE', $fields['C_P_TITLE'], true);
+ Configuration::updateValue('C_P_TEXT_BASIC', $fields['C_P_TEXT_BASIC'], true);
+
+ $modules = Module::getModulesOnDisk(true);
+ if (Shop::isFeatureActive()) {
+ $shops = Shop::getShops(false, null, true);
+ } else {
+ $shops = [1];
+ }
+
+ foreach ($shops as $shop) {
+ foreach ($cookiesDefault['cookie'] as $cookiesPlusFinalityId => $cookieDefault) {
+ $cookiesPlusFinality = new CookiesPlusFinality();
+ $cookiesPlusFinality->id_shop = $shop;
+ $cookiesPlusFinality->technical = (isset($cookieDefault['technical']) && $cookieDefault['technical']) ? $cookieDefault['technical'] : 0;
+ $cookiesPlusFinality->active = (isset($cookieDefault['active']) && $cookieDefault['active']) ? $cookieDefault['active'] : 0;
+ $cookiesPlusFinality->position = $cookieDefault['position'];
+
+ if (isset($cookieDefault['modules']) && $cookieDefault['modules']) {
+ $modulesIds = [];
+ foreach ($modules as $module) {
+ if ($module->installed && in_array($module->name, $cookieDefault['modules'])) {
+ $modulesIds[] = $module->id;
+ }
+ }
+
+ $cookiesPlusFinality->modules = json_encode($modulesIds);
+
+ // If store has any of the modules, enable this finality
+ if ($modulesIds) {
+ $cookiesPlusFinality->active = 1;
+ }
+ }
+
+ foreach ($languages as $lang) {
+ $languageCode = strtok($lang['language_code'], '-');
+ $cookiesPlusFinality->name[$lang['id_lang']] = (isset($cookieDefault['name'][$languageCode]) && $cookieDefault['name'][$languageCode]) ? $cookieDefault['name'][$languageCode] : $cookieDefault['name']['en'];
+ $cookiesPlusFinality->description[$lang['id_lang']] = (isset($cookieDefault['description'][$languageCode]) && $cookieDefault['description'][$languageCode]) ? $cookieDefault['description'][$languageCode] : $cookieDefault['description']['en'];
+ }
+
+ $result = $cookiesPlusFinality->save();
+
+ if ($cookiesPlusFinalityId === CookiesPlusFinality::STATISTIC_COOKIE) {
+ $cookiesPlusStatisticFinalityId = $cookiesPlusFinality->id;
+ }
+
+ if ($cookiesPlusFinalityId === CookiesPlusFinality::MARKETING_COOKIE) {
+ $cookiesPlusMarketingFinalityId = $cookiesPlusFinality->id;
+ }
+
+ if (!$result) {
+ return false;
+ }
+
+ if (isset($cookieDefault['cookies']) && $cookieDefault['cookies']) {
+ foreach ($cookieDefault['cookies'] as $cookie) {
+ $cookiesPlusCookie = new CookiesPlusCookie();
+ $cookiesPlusCookie->id_shop = $shop;
+ $cookiesPlusCookie->id_cookiesplus_finality = $cookiesPlusFinality->id;
+ $cookiesPlusCookie->active = $cookie['active'];
+
+ $cookiesPlusCookie->name = $cookie['name'];
+ $cookiesPlusCookie->provider = isset($cookie['provider']) ? $cookie['provider'] : '';
+ $cookiesPlusCookie->provider_url = isset($cookie['provider_url']) ? $cookie['provider_url'] : '';
+
+ // If store has any of the modules, enable this finality
+ if (isset($cookie['modules']) && $cookie['modules']) {
+ foreach ($modules as $module) {
+ if ($module->installed && isset($module->name) && in_array($module->name, $cookie['modules'])) {
+ $cookiesPlusCookie->active = 1;
+ $cookiesPlusFinality = new CookiesPlusFinality($cookiesPlusFinality->id);
+ $cookiesPlusFinality->active = 1;
+ // $cookiesPlusFinality->save();
+ break;
+ }
+ }
+ }
+
+ foreach ($languages as $lang) {
+ $languageCode = strtok($lang['language_code'], '-');
+
+ if (isset($cookie['purpose']['en'])) {
+ $cookiesPlusCookie->purpose[$lang['id_lang']] = (isset($cookie['purpose'][$languageCode]) && $cookie['purpose'][$languageCode]) ? $cookie['purpose'][$languageCode] : $cookie['purpose']['en'];
+ }
+
+ if (isset($cookie['expiry']['en'])) {
+ $cookiesPlusCookie->expiry[$lang['id_lang']] = (isset($cookie['expiry'][$languageCode]) && $cookie['expiry'][$languageCode]) ? $cookie['expiry'][$languageCode] : $cookie['expiry']['en'];
+ }
+ }
+
+ $cookiesPlusCookie->save();
+ }
+ }
+ }
+
+ // GTM
+ $gtm = [
+ $cookiesPlusStatisticFinalityId => [
+ 'cookiesPlusFinality' => $cookiesPlusStatisticFinalityId,
+ 'gtmFinality' => [
+ 'analytics_storage' => true,
+ ],
+ 'firingEvent' => '',
+ ],
+ $cookiesPlusMarketingFinalityId => [
+ 'cookiesPlusFinality' => $cookiesPlusMarketingFinalityId,
+ 'gtmFinality' => [
+ 'ad_storage' => true,
+ 'ad_user_data' => true,
+ 'ad_personalization' => true,
+ ],
+ 'firingEvent' => '',
+ ],
+ ];
+ $gtm = json_encode($gtm);
+ Configuration::updateValue('C_P_GTM_CONSENT', $gtm, false, null, $shop);
+ }
+
+ return true;
+ }
+
+ public function getContent()
+ {
+ Tools::redirectAdmin('index.php?controller=AdminCookiesPlusConfiguration&token=' . Tools::getAdminTokenLite('AdminCookiesPlusConfiguration'));
+ }
+
+ public function getWarnings($getAll = true)
+ {
+ $warnings = [];
+
+ if (Configuration::get('PS_DISABLE_NON_NATIVE_MODULE')) {
+ $warnings[] = sprintf($this->l('%1$s "%2$s" at %3$s - %4$s'), $this->l('Disable'), $this->l('Disable non PrestaShop modules'), $this->l('Advanced Parameters'), $this->l('Performance'));
+ }
+
+ if (Configuration::get('PS_DISABLE_OVERRIDES')) {
+ $warnings[] = sprintf($this->l('%1$s "%2$s" at %3$s - %4$s'), $this->l('Disable'), $this->l('Disable all overrides'), $this->l('Advanced Parameters'), $this->l('Performance'));
+ }
+
+ $cookiesPlusFinalitiesList = CookiesPlusFinality::getCookiesPlusFinalities();
+ $atLeastOneFinalityNonTechnical = false;
+ $atLeastOneFinalityTechnical = false;
+ foreach ($cookiesPlusFinalitiesList as $cookiesPlusFinality) {
+ if ($cookiesPlusFinality['active'] && $cookiesPlusFinality['technical']) {
+ $atLeastOneFinalityTechnical = true;
+ }
+
+ if ($cookiesPlusFinality['active'] && !$cookiesPlusFinality['technical']) {
+ $atLeastOneFinalityNonTechnical = true;
+ }
+ }
+
+ // If there's any technical cookie finality enabled
+ if (!$atLeastOneFinalityTechnical) {
+ $warnings[] = $this->l('Please check "Cookie finalities". You need to enable at least one technical cookie finality.');
+ }
+
+ // If there's only technical cookies, there's no need to display the warnings
+ if (!$atLeastOneFinalityNonTechnical) {
+ $warnings[] = $this->l('Please check "Cookie finalities". You need to enable at least one non-technical cookie finality. If there\'s only technical cookies finalities enabled, the cookie notice will not be displayed');
+ }
+
+ /*if (Module::isInstalled('litespeedcache')) {
+ $warnings[] = $this->l('It seems that you are using litespeedcache cache. An additional configuration in this module may be required.');
+ }
+
+ if (Module::isInstalled('stadvancedcache')) {
+ $warnings[] = $this->l('It seems that you are using stadvancedcache cache. An additional configuration in this module may be required.');
+ }
+
+ if (Module::isInstalled('jprestaspeedpack')) {
+ $warnings[] = $this->l('It seems that you are using jprestaspeedpack cache. An additional configuration in this module may be required.');
+ }*/
+ if (Module::isInstalled('litespeedcache')
+ || Module::isInstalled('stadvancedcache')
+ || Module::isInstalled('jprestaspeedpack')
+ || Module::isInstalled('pagecache')) {
+ $warnings[] = $this->l('If you are using a cache module please ensure that the cookies module is working correctly.');
+ }
+
+ if (count($warnings) && version_compare(_PS_VERSION_, '1.6.1', '<')) {
+ return $warnings[0];
+ }
+
+ if (!$getAll && count($warnings)) {
+ return $warnings[0];
+ }
+
+ return $warnings;
+ }
+
+ public function getModuleList()
+ {
+ $query = 'SELECT m.`id_module`, m.`name`
+ FROM `' . _DB_PREFIX_ . 'module` m';
+
+ $module_list = Db::getInstance()->executeS($query);
+
+ foreach ($module_list as $key => &$module) {
+ $module['displayName'] = Module::getModuleName($module['name']);
+
+ if ((int) $module['id_module'] === 0) {
+ unset($module_list[$key]);
+ }
+
+ if ($module['name'] === $this->name) {
+ unset($module_list[$key]);
+ }
+ }
+ unset($module);
+
+ usort($module_list, static function ($a, $b) {
+ return strnatcasecmp($a['displayName'], $b['displayName']);
+ });
+
+ return $module_list;
+ }
+
+ protected static function executeModule()
+ {
+ if (!Configuration::get('C_P_ENABLE')) {
+ return false;
+ }
+
+ // Validate allowed IPs
+ if (Configuration::get('C_P_DEBUG') && !self::onlyIPDebug()) {
+ return false;
+ }
+
+ // Validate user agent
+ if (self::byPassUserAgent()) {
+ return false;
+ }
+
+ // Validate disallow IPs
+ if (self::bypassIP()) {
+ return false;
+ }
+
+ return true;
+ }
+
+ protected static function getGeo()
+ {
+ // Don't display outside EU
+ if (Configuration::get('PS_GEOLOCATION_ENABLED')
+ && !Configuration::get('C_P_GEO')
+ && !in_array(Tools::getRemoteAddr(), ['localhost', '127.0.0.1', '::1'])) {
+ // Check if Maxmind Database exists
+ if (@filemtime(_PS_GEOIP_DIR_ . _PS_GEOIP_CITY_FILE_)) {
+ if (version_compare(_PS_VERSION_, '1.7', '<')) {
+ include_once _PS_GEOIP_DIR_ . 'geoipcity.inc';
+
+ $gi = geoip_open(realpath(_PS_GEOIP_DIR_ . _PS_GEOIP_CITY_FILE_), GEOIP_STANDARD);
+ $record = geoip_record_by_addr($gi, Tools::getRemoteAddr());
+
+ if (is_object($record)
+ && $record->continent_code
+ && $record->continent_code !== 'EU') {
+ return false;
+ }
+ } else {
+ $reader = new GeoIp2\Database\Reader(_PS_GEOIP_DIR_ . _PS_GEOIP_CITY_FILE_);
+ try {
+ $record = $reader->city(Tools::getRemoteAddr());
+ } catch (GeoIp2\Exception\AddressNotFoundException $e) {
+ $record = null;
+ }
+
+ if (is_object($record)
+ && $record->continent->code
+ && $record->continent->code !== 'EU') {
+ return false;
+ }
+ }
+ }
+ }
+
+ return true;
+ }
+
+ protected static function byPassUserAgent()
+ {
+ if (isset($_SERVER['HTTP_USER_AGENT'])
+ && Configuration::get('C_P_BOTS')
+ && preg_match('/' . Configuration::get('C_P_BOTS') . '/i', $_SERVER['HTTP_USER_AGENT'])) {
+ return true;
+ }
+
+ return false;
+ }
+
+ protected static function bypassIP()
+ {
+ if (Configuration::get('C_P_IPS')
+ && in_array(Tools::getRemoteAddr(), explode('|', Configuration::get('C_P_IPS')))) {
+ return true;
+ }
+
+ return false;
+ }
+
+ protected static function onlyIPDebug()
+ {
+ if (!Configuration::get('C_P_IPS_DEBUG')) {
+ return true;
+ }
+
+ if (in_array(Tools::getRemoteAddr(), explode('|', Configuration::get('C_P_IPS_DEBUG')))) {
+ return true;
+ }
+
+ return false;
+ }
+
+ public function getCookiesPlusCookiesList()
+ {
+ $idCookiesPlusFinality = (int) Tools::getValue('id_cookiesplus_finality');
+
+ if (!Tools::getIsset('addcookiesplus_finality') && !$idCookiesPlusFinality) {
+ return $this->displayError('Error loading cookies');
+ }
+
+ $cookiesPlusCookiesList = CookiesPlusCookie::getCookiesPlusCookies($idCookiesPlusFinality, null, false, $this->context->shop->id);
+
+ $fields_list = [
+ 'active' => [
+ 'title' => $this->l('Enabled'),
+ 'active' => 'active',
+ 'type' => 'bool',
+ ],
+ 'name' => [
+ 'title' => $this->l('Cookie name'),
+ 'filter_key' => 'a!name',
+ ],
+ 'provider' => [
+ 'title' => $this->l('Provider'),
+ ],
+ 'purpose' => [
+ 'title' => $this->l('Purpose'),
+ 'callback' => 'getCookiePurposeCallback',
+ 'callback_object' => 'CookiesPlusCookie',
+ ],
+ 'expiry' => [
+ 'title' => $this->l('Expiry'),
+ ],
+ ];
+
+ $helperList = new HelperList();
+
+ $helperList->shopLinkType = '';
+ $helperList->simple_header = false;
+ $helperList->show_toolbar = true;
+ $helperList->module = $this;
+ $helperList->actions = ['edit', 'deletecookie'];
+ $helperList->identifier = 'id_cookiesplus_cookie';
+ $helperList->table = 'cookiesplus_cookie';
+ $helperList->token = Tools::getAdminTokenLite('AdminCookiesPlusCookies');
+ $helperList->currentIndex = $this->context->link->getAdminLink('AdminCookiesPlusCookies', false) . '&back=1&id_cookiesplus_finality=' . (int) Tools::getValue('id_cookiesplus_finality');
+
+ $helperList->title = $this->l('Cookies detail');
+
+ if (!Tools::getIsset('addcookiesplus_finality')) {
+ $helperList->toolbar_btn['new'] = [
+ 'href' => $helperList->currentIndex . '&add' . $helperList->table . '&token=' . $helperList->token . '&id_cookiesplus_finality=' . Tools::getValue('id_cookiesplus_finality'),
+ 'desc' => $this->l('Add new'),
+ ];
+ }
+
+ $helperList->listTotal = count($cookiesPlusCookiesList);
+
+ return $helperList->generateList($cookiesPlusCookiesList, $fields_list);
+ }
+
+ public function displayDeleteCookieLink($token = null, $id = null, $name = null)
+ {
+ $tpl = $this->context->smarty->createTemplate('helpers/list/list_action_delete.tpl');
+
+ $tpl->assign([
+ 'href' => $this->context->link->getAdminLink('AdminCookiesPlusCookies', false) . '&id_cookiesplus_cookie=' . $id . '&deletecookiesplus_cookie&token=' . $token,
+ 'confirm' => $this->l('Delete the selected item?') . $name,
+ 'action' => $this->l('Delete'),
+ 'consent_hash' => $id,
+ ]);
+
+ return $tpl->fetch();
+ }
+
+ /* Hooks */
+ public function hookDisplayAfterTitle($params)
+ {
+ return $this->hookDisplayAfterTitleTag($params);
+ }
+
+ public function hookDisplayAfterTitleTag()
+ {
+ if (Module::isInstalled('cdc_googletagmanager')) {
+ $html = '';
+
+ if (Configuration::get('C_P_GTM_ENABLE')) {
+ $cookiesPlusCookiePreferences = self::getCookiesPlusCookiePreferences();
+
+ $gtmConsents = json_decode(Configuration::get('C_P_GTM_CONSENT'), true);
+ $cookiesPlusFinalities = CookiesPlusFinality::getCookiesPlusFinalities((int) $this->context->language->id, true);
+ $gtm = [];
+ foreach ($cookiesPlusFinalities as $cookiesPlusFinality) {
+ $index = 'cookiesplus-finality-' . (int) $cookiesPlusFinality['id_cookiesplus_finality'];
+ if (isset($cookiesPlusCookiePreferences[$index], $gtmConsents[(int) $cookiesPlusFinality['id_cookiesplus_finality']])) {
+ foreach (array_keys($gtmConsents[(int)$cookiesPlusFinality['id_cookiesplus_finality']]['gtmFinality']) as $gtmFinality) {
+ if ($cookiesPlusCookiePreferences[$index] === 'on') {
+ if (isset($gtmConsents[(int)$cookiesPlusFinality['id_cookiesplus_finality']]['gtmFinality'][$gtmFinality])
+ && $gtmConsents[(int)$cookiesPlusFinality['id_cookiesplus_finality']]['gtmFinality'][$gtmFinality]) {
+ $gtm[(int)$cookiesPlusFinality['id_cookiesplus_finality']][$gtmFinality] = true;
+ } else {
+ $gtm[(int)$cookiesPlusFinality['id_cookiesplus_finality']][$gtmFinality] = false;
+ }
+
+ } else {
+ $gtm[(int)$cookiesPlusFinality['id_cookiesplus_finality']][$gtmFinality] = false;
+ }
+ }
+ }
+ }
+
+ $this->context->smarty->assign([
+ 'gtm' => $gtm,
+ ]);
+
+ $html .= $this->context->smarty->fetch($this->local_path . 'views/templates/hook/gtm_consentmode.tpl');
+ }
+
+ if (Configuration::get('C_P_GTM_ENABLE')) {
+ $html .= Configuration::get('C_P_GTM_HEAD');
+ } else {
+ $random = Tools::substr(md5(microtime()), 0, 10);
+ $divName = 'hookDisplayAfterTitleTag_' . $this->id . '_' . $random;
+
+ $this->context->smarty->assign([
+ 'divName' => $divName,
+ 'id_module' => $this->id,
+ 'finalities' => implode(',', array_keys(json_decode(Configuration::get('C_P_GTM_FIRE_CONSENT'), true) ?? []) ?: []),
+ 'script' => json_encode(Configuration::get('C_P_GTM_HEAD')),
+ 'js' => '[]',
+ 'css' => '[]',
+ ]);
+
+ $html .= $this->context->smarty->fetch($this->local_path . 'views/templates/hook/hookmoduledata.tpl');
+ }
+
+ return $html;
+ }
+ }
+
+ /* Don't place in this header anything that can NOT be cachable */
+ public function hookHeader()
+ {
+ return $this->hookDisplayHeader();
+ }
+
+ public function hookDisplayHeader()
+ {
+ $cookiesPlusCookiePreferences = self::getCookiesPlusCookiePreferences();
+ if (isset($cookiesPlusCookiePreferences['consent_date'])
+ && date('Y-m-d H:i', strtotime(Configuration::get('C_P_REVOKE_CONSENT'))) > date('Y-m-d H:i', strtotime($cookiesPlusCookiePreferences['consent_date']))) {
+ $this->resetCookiesPlusPreferences();
+ }
+
+ // Check if consent file exists
+ if (Configuration::get('C_P_SAVE_CONSENT')) {
+ if (isset($cookiesPlusCookiePreferences['consent_hash'])) {
+ if (!CookiesPlusUserConsent::getCookiesPlusUserConsentDataByHash($cookiesPlusCookiePreferences['consent_hash'])) {
+ $this->resetCookiesPlusPreferences();
+ }
+ }
+ }
+
+ $this->context->controller->addCSS(_MODULE_DIR_ . $this->name . '/views/css/cookiesplus.css');
+ if (Configuration::get('C_P_MATERIAL_ICONS')) {
+ $this->context->controller->addCSS(_MODULE_DIR_ . $this->name . '/views/css/cookiesplus-material-icons.css');
+ // $html .= '';
+ }
+
+ if (version_compare(_PS_VERSION_, '1.7', '<')) {
+ $this->context->controller->addJS(_MODULE_DIR_ . $this->name . '/views/js/cookiesplus-front.js');
+ } else {
+ $this->context->controller->registerJavascript(
+ 'cookiesplus-front',
+ 'modules/' . $this->name . '/views/js/cookiesplus-front.js',
+ [
+ 'attributes' => 'async',
+ ]
+ );
+ }
+
+ // Just assign to smarty, in case user add an IF condition in template for a custom script
+ $this->context->smarty->assign([
+ 'C_P_COOKIE_VALUE' => (array) $cookiesPlusCookiePreferences,
+ ]);
+
+ $this->context->smarty->assign([
+ 'C_P_CSS' => Configuration::get('C_P_CSS'),
+ 'C_P_BACKGROUND_COLOR' => Configuration::get('C_P_BACKGROUND_COLOR'),
+ 'C_P_FONT_COLOR' => Configuration::get('C_P_FONT_COLOR'),
+ 'C_P_BUTTON_POSITION' => Configuration::get('C_P_BUTTON_POSITION'),
+ 'C_P_ACCEPT_DISPLAY' => Configuration::get('C_P_ACCEPT_DISPLAY'),
+ 'C_P_ACCEPT_BACKGROUND_COLOR' => Configuration::get('C_P_ACCEPT_BACKGROUND_COLOR'),
+ 'C_P_ACCEPT_BORDER_COLOR' => Configuration::get('C_P_ACCEPT_BORDER_COLOR'),
+ 'C_P_ACCEPT_FONT_COLOR' => Configuration::get('C_P_ACCEPT_FONT_COLOR'),
+ 'C_P_ACCEPT_FONT_SIZE' => Configuration::get('C_P_ACCEPT_FONT_SIZE'),
+ 'C_P_ACCEPT_PADDING' => Configuration::get('C_P_ACCEPT_PADDING'),
+ 'C_P_MORE_INFO_DISPLAY' => Configuration::get('C_P_MORE_INFO_DISPLAY'),
+ 'C_P_MORE_INFO_BACKGROUND_COLOR' => Configuration::get('C_P_MORE_INFO_BACKGROUND_COLOR'),
+ 'C_P_MORE_INFO_BORDER_COLOR' => Configuration::get('C_P_MORE_INFO_BORDER_COLOR'),
+ 'C_P_MORE_INFO_FONT_COLOR' => Configuration::get('C_P_MORE_INFO_FONT_COLOR'),
+ 'C_P_MORE_INFO_FONT_SIZE' => Configuration::get('C_P_MORE_INFO_FONT_SIZE'),
+ 'C_P_MORE_INFO_PADDING' => Configuration::get('C_P_MORE_INFO_PADDING'),
+ 'C_P_REJECT_DISPLAY' => Configuration::get('C_P_REJECT_DISPLAY'),
+ 'C_P_REJECT_BACKGROUND_COLOR' => Configuration::get('C_P_REJECT_BACKGROUND_COLOR'),
+ 'C_P_REJECT_BORDER_COLOR' => Configuration::get('C_P_REJECT_BORDER_COLOR'),
+ 'C_P_REJECT_FONT_COLOR' => Configuration::get('C_P_REJECT_FONT_COLOR'),
+ 'C_P_REJECT_FONT_SIZE' => Configuration::get('C_P_REJECT_FONT_SIZE'),
+ 'C_P_REJECT_PADDING' => Configuration::get('C_P_REJECT_PADDING'),
+ 'C_P_SAVE_BACKGROUND_COLOR' => Configuration::get('C_P_SAVE_BACKGROUND_COLOR'),
+ 'C_P_SAVE_BORDER_COLOR' => Configuration::get('C_P_SAVE_BORDER_COLOR'),
+ 'C_P_SAVE_FONT_COLOR' => Configuration::get('C_P_SAVE_FONT_COLOR'),
+ 'C_P_SAVE_FONT_SIZE' => Configuration::get('C_P_SAVE_FONT_SIZE'),
+ 'C_P_SAVE_PADDING' => Configuration::get('C_P_SAVE_PADDING'),
+ 'C_P_MATERIAL_ICONS_LIBRARY' => Configuration::get('C_P_MATERIAL_ICONS_LIBRARY'),
+ 'C_P_ICONS' => Configuration::get('C_P_ICONS'),
+ 'C_P_TAB_ENABLED' => Configuration::get('C_P_TAB_ENABLED'),
+ 'C_P_TAB_POSITION' => Configuration::get('C_P_TAB_POSITION'),
+ 'C_P_TAB_BACKGROUND_COLOR' => Configuration::get('C_P_TAB_BACKGROUND_COLOR'),
+ 'C_P_TAB_FONT_COLOR' => Configuration::get('C_P_TAB_FONT_COLOR'),
+ ]);
+
+ $html = $this->context->smarty->fetch($this->local_path . 'views/templates/hook/cookies-style.tpl');
+
+ if (!Module::isInstalled('cdc_googletagmanager')) {
+ if (Configuration::get('C_P_GTM_ENABLE')) {
+ $gtmConsents = json_decode(Configuration::get('C_P_GTM_CONSENT'), true);
+ $cookiesPlusFinalities = CookiesPlusFinality::getCookiesPlusFinalities((int) $this->context->language->id, true);
+ $gtm = [];
+ foreach ($cookiesPlusFinalities as $cookiesPlusFinality) {
+ $index = 'cookiesplus-finality-' . (int) $cookiesPlusFinality['id_cookiesplus_finality'];
+ if (isset($cookiesPlusCookiePreferences[$index], $gtmConsents[(int) $cookiesPlusFinality['id_cookiesplus_finality']])) {
+ foreach (array_keys($gtmConsents[(int)$cookiesPlusFinality['id_cookiesplus_finality']]['gtmFinality']) as $gtmFinality) {
+ if ($cookiesPlusCookiePreferences[$index] === 'on') {
+ if (isset($gtmConsents[(int)$cookiesPlusFinality['id_cookiesplus_finality']]['gtmFinality'][$gtmFinality])
+ && $gtmConsents[(int)$cookiesPlusFinality['id_cookiesplus_finality']]['gtmFinality'][$gtmFinality]) {
+ $gtm[(int)$cookiesPlusFinality['id_cookiesplus_finality']][$gtmFinality] = true;
+ } else {
+ $gtm[(int)$cookiesPlusFinality['id_cookiesplus_finality']][$gtmFinality] = false;
+ }
+
+ } else {
+ $gtm[(int)$cookiesPlusFinality['id_cookiesplus_finality']][$gtmFinality] = false;
+ }
+ }
+ }
+ }
+
+ if (!empty($gtm)) {
+ $this->context->smarty->assign([
+ 'gtm' => call_user_func_array('array_merge', $gtm),
+ ]);
+ }
+
+ $html .= $this->context->smarty->fetch($this->local_path . 'views/templates/hook/gtm_consentmode.tpl');
+ }
+
+ if (Configuration::get('C_P_GTM_ENABLE')) {
+ $html .= Configuration::get('C_P_GTM_HEAD');
+ } elseif (Configuration::get('C_P_GTM_FIRE_CONSENT')) {
+ $random = Tools::substr(md5(microtime()), 0, 10);
+ $divName = 'hookDisplayHeader' . $this->id . '_' . $random;
+
+ $this->context->smarty->assign([
+ 'divName' => $divName,
+ 'id_module' => $this->id,
+ 'finalities' => implode(',', array_keys(json_decode(Configuration::get('C_P_GTM_FIRE_CONSENT'), true)) ?: []),
+ 'script' => json_encode(Configuration::get('C_P_GTM_HEAD')),
+ 'js' => '[]',
+ 'css' => '[]',
+ ]);
+
+ $html .= $this->context->smarty->fetch($this->local_path . 'views/templates/hook/hookmoduledata.tpl');
+ }
+ }
+
+ return $html;
+ }
+
+ public function hookDisplayAfterBodyOpeningTag()
+ {
+ $html = '';
+
+ if (Configuration::get('C_P_GTM_ENABLE')) {
+ $html .= Configuration::get('C_P_GTM_BODY');
+ } elseif (Configuration::get('C_P_GTM_FIRE_CONSENT')) {
+ $random = Tools::substr(md5(microtime()), 0, 10);
+ $divName = 'hookDisplayAfterBodyOpeningTag_' . $this->id . '_' . $random;
+
+ $this->context->smarty->assign([
+ 'divName' => $divName,
+ 'id_module' => $this->id,
+ 'finalities' => implode(',', array_keys(json_decode(Configuration::get('C_P_GTM_FIRE_CONSENT'), true)) ?: []),
+ 'script' => json_encode(Configuration::get('C_P_GTM_HEAD')),
+ 'js' => '[]',
+ 'css' => '[]',
+ ]);
+
+ $html .= $this->context->smarty->fetch($this->local_path . 'views/templates/hook/hookmoduledata.tpl');
+ }
+
+ return $html;
+ }
+
+ public function hookDisplayCookiesHeader()
+ {
+ $this->hookDisplayHeader();
+ }
+
+ public function hookFooter()
+ {
+ $html = null;
+
+ $cookiesPlusPreferences = self::getCookiesPlusCookiePreferences();
+
+ // Don't display modal with Creative Elements editor
+ /*if (Tools::isSubmit('cp_type')) {
+ $displayModal = false;
+ }*/
+ // Get scripts from all finalities
+ $script = [];
+ $scriptNot = [];
+ $cookies = [];
+ $gtm = [];
+ $fb = [];
+ if (Configuration::get('C_P_GTM_ENABLE')) {
+ $gtmConsents = json_decode(Configuration::get('C_P_GTM_CONSENT'), true);
+ }
+ if (Configuration::get('C_P_FB_ENABLE')) {
+ $fbConsents = json_decode(Configuration::get('C_P_FB_CONSENT'), true);
+ }
+
+ $cookiesPlusFinalities = CookiesPlusFinality::getCookiesPlusFinalities((int) $this->context->language->id, true);
+ // $atLeastOneFinalityNonTechnical = false;
+ foreach ($cookiesPlusFinalities as &$cookiesPlusFinality) {
+ $cookiesPlusFinality['cookies'] = CookiesPlusCookie::getCookiesPlusCookies($cookiesPlusFinality['id_cookiesplus_finality'], (int) $this->context->language->id, true, $this->context->shop->id);
+ /*if ($cookiesPlusFinality['active'] && !$cookiesPlusFinality['technical']) {
+ $atLeastOneFinalityNonTechnical = true;
+ }*/
+ if ($cookiesPlusFinality['js_script']) {
+ // Strip #', '$1', $cookiesPlusFinality['js_script']);
+
+ // Escape all chars
+ // $cookiesPlusFinality['js_script'] = str_replace('"', "'", $cookiesPlusFinality['js_script']);
+
+ /*$escapers = array("\\", "/", "\"", "\n", "\r", "\t", "\x08", "\x0c", "'",);
+ $replacements = array("\\\\", "\\/", "\\\"", "\\n", "\\r", "\\t", "\\f", "\\b", "\'");
+ $cookiesPlusFinality['js_script'] = str_replace($escapers, $replacements, $cookiesPlusFinality['js_script']);*/
+ // $cookiesPlusFinality['js_script'] = str_replace("\r", "\\r", $cookiesPlusFinality['js_script']);
+ // $cookiesPlusFinality['js_script'] = str_replace("\n", "\\n", $cookiesPlusFinality['js_script']);
+
+ // remove comments
+ // $cookiesPlusFinality['js_script'] = preg_replace('//', '', $cookiesPlusFinality['js_script']);
+
+ // remove tabs, spaces, newlines, etc.
+ // $cookiesPlusFinality['js_script'] = str_replace(array(PHP_EOL, "\t"), '', $cookiesPlusFinality['js_script']);
+ // $cookiesPlusFinality['js_script'] = preg_replace('/\v(?:[\v\h]+)/', '', $cookiesPlusFinality['js_script']);
+ /*$cookiesPlusFinality['js_script'] = str_replace("\n", '', $cookiesPlusFinality['js_script']);
+ $cookiesPlusFinality['js_script'] = str_replace("\r", '', $cookiesPlusFinality['js_script']);
+ $cookiesPlusFinality['js_script'] = str_replace("\t", '', $cookiesPlusFinality['js_script']);*/
+ // remove all spaces
+ // $cookiesPlusFinality['js_script'] = preg_replace('|\s\s+|', ' ', $cookiesPlusFinality['js_script']);
+
+ // Minify fails with
+ /*if (version_compare(_PS_VERSION_, '1.7', '>')) {
+ $script[(int)$cookiesPlusFinality['id_cookiesplus_finality']] = JSMin::minify($cookiesPlusFinality['js_script']);
+ } else {
+ $script[(int)$cookiesPlusFinality['id_cookiesplus_finality']] = $cookiesPlusFinality['js_script'];
+ }*/
+ $script[(int) $cookiesPlusFinality['id_cookiesplus_finality']] = $cookiesPlusFinality['js_script'];
+ }
+
+ if ($cookiesPlusFinality['js_not_script']) {
+ $scriptNot[(int) $cookiesPlusFinality['id_cookiesplus_finality']] = $cookiesPlusFinality['js_not_script'];
+ }
+
+ if ($cookiesPlusFinality['cookies']) {
+ $cookies[(int) $cookiesPlusFinality['id_cookiesplus_finality']] = $cookiesPlusFinality['cookies'];
+ }
+
+ if (Configuration::get('C_P_GTM_ENABLE')) {
+ if ($cookiesPlusFinality['technical']) {
+ continue;
+ }
+
+ if (isset($gtmConsents[(int) $cookiesPlusFinality['id_cookiesplus_finality']])) {
+ if (isset($gtmConsents[(int) $cookiesPlusFinality['id_cookiesplus_finality']]['gtmFinality'])
+ && $gtmConsents[(int) $cookiesPlusFinality['id_cookiesplus_finality']]['gtmFinality']) {
+ $gtm[(int) $cookiesPlusFinality['id_cookiesplus_finality']]['gtmFinality'] = $gtmConsents[$cookiesPlusFinality['id_cookiesplus_finality']]['gtmFinality'];
+ $gtm[(int) $cookiesPlusFinality['id_cookiesplus_finality']]['firingEvent'] = $gtmConsents[$cookiesPlusFinality['id_cookiesplus_finality']]['firingEvent'];
+ }
+ }
+ }
+
+ if (Configuration::get('C_P_FB_ENABLE')) {
+ if ($cookiesPlusFinality['technical']) {
+ continue;
+ }
+
+ if (isset($fbConsents[(int) $cookiesPlusFinality['id_cookiesplus_finality']])) {
+ $fb[(int) $cookiesPlusFinality['id_cookiesplus_finality']] = 'true';
+ }
+ }
+ }
+ unset($cookiesPlusFinality);
+
+ // If there's only technical cookies, there's no need to display the warning
+ /*if (!$atLeastOneFinalityNonTechnical) {
+ $displayModal = false;
+ }*/
+ $script = json_encode($script);
+ $script = self::sanitizeJson($script);
+
+ $scriptNot = json_encode($scriptNot);
+ $scriptNot = self::sanitizeJson($scriptNot);
+
+ $cookies = json_encode($cookies);
+ $cookies = self::sanitizeJson($cookies);
+
+ $gtm = json_encode($gtm);
+ $gtm = self::sanitizeJson($gtm);
+
+ $fb = json_encode($fb);
+ $fb = self::sanitizeJson($fb);
+
+ /*$cookie = array();
+ if (isset($_COOKIE['cookiesplus'])) {
+ $cookie = json_decode($_COOKIE['cookiesplus'], true);
+ }
+
+ $cookieExpiryTime = time() + Configuration::get('C_P_EXPIRY') * 86400;
+ setcookie('cookiesplus', json_encode($cookie), $cookieExpiryTime, '/');
+*/
+ $this->context->smarty->assign([
+ 'C_P_REFRESH' => Configuration::get('C_P_REFRESH'),
+ 'C_P_EXPIRY' => Configuration::get('C_P_EXPIRY') ?: 365,
+ 'C_P_CMS_PAGE' => (int) Configuration::get('C_P_CMS_PAGE'),
+ 'C_P_DATE' => date('Y-m-d H:i', time()),
+ 'C_P_COOKIE_VALUE_JSON' => $cookiesPlusPreferences ? json_encode($cookiesPlusPreferences) : '{}', // empty JSON
+ 'C_P_OVERLAY' => Configuration::get('C_P_OVERLAY'),
+ 'C_P_OVERLAY_OPACITY' => Configuration::get('C_P_OVERLAY_OPACITY'),
+ 'C_P_NOT_AVAILABLE_OUTSIDE_EU' => self::getGeo(), // Don't display modal outside EU
+ 'C_P_FINALITIES_COUNT' => count($cookiesPlusFinalities),
+ 'C_P_SCRIPT' => $script,
+ 'C_P_SCRIPT_NOT' => $scriptNot,
+ 'C_P_COOKIES' => $cookies,
+ 'C_P_GTM' => $gtm,
+ 'C_P_FB' => $fb,
+ ]);
+
+ $html .= $this->context->smarty->fetch($this->local_path . 'views/templates/hook/cookies-notice-vars.tpl');
+
+ if (!self::executeModule()) {
+ return $html;
+ }
+
+ $cpClass = '';
+ if (Configuration::get('C_P_WIDTH') == '100') {
+ $cpClass = 'col-12 col-xs-12';
+ } elseif (Configuration::get('C_P_WIDTH') == '75') {
+ if (Configuration::get('C_P_BUTTON_POSITION') == '2') {
+ $cpClass = 'col-11 col-xs-11 col-md-9';
+ } else {
+ $cpClass = 'col-12 col-xs-12 col-md-9';
+ }
+ } elseif (Configuration::get('C_P_WIDTH') == '50') {
+ if (Configuration::get('C_P_BUTTON_POSITION') == '2') {
+ $cpClass = 'col-11 col-xs-11 col-md-9 col-xl-6';
+ } else {
+ $cpClass = 'col-12 col-xs-12 col-md-9 col-lg-6';
+ }
+ } elseif ((int) Configuration::get('C_P_WIDTH') === 25) {
+ $cpClass = 'col-12 col-xs-12 col-md-6 col-lg-4 col-xl-3';
+ }
+
+ if ($this->context->language->id) {
+ $idLang = $this->context->language->id;
+ } elseif ($this->context->cookie->id_lang) {
+ $idLang = $this->context->cookie->id_lang;
+ } else {
+ $idLang = (int) Configuration::get('PS_LANG_DEFAULT');
+ }
+
+ $this->context->smarty->assign([
+ 'link' => Context::getContext()->link,
+ 'C_P_COOKIE_VALUE' => (array) $cookiesPlusPreferences,
+ 'C_P_POSITION' => Configuration::get('C_P_POSITION'),
+ 'C_P_WIDTH' => Configuration::get('C_P_WIDTH'),
+ 'C_P_CLASS' => $cpClass,
+ 'C_P_BACKGROUND_COLOR' => Configuration::get('C_P_BACKGROUND_COLOR'),
+ 'C_P_FONT_COLOR' => Configuration::get('C_P_FONT_COLOR'),
+ 'C_P_DISPLAY_TITLE' => Configuration::get('C_P_DISPLAY_TITLE'),
+ 'C_P_TITLE' => Configuration::get('C_P_TITLE', $idLang),
+ 'C_P_JS' => Configuration::get('C_P_JS'),
+ 'C_P_TEXT_BASIC' => Configuration::get('C_P_TEXT_BASIC', $idLang),
+ 'C_P_TEXT_REQUIRED' => Configuration::get('C_P_TEXT_REQUIRED', $idLang),
+ 'C_P_TEXT_3RDPARTY' => Configuration::get('C_P_TEXT_3RDPARTY', $idLang),
+ 'C_P_CMS_PAGE' => Configuration::get('C_P_CMS_PAGE'),
+ 'C_P_BUTTON_POSITION' => Configuration::get('C_P_BUTTON_POSITION'),
+ 'C_P_ACCEPT_DISPLAY' => Configuration::get('C_P_ACCEPT_DISPLAY'),
+ 'C_P_ACCEPT_BACKGROUND_COLOR' => Configuration::get('C_P_ACCEPT_BACKGROUND_COLOR'),
+ 'C_P_ACCEPT_BORDER_COLOR' => Configuration::get('C_P_ACCEPT_BORDER_COLOR'),
+ 'C_P_ACCEPT_FONT_COLOR' => Configuration::get('C_P_ACCEPT_FONT_COLOR'),
+ 'C_P_ACCEPT_FONT_SIZE' => Configuration::get('C_P_ACCEPT_FONT_SIZE'),
+ 'C_P_ACCEPT_PADDING' => Configuration::get('C_P_ACCEPT_PADDING'),
+ 'C_P_MORE_INFO_DISPLAY' => Configuration::get('C_P_MORE_INFO_DISPLAY'),
+ 'C_P_MORE_INFO_BACKGROUND_COLOR' => Configuration::get('C_P_MORE_INFO_BACKGROUND_COLOR'),
+ 'C_P_MORE_INFO_BORDER_COLOR' => Configuration::get('C_P_MORE_INFO_BORDER_COLOR'),
+ 'C_P_MORE_INFO_FONT_COLOR' => Configuration::get('C_P_MORE_INFO_FONT_COLOR'),
+ 'C_P_MORE_INFO_FONT_SIZE' => Configuration::get('C_P_MORE_INFO_FONT_SIZE'),
+ 'C_P_MORE_INFO_PADDING' => Configuration::get('C_P_MORE_INFO_PADDING'),
+ 'C_P_REJECT_DISPLAY' => Configuration::get('C_P_REJECT_DISPLAY'),
+ 'C_P_REJECT_BACKGROUND_COLOR' => Configuration::get('C_P_REJECT_BACKGROUND_COLOR'),
+ 'C_P_REJECT_BORDER_COLOR' => Configuration::get('C_P_REJECT_BORDER_COLOR'),
+ 'C_P_REJECT_FONT_COLOR' => Configuration::get('C_P_REJECT_FONT_COLOR'),
+ 'C_P_REJECT_FONT_SIZE' => Configuration::get('C_P_REJECT_FONT_SIZE'),
+ 'C_P_REJECT_PADDING' => Configuration::get('C_P_REJECT_PADDING'),
+ 'C_P_SAVE_BACKGROUND_COLOR' => Configuration::get('C_P_SAVE_BACKGROUND_COLOR'),
+ 'C_P_SAVE_BORDER_COLOR' => Configuration::get('C_P_SAVE_BORDER_COLOR'),
+ 'C_P_SAVE_FONT_COLOR' => Configuration::get('C_P_SAVE_FONT_COLOR'),
+ 'C_P_SAVE_FONT_SIZE' => Configuration::get('C_P_SAVE_FONT_SIZE'),
+ 'C_P_SAVE_PADDING' => Configuration::get('C_P_SAVE_PADDING'),
+ 'C_P_MATERIAL_ICONS_LIBRARY' => Configuration::get('C_P_MATERIAL_ICONS_LIBRARY'),
+ 'C_P_FINALITIES' => $cookiesPlusFinalities,
+ 'C_P_ICONS' => Configuration::get('C_P_ICONS'),
+ 'C_P_TAB_ENABLED' => Configuration::get('C_P_TAB_ENABLED'),
+ 'C_P_TAB_POSITION' => Configuration::get('C_P_TAB_POSITION'),
+ 'C_P_TAB_BACKGROUND_COLOR' => Configuration::get('C_P_TAB_BACKGROUND_COLOR'),
+ 'C_P_TAB_FONT_COLOR' => Configuration::get('C_P_TAB_FONT_COLOR'),
+ 'C_P_SAVE_CONSENT' => (int) Configuration::get('C_P_SAVE_CONSENT'),
+ 'C_P_CONSENT_HASH' => (Configuration::get('C_P_SAVE_CONSENT') && isset($cookiesPlusPreferences['consent_hash'])) ? $cookiesPlusPreferences['consent_hash'] : '',
+ 'C_P_CONSENT_DATE' => isset($cookiesPlusPreferences['consent_date']) ? $cookiesPlusPreferences['consent_date'] : '',
+ 'C_P_REVOKE_CONSENT' => Tools::displayDate(date('Y-m-d', strtotime(Configuration::get('C_P_REVOKE_CONSENT'))), null, false),
+ 'C_P_DISPLAY_DATE' => Configuration::get('C_P_DISPLAY_DATE'),
+ 'C_P_DEFAULT_CONSENT' => Configuration::get('C_P_DEFAULT_CONSENT'),
+ 'download_link' => isset($cookiesPlusPreferences['consent_hash']) ? $this->context->link->getModuleLink('cookiesplus', 'front') . '?hash=' . $cookiesPlusPreferences['consent_hash'] . '&getPdf' : '',
+ ]);
+
+ $html .= $this->display(__FILE__, 'cookies-notice.tpl');
+
+ return $html;
+ }
+
+ public function hookDisplayMobileHeader()
+ {
+ return $this->hookDisplayHeader();
+ }
+
+ public function hookDisplayFooterLinks()
+ {
+ return $this->hookFooter();
+ }
+
+ public function hookDisplayBeforeBodyClosingTag()
+ {
+ return $this->hookFooter();
+ }
+
+ public function hookTmMegaLayoutFooter()
+ {
+ return $this->hookFooter();
+ }
+
+ public function hookBlockFooter1()
+ {
+ return $this->hookFooter();
+ }
+
+ public function hookDisplayFooterBefore()
+ {
+ return $this->hookFooter();
+ }
+
+ public function hookDisplayFooterAfter()
+ {
+ return $this->hookFooter();
+ }
+
+ public function hookDisplaySidebar()
+ {
+ return $this->hookFooter();
+ }
+
+ public function hookDisplayFooterNovOne()
+ {
+ return $this->hookFooter();
+ }
+
+ public function hookDisplayFooterNovTwo()
+ {
+ return $this->hookFooter();
+ }
+
+ public function hookDisplayBanner()
+ {
+ return $this->hookFooter();
+ }
+
+ public function hookDisplayCookies()
+ {
+ return $this->hookFooter();
+ }
+
+ public function hookDisplayMyAccountBlock()
+ {
+ if (!self::executeModule()) {
+ return;
+ }
+
+ if (!self::getGeo()) {
+ return;
+ }
+
+ if (version_compare(_PS_VERSION_, '1.7', '>=')) {
+ return $this->hookDisplayMyAccountBlockFooter();
+ }
+ }
+
+ public function hookDisplayMyAccountBlockFooter()
+ {
+ if (!self::executeModule()) {
+ return;
+ }
+
+ if (!self::getGeo()) {
+ return;
+ }
+
+ if (Configuration::get('C_P_ENABLE')) {
+ if (version_compare(_PS_VERSION_, '1.6', '<')) {
+ return $this->display(__FILE__, 'my-account-block-footer-15.tpl');
+ }
+
+ return $this->context->smarty->fetch($this->local_path . 'views/templates/hook/my-account-block-footer-17.tpl');
+ }
+ }
+
+ public function hookDisplayCustomerAccount()
+ {
+ if (!self::executeModule()) {
+ return;
+ }
+
+ if (!self::getGeo()) {
+ return;
+ }
+
+ if (Configuration::get('C_P_ENABLE')) {
+ if (version_compare(_PS_VERSION_, '1.6', '<')) {
+ return $this->display(__FILE__, 'customer_account_15.tpl');
+ }
+
+ if (version_compare(_PS_VERSION_, '1.7', '<')) {
+ return $this->display(__FILE__, 'customer_account_16.tpl');
+ }
+
+ $this->context->smarty->assign([
+ 'C_P_MATERIAL_ICONS_LIBRARY' => Configuration::get('C_P_MATERIAL_ICONS_LIBRARY'),
+ ]);
+
+ return $this->display(__FILE__, 'customer_account_17.tpl');
+ }
+
+ return false;
+ }
+
+ public function hookDisplayNav()
+ {
+ if (!self::executeModule()) {
+ return;
+ }
+
+ if (!self::getGeo()) {
+ return;
+ }
+
+ if (Configuration::get('C_P_ENABLE')) {
+ if (version_compare(_PS_VERSION_, '1.6', '<')) {
+ return $this->display(__FILE__, 'nav_16.tpl');
+ }
+
+ if (version_compare(_PS_VERSION_, '1.7', '<')) {
+ return $this->display(__FILE__, 'nav_16.tpl');
+ }
+
+ return $this->display(__FILE__, 'nav_17.tpl');
+ }
+
+ return false;
+ }
+
+ public function hookDisplayNav2()
+ {
+ if (!self::executeModule()) {
+ return;
+ }
+
+ if (!self::getGeo()) {
+ return;
+ }
+
+ return $this->hookDisplayNav();
+ }
+
+ public function hookDisplayTop()
+ {
+ return $this->hookFooter();
+ }
+
+ public function hookDisplayBackOfficeHeader()
+ {
+ if (version_compare(_PS_VERSION_, '1.7', '<')
+ && method_exists($this->context->controller, 'addCSS')) {
+ $this->context->controller->addCSS($this->_path . 'views/css/menuTabIcon.css');
+ }
+
+ // Remove expired CookiesPlusUserConsent
+ $expiredCookiesPlusUserConsents = CookiesPlusUserConsent::getCookiesPlusUserConsentExpired($this->context->shop->id);
+ foreach ($expiredCookiesPlusUserConsents as $expiredCookiesPlusUserConsent) {
+ $expiredCookiesPlusUserConsent = new CookiesPlusUserConsent((int) $expiredCookiesPlusUserConsent['id_cookiesplus_user_consent']);
+ $expiredCookiesPlusUserConsent->delete();
+ }
+ }
+
+ public function hookActionHtaccessCreate()
+ {
+ $path = _PS_ROOT_DIR_ . '/.htaccess';
+
+ $specific_before = $specific_after = '';
+ if (file_exists($path)) {
+ $content = Tools::file_get_contents($path);
+ if (preg_match('#^(.*)\# ~~startcookiesplus~~.*\# ~~endcookiesplus~~[^\n]*(.*)$#s', $content, $m)) {
+ $specific_before = $m[1];
+ $specific_after = $m[2];
+ } else {
+ $specific_before = $content;
+ }
+ }
+
+ // Write .htaccess data
+ if (!$write_fd = @fopen($path, 'w')) {
+ return false;
+ }
+
+ if (method_exists('Module', 'resetStaticCache')) {
+ Module::resetStaticCache();
+ }
+
+ if (self::isEnabled($this->name)) {
+ // https://www.imd.guru/sistemas/html/evitar_que_enlacen_directamente_a_imagenes_en_tu_web-Hotlinking.html
+ fwrite($write_fd, "# ~~startcookiesplus~~ Cookies Plus module - Do not remove this comment\n");
+ fwrite($write_fd, "\n");
+ fwrite($write_fd, "RewriteRule .* - [E=Cache-Vary:cookiesplus]\n");
+ fwrite($write_fd, "\n");
+ fwrite($write_fd, "# ~~endcookiesplus~~ Cookies Plus module - Do not remove this comment\n\n");
+ }
+
+ if ($specific_before) {
+ fwrite($write_fd, trim($specific_before) . "\n\n");
+ }
+
+ if ($specific_after) {
+ fwrite($write_fd, "\n\n" . trim($specific_after));
+ }
+
+ fclose($write_fd);
+
+ return true;
+ }
+
+ /**
+ * empty listener for registerGDPRConsent hook
+ */
+ public function hookRegisterGDPRConsent()
+ {
+ /* registerGDPRConsent is a special kind of hook that doesn't need a listener, see :
+ https://build.prestashop.com/howtos/module/how-to-make-your-module-compliant-with-prestashop-official-gdpr-compliance-module/
+ However since Prestashop 1.7.8, modules must implement a listener for all the hooks they register: a check is made
+ at module installation.
+ */
+ }
+
+ public function hookActionShopDataDuplication($params)
+ {
+ $cookiesPlusCookies = Db::getInstance()->executeS(
+ 'SELECT * FROM ' . _DB_PREFIX_ . 'cookiesplus_cookie
+ WHERE id_shop = ' . (int) $params['old_id_shop']
+ );
+
+ foreach ($cookiesPlusCookies as $id => $cookiesPlusCookie) {
+ Db::getInstance()->execute('
+ INSERT IGNORE INTO ' . _DB_PREFIX_ . 'cookiesplus_cookie (id_cookiesplus_cookie, id_shop, active, id_cookiesplus_finality, name, provider, provider_url, date_add, date_upd)
+ VALUES (null, ' . (int) $params['new_id_shop'] . ', ' . (int) $cookiesPlusCookie['active'] . ', ' . (int) $cookiesPlusCookie['id_cookiesplus_finality'] . ', \'' . pSQL($cookiesPlusCookie['name']) . '\', \'' . pSQL($cookiesPlusCookie['provider']) . '\', \'' . pSQL($cookiesPlusCookie['provider_url']) . '\', \'' . date('Y-m-d H:i:s') . '\', \'' . date('Y-m-d H:i:s') . '\')');
+
+ $cookiesPlusCookies[$id]['new_id_cookiesplus_cookie'] = Db::getInstance()->Insert_ID();
+ }
+
+ foreach ($cookiesPlusCookies as $cookiesPlusCookie) {
+ $languages = Db::getInstance()->executeS('
+ SELECT id_lang, purpose, expiry
+ FROM ' . _DB_PREFIX_ . 'cookiesplus_cookie_lang
+ WHERE id_cookiesplus_cookie = ' . (int) $cookiesPlusCookie['id_cookiesplus_cookie']);
+
+ foreach ($languages as $language) {
+ Db::getInstance()->execute('
+ INSERT IGNORE INTO ' . _DB_PREFIX_ . 'cookiesplus_cookie_lang (id_cookiesplus_cookie, id_lang, purpose, expiry)
+ VALUES (' . (int) $cookiesPlusCookie['new_id_cookiesplus_cookie'] . ', ' . (int) $language['id_lang'] . ', \'' . pSQL($language['purpose']) . '\', \'' . pSQL($language['expiry']) . '\')');
+ }
+ }
+
+ $cookiesPlusFinalities = Db::getInstance()->executeS(
+ 'SELECT * FROM ' . _DB_PREFIX_ . 'cookiesplus_finality
+ WHERE id_shop = ' . (int) $params['old_id_shop']
+ );
+
+ foreach ($cookiesPlusFinalities as $id => $cookiesPlusFinality) {
+ Db::getInstance()->execute('
+ INSERT IGNORE INTO ' . _DB_PREFIX_ . 'cookiesplus_finality (id_cookiesplus_finality, id_shop, active, technical, modules, js_script, js_not_script, position, date_add, date_upd)
+ VALUES (null, ' . (int) $params['new_id_shop'] . ', ' . (int) $cookiesPlusFinality['active'] . ', ' . (int) $cookiesPlusFinality['technical'] . ', \'' . pSQL($cookiesPlusFinality['modules']) . '\', \'' . pSQL($cookiesPlusFinality['js_script']) . '\', \'' . pSQL($cookiesPlusFinality['js_not_script']) . '\', ' . (int) $cookiesPlusFinality['position'] . ', \'' . date('Y-m-d H:i:s') . '\', \'' . date('Y-m-d H:i:s') . '\')');
+
+ $cookiesPlusFinalities[$id]['new_id_cookiesplus_finality'] = Db::getInstance()->Insert_ID();
+ }
+
+ foreach ($cookiesPlusFinalities as $cookiesPlusFinality) {
+ $languages = Db::getInstance()->executeS('
+ SELECT id_lang, name, description
+ FROM ' . _DB_PREFIX_ . 'cookiesplus_finality_lang
+ WHERE id_cookiesplus_finality = ' . (int) $cookiesPlusFinality['id_cookiesplus_finality']);
+
+ foreach ($languages as $language) {
+ Db::getInstance()->execute('
+ INSERT IGNORE INTO ' . _DB_PREFIX_ . 'cookiesplus_finality_lang (id_cookiesplus_finality, id_lang, name, description)
+ VALUES (' . (int) $cookiesPlusFinality['new_id_cookiesplus_finality'] . ', ' . (int) $language['id_lang'] . ', \'' . pSQL($language['name']) . '\', \'' . pSQL($language['description']) . '\')');
+ }
+ }
+ }
+
+ public function hookActionOutputHTMLBefore($params)
+ {
+ if (!self::executeModule()) {
+ return;
+ }
+
+ if (Configuration::get('C_P_FB_ENABLE')) {
+ $cookiesPlusCookiePreferences = self::getCookiesPlusCookiePreferences();
+ $fbConsents = json_decode(Configuration::get('C_P_FB_CONSENT'), true) ?: [];
+ $fbAllConsent = true;
+ foreach (array_keys($fbConsents) as $fbConsent) {
+ $key = 'cookiesplus-finality-' . (int) $fbConsent;
+ if (!isset($cookiesPlusCookiePreferences[$key])
+ || $cookiesPlusCookiePreferences[$key] !== 'on') {
+ $fbAllConsent = false;
+ break;
+ }
+ }
+
+ $position = strpos($params['html'], "fbq('init'");
+
+ if ($position) {
+ if ($fbAllConsent) {
+ $params['html'] = substr_replace($params['html'], "fbq('consent', 'grant');", $position, 0);
+ } else {
+ $params['html'] = substr_replace($params['html'], "fbq('consent', 'revoke');", $position, 0);
+ }
+ }
+ }
+
+ if (Configuration::get('C_P_YT_ENABLE')) {
+ $cookiesPlusCookiePreferences = self::getCookiesPlusCookiePreferences();
+ $ytConsents = json_decode(Configuration::get('C_P_YT_CONSENT'), true) ?: [];
+ $ytAllConsent = true;
+ foreach (array_keys($ytConsents) as $ytConsents) {
+ $key = 'cookiesplus-finality-' . (int) $ytConsents;
+ if (!isset($cookiesPlusCookiePreferences[$key])
+ || $cookiesPlusCookiePreferences[$key] !== 'on') {
+ $ytAllConsent = false;
+ break;
+ }
+ }
+
+ if (!$ytAllConsent) {
+ $params['html'] = str_replace('youtube.com/embed/', 'youtube-nocookie.com/embed/', $params['html']);
+ // Elementor
+ $params['html'] = str_replace('data-video-id=', 'data-video-id-blocked=', $params['html']);
+ }
+ }
+ }
+
+ /* Module functions */
+ /* Backward compatibility */
+ public static function updateCookie($modules)
+ {
+ return self::filterHookModuleExecList($modules);
+ }
+
+ public static function filterHookModuleExecList($modules, $hook_name = null)
+ {
+ // return $modules;
+ if (!self::executeModule()) {
+ return $modules;
+ }
+
+ if (!self::getGeo()) {
+ return $modules;
+ }
+
+ // Exclude admin calls
+ /*
+ if (defined('_PS_ADMIN_DIR_')) {
+ return $modules;
+ }
+ */
+ if (is_object(Context::getContext()->controller)
+ && isset(Context::getContext()->controller->controller_type)
+ && Context::getContext()->controller->controller_type === 'admin') {
+ return $modules;
+ }
+
+ // Exclude .map extensions
+ $url = parse_url("http://$_SERVER[HTTP_HOST]$_SERVER[REQUEST_URI]");
+ if (isset($url['path']) && pathinfo($url['path'], PATHINFO_EXTENSION) === 'map') {
+ return $modules;
+ }
+ $url = parse_url("https://$_SERVER[HTTP_HOST]$_SERVER[REQUEST_URI]");
+ if (isset($url['path']) && pathinfo($url['path'], PATHINFO_EXTENSION) === 'map') {
+ return $modules;
+ }
+
+ $cookiesPlusPreferences = self::getCookiesPlusCookiePreferences();
+ $cookiesPlusFinalities = CookiesPlusFinality::getCookiesPlusFinalities(null, true);
+
+ foreach ($cookiesPlusFinalities as $cookiesPlusFinality) {
+ if (!$cookiesPlusFinality['technical']
+ && (!isset($cookiesPlusPreferences['cookiesplus-finality-' . (int) $cookiesPlusFinality['id_cookiesplus_finality']])
+ || (isset($cookiesPlusPreferences['cookiesplus-finality-' . (int) $cookiesPlusFinality['id_cookiesplus_finality']])
+ && $cookiesPlusPreferences['cookiesplus-finality-' . (int) $cookiesPlusFinality['id_cookiesplus_finality']] !== 'on'))) {
+ $blockedModulesId = json_decode($cookiesPlusFinality['modules'], true) ?: [];
+
+ if (is_array($modules) && is_array($blockedModulesId)) {
+ foreach ($modules as $key => $module) {
+ // Cookiesplus module can not be blocked
+ if ($module['module'] === 'cookiesplus') {
+ continue;
+ }
+
+ if (in_array($module['id_module'], $blockedModulesId)) {
+ unset($modules[$key]);
+ }
+ }
+ }
+ }
+ }
+
+ return $modules;
+ }
+
+ public function blockModuleCode($params)
+ {
+ // Recursive call
+ if (!self::executeModule()) {
+ return;
+ }
+
+ if (!self::getGeo()) {
+ return;
+ }
+
+ // Exclude admin calls
+ /*
+ if (defined('_PS_ADMIN_DIR_')) {
+ return $modules;
+ }
+ */
+ $context = Context::getContext();
+
+ if (!$context->controller) {
+ return;
+ }
+
+ if (is_object($context->controller)
+ && isset($context->controller->controller_type)
+ && ($context->controller->controller_type === 'admin'
+ || $context->controller->controller_type === 'moduleadmin')) {
+ return;
+ }
+
+ // Exclude .map extensions
+ $url = parse_url("http://$_SERVER[HTTP_HOST]$_SERVER[REQUEST_URI]");
+ if (isset($url['path']) && pathinfo($url['path'], PATHINFO_EXTENSION) === 'map') {
+ return;
+ }
+ $url = parse_url("https://$_SERVER[HTTP_HOST]$_SERVER[REQUEST_URI]");
+ if (isset($url['path']) && pathinfo($url['path'], PATHINFO_EXTENSION) === 'map') {
+ return;
+ }
+
+ $blockedModulesByFinality = self::getBlockedModulesByFinality();
+
+ if (version_compare(_PS_VERSION_, '1.6.1', '>=')) {
+ return $this->blockModuleCode17($params, $context, $blockedModulesByFinality);
+ }
+
+ return $this->blockModuleCode15($params, $context, $blockedModulesByFinality);
+ }
+
+ public function getBlockedModulesByFinality()
+ {
+ $cacheKey = 'CookiesPlus::blockModuleCode';
+
+ if (!Cache::isStored($cacheKey)) {
+ $cookiesPlusPreferences = self::getCookiesPlusCookiePreferences();
+ $cookiesPlusFinalities = CookiesPlusFinality::getCookiesPlusFinalities(null, true);
+
+ $blockedModulesByFinality = [];
+ foreach ($cookiesPlusFinalities as $cookiesPlusFinality) {
+ $index = 'cookiesplus-finality-' . (int) $cookiesPlusFinality['id_cookiesplus_finality'];
+ if (!$cookiesPlusFinality['technical']
+ && (!isset($cookiesPlusPreferences[$index])
+ || (isset($cookiesPlusPreferences[$index])
+ && $cookiesPlusPreferences[$index] !== 'on'))
+ ) {
+ $blockedModulesId = json_decode($cookiesPlusFinality['modules'], true) ?: [];
+
+ if (is_array($blockedModulesId)) {
+ foreach ($blockedModulesId as $module) {
+ // Cookiesplus module can not be blocked
+ if ($module === $this->id) {
+ continue;
+ }
+
+ $blockedModulesByFinality[(int) $module]['finalities'][] = (int) $cookiesPlusFinality['id_cookiesplus_finality'];
+ }
+ }
+ }
+ }
+
+ Cache::store($cacheKey, $blockedModulesByFinality);
+ }
+
+ return Cache::retrieve($cacheKey);
+ }
+
+ public function blockModuleCode17($params, $context, $blockedModulesByFinality)
+ {
+ if (isset($blockedModulesByFinality[$params['module']->id])) {
+ // Remove JS and CSS files from blocked modules
+ $js_files = [];
+ $css_files = [];
+
+ if (version_compare(_PS_VERSION_, '1.7', '<')) {
+ $jsFileList = $context->controller->js_files;
+ foreach ($jsFileList as $jsFile) {
+ if (strpos($jsFile, '/modules/' . $params['module']->name) !== false) {
+ $js_files[] = $jsFile;
+ $context->controller->removeJs($jsFile);
+ }
+ }
+
+ $cssFileList = $context->controller->css_files;
+ foreach ($cssFileList as $cssFile) {
+ if (strpos($cssFile, '/modules/' . $params['module']->name) !== false) {
+ $css_files[] = $cssFile;
+ $context->controller->removeJs($cssFile);
+ }
+ }
+ } else {
+ $jsFileList = $context->controller->getJavascript();
+ foreach ($jsFileList as $jsFileListPart) {
+ foreach ($jsFileListPart as $jsFileListPartContainer) {
+ foreach ($jsFileListPartContainer as $jsFileListPartContainerFile) {
+ if (strpos($jsFileListPartContainerFile['path'], '/modules/' . $params['module']->name) !== false) {
+ $js_files[] = $jsFileListPartContainerFile['path'];
+ $context->controller->removeJs($jsFileListPartContainerFile['path']);
+ $context->controller->unregisterJavascript($jsFileListPartContainerFile['id']);
+ }
+ }
+ }
+ }
+
+ $cssFileList = $context->controller->getStylesheets();
+ foreach ($cssFileList as $cssFileListPartContainer) {
+ foreach ($cssFileListPartContainer as $cssFileListPartContainerFile) {
+ if (strpos($cssFileListPartContainerFile['path'], '/modules/' . $params['module']->name) !== false) {
+ $css_files[] = $cssFileListPartContainerFile['path'];
+ $context->controller->removeCSS($cssFileListPartContainerFile['path']);
+ $context->controller->unregisterStylesheet($jsFileListPartContainerFile['id']);
+ }
+ }
+ }
+ }
+
+ // Remove cookies
+ if (isset($params['headersBeforeExecution']) && $params['headersBeforeExecution']) {
+ // Remove the original headers
+ header_remove();
+
+ // Set old headers
+ foreach ($params['headersBeforeExecution'] as $header) {
+ header($header, false);
+ }
+ }
+
+ if (Configuration::get('C_P_REFRESH')) {
+ // The module is blocked but with refresh. Don't display any content
+ $params['display'] = '';
+ } else {
+ if ($params['display']) {
+ $originalReturn = $params['display'];
+ $random = Tools::substr(md5(microtime()), 0, 10);
+ $divName = $params['hookName'] . '_' . $params['module']->id . '_' . $random;
+
+ $this->context->smarty->assign([
+ 'divName' => $divName,
+ 'id_module' => $params['module']->id,
+ 'finalities' => implode(',', $blockedModulesByFinality[$params['module']->id]['finalities']),
+ 'script' => json_encode($originalReturn),
+ 'js' => empty($js_files) ? '[]' : json_encode($js_files),
+ 'css' => empty($css_files) ? '[]' : json_encode($css_files),
+ ]);
+
+ $params['display'] = $this->context->smarty->fetch($this->local_path . 'views/templates/hook/hookmoduledata.tpl');
+ }
+ }
+ }
+ }
+
+ public function blockModuleCode15($params, $context, $blockedModulesByFinality)
+ {
+ if (!is_array($params['return'])) {
+ return;
+ }
+
+ foreach (array_keys($params['return']) as $module) {
+ $module = Module::getInstanceByName($module);
+ if (isset($blockedModulesByFinality[$module->id])) {
+ // Remove JS and CSS files from blocked modules
+ $js_files = [];
+ $css_files = [];
+
+ if (version_compare(_PS_VERSION_, '1.7', '<')) {
+ $jsFileList = $context->controller->js_files;
+ foreach ($jsFileList as $jsFile) {
+ if (strpos($jsFile, '/modules/' . $module->name) !== false) {
+ $js_files[] = $jsFile;
+ $context->controller->removeJs($jsFile);
+ }
+ }
+
+ $cssFileList = $context->controller->css_files;
+ foreach ($cssFileList as $cssFile) {
+ if (strpos($cssFile, '/modules/' . $module->name) !== false) {
+ $css_files[] = $cssFile;
+ $context->controller->removeJs($cssFile);
+ }
+ }
+ } else {
+ $jsFileList = $context->controller->getJavascript();
+ foreach ($jsFileList as $jsFileListPart) {
+ foreach ($jsFileListPart as $jsFileListPartContainer) {
+ foreach ($jsFileListPartContainer as $jsFileListPartContainerFile) {
+ if (strpos($jsFileListPartContainerFile['path'], '/modules/' . $module->name) !== false) {
+ $js_files[] = $jsFileListPartContainerFile['path'];
+ $context->controller->removeJs($jsFileListPartContainerFile['path']);
+ }
+ }
+ }
+ }
+
+ $cssFileList = $context->controller->getStylesheets();
+ foreach ($cssFileList as $cssFileListPartContainer) {
+ foreach ($cssFileListPartContainer as $cssFileListPartContainerFile) {
+ if (strpos($cssFileListPartContainerFile['path'], '/modules/' . $module->name) !== false) {
+ $css_files[] = $cssFileListPartContainerFile['path'];
+ $context->controller->removeCSS($cssFileListPartContainerFile['path']);
+ }
+ }
+ }
+ }
+
+ if (Configuration::get('C_P_REFRESH')) {
+ $params['return'][$module->name] = '';
+ } else {
+ $originalReturn = $params['return'][$module->name];
+ $random = Tools::substr(md5(microtime()), 0, 10);
+ $divName = $params['hookName'] . '_' . $module->id . '_' . $random;
+
+ $this->context->smarty->assign([
+ 'divName' => $divName,
+ 'id_module' => $module->id,
+ 'finalities' => implode(',', $blockedModulesByFinality[$module->id]['finalities']),
+ 'script' => json_encode($originalReturn),
+ 'js' => empty($js_files) ? '[]' : json_encode($js_files),
+ 'css' => empty($css_files) ? '[]' : json_encode($css_files),
+ ]);
+
+ $params['return'][$module->name] = $this->context->smarty->fetch($this->local_path . 'views/templates/hook/hookmoduledata.tpl');
+ }
+ }
+ }
+ }
+
+ public function blockModuleCache($modulesToInvoke, $hookName)
+ {
+ if (empty($modulesToInvoke)) {
+ return false;
+ }
+
+ // Don't filter in BO
+ $context = Context::getContext();
+ if (isset($context->controller->controller_type) && $context->controller->controller_type === 'admin') {
+ return $modulesToInvoke;
+ }
+
+ if (!Configuration::get('C_P_REFRESH')) {
+ return $modulesToInvoke;
+ }
+
+ $cookiesPlusPreferences = self::getCookiesPlusCookiePreferences();
+ $cookiesPlusFinalities = CookiesPlusFinality::getCookiesPlusFinalities(null, true);
+
+ $blockedModulesByFinality = [];
+ foreach ($cookiesPlusFinalities as $cookiesPlusFinality) {
+ $index = 'cookiesplus-finality-' . (int) $cookiesPlusFinality['id_cookiesplus_finality'];
+ if (!$cookiesPlusFinality['technical']
+ && (!isset($cookiesPlusPreferences[$index])
+ || (isset($cookiesPlusPreferences[$index])
+ && $cookiesPlusPreferences[$index] !== 'on'))
+ ) {
+ $blockedModulesId = json_decode($cookiesPlusFinality['modules'], true) ?: [];
+
+ if (is_array($blockedModulesId)) {
+ foreach ($blockedModulesId as $module) {
+ // Cookiesplus module can not be blocked
+ if ($module === $this->id) {
+ continue;
+ }
+
+ $blockedModulesByFinality[(int) $module]['finalities'][] = (int) $cookiesPlusFinality['id_cookiesplus_finality'];
+ }
+ }
+ }
+ }
+
+ if (null === $hookName) {
+ foreach ($modulesToInvoke as $modulesToInvokeByHook) {
+ foreach ($modulesToInvokeByHook as $moduleToInvokeKey => $moduleToInvoke) {
+ if (in_array($moduleToInvoke['id_module'], array_keys($blockedModulesByFinality))) {
+ unset($modulesToInvoke[$moduleToInvokeKey]);
+ }
+ }
+ }
+ } else {
+ foreach ($modulesToInvoke as $moduleToInvokeKey => $moduleToInvoke) {
+ if (in_array($moduleToInvoke['id_module'], array_keys($blockedModulesByFinality))) {
+ unset($modulesToInvoke[$moduleToInvokeKey]);
+ }
+ }
+ }
+
+ return $modulesToInvoke;
+ }
+
+ public function resetCookiesPlusPreferences()
+ {
+ $cookieExpiryTime = time() + Configuration::get('C_P_EXPIRY') * 86400;
+
+ $result = setcookie('cookiesplus', json_encode([]), $cookieExpiryTime, '/');
+
+ return true;
+ }
+
+ public function saveCookiesPlusPreferences()
+ {
+ // $cookiesPlusFinalityValue = self::getCookiesPlusCookiePreferences();
+
+ $cookiesPlusFinalityValue = [];
+ // $cookiesPlusFinalityValue['C_P_DISPLAY_MODAL'] = false;
+
+ if (!empty($_SERVER['HTTP_CLIENT_IP'])) {
+ $ip = $_SERVER['HTTP_CLIENT_IP'];
+ } elseif (!empty($_SERVER['HTTP_X_FORWARDED_FOR'])) {
+ $ip = $_SERVER['HTTP_X_FORWARDED_FOR'];
+ } else {
+ $ip = $_SERVER['REMOTE_ADDR'];
+ }
+
+ /*foreach ($cookiesPlusFinalities as $cookiesPlusFinality) {
+ $cookiesPlusFinalityValue['cookiesplus-finality-' . (int)$cookiesPlusFinality['id_cookiesplus_finality']] = Tools::getValue('cookiesplus-finality-' . (int)$cookiesPlusFinality['id_cookiesplus_finality']);
+ }*/
+ // $cookieExpiryTime = time() + Configuration::get('C_P_EXPIRY') * 86400;
+ // $cookiesPlusFinalityValue['expiry'] = time() + Configuration::get('C_P_EXPIRY') * 86400;
+ // $cookiesPlusFinalityValue['consent_date'] = date('Y-m-d H:i:s', time());
+ // $result = setcookie('cookiesplus', json_encode($cookiesPlusFinalityValue), $cookieExpiryTime, '/');
+
+ // $cookiesPlusFinalityValue['cookie'] = json_encode($cookiesPlusFinalityValue);
+
+ // Generate PDF consent
+ if (Configuration::get('C_P_SAVE_CONSENT')) {
+ do {
+ $consentHash = md5(openssl_random_pseudo_bytes(20)) . '-' . Tools::substr(md5(openssl_random_pseudo_bytes(20)), 0, 8);
+ } while (!$consentHash);
+ $cookiesPlusFinalityValue['consent_hash'] = $consentHash;
+ $consentDate = date('Y-m-d H:i', time());
+
+ $data = [];
+ $data['cookiesPlus']['info']['last_update'] = Tools::displayDate(date('Y-m-d', strtotime(Configuration::get('C_P_REVOKE_CONSENT'))), null, false);
+ $data['cookiesPlus']['info']['consent_hash'] = $cookiesPlusFinalityValue['consent_hash'];
+ $data['cookiesPlus']['info']['consent_date'] = $consentDate;
+ $data['cookiesPlus']['info']['consent_ip'] = $ip;
+
+ $cookiesPlusFinalities = CookiesPlusFinality::getCookiesPlusFinalities((int) $this->context->language->id, true);
+ foreach ($cookiesPlusFinalities as &$cookiesPlusFinality) {
+ $cookiesPlusFinality['cookies'] = CookiesPlusCookie::getCookiesPlusCookies($cookiesPlusFinality['id_cookiesplus_finality'], (int) $this->context->language->id, true, $this->context->shop->id);
+ if (Tools::getValue('cookiesplus-finality-' . (int) $cookiesPlusFinality['id_cookiesplus_finality']) !== 'na'
+ && Tools::getValue('cookiesplus-finality-' . (int) $cookiesPlusFinality['id_cookiesplus_finality']) !== 'on'
+ && Tools::getValue('cookiesplus-finality-' . (int) $cookiesPlusFinality['id_cookiesplus_finality']) !== 'off'
+ ) {
+ $_POST['cookiesplus-finality-' . (int) $cookiesPlusFinality['id_cookiesplus_finality']] = 'na';
+ }
+ $cookiesPlusFinality['cookiesplus-finality-' . (int) $cookiesPlusFinality['id_cookiesplus_finality']] = Tools::getValue('cookiesplus-finality-' . (int) $cookiesPlusFinality['id_cookiesplus_finality']);
+ }
+ unset($cookiesPlusFinality);
+ $data['cookiesPlus']['cookiesPlusFinalities'] = $cookiesPlusFinalities;
+
+ // Send an email to admin because of an error
+ /*if (!$result) {
+ Configuration::updateValue('C_P_SAVE_CONSENT', 0);
+ }*/
+ // Save consent
+ $cookiesPlusUserConsent = new CookiesPlusUserConsent();
+ $cookiesPlusUserConsent->data = json_encode($data);
+ $cookiesPlusUserConsent->hash = $cookiesPlusFinalityValue['consent_hash'];
+ $cookiesPlusUserConsent->date = $consentDate;
+ $cookiesPlusUserConsent->ip = $ip;
+ $cookiesPlusUserConsent->save();
+ }
+
+ return $cookiesPlusFinalityValue;
+ }
+
+ public static function getCookiesPlusCookiePreferences()
+ {
+ if (isset($_COOKIE['cookiesplus'])) {
+ return json_decode($_COOKIE['cookiesplus'], true);
+ }
+
+ return [];
+ }
+
+ public static function isCookiesPlusFinalityAccepted($id_cookiesplus_finality)
+ {
+ $cookiesPlusCookiePreferences = self::getCookiesPlusCookiePreferences();
+
+ $index = 'cookiesplus-finality-' . (int) $id_cookiesplus_finality;
+
+ if (isset($cookiesPlusCookiePreferences[$index])
+ && $cookiesPlusCookiePreferences[$index] === 'on') {
+ return true;
+ }
+
+ return false;
+ }
+
+ public function copyOverrideFolder()
+ {
+ if (Module::isInstalled('pagecache')) {
+ return true;
+ }
+
+ if (!is_writable(_PS_MODULE_DIR_ . $this->name)) {
+ return false;
+ }
+
+ $override_folder_name = 'override';
+ if (version_compare(_PS_VERSION_, '1.6.1', '>=')) {
+ $psVersion = '17';
+ } elseif (version_compare(_PS_VERSION_, '1.6', '>=')) {
+ $psVersion = '16';
+ } else {
+ $psVersion = '15';
+ }
+
+ $version_override_folder = _PS_MODULE_DIR_ . $this->name . '/' . $override_folder_name . '_' . $psVersion;
+ $override_folder = _PS_MODULE_DIR_ . $this->name . '/' . $override_folder_name;
+
+ if (file_exists($override_folder) && is_dir($override_folder)) {
+ $this->recursiveRmdir($override_folder);
+ }
+
+ if (is_dir($version_override_folder)) {
+ $this->copyDir($version_override_folder, $override_folder);
+ }
+
+ return true;
+ }
+
+ public function copyDir($src, $dst)
+ {
+ if (is_dir($src)) {
+ $dir = opendir($src);
+ if (!mkdir($dst) && !is_dir($dst)) {
+ throw new RuntimeException(sprintf('Directory "%s" was not created', $dst));
+ }
+ while (false !== ($file = readdir($dir))) {
+ if (($file !== '.') && ($file !== '..')) {
+ if (is_dir($src . '/' . $file)) {
+ $this->copyDir($src . '/' . $file, $dst . '/' . $file);
+ } else {
+ copy($src . '/' . $file, $dst . '/' . $file);
+ }
+ }
+ }
+ closedir($dir);
+ }
+ }
+
+ public function recursiveRmdir($dir)
+ {
+ if (is_dir($dir)) {
+ $objects = scandir($dir);
+ foreach ($objects as $object) {
+ if ($object !== '.' && $object !== '..') {
+ if (filetype($dir . '/' . $object) === 'dir') {
+ $this->recursiveRmdir($dir . '/' . $object);
+ } else {
+ unlink($dir . '/' . $object);
+ }
+ }
+ }
+ reset($objects);
+ rmdir($dir);
+ }
+ }
+
+ public static function sanitizeJson($json)
+ {
+ $escapers = ['\\', '/', '"', "\n", "\r", "\t", "\x08", "\x0c", "\'"];
+ $replacements = ['\\\\', '\\/', '\\"', '\\n', '\\r', '\\t', '\\f', '\\b', "\\\'"];
+
+ return str_replace($escapers, $replacements, $json);
+ }
+
+ public function getDatabaseVersion()
+ {
+ $query = 'SELECT `version`
+ FROM `' . _DB_PREFIX_ . 'module`
+ WHERE `name` = \'' . $this->name . '\';';
+
+ return Db::getInstance()->getValue($query);
+ }
+}
diff --git a/modules/cookiesplus/index.php b/modules/cookiesplus/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/index.php
@@ -0,0 +1,32 @@
+ and others
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/modules/cookiesplus/lib/CodeMirror/README.md b/modules/cookiesplus/lib/CodeMirror/README.md
new file mode 100644
index 00000000..2a7b1f5e
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/README.md
@@ -0,0 +1,48 @@
+# CodeMirror
+
+[](https://travis-ci.org/codemirror/CodeMirror)
+[](https://www.npmjs.org/package/codemirror)
+[](https://gitter.im/codemirror/CodeMirror)
+
+CodeMirror is a versatile text editor implemented in JavaScript for
+the browser. It is specialized for editing code, and comes with over
+100 language modes and various addons that implement more advanced
+editing functionality. Every language comes with fully-featured code
+and syntax highlighting to help with reading and editing complex code.
+
+A rich programming API and a CSS theming system are available for
+customizing CodeMirror to fit your application, and extending it with
+new functionality.
+
+You can find more information (and the
+[manual](https://codemirror.net/doc/manual.html)) on the [project
+page](https://codemirror.net). For questions and discussion, use the
+[discussion forum](https://discuss.codemirror.net/).
+
+See
+[CONTRIBUTING.md](https://github.com/codemirror/CodeMirror/blob/master/CONTRIBUTING.md)
+for contributing guidelines.
+
+The CodeMirror community aims to be welcoming to everybody. We use the
+[Contributor Covenant
+(1.1)](http://contributor-covenant.org/version/1/1/0/) as our code of
+conduct.
+
+### Installation
+
+Either get the [zip file](https://codemirror.net/codemirror.zip) with
+the latest version, or make sure you have [Node](https://nodejs.org/)
+installed and run:
+
+ npm install codemirror
+
+**NOTE**: This is the source repository for the library, and not the
+distribution channel. Cloning it is not the recommended way to install
+the library, and will in fact not work unless you also run the build
+step.
+
+### Quickstart
+
+To build the project, make sure you have Node.js installed (at least version 6)
+and then `npm install`. To run, just open `index.html` in your
+browser (you don't need to run a webserver). Run the tests with `npm test`.
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/comment/comment.js b/modules/cookiesplus/lib/CodeMirror/addon/comment/comment.js
new file mode 100644
index 00000000..2a574ad6
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/comment/comment.js
@@ -0,0 +1,231 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ var noOptions = {};
+ var nonWS = /[^\s\u00a0]/;
+ var Pos = CodeMirror.Pos, cmp = CodeMirror.cmpPos;
+
+ function firstNonWS(str) {
+ var found = str.search(nonWS);
+ return found == -1 ? 0 : found;
+ }
+
+ CodeMirror.commands.toggleComment = function(cm) {
+ cm.toggleComment();
+ };
+
+ CodeMirror.defineExtension("toggleComment", function(options) {
+ if (!options) options = noOptions;
+ var cm = this;
+ var minLine = Infinity, ranges = this.listSelections(), mode = null;
+ for (var i = ranges.length - 1; i >= 0; i--) {
+ var from = ranges[i].from(), to = ranges[i].to();
+ if (from.line >= minLine) continue;
+ if (to.line >= minLine) to = Pos(minLine, 0);
+ minLine = from.line;
+ if (mode == null) {
+ if (cm.uncomment(from, to, options)) mode = "un";
+ else { cm.lineComment(from, to, options); mode = "line"; }
+ } else if (mode == "un") {
+ cm.uncomment(from, to, options);
+ } else {
+ cm.lineComment(from, to, options);
+ }
+ }
+ });
+
+ // Rough heuristic to try and detect lines that are part of multi-line string
+ function probablyInsideString(cm, pos, line) {
+ return /\bstring\b/.test(cm.getTokenTypeAt(Pos(pos.line, 0))) && !/^[\'\"\`]/.test(line)
+ }
+
+ function getMode(cm, pos) {
+ var mode = cm.getMode()
+ return mode.useInnerComments === false || !mode.innerMode ? mode : cm.getModeAt(pos)
+ }
+
+ CodeMirror.defineExtension("lineComment", function(from, to, options) {
+ if (!options) options = noOptions;
+ var self = this, mode = getMode(self, from);
+ var firstLine = self.getLine(from.line);
+ if (firstLine == null || probablyInsideString(self, from, firstLine)) return;
+
+ var commentString = options.lineComment || mode.lineComment;
+ if (!commentString) {
+ if (options.blockCommentStart || mode.blockCommentStart) {
+ options.fullLines = true;
+ self.blockComment(from, to, options);
+ }
+ return;
+ }
+
+ var end = Math.min(to.ch != 0 || to.line == from.line ? to.line + 1 : to.line, self.lastLine() + 1);
+ var pad = options.padding == null ? " " : options.padding;
+ var blankLines = options.commentBlankLines || from.line == to.line;
+
+ self.operation(function() {
+ if (options.indent) {
+ var baseString = null;
+ for (var i = from.line; i < end; ++i) {
+ var line = self.getLine(i);
+ var whitespace = line.slice(0, firstNonWS(line));
+ if (baseString == null || baseString.length > whitespace.length) {
+ baseString = whitespace;
+ }
+ }
+ for (var i = from.line; i < end; ++i) {
+ var line = self.getLine(i), cut = baseString.length;
+ if (!blankLines && !nonWS.test(line)) continue;
+ if (line.slice(0, cut) != baseString) cut = firstNonWS(line);
+ self.replaceRange(baseString + commentString + pad, Pos(i, 0), Pos(i, cut));
+ }
+ } else {
+ for (var i = from.line; i < end; ++i) {
+ if (blankLines || nonWS.test(self.getLine(i)))
+ self.replaceRange(commentString + pad, Pos(i, 0));
+ }
+ }
+ });
+ });
+
+ CodeMirror.defineExtension("blockComment", function(from, to, options) {
+ if (!options) options = noOptions;
+ var self = this, mode = getMode(self, from);
+ var startString = options.blockCommentStart || mode.blockCommentStart;
+ var endString = options.blockCommentEnd || mode.blockCommentEnd;
+ if (!startString || !endString) {
+ if ((options.lineComment || mode.lineComment) && options.fullLines != false)
+ self.lineComment(from, to, options);
+ return;
+ }
+ if (/\bcomment\b/.test(self.getTokenTypeAt(Pos(from.line, 0)))) return
+
+ var end = Math.min(to.line, self.lastLine());
+ if (end != from.line && to.ch == 0 && nonWS.test(self.getLine(end))) --end;
+
+ var pad = options.padding == null ? " " : options.padding;
+ if (from.line > end) return;
+
+ self.operation(function() {
+ if (options.fullLines != false) {
+ var lastLineHasText = nonWS.test(self.getLine(end));
+ self.replaceRange(pad + endString, Pos(end));
+ self.replaceRange(startString + pad, Pos(from.line, 0));
+ var lead = options.blockCommentLead || mode.blockCommentLead;
+ if (lead != null) for (var i = from.line + 1; i <= end; ++i)
+ if (i != end || lastLineHasText)
+ self.replaceRange(lead + pad, Pos(i, 0));
+ } else {
+ var atCursor = cmp(self.getCursor("to"), to) == 0, empty = !self.somethingSelected()
+ self.replaceRange(endString, to);
+ if (atCursor) self.setSelection(empty ? to : self.getCursor("from"), to)
+ self.replaceRange(startString, from);
+ }
+ });
+ });
+
+ CodeMirror.defineExtension("uncomment", function(from, to, options) {
+ if (!options) options = noOptions;
+ var self = this, mode = getMode(self, from);
+ var end = Math.min(to.ch != 0 || to.line == from.line ? to.line : to.line - 1, self.lastLine()), start = Math.min(from.line, end);
+
+ // Try finding line comments
+ var lineString = options.lineComment || mode.lineComment, lines = [];
+ var pad = options.padding == null ? " " : options.padding, didSomething;
+ lineComment: {
+ if (!lineString) break lineComment;
+ for (var i = start; i <= end; ++i) {
+ var line = self.getLine(i);
+ var found = line.indexOf(lineString);
+ if (found > -1 && !/comment/.test(self.getTokenTypeAt(Pos(i, found + 1)))) found = -1;
+ if (found == -1 && nonWS.test(line)) break lineComment;
+ if (found > -1 && nonWS.test(line.slice(0, found))) break lineComment;
+ lines.push(line);
+ }
+ self.operation(function() {
+ for (var i = start; i <= end; ++i) {
+ var line = lines[i - start];
+ var pos = line.indexOf(lineString), endPos = pos + lineString.length;
+ if (pos < 0) continue;
+ if (line.slice(endPos, endPos + pad.length) == pad) endPos += pad.length;
+ didSomething = true;
+ self.replaceRange("", Pos(i, pos), Pos(i, endPos));
+ }
+ });
+ if (didSomething) return true;
+ }
+
+ // Try block comments
+ var startString = options.blockCommentStart || mode.blockCommentStart;
+ var endString = options.blockCommentEnd || mode.blockCommentEnd;
+ if (!startString || !endString) return false;
+ var lead = options.blockCommentLead || mode.blockCommentLead;
+ var startLine = self.getLine(start), open = startLine.indexOf(startString)
+ if (open == -1) return false
+ var endLine = end == start ? startLine : self.getLine(end)
+ var close = endLine.indexOf(endString, end == start ? open + startString.length : 0);
+ var insideStart = Pos(start, open + 1), insideEnd = Pos(end, close + 1)
+ if (close == -1 ||
+ !/comment/.test(self.getTokenTypeAt(insideStart)) ||
+ !/comment/.test(self.getTokenTypeAt(insideEnd)) ||
+ self.getRange(insideStart, insideEnd, "\n").indexOf(endString) > -1)
+ return false;
+
+ // Avoid killing block comments completely outside the selection.
+ // Positions of the last startString before the start of the selection, and the first endString after it.
+ var lastStart = startLine.lastIndexOf(startString, from.ch);
+ var firstEnd = lastStart == -1 ? -1 : startLine.slice(0, from.ch).indexOf(endString, lastStart + startString.length);
+ if (lastStart != -1 && firstEnd != -1 && firstEnd + endString.length != from.ch) return false;
+ // Positions of the first endString after the end of the selection, and the last startString before it.
+ firstEnd = endLine.indexOf(endString, to.ch);
+ var almostLastStart = endLine.slice(to.ch).lastIndexOf(startString, firstEnd - to.ch);
+ lastStart = (firstEnd == -1 || almostLastStart == -1) ? -1 : to.ch + almostLastStart;
+ if (firstEnd != -1 && lastStart != -1 && lastStart != to.ch) return false;
+
+ self.operation(function() {
+ self.replaceRange("", Pos(end, close - (pad && endLine.slice(close - pad.length, close) == pad ? pad.length : 0)),
+ Pos(end, close + endString.length));
+ var openEnd = open + startString.length;
+ if (pad && startLine.slice(openEnd, openEnd + pad.length) == pad) openEnd += pad.length;
+ self.replaceRange("", Pos(start, open), Pos(start, openEnd));
+ if (lead) for (var i = start + 1; i <= end; ++i) {
+ var line = self.getLine(i), found = line.indexOf(lead);
+ if (found == -1 || nonWS.test(line.slice(0, found))) continue;
+ var foundEnd = found + lead.length;
+ if (pad && line.slice(foundEnd, foundEnd + pad.length) == pad) foundEnd += pad.length;
+ self.replaceRange("", Pos(i, found), Pos(i, foundEnd));
+ }
+ });
+ return true;
+ });
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/comment/continuecomment.js b/modules/cookiesplus/lib/CodeMirror/addon/comment/continuecomment.js
new file mode 100644
index 00000000..745f2ee3
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/comment/continuecomment.js
@@ -0,0 +1,134 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ var nonspace = /\S/g;
+ var repeat = String.prototype.repeat || function (n) { return Array(n + 1).join(this); };
+ function continueComment(cm) {
+ if (cm.getOption("disableInput")) return CodeMirror.Pass;
+ var ranges = cm.listSelections(), mode, inserts = [];
+ for (var i = 0; i < ranges.length; i++) {
+ var pos = ranges[i].head
+ if (!/\bcomment\b/.test(cm.getTokenTypeAt(pos))) return CodeMirror.Pass;
+ var modeHere = cm.getModeAt(pos)
+ if (!mode) mode = modeHere;
+ else if (mode != modeHere) return CodeMirror.Pass;
+
+ var insert = null, line, found;
+ var blockStart = mode.blockCommentStart, lineCmt = mode.lineComment;
+ if (blockStart && mode.blockCommentContinue) {
+ line = cm.getLine(pos.line);
+ var end = line.lastIndexOf(mode.blockCommentEnd, pos.ch - mode.blockCommentEnd.length);
+ // 1. if this block comment ended
+ // 2. if this is actually inside a line comment
+ if (end != -1 && end == pos.ch - mode.blockCommentEnd.length ||
+ lineCmt && (found = line.lastIndexOf(lineCmt, pos.ch - 1)) > -1 &&
+ /\bcomment\b/.test(cm.getTokenTypeAt({line: pos.line, ch: found + 1}))) {
+ // ...then don't continue it
+ } else if (pos.ch >= blockStart.length &&
+ (found = line.lastIndexOf(blockStart, pos.ch - blockStart.length)) > -1 &&
+ found > end) {
+ // reuse the existing leading spaces/tabs/mixed
+ // or build the correct indent using CM's tab/indent options
+ if (nonspaceAfter(0, line) >= found) {
+ insert = line.slice(0, found);
+ } else {
+ var tabSize = cm.options.tabSize, numTabs;
+ found = CodeMirror.countColumn(line, found, tabSize);
+ insert = !cm.options.indentWithTabs ? repeat.call(" ", found) :
+ repeat.call("\t", (numTabs = Math.floor(found / tabSize))) +
+ repeat.call(" ", found - tabSize * numTabs);
+ }
+ } else if ((found = line.indexOf(mode.blockCommentContinue)) > -1 &&
+ found <= pos.ch &&
+ found <= nonspaceAfter(0, line)) {
+ insert = line.slice(0, found);
+ }
+ if (insert != null) insert += mode.blockCommentContinue
+ }
+ if (insert == null && lineCmt && continueLineCommentEnabled(cm)) {
+ if (line == null) line = cm.getLine(pos.line);
+ found = line.indexOf(lineCmt);
+ // cursor at pos 0, line comment also at pos 0 => shift it down, don't continue
+ if (!pos.ch && !found) insert = "";
+ // continue only if the line starts with an optional space + line comment
+ else if (found > -1 && nonspaceAfter(0, line) >= found) {
+ // don't continue if there's only space(s) after cursor or the end of the line
+ insert = nonspaceAfter(pos.ch, line) > -1;
+ // but always continue if the next line starts with a line comment too
+ if (!insert) {
+ var next = cm.getLine(pos.line + 1) || '',
+ nextFound = next.indexOf(lineCmt);
+ insert = nextFound > -1 && nonspaceAfter(0, next) >= nextFound || null;
+ }
+ if (insert) {
+ insert = line.slice(0, found) + lineCmt +
+ line.slice(found + lineCmt.length).match(/^\s*/)[0];
+ }
+ }
+ }
+ if (insert == null) return CodeMirror.Pass;
+ inserts[i] = "\n" + insert;
+ }
+
+ cm.operation(function() {
+ for (var i = ranges.length - 1; i >= 0; i--)
+ cm.replaceRange(inserts[i], ranges[i].from(), ranges[i].to(), "+insert");
+ });
+ }
+
+ function nonspaceAfter(ch, str) {
+ nonspace.lastIndex = ch;
+ var m = nonspace.exec(str);
+ return m ? m.index : -1;
+ }
+
+ function continueLineCommentEnabled(cm) {
+ var opt = cm.getOption("continueComments");
+ if (opt && typeof opt == "object")
+ return opt.continueLineComment !== false;
+ return true;
+ }
+
+ CodeMirror.defineOption("continueComments", null, function(cm, val, prev) {
+ if (prev && prev != CodeMirror.Init)
+ cm.removeKeyMap("continueComment");
+ if (val) {
+ var key = "Enter";
+ if (typeof val == "string")
+ key = val;
+ else if (typeof val == "object" && val.key)
+ key = val.key;
+ var map = {name: "continueComment"};
+ map[key] = continueComment;
+ cm.addKeyMap(map);
+ }
+ });
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/comment/index.php b/modules/cookiesplus/lib/CodeMirror/addon/comment/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/comment/index.php
@@ -0,0 +1,32 @@
+",
+ triples: "",
+ explode: "[]{}"
+ };
+
+ var Pos = CodeMirror.Pos;
+
+ CodeMirror.defineOption("autoCloseBrackets", false, function(cm, val, old) {
+ if (old && old != CodeMirror.Init) {
+ cm.removeKeyMap(keyMap);
+ cm.state.closeBrackets = null;
+ }
+ if (val) {
+ ensureBound(getOption(val, "pairs"))
+ cm.state.closeBrackets = val;
+ cm.addKeyMap(keyMap);
+ }
+ });
+
+ function getOption(conf, name) {
+ if (name == "pairs" && typeof conf == "string") return conf;
+ if (typeof conf == "object" && conf[name] != null) return conf[name];
+ return defaults[name];
+ }
+
+ var keyMap = {Backspace: handleBackspace, Enter: handleEnter};
+ function ensureBound(chars) {
+ for (var i = 0; i < chars.length; i++) {
+ var ch = chars.charAt(i), key = "'" + ch + "'"
+ if (!keyMap[key]) keyMap[key] = handler(ch)
+ }
+ }
+ ensureBound(defaults.pairs + "`")
+
+ function handler(ch) {
+ return function(cm) { return handleChar(cm, ch); };
+ }
+
+ function getConfig(cm) {
+ var deflt = cm.state.closeBrackets;
+ if (!deflt || deflt.override) return deflt;
+ var mode = cm.getModeAt(cm.getCursor());
+ return mode.closeBrackets || deflt;
+ }
+
+ function handleBackspace(cm) {
+ var conf = getConfig(cm);
+ if (!conf || cm.getOption("disableInput")) return CodeMirror.Pass;
+
+ var pairs = getOption(conf, "pairs");
+ var ranges = cm.listSelections();
+ for (var i = 0; i < ranges.length; i++) {
+ if (!ranges[i].empty()) return CodeMirror.Pass;
+ var around = charsAround(cm, ranges[i].head);
+ if (!around || pairs.indexOf(around) % 2 != 0) return CodeMirror.Pass;
+ }
+ for (var i = ranges.length - 1; i >= 0; i--) {
+ var cur = ranges[i].head;
+ cm.replaceRange("", Pos(cur.line, cur.ch - 1), Pos(cur.line, cur.ch + 1), "+delete");
+ }
+ }
+
+ function handleEnter(cm) {
+ var conf = getConfig(cm);
+ var explode = conf && getOption(conf, "explode");
+ if (!explode || cm.getOption("disableInput")) return CodeMirror.Pass;
+
+ var ranges = cm.listSelections();
+ for (var i = 0; i < ranges.length; i++) {
+ if (!ranges[i].empty()) return CodeMirror.Pass;
+ var around = charsAround(cm, ranges[i].head);
+ if (!around || explode.indexOf(around) % 2 != 0) return CodeMirror.Pass;
+ }
+ cm.operation(function() {
+ var linesep = cm.lineSeparator() || "\n";
+ cm.replaceSelection(linesep + linesep, null);
+ cm.execCommand("goCharLeft");
+ ranges = cm.listSelections();
+ for (var i = 0; i < ranges.length; i++) {
+ var line = ranges[i].head.line;
+ cm.indentLine(line, null, true);
+ cm.indentLine(line + 1, null, true);
+ }
+ });
+ }
+
+ function contractSelection(sel) {
+ var inverted = CodeMirror.cmpPos(sel.anchor, sel.head) > 0;
+ return {anchor: new Pos(sel.anchor.line, sel.anchor.ch + (inverted ? -1 : 1)),
+ head: new Pos(sel.head.line, sel.head.ch + (inverted ? 1 : -1))};
+ }
+
+ function handleChar(cm, ch) {
+ var conf = getConfig(cm);
+ if (!conf || cm.getOption("disableInput")) return CodeMirror.Pass;
+
+ var pairs = getOption(conf, "pairs");
+ var pos = pairs.indexOf(ch);
+ if (pos == -1) return CodeMirror.Pass;
+
+ var closeBefore = getOption(conf,"closeBefore");
+
+ var triples = getOption(conf, "triples");
+
+ var identical = pairs.charAt(pos + 1) == ch;
+ var ranges = cm.listSelections();
+ var opening = pos % 2 == 0;
+
+ var type;
+ for (var i = 0; i < ranges.length; i++) {
+ var range = ranges[i], cur = range.head, curType;
+ var next = cm.getRange(cur, Pos(cur.line, cur.ch + 1));
+ if (opening && !range.empty()) {
+ curType = "surround";
+ } else if ((identical || !opening) && next == ch) {
+ if (identical && stringStartsAfter(cm, cur))
+ curType = "both";
+ else if (triples.indexOf(ch) >= 0 && cm.getRange(cur, Pos(cur.line, cur.ch + 3)) == ch + ch + ch)
+ curType = "skipThree";
+ else
+ curType = "skip";
+ } else if (identical && cur.ch > 1 && triples.indexOf(ch) >= 0 &&
+ cm.getRange(Pos(cur.line, cur.ch - 2), cur) == ch + ch) {
+ if (cur.ch > 2 && /\bstring/.test(cm.getTokenTypeAt(Pos(cur.line, cur.ch - 2)))) return CodeMirror.Pass;
+ curType = "addFour";
+ } else if (identical) {
+ var prev = cur.ch == 0 ? " " : cm.getRange(Pos(cur.line, cur.ch - 1), cur)
+ if (!CodeMirror.isWordChar(next) && prev != ch && !CodeMirror.isWordChar(prev)) curType = "both";
+ else return CodeMirror.Pass;
+ } else if (opening && (next.length === 0 || /\s/.test(next) || closeBefore.indexOf(next) > -1)) {
+ curType = "both";
+ } else {
+ return CodeMirror.Pass;
+ }
+ if (!type) type = curType;
+ else if (type != curType) return CodeMirror.Pass;
+ }
+
+ var left = pos % 2 ? pairs.charAt(pos - 1) : ch;
+ var right = pos % 2 ? ch : pairs.charAt(pos + 1);
+ cm.operation(function() {
+ if (type == "skip") {
+ cm.execCommand("goCharRight");
+ } else if (type == "skipThree") {
+ for (var i = 0; i < 3; i++)
+ cm.execCommand("goCharRight");
+ } else if (type == "surround") {
+ var sels = cm.getSelections();
+ for (var i = 0; i < sels.length; i++)
+ sels[i] = left + sels[i] + right;
+ cm.replaceSelections(sels, "around");
+ sels = cm.listSelections().slice();
+ for (var i = 0; i < sels.length; i++)
+ sels[i] = contractSelection(sels[i]);
+ cm.setSelections(sels);
+ } else if (type == "both") {
+ cm.replaceSelection(left + right, null);
+ cm.triggerElectric(left + right);
+ cm.execCommand("goCharLeft");
+ } else if (type == "addFour") {
+ cm.replaceSelection(left + left + left + left, "before");
+ cm.execCommand("goCharRight");
+ }
+ });
+ }
+
+ function charsAround(cm, pos) {
+ var str = cm.getRange(Pos(pos.line, pos.ch - 1),
+ Pos(pos.line, pos.ch + 1));
+ return str.length == 2 ? str : null;
+ }
+
+ function stringStartsAfter(cm, pos) {
+ var token = cm.getTokenAt(Pos(pos.line, pos.ch + 1))
+ return /\bstring/.test(token.type) && token.start == pos.ch &&
+ (pos.ch == 0 || !/\bstring/.test(cm.getTokenTypeAt(pos)))
+ }
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/edit/closetag.js b/modules/cookiesplus/lib/CodeMirror/addon/edit/closetag.js
new file mode 100644
index 00000000..8af1a7a9
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/edit/closetag.js
@@ -0,0 +1,203 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+/**
+ * Tag-closer extension for CodeMirror.
+ *
+ * This extension adds an "autoCloseTags" option that can be set to
+ * either true to get the default behavior, or an object to further
+ * configure its behavior.
+ *
+ * These are supported options:
+ *
+ * `whenClosing` (default true)
+ * Whether to autoclose when the '/' of a closing tag is typed.
+ * `whenOpening` (default true)
+ * Whether to autoclose the tag when the final '>' of an opening
+ * tag is typed.
+ * `dontCloseTags` (default is empty tags for HTML, none for XML)
+ * An array of tag names that should not be autoclosed.
+ * `indentTags` (default is block tags for HTML, none for XML)
+ * An array of tag names that should, when opened, cause a
+ * blank line to be added inside the tag, and the blank line and
+ * closing line to be indented.
+ * `emptyTags` (default is none)
+ * An array of XML tag names that should be autoclosed with '/>'.
+ *
+ * See demos/closetag.html for a usage example.
+ */
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"), require("../fold/xml-fold"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror", "../fold/xml-fold"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ CodeMirror.defineOption("autoCloseTags", false, function(cm, val, old) {
+ if (old != CodeMirror.Init && old)
+ cm.removeKeyMap("autoCloseTags");
+ if (!val) return;
+ var map = {name: "autoCloseTags"};
+ if (typeof val != "object" || val.whenClosing !== false)
+ map["'/'"] = function(cm) { return autoCloseSlash(cm); };
+ if (typeof val != "object" || val.whenOpening !== false)
+ map["'>'"] = function(cm) { return autoCloseGT(cm); };
+ cm.addKeyMap(map);
+ });
+
+ var htmlDontClose = ["area", "base", "br", "col", "command", "embed", "hr", "img", "input", "keygen", "link", "meta", "param",
+ "source", "track", "wbr"];
+ var htmlIndent = ["applet", "blockquote", "body", "button", "div", "dl", "fieldset", "form", "frameset", "h1", "h2", "h3", "h4",
+ "h5", "h6", "head", "html", "iframe", "layer", "legend", "object", "ol", "p", "select", "table", "ul"];
+
+ function autoCloseGT(cm) {
+ if (cm.getOption("disableInput")) return CodeMirror.Pass;
+ var ranges = cm.listSelections(), replacements = [];
+ var opt = cm.getOption("autoCloseTags");
+ for (var i = 0; i < ranges.length; i++) {
+ if (!ranges[i].empty()) return CodeMirror.Pass;
+ var pos = ranges[i].head, tok = cm.getTokenAt(pos);
+ var inner = CodeMirror.innerMode(cm.getMode(), tok.state), state = inner.state;
+ var tagInfo = inner.mode.xmlCurrentTag && inner.mode.xmlCurrentTag(state)
+ var tagName = tagInfo && tagInfo.name
+ if (!tagName) return CodeMirror.Pass
+
+ var html = inner.mode.configuration == "html";
+ var dontCloseTags = (typeof opt == "object" && opt.dontCloseTags) || (html && htmlDontClose);
+ var indentTags = (typeof opt == "object" && opt.indentTags) || (html && htmlIndent);
+
+ if (tok.end > pos.ch) tagName = tagName.slice(0, tagName.length - tok.end + pos.ch);
+ var lowerTagName = tagName.toLowerCase();
+ // Don't process the '>' at the end of an end-tag or self-closing tag
+ if (!tagName ||
+ tok.type == "string" && (tok.end != pos.ch || !/[\"\']/.test(tok.string.charAt(tok.string.length - 1)) || tok.string.length == 1) ||
+ tok.type == "tag" && tagInfo.close ||
+ tok.string.indexOf("/") == (pos.ch - tok.start - 1) || // match something like
+ dontCloseTags && indexOf(dontCloseTags, lowerTagName) > -1 ||
+ closingTagExists(cm, inner.mode.xmlCurrentContext && inner.mode.xmlCurrentContext(state) || [], tagName, pos, true))
+ return CodeMirror.Pass;
+
+ var emptyTags = typeof opt == "object" && opt.emptyTags;
+ if (emptyTags && indexOf(emptyTags, tagName) > -1) {
+ replacements[i] = { text: "/>", newPos: CodeMirror.Pos(pos.line, pos.ch + 2) };
+ continue;
+ }
+
+ var indent = indentTags && indexOf(indentTags, lowerTagName) > -1;
+ replacements[i] = {indent: indent,
+ text: ">" + (indent ? "\n\n" : "") + "",
+ newPos: indent ? CodeMirror.Pos(pos.line + 1, 0) : CodeMirror.Pos(pos.line, pos.ch + 1)};
+ }
+
+ var dontIndentOnAutoClose = (typeof opt == "object" && opt.dontIndentOnAutoClose);
+ for (var i = ranges.length - 1; i >= 0; i--) {
+ var info = replacements[i];
+ cm.replaceRange(info.text, ranges[i].head, ranges[i].anchor, "+insert");
+ var sel = cm.listSelections().slice(0);
+ sel[i] = {head: info.newPos, anchor: info.newPos};
+ cm.setSelections(sel);
+ if (!dontIndentOnAutoClose && info.indent) {
+ cm.indentLine(info.newPos.line, null, true);
+ cm.indentLine(info.newPos.line + 1, null, true);
+ }
+ }
+ }
+
+ function autoCloseCurrent(cm, typingSlash) {
+ var ranges = cm.listSelections(), replacements = [];
+ var head = typingSlash ? "/" : "") replacement += ">";
+ replacements[i] = replacement;
+ }
+ cm.replaceSelections(replacements);
+ ranges = cm.listSelections();
+ if (!dontIndentOnAutoClose) {
+ for (var i = 0; i < ranges.length; i++)
+ if (i == ranges.length - 1 || ranges[i].head.line < ranges[i + 1].head.line)
+ cm.indentLine(ranges[i].head.line);
+ }
+ }
+
+ function autoCloseSlash(cm) {
+ if (cm.getOption("disableInput")) return CodeMirror.Pass;
+ return autoCloseCurrent(cm, true);
+ }
+
+ CodeMirror.commands.closeTag = function(cm) { return autoCloseCurrent(cm); };
+
+ function indexOf(collection, elt) {
+ if (collection.indexOf) return collection.indexOf(elt);
+ for (var i = 0, e = collection.length; i < e; ++i)
+ if (collection[i] == elt) return i;
+ return -1;
+ }
+
+ // If xml-fold is loaded, we use its functionality to try and verify
+ // whether a given tag is actually unclosed.
+ function closingTagExists(cm, context, tagName, pos, newTag) {
+ if (!CodeMirror.scanForClosingTag) return false;
+ var end = Math.min(cm.lastLine() + 1, pos.line + 500);
+ var nextClose = CodeMirror.scanForClosingTag(cm, pos, null, end);
+ if (!nextClose || nextClose.tag != tagName) return false;
+ // If the immediate wrapping context contains onCx instances of
+ // the same tag, a closing tag only exists if there are at least
+ // that many closing tags of that type following.
+ var onCx = newTag ? 1 : 0
+ for (var i = context.length - 1; i >= 0; i--) {
+ if (context[i] == tagName) ++onCx
+ else break
+ }
+ pos = nextClose.to;
+ for (var i = 1; i < onCx; i++) {
+ var next = CodeMirror.scanForClosingTag(cm, pos, null, end);
+ if (!next || next.tag != tagName) return false;
+ pos = next.to;
+ }
+ return true;
+ }
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/edit/continuelist.js b/modules/cookiesplus/lib/CodeMirror/addon/edit/continuelist.js
new file mode 100644
index 00000000..490f788d
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/edit/continuelist.js
@@ -0,0 +1,121 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ var listRE = /^(\s*)(>[> ]*|[*+-] \[[x ]\]\s|[*+-]\s|(\d+)([.)]))(\s*)/,
+ emptyListRE = /^(\s*)(>[> ]*|[*+-] \[[x ]\]|[*+-]|(\d+)[.)])(\s*)$/,
+ unorderedListRE = /[*+-]\s/;
+
+ CodeMirror.commands.newlineAndIndentContinueMarkdownList = function(cm) {
+ if (cm.getOption("disableInput")) return CodeMirror.Pass;
+ var ranges = cm.listSelections(), replacements = [];
+ for (var i = 0; i < ranges.length; i++) {
+ var pos = ranges[i].head;
+
+ // If we're not in Markdown mode, fall back to normal newlineAndIndent
+ var eolState = cm.getStateAfter(pos.line);
+ var inner = CodeMirror.innerMode(cm.getMode(), eolState);
+ if (inner.mode.name !== "markdown") {
+ cm.execCommand("newlineAndIndent");
+ return;
+ } else {
+ eolState = inner.state;
+ }
+
+ var inList = eolState.list !== false;
+ var inQuote = eolState.quote !== 0;
+
+ var line = cm.getLine(pos.line), match = listRE.exec(line);
+ var cursorBeforeBullet = /^\s*$/.test(line.slice(0, pos.ch));
+ if (!ranges[i].empty() || (!inList && !inQuote) || !match || cursorBeforeBullet) {
+ cm.execCommand("newlineAndIndent");
+ return;
+ }
+ if (emptyListRE.test(line)) {
+ var endOfQuote = inQuote && />\s*$/.test(line)
+ var endOfList = !/>\s*$/.test(line)
+ if (endOfQuote || endOfList) cm.replaceRange("", {
+ line: pos.line, ch: 0
+ }, {
+ line: pos.line, ch: pos.ch + 1
+ });
+ replacements[i] = "\n";
+ } else {
+ var indent = match[1], after = match[5];
+ var numbered = !(unorderedListRE.test(match[2]) || match[2].indexOf(">") >= 0);
+ var bullet = numbered ? (parseInt(match[3], 10) + 1) + match[4] : match[2].replace("x", " ");
+ replacements[i] = "\n" + indent + bullet + after;
+
+ if (numbered) incrementRemainingMarkdownListNumbers(cm, pos);
+ }
+ }
+
+ cm.replaceSelections(replacements);
+ };
+
+ // Auto-updating Markdown list numbers when a new item is added to the
+ // middle of a list
+ function incrementRemainingMarkdownListNumbers(cm, pos) {
+ var startLine = pos.line, lookAhead = 0, skipCount = 0;
+ var startItem = listRE.exec(cm.getLine(startLine)), startIndent = startItem[1];
+
+ do {
+ lookAhead += 1;
+ var nextLineNumber = startLine + lookAhead;
+ var nextLine = cm.getLine(nextLineNumber), nextItem = listRE.exec(nextLine);
+
+ if (nextItem) {
+ var nextIndent = nextItem[1];
+ var newNumber = (parseInt(startItem[3], 10) + lookAhead - skipCount);
+ var nextNumber = (parseInt(nextItem[3], 10)), itemNumber = nextNumber;
+
+ if (startIndent === nextIndent && !isNaN(nextNumber)) {
+ if (newNumber === nextNumber) itemNumber = nextNumber + 1;
+ if (newNumber > nextNumber) itemNumber = newNumber + 1;
+ cm.replaceRange(
+ nextLine.replace(listRE, nextIndent + itemNumber + nextItem[4] + nextItem[5]),
+ {
+ line: nextLineNumber, ch: 0
+ }, {
+ line: nextLineNumber, ch: nextLine.length
+ });
+ } else {
+ if (startIndent.length > nextIndent.length) return;
+ // This doesn't run if the next line immediatley indents, as it is
+ // not clear of the users intention (new indented item or same level)
+ if ((startIndent.length < nextIndent.length) && (lookAhead === 1)) return;
+ skipCount += 1;
+ }
+ }
+ } while (nextItem);
+ }
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/edit/index.php b/modules/cookiesplus/lib/CodeMirror/addon/edit/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/edit/index.php
@@ -0,0 +1,32 @@
+", ")": "(<", "[": "]>", "]": "[<", "{": "}>", "}": "{<", "<": ">>", ">": "<<"};
+
+ function bracketRegex(config) {
+ return config && config.bracketRegex || /[(){}[\]]/
+ }
+
+ function findMatchingBracket(cm, where, config) {
+ var line = cm.getLineHandle(where.line), pos = where.ch - 1;
+ var afterCursor = config && config.afterCursor
+ if (afterCursor == null)
+ afterCursor = /(^| )cm-fat-cursor($| )/.test(cm.getWrapperElement().className)
+ var re = bracketRegex(config)
+
+ // A cursor is defined as between two characters, but in in vim command mode
+ // (i.e. not insert mode), the cursor is visually represented as a
+ // highlighted box on top of the 2nd character. Otherwise, we allow matches
+ // from before or after the cursor.
+ var match = (!afterCursor && pos >= 0 && re.test(line.text.charAt(pos)) && matching[line.text.charAt(pos)]) ||
+ re.test(line.text.charAt(pos + 1)) && matching[line.text.charAt(++pos)];
+ if (!match) return null;
+ var dir = match.charAt(1) == ">" ? 1 : -1;
+ if (config && config.strict && (dir > 0) != (pos == where.ch)) return null;
+ var style = cm.getTokenTypeAt(Pos(where.line, pos + 1));
+
+ var found = scanForBracket(cm, Pos(where.line, pos + (dir > 0 ? 1 : 0)), dir, style || null, config);
+ if (found == null) return null;
+ return {from: Pos(where.line, pos), to: found && found.pos,
+ match: found && found.ch == match.charAt(0), forward: dir > 0};
+ }
+
+ // bracketRegex is used to specify which type of bracket to scan
+ // should be a regexp, e.g. /[[\]]/
+ //
+ // Note: If "where" is on an open bracket, then this bracket is ignored.
+ //
+ // Returns false when no bracket was found, null when it reached
+ // maxScanLines and gave up
+ function scanForBracket(cm, where, dir, style, config) {
+ var maxScanLen = (config && config.maxScanLineLength) || 10000;
+ var maxScanLines = (config && config.maxScanLines) || 1000;
+
+ var stack = [];
+ var re = bracketRegex(config)
+ var lineEnd = dir > 0 ? Math.min(where.line + maxScanLines, cm.lastLine() + 1)
+ : Math.max(cm.firstLine() - 1, where.line - maxScanLines);
+ for (var lineNo = where.line; lineNo != lineEnd; lineNo += dir) {
+ var line = cm.getLine(lineNo);
+ if (!line) continue;
+ var pos = dir > 0 ? 0 : line.length - 1, end = dir > 0 ? line.length : -1;
+ if (line.length > maxScanLen) continue;
+ if (lineNo == where.line) pos = where.ch - (dir < 0 ? 1 : 0);
+ for (; pos != end; pos += dir) {
+ var ch = line.charAt(pos);
+ if (re.test(ch) && (style === undefined || cm.getTokenTypeAt(Pos(lineNo, pos + 1)) == style)) {
+ var match = matching[ch];
+ if (match && (match.charAt(1) == ">") == (dir > 0)) stack.push(ch);
+ else if (!stack.length) return {pos: Pos(lineNo, pos), ch: ch};
+ else stack.pop();
+ }
+ }
+ }
+ return lineNo - dir == (dir > 0 ? cm.lastLine() : cm.firstLine()) ? false : null;
+ }
+
+ function matchBrackets(cm, autoclear, config) {
+ // Disable brace matching in long lines, since it'll cause hugely slow updates
+ var maxHighlightLen = cm.state.matchBrackets.maxHighlightLineLength || 1000;
+ var marks = [], ranges = cm.listSelections();
+ for (var i = 0; i < ranges.length; i++) {
+ var match = ranges[i].empty() && findMatchingBracket(cm, ranges[i].head, config);
+ if (match && cm.getLine(match.from.line).length <= maxHighlightLen) {
+ var style = match.match ? "CodeMirror-matchingbracket" : "CodeMirror-nonmatchingbracket";
+ marks.push(cm.markText(match.from, Pos(match.from.line, match.from.ch + 1), {className: style}));
+ if (match.to && cm.getLine(match.to.line).length <= maxHighlightLen)
+ marks.push(cm.markText(match.to, Pos(match.to.line, match.to.ch + 1), {className: style}));
+ }
+ }
+
+ if (marks.length) {
+ // Kludge to work around the IE bug from issue #1193, where text
+ // input stops going to the textare whever this fires.
+ if (ie_lt8 && cm.state.focused) cm.focus();
+
+ var clear = function() {
+ cm.operation(function() {
+ for (var i = 0; i < marks.length; i++) marks[i].clear();
+ });
+ };
+ if (autoclear) setTimeout(clear, 800);
+ else return clear;
+ }
+ }
+
+ function doMatchBrackets(cm) {
+ cm.operation(function() {
+ if (cm.state.matchBrackets.currentlyHighlighted) {
+ cm.state.matchBrackets.currentlyHighlighted();
+ cm.state.matchBrackets.currentlyHighlighted = null;
+ }
+ cm.state.matchBrackets.currentlyHighlighted = matchBrackets(cm, false, cm.state.matchBrackets);
+ });
+ }
+
+ CodeMirror.defineOption("matchBrackets", false, function(cm, val, old) {
+ function clear(cm) {
+ if (cm.state.matchBrackets && cm.state.matchBrackets.currentlyHighlighted) {
+ cm.state.matchBrackets.currentlyHighlighted();
+ cm.state.matchBrackets.currentlyHighlighted = null;
+ }
+ }
+
+ if (old && old != CodeMirror.Init) {
+ cm.off("cursorActivity", doMatchBrackets);
+ cm.off("focus", doMatchBrackets)
+ cm.off("blur", clear)
+ clear(cm);
+ }
+ if (val) {
+ cm.state.matchBrackets = typeof val == "object" ? val : {};
+ cm.on("cursorActivity", doMatchBrackets);
+ cm.on("focus", doMatchBrackets)
+ cm.on("blur", clear)
+ }
+ });
+
+ CodeMirror.defineExtension("matchBrackets", function() {matchBrackets(this, true);});
+ CodeMirror.defineExtension("findMatchingBracket", function(pos, config, oldConfig){
+ // Backwards-compatibility kludge
+ if (oldConfig || typeof config == "boolean") {
+ if (!oldConfig) {
+ config = config ? {strict: true} : null
+ } else {
+ oldConfig.strict = config
+ config = oldConfig
+ }
+ }
+ return findMatchingBracket(this, pos, config)
+ });
+ CodeMirror.defineExtension("scanForBracket", function(pos, dir, style, config){
+ return scanForBracket(this, pos, dir, style, config);
+ });
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/edit/matchtags.js b/modules/cookiesplus/lib/CodeMirror/addon/edit/matchtags.js
new file mode 100644
index 00000000..a6c8835b
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/edit/matchtags.js
@@ -0,0 +1,86 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"), require("../fold/xml-fold"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror", "../fold/xml-fold"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ CodeMirror.defineOption("matchTags", false, function(cm, val, old) {
+ if (old && old != CodeMirror.Init) {
+ cm.off("cursorActivity", doMatchTags);
+ cm.off("viewportChange", maybeUpdateMatch);
+ clear(cm);
+ }
+ if (val) {
+ cm.state.matchBothTags = typeof val == "object" && val.bothTags;
+ cm.on("cursorActivity", doMatchTags);
+ cm.on("viewportChange", maybeUpdateMatch);
+ doMatchTags(cm);
+ }
+ });
+
+ function clear(cm) {
+ if (cm.state.tagHit) cm.state.tagHit.clear();
+ if (cm.state.tagOther) cm.state.tagOther.clear();
+ cm.state.tagHit = cm.state.tagOther = null;
+ }
+
+ function doMatchTags(cm) {
+ cm.state.failedTagMatch = false;
+ cm.operation(function() {
+ clear(cm);
+ if (cm.somethingSelected()) return;
+ var cur = cm.getCursor(), range = cm.getViewport();
+ range.from = Math.min(range.from, cur.line); range.to = Math.max(cur.line + 1, range.to);
+ var match = CodeMirror.findMatchingTag(cm, cur, range);
+ if (!match) return;
+ if (cm.state.matchBothTags) {
+ var hit = match.at == "open" ? match.open : match.close;
+ if (hit) cm.state.tagHit = cm.markText(hit.from, hit.to, {className: "CodeMirror-matchingtag"});
+ }
+ var other = match.at == "close" ? match.open : match.close;
+ if (other)
+ cm.state.tagOther = cm.markText(other.from, other.to, {className: "CodeMirror-matchingtag"});
+ else
+ cm.state.failedTagMatch = true;
+ });
+ }
+
+ function maybeUpdateMatch(cm) {
+ if (cm.state.failedTagMatch) doMatchTags(cm);
+ }
+
+ CodeMirror.commands.toMatchingTag = function(cm) {
+ var found = CodeMirror.findMatchingTag(cm, cm.getCursor());
+ if (found) {
+ var other = found.at == "close" ? found.open : found.close;
+ if (other) cm.extendSelection(other.to, other.from);
+ }
+ };
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/edit/trailingspace.js b/modules/cookiesplus/lib/CodeMirror/addon/edit/trailingspace.js
new file mode 100644
index 00000000..ab7cc629
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/edit/trailingspace.js
@@ -0,0 +1,47 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ CodeMirror.defineOption("showTrailingSpace", false, function(cm, val, prev) {
+ if (prev == CodeMirror.Init) prev = false;
+ if (prev && !val)
+ cm.removeOverlay("trailingspace");
+ else if (!prev && val)
+ cm.addOverlay({
+ token: function(stream) {
+ for (var l = stream.string.length, i = l; i && /\s/.test(stream.string.charAt(i - 1)); --i) {}
+ if (i > stream.pos) { stream.pos = i; return null; }
+ stream.pos = l;
+ return "trailingspace";
+ },
+ name: "trailingspace"
+ });
+ });
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/fold/brace-fold.js b/modules/cookiesplus/lib/CodeMirror/addon/fold/brace-fold.js
new file mode 100644
index 00000000..1567395c
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/fold/brace-fold.js
@@ -0,0 +1,125 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+"use strict";
+
+CodeMirror.registerHelper("fold", "brace", function(cm, start) {
+ var line = start.line, lineText = cm.getLine(line);
+ var tokenType;
+
+ function findOpening(openCh) {
+ for (var at = start.ch, pass = 0;;) {
+ var found = at <= 0 ? -1 : lineText.lastIndexOf(openCh, at - 1);
+ if (found == -1) {
+ if (pass == 1) break;
+ pass = 1;
+ at = lineText.length;
+ continue;
+ }
+ if (pass == 1 && found < start.ch) break;
+ tokenType = cm.getTokenTypeAt(CodeMirror.Pos(line, found + 1));
+ if (!/^(comment|string)/.test(tokenType)) return found + 1;
+ at = found - 1;
+ }
+ }
+
+ var startToken = "{", endToken = "}", startCh = findOpening("{");
+ if (startCh == null) {
+ startToken = "[", endToken = "]";
+ startCh = findOpening("[");
+ }
+
+ if (startCh == null) return;
+ var count = 1, lastLine = cm.lastLine(), end, endCh;
+ outer: for (var i = line; i <= lastLine; ++i) {
+ var text = cm.getLine(i), pos = i == line ? startCh : 0;
+ for (;;) {
+ var nextOpen = text.indexOf(startToken, pos), nextClose = text.indexOf(endToken, pos);
+ if (nextOpen < 0) nextOpen = text.length;
+ if (nextClose < 0) nextClose = text.length;
+ pos = Math.min(nextOpen, nextClose);
+ if (pos == text.length) break;
+ if (cm.getTokenTypeAt(CodeMirror.Pos(i, pos + 1)) == tokenType) {
+ if (pos == nextOpen) ++count;
+ else if (!--count) { end = i; endCh = pos; break outer; }
+ }
+ ++pos;
+ }
+ }
+ if (end == null || line == end) return;
+ return {from: CodeMirror.Pos(line, startCh),
+ to: CodeMirror.Pos(end, endCh)};
+});
+
+CodeMirror.registerHelper("fold", "import", function(cm, start) {
+ function hasImport(line) {
+ if (line < cm.firstLine() || line > cm.lastLine()) return null;
+ var start = cm.getTokenAt(CodeMirror.Pos(line, 1));
+ if (!/\S/.test(start.string)) start = cm.getTokenAt(CodeMirror.Pos(line, start.end + 1));
+ if (start.type != "keyword" || start.string != "import") return null;
+ // Now find closing semicolon, return its position
+ for (var i = line, e = Math.min(cm.lastLine(), line + 10); i <= e; ++i) {
+ var text = cm.getLine(i), semi = text.indexOf(";");
+ if (semi != -1) return {startCh: start.end, end: CodeMirror.Pos(i, semi)};
+ }
+ }
+
+ var startLine = start.line, has = hasImport(startLine), prev;
+ if (!has || hasImport(startLine - 1) || ((prev = hasImport(startLine - 2)) && prev.end.line == startLine - 1))
+ return null;
+ for (var end = has.end;;) {
+ var next = hasImport(end.line + 1);
+ if (next == null) break;
+ end = next.end;
+ }
+ return {from: cm.clipPos(CodeMirror.Pos(startLine, has.startCh + 1)), to: end};
+});
+
+CodeMirror.registerHelper("fold", "include", function(cm, start) {
+ function hasInclude(line) {
+ if (line < cm.firstLine() || line > cm.lastLine()) return null;
+ var start = cm.getTokenAt(CodeMirror.Pos(line, 1));
+ if (!/\S/.test(start.string)) start = cm.getTokenAt(CodeMirror.Pos(line, start.end + 1));
+ if (start.type == "meta" && start.string.slice(0, 8) == "#include") return start.start + 8;
+ }
+
+ var startLine = start.line, has = hasInclude(startLine);
+ if (has == null || hasInclude(startLine - 1) != null) return null;
+ for (var end = startLine;;) {
+ var next = hasInclude(end + 1);
+ if (next == null) break;
+ ++end;
+ }
+ return {from: CodeMirror.Pos(startLine, has + 1),
+ to: cm.clipPos(CodeMirror.Pos(end))};
+});
+
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/fold/comment-fold.js b/modules/cookiesplus/lib/CodeMirror/addon/fold/comment-fold.js
new file mode 100644
index 00000000..b457d426
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/fold/comment-fold.js
@@ -0,0 +1,79 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+"use strict";
+
+CodeMirror.registerGlobalHelper("fold", "comment", function(mode) {
+ return mode.blockCommentStart && mode.blockCommentEnd;
+}, function(cm, start) {
+ var mode = cm.getModeAt(start), startToken = mode.blockCommentStart, endToken = mode.blockCommentEnd;
+ if (!startToken || !endToken) return;
+ var line = start.line, lineText = cm.getLine(line);
+
+ var startCh;
+ for (var at = start.ch, pass = 0;;) {
+ var found = at <= 0 ? -1 : lineText.lastIndexOf(startToken, at - 1);
+ if (found == -1) {
+ if (pass == 1) return;
+ pass = 1;
+ at = lineText.length;
+ continue;
+ }
+ if (pass == 1 && found < start.ch) return;
+ if (/comment/.test(cm.getTokenTypeAt(CodeMirror.Pos(line, found + 1))) &&
+ (found == 0 || lineText.slice(found - endToken.length, found) == endToken ||
+ !/comment/.test(cm.getTokenTypeAt(CodeMirror.Pos(line, found))))) {
+ startCh = found + startToken.length;
+ break;
+ }
+ at = found - 1;
+ }
+
+ var depth = 1, lastLine = cm.lastLine(), end, endCh;
+ outer: for (var i = line; i <= lastLine; ++i) {
+ var text = cm.getLine(i), pos = i == line ? startCh : 0;
+ for (;;) {
+ var nextOpen = text.indexOf(startToken, pos), nextClose = text.indexOf(endToken, pos);
+ if (nextOpen < 0) nextOpen = text.length;
+ if (nextClose < 0) nextClose = text.length;
+ pos = Math.min(nextOpen, nextClose);
+ if (pos == text.length) break;
+ if (pos == nextOpen) ++depth;
+ else if (!--depth) { end = i; endCh = pos; break outer; }
+ ++pos;
+ }
+ }
+ if (end == null || line == end && endCh == startCh) return;
+ return {from: CodeMirror.Pos(line, startCh),
+ to: CodeMirror.Pos(end, endCh)};
+});
+
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/fold/foldcode.js b/modules/cookiesplus/lib/CodeMirror/addon/fold/foldcode.js
new file mode 100644
index 00000000..d5e03755
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/fold/foldcode.js
@@ -0,0 +1,177 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ function doFold(cm, pos, options, force) {
+ if (options && options.call) {
+ var finder = options;
+ options = null;
+ } else {
+ var finder = getOption(cm, options, "rangeFinder");
+ }
+ if (typeof pos == "number") pos = CodeMirror.Pos(pos, 0);
+ var minSize = getOption(cm, options, "minFoldSize");
+
+ function getRange(allowFolded) {
+ var range = finder(cm, pos);
+ if (!range || range.to.line - range.from.line < minSize) return null;
+ var marks = cm.findMarksAt(range.from);
+ for (var i = 0; i < marks.length; ++i) {
+ if (marks[i].__isFold && force !== "fold") {
+ if (!allowFolded) return null;
+ range.cleared = true;
+ marks[i].clear();
+ }
+ }
+ return range;
+ }
+
+ var range = getRange(true);
+ if (getOption(cm, options, "scanUp")) while (!range && pos.line > cm.firstLine()) {
+ pos = CodeMirror.Pos(pos.line - 1, 0);
+ range = getRange(false);
+ }
+ if (!range || range.cleared || force === "unfold") return;
+
+ var myWidget = makeWidget(cm, options, range);
+ CodeMirror.on(myWidget, "mousedown", function(e) {
+ myRange.clear();
+ CodeMirror.e_preventDefault(e);
+ });
+ var myRange = cm.markText(range.from, range.to, {
+ replacedWith: myWidget,
+ clearOnEnter: getOption(cm, options, "clearOnEnter"),
+ __isFold: true
+ });
+ myRange.on("clear", function(from, to) {
+ CodeMirror.signal(cm, "unfold", cm, from, to);
+ });
+ CodeMirror.signal(cm, "fold", cm, range.from, range.to);
+ }
+
+ function makeWidget(cm, options, range) {
+ var widget = getOption(cm, options, "widget");
+
+ if (typeof widget == "function") {
+ widget = widget(range.from, range.to);
+ }
+
+ if (typeof widget == "string") {
+ var text = document.createTextNode(widget);
+ widget = document.createElement("span");
+ widget.appendChild(text);
+ widget.className = "CodeMirror-foldmarker";
+ } else if (widget) {
+ widget = widget.cloneNode(true)
+ }
+ return widget;
+ }
+
+ // Clumsy backwards-compatible interface
+ CodeMirror.newFoldFunction = function(rangeFinder, widget) {
+ return function(cm, pos) { doFold(cm, pos, {rangeFinder: rangeFinder, widget: widget}); };
+ };
+
+ // New-style interface
+ CodeMirror.defineExtension("foldCode", function(pos, options, force) {
+ doFold(this, pos, options, force);
+ });
+
+ CodeMirror.defineExtension("isFolded", function(pos) {
+ var marks = this.findMarksAt(pos);
+ for (var i = 0; i < marks.length; ++i)
+ if (marks[i].__isFold) return true;
+ });
+
+ CodeMirror.commands.toggleFold = function(cm) {
+ cm.foldCode(cm.getCursor());
+ };
+ CodeMirror.commands.fold = function(cm) {
+ cm.foldCode(cm.getCursor(), null, "fold");
+ };
+ CodeMirror.commands.unfold = function(cm) {
+ cm.foldCode(cm.getCursor(), null, "unfold");
+ };
+ CodeMirror.commands.foldAll = function(cm) {
+ cm.operation(function() {
+ for (var i = cm.firstLine(), e = cm.lastLine(); i <= e; i++)
+ cm.foldCode(CodeMirror.Pos(i, 0), null, "fold");
+ });
+ };
+ CodeMirror.commands.unfoldAll = function(cm) {
+ cm.operation(function() {
+ for (var i = cm.firstLine(), e = cm.lastLine(); i <= e; i++)
+ cm.foldCode(CodeMirror.Pos(i, 0), null, "unfold");
+ });
+ };
+
+ CodeMirror.registerHelper("fold", "combine", function() {
+ var funcs = Array.prototype.slice.call(arguments, 0);
+ return function(cm, start) {
+ for (var i = 0; i < funcs.length; ++i) {
+ var found = funcs[i](cm, start);
+ if (found) return found;
+ }
+ };
+ });
+
+ CodeMirror.registerHelper("fold", "auto", function(cm, start) {
+ var helpers = cm.getHelpers(start, "fold");
+ for (var i = 0; i < helpers.length; i++) {
+ var cur = helpers[i](cm, start);
+ if (cur) return cur;
+ }
+ });
+
+ var defaultOptions = {
+ rangeFinder: CodeMirror.fold.auto,
+ widget: "\u2194",
+ minFoldSize: 0,
+ scanUp: false,
+ clearOnEnter: true
+ };
+
+ CodeMirror.defineOption("foldOptions", null);
+
+ function getOption(cm, options, name) {
+ if (options && options[name] !== undefined)
+ return options[name];
+ var editorOptions = cm.options.foldOptions;
+ if (editorOptions && editorOptions[name] !== undefined)
+ return editorOptions[name];
+ return defaultOptions[name];
+ }
+
+ CodeMirror.defineExtension("foldOption", function(options, name) {
+ return getOption(this, options, name);
+ });
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/fold/foldgutter.css b/modules/cookiesplus/lib/CodeMirror/addon/fold/foldgutter.css
new file mode 100644
index 00000000..c2e55e69
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/fold/foldgutter.css
@@ -0,0 +1,43 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+.CodeMirror-foldmarker {
+ color: blue;
+ text-shadow: #b9f 1px 1px 2px, #b9f -1px -1px 2px, #b9f 1px -1px 2px, #b9f -1px 1px 2px;
+ font-family: arial;
+ line-height: .3;
+ cursor: pointer;
+}
+.CodeMirror-foldgutter {
+ width: .7em;
+}
+.CodeMirror-foldgutter-open,
+.CodeMirror-foldgutter-folded {
+ cursor: pointer;
+}
+.CodeMirror-foldgutter-open:after {
+ content: "\25BE";
+}
+.CodeMirror-foldgutter-folded:after {
+ content: "\25B8";
+}
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/fold/foldgutter.js b/modules/cookiesplus/lib/CodeMirror/addon/fold/foldgutter.js
new file mode 100644
index 00000000..a62583c8
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/fold/foldgutter.js
@@ -0,0 +1,183 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"), require("./foldcode"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror", "./foldcode"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ CodeMirror.defineOption("foldGutter", false, function(cm, val, old) {
+ if (old && old != CodeMirror.Init) {
+ cm.clearGutter(cm.state.foldGutter.options.gutter);
+ cm.state.foldGutter = null;
+ cm.off("gutterClick", onGutterClick);
+ cm.off("changes", onChange);
+ cm.off("viewportChange", onViewportChange);
+ cm.off("fold", onFold);
+ cm.off("unfold", onFold);
+ cm.off("swapDoc", onChange);
+ }
+ if (val) {
+ cm.state.foldGutter = new State(parseOptions(val));
+ updateInViewport(cm);
+ cm.on("gutterClick", onGutterClick);
+ cm.on("changes", onChange);
+ cm.on("viewportChange", onViewportChange);
+ cm.on("fold", onFold);
+ cm.on("unfold", onFold);
+ cm.on("swapDoc", onChange);
+ }
+ });
+
+ var Pos = CodeMirror.Pos;
+
+ function State(options) {
+ this.options = options;
+ this.from = this.to = 0;
+ }
+
+ function parseOptions(opts) {
+ if (opts === true) opts = {};
+ if (opts.gutter == null) opts.gutter = "CodeMirror-foldgutter";
+ if (opts.indicatorOpen == null) opts.indicatorOpen = "CodeMirror-foldgutter-open";
+ if (opts.indicatorFolded == null) opts.indicatorFolded = "CodeMirror-foldgutter-folded";
+ return opts;
+ }
+
+ function isFolded(cm, line) {
+ var marks = cm.findMarks(Pos(line, 0), Pos(line + 1, 0));
+ for (var i = 0; i < marks.length; ++i) {
+ if (marks[i].__isFold) {
+ var fromPos = marks[i].find(-1);
+ if (fromPos && fromPos.line === line)
+ return marks[i];
+ }
+ }
+ }
+
+ function marker(spec) {
+ if (typeof spec == "string") {
+ var elt = document.createElement("div");
+ elt.className = spec + " CodeMirror-guttermarker-subtle";
+ return elt;
+ } else {
+ return spec.cloneNode(true);
+ }
+ }
+
+ function updateFoldInfo(cm, from, to) {
+ var opts = cm.state.foldGutter.options, cur = from - 1;
+ var minSize = cm.foldOption(opts, "minFoldSize");
+ var func = cm.foldOption(opts, "rangeFinder");
+ // we can reuse the built-in indicator element if its className matches the new state
+ var clsFolded = typeof opts.indicatorFolded == "string" && classTest(opts.indicatorFolded);
+ var clsOpen = typeof opts.indicatorOpen == "string" && classTest(opts.indicatorOpen);
+ cm.eachLine(from, to, function(line) {
+ ++cur;
+ var mark = null;
+ var old = line.gutterMarkers;
+ if (old) old = old[opts.gutter];
+ if (isFolded(cm, cur)) {
+ if (clsFolded && old && clsFolded.test(old.className)) return;
+ mark = marker(opts.indicatorFolded);
+ } else {
+ var pos = Pos(cur, 0);
+ var range = func && func(cm, pos);
+ if (range && range.to.line - range.from.line >= minSize) {
+ if (clsOpen && old && clsOpen.test(old.className)) return;
+ mark = marker(opts.indicatorOpen);
+ }
+ }
+ if (!mark && !old) return;
+ cm.setGutterMarker(line, opts.gutter, mark);
+ });
+ }
+
+ // copied from CodeMirror/src/util/dom.js
+ function classTest(cls) { return new RegExp("(^|\\s)" + cls + "(?:$|\\s)\\s*") }
+
+ function updateInViewport(cm) {
+ var vp = cm.getViewport(), state = cm.state.foldGutter;
+ if (!state) return;
+ cm.operation(function() {
+ updateFoldInfo(cm, vp.from, vp.to);
+ });
+ state.from = vp.from; state.to = vp.to;
+ }
+
+ function onGutterClick(cm, line, gutter) {
+ var state = cm.state.foldGutter;
+ if (!state) return;
+ var opts = state.options;
+ if (gutter != opts.gutter) return;
+ var folded = isFolded(cm, line);
+ if (folded) folded.clear();
+ else cm.foldCode(Pos(line, 0), opts);
+ }
+
+ function onChange(cm) {
+ var state = cm.state.foldGutter;
+ if (!state) return;
+ var opts = state.options;
+ state.from = state.to = 0;
+ clearTimeout(state.changeUpdate);
+ state.changeUpdate = setTimeout(function() { updateInViewport(cm); }, opts.foldOnChangeTimeSpan || 600);
+ }
+
+ function onViewportChange(cm) {
+ var state = cm.state.foldGutter;
+ if (!state) return;
+ var opts = state.options;
+ clearTimeout(state.changeUpdate);
+ state.changeUpdate = setTimeout(function() {
+ var vp = cm.getViewport();
+ if (state.from == state.to || vp.from - state.to > 20 || state.from - vp.to > 20) {
+ updateInViewport(cm);
+ } else {
+ cm.operation(function() {
+ if (vp.from < state.from) {
+ updateFoldInfo(cm, vp.from, state.from);
+ state.from = vp.from;
+ }
+ if (vp.to > state.to) {
+ updateFoldInfo(cm, state.to, vp.to);
+ state.to = vp.to;
+ }
+ });
+ }
+ }, opts.updateViewportTimeSpan || 400);
+ }
+
+ function onFold(cm, from) {
+ var state = cm.state.foldGutter;
+ if (!state) return;
+ var line = from.line;
+ if (line >= state.from && line < state.to)
+ updateFoldInfo(cm, line, line + 1);
+ }
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/fold/indent-fold.js b/modules/cookiesplus/lib/CodeMirror/addon/fold/indent-fold.js
new file mode 100644
index 00000000..6ac9bd47
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/fold/indent-fold.js
@@ -0,0 +1,68 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+"use strict";
+
+function lineIndent(cm, lineNo) {
+ var text = cm.getLine(lineNo)
+ var spaceTo = text.search(/\S/)
+ if (spaceTo == -1 || /\bcomment\b/.test(cm.getTokenTypeAt(CodeMirror.Pos(lineNo, spaceTo + 1))))
+ return -1
+ return CodeMirror.countColumn(text, null, cm.getOption("tabSize"))
+}
+
+CodeMirror.registerHelper("fold", "indent", function(cm, start) {
+ var myIndent = lineIndent(cm, start.line)
+ if (myIndent < 0) return
+ var lastLineInFold = null
+
+ // Go through lines until we find a line that definitely doesn't belong in
+ // the block we're folding, or to the end.
+ for (var i = start.line + 1, end = cm.lastLine(); i <= end; ++i) {
+ var indent = lineIndent(cm, i)
+ if (indent == -1) {
+ } else if (indent > myIndent) {
+ // Lines with a greater indent are considered part of the block.
+ lastLineInFold = i;
+ } else {
+ // If this line has non-space, non-comment content, and is
+ // indented less or equal to the start line, it is the start of
+ // another block.
+ break;
+ }
+ }
+ if (lastLineInFold) return {
+ from: CodeMirror.Pos(start.line, cm.getLine(start.line).length),
+ to: CodeMirror.Pos(lastLineInFold, cm.getLine(lastLineInFold).length)
+ };
+});
+
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/fold/index.php b/modules/cookiesplus/lib/CodeMirror/addon/fold/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/fold/index.php
@@ -0,0 +1,32 @@
+= iter.max) return;
+ iter.ch = 0;
+ iter.text = iter.cm.getLine(++iter.line);
+ return true;
+ }
+ function prevLine(iter) {
+ if (iter.line <= iter.min) return;
+ iter.text = iter.cm.getLine(--iter.line);
+ iter.ch = iter.text.length;
+ return true;
+ }
+
+ function toTagEnd(iter) {
+ for (;;) {
+ var gt = iter.text.indexOf(">", iter.ch);
+ if (gt == -1) { if (nextLine(iter)) continue; else return; }
+ if (!tagAt(iter, gt + 1)) { iter.ch = gt + 1; continue; }
+ var lastSlash = iter.text.lastIndexOf("/", gt);
+ var selfClose = lastSlash > -1 && !/\S/.test(iter.text.slice(lastSlash + 1, gt));
+ iter.ch = gt + 1;
+ return selfClose ? "selfClose" : "regular";
+ }
+ }
+ function toTagStart(iter) {
+ for (;;) {
+ var lt = iter.ch ? iter.text.lastIndexOf("<", iter.ch - 1) : -1;
+ if (lt == -1) { if (prevLine(iter)) continue; else return; }
+ if (!tagAt(iter, lt + 1)) { iter.ch = lt; continue; }
+ xmlTagStart.lastIndex = lt;
+ iter.ch = lt;
+ var match = xmlTagStart.exec(iter.text);
+ if (match && match.index == lt) return match;
+ }
+ }
+
+ function toNextTag(iter) {
+ for (;;) {
+ xmlTagStart.lastIndex = iter.ch;
+ var found = xmlTagStart.exec(iter.text);
+ if (!found) { if (nextLine(iter)) continue; else return; }
+ if (!tagAt(iter, found.index + 1)) { iter.ch = found.index + 1; continue; }
+ iter.ch = found.index + found[0].length;
+ return found;
+ }
+ }
+ function toPrevTag(iter) {
+ for (;;) {
+ var gt = iter.ch ? iter.text.lastIndexOf(">", iter.ch - 1) : -1;
+ if (gt == -1) { if (prevLine(iter)) continue; else return; }
+ if (!tagAt(iter, gt + 1)) { iter.ch = gt; continue; }
+ var lastSlash = iter.text.lastIndexOf("/", gt);
+ var selfClose = lastSlash > -1 && !/\S/.test(iter.text.slice(lastSlash + 1, gt));
+ iter.ch = gt + 1;
+ return selfClose ? "selfClose" : "regular";
+ }
+ }
+
+ function findMatchingClose(iter, tag) {
+ var stack = [];
+ for (;;) {
+ var next = toNextTag(iter), end, startLine = iter.line, startCh = iter.ch - (next ? next[0].length : 0);
+ if (!next || !(end = toTagEnd(iter))) return;
+ if (end == "selfClose") continue;
+ if (next[1]) { // closing tag
+ for (var i = stack.length - 1; i >= 0; --i) if (stack[i] == next[2]) {
+ stack.length = i;
+ break;
+ }
+ if (i < 0 && (!tag || tag == next[2])) return {
+ tag: next[2],
+ from: Pos(startLine, startCh),
+ to: Pos(iter.line, iter.ch)
+ };
+ } else { // opening tag
+ stack.push(next[2]);
+ }
+ }
+ }
+ function findMatchingOpen(iter, tag) {
+ var stack = [];
+ for (;;) {
+ var prev = toPrevTag(iter);
+ if (!prev) return;
+ if (prev == "selfClose") { toTagStart(iter); continue; }
+ var endLine = iter.line, endCh = iter.ch;
+ var start = toTagStart(iter);
+ if (!start) return;
+ if (start[1]) { // closing tag
+ stack.push(start[2]);
+ } else { // opening tag
+ for (var i = stack.length - 1; i >= 0; --i) if (stack[i] == start[2]) {
+ stack.length = i;
+ break;
+ }
+ if (i < 0 && (!tag || tag == start[2])) return {
+ tag: start[2],
+ from: Pos(iter.line, iter.ch),
+ to: Pos(endLine, endCh)
+ };
+ }
+ }
+ }
+
+ CodeMirror.registerHelper("fold", "xml", function(cm, start) {
+ var iter = new Iter(cm, start.line, 0);
+ for (;;) {
+ var openTag = toNextTag(iter)
+ if (!openTag || iter.line != start.line) return
+ var end = toTagEnd(iter)
+ if (!end) return
+ if (!openTag[1] && end != "selfClose") {
+ var startPos = Pos(iter.line, iter.ch);
+ var endPos = findMatchingClose(iter, openTag[2]);
+ return endPos && cmp(endPos.from, startPos) > 0 ? {from: startPos, to: endPos.from} : null
+ }
+ }
+ });
+ CodeMirror.findMatchingTag = function(cm, pos, range) {
+ var iter = new Iter(cm, pos.line, pos.ch, range);
+ if (iter.text.indexOf(">") == -1 && iter.text.indexOf("<") == -1) return;
+ var end = toTagEnd(iter), to = end && Pos(iter.line, iter.ch);
+ var start = end && toTagStart(iter);
+ if (!end || !start || cmp(iter, pos) > 0) return;
+ var here = {from: Pos(iter.line, iter.ch), to: to, tag: start[2]};
+ if (end == "selfClose") return {open: here, close: null, at: "open"};
+
+ if (start[1]) { // closing tag
+ return {open: findMatchingOpen(iter, start[2]), close: here, at: "close"};
+ } else { // opening tag
+ iter = new Iter(cm, to.line, to.ch, range);
+ return {open: here, close: findMatchingClose(iter, start[2]), at: "open"};
+ }
+ };
+
+ CodeMirror.findEnclosingTag = function(cm, pos, range, tag) {
+ var iter = new Iter(cm, pos.line, pos.ch, range);
+ for (;;) {
+ var open = findMatchingOpen(iter, tag);
+ if (!open) break;
+ var forward = new Iter(cm, pos.line, pos.ch, range);
+ var close = findMatchingClose(forward, open.tag);
+ if (close) return {open: open, close: close};
+ }
+ };
+
+ // Used by addon/edit/closetag.js
+ CodeMirror.scanForClosingTag = function(cm, pos, name, end) {
+ var iter = new Iter(cm, pos.line, pos.ch, end ? {from: 0, to: end} : null);
+ return findMatchingClose(iter, name);
+ };
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/hint/anyword-hint.js b/modules/cookiesplus/lib/CodeMirror/addon/hint/anyword-hint.js
new file mode 100644
index 00000000..68f48524
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/hint/anyword-hint.js
@@ -0,0 +1,61 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ var WORD = /[\w$]+/, RANGE = 500;
+
+ CodeMirror.registerHelper("hint", "anyword", function(editor, options) {
+ var word = options && options.word || WORD;
+ var range = options && options.range || RANGE;
+ var cur = editor.getCursor(), curLine = editor.getLine(cur.line);
+ var end = cur.ch, start = end;
+ while (start && word.test(curLine.charAt(start - 1))) --start;
+ var curWord = start != end && curLine.slice(start, end);
+
+ var list = options && options.list || [], seen = {};
+ var re = new RegExp(word.source, "g");
+ for (var dir = -1; dir <= 1; dir += 2) {
+ var line = cur.line, endLine = Math.min(Math.max(line + dir * range, editor.firstLine()), editor.lastLine()) + dir;
+ for (; line != endLine; line += dir) {
+ var text = editor.getLine(line), m;
+ while (m = re.exec(text)) {
+ if (line == cur.line && m[0] === curWord) continue;
+ if ((!curWord || m[0].lastIndexOf(curWord, 0) == 0) && !Object.prototype.hasOwnProperty.call(seen, m[0])) {
+ seen[m[0]] = true;
+ list.push(m[0]);
+ }
+ }
+ }
+ }
+ return {list: list, from: CodeMirror.Pos(cur.line, start), to: CodeMirror.Pos(cur.line, end)};
+ });
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/hint/css-hint.js b/modules/cookiesplus/lib/CodeMirror/addon/hint/css-hint.js
new file mode 100644
index 00000000..0af541ba
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/hint/css-hint.js
@@ -0,0 +1,86 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"), require("../../mode/css/css"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror", "../../mode/css/css"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ var pseudoClasses = {"active":1, "after":1, "before":1, "checked":1, "default":1,
+ "disabled":1, "empty":1, "enabled":1, "first-child":1, "first-letter":1,
+ "first-line":1, "first-of-type":1, "focus":1, "hover":1, "in-range":1,
+ "indeterminate":1, "invalid":1, "lang":1, "last-child":1, "last-of-type":1,
+ "link":1, "not":1, "nth-child":1, "nth-last-child":1, "nth-last-of-type":1,
+ "nth-of-type":1, "only-of-type":1, "only-child":1, "optional":1, "out-of-range":1,
+ "placeholder":1, "read-only":1, "read-write":1, "required":1, "root":1,
+ "selection":1, "target":1, "valid":1, "visited":1
+ };
+
+ CodeMirror.registerHelper("hint", "css", function(cm) {
+ var cur = cm.getCursor(), token = cm.getTokenAt(cur);
+ var inner = CodeMirror.innerMode(cm.getMode(), token.state);
+ if (inner.mode.name != "css") return;
+
+ if (token.type == "keyword" && "!important".indexOf(token.string) == 0)
+ return {list: ["!important"], from: CodeMirror.Pos(cur.line, token.start),
+ to: CodeMirror.Pos(cur.line, token.end)};
+
+ var start = token.start, end = cur.ch, word = token.string.slice(0, end - start);
+ if (/[^\w$_-]/.test(word)) {
+ word = ""; start = end = cur.ch;
+ }
+
+ var spec = CodeMirror.resolveMode("text/css");
+
+ var result = [];
+ function add(keywords) {
+ for (var name in keywords)
+ if (!word || name.lastIndexOf(word, 0) == 0)
+ result.push(name);
+ }
+
+ var st = inner.state.state;
+ if (st == "pseudo" || token.type == "variable-3") {
+ add(pseudoClasses);
+ } else if (st == "block" || st == "maybeprop") {
+ add(spec.propertyKeywords);
+ } else if (st == "prop" || st == "parens" || st == "at" || st == "params") {
+ add(spec.valueKeywords);
+ add(spec.colorKeywords);
+ } else if (st == "media" || st == "media_parens") {
+ add(spec.mediaTypes);
+ add(spec.mediaFeatures);
+ }
+
+ if (result.length) return {
+ list: result,
+ from: CodeMirror.Pos(cur.line, start),
+ to: CodeMirror.Pos(cur.line, end)
+ };
+ });
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/hint/html-hint.js b/modules/cookiesplus/lib/CodeMirror/addon/hint/html-hint.js
new file mode 100644
index 00000000..3c69e7a3
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/hint/html-hint.js
@@ -0,0 +1,370 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"), require("./xml-hint"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror", "./xml-hint"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ var langs = "ab aa af ak sq am ar an hy as av ae ay az bm ba eu be bn bh bi bs br bg my ca ch ce ny zh cv kw co cr hr cs da dv nl dz en eo et ee fo fj fi fr ff gl ka de el gn gu ht ha he hz hi ho hu ia id ie ga ig ik io is it iu ja jv kl kn kr ks kk km ki rw ky kv kg ko ku kj la lb lg li ln lo lt lu lv gv mk mg ms ml mt mi mr mh mn na nv nb nd ne ng nn no ii nr oc oj cu om or os pa pi fa pl ps pt qu rm rn ro ru sa sc sd se sm sg sr gd sn si sk sl so st es su sw ss sv ta te tg th ti bo tk tl tn to tr ts tt tw ty ug uk ur uz ve vi vo wa cy wo fy xh yi yo za zu".split(" ");
+ var targets = ["_blank", "_self", "_top", "_parent"];
+ var charsets = ["ascii", "utf-8", "utf-16", "latin1", "latin1"];
+ var methods = ["get", "post", "put", "delete"];
+ var encs = ["application/x-www-form-urlencoded", "multipart/form-data", "text/plain"];
+ var media = ["all", "screen", "print", "embossed", "braille", "handheld", "print", "projection", "screen", "tty", "tv", "speech",
+ "3d-glasses", "resolution [>][<][=] [X]", "device-aspect-ratio: X/Y", "orientation:portrait",
+ "orientation:landscape", "device-height: [X]", "device-width: [X]"];
+ var s = { attrs: {} }; // Simple tag, reused for a whole lot of tags
+
+ var data = {
+ a: {
+ attrs: {
+ href: null, ping: null, type: null,
+ media: media,
+ target: targets,
+ hreflang: langs
+ }
+ },
+ abbr: s,
+ acronym: s,
+ address: s,
+ applet: s,
+ area: {
+ attrs: {
+ alt: null, coords: null, href: null, target: null, ping: null,
+ media: media, hreflang: langs, type: null,
+ shape: ["default", "rect", "circle", "poly"]
+ }
+ },
+ article: s,
+ aside: s,
+ audio: {
+ attrs: {
+ src: null, mediagroup: null,
+ crossorigin: ["anonymous", "use-credentials"],
+ preload: ["none", "metadata", "auto"],
+ autoplay: ["", "autoplay"],
+ loop: ["", "loop"],
+ controls: ["", "controls"]
+ }
+ },
+ b: s,
+ base: { attrs: { href: null, target: targets } },
+ basefont: s,
+ bdi: s,
+ bdo: s,
+ big: s,
+ blockquote: { attrs: { cite: null } },
+ body: s,
+ br: s,
+ button: {
+ attrs: {
+ form: null, formaction: null, name: null, value: null,
+ autofocus: ["", "autofocus"],
+ disabled: ["", "autofocus"],
+ formenctype: encs,
+ formmethod: methods,
+ formnovalidate: ["", "novalidate"],
+ formtarget: targets,
+ type: ["submit", "reset", "button"]
+ }
+ },
+ canvas: { attrs: { width: null, height: null } },
+ caption: s,
+ center: s,
+ cite: s,
+ code: s,
+ col: { attrs: { span: null } },
+ colgroup: { attrs: { span: null } },
+ command: {
+ attrs: {
+ type: ["command", "checkbox", "radio"],
+ label: null, icon: null, radiogroup: null, command: null, title: null,
+ disabled: ["", "disabled"],
+ checked: ["", "checked"]
+ }
+ },
+ data: { attrs: { value: null } },
+ datagrid: { attrs: { disabled: ["", "disabled"], multiple: ["", "multiple"] } },
+ datalist: { attrs: { data: null } },
+ dd: s,
+ del: { attrs: { cite: null, datetime: null } },
+ details: { attrs: { open: ["", "open"] } },
+ dfn: s,
+ dir: s,
+ div: s,
+ dl: s,
+ dt: s,
+ em: s,
+ embed: { attrs: { src: null, type: null, width: null, height: null } },
+ eventsource: { attrs: { src: null } },
+ fieldset: { attrs: { disabled: ["", "disabled"], form: null, name: null } },
+ figcaption: s,
+ figure: s,
+ font: s,
+ footer: s,
+ form: {
+ attrs: {
+ action: null, name: null,
+ "accept-charset": charsets,
+ autocomplete: ["on", "off"],
+ enctype: encs,
+ method: methods,
+ novalidate: ["", "novalidate"],
+ target: targets
+ }
+ },
+ frame: s,
+ frameset: s,
+ h1: s, h2: s, h3: s, h4: s, h5: s, h6: s,
+ head: {
+ attrs: {},
+ children: ["title", "base", "link", "style", "meta", "script", "noscript", "command"]
+ },
+ header: s,
+ hgroup: s,
+ hr: s,
+ html: {
+ attrs: { manifest: null },
+ children: ["head", "body"]
+ },
+ i: s,
+ iframe: {
+ attrs: {
+ src: null, srcdoc: null, name: null, width: null, height: null,
+ sandbox: ["allow-top-navigation", "allow-same-origin", "allow-forms", "allow-scripts"],
+ seamless: ["", "seamless"]
+ }
+ },
+ img: {
+ attrs: {
+ alt: null, src: null, ismap: null, usemap: null, width: null, height: null,
+ crossorigin: ["anonymous", "use-credentials"]
+ }
+ },
+ input: {
+ attrs: {
+ alt: null, dirname: null, form: null, formaction: null,
+ height: null, list: null, max: null, maxlength: null, min: null,
+ name: null, pattern: null, placeholder: null, size: null, src: null,
+ step: null, value: null, width: null,
+ accept: ["audio/*", "video/*", "image/*"],
+ autocomplete: ["on", "off"],
+ autofocus: ["", "autofocus"],
+ checked: ["", "checked"],
+ disabled: ["", "disabled"],
+ formenctype: encs,
+ formmethod: methods,
+ formnovalidate: ["", "novalidate"],
+ formtarget: targets,
+ multiple: ["", "multiple"],
+ readonly: ["", "readonly"],
+ required: ["", "required"],
+ type: ["hidden", "text", "search", "tel", "url", "email", "password", "datetime", "date", "month",
+ "week", "time", "datetime-local", "number", "range", "color", "checkbox", "radio",
+ "file", "submit", "image", "reset", "button"]
+ }
+ },
+ ins: { attrs: { cite: null, datetime: null } },
+ kbd: s,
+ keygen: {
+ attrs: {
+ challenge: null, form: null, name: null,
+ autofocus: ["", "autofocus"],
+ disabled: ["", "disabled"],
+ keytype: ["RSA"]
+ }
+ },
+ label: { attrs: { "for": null, form: null } },
+ legend: s,
+ li: { attrs: { value: null } },
+ link: {
+ attrs: {
+ href: null, type: null,
+ hreflang: langs,
+ media: media,
+ sizes: ["all", "16x16", "16x16 32x32", "16x16 32x32 64x64"]
+ }
+ },
+ map: { attrs: { name: null } },
+ mark: s,
+ menu: { attrs: { label: null, type: ["list", "context", "toolbar"] } },
+ meta: {
+ attrs: {
+ content: null,
+ charset: charsets,
+ name: ["viewport", "application-name", "author", "description", "generator", "keywords"],
+ "http-equiv": ["content-language", "content-type", "default-style", "refresh"]
+ }
+ },
+ meter: { attrs: { value: null, min: null, low: null, high: null, max: null, optimum: null } },
+ nav: s,
+ noframes: s,
+ noscript: s,
+ object: {
+ attrs: {
+ data: null, type: null, name: null, usemap: null, form: null, width: null, height: null,
+ typemustmatch: ["", "typemustmatch"]
+ }
+ },
+ ol: { attrs: { reversed: ["", "reversed"], start: null, type: ["1", "a", "A", "i", "I"] } },
+ optgroup: { attrs: { disabled: ["", "disabled"], label: null } },
+ option: { attrs: { disabled: ["", "disabled"], label: null, selected: ["", "selected"], value: null } },
+ output: { attrs: { "for": null, form: null, name: null } },
+ p: s,
+ param: { attrs: { name: null, value: null } },
+ pre: s,
+ progress: { attrs: { value: null, max: null } },
+ q: { attrs: { cite: null } },
+ rp: s,
+ rt: s,
+ ruby: s,
+ s: s,
+ samp: s,
+ script: {
+ attrs: {
+ type: ["text/javascript"],
+ src: null,
+ async: ["", "async"],
+ defer: ["", "defer"],
+ charset: charsets
+ }
+ },
+ section: s,
+ select: {
+ attrs: {
+ form: null, name: null, size: null,
+ autofocus: ["", "autofocus"],
+ disabled: ["", "disabled"],
+ multiple: ["", "multiple"]
+ }
+ },
+ small: s,
+ source: { attrs: { src: null, type: null, media: null } },
+ span: s,
+ strike: s,
+ strong: s,
+ style: {
+ attrs: {
+ type: ["text/css"],
+ media: media,
+ scoped: null
+ }
+ },
+ sub: s,
+ summary: s,
+ sup: s,
+ table: s,
+ tbody: s,
+ td: { attrs: { colspan: null, rowspan: null, headers: null } },
+ textarea: {
+ attrs: {
+ dirname: null, form: null, maxlength: null, name: null, placeholder: null,
+ rows: null, cols: null,
+ autofocus: ["", "autofocus"],
+ disabled: ["", "disabled"],
+ readonly: ["", "readonly"],
+ required: ["", "required"],
+ wrap: ["soft", "hard"]
+ }
+ },
+ tfoot: s,
+ th: { attrs: { colspan: null, rowspan: null, headers: null, scope: ["row", "col", "rowgroup", "colgroup"] } },
+ thead: s,
+ time: { attrs: { datetime: null } },
+ title: s,
+ tr: s,
+ track: {
+ attrs: {
+ src: null, label: null, "default": null,
+ kind: ["subtitles", "captions", "descriptions", "chapters", "metadata"],
+ srclang: langs
+ }
+ },
+ tt: s,
+ u: s,
+ ul: s,
+ "var": s,
+ video: {
+ attrs: {
+ src: null, poster: null, width: null, height: null,
+ crossorigin: ["anonymous", "use-credentials"],
+ preload: ["auto", "metadata", "none"],
+ autoplay: ["", "autoplay"],
+ mediagroup: ["movie"],
+ muted: ["", "muted"],
+ controls: ["", "controls"]
+ }
+ },
+ wbr: s
+ };
+
+ var globalAttrs = {
+ accesskey: ["a", "b", "c", "d", "e", "f", "g", "h", "i", "j", "k", "l", "m", "n", "o", "p", "q", "r", "s", "t", "u", "v", "w", "x", "y", "z", "0", "1", "2", "3", "4", "5", "6", "7", "8", "9"],
+ "class": null,
+ contenteditable: ["true", "false"],
+ contextmenu: null,
+ dir: ["ltr", "rtl", "auto"],
+ draggable: ["true", "false", "auto"],
+ dropzone: ["copy", "move", "link", "string:", "file:"],
+ hidden: ["hidden"],
+ id: null,
+ inert: ["inert"],
+ itemid: null,
+ itemprop: null,
+ itemref: null,
+ itemscope: ["itemscope"],
+ itemtype: null,
+ lang: ["en", "es"],
+ spellcheck: ["true", "false"],
+ autocorrect: ["true", "false"],
+ autocapitalize: ["true", "false"],
+ style: null,
+ tabindex: ["1", "2", "3", "4", "5", "6", "7", "8", "9"],
+ title: null,
+ translate: ["yes", "no"],
+ onclick: null,
+ rel: ["stylesheet", "alternate", "author", "bookmark", "help", "license", "next", "nofollow", "noreferrer", "prefetch", "prev", "search", "tag"]
+ };
+ function populate(obj) {
+ for (var attr in globalAttrs) if (globalAttrs.hasOwnProperty(attr))
+ obj.attrs[attr] = globalAttrs[attr];
+ }
+
+ populate(s);
+ for (var tag in data) if (data.hasOwnProperty(tag) && data[tag] != s)
+ populate(data[tag]);
+
+ CodeMirror.htmlSchema = data;
+ function htmlHint(cm, options) {
+ var local = {schemaInfo: data};
+ if (options) for (var opt in options) local[opt] = options[opt];
+ return CodeMirror.hint.xml(cm, local);
+ }
+ CodeMirror.registerHelper("hint", "html", htmlHint);
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/hint/index.php b/modules/cookiesplus/lib/CodeMirror/addon/hint/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/hint/index.php
@@ -0,0 +1,32 @@
+ cur.ch) {
+ token.end = cur.ch;
+ token.string = token.string.slice(0, cur.ch - token.start);
+ }
+
+ var tprop = token;
+ // If it is a property, find out what it is a property of.
+ while (tprop.type == "property") {
+ tprop = getToken(editor, Pos(cur.line, tprop.start));
+ if (tprop.string != ".") return;
+ tprop = getToken(editor, Pos(cur.line, tprop.start));
+ if (!context) var context = [];
+ context.push(tprop);
+ }
+ return {list: getCompletions(token, context, keywords, options),
+ from: Pos(cur.line, token.start),
+ to: Pos(cur.line, token.end)};
+ }
+
+ function javascriptHint(editor, options) {
+ return scriptHint(editor, javascriptKeywords,
+ function (e, cur) {return e.getTokenAt(cur);},
+ options);
+ };
+ CodeMirror.registerHelper("hint", "javascript", javascriptHint);
+
+ function getCoffeeScriptToken(editor, cur) {
+ // This getToken, it is for coffeescript, imitates the behavior of
+ // getTokenAt method in javascript.js, that is, returning "property"
+ // type and treat "." as indepenent token.
+ var token = editor.getTokenAt(cur);
+ if (cur.ch == token.start + 1 && token.string.charAt(0) == '.') {
+ token.end = token.start;
+ token.string = '.';
+ token.type = "property";
+ }
+ else if (/^\.[\w$_]*$/.test(token.string)) {
+ token.type = "property";
+ token.start++;
+ token.string = token.string.replace(/\./, '');
+ }
+ return token;
+ }
+
+ function coffeescriptHint(editor, options) {
+ return scriptHint(editor, coffeescriptKeywords, getCoffeeScriptToken, options);
+ }
+ CodeMirror.registerHelper("hint", "coffeescript", coffeescriptHint);
+
+ var stringProps = ("charAt charCodeAt indexOf lastIndexOf substring substr slice trim trimLeft trimRight " +
+ "toUpperCase toLowerCase split concat match replace search").split(" ");
+ var arrayProps = ("length concat join splice push pop shift unshift slice reverse sort indexOf " +
+ "lastIndexOf every some filter forEach map reduce reduceRight ").split(" ");
+ var funcProps = "prototype apply call bind".split(" ");
+ var javascriptKeywords = ("break case catch class const continue debugger default delete do else export extends false finally for function " +
+ "if in import instanceof new null return super switch this throw true try typeof var void while with yield").split(" ");
+ var coffeescriptKeywords = ("and break catch class continue delete do else extends false finally for " +
+ "if in instanceof isnt new no not null of off on or return switch then throw true try typeof until void while with yes").split(" ");
+
+ function forAllProps(obj, callback) {
+ if (!Object.getOwnPropertyNames || !Object.getPrototypeOf) {
+ for (var name in obj) callback(name)
+ } else {
+ for (var o = obj; o; o = Object.getPrototypeOf(o))
+ Object.getOwnPropertyNames(o).forEach(callback)
+ }
+ }
+
+ function getCompletions(token, context, keywords, options) {
+ var found = [], start = token.string, global = options && options.globalScope || window;
+ function maybeAdd(str) {
+ if (str.lastIndexOf(start, 0) == 0 && !arrayContains(found, str)) found.push(str);
+ }
+ function gatherCompletions(obj) {
+ if (typeof obj == "string") forEach(stringProps, maybeAdd);
+ else if (obj instanceof Array) forEach(arrayProps, maybeAdd);
+ else if (obj instanceof Function) forEach(funcProps, maybeAdd);
+ forAllProps(obj, maybeAdd)
+ }
+
+ if (context && context.length) {
+ // If this is a property, see if it belongs to some object we can
+ // find in the current environment.
+ var obj = context.pop(), base;
+ if (obj.type && obj.type.indexOf("variable") === 0) {
+ if (options && options.additionalContext)
+ base = options.additionalContext[obj.string];
+ if (!options || options.useGlobalScope !== false)
+ base = base || global[obj.string];
+ } else if (obj.type == "string") {
+ base = "";
+ } else if (obj.type == "atom") {
+ base = 1;
+ } else if (obj.type == "function") {
+ if (global.jQuery != null && (obj.string == '$' || obj.string == 'jQuery') &&
+ (typeof global.jQuery == 'function'))
+ base = global.jQuery();
+ else if (global._ != null && (obj.string == '_') && (typeof global._ == 'function'))
+ base = global._();
+ }
+ while (base != null && context.length)
+ base = base[context.pop().string];
+ if (base != null) gatherCompletions(base);
+ } else {
+ // If not, just look in the global object, any local scope, and optional additional-context
+ // (reading into JS mode internals to get at the local and global variables)
+ for (var v = token.state.localVars; v; v = v.next) maybeAdd(v.name);
+ for (var c = token.state.context; c; c = c.prev)
+ for (var v = c.vars; v; v = v.next) maybeAdd(v.name)
+ for (var v = token.state.globalVars; v; v = v.next) maybeAdd(v.name);
+ if (options && options.additionalContext != null)
+ for (var key in options.additionalContext)
+ maybeAdd(key);
+ if (!options || options.useGlobalScope !== false)
+ gatherCompletions(global);
+ forEach(keywords, maybeAdd);
+ }
+ return found;
+ }
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/hint/show-hint.css b/modules/cookiesplus/lib/CodeMirror/addon/hint/show-hint.css
new file mode 100644
index 00000000..29462e6a
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/hint/show-hint.css
@@ -0,0 +1,59 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+.CodeMirror-hints {
+ position: absolute;
+ z-index: 10;
+ overflow: hidden;
+ list-style: none;
+
+ margin: 0;
+ padding: 2px;
+
+ -webkit-box-shadow: 2px 3px 5px rgba(0,0,0,.2);
+ -moz-box-shadow: 2px 3px 5px rgba(0,0,0,.2);
+ box-shadow: 2px 3px 5px rgba(0,0,0,.2);
+ border-radius: 3px;
+ border: 1px solid silver;
+
+ background: white;
+ font-size: 90%;
+ font-family: monospace;
+
+ max-height: 20em;
+ overflow-y: auto;
+}
+
+.CodeMirror-hint {
+ margin: 0;
+ padding: 0 4px;
+ border-radius: 2px;
+ white-space: pre;
+ color: black;
+ cursor: pointer;
+}
+
+li.CodeMirror-hint-active {
+ background: #08f;
+ color: white;
+}
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/hint/show-hint.js b/modules/cookiesplus/lib/CodeMirror/addon/hint/show-hint.js
new file mode 100644
index 00000000..c9ee7399
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/hint/show-hint.js
@@ -0,0 +1,499 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ var HINT_ELEMENT_CLASS = "CodeMirror-hint";
+ var ACTIVE_HINT_ELEMENT_CLASS = "CodeMirror-hint-active";
+
+ // This is the old interface, kept around for now to stay
+ // backwards-compatible.
+ CodeMirror.showHint = function(cm, getHints, options) {
+ if (!getHints) return cm.showHint(options);
+ if (options && options.async) getHints.async = true;
+ var newOpts = {hint: getHints};
+ if (options) for (var prop in options) newOpts[prop] = options[prop];
+ return cm.showHint(newOpts);
+ };
+
+ CodeMirror.defineExtension("showHint", function(options) {
+ options = parseOptions(this, this.getCursor("start"), options);
+ var selections = this.listSelections()
+ if (selections.length > 1) return;
+ // By default, don't allow completion when something is selected.
+ // A hint function can have a `supportsSelection` property to
+ // indicate that it can handle selections.
+ if (this.somethingSelected()) {
+ if (!options.hint.supportsSelection) return;
+ // Don't try with cross-line selections
+ for (var i = 0; i < selections.length; i++)
+ if (selections[i].head.line != selections[i].anchor.line) return;
+ }
+
+ if (this.state.completionActive) this.state.completionActive.close();
+ var completion = this.state.completionActive = new Completion(this, options);
+ if (!completion.options.hint) return;
+
+ CodeMirror.signal(this, "startCompletion", this);
+ completion.update(true);
+ });
+
+ CodeMirror.defineExtension("closeHint", function() {
+ if (this.state.completionActive) this.state.completionActive.close()
+ })
+
+ function Completion(cm, options) {
+ this.cm = cm;
+ this.options = options;
+ this.widget = null;
+ this.debounce = 0;
+ this.tick = 0;
+ this.startPos = this.cm.getCursor("start");
+ this.startLen = this.cm.getLine(this.startPos.line).length - this.cm.getSelection().length;
+
+ var self = this;
+ cm.on("cursorActivity", this.activityFunc = function() { self.cursorActivity(); });
+ }
+
+ var requestAnimationFrame = window.requestAnimationFrame || function(fn) {
+ return setTimeout(fn, 1000/60);
+ };
+ var cancelAnimationFrame = window.cancelAnimationFrame || clearTimeout;
+
+ Completion.prototype = {
+ close: function() {
+ if (!this.active()) return;
+ this.cm.state.completionActive = null;
+ this.tick = null;
+ this.cm.off("cursorActivity", this.activityFunc);
+
+ if (this.widget && this.data) CodeMirror.signal(this.data, "close");
+ if (this.widget) this.widget.close();
+ CodeMirror.signal(this.cm, "endCompletion", this.cm);
+ },
+
+ active: function() {
+ return this.cm.state.completionActive == this;
+ },
+
+ pick: function(data, i) {
+ var completion = data.list[i], self = this;
+ this.cm.operation(function() {
+ if (completion.hint)
+ completion.hint(self.cm, data, completion);
+ else
+ self.cm.replaceRange(getText(completion), completion.from || data.from,
+ completion.to || data.to, "complete");
+ CodeMirror.signal(data, "pick", completion);
+ self.cm.scrollIntoView();
+ })
+ this.close();
+ },
+
+ cursorActivity: function() {
+ if (this.debounce) {
+ cancelAnimationFrame(this.debounce);
+ this.debounce = 0;
+ }
+
+ var identStart = this.startPos;
+ if(this.data) {
+ identStart = this.data.from;
+ }
+
+ var pos = this.cm.getCursor(), line = this.cm.getLine(pos.line);
+ if (pos.line != this.startPos.line || line.length - pos.ch != this.startLen - this.startPos.ch ||
+ pos.ch < identStart.ch || this.cm.somethingSelected() ||
+ (!pos.ch || this.options.closeCharacters.test(line.charAt(pos.ch - 1)))) {
+ this.close();
+ } else {
+ var self = this;
+ this.debounce = requestAnimationFrame(function() {self.update();});
+ if (this.widget) this.widget.disable();
+ }
+ },
+
+ update: function(first) {
+ if (this.tick == null) return
+ var self = this, myTick = ++this.tick
+ fetchHints(this.options.hint, this.cm, this.options, function(data) {
+ if (self.tick == myTick) self.finishUpdate(data, first)
+ })
+ },
+
+ finishUpdate: function(data, first) {
+ if (this.data) CodeMirror.signal(this.data, "update");
+
+ var picked = (this.widget && this.widget.picked) || (first && this.options.completeSingle);
+ if (this.widget) this.widget.close();
+
+ this.data = data;
+
+ if (data && data.list.length) {
+ if (picked && data.list.length == 1) {
+ this.pick(data, 0);
+ } else {
+ this.widget = new Widget(this, data);
+ CodeMirror.signal(data, "shown");
+ }
+ }
+ }
+ };
+
+ function parseOptions(cm, pos, options) {
+ var editor = cm.options.hintOptions;
+ var out = {};
+ for (var prop in defaultOptions) out[prop] = defaultOptions[prop];
+ if (editor) for (var prop in editor)
+ if (editor[prop] !== undefined) out[prop] = editor[prop];
+ if (options) for (var prop in options)
+ if (options[prop] !== undefined) out[prop] = options[prop];
+ if (out.hint.resolve) out.hint = out.hint.resolve(cm, pos)
+ return out;
+ }
+
+ function getText(completion) {
+ if (typeof completion == "string") return completion;
+ else return completion.text;
+ }
+
+ function buildKeyMap(completion, handle) {
+ var baseMap = {
+ Up: function() {handle.moveFocus(-1);},
+ Down: function() {handle.moveFocus(1);},
+ PageUp: function() {handle.moveFocus(-handle.menuSize() + 1, true);},
+ PageDown: function() {handle.moveFocus(handle.menuSize() - 1, true);},
+ Home: function() {handle.setFocus(0);},
+ End: function() {handle.setFocus(handle.length - 1);},
+ Enter: handle.pick,
+ Tab: handle.pick,
+ Esc: handle.close
+ };
+
+ var mac = /Mac/.test(navigator.platform);
+
+ if (mac) {
+ baseMap["Ctrl-P"] = function() {handle.moveFocus(-1);};
+ baseMap["Ctrl-N"] = function() {handle.moveFocus(1);};
+ }
+
+ var custom = completion.options.customKeys;
+ var ourMap = custom ? {} : baseMap;
+ function addBinding(key, val) {
+ var bound;
+ if (typeof val != "string")
+ bound = function(cm) { return val(cm, handle); };
+ // This mechanism is deprecated
+ else if (baseMap.hasOwnProperty(val))
+ bound = baseMap[val];
+ else
+ bound = val;
+ ourMap[key] = bound;
+ }
+ if (custom)
+ for (var key in custom) if (custom.hasOwnProperty(key))
+ addBinding(key, custom[key]);
+ var extra = completion.options.extraKeys;
+ if (extra)
+ for (var key in extra) if (extra.hasOwnProperty(key))
+ addBinding(key, extra[key]);
+ return ourMap;
+ }
+
+ function getHintElement(hintsElement, el) {
+ while (el && el != hintsElement) {
+ if (el.nodeName.toUpperCase() === "LI" && el.parentNode == hintsElement) return el;
+ el = el.parentNode;
+ }
+ }
+
+ function Widget(completion, data) {
+ this.completion = completion;
+ this.data = data;
+ this.picked = false;
+ var widget = this, cm = completion.cm;
+ var ownerDocument = cm.getInputField().ownerDocument;
+ var parentWindow = ownerDocument.defaultView || ownerDocument.parentWindow;
+
+ var hints = this.hints = ownerDocument.createElement("ul");
+ var theme = completion.cm.options.theme;
+ hints.className = "CodeMirror-hints " + theme;
+ this.selectedHint = data.selectedHint || 0;
+
+ var completions = data.list;
+ for (var i = 0; i < completions.length; ++i) {
+ var elt = hints.appendChild(ownerDocument.createElement("li")), cur = completions[i];
+ var className = HINT_ELEMENT_CLASS + (i != this.selectedHint ? "" : " " + ACTIVE_HINT_ELEMENT_CLASS);
+ if (cur.className != null) className = cur.className + " " + className;
+ elt.className = className;
+ if (cur.render) cur.render(elt, data, cur);
+ else elt.appendChild(ownerDocument.createTextNode(cur.displayText || getText(cur)));
+ elt.hintId = i;
+ }
+
+ var container = completion.options.container || ownerDocument.body;
+ var pos = cm.cursorCoords(completion.options.alignWithWord ? data.from : null);
+ var left = pos.left, top = pos.bottom, below = true;
+ var offsetLeft = 0, offsetTop = 0;
+ if (container !== ownerDocument.body) {
+ // We offset the cursor position because left and top are relative to the offsetParent's top left corner.
+ var isContainerPositioned = ['absolute', 'relative', 'fixed'].indexOf(parentWindow.getComputedStyle(container).position) !== -1;
+ var offsetParent = isContainerPositioned ? container : container.offsetParent;
+ var offsetParentPosition = offsetParent.getBoundingClientRect();
+ var bodyPosition = ownerDocument.body.getBoundingClientRect();
+ offsetLeft = (offsetParentPosition.left - bodyPosition.left - offsetParent.scrollLeft);
+ offsetTop = (offsetParentPosition.top - bodyPosition.top - offsetParent.scrollTop);
+ }
+ hints.style.left = (left - offsetLeft) + "px";
+ hints.style.top = (top - offsetTop) + "px";
+
+ // If we're at the edge of the screen, then we want the menu to appear on the left of the cursor.
+ var winW = parentWindow.innerWidth || Math.max(ownerDocument.body.offsetWidth, ownerDocument.documentElement.offsetWidth);
+ var winH = parentWindow.innerHeight || Math.max(ownerDocument.body.offsetHeight, ownerDocument.documentElement.offsetHeight);
+ container.appendChild(hints);
+ var box = hints.getBoundingClientRect(), overlapY = box.bottom - winH;
+ var scrolls = hints.scrollHeight > hints.clientHeight + 1
+ var startScroll = cm.getScrollInfo();
+
+ if (overlapY > 0) {
+ var height = box.bottom - box.top, curTop = pos.top - (pos.bottom - box.top);
+ if (curTop - height > 0) { // Fits above cursor
+ hints.style.top = (top = pos.top - height - offsetTop) + "px";
+ below = false;
+ } else if (height > winH) {
+ hints.style.height = (winH - 5) + "px";
+ hints.style.top = (top = pos.bottom - box.top - offsetTop) + "px";
+ var cursor = cm.getCursor();
+ if (data.from.ch != cursor.ch) {
+ pos = cm.cursorCoords(cursor);
+ hints.style.left = (left = pos.left - offsetLeft) + "px";
+ box = hints.getBoundingClientRect();
+ }
+ }
+ }
+ var overlapX = box.right - winW;
+ if (overlapX > 0) {
+ if (box.right - box.left > winW) {
+ hints.style.width = (winW - 5) + "px";
+ overlapX -= (box.right - box.left) - winW;
+ }
+ hints.style.left = (left = pos.left - overlapX - offsetLeft) + "px";
+ }
+ if (scrolls) for (var node = hints.firstChild; node; node = node.nextSibling)
+ node.style.paddingRight = cm.display.nativeBarWidth + "px"
+
+ cm.addKeyMap(this.keyMap = buildKeyMap(completion, {
+ moveFocus: function(n, avoidWrap) { widget.changeActive(widget.selectedHint + n, avoidWrap); },
+ setFocus: function(n) { widget.changeActive(n); },
+ menuSize: function() { return widget.screenAmount(); },
+ length: completions.length,
+ close: function() { completion.close(); },
+ pick: function() { widget.pick(); },
+ data: data
+ }));
+
+ if (completion.options.closeOnUnfocus) {
+ var closingOnBlur;
+ cm.on("blur", this.onBlur = function() { closingOnBlur = setTimeout(function() { completion.close(); }, 100); });
+ cm.on("focus", this.onFocus = function() { clearTimeout(closingOnBlur); });
+ }
+
+ cm.on("scroll", this.onScroll = function() {
+ var curScroll = cm.getScrollInfo(), editor = cm.getWrapperElement().getBoundingClientRect();
+ var newTop = top + startScroll.top - curScroll.top;
+ var point = newTop - (parentWindow.pageYOffset || (ownerDocument.documentElement || ownerDocument.body).scrollTop);
+ if (!below) point += hints.offsetHeight;
+ if (point <= editor.top || point >= editor.bottom) return completion.close();
+ hints.style.top = newTop + "px";
+ hints.style.left = (left + startScroll.left - curScroll.left) + "px";
+ });
+
+ CodeMirror.on(hints, "dblclick", function(e) {
+ var t = getHintElement(hints, e.target || e.srcElement);
+ if (t && t.hintId != null) {widget.changeActive(t.hintId); widget.pick();}
+ });
+
+ CodeMirror.on(hints, "click", function(e) {
+ var t = getHintElement(hints, e.target || e.srcElement);
+ if (t && t.hintId != null) {
+ widget.changeActive(t.hintId);
+ if (completion.options.completeOnSingleClick) widget.pick();
+ }
+ });
+
+ CodeMirror.on(hints, "mousedown", function() {
+ setTimeout(function(){cm.focus();}, 20);
+ });
+ this.scrollToActive()
+
+ CodeMirror.signal(data, "select", completions[this.selectedHint], hints.childNodes[this.selectedHint]);
+ return true;
+ }
+
+ Widget.prototype = {
+ close: function() {
+ if (this.completion.widget != this) return;
+ this.completion.widget = null;
+ this.hints.parentNode.removeChild(this.hints);
+ this.completion.cm.removeKeyMap(this.keyMap);
+
+ var cm = this.completion.cm;
+ if (this.completion.options.closeOnUnfocus) {
+ cm.off("blur", this.onBlur);
+ cm.off("focus", this.onFocus);
+ }
+ cm.off("scroll", this.onScroll);
+ },
+
+ disable: function() {
+ this.completion.cm.removeKeyMap(this.keyMap);
+ var widget = this;
+ this.keyMap = {Enter: function() { widget.picked = true; }};
+ this.completion.cm.addKeyMap(this.keyMap);
+ },
+
+ pick: function() {
+ this.completion.pick(this.data, this.selectedHint);
+ },
+
+ changeActive: function(i, avoidWrap) {
+ if (i >= this.data.list.length)
+ i = avoidWrap ? this.data.list.length - 1 : 0;
+ else if (i < 0)
+ i = avoidWrap ? 0 : this.data.list.length - 1;
+ if (this.selectedHint == i) return;
+ var node = this.hints.childNodes[this.selectedHint];
+ if (node) node.className = node.className.replace(" " + ACTIVE_HINT_ELEMENT_CLASS, "");
+ node = this.hints.childNodes[this.selectedHint = i];
+ node.className += " " + ACTIVE_HINT_ELEMENT_CLASS;
+ this.scrollToActive()
+ CodeMirror.signal(this.data, "select", this.data.list[this.selectedHint], node);
+ },
+
+ scrollToActive: function() {
+ var margin = this.completion.options.scrollMargin || 0;
+ var node1 = this.hints.childNodes[Math.max(0, this.selectedHint - margin)];
+ var node2 = this.hints.childNodes[Math.min(this.data.list.length - 1, this.selectedHint + margin)];
+ var firstNode = this.hints.firstChild;
+ if (node1.offsetTop < this.hints.scrollTop)
+ this.hints.scrollTop = node1.offsetTop - firstNode.offsetTop;
+ else if (node2.offsetTop + node2.offsetHeight > this.hints.scrollTop + this.hints.clientHeight)
+ this.hints.scrollTop = node2.offsetTop + node2.offsetHeight - this.hints.clientHeight + firstNode.offsetTop;
+ },
+
+ screenAmount: function() {
+ return Math.floor(this.hints.clientHeight / this.hints.firstChild.offsetHeight) || 1;
+ }
+ };
+
+ function applicableHelpers(cm, helpers) {
+ if (!cm.somethingSelected()) return helpers
+ var result = []
+ for (var i = 0; i < helpers.length; i++)
+ if (helpers[i].supportsSelection) result.push(helpers[i])
+ return result
+ }
+
+ function fetchHints(hint, cm, options, callback) {
+ if (hint.async) {
+ hint(cm, callback, options)
+ } else {
+ var result = hint(cm, options)
+ if (result && result.then) result.then(callback)
+ else callback(result)
+ }
+ }
+
+ function resolveAutoHints(cm, pos) {
+ var helpers = cm.getHelpers(pos, "hint"), words
+ if (helpers.length) {
+ var resolved = function(cm, callback, options) {
+ var app = applicableHelpers(cm, helpers);
+ function run(i) {
+ if (i == app.length) return callback(null)
+ fetchHints(app[i], cm, options, function(result) {
+ if (result && result.list.length > 0) callback(result)
+ else run(i + 1)
+ })
+ }
+ run(0)
+ }
+ resolved.async = true
+ resolved.supportsSelection = true
+ return resolved
+ } else if (words = cm.getHelper(cm.getCursor(), "hintWords")) {
+ return function(cm) { return CodeMirror.hint.fromList(cm, {words: words}) }
+ } else if (CodeMirror.hint.anyword) {
+ return function(cm, options) { return CodeMirror.hint.anyword(cm, options) }
+ } else {
+ return function() {}
+ }
+ }
+
+ CodeMirror.registerHelper("hint", "auto", {
+ resolve: resolveAutoHints
+ });
+
+ CodeMirror.registerHelper("hint", "fromList", function(cm, options) {
+ var cur = cm.getCursor(), token = cm.getTokenAt(cur)
+ var term, from = CodeMirror.Pos(cur.line, token.start), to = cur
+ if (token.start < cur.ch && /\w/.test(token.string.charAt(cur.ch - token.start - 1))) {
+ term = token.string.substr(0, cur.ch - token.start)
+ } else {
+ term = ""
+ from = cur
+ }
+ var found = [];
+ for (var i = 0; i < options.words.length; i++) {
+ var word = options.words[i];
+ if (word.slice(0, term.length) == term)
+ found.push(word);
+ }
+
+ if (found.length) return {list: found, from: from, to: to};
+ });
+
+ CodeMirror.commands.autocomplete = CodeMirror.showHint;
+
+ var defaultOptions = {
+ hint: CodeMirror.hint.auto,
+ completeSingle: true,
+ alignWithWord: true,
+ closeCharacters: /[\s()\[\]{};:>,]/,
+ closeOnUnfocus: true,
+ completeOnSingleClick: true,
+ container: null,
+ customKeys: null,
+ extraKeys: null
+ };
+
+ CodeMirror.defineOption("hintOptions", null);
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/hint/sql-hint.js b/modules/cookiesplus/lib/CodeMirror/addon/hint/sql-hint.js
new file mode 100644
index 00000000..185ad89c
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/hint/sql-hint.js
@@ -0,0 +1,324 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"), require("../../mode/sql/sql"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror", "../../mode/sql/sql"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ var tables;
+ var defaultTable;
+ var keywords;
+ var identifierQuote;
+ var CONS = {
+ QUERY_DIV: ";",
+ ALIAS_KEYWORD: "AS"
+ };
+ var Pos = CodeMirror.Pos, cmpPos = CodeMirror.cmpPos;
+
+ function isArray(val) { return Object.prototype.toString.call(val) == "[object Array]" }
+
+ function getKeywords(editor) {
+ var mode = editor.doc.modeOption;
+ if (mode === "sql") mode = "text/x-sql";
+ return CodeMirror.resolveMode(mode).keywords;
+ }
+
+ function getIdentifierQuote(editor) {
+ var mode = editor.doc.modeOption;
+ if (mode === "sql") mode = "text/x-sql";
+ return CodeMirror.resolveMode(mode).identifierQuote || "`";
+ }
+
+ function getText(item) {
+ return typeof item == "string" ? item : item.text;
+ }
+
+ function wrapTable(name, value) {
+ if (isArray(value)) value = {columns: value}
+ if (!value.text) value.text = name
+ return value
+ }
+
+ function parseTables(input) {
+ var result = {}
+ if (isArray(input)) {
+ for (var i = input.length - 1; i >= 0; i--) {
+ var item = input[i]
+ result[getText(item).toUpperCase()] = wrapTable(getText(item), item)
+ }
+ } else if (input) {
+ for (var name in input)
+ result[name.toUpperCase()] = wrapTable(name, input[name])
+ }
+ return result
+ }
+
+ function getTable(name) {
+ return tables[name.toUpperCase()]
+ }
+
+ function shallowClone(object) {
+ var result = {};
+ for (var key in object) if (object.hasOwnProperty(key))
+ result[key] = object[key];
+ return result;
+ }
+
+ function match(string, word) {
+ var len = string.length;
+ var sub = getText(word).substr(0, len);
+ return string.toUpperCase() === sub.toUpperCase();
+ }
+
+ function addMatches(result, search, wordlist, formatter) {
+ if (isArray(wordlist)) {
+ for (var i = 0; i < wordlist.length; i++)
+ if (match(search, wordlist[i])) result.push(formatter(wordlist[i]))
+ } else {
+ for (var word in wordlist) if (wordlist.hasOwnProperty(word)) {
+ var val = wordlist[word]
+ if (!val || val === true)
+ val = word
+ else
+ val = val.displayText ? {text: val.text, displayText: val.displayText} : val.text
+ if (match(search, val)) result.push(formatter(val))
+ }
+ }
+ }
+
+ function cleanName(name) {
+ // Get rid name from identifierQuote and preceding dot(.)
+ if (name.charAt(0) == ".") {
+ name = name.substr(1);
+ }
+ // replace doublicated identifierQuotes with single identifierQuotes
+ // and remove single identifierQuotes
+ var nameParts = name.split(identifierQuote+identifierQuote);
+ for (var i = 0; i < nameParts.length; i++)
+ nameParts[i] = nameParts[i].replace(new RegExp(identifierQuote,"g"), "");
+ return nameParts.join(identifierQuote);
+ }
+
+ function insertIdentifierQuotes(name) {
+ var nameParts = getText(name).split(".");
+ for (var i = 0; i < nameParts.length; i++)
+ nameParts[i] = identifierQuote +
+ // doublicate identifierQuotes
+ nameParts[i].replace(new RegExp(identifierQuote,"g"), identifierQuote+identifierQuote) +
+ identifierQuote;
+ var escaped = nameParts.join(".");
+ if (typeof name == "string") return escaped;
+ name = shallowClone(name);
+ name.text = escaped;
+ return name;
+ }
+
+ function nameCompletion(cur, token, result, editor) {
+ // Try to complete table, column names and return start position of completion
+ var useIdentifierQuotes = false;
+ var nameParts = [];
+ var start = token.start;
+ var cont = true;
+ while (cont) {
+ cont = (token.string.charAt(0) == ".");
+ useIdentifierQuotes = useIdentifierQuotes || (token.string.charAt(0) == identifierQuote);
+
+ start = token.start;
+ nameParts.unshift(cleanName(token.string));
+
+ token = editor.getTokenAt(Pos(cur.line, token.start));
+ if (token.string == ".") {
+ cont = true;
+ token = editor.getTokenAt(Pos(cur.line, token.start));
+ }
+ }
+
+ // Try to complete table names
+ var string = nameParts.join(".");
+ addMatches(result, string, tables, function(w) {
+ return useIdentifierQuotes ? insertIdentifierQuotes(w) : w;
+ });
+
+ // Try to complete columns from defaultTable
+ addMatches(result, string, defaultTable, function(w) {
+ return useIdentifierQuotes ? insertIdentifierQuotes(w) : w;
+ });
+
+ // Try to complete columns
+ string = nameParts.pop();
+ var table = nameParts.join(".");
+
+ var alias = false;
+ var aliasTable = table;
+ // Check if table is available. If not, find table by Alias
+ if (!getTable(table)) {
+ var oldTable = table;
+ table = findTableByAlias(table, editor);
+ if (table !== oldTable) alias = true;
+ }
+
+ var columns = getTable(table);
+ if (columns && columns.columns)
+ columns = columns.columns;
+
+ if (columns) {
+ addMatches(result, string, columns, function(w) {
+ var tableInsert = table;
+ if (alias == true) tableInsert = aliasTable;
+ if (typeof w == "string") {
+ w = tableInsert + "." + w;
+ } else {
+ w = shallowClone(w);
+ w.text = tableInsert + "." + w.text;
+ }
+ return useIdentifierQuotes ? insertIdentifierQuotes(w) : w;
+ });
+ }
+
+ return start;
+ }
+
+ function eachWord(lineText, f) {
+ var words = lineText.split(/\s+/)
+ for (var i = 0; i < words.length; i++)
+ if (words[i]) f(words[i].replace(/[,;]/g, ''))
+ }
+
+ function findTableByAlias(alias, editor) {
+ var doc = editor.doc;
+ var fullQuery = doc.getValue();
+ var aliasUpperCase = alias.toUpperCase();
+ var previousWord = "";
+ var table = "";
+ var separator = [];
+ var validRange = {
+ start: Pos(0, 0),
+ end: Pos(editor.lastLine(), editor.getLineHandle(editor.lastLine()).length)
+ };
+
+ // add separator
+ var indexOfSeparator = fullQuery.indexOf(CONS.QUERY_DIV);
+ while(indexOfSeparator != -1) {
+ separator.push(doc.posFromIndex(indexOfSeparator));
+ indexOfSeparator = fullQuery.indexOf(CONS.QUERY_DIV, indexOfSeparator+1);
+ }
+ separator.unshift(Pos(0, 0));
+ separator.push(Pos(editor.lastLine(), editor.getLineHandle(editor.lastLine()).text.length));
+
+ // find valid range
+ var prevItem = null;
+ var current = editor.getCursor()
+ for (var i = 0; i < separator.length; i++) {
+ if ((prevItem == null || cmpPos(current, prevItem) > 0) && cmpPos(current, separator[i]) <= 0) {
+ validRange = {start: prevItem, end: separator[i]};
+ break;
+ }
+ prevItem = separator[i];
+ }
+
+ if (validRange.start) {
+ var query = doc.getRange(validRange.start, validRange.end, false);
+
+ for (var i = 0; i < query.length; i++) {
+ var lineText = query[i];
+ eachWord(lineText, function(word) {
+ var wordUpperCase = word.toUpperCase();
+ if (wordUpperCase === aliasUpperCase && getTable(previousWord))
+ table = previousWord;
+ if (wordUpperCase !== CONS.ALIAS_KEYWORD)
+ previousWord = word;
+ });
+ if (table) break;
+ }
+ }
+ return table;
+ }
+
+ CodeMirror.registerHelper("hint", "sql", function(editor, options) {
+ tables = parseTables(options && options.tables)
+ var defaultTableName = options && options.defaultTable;
+ var disableKeywords = options && options.disableKeywords;
+ defaultTable = defaultTableName && getTable(defaultTableName);
+ keywords = getKeywords(editor);
+ identifierQuote = getIdentifierQuote(editor);
+
+ if (defaultTableName && !defaultTable)
+ defaultTable = findTableByAlias(defaultTableName, editor);
+
+ defaultTable = defaultTable || [];
+
+ if (defaultTable.columns)
+ defaultTable = defaultTable.columns;
+
+ var cur = editor.getCursor();
+ var result = [];
+ var token = editor.getTokenAt(cur), start, end, search;
+ if (token.end > cur.ch) {
+ token.end = cur.ch;
+ token.string = token.string.slice(0, cur.ch - token.start);
+ }
+
+ if (token.string.match(/^[.`"'\w@][\w$#]*$/g)) {
+ search = token.string;
+ start = token.start;
+ end = token.end;
+ } else {
+ start = end = cur.ch;
+ search = "";
+ }
+ if (search.charAt(0) == "." || search.charAt(0) == identifierQuote) {
+ start = nameCompletion(cur, token, result, editor);
+ } else {
+ var objectOrClass = function(w, className) {
+ if (typeof w === "object") {
+ w.className = className;
+ } else {
+ w = { text: w, className: className };
+ }
+ return w;
+ };
+ addMatches(result, search, defaultTable, function(w) {
+ return objectOrClass(w, "CodeMirror-hint-table CodeMirror-hint-default-table");
+ });
+ addMatches(
+ result,
+ search,
+ tables, function(w) {
+ return objectOrClass(w, "CodeMirror-hint-table");
+ }
+ );
+ if (!disableKeywords)
+ addMatches(result, search, keywords, function(w) {
+ return objectOrClass(w.toUpperCase(), "CodeMirror-hint-keyword");
+ });
+ }
+
+ return {list: result, from: Pos(cur.line, start), to: Pos(cur.line, end)};
+ });
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/hint/xml-hint.js b/modules/cookiesplus/lib/CodeMirror/addon/hint/xml-hint.js
new file mode 100644
index 00000000..68930b17
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/hint/xml-hint.js
@@ -0,0 +1,152 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ var Pos = CodeMirror.Pos;
+
+ function matches(hint, typed, matchInMiddle) {
+ if (matchInMiddle) return hint.indexOf(typed) >= 0;
+ else return hint.lastIndexOf(typed, 0) == 0;
+ }
+
+ function getHints(cm, options) {
+ var tags = options && options.schemaInfo;
+ var quote = (options && options.quoteChar) || '"';
+ var matchInMiddle = options && options.matchInMiddle;
+ if (!tags) return;
+ var cur = cm.getCursor(), token = cm.getTokenAt(cur);
+ if (token.end > cur.ch) {
+ token.end = cur.ch;
+ token.string = token.string.slice(0, cur.ch - token.start);
+ }
+ var inner = CodeMirror.innerMode(cm.getMode(), token.state);
+ if (!inner.mode.xmlCurrentTag) return
+ var result = [], replaceToken = false, prefix;
+ var tag = /\btag\b/.test(token.type) && !/>$/.test(token.string);
+ var tagName = tag && /^\w/.test(token.string), tagStart;
+
+ if (tagName) {
+ var before = cm.getLine(cur.line).slice(Math.max(0, token.start - 2), token.start);
+ var tagType = /<\/$/.test(before) ? "close" : /<$/.test(before) ? "open" : null;
+ if (tagType) tagStart = token.start - (tagType == "close" ? 2 : 1);
+ } else if (tag && token.string == "<") {
+ tagType = "open";
+ } else if (tag && token.string == "");
+ } else {
+ // Attribute completion
+ var curTag = tagInfo && tags[tagInfo.name], attrs = curTag && curTag.attrs;
+ var globalAttrs = tags["!attrs"];
+ if (!attrs && !globalAttrs) return;
+ if (!attrs) {
+ attrs = globalAttrs;
+ } else if (globalAttrs) { // Combine tag-local and global attributes
+ var set = {};
+ for (var nm in globalAttrs) if (globalAttrs.hasOwnProperty(nm)) set[nm] = globalAttrs[nm];
+ for (var nm in attrs) if (attrs.hasOwnProperty(nm)) set[nm] = attrs[nm];
+ attrs = set;
+ }
+ if (token.type == "string" || token.string == "=") { // A value
+ var before = cm.getRange(Pos(cur.line, Math.max(0, cur.ch - 60)),
+ Pos(cur.line, token.type == "string" ? token.start : token.end));
+ var atName = before.match(/([^\s\u00a0=<>\"\']+)=$/), atValues;
+ if (!atName || !attrs.hasOwnProperty(atName[1]) || !(atValues = attrs[atName[1]])) return;
+ if (typeof atValues == 'function') atValues = atValues.call(this, cm); // Functions can be used to supply values for autocomplete widget
+ if (token.type == "string") {
+ prefix = token.string;
+ var n = 0;
+ if (/['"]/.test(token.string.charAt(0))) {
+ quote = token.string.charAt(0);
+ prefix = token.string.slice(1);
+ n++;
+ }
+ var len = token.string.length;
+ if (/['"]/.test(token.string.charAt(len - 1))) {
+ quote = token.string.charAt(len - 1);
+ prefix = token.string.substr(n, len - 2);
+ }
+ if (n) { // an opening quote
+ var line = cm.getLine(cur.line);
+ if (line.length > token.end && line.charAt(token.end) == quote) token.end++; // include a closing quote
+ }
+ replaceToken = true;
+ }
+ function returnHintsFromAtValues(atValues) {
+ if (atValues)
+ for (var i = 0; i < atValues.length; ++i) if (!prefix || matches(atValues[i], prefix, matchInMiddle))
+ result.push(quote + atValues[i] + quote);
+ return returnHints();
+ }
+ if (atValues && atValues.then) return atValues.then(returnHintsFromAtValues);
+ return returnHintsFromAtValues(atValues);
+ } else { // An attribute name
+ if (token.type == "attribute") {
+ prefix = token.string;
+ replaceToken = true;
+ }
+ for (var attr in attrs) if (attrs.hasOwnProperty(attr) && (!prefix || matches(attr, prefix, matchInMiddle)))
+ result.push(attr);
+ }
+ }
+ function returnHints() {
+ return {
+ list: result,
+ from: replaceToken ? Pos(cur.line, tagStart == null ? token.start : tagStart) : cur,
+ to: replaceToken ? Pos(cur.line, token.end) : cur
+ };
+ }
+ return returnHints();
+ }
+
+ CodeMirror.registerHelper("hint", "xml", getHints);
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/index.php b/modules/cookiesplus/lib/CodeMirror/addon/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/index.php
@@ -0,0 +1,32 @@
+ -1) {
+ end += index;
+ }
+ }
+
+ // Convert to format expected by validation service
+ var hint = {
+ message: error.reason,
+ severity: error.code ? (error.code.startsWith('W') ? "warning" : "error") : "error",
+ from: CodeMirror.Pos(error.line - 1, start),
+ to: CodeMirror.Pos(error.line - 1, end)
+ };
+
+ output.push(hint);
+ }
+ }
+ }
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/lint/json-lint.js b/modules/cookiesplus/lib/CodeMirror/addon/lint/json-lint.js
new file mode 100644
index 00000000..849db1ca
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/lint/json-lint.js
@@ -0,0 +1,60 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+// Depends on jsonlint.js from https://github.com/zaach/jsonlint
+
+// declare global: jsonlint
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+"use strict";
+
+CodeMirror.registerHelper("lint", "json", function(text) {
+ var found = [];
+ if (!window.jsonlint) {
+ if (window.console) {
+ window.console.error("Error: window.jsonlint not defined, CodeMirror JSON linting cannot run.");
+ }
+ return found;
+ }
+ // for jsonlint's web dist jsonlint is exported as an object with a single property parser, of which parseError
+ // is a subproperty
+ var jsonlint = window.jsonlint.parser || window.jsonlint
+ jsonlint.parseError = function(str, hash) {
+ var loc = hash.loc;
+ found.push({from: CodeMirror.Pos(loc.first_line - 1, loc.first_column),
+ to: CodeMirror.Pos(loc.last_line - 1, loc.last_column),
+ message: str});
+ };
+ try { jsonlint.parse(text); }
+ catch(e) {}
+ return found;
+});
+
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/lint/lint.css b/modules/cookiesplus/lib/CodeMirror/addon/lint/lint.css
new file mode 100644
index 00000000..903fcc5b
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/lint/lint.css
@@ -0,0 +1,97 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+/* The lint marker gutter */
+.CodeMirror-lint-markers {
+ width: 16px;
+}
+
+.CodeMirror-lint-tooltip {
+ background-color: #ffd;
+ border: 1px solid black;
+ border-radius: 4px 4px 4px 4px;
+ color: black;
+ font-family: monospace;
+ font-size: 10pt;
+ overflow: hidden;
+ padding: 2px 5px;
+ position: fixed;
+ white-space: pre;
+ white-space: pre-wrap;
+ z-index: 100;
+ max-width: 600px;
+ opacity: 0;
+ transition: opacity .4s;
+ -moz-transition: opacity .4s;
+ -webkit-transition: opacity .4s;
+ -o-transition: opacity .4s;
+ -ms-transition: opacity .4s;
+}
+
+.CodeMirror-lint-mark-error, .CodeMirror-lint-mark-warning {
+ background-position: left bottom;
+ background-repeat: repeat-x;
+}
+
+.CodeMirror-lint-mark-error {
+ background-image:
+ url("data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAQAAAADCAYAAAC09K7GAAAAAXNSR0IArs4c6QAAAAZiS0dEAP8A/wD/oL2nkwAAAAlwSFlzAAALEwAACxMBAJqcGAAAAAd0SU1FB9sJDw4cOCW1/KIAAAAZdEVYdENvbW1lbnQAQ3JlYXRlZCB3aXRoIEdJTVBXgQ4XAAAAHElEQVQI12NggIL/DAz/GdA5/xkY/qPKMDAwAADLZwf5rvm+LQAAAABJRU5ErkJggg==")
+ ;
+}
+
+.CodeMirror-lint-mark-warning {
+ background-image: url("data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAQAAAADCAYAAAC09K7GAAAAAXNSR0IArs4c6QAAAAZiS0dEAP8A/wD/oL2nkwAAAAlwSFlzAAALEwAACxMBAJqcGAAAAAd0SU1FB9sJFhQXEbhTg7YAAAAZdEVYdENvbW1lbnQAQ3JlYXRlZCB3aXRoIEdJTVBXgQ4XAAAAMklEQVQI12NkgIIvJ3QXMjAwdDN+OaEbysDA4MPAwNDNwMCwiOHLCd1zX07o6kBVGQEAKBANtobskNMAAAAASUVORK5CYII=");
+}
+
+.CodeMirror-lint-marker-error, .CodeMirror-lint-marker-warning {
+ background-position: center center;
+ background-repeat: no-repeat;
+ cursor: pointer;
+ display: inline-block;
+ height: 16px;
+ width: 16px;
+ vertical-align: middle;
+ position: relative;
+}
+
+.CodeMirror-lint-message-error, .CodeMirror-lint-message-warning {
+ padding-left: 18px;
+ background-position: top left;
+ background-repeat: no-repeat;
+}
+
+.CodeMirror-lint-marker-error, .CodeMirror-lint-message-error {
+ background-image: url("data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABAAAAAQCAMAAAAoLQ9TAAAAHlBMVEW7AAC7AACxAAC7AAC7AAAAAAC4AAC5AAD//
+/+7AAAUdclpAAAABnRSTlMXnORSiwCK0ZKSAAAATUlEQVR42mWPOQ7AQAgDuQLx/z8csYRmPRIFIwRGnosRrpamvkKi0FTIiMASR3hhKW+hAN6/tIWhu9PDWiTGNEkTtIOucA5Oyr9ckPgAWm0GPBog6v4AAAAASUVORK5CYII=");
+}
+
+.CodeMirror-lint-marker-warning, .CodeMirror-lint-message-warning {
+ background-image: url("data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABAAAAAQCAMAAAAoLQ9TAAAANlBMVEX/uwDvrwD/uwD/uwD/uwD/uwD/uwD/uwD/uwD6twD/uwAAAADurwD2tQD7uAD+ugAAAAD/uwDhmeTRAAAADHRSTlMJ8mN1EYcbmiixgACm7WbuAAAAVklEQVR42n3PUQqAIBBFUU1LLc3u/jdbOJoW1P08DA9Gba8+YWJ6gNJoNYIBzAA2chBth5kLmG9YUoG0NHAUwFXwO9LuBQL1giCQb8gC9Oro2vp5rncCIY8L8uEx5ZkAAAAASUVORK5CYII=");
+}
+
+.CodeMirror-lint-marker-multiple {
+ background-image: url("data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAcAAAAHCAMAAADzjKfhAAAACVBMVEUAAAAAAAC/v7914kyHAAAAAXRSTlMAQObYZgAAACNJREFUeNo1ioEJAAAIwmz/H90iFFSGJgFMe3gaLZ0od+9/AQZ0ADosbYraAAAAAElFTkSuQmCC");
+ background-repeat: no-repeat;
+ background-position: right bottom;
+ width: 100%; height: 100%;
+}
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/lint/lint.js b/modules/cookiesplus/lib/CodeMirror/addon/lint/lint.js
new file mode 100644
index 00000000..b5fe03d8
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/lint/lint.js
@@ -0,0 +1,275 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+ var GUTTER_ID = "CodeMirror-lint-markers";
+
+ function showTooltip(cm, e, content) {
+ var tt = document.createElement("div");
+ tt.className = "CodeMirror-lint-tooltip cm-s-" + cm.options.theme;
+ tt.appendChild(content.cloneNode(true));
+ if (cm.state.lint.options.selfContain)
+ cm.getWrapperElement().appendChild(tt);
+ else
+ document.body.appendChild(tt);
+
+ function position(e) {
+ if (!tt.parentNode) return CodeMirror.off(document, "mousemove", position);
+ tt.style.top = Math.max(0, e.clientY - tt.offsetHeight - 5) + "px";
+ tt.style.left = (e.clientX + 5) + "px";
+ }
+ CodeMirror.on(document, "mousemove", position);
+ position(e);
+ if (tt.style.opacity != null) tt.style.opacity = 1;
+ return tt;
+ }
+ function rm(elt) {
+ if (elt.parentNode) elt.parentNode.removeChild(elt);
+ }
+ function hideTooltip(tt) {
+ if (!tt.parentNode) return;
+ if (tt.style.opacity == null) rm(tt);
+ tt.style.opacity = 0;
+ setTimeout(function() { rm(tt); }, 600);
+ }
+
+ function showTooltipFor(cm, e, content, node) {
+ var tooltip = showTooltip(cm, e, content);
+ function hide() {
+ CodeMirror.off(node, "mouseout", hide);
+ if (tooltip) { hideTooltip(tooltip); tooltip = null; }
+ }
+ var poll = setInterval(function() {
+ if (tooltip) for (var n = node;; n = n.parentNode) {
+ if (n && n.nodeType == 11) n = n.host;
+ if (n == document.body) return;
+ if (!n) { hide(); break; }
+ }
+ if (!tooltip) return clearInterval(poll);
+ }, 400);
+ CodeMirror.on(node, "mouseout", hide);
+ }
+
+ function LintState(cm, options, hasGutter) {
+ this.marked = [];
+ this.options = options;
+ this.timeout = null;
+ this.hasGutter = hasGutter;
+ this.onMouseOver = function(e) { onMouseOver(cm, e); };
+ this.waitingFor = 0
+ }
+
+ function parseOptions(_cm, options) {
+ if (options instanceof Function) return {getAnnotations: options};
+ if (!options || options === true) options = {};
+ return options;
+ }
+
+ function clearMarks(cm) {
+ var state = cm.state.lint;
+ if (state.hasGutter) cm.clearGutter(GUTTER_ID);
+ for (var i = 0; i < state.marked.length; ++i)
+ state.marked[i].clear();
+ state.marked.length = 0;
+ }
+
+ function makeMarker(cm, labels, severity, multiple, tooltips) {
+ var marker = document.createElement("div"), inner = marker;
+ marker.className = "CodeMirror-lint-marker-" + severity;
+ if (multiple) {
+ inner = marker.appendChild(document.createElement("div"));
+ inner.className = "CodeMirror-lint-marker-multiple";
+ }
+
+ if (tooltips != false) CodeMirror.on(inner, "mouseover", function(e) {
+ showTooltipFor(cm, e, labels, inner);
+ });
+
+ return marker;
+ }
+
+ function getMaxSeverity(a, b) {
+ if (a == "error") return a;
+ else return b;
+ }
+
+ function groupByLine(annotations) {
+ var lines = [];
+ for (var i = 0; i < annotations.length; ++i) {
+ var ann = annotations[i], line = ann.from.line;
+ (lines[line] || (lines[line] = [])).push(ann);
+ }
+ return lines;
+ }
+
+ function annotationTooltip(ann) {
+ var severity = ann.severity;
+ if (!severity) severity = "error";
+ var tip = document.createElement("div");
+ tip.className = "CodeMirror-lint-message-" + severity;
+ if (typeof ann.messageHTML != 'undefined') {
+ tip.innerHTML = ann.messageHTML;
+ } else {
+ tip.appendChild(document.createTextNode(ann.message));
+ }
+ return tip;
+ }
+
+ function lintAsync(cm, getAnnotations, passOptions) {
+ var state = cm.state.lint
+ var id = ++state.waitingFor
+ function abort() {
+ id = -1
+ cm.off("change", abort)
+ }
+ cm.on("change", abort)
+ getAnnotations(cm.getValue(), function(annotations, arg2) {
+ cm.off("change", abort)
+ if (state.waitingFor != id) return
+ if (arg2 && annotations instanceof CodeMirror) annotations = arg2
+ cm.operation(function() {updateLinting(cm, annotations)})
+ }, passOptions, cm);
+ }
+
+ function startLinting(cm) {
+ var state = cm.state.lint, options = state.options;
+ /*
+ * Passing rules in `options` property prevents JSHint (and other linters) from complaining
+ * about unrecognized rules like `onUpdateLinting`, `delay`, `lintOnChange`, etc.
+ */
+ var passOptions = options.options || options;
+ var getAnnotations = options.getAnnotations || cm.getHelper(CodeMirror.Pos(0, 0), "lint");
+ if (!getAnnotations) return;
+ if (options.async || getAnnotations.async) {
+ lintAsync(cm, getAnnotations, passOptions)
+ } else {
+ var annotations = getAnnotations(cm.getValue(), passOptions, cm);
+ if (!annotations) return;
+ if (annotations.then) annotations.then(function(issues) {
+ cm.operation(function() {updateLinting(cm, issues)})
+ });
+ else cm.operation(function() {updateLinting(cm, annotations)})
+ }
+ }
+
+ function updateLinting(cm, annotationsNotSorted) {
+ clearMarks(cm);
+ var state = cm.state.lint, options = state.options;
+
+ var annotations = groupByLine(annotationsNotSorted);
+
+ for (var line = 0; line < annotations.length; ++line) {
+ var anns = annotations[line];
+ if (!anns) continue;
+
+ var maxSeverity = null;
+ var tipLabel = state.hasGutter && document.createDocumentFragment();
+
+ for (var i = 0; i < anns.length; ++i) {
+ var ann = anns[i];
+ var severity = ann.severity;
+ if (!severity) severity = "error";
+ maxSeverity = getMaxSeverity(maxSeverity, severity);
+
+ if (options.formatAnnotation) ann = options.formatAnnotation(ann);
+ if (state.hasGutter) tipLabel.appendChild(annotationTooltip(ann));
+
+ if (ann.to) state.marked.push(cm.markText(ann.from, ann.to, {
+ className: "CodeMirror-lint-mark-" + severity,
+ __annotation: ann
+ }));
+ }
+
+ if (state.hasGutter)
+ cm.setGutterMarker(line, GUTTER_ID, makeMarker(cm, tipLabel, maxSeverity, anns.length > 1,
+ state.options.tooltips));
+ }
+ if (options.onUpdateLinting) options.onUpdateLinting(annotationsNotSorted, annotations, cm);
+ }
+
+ function onChange(cm) {
+ var state = cm.state.lint;
+ if (!state) return;
+ clearTimeout(state.timeout);
+ state.timeout = setTimeout(function(){startLinting(cm);}, state.options.delay || 500);
+ }
+
+ function popupTooltips(cm, annotations, e) {
+ var target = e.target || e.srcElement;
+ var tooltip = document.createDocumentFragment();
+ for (var i = 0; i < annotations.length; i++) {
+ var ann = annotations[i];
+ tooltip.appendChild(annotationTooltip(ann));
+ }
+ showTooltipFor(cm, e, tooltip, target);
+ }
+
+ function onMouseOver(cm, e) {
+ var target = e.target || e.srcElement;
+ if (!/\bCodeMirror-lint-mark-/.test(target.className)) return;
+ var box = target.getBoundingClientRect(), x = (box.left + box.right) / 2, y = (box.top + box.bottom) / 2;
+ var spans = cm.findMarksAt(cm.coordsChar({left: x, top: y}, "client"));
+
+ var annotations = [];
+ for (var i = 0; i < spans.length; ++i) {
+ var ann = spans[i].__annotation;
+ if (ann) annotations.push(ann);
+ }
+ if (annotations.length) popupTooltips(cm, annotations, e);
+ }
+
+ CodeMirror.defineOption("lint", false, function(cm, val, old) {
+ if (old && old != CodeMirror.Init) {
+ clearMarks(cm);
+ if (cm.state.lint.options.lintOnChange !== false)
+ cm.off("change", onChange);
+ CodeMirror.off(cm.getWrapperElement(), "mouseover", cm.state.lint.onMouseOver);
+ clearTimeout(cm.state.lint.timeout);
+ delete cm.state.lint;
+ }
+
+ if (val) {
+ var gutters = cm.getOption("gutters"), hasLintGutter = false;
+ for (var i = 0; i < gutters.length; ++i) if (gutters[i] == GUTTER_ID) hasLintGutter = true;
+ var state = cm.state.lint = new LintState(cm, parseOptions(cm, val), hasLintGutter);
+ if (state.options.lintOnChange !== false)
+ cm.on("change", onChange);
+ if (state.options.tooltips != false && state.options.tooltips != "gutter")
+ CodeMirror.on(cm.getWrapperElement(), "mouseover", state.onMouseOver);
+
+ startLinting(cm);
+ }
+ });
+
+ CodeMirror.defineExtension("performLint", function() {
+ if (this.state.lint) startLinting(this);
+ });
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/lint/yaml-lint.js b/modules/cookiesplus/lib/CodeMirror/addon/lint/yaml-lint.js
new file mode 100644
index 00000000..f5869eff
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/lint/yaml-lint.js
@@ -0,0 +1,61 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+"use strict";
+
+// Depends on js-yaml.js from https://github.com/nodeca/js-yaml
+
+// declare global: jsyaml
+
+CodeMirror.registerHelper("lint", "yaml", function(text) {
+ var found = [];
+ if (!window.jsyaml) {
+ if (window.console) {
+ window.console.error("Error: window.jsyaml not defined, CodeMirror YAML linting cannot run.");
+ }
+ return found;
+ }
+ try { jsyaml.loadAll(text); }
+ catch(e) {
+ var loc = e.mark,
+ // js-yaml YAMLException doesn't always provide an accurate lineno
+ // e.g., when there are multiple yaml docs
+ // ---
+ // ---
+ // foo:bar
+ from = loc ? CodeMirror.Pos(loc.line, loc.column) : CodeMirror.Pos(0, 0),
+ to = from;
+ found.push({ from: from, to: to, message: e.message });
+ }
+ return found;
+});
+
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/merge/index.php b/modules/cookiesplus/lib/CodeMirror/addon/merge/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/merge/index.php
@@ -0,0 +1,32 @@
+ now) return false;
+
+ var sInfo = editor.getScrollInfo();
+ if (dv.mv.options.connect == "align") {
+ targetPos = sInfo.top;
+ } else {
+ var halfScreen = .5 * sInfo.clientHeight, midY = sInfo.top + halfScreen;
+ var mid = editor.lineAtHeight(midY, "local");
+ var around = chunkBoundariesAround(dv.chunks, mid, toOrig);
+ var off = getOffsets(editor, toOrig ? around.edit : around.orig);
+ var offOther = getOffsets(other, toOrig ? around.orig : around.edit);
+ var ratio = (midY - off.top) / (off.bot - off.top);
+ var targetPos = (offOther.top - halfScreen) + ratio * (offOther.bot - offOther.top);
+
+ var botDist, mix;
+ // Some careful tweaking to make sure no space is left out of view
+ // when scrolling to top or bottom.
+ if (targetPos > sInfo.top && (mix = sInfo.top / halfScreen) < 1) {
+ targetPos = targetPos * mix + sInfo.top * (1 - mix);
+ } else if ((botDist = sInfo.height - sInfo.clientHeight - sInfo.top) < halfScreen) {
+ var otherInfo = other.getScrollInfo();
+ var botDistOther = otherInfo.height - otherInfo.clientHeight - targetPos;
+ if (botDistOther > botDist && (mix = botDist / halfScreen) < 1)
+ targetPos = targetPos * mix + (otherInfo.height - otherInfo.clientHeight - botDist) * (1 - mix);
+ }
+ }
+
+ other.scrollTo(sInfo.left, targetPos);
+ other.state.scrollSetAt = now;
+ other.state.scrollSetBy = dv;
+ return true;
+ }
+
+ function getOffsets(editor, around) {
+ var bot = around.after;
+ if (bot == null) bot = editor.lastLine() + 1;
+ return {top: editor.heightAtLine(around.before || 0, "local"),
+ bot: editor.heightAtLine(bot, "local")};
+ }
+
+ function setScrollLock(dv, val, action) {
+ dv.lockScroll = val;
+ if (val && action != false) syncScroll(dv, DIFF_INSERT) && makeConnections(dv);
+ (val ? CodeMirror.addClass : CodeMirror.rmClass)(dv.lockButton, "CodeMirror-merge-scrolllock-enabled");
+ }
+
+ // Updating the marks for editor content
+
+ function removeClass(editor, line, classes) {
+ var locs = classes.classLocation
+ for (var i = 0; i < locs.length; i++) {
+ editor.removeLineClass(line, locs[i], classes.chunk);
+ editor.removeLineClass(line, locs[i], classes.start);
+ editor.removeLineClass(line, locs[i], classes.end);
+ }
+ }
+
+ function clearMarks(editor, arr, classes) {
+ for (var i = 0; i < arr.length; ++i) {
+ var mark = arr[i];
+ if (mark instanceof CodeMirror.TextMarker)
+ mark.clear();
+ else if (mark.parent)
+ removeClass(editor, mark, classes);
+ }
+ arr.length = 0;
+ }
+
+ // FIXME maybe add a margin around viewport to prevent too many updates
+ function updateMarks(editor, diff, state, type, classes) {
+ var vp = editor.getViewport();
+ editor.operation(function() {
+ if (state.from == state.to || vp.from - state.to > 20 || state.from - vp.to > 20) {
+ clearMarks(editor, state.marked, classes);
+ markChanges(editor, diff, type, state.marked, vp.from, vp.to, classes);
+ state.from = vp.from; state.to = vp.to;
+ } else {
+ if (vp.from < state.from) {
+ markChanges(editor, diff, type, state.marked, vp.from, state.from, classes);
+ state.from = vp.from;
+ }
+ if (vp.to > state.to) {
+ markChanges(editor, diff, type, state.marked, state.to, vp.to, classes);
+ state.to = vp.to;
+ }
+ }
+ });
+ }
+
+ function addClass(editor, lineNr, classes, main, start, end) {
+ var locs = classes.classLocation, line = editor.getLineHandle(lineNr);
+ for (var i = 0; i < locs.length; i++) {
+ if (main) editor.addLineClass(line, locs[i], classes.chunk);
+ if (start) editor.addLineClass(line, locs[i], classes.start);
+ if (end) editor.addLineClass(line, locs[i], classes.end);
+ }
+ return line;
+ }
+
+ function markChanges(editor, diff, type, marks, from, to, classes) {
+ var pos = Pos(0, 0);
+ var top = Pos(from, 0), bot = editor.clipPos(Pos(to - 1));
+ var cls = type == DIFF_DELETE ? classes.del : classes.insert;
+ function markChunk(start, end) {
+ var bfrom = Math.max(from, start), bto = Math.min(to, end);
+ for (var i = bfrom; i < bto; ++i)
+ marks.push(addClass(editor, i, classes, true, i == start, i == end - 1));
+ // When the chunk is empty, make sure a horizontal line shows up
+ if (start == end && bfrom == end && bto == end) {
+ if (bfrom)
+ marks.push(addClass(editor, bfrom - 1, classes, false, false, true));
+ else
+ marks.push(addClass(editor, bfrom, classes, false, true, false));
+ }
+ }
+
+ var chunkStart = 0, pending = false;
+ for (var i = 0; i < diff.length; ++i) {
+ var part = diff[i], tp = part[0], str = part[1];
+ if (tp == DIFF_EQUAL) {
+ var cleanFrom = pos.line + (startOfLineClean(diff, i) ? 0 : 1);
+ moveOver(pos, str);
+ var cleanTo = pos.line + (endOfLineClean(diff, i) ? 1 : 0);
+ if (cleanTo > cleanFrom) {
+ if (pending) { markChunk(chunkStart, cleanFrom); pending = false }
+ chunkStart = cleanTo;
+ }
+ } else {
+ pending = true
+ if (tp == type) {
+ var end = moveOver(pos, str, true);
+ var a = posMax(top, pos), b = posMin(bot, end);
+ if (!posEq(a, b))
+ marks.push(editor.markText(a, b, {className: cls}));
+ pos = end;
+ }
+ }
+ }
+ if (pending) markChunk(chunkStart, pos.line + 1);
+ }
+
+ // Updating the gap between editor and original
+
+ function makeConnections(dv) {
+ if (!dv.showDifferences) return;
+
+ if (dv.svg) {
+ clear(dv.svg);
+ var w = dv.gap.offsetWidth;
+ attrs(dv.svg, "width", w, "height", dv.gap.offsetHeight);
+ }
+ if (dv.copyButtons) clear(dv.copyButtons);
+
+ var vpEdit = dv.edit.getViewport(), vpOrig = dv.orig.getViewport();
+ var outerTop = dv.mv.wrap.getBoundingClientRect().top
+ var sTopEdit = outerTop - dv.edit.getScrollerElement().getBoundingClientRect().top + dv.edit.getScrollInfo().top
+ var sTopOrig = outerTop - dv.orig.getScrollerElement().getBoundingClientRect().top + dv.orig.getScrollInfo().top;
+ for (var i = 0; i < dv.chunks.length; i++) {
+ var ch = dv.chunks[i];
+ if (ch.editFrom <= vpEdit.to && ch.editTo >= vpEdit.from &&
+ ch.origFrom <= vpOrig.to && ch.origTo >= vpOrig.from)
+ drawConnectorsForChunk(dv, ch, sTopOrig, sTopEdit, w);
+ }
+ }
+
+ function getMatchingOrigLine(editLine, chunks) {
+ var editStart = 0, origStart = 0;
+ for (var i = 0; i < chunks.length; i++) {
+ var chunk = chunks[i];
+ if (chunk.editTo > editLine && chunk.editFrom <= editLine) return null;
+ if (chunk.editFrom > editLine) break;
+ editStart = chunk.editTo;
+ origStart = chunk.origTo;
+ }
+ return origStart + (editLine - editStart);
+ }
+
+ // Combines information about chunks and widgets/markers to return
+ // an array of lines, in a single editor, that probably need to be
+ // aligned with their counterparts in the editor next to it.
+ function alignableFor(cm, chunks, isOrig) {
+ var tracker = cm.state.trackAlignable
+ var start = cm.firstLine(), trackI = 0
+ var result = []
+ for (var i = 0;; i++) {
+ var chunk = chunks[i]
+ var chunkStart = !chunk ? 1e9 : isOrig ? chunk.origFrom : chunk.editFrom
+ for (; trackI < tracker.alignable.length; trackI += 2) {
+ var n = tracker.alignable[trackI] + 1
+ if (n <= start) continue
+ if (n <= chunkStart) result.push(n)
+ else break
+ }
+ if (!chunk) break
+ result.push(start = isOrig ? chunk.origTo : chunk.editTo)
+ }
+ return result
+ }
+
+ // Given information about alignable lines in two editors, fill in
+ // the result (an array of three-element arrays) to reflect the
+ // lines that need to be aligned with each other.
+ function mergeAlignable(result, origAlignable, chunks, setIndex) {
+ var rI = 0, origI = 0, chunkI = 0, diff = 0
+ outer: for (;; rI++) {
+ var nextR = result[rI], nextO = origAlignable[origI]
+ if (!nextR && nextO == null) break
+
+ var rLine = nextR ? nextR[0] : 1e9, oLine = nextO == null ? 1e9 : nextO
+ while (chunkI < chunks.length) {
+ var chunk = chunks[chunkI]
+ if (chunk.origFrom <= oLine && chunk.origTo > oLine) {
+ origI++
+ rI--
+ continue outer;
+ }
+ if (chunk.editTo > rLine) {
+ if (chunk.editFrom <= rLine) continue outer;
+ break
+ }
+ diff += (chunk.origTo - chunk.origFrom) - (chunk.editTo - chunk.editFrom)
+ chunkI++
+ }
+ if (rLine == oLine - diff) {
+ nextR[setIndex] = oLine
+ origI++
+ } else if (rLine < oLine - diff) {
+ nextR[setIndex] = rLine + diff
+ } else {
+ var record = [oLine - diff, null, null]
+ record[setIndex] = oLine
+ result.splice(rI, 0, record)
+ origI++
+ }
+ }
+ }
+
+ function findAlignedLines(dv, other) {
+ var alignable = alignableFor(dv.edit, dv.chunks, false), result = []
+ if (other) for (var i = 0, j = 0; i < other.chunks.length; i++) {
+ var n = other.chunks[i].editTo
+ while (j < alignable.length && alignable[j] < n) j++
+ if (j == alignable.length || alignable[j] != n) alignable.splice(j++, 0, n)
+ }
+ for (var i = 0; i < alignable.length; i++)
+ result.push([alignable[i], null, null])
+
+ mergeAlignable(result, alignableFor(dv.orig, dv.chunks, true), dv.chunks, 1)
+ if (other)
+ mergeAlignable(result, alignableFor(other.orig, other.chunks, true), other.chunks, 2)
+
+ return result
+ }
+
+ function alignChunks(dv, force) {
+ if (!dv.dealigned && !force) return;
+ if (!dv.orig.curOp) return dv.orig.operation(function() {
+ alignChunks(dv, force);
+ });
+
+ dv.dealigned = false;
+ var other = dv.mv.left == dv ? dv.mv.right : dv.mv.left;
+ if (other) {
+ ensureDiff(other);
+ other.dealigned = false;
+ }
+ var linesToAlign = findAlignedLines(dv, other);
+
+ // Clear old aligners
+ var aligners = dv.mv.aligners;
+ for (var i = 0; i < aligners.length; i++)
+ aligners[i].clear();
+ aligners.length = 0;
+
+ var cm = [dv.edit, dv.orig], scroll = [], offset = []
+ if (other) cm.push(other.orig);
+ for (var i = 0; i < cm.length; i++) {
+ scroll.push(cm[i].getScrollInfo().top);
+ offset.push(-cm[i].getScrollerElement().getBoundingClientRect().top)
+ }
+
+ if (offset[0] != offset[1] || cm.length == 3 && offset[1] != offset[2])
+ alignLines(cm, offset, [0, 0, 0], aligners)
+ for (var ln = 0; ln < linesToAlign.length; ln++)
+ alignLines(cm, offset, linesToAlign[ln], aligners);
+
+ for (var i = 0; i < cm.length; i++)
+ cm[i].scrollTo(null, scroll[i]);
+ }
+
+ function alignLines(cm, cmOffset, lines, aligners) {
+ var maxOffset = -1e8, offset = [];
+ for (var i = 0; i < cm.length; i++) if (lines[i] != null) {
+ var off = cm[i].heightAtLine(lines[i], "local") - cmOffset[i];
+ offset[i] = off;
+ maxOffset = Math.max(maxOffset, off);
+ }
+ for (var i = 0; i < cm.length; i++) if (lines[i] != null) {
+ var diff = maxOffset - offset[i];
+ if (diff > 1)
+ aligners.push(padAbove(cm[i], lines[i], diff));
+ }
+ }
+
+ function padAbove(cm, line, size) {
+ var above = true;
+ if (line > cm.lastLine()) {
+ line--;
+ above = false;
+ }
+ var elt = document.createElement("div");
+ elt.className = "CodeMirror-merge-spacer";
+ elt.style.height = size + "px"; elt.style.minWidth = "1px";
+ return cm.addLineWidget(line, elt, {height: size, above: above, mergeSpacer: true, handleMouseEvents: true});
+ }
+
+ function drawConnectorsForChunk(dv, chunk, sTopOrig, sTopEdit, w) {
+ var flip = dv.type == "left";
+ var top = dv.orig.heightAtLine(chunk.origFrom, "local", true) - sTopOrig;
+ if (dv.svg) {
+ var topLpx = top;
+ var topRpx = dv.edit.heightAtLine(chunk.editFrom, "local", true) - sTopEdit;
+ if (flip) { var tmp = topLpx; topLpx = topRpx; topRpx = tmp; }
+ var botLpx = dv.orig.heightAtLine(chunk.origTo, "local", true) - sTopOrig;
+ var botRpx = dv.edit.heightAtLine(chunk.editTo, "local", true) - sTopEdit;
+ if (flip) { var tmp = botLpx; botLpx = botRpx; botRpx = tmp; }
+ var curveTop = " C " + w/2 + " " + topRpx + " " + w/2 + " " + topLpx + " " + (w + 2) + " " + topLpx;
+ var curveBot = " C " + w/2 + " " + botLpx + " " + w/2 + " " + botRpx + " -1 " + botRpx;
+ attrs(dv.svg.appendChild(document.createElementNS(svgNS, "path")),
+ "d", "M -1 " + topRpx + curveTop + " L " + (w + 2) + " " + botLpx + curveBot + " z",
+ "class", dv.classes.connect);
+ }
+ if (dv.copyButtons) {
+ var copy = dv.copyButtons.appendChild(elt("div", dv.type == "left" ? "\u21dd" : "\u21dc",
+ "CodeMirror-merge-copy"));
+ var editOriginals = dv.mv.options.allowEditingOriginals;
+ copy.title = dv.edit.phrase(editOriginals ? "Push to left" : "Revert chunk");
+ copy.chunk = chunk;
+ copy.style.top = (chunk.origTo > chunk.origFrom ? top : dv.edit.heightAtLine(chunk.editFrom, "local") - sTopEdit) + "px";
+
+ if (editOriginals) {
+ var topReverse = dv.edit.heightAtLine(chunk.editFrom, "local") - sTopEdit;
+ var copyReverse = dv.copyButtons.appendChild(elt("div", dv.type == "right" ? "\u21dd" : "\u21dc",
+ "CodeMirror-merge-copy-reverse"));
+ copyReverse.title = "Push to right";
+ copyReverse.chunk = {editFrom: chunk.origFrom, editTo: chunk.origTo,
+ origFrom: chunk.editFrom, origTo: chunk.editTo};
+ copyReverse.style.top = topReverse + "px";
+ dv.type == "right" ? copyReverse.style.left = "2px" : copyReverse.style.right = "2px";
+ }
+ }
+ }
+
+ function copyChunk(dv, to, from, chunk) {
+ if (dv.diffOutOfDate) return;
+ var origStart = chunk.origTo > from.lastLine() ? Pos(chunk.origFrom - 1) : Pos(chunk.origFrom, 0)
+ var origEnd = Pos(chunk.origTo, 0)
+ var editStart = chunk.editTo > to.lastLine() ? Pos(chunk.editFrom - 1) : Pos(chunk.editFrom, 0)
+ var editEnd = Pos(chunk.editTo, 0)
+ var handler = dv.mv.options.revertChunk
+ if (handler)
+ handler(dv.mv, from, origStart, origEnd, to, editStart, editEnd)
+ else
+ to.replaceRange(from.getRange(origStart, origEnd), editStart, editEnd)
+ }
+
+ // Merge view, containing 0, 1, or 2 diff views.
+
+ var MergeView = CodeMirror.MergeView = function(node, options) {
+ if (!(this instanceof MergeView)) return new MergeView(node, options);
+
+ this.options = options;
+ var origLeft = options.origLeft, origRight = options.origRight == null ? options.orig : options.origRight;
+
+ var hasLeft = origLeft != null, hasRight = origRight != null;
+ var panes = 1 + (hasLeft ? 1 : 0) + (hasRight ? 1 : 0);
+ var wrap = [], left = this.left = null, right = this.right = null;
+ var self = this;
+
+ if (hasLeft) {
+ left = this.left = new DiffView(this, "left");
+ var leftPane = elt("div", null, "CodeMirror-merge-pane CodeMirror-merge-left");
+ wrap.push(leftPane);
+ wrap.push(buildGap(left));
+ }
+
+ var editPane = elt("div", null, "CodeMirror-merge-pane CodeMirror-merge-editor");
+ wrap.push(editPane);
+
+ if (hasRight) {
+ right = this.right = new DiffView(this, "right");
+ wrap.push(buildGap(right));
+ var rightPane = elt("div", null, "CodeMirror-merge-pane CodeMirror-merge-right");
+ wrap.push(rightPane);
+ }
+
+ (hasRight ? rightPane : editPane).className += " CodeMirror-merge-pane-rightmost";
+
+ wrap.push(elt("div", null, null, "height: 0; clear: both;"));
+
+ var wrapElt = this.wrap = node.appendChild(elt("div", wrap, "CodeMirror-merge CodeMirror-merge-" + panes + "pane"));
+ this.edit = CodeMirror(editPane, copyObj(options));
+
+ if (left) left.init(leftPane, origLeft, options);
+ if (right) right.init(rightPane, origRight, options);
+ if (options.collapseIdentical)
+ this.editor().operation(function() {
+ collapseIdenticalStretches(self, options.collapseIdentical);
+ });
+ if (options.connect == "align") {
+ this.aligners = [];
+ alignChunks(this.left || this.right, true);
+ }
+ if (left) left.registerEvents(right)
+ if (right) right.registerEvents(left)
+
+
+ var onResize = function() {
+ if (left) makeConnections(left);
+ if (right) makeConnections(right);
+ };
+ CodeMirror.on(window, "resize", onResize);
+ var resizeInterval = setInterval(function() {
+ for (var p = wrapElt.parentNode; p && p != document.body; p = p.parentNode) {}
+ if (!p) { clearInterval(resizeInterval); CodeMirror.off(window, "resize", onResize); }
+ }, 5000);
+ };
+
+ function buildGap(dv) {
+ var lock = dv.lockButton = elt("div", null, "CodeMirror-merge-scrolllock");
+ var lockWrap = elt("div", [lock], "CodeMirror-merge-scrolllock-wrap");
+ CodeMirror.on(lock, "click", function() { setScrollLock(dv, !dv.lockScroll); });
+ var gapElts = [lockWrap];
+ if (dv.mv.options.revertButtons !== false) {
+ dv.copyButtons = elt("div", null, "CodeMirror-merge-copybuttons-" + dv.type);
+ CodeMirror.on(dv.copyButtons, "click", function(e) {
+ var node = e.target || e.srcElement;
+ if (!node.chunk) return;
+ if (node.className == "CodeMirror-merge-copy-reverse") {
+ copyChunk(dv, dv.orig, dv.edit, node.chunk);
+ return;
+ }
+ copyChunk(dv, dv.edit, dv.orig, node.chunk);
+ });
+ gapElts.unshift(dv.copyButtons);
+ }
+ if (dv.mv.options.connect != "align") {
+ var svg = document.createElementNS && document.createElementNS(svgNS, "svg");
+ if (svg && !svg.createSVGRect) svg = null;
+ dv.svg = svg;
+ if (svg) gapElts.push(svg);
+ }
+
+ return dv.gap = elt("div", gapElts, "CodeMirror-merge-gap");
+ }
+
+ MergeView.prototype = {
+ constructor: MergeView,
+ editor: function() { return this.edit; },
+ rightOriginal: function() { return this.right && this.right.orig; },
+ leftOriginal: function() { return this.left && this.left.orig; },
+ setShowDifferences: function(val) {
+ if (this.right) this.right.setShowDifferences(val);
+ if (this.left) this.left.setShowDifferences(val);
+ },
+ rightChunks: function() {
+ if (this.right) { ensureDiff(this.right); return this.right.chunks; }
+ },
+ leftChunks: function() {
+ if (this.left) { ensureDiff(this.left); return this.left.chunks; }
+ }
+ };
+
+ function asString(obj) {
+ if (typeof obj == "string") return obj;
+ else return obj.getValue();
+ }
+
+ // Operations on diffs
+ var dmp;
+ function getDiff(a, b, ignoreWhitespace) {
+ if (!dmp) dmp = new diff_match_patch();
+
+ var diff = dmp.diff_main(a, b);
+ // The library sometimes leaves in empty parts, which confuse the algorithm
+ for (var i = 0; i < diff.length; ++i) {
+ var part = diff[i];
+ if (ignoreWhitespace ? !/[^ \t]/.test(part[1]) : !part[1]) {
+ diff.splice(i--, 1);
+ } else if (i && diff[i - 1][0] == part[0]) {
+ diff.splice(i--, 1);
+ diff[i][1] += part[1];
+ }
+ }
+ return diff;
+ }
+
+ function getChunks(diff) {
+ var chunks = [];
+ if (!diff.length) return chunks;
+ var startEdit = 0, startOrig = 0;
+ var edit = Pos(0, 0), orig = Pos(0, 0);
+ for (var i = 0; i < diff.length; ++i) {
+ var part = diff[i], tp = part[0];
+ if (tp == DIFF_EQUAL) {
+ var startOff = !startOfLineClean(diff, i) || edit.line < startEdit || orig.line < startOrig ? 1 : 0;
+ var cleanFromEdit = edit.line + startOff, cleanFromOrig = orig.line + startOff;
+ moveOver(edit, part[1], null, orig);
+ var endOff = endOfLineClean(diff, i) ? 1 : 0;
+ var cleanToEdit = edit.line + endOff, cleanToOrig = orig.line + endOff;
+ if (cleanToEdit > cleanFromEdit) {
+ if (i) chunks.push({origFrom: startOrig, origTo: cleanFromOrig,
+ editFrom: startEdit, editTo: cleanFromEdit});
+ startEdit = cleanToEdit; startOrig = cleanToOrig;
+ }
+ } else {
+ moveOver(tp == DIFF_INSERT ? edit : orig, part[1]);
+ }
+ }
+ if (startEdit <= edit.line || startOrig <= orig.line)
+ chunks.push({origFrom: startOrig, origTo: orig.line + 1,
+ editFrom: startEdit, editTo: edit.line + 1});
+ return chunks;
+ }
+
+ function endOfLineClean(diff, i) {
+ if (i == diff.length - 1) return true;
+ var next = diff[i + 1][1];
+ if ((next.length == 1 && i < diff.length - 2) || next.charCodeAt(0) != 10) return false;
+ if (i == diff.length - 2) return true;
+ next = diff[i + 2][1];
+ return (next.length > 1 || i == diff.length - 3) && next.charCodeAt(0) == 10;
+ }
+
+ function startOfLineClean(diff, i) {
+ if (i == 0) return true;
+ var last = diff[i - 1][1];
+ if (last.charCodeAt(last.length - 1) != 10) return false;
+ if (i == 1) return true;
+ last = diff[i - 2][1];
+ return last.charCodeAt(last.length - 1) == 10;
+ }
+
+ function chunkBoundariesAround(chunks, n, nInEdit) {
+ var beforeE, afterE, beforeO, afterO;
+ for (var i = 0; i < chunks.length; i++) {
+ var chunk = chunks[i];
+ var fromLocal = nInEdit ? chunk.editFrom : chunk.origFrom;
+ var toLocal = nInEdit ? chunk.editTo : chunk.origTo;
+ if (afterE == null) {
+ if (fromLocal > n) { afterE = chunk.editFrom; afterO = chunk.origFrom; }
+ else if (toLocal > n) { afterE = chunk.editTo; afterO = chunk.origTo; }
+ }
+ if (toLocal <= n) { beforeE = chunk.editTo; beforeO = chunk.origTo; }
+ else if (fromLocal <= n) { beforeE = chunk.editFrom; beforeO = chunk.origFrom; }
+ }
+ return {edit: {before: beforeE, after: afterE}, orig: {before: beforeO, after: afterO}};
+ }
+
+ function collapseSingle(cm, from, to) {
+ cm.addLineClass(from, "wrap", "CodeMirror-merge-collapsed-line");
+ var widget = document.createElement("span");
+ widget.className = "CodeMirror-merge-collapsed-widget";
+ widget.title = cm.phrase("Identical text collapsed. Click to expand.");
+ var mark = cm.markText(Pos(from, 0), Pos(to - 1), {
+ inclusiveLeft: true,
+ inclusiveRight: true,
+ replacedWith: widget,
+ clearOnEnter: true
+ });
+ function clear() {
+ mark.clear();
+ cm.removeLineClass(from, "wrap", "CodeMirror-merge-collapsed-line");
+ }
+ if (mark.explicitlyCleared) clear();
+ CodeMirror.on(widget, "click", clear);
+ mark.on("clear", clear);
+ CodeMirror.on(widget, "click", clear);
+ return {mark: mark, clear: clear};
+ }
+
+ function collapseStretch(size, editors) {
+ var marks = [];
+ function clear() {
+ for (var i = 0; i < marks.length; i++) marks[i].clear();
+ }
+ for (var i = 0; i < editors.length; i++) {
+ var editor = editors[i];
+ var mark = collapseSingle(editor.cm, editor.line, editor.line + size);
+ marks.push(mark);
+ mark.mark.on("clear", clear);
+ }
+ return marks[0].mark;
+ }
+
+ function unclearNearChunks(dv, margin, off, clear) {
+ for (var i = 0; i < dv.chunks.length; i++) {
+ var chunk = dv.chunks[i];
+ for (var l = chunk.editFrom - margin; l < chunk.editTo + margin; l++) {
+ var pos = l + off;
+ if (pos >= 0 && pos < clear.length) clear[pos] = false;
+ }
+ }
+ }
+
+ function collapseIdenticalStretches(mv, margin) {
+ if (typeof margin != "number") margin = 2;
+ var clear = [], edit = mv.editor(), off = edit.firstLine();
+ for (var l = off, e = edit.lastLine(); l <= e; l++) clear.push(true);
+ if (mv.left) unclearNearChunks(mv.left, margin, off, clear);
+ if (mv.right) unclearNearChunks(mv.right, margin, off, clear);
+
+ for (var i = 0; i < clear.length; i++) {
+ if (clear[i]) {
+ var line = i + off;
+ for (var size = 1; i < clear.length - 1 && clear[i + 1]; i++, size++) {}
+ if (size > margin) {
+ var editors = [{line: line, cm: edit}];
+ if (mv.left) editors.push({line: getMatchingOrigLine(line, mv.left.chunks), cm: mv.left.orig});
+ if (mv.right) editors.push({line: getMatchingOrigLine(line, mv.right.chunks), cm: mv.right.orig});
+ var mark = collapseStretch(size, editors);
+ if (mv.options.onCollapse) mv.options.onCollapse(mv, line, size, mark);
+ }
+ }
+ }
+ }
+
+ // General utilities
+
+ function elt(tag, content, className, style) {
+ var e = document.createElement(tag);
+ if (className) e.className = className;
+ if (style) e.style.cssText = style;
+ if (typeof content == "string") e.appendChild(document.createTextNode(content));
+ else if (content) for (var i = 0; i < content.length; ++i) e.appendChild(content[i]);
+ return e;
+ }
+
+ function clear(node) {
+ for (var count = node.childNodes.length; count > 0; --count)
+ node.removeChild(node.firstChild);
+ }
+
+ function attrs(elt) {
+ for (var i = 1; i < arguments.length; i += 2)
+ elt.setAttribute(arguments[i], arguments[i+1]);
+ }
+
+ function copyObj(obj, target) {
+ if (!target) target = {};
+ for (var prop in obj) if (obj.hasOwnProperty(prop)) target[prop] = obj[prop];
+ return target;
+ }
+
+ function moveOver(pos, str, copy, other) {
+ var out = copy ? Pos(pos.line, pos.ch) : pos, at = 0;
+ for (;;) {
+ var nl = str.indexOf("\n", at);
+ if (nl == -1) break;
+ ++out.line;
+ if (other) ++other.line;
+ at = nl + 1;
+ }
+ out.ch = (at ? 0 : out.ch) + (str.length - at);
+ if (other) other.ch = (at ? 0 : other.ch) + (str.length - at);
+ return out;
+ }
+
+ // Tracks collapsed markers and line widgets, in order to be able to
+ // accurately align the content of two editors.
+
+ var F_WIDGET = 1, F_WIDGET_BELOW = 2, F_MARKER = 4
+
+ function TrackAlignable(cm) {
+ this.cm = cm
+ this.alignable = []
+ this.height = cm.doc.height
+ var self = this
+ cm.on("markerAdded", function(_, marker) {
+ if (!marker.collapsed) return
+ var found = marker.find(1)
+ if (found != null) self.set(found.line, F_MARKER)
+ })
+ cm.on("markerCleared", function(_, marker, _min, max) {
+ if (max != null && marker.collapsed)
+ self.check(max, F_MARKER, self.hasMarker)
+ })
+ cm.on("markerChanged", this.signal.bind(this))
+ cm.on("lineWidgetAdded", function(_, widget, lineNo) {
+ if (widget.mergeSpacer) return
+ if (widget.above) self.set(lineNo - 1, F_WIDGET_BELOW)
+ else self.set(lineNo, F_WIDGET)
+ })
+ cm.on("lineWidgetCleared", function(_, widget, lineNo) {
+ if (widget.mergeSpacer) return
+ if (widget.above) self.check(lineNo - 1, F_WIDGET_BELOW, self.hasWidgetBelow)
+ else self.check(lineNo, F_WIDGET, self.hasWidget)
+ })
+ cm.on("lineWidgetChanged", this.signal.bind(this))
+ cm.on("change", function(_, change) {
+ var start = change.from.line, nBefore = change.to.line - change.from.line
+ var nAfter = change.text.length - 1, end = start + nAfter
+ if (nBefore || nAfter) self.map(start, nBefore, nAfter)
+ self.check(end, F_MARKER, self.hasMarker)
+ if (nBefore || nAfter) self.check(change.from.line, F_MARKER, self.hasMarker)
+ })
+ cm.on("viewportChange", function() {
+ if (self.cm.doc.height != self.height) self.signal()
+ })
+ }
+
+ TrackAlignable.prototype = {
+ signal: function() {
+ CodeMirror.signal(this, "realign")
+ this.height = this.cm.doc.height
+ },
+
+ set: function(n, flags) {
+ var pos = -1
+ for (; pos < this.alignable.length; pos += 2) {
+ var diff = this.alignable[pos] - n
+ if (diff == 0) {
+ if ((this.alignable[pos + 1] & flags) == flags) return
+ this.alignable[pos + 1] |= flags
+ this.signal()
+ return
+ }
+ if (diff > 0) break
+ }
+ this.signal()
+ this.alignable.splice(pos, 0, n, flags)
+ },
+
+ find: function(n) {
+ for (var i = 0; i < this.alignable.length; i += 2)
+ if (this.alignable[i] == n) return i
+ return -1
+ },
+
+ check: function(n, flag, pred) {
+ var found = this.find(n)
+ if (found == -1 || !(this.alignable[found + 1] & flag)) return
+ if (!pred.call(this, n)) {
+ this.signal()
+ var flags = this.alignable[found + 1] & ~flag
+ if (flags) this.alignable[found + 1] = flags
+ else this.alignable.splice(found, 2)
+ }
+ },
+
+ hasMarker: function(n) {
+ var handle = this.cm.getLineHandle(n)
+ if (handle.markedSpans) for (var i = 0; i < handle.markedSpans.length; i++)
+ if (handle.markedSpans[i].marker.collapsed && handle.markedSpans[i].to != null)
+ return true
+ return false
+ },
+
+ hasWidget: function(n) {
+ var handle = this.cm.getLineHandle(n)
+ if (handle.widgets) for (var i = 0; i < handle.widgets.length; i++)
+ if (!handle.widgets[i].above && !handle.widgets[i].mergeSpacer) return true
+ return false
+ },
+
+ hasWidgetBelow: function(n) {
+ if (n == this.cm.lastLine()) return false
+ var handle = this.cm.getLineHandle(n + 1)
+ if (handle.widgets) for (var i = 0; i < handle.widgets.length; i++)
+ if (handle.widgets[i].above && !handle.widgets[i].mergeSpacer) return true
+ return false
+ },
+
+ map: function(from, nBefore, nAfter) {
+ var diff = nAfter - nBefore, to = from + nBefore, widgetFrom = -1, widgetTo = -1
+ for (var i = 0; i < this.alignable.length; i += 2) {
+ var n = this.alignable[i]
+ if (n == from && (this.alignable[i + 1] & F_WIDGET_BELOW)) widgetFrom = i
+ if (n == to && (this.alignable[i + 1] & F_WIDGET_BELOW)) widgetTo = i
+ if (n <= from) continue
+ else if (n < to) this.alignable.splice(i--, 2)
+ else this.alignable[i] += diff
+ }
+ if (widgetFrom > -1) {
+ var flags = this.alignable[widgetFrom + 1]
+ if (flags == F_WIDGET_BELOW) this.alignable.splice(widgetFrom, 2)
+ else this.alignable[widgetFrom + 1] = flags & ~F_WIDGET_BELOW
+ }
+ if (widgetTo > -1 && nAfter)
+ this.set(from + nAfter, F_WIDGET_BELOW)
+ }
+ }
+
+ function posMin(a, b) { return (a.line - b.line || a.ch - b.ch) < 0 ? a : b; }
+ function posMax(a, b) { return (a.line - b.line || a.ch - b.ch) > 0 ? a : b; }
+ function posEq(a, b) { return a.line == b.line && a.ch == b.ch; }
+
+ function findPrevDiff(chunks, start, isOrig) {
+ for (var i = chunks.length - 1; i >= 0; i--) {
+ var chunk = chunks[i];
+ var to = (isOrig ? chunk.origTo : chunk.editTo) - 1;
+ if (to < start) return to;
+ }
+ }
+
+ function findNextDiff(chunks, start, isOrig) {
+ for (var i = 0; i < chunks.length; i++) {
+ var chunk = chunks[i];
+ var from = (isOrig ? chunk.origFrom : chunk.editFrom);
+ if (from > start) return from;
+ }
+ }
+
+ function goNearbyDiff(cm, dir) {
+ var found = null, views = cm.state.diffViews, line = cm.getCursor().line;
+ if (views) for (var i = 0; i < views.length; i++) {
+ var dv = views[i], isOrig = cm == dv.orig;
+ ensureDiff(dv);
+ var pos = dir < 0 ? findPrevDiff(dv.chunks, line, isOrig) : findNextDiff(dv.chunks, line, isOrig);
+ if (pos != null && (found == null || (dir < 0 ? pos > found : pos < found)))
+ found = pos;
+ }
+ if (found != null)
+ cm.setCursor(found, 0);
+ else
+ return CodeMirror.Pass;
+ }
+
+ CodeMirror.commands.goNextDiff = function(cm) {
+ return goNearbyDiff(cm, 1);
+ };
+ CodeMirror.commands.goPrevDiff = function(cm) {
+ return goNearbyDiff(cm, -1);
+ };
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/mode/index.php b/modules/cookiesplus/lib/CodeMirror/addon/mode/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/mode/index.php
@@ -0,0 +1,32 @@
+ -1 ? found + pattern.length : found;
+ }
+ var m = pattern.exec(from ? string.slice(from) : string);
+ return m ? m.index + from + (returnEnd ? m[0].length : 0) : -1;
+ }
+
+ return {
+ startState: function() {
+ return {
+ outer: CodeMirror.startState(outer),
+ innerActive: null,
+ inner: null
+ };
+ },
+
+ copyState: function(state) {
+ return {
+ outer: CodeMirror.copyState(outer, state.outer),
+ innerActive: state.innerActive,
+ inner: state.innerActive && CodeMirror.copyState(state.innerActive.mode, state.inner)
+ };
+ },
+
+ token: function(stream, state) {
+ if (!state.innerActive) {
+ var cutOff = Infinity, oldContent = stream.string;
+ for (var i = 0; i < others.length; ++i) {
+ var other = others[i];
+ var found = indexOf(oldContent, other.open, stream.pos);
+ if (found == stream.pos) {
+ if (!other.parseDelimiters) stream.match(other.open);
+ state.innerActive = other;
+
+ // Get the outer indent, making sure to handle CodeMirror.Pass
+ var outerIndent = 0;
+ if (outer.indent) {
+ var possibleOuterIndent = outer.indent(state.outer, "", "");
+ if (possibleOuterIndent !== CodeMirror.Pass) outerIndent = possibleOuterIndent;
+ }
+
+ state.inner = CodeMirror.startState(other.mode, outerIndent);
+ return other.delimStyle && (other.delimStyle + " " + other.delimStyle + "-open");
+ } else if (found != -1 && found < cutOff) {
+ cutOff = found;
+ }
+ }
+ if (cutOff != Infinity) stream.string = oldContent.slice(0, cutOff);
+ var outerToken = outer.token(stream, state.outer);
+ if (cutOff != Infinity) stream.string = oldContent;
+ return outerToken;
+ } else {
+ var curInner = state.innerActive, oldContent = stream.string;
+ if (!curInner.close && stream.sol()) {
+ state.innerActive = state.inner = null;
+ return this.token(stream, state);
+ }
+ var found = curInner.close ? indexOf(oldContent, curInner.close, stream.pos, curInner.parseDelimiters) : -1;
+ if (found == stream.pos && !curInner.parseDelimiters) {
+ stream.match(curInner.close);
+ state.innerActive = state.inner = null;
+ return curInner.delimStyle && (curInner.delimStyle + " " + curInner.delimStyle + "-close");
+ }
+ if (found > -1) stream.string = oldContent.slice(0, found);
+ var innerToken = curInner.mode.token(stream, state.inner);
+ if (found > -1) stream.string = oldContent;
+
+ if (found == stream.pos && curInner.parseDelimiters)
+ state.innerActive = state.inner = null;
+
+ if (curInner.innerStyle) {
+ if (innerToken) innerToken = innerToken + " " + curInner.innerStyle;
+ else innerToken = curInner.innerStyle;
+ }
+
+ return innerToken;
+ }
+ },
+
+ indent: function(state, textAfter, line) {
+ var mode = state.innerActive ? state.innerActive.mode : outer;
+ if (!mode.indent) return CodeMirror.Pass;
+ return mode.indent(state.innerActive ? state.inner : state.outer, textAfter, line);
+ },
+
+ blankLine: function(state) {
+ var mode = state.innerActive ? state.innerActive.mode : outer;
+ if (mode.blankLine) {
+ mode.blankLine(state.innerActive ? state.inner : state.outer);
+ }
+ if (!state.innerActive) {
+ for (var i = 0; i < others.length; ++i) {
+ var other = others[i];
+ if (other.open === "\n") {
+ state.innerActive = other;
+ state.inner = CodeMirror.startState(other.mode, mode.indent ? mode.indent(state.outer, "", "") : 0);
+ }
+ }
+ } else if (state.innerActive.close === "\n") {
+ state.innerActive = state.inner = null;
+ }
+ },
+
+ electricChars: outer.electricChars,
+
+ innerMode: function(state) {
+ return state.inner ? {state: state.inner, mode: state.innerActive.mode} : {state: state.outer, mode: outer};
+ }
+ };
+};
+
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/mode/multiplex_test.js b/modules/cookiesplus/lib/CodeMirror/addon/mode/multiplex_test.js
new file mode 100644
index 00000000..16a31ded
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/mode/multiplex_test.js
@@ -0,0 +1,53 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function() {
+ CodeMirror.defineMode("markdown_with_stex", function(){
+ var inner = CodeMirror.getMode({}, "stex");
+ var outer = CodeMirror.getMode({}, "markdown");
+
+ var innerOptions = {
+ open: '$',
+ close: '$',
+ mode: inner,
+ delimStyle: 'delim',
+ innerStyle: 'inner'
+ };
+
+ return CodeMirror.multiplexingMode(outer, innerOptions);
+ });
+
+ var mode = CodeMirror.getMode({}, "markdown_with_stex");
+
+ function MT(name) {
+ test.mode(
+ name,
+ mode,
+ Array.prototype.slice.call(arguments, 1),
+ 'multiplexing');
+ }
+
+ MT(
+ "stexInsideMarkdown",
+ "[strong **Equation:**] [delim&delim-open $][inner&tag \\pi][delim&delim-close $]");
+})();
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/mode/overlay.js b/modules/cookiesplus/lib/CodeMirror/addon/mode/overlay.js
new file mode 100644
index 00000000..c0cc7564
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/mode/overlay.js
@@ -0,0 +1,110 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+// Utility function that allows modes to be combined. The mode given
+// as the base argument takes care of most of the normal mode
+// functionality, but a second (typically simple) mode is used, which
+// can override the style of text. Both modes get to parse all of the
+// text, but when both assign a non-null style to a piece of code, the
+// overlay wins, unless the combine argument was true and not overridden,
+// or state.overlay.combineTokens was true, in which case the styles are
+// combined.
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+"use strict";
+
+CodeMirror.overlayMode = function(base, overlay, combine) {
+ return {
+ startState: function() {
+ return {
+ base: CodeMirror.startState(base),
+ overlay: CodeMirror.startState(overlay),
+ basePos: 0, baseCur: null,
+ overlayPos: 0, overlayCur: null,
+ streamSeen: null
+ };
+ },
+ copyState: function(state) {
+ return {
+ base: CodeMirror.copyState(base, state.base),
+ overlay: CodeMirror.copyState(overlay, state.overlay),
+ basePos: state.basePos, baseCur: null,
+ overlayPos: state.overlayPos, overlayCur: null
+ };
+ },
+
+ token: function(stream, state) {
+ if (stream != state.streamSeen ||
+ Math.min(state.basePos, state.overlayPos) < stream.start) {
+ state.streamSeen = stream;
+ state.basePos = state.overlayPos = stream.start;
+ }
+
+ if (stream.start == state.basePos) {
+ state.baseCur = base.token(stream, state.base);
+ state.basePos = stream.pos;
+ }
+ if (stream.start == state.overlayPos) {
+ stream.pos = stream.start;
+ state.overlayCur = overlay.token(stream, state.overlay);
+ state.overlayPos = stream.pos;
+ }
+ stream.pos = Math.min(state.basePos, state.overlayPos);
+
+ // state.overlay.combineTokens always takes precedence over combine,
+ // unless set to null
+ if (state.overlayCur == null) return state.baseCur;
+ else if (state.baseCur != null &&
+ state.overlay.combineTokens ||
+ combine && state.overlay.combineTokens == null)
+ return state.baseCur + " " + state.overlayCur;
+ else return state.overlayCur;
+ },
+
+ indent: base.indent && function(state, textAfter, line) {
+ return base.indent(state.base, textAfter, line);
+ },
+ electricChars: base.electricChars,
+
+ innerMode: function(state) { return {state: state.base, mode: base}; },
+
+ blankLine: function(state) {
+ var baseToken, overlayToken;
+ if (base.blankLine) baseToken = base.blankLine(state.base);
+ if (overlay.blankLine) overlayToken = overlay.blankLine(state.overlay);
+
+ return overlayToken == null ?
+ baseToken :
+ (combine && baseToken != null ? baseToken + " " + overlayToken : overlayToken);
+ }
+ };
+};
+
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/mode/simple.js b/modules/cookiesplus/lib/CodeMirror/addon/mode/simple.js
new file mode 100644
index 00000000..93e28f64
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/mode/simple.js
@@ -0,0 +1,236 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ CodeMirror.defineSimpleMode = function(name, states) {
+ CodeMirror.defineMode(name, function(config) {
+ return CodeMirror.simpleMode(config, states);
+ });
+ };
+
+ CodeMirror.simpleMode = function(config, states) {
+ ensureState(states, "start");
+ var states_ = {}, meta = states.meta || {}, hasIndentation = false;
+ for (var state in states) if (state != meta && states.hasOwnProperty(state)) {
+ var list = states_[state] = [], orig = states[state];
+ for (var i = 0; i < orig.length; i++) {
+ var data = orig[i];
+ list.push(new Rule(data, states));
+ if (data.indent || data.dedent) hasIndentation = true;
+ }
+ }
+ var mode = {
+ startState: function() {
+ return {state: "start", pending: null,
+ local: null, localState: null,
+ indent: hasIndentation ? [] : null};
+ },
+ copyState: function(state) {
+ var s = {state: state.state, pending: state.pending,
+ local: state.local, localState: null,
+ indent: state.indent && state.indent.slice(0)};
+ if (state.localState)
+ s.localState = CodeMirror.copyState(state.local.mode, state.localState);
+ if (state.stack)
+ s.stack = state.stack.slice(0);
+ for (var pers = state.persistentStates; pers; pers = pers.next)
+ s.persistentStates = {mode: pers.mode,
+ spec: pers.spec,
+ state: pers.state == state.localState ? s.localState : CodeMirror.copyState(pers.mode, pers.state),
+ next: s.persistentStates};
+ return s;
+ },
+ token: tokenFunction(states_, config),
+ innerMode: function(state) { return state.local && {mode: state.local.mode, state: state.localState}; },
+ indent: indentFunction(states_, meta)
+ };
+ if (meta) for (var prop in meta) if (meta.hasOwnProperty(prop))
+ mode[prop] = meta[prop];
+ return mode;
+ };
+
+ function ensureState(states, name) {
+ if (!states.hasOwnProperty(name))
+ throw new Error("Undefined state " + name + " in simple mode");
+ }
+
+ function toRegex(val, caret) {
+ if (!val) return /(?:)/;
+ var flags = "";
+ if (val instanceof RegExp) {
+ if (val.ignoreCase) flags = "i";
+ val = val.source;
+ } else {
+ val = String(val);
+ }
+ return new RegExp((caret === false ? "" : "^") + "(?:" + val + ")", flags);
+ }
+
+ function asToken(val) {
+ if (!val) return null;
+ if (val.apply) return val
+ if (typeof val == "string") return val.replace(/\./g, " ");
+ var result = [];
+ for (var i = 0; i < val.length; i++)
+ result.push(val[i] && val[i].replace(/\./g, " "));
+ return result;
+ }
+
+ function Rule(data, states) {
+ if (data.next || data.push) ensureState(states, data.next || data.push);
+ this.regex = toRegex(data.regex);
+ this.token = asToken(data.token);
+ this.data = data;
+ }
+
+ function tokenFunction(states, config) {
+ return function(stream, state) {
+ if (state.pending) {
+ var pend = state.pending.shift();
+ if (state.pending.length == 0) state.pending = null;
+ stream.pos += pend.text.length;
+ return pend.token;
+ }
+
+ if (state.local) {
+ if (state.local.end && stream.match(state.local.end)) {
+ var tok = state.local.endToken || null;
+ state.local = state.localState = null;
+ return tok;
+ } else {
+ var tok = state.local.mode.token(stream, state.localState), m;
+ if (state.local.endScan && (m = state.local.endScan.exec(stream.current())))
+ stream.pos = stream.start + m.index;
+ return tok;
+ }
+ }
+
+ var curState = states[state.state];
+ for (var i = 0; i < curState.length; i++) {
+ var rule = curState[i];
+ var matches = (!rule.data.sol || stream.sol()) && stream.match(rule.regex);
+ if (matches) {
+ if (rule.data.next) {
+ state.state = rule.data.next;
+ } else if (rule.data.push) {
+ (state.stack || (state.stack = [])).push(state.state);
+ state.state = rule.data.push;
+ } else if (rule.data.pop && state.stack && state.stack.length) {
+ state.state = state.stack.pop();
+ }
+
+ if (rule.data.mode)
+ enterLocalMode(config, state, rule.data.mode, rule.token);
+ if (rule.data.indent)
+ state.indent.push(stream.indentation() + config.indentUnit);
+ if (rule.data.dedent)
+ state.indent.pop();
+ var token = rule.token
+ if (token && token.apply) token = token(matches)
+ if (matches.length > 2 && rule.token && typeof rule.token != "string") {
+ state.pending = [];
+ for (var j = 2; j < matches.length; j++)
+ if (matches[j])
+ state.pending.push({text: matches[j], token: rule.token[j - 1]});
+ stream.backUp(matches[0].length - (matches[1] ? matches[1].length : 0));
+ return token[0];
+ } else if (token && token.join) {
+ return token[0];
+ } else {
+ return token;
+ }
+ }
+ }
+ stream.next();
+ return null;
+ };
+ }
+
+ function cmp(a, b) {
+ if (a === b) return true;
+ if (!a || typeof a != "object" || !b || typeof b != "object") return false;
+ var props = 0;
+ for (var prop in a) if (a.hasOwnProperty(prop)) {
+ if (!b.hasOwnProperty(prop) || !cmp(a[prop], b[prop])) return false;
+ props++;
+ }
+ for (var prop in b) if (b.hasOwnProperty(prop)) props--;
+ return props == 0;
+ }
+
+ function enterLocalMode(config, state, spec, token) {
+ var pers;
+ if (spec.persistent) for (var p = state.persistentStates; p && !pers; p = p.next)
+ if (spec.spec ? cmp(spec.spec, p.spec) : spec.mode == p.mode) pers = p;
+ var mode = pers ? pers.mode : spec.mode || CodeMirror.getMode(config, spec.spec);
+ var lState = pers ? pers.state : CodeMirror.startState(mode);
+ if (spec.persistent && !pers)
+ state.persistentStates = {mode: mode, spec: spec.spec, state: lState, next: state.persistentStates};
+
+ state.localState = lState;
+ state.local = {mode: mode,
+ end: spec.end && toRegex(spec.end),
+ endScan: spec.end && spec.forceEnd !== false && toRegex(spec.end, false),
+ endToken: token && token.join ? token[token.length - 1] : token};
+ }
+
+ function indexOf(val, arr) {
+ for (var i = 0; i < arr.length; i++) if (arr[i] === val) return true;
+ }
+
+ function indentFunction(states, meta) {
+ return function(state, textAfter, line) {
+ if (state.local && state.local.mode.indent)
+ return state.local.mode.indent(state.localState, textAfter, line);
+ if (state.indent == null || state.local || meta.dontIndentStates && indexOf(state.state, meta.dontIndentStates) > -1)
+ return CodeMirror.Pass;
+
+ var pos = state.indent.length - 1, rules = states[state.state];
+ scan: for (;;) {
+ for (var i = 0; i < rules.length; i++) {
+ var rule = rules[i];
+ if (rule.data.dedent && rule.data.dedentIfLineStart !== false) {
+ var m = rule.regex.exec(textAfter);
+ if (m && m[0]) {
+ pos--;
+ if (rule.next || rule.push) rules = states[rule.next || rule.push];
+ textAfter = textAfter.slice(m[0].length);
+ continue scan;
+ }
+ }
+ }
+ break;
+ }
+ return pos < 0 ? 0 : state.indent[pos];
+ };
+ }
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/runmode/colorize.js b/modules/cookiesplus/lib/CodeMirror/addon/runmode/colorize.js
new file mode 100644
index 00000000..b857e111
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/runmode/colorize.js
@@ -0,0 +1,60 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"), require("./runmode"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror", "./runmode"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ var isBlock = /^(p|li|div|h\\d|pre|blockquote|td)$/;
+
+ function textContent(node, out) {
+ if (node.nodeType == 3) return out.push(node.nodeValue);
+ for (var ch = node.firstChild; ch; ch = ch.nextSibling) {
+ textContent(ch, out);
+ if (isBlock.test(node.nodeType)) out.push("\n");
+ }
+ }
+
+ CodeMirror.colorize = function(collection, defaultMode) {
+ if (!collection) collection = document.body.getElementsByTagName("pre");
+
+ for (var i = 0; i < collection.length; ++i) {
+ var node = collection[i];
+ var mode = node.getAttribute("data-lang") || defaultMode;
+ if (!mode) continue;
+
+ var text = [];
+ textContent(node, text);
+ node.innerHTML = "";
+ CodeMirror.runMode(text.join(""), mode, node);
+
+ node.className += " cm-s-default";
+ }
+ };
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/runmode/index.php b/modules/cookiesplus/lib/CodeMirror/addon/runmode/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/runmode/index.php
@@ -0,0 +1,32 @@
+= end)
+ { return n + (end - i) }
+ n += nextTab - i;
+ n += tabSize - (n % tabSize);
+ i = nextTab + 1;
+ }
+ }
+
+ function nothing() {}
+
+ function createObj(base, props) {
+ var inst;
+ if (Object.create) {
+ inst = Object.create(base);
+ } else {
+ nothing.prototype = base;
+ inst = new nothing();
+ }
+ if (props) { copyObj(props, inst); }
+ return inst
+ }
+
+ // STRING STREAM
+
+ // Fed to the mode parsers, provides helper functions to make
+ // parsers more succinct.
+
+ var StringStream = function(string, tabSize, lineOracle) {
+ this.pos = this.start = 0;
+ this.string = string;
+ this.tabSize = tabSize || 8;
+ this.lastColumnPos = this.lastColumnValue = 0;
+ this.lineStart = 0;
+ this.lineOracle = lineOracle;
+ };
+
+ StringStream.prototype.eol = function () {return this.pos >= this.string.length};
+ StringStream.prototype.sol = function () {return this.pos == this.lineStart};
+ StringStream.prototype.peek = function () {return this.string.charAt(this.pos) || undefined};
+ StringStream.prototype.next = function () {
+ if (this.pos < this.string.length)
+ { return this.string.charAt(this.pos++) }
+ };
+ StringStream.prototype.eat = function (match) {
+ var ch = this.string.charAt(this.pos);
+ var ok;
+ if (typeof match == "string") { ok = ch == match; }
+ else { ok = ch && (match.test ? match.test(ch) : match(ch)); }
+ if (ok) {++this.pos; return ch}
+ };
+ StringStream.prototype.eatWhile = function (match) {
+ var start = this.pos;
+ while (this.eat(match)){}
+ return this.pos > start
+ };
+ StringStream.prototype.eatSpace = function () {
+ var start = this.pos;
+ while (/[\s\u00a0]/.test(this.string.charAt(this.pos))) { ++this.pos; }
+ return this.pos > start
+ };
+ StringStream.prototype.skipToEnd = function () {this.pos = this.string.length;};
+ StringStream.prototype.skipTo = function (ch) {
+ var found = this.string.indexOf(ch, this.pos);
+ if (found > -1) {this.pos = found; return true}
+ };
+ StringStream.prototype.backUp = function (n) {this.pos -= n;};
+ StringStream.prototype.column = function () {
+ if (this.lastColumnPos < this.start) {
+ this.lastColumnValue = countColumn(this.string, this.start, this.tabSize, this.lastColumnPos, this.lastColumnValue);
+ this.lastColumnPos = this.start;
+ }
+ return this.lastColumnValue - (this.lineStart ? countColumn(this.string, this.lineStart, this.tabSize) : 0)
+ };
+ StringStream.prototype.indentation = function () {
+ return countColumn(this.string, null, this.tabSize) -
+ (this.lineStart ? countColumn(this.string, this.lineStart, this.tabSize) : 0)
+ };
+ StringStream.prototype.match = function (pattern, consume, caseInsensitive) {
+ if (typeof pattern == "string") {
+ var cased = function (str) { return caseInsensitive ? str.toLowerCase() : str; };
+ var substr = this.string.substr(this.pos, pattern.length);
+ if (cased(substr) == cased(pattern)) {
+ if (consume !== false) { this.pos += pattern.length; }
+ return true
+ }
+ } else {
+ var match = this.string.slice(this.pos).match(pattern);
+ if (match && match.index > 0) { return null }
+ if (match && consume !== false) { this.pos += match[0].length; }
+ return match
+ }
+ };
+ StringStream.prototype.current = function (){return this.string.slice(this.start, this.pos)};
+ StringStream.prototype.hideFirstChars = function (n, inner) {
+ this.lineStart += n;
+ try { return inner() }
+ finally { this.lineStart -= n; }
+ };
+ StringStream.prototype.lookAhead = function (n) {
+ var oracle = this.lineOracle;
+ return oracle && oracle.lookAhead(n)
+ };
+ StringStream.prototype.baseToken = function () {
+ var oracle = this.lineOracle;
+ return oracle && oracle.baseToken(this.pos)
+ };
+
+ // Known modes, by name and by MIME
+ var modes = {}, mimeModes = {};
+
+ // Extra arguments are stored as the mode's dependencies, which is
+ // used by (legacy) mechanisms like loadmode.js to automatically
+ // load a mode. (Preferred mechanism is the require/define calls.)
+ function defineMode(name, mode) {
+ if (arguments.length > 2)
+ { mode.dependencies = Array.prototype.slice.call(arguments, 2); }
+ modes[name] = mode;
+ }
+
+ function defineMIME(mime, spec) {
+ mimeModes[mime] = spec;
+ }
+
+ // Given a MIME type, a {name, ...options} config object, or a name
+ // string, return a mode config object.
+ function resolveMode(spec) {
+ if (typeof spec == "string" && mimeModes.hasOwnProperty(spec)) {
+ spec = mimeModes[spec];
+ } else if (spec && typeof spec.name == "string" && mimeModes.hasOwnProperty(spec.name)) {
+ var found = mimeModes[spec.name];
+ if (typeof found == "string") { found = {name: found}; }
+ spec = createObj(found, spec);
+ spec.name = found.name;
+ } else if (typeof spec == "string" && /^[\w\-]+\/[\w\-]+\+xml$/.test(spec)) {
+ return resolveMode("application/xml")
+ } else if (typeof spec == "string" && /^[\w\-]+\/[\w\-]+\+json$/.test(spec)) {
+ return resolveMode("application/json")
+ }
+ if (typeof spec == "string") { return {name: spec} }
+ else { return spec || {name: "null"} }
+ }
+
+ // Given a mode spec (anything that resolveMode accepts), find and
+ // initialize an actual mode object.
+ function getMode(options, spec) {
+ spec = resolveMode(spec);
+ var mfactory = modes[spec.name];
+ if (!mfactory) { return getMode(options, "text/plain") }
+ var modeObj = mfactory(options, spec);
+ if (modeExtensions.hasOwnProperty(spec.name)) {
+ var exts = modeExtensions[spec.name];
+ for (var prop in exts) {
+ if (!exts.hasOwnProperty(prop)) { continue }
+ if (modeObj.hasOwnProperty(prop)) { modeObj["_" + prop] = modeObj[prop]; }
+ modeObj[prop] = exts[prop];
+ }
+ }
+ modeObj.name = spec.name;
+ if (spec.helperType) { modeObj.helperType = spec.helperType; }
+ if (spec.modeProps) { for (var prop$1 in spec.modeProps)
+ { modeObj[prop$1] = spec.modeProps[prop$1]; } }
+
+ return modeObj
+ }
+
+ // This can be used to attach properties to mode objects from
+ // outside the actual mode definition.
+ var modeExtensions = {};
+ function extendMode(mode, properties) {
+ var exts = modeExtensions.hasOwnProperty(mode) ? modeExtensions[mode] : (modeExtensions[mode] = {});
+ copyObj(properties, exts);
+ }
+
+ function copyState(mode, state) {
+ if (state === true) { return state }
+ if (mode.copyState) { return mode.copyState(state) }
+ var nstate = {};
+ for (var n in state) {
+ var val = state[n];
+ if (val instanceof Array) { val = val.concat([]); }
+ nstate[n] = val;
+ }
+ return nstate
+ }
+
+ // Given a mode and a state (for that mode), find the inner mode and
+ // state at the position that the state refers to.
+ function innerMode(mode, state) {
+ var info;
+ while (mode.innerMode) {
+ info = mode.innerMode(state);
+ if (!info || info.mode == mode) { break }
+ state = info.state;
+ mode = info.mode;
+ }
+ return info || {mode: mode, state: state}
+ }
+
+ function startState(mode, a1, a2) {
+ return mode.startState ? mode.startState(a1, a2) : true
+ }
+
+ var modeMethods = {
+ __proto__: null,
+ modes: modes,
+ mimeModes: mimeModes,
+ defineMode: defineMode,
+ defineMIME: defineMIME,
+ resolveMode: resolveMode,
+ getMode: getMode,
+ modeExtensions: modeExtensions,
+ extendMode: extendMode,
+ copyState: copyState,
+ innerMode: innerMode,
+ startState: startState
+ };
+
+ // declare global: globalThis, CodeMirror
+
+ // Create a minimal CodeMirror needed to use runMode, and assign to root.
+ var root = typeof globalThis !== 'undefined' ? globalThis : window;
+ root.CodeMirror = {};
+
+ // Copy StringStream and mode methods into CodeMirror object.
+ CodeMirror.StringStream = StringStream;
+ for (var exported in modeMethods) { CodeMirror[exported] = modeMethods[exported]; }
+
+ // Minimal default mode.
+ CodeMirror.defineMode("null", function () { return ({token: function (stream) { return stream.skipToEnd(); }}); });
+ CodeMirror.defineMIME("text/plain", "null");
+
+ CodeMirror.registerHelper = CodeMirror.registerGlobalHelper = Math.min;
+ CodeMirror.splitLines = function(string) { return string.split(/\r?\n|\r/) };
+
+ CodeMirror.defaults = { indentUnit: 2 };
+
+ // CodeMirror, copyright (c) by Marijn Haverbeke and others
+ // Distributed under an MIT license: https://codemirror.net/LICENSE
+
+ (function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ { mod(require("../../lib/codemirror")); }
+ else if (typeof define == "function" && define.amd) // AMD
+ { define(["../../lib/codemirror"], mod); }
+ else // Plain browser env
+ { mod(CodeMirror); }
+ })(function(CodeMirror) {
+
+ CodeMirror.runMode = function(string, modespec, callback, options) {
+ var mode = CodeMirror.getMode(CodeMirror.defaults, modespec);
+ var tabSize = (options && options.tabSize) || CodeMirror.defaults.tabSize;
+
+ // Create a tokenizing callback function if passed-in callback is a DOM element.
+ if (callback.appendChild) {
+ var ie = /MSIE \d/.test(navigator.userAgent);
+ var ie_lt9 = ie && (document.documentMode == null || document.documentMode < 9);
+ var node = callback, col = 0;
+ node.innerHTML = "";
+ callback = function(text, style) {
+ if (text == "\n") {
+ // Emitting LF or CRLF on IE8 or earlier results in an incorrect display.
+ // Emitting a carriage return makes everything ok.
+ node.appendChild(document.createTextNode(ie_lt9 ? '\r' : text));
+ col = 0;
+ return;
+ }
+ var content = "";
+ // replace tabs
+ for (var pos = 0;;) {
+ var idx = text.indexOf("\t", pos);
+ if (idx == -1) {
+ content += text.slice(pos);
+ col += text.length - pos;
+ break;
+ } else {
+ col += idx - pos;
+ content += text.slice(pos, idx);
+ var size = tabSize - col % tabSize;
+ col += size;
+ for (var i = 0; i < size; ++i) { content += " "; }
+ pos = idx + 1;
+ }
+ }
+ // Create a node with token style and append it to the callback DOM element.
+ if (style) {
+ var sp = node.appendChild(document.createElement("span"));
+ sp.className = "cm-" + style.replace(/ +/g, " cm-");
+ sp.appendChild(document.createTextNode(content));
+ } else {
+ node.appendChild(document.createTextNode(content));
+ }
+ };
+ }
+
+ var lines = CodeMirror.splitLines(string), state = (options && options.state) || CodeMirror.startState(mode);
+ for (var i = 0, e = lines.length; i < e; ++i) {
+ if (i) { callback("\n"); }
+ var stream = new CodeMirror.StringStream(lines[i], null, {
+ lookAhead: function(n) { return lines[i + n] },
+ baseToken: function() {}
+ });
+ if (!stream.string && mode.blankLine) { mode.blankLine(state); }
+ while (!stream.eol()) {
+ var style = mode.token(stream, state);
+ callback(stream.current(), style, i, stream.start, state);
+ stream.start = stream.pos;
+ }
+ }
+ };
+
+ });
+
+}());
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/runmode/runmode.js b/modules/cookiesplus/lib/CodeMirror/addon/runmode/runmode.js
new file mode 100644
index 00000000..4a55cec9
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/runmode/runmode.js
@@ -0,0 +1,96 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+"use strict";
+
+CodeMirror.runMode = function(string, modespec, callback, options) {
+ var mode = CodeMirror.getMode(CodeMirror.defaults, modespec);
+ var tabSize = (options && options.tabSize) || CodeMirror.defaults.tabSize;
+
+ // Create a tokenizing callback function if passed-in callback is a DOM element.
+ if (callback.appendChild) {
+ var ie = /MSIE \d/.test(navigator.userAgent);
+ var ie_lt9 = ie && (document.documentMode == null || document.documentMode < 9);
+ var node = callback, col = 0;
+ node.innerHTML = "";
+ callback = function(text, style) {
+ if (text == "\n") {
+ // Emitting LF or CRLF on IE8 or earlier results in an incorrect display.
+ // Emitting a carriage return makes everything ok.
+ node.appendChild(document.createTextNode(ie_lt9 ? '\r' : text));
+ col = 0;
+ return;
+ }
+ var content = "";
+ // replace tabs
+ for (var pos = 0;;) {
+ var idx = text.indexOf("\t", pos);
+ if (idx == -1) {
+ content += text.slice(pos);
+ col += text.length - pos;
+ break;
+ } else {
+ col += idx - pos;
+ content += text.slice(pos, idx);
+ var size = tabSize - col % tabSize;
+ col += size;
+ for (var i = 0; i < size; ++i) content += " ";
+ pos = idx + 1;
+ }
+ }
+ // Create a node with token style and append it to the callback DOM element.
+ if (style) {
+ var sp = node.appendChild(document.createElement("span"));
+ sp.className = "cm-" + style.replace(/ +/g, " cm-");
+ sp.appendChild(document.createTextNode(content));
+ } else {
+ node.appendChild(document.createTextNode(content));
+ }
+ };
+ }
+
+ var lines = CodeMirror.splitLines(string), state = (options && options.state) || CodeMirror.startState(mode);
+ for (var i = 0, e = lines.length; i < e; ++i) {
+ if (i) callback("\n");
+ var stream = new CodeMirror.StringStream(lines[i], null, {
+ lookAhead: function(n) { return lines[i + n] },
+ baseToken: function() {}
+ });
+ if (!stream.string && mode.blankLine) mode.blankLine(state);
+ while (!stream.eol()) {
+ var style = mode.token(stream, state);
+ callback(stream.current(), style, i, stream.start, state);
+ stream.start = stream.pos;
+ }
+ }
+};
+
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/runmode/runmode.node.js b/modules/cookiesplus/lib/CodeMirror/addon/runmode/runmode.node.js
new file mode 100644
index 00000000..e1628d33
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/runmode/runmode.node.js
@@ -0,0 +1,352 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+'use strict';
+
+function copyObj(obj, target, overwrite) {
+ if (!target) { target = {}; }
+ for (var prop in obj)
+ { if (obj.hasOwnProperty(prop) && (overwrite !== false || !target.hasOwnProperty(prop)))
+ { target[prop] = obj[prop]; } }
+ return target
+}
+
+// Counts the column offset in a string, taking tabs into account.
+// Used mostly to find indentation.
+function countColumn(string, end, tabSize, startIndex, startValue) {
+ if (end == null) {
+ end = string.search(/[^\s\u00a0]/);
+ if (end == -1) { end = string.length; }
+ }
+ for (var i = startIndex || 0, n = startValue || 0;;) {
+ var nextTab = string.indexOf("\t", i);
+ if (nextTab < 0 || nextTab >= end)
+ { return n + (end - i) }
+ n += nextTab - i;
+ n += tabSize - (n % tabSize);
+ i = nextTab + 1;
+ }
+}
+
+function nothing() {}
+
+function createObj(base, props) {
+ var inst;
+ if (Object.create) {
+ inst = Object.create(base);
+ } else {
+ nothing.prototype = base;
+ inst = new nothing();
+ }
+ if (props) { copyObj(props, inst); }
+ return inst
+}
+
+// STRING STREAM
+
+// Fed to the mode parsers, provides helper functions to make
+// parsers more succinct.
+
+var StringStream = function(string, tabSize, lineOracle) {
+ this.pos = this.start = 0;
+ this.string = string;
+ this.tabSize = tabSize || 8;
+ this.lastColumnPos = this.lastColumnValue = 0;
+ this.lineStart = 0;
+ this.lineOracle = lineOracle;
+};
+
+StringStream.prototype.eol = function () {return this.pos >= this.string.length};
+StringStream.prototype.sol = function () {return this.pos == this.lineStart};
+StringStream.prototype.peek = function () {return this.string.charAt(this.pos) || undefined};
+StringStream.prototype.next = function () {
+ if (this.pos < this.string.length)
+ { return this.string.charAt(this.pos++) }
+};
+StringStream.prototype.eat = function (match) {
+ var ch = this.string.charAt(this.pos);
+ var ok;
+ if (typeof match == "string") { ok = ch == match; }
+ else { ok = ch && (match.test ? match.test(ch) : match(ch)); }
+ if (ok) {++this.pos; return ch}
+};
+StringStream.prototype.eatWhile = function (match) {
+ var start = this.pos;
+ while (this.eat(match)){}
+ return this.pos > start
+};
+StringStream.prototype.eatSpace = function () {
+ var start = this.pos;
+ while (/[\s\u00a0]/.test(this.string.charAt(this.pos))) { ++this.pos; }
+ return this.pos > start
+};
+StringStream.prototype.skipToEnd = function () {this.pos = this.string.length;};
+StringStream.prototype.skipTo = function (ch) {
+ var found = this.string.indexOf(ch, this.pos);
+ if (found > -1) {this.pos = found; return true}
+};
+StringStream.prototype.backUp = function (n) {this.pos -= n;};
+StringStream.prototype.column = function () {
+ if (this.lastColumnPos < this.start) {
+ this.lastColumnValue = countColumn(this.string, this.start, this.tabSize, this.lastColumnPos, this.lastColumnValue);
+ this.lastColumnPos = this.start;
+ }
+ return this.lastColumnValue - (this.lineStart ? countColumn(this.string, this.lineStart, this.tabSize) : 0)
+};
+StringStream.prototype.indentation = function () {
+ return countColumn(this.string, null, this.tabSize) -
+ (this.lineStart ? countColumn(this.string, this.lineStart, this.tabSize) : 0)
+};
+StringStream.prototype.match = function (pattern, consume, caseInsensitive) {
+ if (typeof pattern == "string") {
+ var cased = function (str) { return caseInsensitive ? str.toLowerCase() : str; };
+ var substr = this.string.substr(this.pos, pattern.length);
+ if (cased(substr) == cased(pattern)) {
+ if (consume !== false) { this.pos += pattern.length; }
+ return true
+ }
+ } else {
+ var match = this.string.slice(this.pos).match(pattern);
+ if (match && match.index > 0) { return null }
+ if (match && consume !== false) { this.pos += match[0].length; }
+ return match
+ }
+};
+StringStream.prototype.current = function (){return this.string.slice(this.start, this.pos)};
+StringStream.prototype.hideFirstChars = function (n, inner) {
+ this.lineStart += n;
+ try { return inner() }
+ finally { this.lineStart -= n; }
+};
+StringStream.prototype.lookAhead = function (n) {
+ var oracle = this.lineOracle;
+ return oracle && oracle.lookAhead(n)
+};
+StringStream.prototype.baseToken = function () {
+ var oracle = this.lineOracle;
+ return oracle && oracle.baseToken(this.pos)
+};
+
+// Known modes, by name and by MIME
+var modes = {}, mimeModes = {};
+
+// Extra arguments are stored as the mode's dependencies, which is
+// used by (legacy) mechanisms like loadmode.js to automatically
+// load a mode. (Preferred mechanism is the require/define calls.)
+function defineMode(name, mode) {
+ if (arguments.length > 2)
+ { mode.dependencies = Array.prototype.slice.call(arguments, 2); }
+ modes[name] = mode;
+}
+
+function defineMIME(mime, spec) {
+ mimeModes[mime] = spec;
+}
+
+// Given a MIME type, a {name, ...options} config object, or a name
+// string, return a mode config object.
+function resolveMode(spec) {
+ if (typeof spec == "string" && mimeModes.hasOwnProperty(spec)) {
+ spec = mimeModes[spec];
+ } else if (spec && typeof spec.name == "string" && mimeModes.hasOwnProperty(spec.name)) {
+ var found = mimeModes[spec.name];
+ if (typeof found == "string") { found = {name: found}; }
+ spec = createObj(found, spec);
+ spec.name = found.name;
+ } else if (typeof spec == "string" && /^[\w\-]+\/[\w\-]+\+xml$/.test(spec)) {
+ return resolveMode("application/xml")
+ } else if (typeof spec == "string" && /^[\w\-]+\/[\w\-]+\+json$/.test(spec)) {
+ return resolveMode("application/json")
+ }
+ if (typeof spec == "string") { return {name: spec} }
+ else { return spec || {name: "null"} }
+}
+
+// Given a mode spec (anything that resolveMode accepts), find and
+// initialize an actual mode object.
+function getMode(options, spec) {
+ spec = resolveMode(spec);
+ var mfactory = modes[spec.name];
+ if (!mfactory) { return getMode(options, "text/plain") }
+ var modeObj = mfactory(options, spec);
+ if (modeExtensions.hasOwnProperty(spec.name)) {
+ var exts = modeExtensions[spec.name];
+ for (var prop in exts) {
+ if (!exts.hasOwnProperty(prop)) { continue }
+ if (modeObj.hasOwnProperty(prop)) { modeObj["_" + prop] = modeObj[prop]; }
+ modeObj[prop] = exts[prop];
+ }
+ }
+ modeObj.name = spec.name;
+ if (spec.helperType) { modeObj.helperType = spec.helperType; }
+ if (spec.modeProps) { for (var prop$1 in spec.modeProps)
+ { modeObj[prop$1] = spec.modeProps[prop$1]; } }
+
+ return modeObj
+}
+
+// This can be used to attach properties to mode objects from
+// outside the actual mode definition.
+var modeExtensions = {};
+function extendMode(mode, properties) {
+ var exts = modeExtensions.hasOwnProperty(mode) ? modeExtensions[mode] : (modeExtensions[mode] = {});
+ copyObj(properties, exts);
+}
+
+function copyState(mode, state) {
+ if (state === true) { return state }
+ if (mode.copyState) { return mode.copyState(state) }
+ var nstate = {};
+ for (var n in state) {
+ var val = state[n];
+ if (val instanceof Array) { val = val.concat([]); }
+ nstate[n] = val;
+ }
+ return nstate
+}
+
+// Given a mode and a state (for that mode), find the inner mode and
+// state at the position that the state refers to.
+function innerMode(mode, state) {
+ var info;
+ while (mode.innerMode) {
+ info = mode.innerMode(state);
+ if (!info || info.mode == mode) { break }
+ state = info.state;
+ mode = info.mode;
+ }
+ return info || {mode: mode, state: state}
+}
+
+function startState(mode, a1, a2) {
+ return mode.startState ? mode.startState(a1, a2) : true
+}
+
+var modeMethods = {
+ __proto__: null,
+ modes: modes,
+ mimeModes: mimeModes,
+ defineMode: defineMode,
+ defineMIME: defineMIME,
+ resolveMode: resolveMode,
+ getMode: getMode,
+ modeExtensions: modeExtensions,
+ extendMode: extendMode,
+ copyState: copyState,
+ innerMode: innerMode,
+ startState: startState
+};
+
+// Copy StringStream and mode methods into exports (CodeMirror) object.
+exports.StringStream = StringStream;
+exports.countColumn = countColumn;
+for (var exported in modeMethods) { exports[exported] = modeMethods[exported]; }
+
+// Shim library CodeMirror with the minimal CodeMirror defined above.
+require.cache[require.resolve("../../lib/codemirror")] = require.cache[require.resolve("./runmode.node")];
+require.cache[require.resolve("../../addon/runmode/runmode")] = require.cache[require.resolve("./runmode.node")];
+
+// Minimal default mode.
+exports.defineMode("null", function () { return ({token: function (stream) { return stream.skipToEnd(); }}); });
+exports.defineMIME("text/plain", "null");
+
+exports.registerHelper = exports.registerGlobalHelper = Math.min;
+exports.splitLines = function(string) { return string.split(/\r?\n|\r/) };
+
+exports.defaults = { indentUnit: 2 };
+
+// CodeMirror, copyright (c) by Marijn Haverbeke and others
+// Distributed under an MIT license: https://codemirror.net/LICENSE
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ { mod(require("../../lib/codemirror")); }
+ else if (typeof define == "function" && define.amd) // AMD
+ { define(["../../lib/codemirror"], mod); }
+ else // Plain browser env
+ { mod(CodeMirror); }
+})(function(CodeMirror) {
+
+CodeMirror.runMode = function(string, modespec, callback, options) {
+ var mode = CodeMirror.getMode(CodeMirror.defaults, modespec);
+ var tabSize = (options && options.tabSize) || CodeMirror.defaults.tabSize;
+
+ // Create a tokenizing callback function if passed-in callback is a DOM element.
+ if (callback.appendChild) {
+ var ie = /MSIE \d/.test(navigator.userAgent);
+ var ie_lt9 = ie && (document.documentMode == null || document.documentMode < 9);
+ var node = callback, col = 0;
+ node.innerHTML = "";
+ callback = function(text, style) {
+ if (text == "\n") {
+ // Emitting LF or CRLF on IE8 or earlier results in an incorrect display.
+ // Emitting a carriage return makes everything ok.
+ node.appendChild(document.createTextNode(ie_lt9 ? '\r' : text));
+ col = 0;
+ return;
+ }
+ var content = "";
+ // replace tabs
+ for (var pos = 0;;) {
+ var idx = text.indexOf("\t", pos);
+ if (idx == -1) {
+ content += text.slice(pos);
+ col += text.length - pos;
+ break;
+ } else {
+ col += idx - pos;
+ content += text.slice(pos, idx);
+ var size = tabSize - col % tabSize;
+ col += size;
+ for (var i = 0; i < size; ++i) { content += " "; }
+ pos = idx + 1;
+ }
+ }
+ // Create a node with token style and append it to the callback DOM element.
+ if (style) {
+ var sp = node.appendChild(document.createElement("span"));
+ sp.className = "cm-" + style.replace(/ +/g, " cm-");
+ sp.appendChild(document.createTextNode(content));
+ } else {
+ node.appendChild(document.createTextNode(content));
+ }
+ };
+ }
+
+ var lines = CodeMirror.splitLines(string), state = (options && options.state) || CodeMirror.startState(mode);
+ for (var i = 0, e = lines.length; i < e; ++i) {
+ if (i) { callback("\n"); }
+ var stream = new CodeMirror.StringStream(lines[i], null, {
+ lookAhead: function(n) { return lines[i + n] },
+ baseToken: function() {}
+ });
+ if (!stream.string && mode.blankLine) { mode.blankLine(state); }
+ while (!stream.eol()) {
+ var style = mode.token(stream, state);
+ callback(stream.current(), style, i, stream.start, state);
+ stream.start = stream.pos;
+ }
+ }
+};
+
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/scroll/annotatescrollbar.js b/modules/cookiesplus/lib/CodeMirror/addon/scroll/annotatescrollbar.js
new file mode 100644
index 00000000..2deece93
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/scroll/annotatescrollbar.js
@@ -0,0 +1,148 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ CodeMirror.defineExtension("annotateScrollbar", function(options) {
+ if (typeof options == "string") options = {className: options};
+ return new Annotation(this, options);
+ });
+
+ CodeMirror.defineOption("scrollButtonHeight", 0);
+
+ function Annotation(cm, options) {
+ this.cm = cm;
+ this.options = options;
+ this.buttonHeight = options.scrollButtonHeight || cm.getOption("scrollButtonHeight");
+ this.annotations = [];
+ this.doRedraw = this.doUpdate = null;
+ this.div = cm.getWrapperElement().appendChild(document.createElement("div"));
+ this.div.style.cssText = "position: absolute; right: 0; top: 0; z-index: 7; pointer-events: none";
+ this.computeScale();
+
+ function scheduleRedraw(delay) {
+ clearTimeout(self.doRedraw);
+ self.doRedraw = setTimeout(function() { self.redraw(); }, delay);
+ }
+
+ var self = this;
+ cm.on("refresh", this.resizeHandler = function() {
+ clearTimeout(self.doUpdate);
+ self.doUpdate = setTimeout(function() {
+ if (self.computeScale()) scheduleRedraw(20);
+ }, 100);
+ });
+ cm.on("markerAdded", this.resizeHandler);
+ cm.on("markerCleared", this.resizeHandler);
+ if (options.listenForChanges !== false)
+ cm.on("changes", this.changeHandler = function() {
+ scheduleRedraw(250);
+ });
+ }
+
+ Annotation.prototype.computeScale = function() {
+ var cm = this.cm;
+ var hScale = (cm.getWrapperElement().clientHeight - cm.display.barHeight - this.buttonHeight * 2) /
+ cm.getScrollerElement().scrollHeight
+ if (hScale != this.hScale) {
+ this.hScale = hScale;
+ return true;
+ }
+ };
+
+ Annotation.prototype.update = function(annotations) {
+ this.annotations = annotations;
+ this.redraw();
+ };
+
+ Annotation.prototype.redraw = function(compute) {
+ if (compute !== false) this.computeScale();
+ var cm = this.cm, hScale = this.hScale;
+
+ var frag = document.createDocumentFragment(), anns = this.annotations;
+
+ var wrapping = cm.getOption("lineWrapping");
+ var singleLineH = wrapping && cm.defaultTextHeight() * 1.5;
+ var curLine = null, curLineObj = null;
+
+ function getY(pos, top) {
+ if (curLine != pos.line) {
+ curLine = pos.line
+ curLineObj = cm.getLineHandle(pos.line)
+ var visual = cm.getLineHandleVisualStart(curLineObj)
+ if (visual != curLineObj) {
+ curLine = cm.getLineNumber(visual)
+ curLineObj = visual
+ }
+ }
+ if ((curLineObj.widgets && curLineObj.widgets.length) ||
+ (wrapping && curLineObj.height > singleLineH))
+ return cm.charCoords(pos, "local")[top ? "top" : "bottom"];
+ var topY = cm.heightAtLine(curLineObj, "local");
+ return topY + (top ? 0 : curLineObj.height);
+ }
+
+ var lastLine = cm.lastLine()
+ if (cm.display.barWidth) for (var i = 0, nextTop; i < anns.length; i++) {
+ var ann = anns[i];
+ if (ann.to.line > lastLine) continue;
+ var top = nextTop || getY(ann.from, true) * hScale;
+ var bottom = getY(ann.to, false) * hScale;
+ while (i < anns.length - 1) {
+ if (anns[i + 1].to.line > lastLine) break;
+ nextTop = getY(anns[i + 1].from, true) * hScale;
+ if (nextTop > bottom + .9) break;
+ ann = anns[++i];
+ bottom = getY(ann.to, false) * hScale;
+ }
+ if (bottom == top) continue;
+ var height = Math.max(bottom - top, 3);
+
+ var elt = frag.appendChild(document.createElement("div"));
+ elt.style.cssText = "position: absolute; right: 0px; width: " + Math.max(cm.display.barWidth - 1, 2) + "px; top: "
+ + (top + this.buttonHeight) + "px; height: " + height + "px";
+ elt.className = this.options.className;
+ if (ann.id) {
+ elt.setAttribute("annotation-id", ann.id);
+ }
+ }
+ this.div.textContent = "";
+ this.div.appendChild(frag);
+ };
+
+ Annotation.prototype.clear = function() {
+ this.cm.off("refresh", this.resizeHandler);
+ this.cm.off("markerAdded", this.resizeHandler);
+ this.cm.off("markerCleared", this.resizeHandler);
+ if (this.changeHandler) this.cm.off("changes", this.changeHandler);
+ this.div.parentNode.removeChild(this.div);
+ };
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/scroll/index.php b/modules/cookiesplus/lib/CodeMirror/addon/scroll/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/scroll/index.php
@@ -0,0 +1,32 @@
+ 1) {
+ var totalH = cm.display.scroller.clientHeight - 30,
+ lastLineH = cm.getLineHandle(cm.lastLine()).height;
+ padding = (totalH - lastLineH) + "px";
+ }
+ if (cm.state.scrollPastEndPadding != padding) {
+ cm.state.scrollPastEndPadding = padding;
+ cm.display.lineSpace.parentNode.style.paddingBottom = padding;
+ cm.off("refresh", updateBottomMargin);
+ cm.setSize();
+ cm.on("refresh", updateBottomMargin);
+ }
+ }
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/scroll/simplescrollbars.css b/modules/cookiesplus/lib/CodeMirror/addon/scroll/simplescrollbars.css
new file mode 100644
index 00000000..3eee34c6
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/scroll/simplescrollbars.css
@@ -0,0 +1,89 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+.CodeMirror-simplescroll-horizontal div, .CodeMirror-simplescroll-vertical div {
+ position: absolute;
+ background: #ccc;
+ -moz-box-sizing: border-box;
+ box-sizing: border-box;
+ border: 1px solid #bbb;
+ border-radius: 2px;
+}
+
+.CodeMirror-simplescroll-horizontal, .CodeMirror-simplescroll-vertical {
+ position: absolute;
+ z-index: 6;
+ background: #eee;
+}
+
+.CodeMirror-simplescroll-horizontal {
+ bottom: 0; left: 0;
+ height: 8px;
+}
+.CodeMirror-simplescroll-horizontal div {
+ bottom: 0;
+ height: 100%;
+}
+
+.CodeMirror-simplescroll-vertical {
+ right: 0; top: 0;
+ width: 8px;
+}
+.CodeMirror-simplescroll-vertical div {
+ right: 0;
+ width: 100%;
+}
+
+
+.CodeMirror-overlayscroll .CodeMirror-scrollbar-filler, .CodeMirror-overlayscroll .CodeMirror-gutter-filler {
+ display: none;
+}
+
+.CodeMirror-overlayscroll-horizontal div, .CodeMirror-overlayscroll-vertical div {
+ position: absolute;
+ background: #bcd;
+ border-radius: 3px;
+}
+
+.CodeMirror-overlayscroll-horizontal, .CodeMirror-overlayscroll-vertical {
+ position: absolute;
+ z-index: 6;
+}
+
+.CodeMirror-overlayscroll-horizontal {
+ bottom: 0; left: 0;
+ height: 6px;
+}
+.CodeMirror-overlayscroll-horizontal div {
+ bottom: 0;
+ height: 100%;
+}
+
+.CodeMirror-overlayscroll-vertical {
+ right: 0; top: 0;
+ width: 6px;
+}
+.CodeMirror-overlayscroll-vertical div {
+ right: 0;
+ width: 100%;
+}
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/scroll/simplescrollbars.js b/modules/cookiesplus/lib/CodeMirror/addon/scroll/simplescrollbars.js
new file mode 100644
index 00000000..1ada2094
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/scroll/simplescrollbars.js
@@ -0,0 +1,172 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ function Bar(cls, orientation, scroll) {
+ this.orientation = orientation;
+ this.scroll = scroll;
+ this.screen = this.total = this.size = 1;
+ this.pos = 0;
+
+ this.node = document.createElement("div");
+ this.node.className = cls + "-" + orientation;
+ this.inner = this.node.appendChild(document.createElement("div"));
+
+ var self = this;
+ CodeMirror.on(this.inner, "mousedown", function(e) {
+ if (e.which != 1) return;
+ CodeMirror.e_preventDefault(e);
+ var axis = self.orientation == "horizontal" ? "pageX" : "pageY";
+ var start = e[axis], startpos = self.pos;
+ function done() {
+ CodeMirror.off(document, "mousemove", move);
+ CodeMirror.off(document, "mouseup", done);
+ }
+ function move(e) {
+ if (e.which != 1) return done();
+ self.moveTo(startpos + (e[axis] - start) * (self.total / self.size));
+ }
+ CodeMirror.on(document, "mousemove", move);
+ CodeMirror.on(document, "mouseup", done);
+ });
+
+ CodeMirror.on(this.node, "click", function(e) {
+ CodeMirror.e_preventDefault(e);
+ var innerBox = self.inner.getBoundingClientRect(), where;
+ if (self.orientation == "horizontal")
+ where = e.clientX < innerBox.left ? -1 : e.clientX > innerBox.right ? 1 : 0;
+ else
+ where = e.clientY < innerBox.top ? -1 : e.clientY > innerBox.bottom ? 1 : 0;
+ self.moveTo(self.pos + where * self.screen);
+ });
+
+ function onWheel(e) {
+ var moved = CodeMirror.wheelEventPixels(e)[self.orientation == "horizontal" ? "x" : "y"];
+ var oldPos = self.pos;
+ self.moveTo(self.pos + moved);
+ if (self.pos != oldPos) CodeMirror.e_preventDefault(e);
+ }
+ CodeMirror.on(this.node, "mousewheel", onWheel);
+ CodeMirror.on(this.node, "DOMMouseScroll", onWheel);
+ }
+
+ Bar.prototype.setPos = function(pos, force) {
+ if (pos < 0) pos = 0;
+ if (pos > this.total - this.screen) pos = this.total - this.screen;
+ if (!force && pos == this.pos) return false;
+ this.pos = pos;
+ this.inner.style[this.orientation == "horizontal" ? "left" : "top"] =
+ (pos * (this.size / this.total)) + "px";
+ return true
+ };
+
+ Bar.prototype.moveTo = function(pos) {
+ if (this.setPos(pos)) this.scroll(pos, this.orientation);
+ }
+
+ var minButtonSize = 10;
+
+ Bar.prototype.update = function(scrollSize, clientSize, barSize) {
+ var sizeChanged = this.screen != clientSize || this.total != scrollSize || this.size != barSize
+ if (sizeChanged) {
+ this.screen = clientSize;
+ this.total = scrollSize;
+ this.size = barSize;
+ }
+
+ var buttonSize = this.screen * (this.size / this.total);
+ if (buttonSize < minButtonSize) {
+ this.size -= minButtonSize - buttonSize;
+ buttonSize = minButtonSize;
+ }
+ this.inner.style[this.orientation == "horizontal" ? "width" : "height"] =
+ buttonSize + "px";
+ this.setPos(this.pos, sizeChanged);
+ };
+
+ function SimpleScrollbars(cls, place, scroll) {
+ this.addClass = cls;
+ this.horiz = new Bar(cls, "horizontal", scroll);
+ place(this.horiz.node);
+ this.vert = new Bar(cls, "vertical", scroll);
+ place(this.vert.node);
+ this.width = null;
+ }
+
+ SimpleScrollbars.prototype.update = function(measure) {
+ if (this.width == null) {
+ var style = window.getComputedStyle ? window.getComputedStyle(this.horiz.node) : this.horiz.node.currentStyle;
+ if (style) this.width = parseInt(style.height);
+ }
+ var width = this.width || 0;
+
+ var needsH = measure.scrollWidth > measure.clientWidth + 1;
+ var needsV = measure.scrollHeight > measure.clientHeight + 1;
+ this.vert.node.style.display = needsV ? "block" : "none";
+ this.horiz.node.style.display = needsH ? "block" : "none";
+
+ if (needsV) {
+ this.vert.update(measure.scrollHeight, measure.clientHeight,
+ measure.viewHeight - (needsH ? width : 0));
+ this.vert.node.style.bottom = needsH ? width + "px" : "0";
+ }
+ if (needsH) {
+ this.horiz.update(measure.scrollWidth, measure.clientWidth,
+ measure.viewWidth - (needsV ? width : 0) - measure.barLeft);
+ this.horiz.node.style.right = needsV ? width + "px" : "0";
+ this.horiz.node.style.left = measure.barLeft + "px";
+ }
+
+ return {right: needsV ? width : 0, bottom: needsH ? width : 0};
+ };
+
+ SimpleScrollbars.prototype.setScrollTop = function(pos) {
+ this.vert.setPos(pos);
+ };
+
+ SimpleScrollbars.prototype.setScrollLeft = function(pos) {
+ this.horiz.setPos(pos);
+ };
+
+ SimpleScrollbars.prototype.clear = function() {
+ var parent = this.horiz.node.parentNode;
+ parent.removeChild(this.horiz.node);
+ parent.removeChild(this.vert.node);
+ };
+
+ CodeMirror.scrollbarModel.simple = function(place, scroll) {
+ return new SimpleScrollbars("CodeMirror-simplescroll", place, scroll);
+ };
+ CodeMirror.scrollbarModel.overlay = function(place, scroll) {
+ return new SimpleScrollbars("CodeMirror-overlayscroll", place, scroll);
+ };
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/search/index.php b/modules/cookiesplus/lib/CodeMirror/addon/search/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/search/index.php
@@ -0,0 +1,32 @@
+ ' + cm.phrase("(Use line:column or scroll% syntax)") + '';
+ }
+
+ function interpretLine(cm, string) {
+ var num = Number(string)
+ if (/^[-+]/.test(string)) return cm.getCursor().line + num
+ else return num - 1
+ }
+
+ CodeMirror.commands.jumpToLine = function(cm) {
+ var cur = cm.getCursor();
+ dialog(cm, getJumpDialog(cm), cm.phrase("Jump to line:"), (cur.line + 1) + ":" + cur.ch, function(posStr) {
+ if (!posStr) return;
+
+ var match;
+ if (match = /^\s*([\+\-]?\d+)\s*\:\s*(\d+)\s*$/.exec(posStr)) {
+ cm.setCursor(interpretLine(cm, match[1]), Number(match[2]))
+ } else if (match = /^\s*([\+\-]?\d+(\.\d+)?)\%\s*/.exec(posStr)) {
+ var line = Math.round(cm.lineCount() * Number(match[1]) / 100);
+ if (/^[-+]/.test(match[1])) line = cur.line + line + 1;
+ cm.setCursor(line - 1, cur.ch);
+ } else if (match = /^\s*\:?\s*([\+\-]?\d+)\s*/.exec(posStr)) {
+ cm.setCursor(interpretLine(cm, match[1]), cur.ch);
+ }
+ });
+ };
+
+ CodeMirror.keyMap["default"]["Alt-G"] = "jumpToLine";
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/search/match-highlighter.js b/modules/cookiesplus/lib/CodeMirror/addon/search/match-highlighter.js
new file mode 100644
index 00000000..52effce7
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/search/match-highlighter.js
@@ -0,0 +1,187 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+// Highlighting text that matches the selection
+//
+// Defines an option highlightSelectionMatches, which, when enabled,
+// will style strings that match the selection throughout the
+// document.
+//
+// The option can be set to true to simply enable it, or to a
+// {minChars, style, wordsOnly, showToken, delay} object to explicitly
+// configure it. minChars is the minimum amount of characters that should be
+// selected for the behavior to occur, and style is the token style to
+// apply to the matches. This will be prefixed by "cm-" to create an
+// actual CSS class name. If wordsOnly is enabled, the matches will be
+// highlighted only if the selected text is a word. showToken, when enabled,
+// will cause the current token to be highlighted when nothing is selected.
+// delay is used to specify how much time to wait, in milliseconds, before
+// highlighting the matches. If annotateScrollbar is enabled, the occurences
+// will be highlighted on the scrollbar via the matchesonscrollbar addon.
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"), require("./matchesonscrollbar"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror", "./matchesonscrollbar"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ var defaults = {
+ style: "matchhighlight",
+ minChars: 2,
+ delay: 100,
+ wordsOnly: false,
+ annotateScrollbar: false,
+ showToken: false,
+ trim: true
+ }
+
+ function State(options) {
+ this.options = {}
+ for (var name in defaults)
+ this.options[name] = (options && options.hasOwnProperty(name) ? options : defaults)[name]
+ this.overlay = this.timeout = null;
+ this.matchesonscroll = null;
+ this.active = false;
+ }
+
+ CodeMirror.defineOption("highlightSelectionMatches", false, function(cm, val, old) {
+ if (old && old != CodeMirror.Init) {
+ removeOverlay(cm);
+ clearTimeout(cm.state.matchHighlighter.timeout);
+ cm.state.matchHighlighter = null;
+ cm.off("cursorActivity", cursorActivity);
+ cm.off("focus", onFocus)
+ }
+ if (val) {
+ var state = cm.state.matchHighlighter = new State(val);
+ if (cm.hasFocus()) {
+ state.active = true
+ highlightMatches(cm)
+ } else {
+ cm.on("focus", onFocus)
+ }
+ cm.on("cursorActivity", cursorActivity);
+ }
+ });
+
+ function cursorActivity(cm) {
+ var state = cm.state.matchHighlighter;
+ if (state.active || cm.hasFocus()) scheduleHighlight(cm, state)
+ }
+
+ function onFocus(cm) {
+ var state = cm.state.matchHighlighter
+ if (!state.active) {
+ state.active = true
+ scheduleHighlight(cm, state)
+ }
+ }
+
+ function scheduleHighlight(cm, state) {
+ clearTimeout(state.timeout);
+ state.timeout = setTimeout(function() {highlightMatches(cm);}, state.options.delay);
+ }
+
+ function addOverlay(cm, query, hasBoundary, style) {
+ var state = cm.state.matchHighlighter;
+ cm.addOverlay(state.overlay = makeOverlay(query, hasBoundary, style));
+ if (state.options.annotateScrollbar && cm.showMatchesOnScrollbar) {
+ var searchFor = hasBoundary ? new RegExp((/\w/.test(query.charAt(0)) ? "\\b" : "") +
+ query.replace(/[\\\[.+*?(){|^$]/g, "\\$&") +
+ (/\w/.test(query.charAt(query.length - 1)) ? "\\b" : "")) : query;
+ state.matchesonscroll = cm.showMatchesOnScrollbar(searchFor, false,
+ {className: "CodeMirror-selection-highlight-scrollbar"});
+ }
+ }
+
+ function removeOverlay(cm) {
+ var state = cm.state.matchHighlighter;
+ if (state.overlay) {
+ cm.removeOverlay(state.overlay);
+ state.overlay = null;
+ if (state.matchesonscroll) {
+ state.matchesonscroll.clear();
+ state.matchesonscroll = null;
+ }
+ }
+ }
+
+ function highlightMatches(cm) {
+ cm.operation(function() {
+ var state = cm.state.matchHighlighter;
+ removeOverlay(cm);
+ if (!cm.somethingSelected() && state.options.showToken) {
+ var re = state.options.showToken === true ? /[\w$]/ : state.options.showToken;
+ var cur = cm.getCursor(), line = cm.getLine(cur.line), start = cur.ch, end = start;
+ while (start && re.test(line.charAt(start - 1))) --start;
+ while (end < line.length && re.test(line.charAt(end))) ++end;
+ if (start < end)
+ addOverlay(cm, line.slice(start, end), re, state.options.style);
+ return;
+ }
+ var from = cm.getCursor("from"), to = cm.getCursor("to");
+ if (from.line != to.line) return;
+ if (state.options.wordsOnly && !isWord(cm, from, to)) return;
+ var selection = cm.getRange(from, to)
+ if (state.options.trim) selection = selection.replace(/^\s+|\s+$/g, "")
+ if (selection.length >= state.options.minChars)
+ addOverlay(cm, selection, false, state.options.style);
+ });
+ }
+
+ function isWord(cm, from, to) {
+ var str = cm.getRange(from, to);
+ if (str.match(/^\w+$/) !== null) {
+ if (from.ch > 0) {
+ var pos = {line: from.line, ch: from.ch - 1};
+ var chr = cm.getRange(pos, from);
+ if (chr.match(/\W/) === null) return false;
+ }
+ if (to.ch < cm.getLine(from.line).length) {
+ var pos = {line: to.line, ch: to.ch + 1};
+ var chr = cm.getRange(to, pos);
+ if (chr.match(/\W/) === null) return false;
+ }
+ return true;
+ } else return false;
+ }
+
+ function boundariesAround(stream, re) {
+ return (!stream.start || !re.test(stream.string.charAt(stream.start - 1))) &&
+ (stream.pos == stream.string.length || !re.test(stream.string.charAt(stream.pos)));
+ }
+
+ function makeOverlay(query, hasBoundary, style) {
+ return {token: function(stream) {
+ if (stream.match(query) &&
+ (!hasBoundary || boundariesAround(stream, hasBoundary)))
+ return style;
+ stream.next();
+ stream.skipTo(query.charAt(0)) || stream.skipToEnd();
+ }};
+ }
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/search/matchesonscrollbar.css b/modules/cookiesplus/lib/CodeMirror/addon/search/matchesonscrollbar.css
new file mode 100644
index 00000000..e6b6c1e1
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/search/matchesonscrollbar.css
@@ -0,0 +1,31 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+.CodeMirror-search-match {
+ background: gold;
+ border-top: 1px solid orange;
+ border-bottom: 1px solid orange;
+ -moz-box-sizing: border-box;
+ box-sizing: border-box;
+ opacity: .5;
+}
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/search/matchesonscrollbar.js b/modules/cookiesplus/lib/CodeMirror/addon/search/matchesonscrollbar.js
new file mode 100644
index 00000000..1c776b71
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/search/matchesonscrollbar.js
@@ -0,0 +1,117 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"), require("./searchcursor"), require("../scroll/annotatescrollbar"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror", "./searchcursor", "../scroll/annotatescrollbar"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ CodeMirror.defineExtension("showMatchesOnScrollbar", function(query, caseFold, options) {
+ if (typeof options == "string") options = {className: options};
+ if (!options) options = {};
+ return new SearchAnnotation(this, query, caseFold, options);
+ });
+
+ function SearchAnnotation(cm, query, caseFold, options) {
+ this.cm = cm;
+ this.options = options;
+ var annotateOptions = {listenForChanges: false};
+ for (var prop in options) annotateOptions[prop] = options[prop];
+ if (!annotateOptions.className) annotateOptions.className = "CodeMirror-search-match";
+ this.annotation = cm.annotateScrollbar(annotateOptions);
+ this.query = query;
+ this.caseFold = caseFold;
+ this.gap = {from: cm.firstLine(), to: cm.lastLine() + 1};
+ this.matches = [];
+ this.update = null;
+
+ this.findMatches();
+ this.annotation.update(this.matches);
+
+ var self = this;
+ cm.on("change", this.changeHandler = function(_cm, change) { self.onChange(change); });
+ }
+
+ var MAX_MATCHES = 1000;
+
+ SearchAnnotation.prototype.findMatches = function() {
+ if (!this.gap) return;
+ for (var i = 0; i < this.matches.length; i++) {
+ var match = this.matches[i];
+ if (match.from.line >= this.gap.to) break;
+ if (match.to.line >= this.gap.from) this.matches.splice(i--, 1);
+ }
+ var cursor = this.cm.getSearchCursor(this.query, CodeMirror.Pos(this.gap.from, 0), {caseFold: this.caseFold, multiline: this.options.multiline});
+ var maxMatches = this.options && this.options.maxMatches || MAX_MATCHES;
+ while (cursor.findNext()) {
+ var match = {from: cursor.from(), to: cursor.to()};
+ if (match.from.line >= this.gap.to) break;
+ this.matches.splice(i++, 0, match);
+ if (this.matches.length > maxMatches) break;
+ }
+ this.gap = null;
+ };
+
+ function offsetLine(line, changeStart, sizeChange) {
+ if (line <= changeStart) return line;
+ return Math.max(changeStart, line + sizeChange);
+ }
+
+ SearchAnnotation.prototype.onChange = function(change) {
+ var startLine = change.from.line;
+ var endLine = CodeMirror.changeEnd(change).line;
+ var sizeChange = endLine - change.to.line;
+ if (this.gap) {
+ this.gap.from = Math.min(offsetLine(this.gap.from, startLine, sizeChange), change.from.line);
+ this.gap.to = Math.max(offsetLine(this.gap.to, startLine, sizeChange), change.from.line);
+ } else {
+ this.gap = {from: change.from.line, to: endLine + 1};
+ }
+
+ if (sizeChange) for (var i = 0; i < this.matches.length; i++) {
+ var match = this.matches[i];
+ var newFrom = offsetLine(match.from.line, startLine, sizeChange);
+ if (newFrom != match.from.line) match.from = CodeMirror.Pos(newFrom, match.from.ch);
+ var newTo = offsetLine(match.to.line, startLine, sizeChange);
+ if (newTo != match.to.line) match.to = CodeMirror.Pos(newTo, match.to.ch);
+ }
+ clearTimeout(this.update);
+ var self = this;
+ this.update = setTimeout(function() { self.updateAfterChange(); }, 250);
+ };
+
+ SearchAnnotation.prototype.updateAfterChange = function() {
+ this.findMatches();
+ this.annotation.update(this.matches);
+ };
+
+ SearchAnnotation.prototype.clear = function() {
+ this.cm.off("change", this.changeHandler);
+ this.annotation.clear();
+ };
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/search/search.js b/modules/cookiesplus/lib/CodeMirror/addon/search/search.js
new file mode 100644
index 00000000..d3503776
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/search/search.js
@@ -0,0 +1,280 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+// Define search commands. Depends on dialog.js or another
+// implementation of the openDialog method.
+
+// Replace works a little oddly -- it will do the replace on the next
+// Ctrl-G (or whatever is bound to findNext) press. You prevent a
+// replace by making sure the match is no longer selected when hitting
+// Ctrl-G.
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"), require("./searchcursor"), require("../dialog/dialog"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror", "./searchcursor", "../dialog/dialog"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ function searchOverlay(query, caseInsensitive) {
+ if (typeof query == "string")
+ query = new RegExp(query.replace(/[\-\[\]\/\{\}\(\)\*\+\?\.\\\^\$\|]/g, "\\$&"), caseInsensitive ? "gi" : "g");
+ else if (!query.global)
+ query = new RegExp(query.source, query.ignoreCase ? "gi" : "g");
+
+ return {token: function(stream) {
+ query.lastIndex = stream.pos;
+ var match = query.exec(stream.string);
+ if (match && match.index == stream.pos) {
+ stream.pos += match[0].length || 1;
+ return "searching";
+ } else if (match) {
+ stream.pos = match.index;
+ } else {
+ stream.skipToEnd();
+ }
+ }};
+ }
+
+ function SearchState() {
+ this.posFrom = this.posTo = this.lastQuery = this.query = null;
+ this.overlay = null;
+ }
+
+ function getSearchState(cm) {
+ return cm.state.search || (cm.state.search = new SearchState());
+ }
+
+ function queryCaseInsensitive(query) {
+ return typeof query == "string" && query == query.toLowerCase();
+ }
+
+ function getSearchCursor(cm, query, pos) {
+ // Heuristic: if the query string is all lowercase, do a case insensitive search.
+ return cm.getSearchCursor(query, pos, {caseFold: queryCaseInsensitive(query), multiline: true});
+ }
+
+ function persistentDialog(cm, text, deflt, onEnter, onKeyDown) {
+ cm.openDialog(text, onEnter, {
+ value: deflt,
+ selectValueOnOpen: true,
+ closeOnEnter: false,
+ onClose: function() { clearSearch(cm); },
+ onKeyDown: onKeyDown
+ });
+ }
+
+ function dialog(cm, text, shortText, deflt, f) {
+ if (cm.openDialog) cm.openDialog(text, f, {value: deflt, selectValueOnOpen: true});
+ else f(prompt(shortText, deflt));
+ }
+
+ function confirmDialog(cm, text, shortText, fs) {
+ if (cm.openConfirm) cm.openConfirm(text, fs);
+ else if (confirm(shortText)) fs[0]();
+ }
+
+ function parseString(string) {
+ return string.replace(/\\([nrt\\])/g, function(match, ch) {
+ if (ch == "n") return "\n"
+ if (ch == "r") return "\r"
+ if (ch == "t") return "\t"
+ if (ch == "\\") return "\\"
+ return match
+ })
+ }
+
+ function parseQuery(query) {
+ var isRE = query.match(/^\/(.*)\/([a-z]*)$/);
+ if (isRE) {
+ try { query = new RegExp(isRE[1], isRE[2].indexOf("i") == -1 ? "" : "i"); }
+ catch(e) {} // Not a regular expression after all, do a string search
+ } else {
+ query = parseString(query)
+ }
+ if (typeof query == "string" ? query == "" : query.test(""))
+ query = /x^/;
+ return query;
+ }
+
+ function startSearch(cm, state, query) {
+ state.queryText = query;
+ state.query = parseQuery(query);
+ cm.removeOverlay(state.overlay, queryCaseInsensitive(state.query));
+ state.overlay = searchOverlay(state.query, queryCaseInsensitive(state.query));
+ cm.addOverlay(state.overlay);
+ if (cm.showMatchesOnScrollbar) {
+ if (state.annotate) { state.annotate.clear(); state.annotate = null; }
+ state.annotate = cm.showMatchesOnScrollbar(state.query, queryCaseInsensitive(state.query));
+ }
+ }
+
+ function doSearch(cm, rev, persistent, immediate) {
+ var state = getSearchState(cm);
+ if (state.query) return findNext(cm, rev);
+ var q = cm.getSelection() || state.lastQuery;
+ if (q instanceof RegExp && q.source == "x^") q = null
+ if (persistent && cm.openDialog) {
+ var hiding = null
+ var searchNext = function(query, event) {
+ CodeMirror.e_stop(event);
+ if (!query) return;
+ if (query != state.queryText) {
+ startSearch(cm, state, query);
+ state.posFrom = state.posTo = cm.getCursor();
+ }
+ if (hiding) hiding.style.opacity = 1
+ findNext(cm, event.shiftKey, function(_, to) {
+ var dialog
+ if (to.line < 3 && document.querySelector &&
+ (dialog = cm.display.wrapper.querySelector(".CodeMirror-dialog")) &&
+ dialog.getBoundingClientRect().bottom - 4 > cm.cursorCoords(to, "window").top)
+ (hiding = dialog).style.opacity = .4
+ })
+ };
+ persistentDialog(cm, getQueryDialog(cm), q, searchNext, function(event, query) {
+ var keyName = CodeMirror.keyName(event)
+ var extra = cm.getOption('extraKeys'), cmd = (extra && extra[keyName]) || CodeMirror.keyMap[cm.getOption("keyMap")][keyName]
+ if (cmd == "findNext" || cmd == "findPrev" ||
+ cmd == "findPersistentNext" || cmd == "findPersistentPrev") {
+ CodeMirror.e_stop(event);
+ startSearch(cm, getSearchState(cm), query);
+ cm.execCommand(cmd);
+ } else if (cmd == "find" || cmd == "findPersistent") {
+ CodeMirror.e_stop(event);
+ searchNext(query, event);
+ }
+ });
+ if (immediate && q) {
+ startSearch(cm, state, q);
+ findNext(cm, rev);
+ }
+ } else {
+ dialog(cm, getQueryDialog(cm), "Search for:", q, function(query) {
+ if (query && !state.query) cm.operation(function() {
+ startSearch(cm, state, query);
+ state.posFrom = state.posTo = cm.getCursor();
+ findNext(cm, rev);
+ });
+ });
+ }
+ }
+
+ function findNext(cm, rev, callback) {cm.operation(function() {
+ var state = getSearchState(cm);
+ var cursor = getSearchCursor(cm, state.query, rev ? state.posFrom : state.posTo);
+ if (!cursor.find(rev)) {
+ cursor = getSearchCursor(cm, state.query, rev ? CodeMirror.Pos(cm.lastLine()) : CodeMirror.Pos(cm.firstLine(), 0));
+ if (!cursor.find(rev)) return;
+ }
+ cm.setSelection(cursor.from(), cursor.to());
+ cm.scrollIntoView({from: cursor.from(), to: cursor.to()}, 20);
+ state.posFrom = cursor.from(); state.posTo = cursor.to();
+ if (callback) callback(cursor.from(), cursor.to())
+ });}
+
+ function clearSearch(cm) {cm.operation(function() {
+ var state = getSearchState(cm);
+ state.lastQuery = state.query;
+ if (!state.query) return;
+ state.query = state.queryText = null;
+ cm.removeOverlay(state.overlay);
+ if (state.annotate) { state.annotate.clear(); state.annotate = null; }
+ });}
+
+
+ function getQueryDialog(cm) {
+ return '' + cm.phrase("Search:") + '' + cm.phrase("(Use /re/ syntax for regexp search)") + '';
+ }
+ function getReplaceQueryDialog(cm) {
+ return ' ' + cm.phrase("(Use /re/ syntax for regexp search)") + '';
+ }
+ function getReplacementQueryDialog(cm) {
+ return '' + cm.phrase("With:") + ' ';
+ }
+ function getDoReplaceConfirm(cm) {
+ return '' + cm.phrase("Replace?") + ' ';
+ }
+
+ function replaceAll(cm, query, text) {
+ cm.operation(function() {
+ for (var cursor = getSearchCursor(cm, query); cursor.findNext();) {
+ if (typeof query != "string") {
+ var match = cm.getRange(cursor.from(), cursor.to()).match(query);
+ cursor.replace(text.replace(/\$(\d)/g, function(_, i) {return match[i];}));
+ } else cursor.replace(text);
+ }
+ });
+ }
+
+ function replace(cm, all) {
+ if (cm.getOption("readOnly")) return;
+ var query = cm.getSelection() || getSearchState(cm).lastQuery;
+ var dialogText = '' + (all ? cm.phrase("Replace all:") : cm.phrase("Replace:")) + '';
+ dialog(cm, dialogText + getReplaceQueryDialog(cm), dialogText, query, function(query) {
+ if (!query) return;
+ query = parseQuery(query);
+ dialog(cm, getReplacementQueryDialog(cm), cm.phrase("Replace with:"), "", function(text) {
+ text = parseString(text)
+ if (all) {
+ replaceAll(cm, query, text)
+ } else {
+ clearSearch(cm);
+ var cursor = getSearchCursor(cm, query, cm.getCursor("from"));
+ var advance = function() {
+ var start = cursor.from(), match;
+ if (!(match = cursor.findNext())) {
+ cursor = getSearchCursor(cm, query);
+ if (!(match = cursor.findNext()) ||
+ (start && cursor.from().line == start.line && cursor.from().ch == start.ch)) return;
+ }
+ cm.setSelection(cursor.from(), cursor.to());
+ cm.scrollIntoView({from: cursor.from(), to: cursor.to()});
+ confirmDialog(cm, getDoReplaceConfirm(cm), cm.phrase("Replace?"),
+ [function() {doReplace(match);}, advance,
+ function() {replaceAll(cm, query, text)}]);
+ };
+ var doReplace = function(match) {
+ cursor.replace(typeof query == "string" ? text :
+ text.replace(/\$(\d)/g, function(_, i) {return match[i];}));
+ advance();
+ };
+ advance();
+ }
+ });
+ });
+ }
+
+ CodeMirror.commands.find = function(cm) {clearSearch(cm); doSearch(cm);};
+ CodeMirror.commands.findPersistent = function(cm) {clearSearch(cm); doSearch(cm, false, true);};
+ CodeMirror.commands.findPersistentNext = function(cm) {doSearch(cm, false, true, true);};
+ CodeMirror.commands.findPersistentPrev = function(cm) {doSearch(cm, true, true, true);};
+ CodeMirror.commands.findNext = doSearch;
+ CodeMirror.commands.findPrev = function(cm) {doSearch(cm, true);};
+ CodeMirror.commands.clearSearch = clearSearch;
+ CodeMirror.commands.replace = replace;
+ CodeMirror.commands.replaceAll = function(cm) {replace(cm, true);};
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/search/searchcursor.js b/modules/cookiesplus/lib/CodeMirror/addon/search/searchcursor.js
new file mode 100644
index 00000000..2f761e37
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/search/searchcursor.js
@@ -0,0 +1,316 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"))
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod)
+ else // Plain browser env
+ mod(CodeMirror)
+})(function(CodeMirror) {
+ "use strict"
+ var Pos = CodeMirror.Pos
+
+ function regexpFlags(regexp) {
+ var flags = regexp.flags
+ return flags != null ? flags : (regexp.ignoreCase ? "i" : "")
+ + (regexp.global ? "g" : "")
+ + (regexp.multiline ? "m" : "")
+ }
+
+ function ensureFlags(regexp, flags) {
+ var current = regexpFlags(regexp), target = current
+ for (var i = 0; i < flags.length; i++) if (target.indexOf(flags.charAt(i)) == -1)
+ target += flags.charAt(i)
+ return current == target ? regexp : new RegExp(regexp.source, target)
+ }
+
+ function maybeMultiline(regexp) {
+ return /\\s|\\n|\n|\\W|\\D|\[\^/.test(regexp.source)
+ }
+
+ function searchRegexpForward(doc, regexp, start) {
+ regexp = ensureFlags(regexp, "g")
+ for (var line = start.line, ch = start.ch, last = doc.lastLine(); line <= last; line++, ch = 0) {
+ regexp.lastIndex = ch
+ var string = doc.getLine(line), match = regexp.exec(string)
+ if (match)
+ return {from: Pos(line, match.index),
+ to: Pos(line, match.index + match[0].length),
+ match: match}
+ }
+ }
+
+ function searchRegexpForwardMultiline(doc, regexp, start) {
+ if (!maybeMultiline(regexp)) return searchRegexpForward(doc, regexp, start)
+
+ regexp = ensureFlags(regexp, "gm")
+ var string, chunk = 1
+ for (var line = start.line, last = doc.lastLine(); line <= last;) {
+ // This grows the search buffer in exponentially-sized chunks
+ // between matches, so that nearby matches are fast and don't
+ // require concatenating the whole document (in case we're
+ // searching for something that has tons of matches), but at the
+ // same time, the amount of retries is limited.
+ for (var i = 0; i < chunk; i++) {
+ if (line > last) break
+ var curLine = doc.getLine(line++)
+ string = string == null ? curLine : string + "\n" + curLine
+ }
+ chunk = chunk * 2
+ regexp.lastIndex = start.ch
+ var match = regexp.exec(string)
+ if (match) {
+ var before = string.slice(0, match.index).split("\n"), inside = match[0].split("\n")
+ var startLine = start.line + before.length - 1, startCh = before[before.length - 1].length
+ return {from: Pos(startLine, startCh),
+ to: Pos(startLine + inside.length - 1,
+ inside.length == 1 ? startCh + inside[0].length : inside[inside.length - 1].length),
+ match: match}
+ }
+ }
+ }
+
+ function lastMatchIn(string, regexp, endMargin) {
+ var match, from = 0
+ while (from <= string.length) {
+ regexp.lastIndex = from
+ var newMatch = regexp.exec(string)
+ if (!newMatch) break
+ var end = newMatch.index + newMatch[0].length
+ if (end > string.length - endMargin) break
+ if (!match || end > match.index + match[0].length)
+ match = newMatch
+ from = newMatch.index + 1
+ }
+ return match
+ }
+
+ function searchRegexpBackward(doc, regexp, start) {
+ regexp = ensureFlags(regexp, "g")
+ for (var line = start.line, ch = start.ch, first = doc.firstLine(); line >= first; line--, ch = -1) {
+ var string = doc.getLine(line)
+ var match = lastMatchIn(string, regexp, ch < 0 ? 0 : string.length - ch)
+ if (match)
+ return {from: Pos(line, match.index),
+ to: Pos(line, match.index + match[0].length),
+ match: match}
+ }
+ }
+
+ function searchRegexpBackwardMultiline(doc, regexp, start) {
+ if (!maybeMultiline(regexp)) return searchRegexpBackward(doc, regexp, start)
+ regexp = ensureFlags(regexp, "gm")
+ var string, chunkSize = 1, endMargin = doc.getLine(start.line).length - start.ch
+ for (var line = start.line, first = doc.firstLine(); line >= first;) {
+ for (var i = 0; i < chunkSize && line >= first; i++) {
+ var curLine = doc.getLine(line--)
+ string = string == null ? curLine : curLine + "\n" + string
+ }
+ chunkSize *= 2
+
+ var match = lastMatchIn(string, regexp, endMargin)
+ if (match) {
+ var before = string.slice(0, match.index).split("\n"), inside = match[0].split("\n")
+ var startLine = line + before.length, startCh = before[before.length - 1].length
+ return {from: Pos(startLine, startCh),
+ to: Pos(startLine + inside.length - 1,
+ inside.length == 1 ? startCh + inside[0].length : inside[inside.length - 1].length),
+ match: match}
+ }
+ }
+ }
+
+ var doFold, noFold
+ if (String.prototype.normalize) {
+ doFold = function(str) { return str.normalize("NFD").toLowerCase() }
+ noFold = function(str) { return str.normalize("NFD") }
+ } else {
+ doFold = function(str) { return str.toLowerCase() }
+ noFold = function(str) { return str }
+ }
+
+ // Maps a position in a case-folded line back to a position in the original line
+ // (compensating for codepoints increasing in number during folding)
+ function adjustPos(orig, folded, pos, foldFunc) {
+ if (orig.length == folded.length) return pos
+ for (var min = 0, max = pos + Math.max(0, orig.length - folded.length);;) {
+ if (min == max) return min
+ var mid = (min + max) >> 1
+ var len = foldFunc(orig.slice(0, mid)).length
+ if (len == pos) return mid
+ else if (len > pos) max = mid
+ else min = mid + 1
+ }
+ }
+
+ function searchStringForward(doc, query, start, caseFold) {
+ // Empty string would match anything and never progress, so we
+ // define it to match nothing instead.
+ if (!query.length) return null
+ var fold = caseFold ? doFold : noFold
+ var lines = fold(query).split(/\r|\n\r?/)
+
+ search: for (var line = start.line, ch = start.ch, last = doc.lastLine() + 1 - lines.length; line <= last; line++, ch = 0) {
+ var orig = doc.getLine(line).slice(ch), string = fold(orig)
+ if (lines.length == 1) {
+ var found = string.indexOf(lines[0])
+ if (found == -1) continue search
+ var start = adjustPos(orig, string, found, fold) + ch
+ return {from: Pos(line, adjustPos(orig, string, found, fold) + ch),
+ to: Pos(line, adjustPos(orig, string, found + lines[0].length, fold) + ch)}
+ } else {
+ var cutFrom = string.length - lines[0].length
+ if (string.slice(cutFrom) != lines[0]) continue search
+ for (var i = 1; i < lines.length - 1; i++)
+ if (fold(doc.getLine(line + i)) != lines[i]) continue search
+ var end = doc.getLine(line + lines.length - 1), endString = fold(end), lastLine = lines[lines.length - 1]
+ if (endString.slice(0, lastLine.length) != lastLine) continue search
+ return {from: Pos(line, adjustPos(orig, string, cutFrom, fold) + ch),
+ to: Pos(line + lines.length - 1, adjustPos(end, endString, lastLine.length, fold))}
+ }
+ }
+ }
+
+ function searchStringBackward(doc, query, start, caseFold) {
+ if (!query.length) return null
+ var fold = caseFold ? doFold : noFold
+ var lines = fold(query).split(/\r|\n\r?/)
+
+ search: for (var line = start.line, ch = start.ch, first = doc.firstLine() - 1 + lines.length; line >= first; line--, ch = -1) {
+ var orig = doc.getLine(line)
+ if (ch > -1) orig = orig.slice(0, ch)
+ var string = fold(orig)
+ if (lines.length == 1) {
+ var found = string.lastIndexOf(lines[0])
+ if (found == -1) continue search
+ return {from: Pos(line, adjustPos(orig, string, found, fold)),
+ to: Pos(line, adjustPos(orig, string, found + lines[0].length, fold))}
+ } else {
+ var lastLine = lines[lines.length - 1]
+ if (string.slice(0, lastLine.length) != lastLine) continue search
+ for (var i = 1, start = line - lines.length + 1; i < lines.length - 1; i++)
+ if (fold(doc.getLine(start + i)) != lines[i]) continue search
+ var top = doc.getLine(line + 1 - lines.length), topString = fold(top)
+ if (topString.slice(topString.length - lines[0].length) != lines[0]) continue search
+ return {from: Pos(line + 1 - lines.length, adjustPos(top, topString, top.length - lines[0].length, fold)),
+ to: Pos(line, adjustPos(orig, string, lastLine.length, fold))}
+ }
+ }
+ }
+
+ function SearchCursor(doc, query, pos, options) {
+ this.atOccurrence = false
+ this.doc = doc
+ pos = pos ? doc.clipPos(pos) : Pos(0, 0)
+ this.pos = {from: pos, to: pos}
+
+ var caseFold
+ if (typeof options == "object") {
+ caseFold = options.caseFold
+ } else { // Backwards compat for when caseFold was the 4th argument
+ caseFold = options
+ options = null
+ }
+
+ if (typeof query == "string") {
+ if (caseFold == null) caseFold = false
+ this.matches = function(reverse, pos) {
+ return (reverse ? searchStringBackward : searchStringForward)(doc, query, pos, caseFold)
+ }
+ } else {
+ query = ensureFlags(query, "gm")
+ if (!options || options.multiline !== false)
+ this.matches = function(reverse, pos) {
+ return (reverse ? searchRegexpBackwardMultiline : searchRegexpForwardMultiline)(doc, query, pos)
+ }
+ else
+ this.matches = function(reverse, pos) {
+ return (reverse ? searchRegexpBackward : searchRegexpForward)(doc, query, pos)
+ }
+ }
+ }
+
+ SearchCursor.prototype = {
+ findNext: function() {return this.find(false)},
+ findPrevious: function() {return this.find(true)},
+
+ find: function(reverse) {
+ var result = this.matches(reverse, this.doc.clipPos(reverse ? this.pos.from : this.pos.to))
+
+ // Implements weird auto-growing behavior on null-matches for
+ // backwards-compatibility with the vim code (unfortunately)
+ while (result && CodeMirror.cmpPos(result.from, result.to) == 0) {
+ if (reverse) {
+ if (result.from.ch) result.from = Pos(result.from.line, result.from.ch - 1)
+ else if (result.from.line == this.doc.firstLine()) result = null
+ else result = this.matches(reverse, this.doc.clipPos(Pos(result.from.line - 1)))
+ } else {
+ if (result.to.ch < this.doc.getLine(result.to.line).length) result.to = Pos(result.to.line, result.to.ch + 1)
+ else if (result.to.line == this.doc.lastLine()) result = null
+ else result = this.matches(reverse, Pos(result.to.line + 1, 0))
+ }
+ }
+
+ if (result) {
+ this.pos = result
+ this.atOccurrence = true
+ return this.pos.match || true
+ } else {
+ var end = Pos(reverse ? this.doc.firstLine() : this.doc.lastLine() + 1, 0)
+ this.pos = {from: end, to: end}
+ return this.atOccurrence = false
+ }
+ },
+
+ from: function() {if (this.atOccurrence) return this.pos.from},
+ to: function() {if (this.atOccurrence) return this.pos.to},
+
+ replace: function(newText, origin) {
+ if (!this.atOccurrence) return
+ var lines = CodeMirror.splitLines(newText)
+ this.doc.replaceRange(lines, this.pos.from, this.pos.to, origin)
+ this.pos.to = Pos(this.pos.from.line + lines.length - 1,
+ lines[lines.length - 1].length + (lines.length == 1 ? this.pos.from.ch : 0))
+ }
+ }
+
+ CodeMirror.defineExtension("getSearchCursor", function(query, pos, caseFold) {
+ return new SearchCursor(this.doc, query, pos, caseFold)
+ })
+ CodeMirror.defineDocExtension("getSearchCursor", function(query, pos, caseFold) {
+ return new SearchCursor(this, query, pos, caseFold)
+ })
+
+ CodeMirror.defineExtension("selectMatches", function(query, caseFold) {
+ var ranges = []
+ var cur = this.getSearchCursor(query, this.getCursor("from"), caseFold)
+ while (cur.findNext()) {
+ if (CodeMirror.cmpPos(cur.to(), this.getCursor("to")) > 0) break
+ ranges.push({anchor: cur.from(), head: cur.to()})
+ }
+ if (ranges.length)
+ this.setSelections(ranges, 0)
+ })
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/selection/active-line.js b/modules/cookiesplus/lib/CodeMirror/addon/selection/active-line.js
new file mode 100644
index 00000000..9054a792
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/selection/active-line.js
@@ -0,0 +1,92 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+ var WRAP_CLASS = "CodeMirror-activeline";
+ var BACK_CLASS = "CodeMirror-activeline-background";
+ var GUTT_CLASS = "CodeMirror-activeline-gutter";
+
+ CodeMirror.defineOption("styleActiveLine", false, function(cm, val, old) {
+ var prev = old == CodeMirror.Init ? false : old;
+ if (val == prev) return
+ if (prev) {
+ cm.off("beforeSelectionChange", selectionChange);
+ clearActiveLines(cm);
+ delete cm.state.activeLines;
+ }
+ if (val) {
+ cm.state.activeLines = [];
+ updateActiveLines(cm, cm.listSelections());
+ cm.on("beforeSelectionChange", selectionChange);
+ }
+ });
+
+ function clearActiveLines(cm) {
+ for (var i = 0; i < cm.state.activeLines.length; i++) {
+ cm.removeLineClass(cm.state.activeLines[i], "wrap", WRAP_CLASS);
+ cm.removeLineClass(cm.state.activeLines[i], "background", BACK_CLASS);
+ cm.removeLineClass(cm.state.activeLines[i], "gutter", GUTT_CLASS);
+ }
+ }
+
+ function sameArray(a, b) {
+ if (a.length != b.length) return false;
+ for (var i = 0; i < a.length; i++)
+ if (a[i] != b[i]) return false;
+ return true;
+ }
+
+ function updateActiveLines(cm, ranges) {
+ var active = [];
+ for (var i = 0; i < ranges.length; i++) {
+ var range = ranges[i];
+ var option = cm.getOption("styleActiveLine");
+ if (typeof option == "object" && option.nonEmpty ? range.anchor.line != range.head.line : !range.empty())
+ continue
+ var line = cm.getLineHandleVisualStart(range.head.line);
+ if (active[active.length - 1] != line) active.push(line);
+ }
+ if (sameArray(cm.state.activeLines, active)) return;
+ cm.operation(function() {
+ clearActiveLines(cm);
+ for (var i = 0; i < active.length; i++) {
+ cm.addLineClass(active[i], "wrap", WRAP_CLASS);
+ cm.addLineClass(active[i], "background", BACK_CLASS);
+ cm.addLineClass(active[i], "gutter", GUTT_CLASS);
+ }
+ cm.state.activeLines = active;
+ });
+ }
+
+ function selectionChange(cm, sel) {
+ updateActiveLines(cm, sel.ranges);
+ }
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/selection/index.php b/modules/cookiesplus/lib/CodeMirror/addon/selection/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/selection/index.php
@@ -0,0 +1,32 @@
+= to.line;
+ var end = atEnd ? to : Pos(endLine, 0);
+ var mark = cm.markText(start, end, {className: cls});
+ if (addAt == null) array.push(mark);
+ else array.splice(addAt++, 0, mark);
+ if (atEnd) break;
+ line = endLine;
+ }
+ }
+
+ function clear(cm) {
+ var array = cm.state.markedSelection;
+ for (var i = 0; i < array.length; ++i) array[i].clear();
+ array.length = 0;
+ }
+
+ function reset(cm) {
+ clear(cm);
+ var ranges = cm.listSelections();
+ for (var i = 0; i < ranges.length; i++)
+ coverRange(cm, ranges[i].from(), ranges[i].to());
+ }
+
+ function update(cm) {
+ if (!cm.somethingSelected()) return clear(cm);
+ if (cm.listSelections().length > 1) return reset(cm);
+
+ var from = cm.getCursor("start"), to = cm.getCursor("end");
+
+ var array = cm.state.markedSelection;
+ if (!array.length) return coverRange(cm, from, to);
+
+ var coverStart = array[0].find(), coverEnd = array[array.length - 1].find();
+ if (!coverStart || !coverEnd || to.line - from.line <= CHUNK_SIZE ||
+ cmp(from, coverEnd.to) >= 0 || cmp(to, coverStart.from) <= 0)
+ return reset(cm);
+
+ while (cmp(from, coverStart.from) > 0) {
+ array.shift().clear();
+ coverStart = array[0].find();
+ }
+ if (cmp(from, coverStart.from) < 0) {
+ if (coverStart.to.line - from.line < CHUNK_SIZE) {
+ array.shift().clear();
+ coverRange(cm, from, coverStart.to, 0);
+ } else {
+ coverRange(cm, from, coverStart.from, 0);
+ }
+ }
+
+ while (cmp(to, coverEnd.to) < 0) {
+ array.pop().clear();
+ coverEnd = array[array.length - 1].find();
+ }
+ if (cmp(to, coverEnd.to) > 0) {
+ if (to.line - coverEnd.from.line < CHUNK_SIZE) {
+ array.pop().clear();
+ coverRange(cm, coverEnd.from, to);
+ } else {
+ coverRange(cm, coverEnd.to, to);
+ }
+ }
+ }
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/selection/selection-pointer.js b/modules/cookiesplus/lib/CodeMirror/addon/selection/selection-pointer.js
new file mode 100644
index 00000000..2bde5a67
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/selection/selection-pointer.js
@@ -0,0 +1,118 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ CodeMirror.defineOption("selectionPointer", false, function(cm, val) {
+ var data = cm.state.selectionPointer;
+ if (data) {
+ CodeMirror.off(cm.getWrapperElement(), "mousemove", data.mousemove);
+ CodeMirror.off(cm.getWrapperElement(), "mouseout", data.mouseout);
+ CodeMirror.off(window, "scroll", data.windowScroll);
+ cm.off("cursorActivity", reset);
+ cm.off("scroll", reset);
+ cm.state.selectionPointer = null;
+ cm.display.lineDiv.style.cursor = "";
+ }
+ if (val) {
+ data = cm.state.selectionPointer = {
+ value: typeof val == "string" ? val : "default",
+ mousemove: function(event) { mousemove(cm, event); },
+ mouseout: function(event) { mouseout(cm, event); },
+ windowScroll: function() { reset(cm); },
+ rects: null,
+ mouseX: null, mouseY: null,
+ willUpdate: false
+ };
+ CodeMirror.on(cm.getWrapperElement(), "mousemove", data.mousemove);
+ CodeMirror.on(cm.getWrapperElement(), "mouseout", data.mouseout);
+ CodeMirror.on(window, "scroll", data.windowScroll);
+ cm.on("cursorActivity", reset);
+ cm.on("scroll", reset);
+ }
+ });
+
+ function mousemove(cm, event) {
+ var data = cm.state.selectionPointer;
+ if (event.buttons == null ? event.which : event.buttons) {
+ data.mouseX = data.mouseY = null;
+ } else {
+ data.mouseX = event.clientX;
+ data.mouseY = event.clientY;
+ }
+ scheduleUpdate(cm);
+ }
+
+ function mouseout(cm, event) {
+ if (!cm.getWrapperElement().contains(event.relatedTarget)) {
+ var data = cm.state.selectionPointer;
+ data.mouseX = data.mouseY = null;
+ scheduleUpdate(cm);
+ }
+ }
+
+ function reset(cm) {
+ cm.state.selectionPointer.rects = null;
+ scheduleUpdate(cm);
+ }
+
+ function scheduleUpdate(cm) {
+ if (!cm.state.selectionPointer.willUpdate) {
+ cm.state.selectionPointer.willUpdate = true;
+ setTimeout(function() {
+ update(cm);
+ cm.state.selectionPointer.willUpdate = false;
+ }, 50);
+ }
+ }
+
+ function update(cm) {
+ var data = cm.state.selectionPointer;
+ if (!data) return;
+ if (data.rects == null && data.mouseX != null) {
+ data.rects = [];
+ if (cm.somethingSelected()) {
+ for (var sel = cm.display.selectionDiv.firstChild; sel; sel = sel.nextSibling)
+ data.rects.push(sel.getBoundingClientRect());
+ }
+ }
+ var inside = false;
+ if (data.mouseX != null) for (var i = 0; i < data.rects.length; i++) {
+ var rect = data.rects[i];
+ if (rect.left <= data.mouseX && rect.right >= data.mouseX &&
+ rect.top <= data.mouseY && rect.bottom >= data.mouseY)
+ inside = true;
+ }
+ var cursor = inside ? data.value : "";
+ if (cm.display.lineDiv.style.cursor != cursor)
+ cm.display.lineDiv.style.cursor = cursor;
+ }
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/tern/index.php b/modules/cookiesplus/lib/CodeMirror/addon/tern/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/tern/index.php
@@ -0,0 +1,32 @@
+= 0)
+ ts.cachedArgHints = null;
+
+ var changed = data.changed;
+ if (changed == null)
+ data.changed = changed = {from: change.from.line, to: change.from.line};
+ var end = change.from.line + (change.text.length - 1);
+ if (change.from.line < changed.to) changed.to = changed.to - (change.to.line - end);
+ if (end >= changed.to) changed.to = end + 1;
+ if (changed.from > change.from.line) changed.from = change.from.line;
+
+ if (doc.lineCount() > bigDoc && change.to - changed.from > 100) setTimeout(function() {
+ if (data.changed && data.changed.to - data.changed.from > 100) sendDoc(ts, data);
+ }, 200);
+ }
+
+ function sendDoc(ts, doc) {
+ ts.server.request({files: [{type: "full", name: doc.name, text: docValue(ts, doc)}]}, function(error) {
+ if (error) window.console.error(error);
+ else doc.changed = null;
+ });
+ }
+
+ // Completion
+
+ function hint(ts, cm, c) {
+ ts.request(cm, {type: "completions", types: true, docs: true, urls: true}, function(error, data) {
+ if (error) return showError(ts, cm, error);
+ var completions = [], after = "";
+ var from = data.start, to = data.end;
+ if (cm.getRange(Pos(from.line, from.ch - 2), from) == "[\"" &&
+ cm.getRange(to, Pos(to.line, to.ch + 2)) != "\"]")
+ after = "\"]";
+
+ for (var i = 0; i < data.completions.length; ++i) {
+ var completion = data.completions[i], className = typeToIcon(completion.type);
+ if (data.guess) className += " " + cls + "guess";
+ completions.push({text: completion.name + after,
+ displayText: completion.displayName || completion.name,
+ className: className,
+ data: completion});
+ }
+
+ var obj = {from: from, to: to, list: completions};
+ var tooltip = null;
+ CodeMirror.on(obj, "close", function() { remove(tooltip); });
+ CodeMirror.on(obj, "update", function() { remove(tooltip); });
+ CodeMirror.on(obj, "select", function(cur, node) {
+ remove(tooltip);
+ var content = ts.options.completionTip ? ts.options.completionTip(cur.data) : cur.data.doc;
+ if (content) {
+ tooltip = makeTooltip(node.parentNode.getBoundingClientRect().right + window.pageXOffset,
+ node.getBoundingClientRect().top + window.pageYOffset, content, cm);
+ tooltip.className += " " + cls + "hint-doc";
+ }
+ });
+ c(obj);
+ });
+ }
+
+ function typeToIcon(type) {
+ var suffix;
+ if (type == "?") suffix = "unknown";
+ else if (type == "number" || type == "string" || type == "bool") suffix = type;
+ else if (/^fn\(/.test(type)) suffix = "fn";
+ else if (/^\[/.test(type)) suffix = "array";
+ else suffix = "object";
+ return cls + "completion " + cls + "completion-" + suffix;
+ }
+
+ // Type queries
+
+ function showContextInfo(ts, cm, pos, queryName, c) {
+ ts.request(cm, queryName, function(error, data) {
+ if (error) return showError(ts, cm, error);
+ if (ts.options.typeTip) {
+ var tip = ts.options.typeTip(data);
+ } else {
+ var tip = elt("span", null, elt("strong", null, data.type || "not found"));
+ if (data.doc)
+ tip.appendChild(document.createTextNode(" — " + data.doc));
+ if (data.url) {
+ tip.appendChild(document.createTextNode(" "));
+ var child = tip.appendChild(elt("a", null, "[docs]"));
+ child.href = data.url;
+ child.target = "_blank";
+ }
+ }
+ tempTooltip(cm, tip, ts);
+ if (c) c();
+ }, pos);
+ }
+
+ // Maintaining argument hints
+
+ function updateArgHints(ts, cm) {
+ closeArgHints(ts);
+
+ if (cm.somethingSelected()) return;
+ var state = cm.getTokenAt(cm.getCursor()).state;
+ var inner = CodeMirror.innerMode(cm.getMode(), state);
+ if (inner.mode.name != "javascript") return;
+ var lex = inner.state.lexical;
+ if (lex.info != "call") return;
+
+ var ch, argPos = lex.pos || 0, tabSize = cm.getOption("tabSize");
+ for (var line = cm.getCursor().line, e = Math.max(0, line - 9), found = false; line >= e; --line) {
+ var str = cm.getLine(line), extra = 0;
+ for (var pos = 0;;) {
+ var tab = str.indexOf("\t", pos);
+ if (tab == -1) break;
+ extra += tabSize - (tab + extra) % tabSize - 1;
+ pos = tab + 1;
+ }
+ ch = lex.column - extra;
+ if (str.charAt(ch) == "(") {found = true; break;}
+ }
+ if (!found) return;
+
+ var start = Pos(line, ch);
+ var cache = ts.cachedArgHints;
+ if (cache && cache.doc == cm.getDoc() && cmpPos(start, cache.start) == 0)
+ return showArgHints(ts, cm, argPos);
+
+ ts.request(cm, {type: "type", preferFunction: true, end: start}, function(error, data) {
+ if (error || !data.type || !(/^fn\(/).test(data.type)) return;
+ ts.cachedArgHints = {
+ start: start,
+ type: parseFnType(data.type),
+ name: data.exprName || data.name || "fn",
+ guess: data.guess,
+ doc: cm.getDoc()
+ };
+ showArgHints(ts, cm, argPos);
+ });
+ }
+
+ function showArgHints(ts, cm, pos) {
+ closeArgHints(ts);
+
+ var cache = ts.cachedArgHints, tp = cache.type;
+ var tip = elt("span", cache.guess ? cls + "fhint-guess" : null,
+ elt("span", cls + "fname", cache.name), "(");
+ for (var i = 0; i < tp.args.length; ++i) {
+ if (i) tip.appendChild(document.createTextNode(", "));
+ var arg = tp.args[i];
+ tip.appendChild(elt("span", cls + "farg" + (i == pos ? " " + cls + "farg-current" : ""), arg.name || "?"));
+ if (arg.type != "?") {
+ tip.appendChild(document.createTextNode(":\u00a0"));
+ tip.appendChild(elt("span", cls + "type", arg.type));
+ }
+ }
+ tip.appendChild(document.createTextNode(tp.rettype ? ") ->\u00a0" : ")"));
+ if (tp.rettype) tip.appendChild(elt("span", cls + "type", tp.rettype));
+ var place = cm.cursorCoords(null, "page");
+ var tooltip = ts.activeArgHints = makeTooltip(place.right + 1, place.bottom, tip, cm)
+ setTimeout(function() {
+ tooltip.clear = onEditorActivity(cm, function() {
+ if (ts.activeArgHints == tooltip) closeArgHints(ts) })
+ }, 20)
+ }
+
+ function parseFnType(text) {
+ var args = [], pos = 3;
+
+ function skipMatching(upto) {
+ var depth = 0, start = pos;
+ for (;;) {
+ var next = text.charAt(pos);
+ if (upto.test(next) && !depth) return text.slice(start, pos);
+ if (/[{\[\(]/.test(next)) ++depth;
+ else if (/[}\]\)]/.test(next)) --depth;
+ ++pos;
+ }
+ }
+
+ // Parse arguments
+ if (text.charAt(pos) != ")") for (;;) {
+ var name = text.slice(pos).match(/^([^, \(\[\{]+): /);
+ if (name) {
+ pos += name[0].length;
+ name = name[1];
+ }
+ args.push({name: name, type: skipMatching(/[\),]/)});
+ if (text.charAt(pos) == ")") break;
+ pos += 2;
+ }
+
+ var rettype = text.slice(pos).match(/^\) -> (.*)$/);
+
+ return {args: args, rettype: rettype && rettype[1]};
+ }
+
+ // Moving to the definition of something
+
+ function jumpToDef(ts, cm) {
+ function inner(varName) {
+ var req = {type: "definition", variable: varName || null};
+ var doc = findDoc(ts, cm.getDoc());
+ ts.server.request(buildRequest(ts, doc, req), function(error, data) {
+ if (error) return showError(ts, cm, error);
+ if (!data.file && data.url) { window.open(data.url); return; }
+
+ if (data.file) {
+ var localDoc = ts.docs[data.file], found;
+ if (localDoc && (found = findContext(localDoc.doc, data))) {
+ ts.jumpStack.push({file: doc.name,
+ start: cm.getCursor("from"),
+ end: cm.getCursor("to")});
+ moveTo(ts, doc, localDoc, found.start, found.end);
+ return;
+ }
+ }
+ showError(ts, cm, "Could not find a definition.");
+ });
+ }
+
+ if (!atInterestingExpression(cm))
+ dialog(cm, "Jump to variable", function(name) { if (name) inner(name); });
+ else
+ inner();
+ }
+
+ function jumpBack(ts, cm) {
+ var pos = ts.jumpStack.pop(), doc = pos && ts.docs[pos.file];
+ if (!doc) return;
+ moveTo(ts, findDoc(ts, cm.getDoc()), doc, pos.start, pos.end);
+ }
+
+ function moveTo(ts, curDoc, doc, start, end) {
+ doc.doc.setSelection(start, end);
+ if (curDoc != doc && ts.options.switchToDoc) {
+ closeArgHints(ts);
+ ts.options.switchToDoc(doc.name, doc.doc);
+ }
+ }
+
+ // The {line,ch} representation of positions makes this rather awkward.
+ function findContext(doc, data) {
+ var before = data.context.slice(0, data.contextOffset).split("\n");
+ var startLine = data.start.line - (before.length - 1);
+ var start = Pos(startLine, (before.length == 1 ? data.start.ch : doc.getLine(startLine).length) - before[0].length);
+
+ var text = doc.getLine(startLine).slice(start.ch);
+ for (var cur = startLine + 1; cur < doc.lineCount() && text.length < data.context.length; ++cur)
+ text += "\n" + doc.getLine(cur);
+ if (text.slice(0, data.context.length) == data.context) return data;
+
+ var cursor = doc.getSearchCursor(data.context, 0, false);
+ var nearest, nearestDist = Infinity;
+ while (cursor.findNext()) {
+ var from = cursor.from(), dist = Math.abs(from.line - start.line) * 10000;
+ if (!dist) dist = Math.abs(from.ch - start.ch);
+ if (dist < nearestDist) { nearest = from; nearestDist = dist; }
+ }
+ if (!nearest) return null;
+
+ if (before.length == 1)
+ nearest.ch += before[0].length;
+ else
+ nearest = Pos(nearest.line + (before.length - 1), before[before.length - 1].length);
+ if (data.start.line == data.end.line)
+ var end = Pos(nearest.line, nearest.ch + (data.end.ch - data.start.ch));
+ else
+ var end = Pos(nearest.line + (data.end.line - data.start.line), data.end.ch);
+ return {start: nearest, end: end};
+ }
+
+ function atInterestingExpression(cm) {
+ var pos = cm.getCursor("end"), tok = cm.getTokenAt(pos);
+ if (tok.start < pos.ch && tok.type == "comment") return false;
+ return /[\w)\]]/.test(cm.getLine(pos.line).slice(Math.max(pos.ch - 1, 0), pos.ch + 1));
+ }
+
+ // Variable renaming
+
+ function rename(ts, cm) {
+ var token = cm.getTokenAt(cm.getCursor());
+ if (!/\w/.test(token.string)) return showError(ts, cm, "Not at a variable");
+ dialog(cm, "New name for " + token.string, function(newName) {
+ ts.request(cm, {type: "rename", newName: newName, fullDocs: true}, function(error, data) {
+ if (error) return showError(ts, cm, error);
+ applyChanges(ts, data.changes);
+ });
+ });
+ }
+
+ function selectName(ts, cm) {
+ var name = findDoc(ts, cm.doc).name;
+ ts.request(cm, {type: "refs"}, function(error, data) {
+ if (error) return showError(ts, cm, error);
+ var ranges = [], cur = 0;
+ var curPos = cm.getCursor();
+ for (var i = 0; i < data.refs.length; i++) {
+ var ref = data.refs[i];
+ if (ref.file == name) {
+ ranges.push({anchor: ref.start, head: ref.end});
+ if (cmpPos(curPos, ref.start) >= 0 && cmpPos(curPos, ref.end) <= 0)
+ cur = ranges.length - 1;
+ }
+ }
+ cm.setSelections(ranges, cur);
+ });
+ }
+
+ var nextChangeOrig = 0;
+ function applyChanges(ts, changes) {
+ var perFile = Object.create(null);
+ for (var i = 0; i < changes.length; ++i) {
+ var ch = changes[i];
+ (perFile[ch.file] || (perFile[ch.file] = [])).push(ch);
+ }
+ for (var file in perFile) {
+ var known = ts.docs[file], chs = perFile[file];;
+ if (!known) continue;
+ chs.sort(function(a, b) { return cmpPos(b.start, a.start); });
+ var origin = "*rename" + (++nextChangeOrig);
+ for (var i = 0; i < chs.length; ++i) {
+ var ch = chs[i];
+ known.doc.replaceRange(ch.text, ch.start, ch.end, origin);
+ }
+ }
+ }
+
+ // Generic request-building helper
+
+ function buildRequest(ts, doc, query, pos) {
+ var files = [], offsetLines = 0, allowFragments = !query.fullDocs;
+ if (!allowFragments) delete query.fullDocs;
+ if (typeof query == "string") query = {type: query};
+ query.lineCharPositions = true;
+ if (query.end == null) {
+ query.end = pos || doc.doc.getCursor("end");
+ if (doc.doc.somethingSelected())
+ query.start = doc.doc.getCursor("start");
+ }
+ var startPos = query.start || query.end;
+
+ if (doc.changed) {
+ if (doc.doc.lineCount() > bigDoc && allowFragments !== false &&
+ doc.changed.to - doc.changed.from < 100 &&
+ doc.changed.from <= startPos.line && doc.changed.to > query.end.line) {
+ files.push(getFragmentAround(doc, startPos, query.end));
+ query.file = "#0";
+ var offsetLines = files[0].offsetLines;
+ if (query.start != null) query.start = Pos(query.start.line - -offsetLines, query.start.ch);
+ query.end = Pos(query.end.line - offsetLines, query.end.ch);
+ } else {
+ files.push({type: "full",
+ name: doc.name,
+ text: docValue(ts, doc)});
+ query.file = doc.name;
+ doc.changed = null;
+ }
+ } else {
+ query.file = doc.name;
+ }
+ for (var name in ts.docs) {
+ var cur = ts.docs[name];
+ if (cur.changed && cur != doc) {
+ files.push({type: "full", name: cur.name, text: docValue(ts, cur)});
+ cur.changed = null;
+ }
+ }
+
+ return {query: query, files: files};
+ }
+
+ function getFragmentAround(data, start, end) {
+ var doc = data.doc;
+ var minIndent = null, minLine = null, endLine, tabSize = 4;
+ for (var p = start.line - 1, min = Math.max(0, p - 50); p >= min; --p) {
+ var line = doc.getLine(p), fn = line.search(/\bfunction\b/);
+ if (fn < 0) continue;
+ var indent = CodeMirror.countColumn(line, null, tabSize);
+ if (minIndent != null && minIndent <= indent) continue;
+ minIndent = indent;
+ minLine = p;
+ }
+ if (minLine == null) minLine = min;
+ var max = Math.min(doc.lastLine(), end.line + 20);
+ if (minIndent == null || minIndent == CodeMirror.countColumn(doc.getLine(start.line), null, tabSize))
+ endLine = max;
+ else for (endLine = end.line + 1; endLine < max; ++endLine) {
+ var indent = CodeMirror.countColumn(doc.getLine(endLine), null, tabSize);
+ if (indent <= minIndent) break;
+ }
+ var from = Pos(minLine, 0);
+
+ return {type: "part",
+ name: data.name,
+ offsetLines: from.line,
+ text: doc.getRange(from, Pos(endLine, end.line == endLine ? null : 0))};
+ }
+
+ // Generic utilities
+
+ var cmpPos = CodeMirror.cmpPos;
+
+ function elt(tagname, cls /*, ... elts*/) {
+ var e = document.createElement(tagname);
+ if (cls) e.className = cls;
+ for (var i = 2; i < arguments.length; ++i) {
+ var elt = arguments[i];
+ if (typeof elt == "string") elt = document.createTextNode(elt);
+ e.appendChild(elt);
+ }
+ return e;
+ }
+
+ function dialog(cm, text, f) {
+ if (cm.openDialog)
+ cm.openDialog(text + ": ", f);
+ else
+ f(prompt(text, ""));
+ }
+
+ // Tooltips
+
+ function tempTooltip(cm, content, ts) {
+ if (cm.state.ternTooltip) remove(cm.state.ternTooltip);
+ var where = cm.cursorCoords();
+ var tip = cm.state.ternTooltip = makeTooltip(where.right + 1, where.bottom, content, cm);
+ function maybeClear() {
+ old = true;
+ if (!mouseOnTip) clear();
+ }
+ function clear() {
+ cm.state.ternTooltip = null;
+ if (tip.parentNode) fadeOut(tip)
+ clearActivity()
+ }
+ var mouseOnTip = false, old = false;
+ CodeMirror.on(tip, "mousemove", function() { mouseOnTip = true; });
+ CodeMirror.on(tip, "mouseout", function(e) {
+ var related = e.relatedTarget || e.toElement
+ if (!related || !CodeMirror.contains(tip, related)) {
+ if (old) clear();
+ else mouseOnTip = false;
+ }
+ });
+ setTimeout(maybeClear, ts.options.hintDelay ? ts.options.hintDelay : 1700);
+ var clearActivity = onEditorActivity(cm, clear)
+ }
+
+ function onEditorActivity(cm, f) {
+ cm.on("cursorActivity", f)
+ cm.on("blur", f)
+ cm.on("scroll", f)
+ cm.on("setDoc", f)
+ return function() {
+ cm.off("cursorActivity", f)
+ cm.off("blur", f)
+ cm.off("scroll", f)
+ cm.off("setDoc", f)
+ }
+ }
+
+ function makeTooltip(x, y, content, cm) {
+ var node = elt("div", cls + "tooltip", content);
+ node.style.left = x + "px";
+ node.style.top = y + "px";
+ var container = ((cm.options || {}).hintOptions || {}).container || document.body;
+ container.appendChild(node);
+ return node;
+ }
+
+ function remove(node) {
+ var p = node && node.parentNode;
+ if (p) p.removeChild(node);
+ }
+
+ function fadeOut(tooltip) {
+ tooltip.style.opacity = "0";
+ setTimeout(function() { remove(tooltip); }, 1100);
+ }
+
+ function showError(ts, cm, msg) {
+ if (ts.options.showError)
+ ts.options.showError(cm, msg);
+ else
+ tempTooltip(cm, String(msg), ts);
+ }
+
+ function closeArgHints(ts) {
+ if (ts.activeArgHints) {
+ if (ts.activeArgHints.clear) ts.activeArgHints.clear()
+ remove(ts.activeArgHints)
+ ts.activeArgHints = null
+ }
+ }
+
+ function docValue(ts, doc) {
+ var val = doc.doc.getValue();
+ if (ts.options.fileFilter) val = ts.options.fileFilter(val, doc.name, doc.doc);
+ return val;
+ }
+
+ // Worker wrapper
+
+ function WorkerServer(ts) {
+ var worker = ts.worker = new Worker(ts.options.workerScript);
+ worker.postMessage({type: "init",
+ defs: ts.options.defs,
+ plugins: ts.options.plugins,
+ scripts: ts.options.workerDeps});
+ var msgId = 0, pending = {};
+
+ function send(data, c) {
+ if (c) {
+ data.id = ++msgId;
+ pending[msgId] = c;
+ }
+ worker.postMessage(data);
+ }
+ worker.onmessage = function(e) {
+ var data = e.data;
+ if (data.type == "getFile") {
+ getFile(ts, data.name, function(err, text) {
+ send({type: "getFile", err: String(err), text: text, id: data.id});
+ });
+ } else if (data.type == "debug") {
+ window.console.log(data.message);
+ } else if (data.id && pending[data.id]) {
+ pending[data.id](data.err, data.body);
+ delete pending[data.id];
+ }
+ };
+ worker.onerror = function(e) {
+ for (var id in pending) pending[id](e);
+ pending = {};
+ };
+
+ this.addFile = function(name, text) { send({type: "add", name: name, text: text}); };
+ this.delFile = function(name) { send({type: "del", name: name}); };
+ this.request = function(body, c) { send({type: "req", body: body}, c); };
+ }
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/tern/worker.js b/modules/cookiesplus/lib/CodeMirror/addon/tern/worker.js
new file mode 100644
index 00000000..00414b4a
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/tern/worker.js
@@ -0,0 +1,64 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+// declare global: tern, server
+
+var server;
+
+this.onmessage = function(e) {
+ var data = e.data;
+ switch (data.type) {
+ case "init": return startServer(data.defs, data.plugins, data.scripts);
+ case "add": return server.addFile(data.name, data.text);
+ case "del": return server.delFile(data.name);
+ case "req": return server.request(data.body, function(err, reqData) {
+ postMessage({id: data.id, body: reqData, err: err && String(err)});
+ });
+ case "getFile":
+ var c = pending[data.id];
+ delete pending[data.id];
+ return c(data.err, data.text);
+ default: throw new Error("Unknown message type: " + data.type);
+ }
+};
+
+var nextId = 0, pending = {};
+function getFile(file, c) {
+ postMessage({type: "getFile", name: file, id: ++nextId});
+ pending[nextId] = c;
+}
+
+function startServer(defs, plugins, scripts) {
+ if (scripts) importScripts.apply(null, scripts);
+
+ server = new tern.Server({
+ getFile: getFile,
+ async: true,
+ defs: defs,
+ plugins: plugins
+ });
+}
+
+this.console = {
+ log: function(v) { postMessage({type: "debug", message: v}); }
+};
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/wrap/hardwrap.js b/modules/cookiesplus/lib/CodeMirror/addon/wrap/hardwrap.js
new file mode 100644
index 00000000..64a75581
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/wrap/hardwrap.js
@@ -0,0 +1,179 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ "use strict";
+
+ var Pos = CodeMirror.Pos;
+
+ function findParagraph(cm, pos, options) {
+ var startRE = options.paragraphStart || cm.getHelper(pos, "paragraphStart");
+ for (var start = pos.line, first = cm.firstLine(); start > first; --start) {
+ var line = cm.getLine(start);
+ if (startRE && startRE.test(line)) break;
+ if (!/\S/.test(line)) { ++start; break; }
+ }
+ var endRE = options.paragraphEnd || cm.getHelper(pos, "paragraphEnd");
+ for (var end = pos.line + 1, last = cm.lastLine(); end <= last; ++end) {
+ var line = cm.getLine(end);
+ if (endRE && endRE.test(line)) { ++end; break; }
+ if (!/\S/.test(line)) break;
+ }
+ return {from: start, to: end};
+ }
+
+ function findBreakPoint(text, column, wrapOn, killTrailingSpace, forceBreak) {
+ var at = column
+ while (at < text.length && text.charAt(at) == " ") at++
+ for (; at > 0; --at)
+ if (wrapOn.test(text.slice(at - 1, at + 1))) break;
+
+ if (at == 0 && !forceBreak) {
+ // didn't find a break point before column, in non-forceBreak mode try to
+ // find one after 'column'.
+ for (at = column + 1; at < text.length - 1; ++at) {
+ if (wrapOn.test(text.slice(at - 1, at + 1))) break;
+ }
+ }
+
+ for (var first = true;; first = false) {
+ var endOfText = at;
+ if (killTrailingSpace)
+ while (text.charAt(endOfText - 1) == " ") --endOfText;
+ if (endOfText == 0 && first) at = column;
+ else return {from: endOfText, to: at};
+ }
+ }
+
+ function wrapRange(cm, from, to, options) {
+ from = cm.clipPos(from); to = cm.clipPos(to);
+ var column = options.column || 80;
+ var wrapOn = options.wrapOn || /\s\S|-[^\.\d]/;
+ var forceBreak = options.forceBreak !== false;
+ var killTrailing = options.killTrailingSpace !== false;
+ var changes = [], curLine = "", curNo = from.line;
+ var lines = cm.getRange(from, to, false);
+ if (!lines.length) return null;
+ var leadingSpace = lines[0].match(/^[ \t]*/)[0];
+ if (leadingSpace.length >= column) column = leadingSpace.length + 1
+
+ for (var i = 0; i < lines.length; ++i) {
+ var text = lines[i], oldLen = curLine.length, spaceInserted = 0;
+ if (curLine && text && !wrapOn.test(curLine.charAt(curLine.length - 1) + text.charAt(0))) {
+ curLine += " ";
+ spaceInserted = 1;
+ }
+ var spaceTrimmed = "";
+ if (i) {
+ spaceTrimmed = text.match(/^\s*/)[0];
+ text = text.slice(spaceTrimmed.length);
+ }
+ curLine += text;
+ if (i) {
+ var firstBreak = curLine.length > column && leadingSpace == spaceTrimmed &&
+ findBreakPoint(curLine, column, wrapOn, killTrailing, forceBreak);
+ // If this isn't broken, or is broken at a different point, remove old break
+ if (!firstBreak || firstBreak.from != oldLen || firstBreak.to != oldLen + spaceInserted) {
+ changes.push({text: [spaceInserted ? " " : ""],
+ from: Pos(curNo, oldLen),
+ to: Pos(curNo + 1, spaceTrimmed.length)});
+ } else {
+ curLine = leadingSpace + text;
+ ++curNo;
+ }
+ }
+ while (curLine.length > column) {
+ var bp = findBreakPoint(curLine, column, wrapOn, killTrailing, forceBreak);
+ if (bp.from != bp.to || forceBreak) {
+ changes.push({text: ["", leadingSpace],
+ from: Pos(curNo, bp.from),
+ to: Pos(curNo, bp.to)});
+ curLine = leadingSpace + curLine.slice(bp.to);
+ ++curNo;
+ } else {
+ break;
+ }
+ }
+ }
+ if (changes.length) cm.operation(function() {
+ for (var i = 0; i < changes.length; ++i) {
+ var change = changes[i];
+ if (change.text || CodeMirror.cmpPos(change.from, change.to))
+ cm.replaceRange(change.text, change.from, change.to);
+ }
+ });
+ return changes.length ? {from: changes[0].from, to: CodeMirror.changeEnd(changes[changes.length - 1])} : null;
+ }
+
+ CodeMirror.defineExtension("wrapParagraph", function(pos, options) {
+ options = options || {};
+ if (!pos) pos = this.getCursor();
+ var para = findParagraph(this, pos, options);
+ return wrapRange(this, Pos(para.from, 0), Pos(para.to - 1), options);
+ });
+
+ CodeMirror.commands.wrapLines = function(cm) {
+ cm.operation(function() {
+ var ranges = cm.listSelections(), at = cm.lastLine() + 1;
+ for (var i = ranges.length - 1; i >= 0; i--) {
+ var range = ranges[i], span;
+ if (range.empty()) {
+ var para = findParagraph(cm, range.head, {});
+ span = {from: Pos(para.from, 0), to: Pos(para.to - 1)};
+ } else {
+ span = {from: range.from(), to: range.to()};
+ }
+ if (span.to.line >= at) continue;
+ at = span.from.line;
+ wrapRange(cm, span.from, span.to, {});
+ }
+ });
+ };
+
+ CodeMirror.defineExtension("wrapRange", function(from, to, options) {
+ return wrapRange(this, from, to, options || {});
+ });
+
+ CodeMirror.defineExtension("wrapParagraphsInRange", function(from, to, options) {
+ options = options || {};
+ var cm = this, paras = [];
+ for (var line = from.line; line <= to.line;) {
+ var para = findParagraph(cm, Pos(line, 0), options);
+ paras.push(para);
+ line = para.to;
+ }
+ var madeChange = false;
+ if (paras.length) cm.operation(function() {
+ for (var i = paras.length - 1; i >= 0; --i)
+ madeChange = madeChange || wrapRange(cm, Pos(paras[i].from, 0), Pos(paras[i].to - 1), options);
+ });
+ return madeChange;
+ });
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/addon/wrap/index.php b/modules/cookiesplus/lib/CodeMirror/addon/wrap/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/addon/wrap/index.php
@@ -0,0 +1,32 @@
+
+
+
+
+CodeMirror
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
CodeMirror is a versatile text editor
+ implemented in JavaScript for the browser. It is specialized for
+ editing code, and comes with a number of language modes and addons
+ that implement more advanced editing functionality.
+
+
A rich programming API and a
+ CSS theming system are
+ available for customizing CodeMirror to fit your application, and
+ extending it with new functionality.
Development and bug tracking happens
+ on github
+ (alternate git
+ repository).
+ Please read these
+ pointers before submitting a bug. Use pull requests to submit
+ patches. All contributions must be released under the same MIT
+ license that CodeMirror uses.
+
+
Discussion around the project is done on
+ a discussion forum.
+ Announcements related to the project, such as new versions, are
+ posted in the
+ forum's "announce"
+ category. If needed, you can
+ contact the maintainer
+ directly. We aim to be an inclusive, welcoming community. To make
+ that explicit, we have
+ a code of
+ conduct that applies to communication around the project.
+
+
+
+
Browser support
+
The desktop versions of the following browsers,
+ in standards mode (HTML5 <!doctype html>
+ recommended) are supported:
+
+
Firefox
version 4 and up
+
Chrome
any version
+
Safari
version 5.2 and up
+
Internet Explorer/Edge
version 8 and up
+
Opera
version 9 and up
+
+
Support for modern mobile browsers is experimental. Recent
+ versions of the iOS browser and Chrome on Android should work
+ pretty well.
+
+
+
+
+
+
Sponsors
+
These companies support development of this project:
+
+
+
+
+
+
+
diff --git a/modules/cookiesplus/lib/CodeMirror/index.php b/modules/cookiesplus/lib/CodeMirror/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/index.php
@@ -0,0 +1,32 @@
+ 50) killRing.shift();
+ }
+ function growRingTop(str) {
+ if (!killRing.length) return addToRing(str);
+ killRing[killRing.length - 1] += str;
+ }
+ function getFromRing(n) { return killRing[killRing.length - (n ? Math.min(n, 1) : 1)] || ""; }
+ function popFromRing() { if (killRing.length > 1) killRing.pop(); return getFromRing(); }
+
+ var lastKill = null;
+
+ function kill(cm, from, to, ring, text) {
+ if (text == null) text = cm.getRange(from, to);
+
+ if (ring == "grow" && lastKill && lastKill.cm == cm && posEq(from, lastKill.pos) && cm.isClean(lastKill.gen))
+ growRingTop(text);
+ else if (ring !== false)
+ addToRing(text);
+ cm.replaceRange("", from, to, "+delete");
+
+ if (ring == "grow") lastKill = {cm: cm, pos: from, gen: cm.changeGeneration()};
+ else lastKill = null;
+ }
+
+ // Boundaries of various units
+
+ function byChar(cm, pos, dir) {
+ return cm.findPosH(pos, dir, "char", true);
+ }
+
+ function byWord(cm, pos, dir) {
+ return cm.findPosH(pos, dir, "word", true);
+ }
+
+ function byLine(cm, pos, dir) {
+ return cm.findPosV(pos, dir, "line", cm.doc.sel.goalColumn);
+ }
+
+ function byPage(cm, pos, dir) {
+ return cm.findPosV(pos, dir, "page", cm.doc.sel.goalColumn);
+ }
+
+ function byParagraph(cm, pos, dir) {
+ var no = pos.line, line = cm.getLine(no);
+ var sawText = /\S/.test(dir < 0 ? line.slice(0, pos.ch) : line.slice(pos.ch));
+ var fst = cm.firstLine(), lst = cm.lastLine();
+ for (;;) {
+ no += dir;
+ if (no < fst || no > lst)
+ return cm.clipPos(Pos(no - dir, dir < 0 ? 0 : null));
+ line = cm.getLine(no);
+ var hasText = /\S/.test(line);
+ if (hasText) sawText = true;
+ else if (sawText) return Pos(no, 0);
+ }
+ }
+
+ function bySentence(cm, pos, dir) {
+ var line = pos.line, ch = pos.ch;
+ var text = cm.getLine(pos.line), sawWord = false;
+ for (;;) {
+ var next = text.charAt(ch + (dir < 0 ? -1 : 0));
+ if (!next) { // End/beginning of line reached
+ if (line == (dir < 0 ? cm.firstLine() : cm.lastLine())) return Pos(line, ch);
+ text = cm.getLine(line + dir);
+ if (!/\S/.test(text)) return Pos(line, ch);
+ line += dir;
+ ch = dir < 0 ? text.length : 0;
+ continue;
+ }
+ if (sawWord && /[!?.]/.test(next)) return Pos(line, ch + (dir > 0 ? 1 : 0));
+ if (!sawWord) sawWord = /\w/.test(next);
+ ch += dir;
+ }
+ }
+
+ function byExpr(cm, pos, dir) {
+ var wrap;
+ if (cm.findMatchingBracket && (wrap = cm.findMatchingBracket(pos, {strict: true}))
+ && wrap.match && (wrap.forward ? 1 : -1) == dir)
+ return dir > 0 ? Pos(wrap.to.line, wrap.to.ch + 1) : wrap.to;
+
+ for (var first = true;; first = false) {
+ var token = cm.getTokenAt(pos);
+ var after = Pos(pos.line, dir < 0 ? token.start : token.end);
+ if (first && dir > 0 && token.end == pos.ch || !/\w/.test(token.string)) {
+ var newPos = cm.findPosH(after, dir, "char");
+ if (posEq(after, newPos)) return pos;
+ else pos = newPos;
+ } else {
+ return after;
+ }
+ }
+ }
+
+ // Prefixes (only crudely supported)
+
+ function getPrefix(cm, precise) {
+ var digits = cm.state.emacsPrefix;
+ if (!digits) return precise ? null : 1;
+ clearPrefix(cm);
+ return digits == "-" ? -1 : Number(digits);
+ }
+
+ function repeated(cmd) {
+ var f = typeof cmd == "string" ? function(cm) { cm.execCommand(cmd); } : cmd;
+ return function(cm) {
+ var prefix = getPrefix(cm);
+ f(cm);
+ for (var i = 1; i < prefix; ++i) f(cm);
+ };
+ }
+
+ function findEnd(cm, pos, by, dir) {
+ var prefix = getPrefix(cm);
+ if (prefix < 0) { dir = -dir; prefix = -prefix; }
+ for (var i = 0; i < prefix; ++i) {
+ var newPos = by(cm, pos, dir);
+ if (posEq(newPos, pos)) break;
+ pos = newPos;
+ }
+ return pos;
+ }
+
+ function move(by, dir) {
+ var f = function(cm) {
+ cm.extendSelection(findEnd(cm, cm.getCursor(), by, dir));
+ };
+ f.motion = true;
+ return f;
+ }
+
+ function killTo(cm, by, dir, ring) {
+ var selections = cm.listSelections(), cursor;
+ var i = selections.length;
+ while (i--) {
+ cursor = selections[i].head;
+ kill(cm, cursor, findEnd(cm, cursor, by, dir), ring);
+ }
+ }
+
+ function killRegion(cm, ring) {
+ if (cm.somethingSelected()) {
+ var selections = cm.listSelections(), selection;
+ var i = selections.length;
+ while (i--) {
+ selection = selections[i];
+ kill(cm, selection.anchor, selection.head, ring);
+ }
+ return true;
+ }
+ }
+
+ function addPrefix(cm, digit) {
+ if (cm.state.emacsPrefix) {
+ if (digit != "-") cm.state.emacsPrefix += digit;
+ return;
+ }
+ // Not active yet
+ cm.state.emacsPrefix = digit;
+ cm.on("keyHandled", maybeClearPrefix);
+ cm.on("inputRead", maybeDuplicateInput);
+ }
+
+ var prefixPreservingKeys = {"Alt-G": true, "Ctrl-X": true, "Ctrl-Q": true, "Ctrl-U": true};
+
+ function maybeClearPrefix(cm, arg) {
+ if (!cm.state.emacsPrefixMap && !prefixPreservingKeys.hasOwnProperty(arg))
+ clearPrefix(cm);
+ }
+
+ function clearPrefix(cm) {
+ cm.state.emacsPrefix = null;
+ cm.off("keyHandled", maybeClearPrefix);
+ cm.off("inputRead", maybeDuplicateInput);
+ }
+
+ function maybeDuplicateInput(cm, event) {
+ var dup = getPrefix(cm);
+ if (dup > 1 && event.origin == "+input") {
+ var one = event.text.join("\n"), txt = "";
+ for (var i = 1; i < dup; ++i) txt += one;
+ cm.replaceSelection(txt);
+ }
+ }
+
+ function addPrefixMap(cm) {
+ cm.state.emacsPrefixMap = true;
+ cm.addKeyMap(prefixMap);
+ cm.on("keyHandled", maybeRemovePrefixMap);
+ cm.on("inputRead", maybeRemovePrefixMap);
+ }
+
+ function maybeRemovePrefixMap(cm, arg) {
+ if (typeof arg == "string" && (/^\d$/.test(arg) || arg == "Ctrl-U")) return;
+ cm.removeKeyMap(prefixMap);
+ cm.state.emacsPrefixMap = false;
+ cm.off("keyHandled", maybeRemovePrefixMap);
+ cm.off("inputRead", maybeRemovePrefixMap);
+ }
+
+ // Utilities
+
+ function setMark(cm) {
+ cm.setCursor(cm.getCursor());
+ cm.setExtending(!cm.getExtending());
+ cm.on("change", function() { cm.setExtending(false); });
+ }
+
+ function clearMark(cm) {
+ cm.setExtending(false);
+ cm.setCursor(cm.getCursor());
+ }
+
+ function getInput(cm, msg, f) {
+ if (cm.openDialog)
+ cm.openDialog(msg + ": ", f, {bottom: true});
+ else
+ f(prompt(msg, ""));
+ }
+
+ function operateOnWord(cm, op) {
+ var start = cm.getCursor(), end = cm.findPosH(start, 1, "word");
+ cm.replaceRange(op(cm.getRange(start, end)), start, end);
+ cm.setCursor(end);
+ }
+
+ function toEnclosingExpr(cm) {
+ var pos = cm.getCursor(), line = pos.line, ch = pos.ch;
+ var stack = [];
+ while (line >= cm.firstLine()) {
+ var text = cm.getLine(line);
+ for (var i = ch == null ? text.length : ch; i > 0;) {
+ var ch = text.charAt(--i);
+ if (ch == ")")
+ stack.push("(");
+ else if (ch == "]")
+ stack.push("[");
+ else if (ch == "}")
+ stack.push("{");
+ else if (/[\(\{\[]/.test(ch) && (!stack.length || stack.pop() != ch))
+ return cm.extendSelection(Pos(line, i));
+ }
+ --line; ch = null;
+ }
+ }
+
+ function quit(cm) {
+ cm.execCommand("clearSearch");
+ clearMark(cm);
+ }
+
+ CodeMirror.emacs = {kill: kill, killRegion: killRegion, repeated: repeated};
+
+ // Actual keymap
+
+ var keyMap = CodeMirror.keyMap.emacs = CodeMirror.normalizeKeyMap({
+ "Ctrl-W": function(cm) {kill(cm, cm.getCursor("start"), cm.getCursor("end"), true);},
+ "Ctrl-K": repeated(function(cm) {
+ var start = cm.getCursor(), end = cm.clipPos(Pos(start.line));
+ var text = cm.getRange(start, end);
+ if (!/\S/.test(text)) {
+ text += "\n";
+ end = Pos(start.line + 1, 0);
+ }
+ kill(cm, start, end, "grow", text);
+ }),
+ "Alt-W": function(cm) {
+ addToRing(cm.getSelection());
+ clearMark(cm);
+ },
+ "Ctrl-Y": function(cm) {
+ var start = cm.getCursor();
+ cm.replaceRange(getFromRing(getPrefix(cm)), start, start, "paste");
+ cm.setSelection(start, cm.getCursor());
+ },
+ "Alt-Y": function(cm) {cm.replaceSelection(popFromRing(), "around", "paste");},
+
+ "Ctrl-Space": setMark, "Ctrl-Shift-2": setMark,
+
+ "Ctrl-F": move(byChar, 1), "Ctrl-B": move(byChar, -1),
+ "Right": move(byChar, 1), "Left": move(byChar, -1),
+ "Ctrl-D": function(cm) { killTo(cm, byChar, 1, false); },
+ "Delete": function(cm) { killRegion(cm, false) || killTo(cm, byChar, 1, false); },
+ "Ctrl-H": function(cm) { killTo(cm, byChar, -1, false); },
+ "Backspace": function(cm) { killRegion(cm, false) || killTo(cm, byChar, -1, false); },
+
+ "Alt-F": move(byWord, 1), "Alt-B": move(byWord, -1),
+ "Alt-Right": move(byWord, 1), "Alt-Left": move(byWord, -1),
+ "Alt-D": function(cm) { killTo(cm, byWord, 1, "grow"); },
+ "Alt-Backspace": function(cm) { killTo(cm, byWord, -1, "grow"); },
+
+ "Ctrl-N": move(byLine, 1), "Ctrl-P": move(byLine, -1),
+ "Down": move(byLine, 1), "Up": move(byLine, -1),
+ "Ctrl-A": "goLineStart", "Ctrl-E": "goLineEnd",
+ "End": "goLineEnd", "Home": "goLineStart",
+
+ "Alt-V": move(byPage, -1), "Ctrl-V": move(byPage, 1),
+ "PageUp": move(byPage, -1), "PageDown": move(byPage, 1),
+
+ "Ctrl-Up": move(byParagraph, -1), "Ctrl-Down": move(byParagraph, 1),
+
+ "Alt-A": move(bySentence, -1), "Alt-E": move(bySentence, 1),
+ "Alt-K": function(cm) { killTo(cm, bySentence, 1, "grow"); },
+
+ "Ctrl-Alt-K": function(cm) { killTo(cm, byExpr, 1, "grow"); },
+ "Ctrl-Alt-Backspace": function(cm) { killTo(cm, byExpr, -1, "grow"); },
+ "Ctrl-Alt-F": move(byExpr, 1), "Ctrl-Alt-B": move(byExpr, -1, "grow"),
+
+ "Shift-Ctrl-Alt-2": function(cm) {
+ var cursor = cm.getCursor();
+ cm.setSelection(findEnd(cm, cursor, byExpr, 1), cursor);
+ },
+ "Ctrl-Alt-T": function(cm) {
+ var leftStart = byExpr(cm, cm.getCursor(), -1), leftEnd = byExpr(cm, leftStart, 1);
+ var rightEnd = byExpr(cm, leftEnd, 1), rightStart = byExpr(cm, rightEnd, -1);
+ cm.replaceRange(cm.getRange(rightStart, rightEnd) + cm.getRange(leftEnd, rightStart) +
+ cm.getRange(leftStart, leftEnd), leftStart, rightEnd);
+ },
+ "Ctrl-Alt-U": repeated(toEnclosingExpr),
+
+ "Alt-Space": function(cm) {
+ var pos = cm.getCursor(), from = pos.ch, to = pos.ch, text = cm.getLine(pos.line);
+ while (from && /\s/.test(text.charAt(from - 1))) --from;
+ while (to < text.length && /\s/.test(text.charAt(to))) ++to;
+ cm.replaceRange(" ", Pos(pos.line, from), Pos(pos.line, to));
+ },
+ "Ctrl-O": repeated(function(cm) { cm.replaceSelection("\n", "start"); }),
+ "Ctrl-T": repeated(function(cm) {
+ cm.execCommand("transposeChars");
+ }),
+
+ "Alt-C": repeated(function(cm) {
+ operateOnWord(cm, function(w) {
+ var letter = w.search(/\w/);
+ if (letter == -1) return w;
+ return w.slice(0, letter) + w.charAt(letter).toUpperCase() + w.slice(letter + 1).toLowerCase();
+ });
+ }),
+ "Alt-U": repeated(function(cm) {
+ operateOnWord(cm, function(w) { return w.toUpperCase(); });
+ }),
+ "Alt-L": repeated(function(cm) {
+ operateOnWord(cm, function(w) { return w.toLowerCase(); });
+ }),
+
+ "Alt-;": "toggleComment",
+
+ "Ctrl-/": repeated("undo"), "Shift-Ctrl--": repeated("undo"),
+ "Ctrl-Z": repeated("undo"), "Cmd-Z": repeated("undo"),
+ "Shift-Ctrl-Z": "redo",
+ "Shift-Alt-,": "goDocStart", "Shift-Alt-.": "goDocEnd",
+ "Ctrl-S": "findPersistentNext", "Ctrl-R": "findPersistentPrev", "Ctrl-G": quit, "Shift-Alt-5": "replace",
+ "Alt-/": "autocomplete",
+ "Enter": "newlineAndIndent",
+ "Ctrl-J": repeated(function(cm) { cm.replaceSelection("\n", "end"); }),
+ "Tab": "indentAuto",
+
+ "Alt-G G": function(cm) {
+ var prefix = getPrefix(cm, true);
+ if (prefix != null && prefix > 0) return cm.setCursor(prefix - 1);
+
+ getInput(cm, "Goto line", function(str) {
+ var num;
+ if (str && !isNaN(num = Number(str)) && num == (num|0) && num > 0)
+ cm.setCursor(num - 1);
+ });
+ },
+
+ "Ctrl-X Tab": function(cm) {
+ cm.indentSelection(getPrefix(cm, true) || cm.getOption("indentUnit"));
+ },
+ "Ctrl-X Ctrl-X": function(cm) {
+ cm.setSelection(cm.getCursor("head"), cm.getCursor("anchor"));
+ },
+ "Ctrl-X Ctrl-S": "save",
+ "Ctrl-X Ctrl-W": "save",
+ "Ctrl-X S": "saveAll",
+ "Ctrl-X F": "open",
+ "Ctrl-X U": repeated("undo"),
+ "Ctrl-X K": "close",
+ "Ctrl-X Delete": function(cm) { kill(cm, cm.getCursor(), bySentence(cm, cm.getCursor(), 1), "grow"); },
+ "Ctrl-X H": "selectAll",
+
+ "Ctrl-Q Tab": repeated("insertTab"),
+ "Ctrl-U": addPrefixMap,
+ "fallthrough": "default"
+ });
+
+ var prefixMap = {"Ctrl-G": clearPrefix};
+ function regPrefix(d) {
+ prefixMap[d] = function(cm) { addPrefix(cm, d); };
+ keyMap["Ctrl-" + d] = function(cm) { addPrefix(cm, d); };
+ prefixPreservingKeys["Ctrl-" + d] = true;
+ }
+ for (var i = 0; i < 10; ++i) regPrefix(String(i));
+ regPrefix("-");
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/keymap/index.php b/modules/cookiesplus/lib/CodeMirror/keymap/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/keymap/index.php
@@ -0,0 +1,32 @@
+ 0 && start.ch >= line.length) return doc.clipPos(Pos(start.line + 1, 0));
+ var state = "start", type, startPos = start.ch;
+ for (var pos = startPos, e = dir < 0 ? 0 : line.length, i = 0; pos != e; pos += dir, i++) {
+ var next = line.charAt(dir < 0 ? pos - 1 : pos);
+ var cat = next != "_" && CodeMirror.isWordChar(next) ? "w" : "o";
+ if (cat == "w" && next.toUpperCase() == next) cat = "W";
+ if (state == "start") {
+ if (cat != "o") { state = "in"; type = cat; }
+ else startPos = pos + dir
+ } else if (state == "in") {
+ if (type != cat) {
+ if (type == "w" && cat == "W" && dir < 0) pos--;
+ if (type == "W" && cat == "w" && dir > 0) { // From uppercase to lowercase
+ if (pos == startPos + 1) { type = "w"; continue; }
+ else pos--;
+ }
+ break;
+ }
+ }
+ }
+ return Pos(start.line, pos);
+ }
+
+ function moveSubword(cm, dir) {
+ cm.extendSelectionsBy(function(range) {
+ if (cm.display.shift || cm.doc.extend || range.empty())
+ return findPosSubword(cm.doc, range.head, dir);
+ else
+ return dir < 0 ? range.from() : range.to();
+ });
+ }
+
+ cmds.goSubwordLeft = function(cm) { moveSubword(cm, -1); };
+ cmds.goSubwordRight = function(cm) { moveSubword(cm, 1); };
+
+ cmds.scrollLineUp = function(cm) {
+ var info = cm.getScrollInfo();
+ if (!cm.somethingSelected()) {
+ var visibleBottomLine = cm.lineAtHeight(info.top + info.clientHeight, "local");
+ if (cm.getCursor().line >= visibleBottomLine)
+ cm.execCommand("goLineUp");
+ }
+ cm.scrollTo(null, info.top - cm.defaultTextHeight());
+ };
+ cmds.scrollLineDown = function(cm) {
+ var info = cm.getScrollInfo();
+ if (!cm.somethingSelected()) {
+ var visibleTopLine = cm.lineAtHeight(info.top, "local")+1;
+ if (cm.getCursor().line <= visibleTopLine)
+ cm.execCommand("goLineDown");
+ }
+ cm.scrollTo(null, info.top + cm.defaultTextHeight());
+ };
+
+ cmds.splitSelectionByLine = function(cm) {
+ var ranges = cm.listSelections(), lineRanges = [];
+ for (var i = 0; i < ranges.length; i++) {
+ var from = ranges[i].from(), to = ranges[i].to();
+ for (var line = from.line; line <= to.line; ++line)
+ if (!(to.line > from.line && line == to.line && to.ch == 0))
+ lineRanges.push({anchor: line == from.line ? from : Pos(line, 0),
+ head: line == to.line ? to : Pos(line)});
+ }
+ cm.setSelections(lineRanges, 0);
+ };
+
+ cmds.singleSelectionTop = function(cm) {
+ var range = cm.listSelections()[0];
+ cm.setSelection(range.anchor, range.head, {scroll: false});
+ };
+
+ cmds.selectLine = function(cm) {
+ var ranges = cm.listSelections(), extended = [];
+ for (var i = 0; i < ranges.length; i++) {
+ var range = ranges[i];
+ extended.push({anchor: Pos(range.from().line, 0),
+ head: Pos(range.to().line + 1, 0)});
+ }
+ cm.setSelections(extended);
+ };
+
+ function insertLine(cm, above) {
+ if (cm.isReadOnly()) return CodeMirror.Pass
+ cm.operation(function() {
+ var len = cm.listSelections().length, newSelection = [], last = -1;
+ for (var i = 0; i < len; i++) {
+ var head = cm.listSelections()[i].head;
+ if (head.line <= last) continue;
+ var at = Pos(head.line + (above ? 0 : 1), 0);
+ cm.replaceRange("\n", at, null, "+insertLine");
+ cm.indentLine(at.line, null, true);
+ newSelection.push({head: at, anchor: at});
+ last = head.line + 1;
+ }
+ cm.setSelections(newSelection);
+ });
+ cm.execCommand("indentAuto");
+ }
+
+ cmds.insertLineAfter = function(cm) { return insertLine(cm, false); };
+
+ cmds.insertLineBefore = function(cm) { return insertLine(cm, true); };
+
+ function wordAt(cm, pos) {
+ var start = pos.ch, end = start, line = cm.getLine(pos.line);
+ while (start && CodeMirror.isWordChar(line.charAt(start - 1))) --start;
+ while (end < line.length && CodeMirror.isWordChar(line.charAt(end))) ++end;
+ return {from: Pos(pos.line, start), to: Pos(pos.line, end), word: line.slice(start, end)};
+ }
+
+ cmds.selectNextOccurrence = function(cm) {
+ var from = cm.getCursor("from"), to = cm.getCursor("to");
+ var fullWord = cm.state.sublimeFindFullWord == cm.doc.sel;
+ if (CodeMirror.cmpPos(from, to) == 0) {
+ var word = wordAt(cm, from);
+ if (!word.word) return;
+ cm.setSelection(word.from, word.to);
+ fullWord = true;
+ } else {
+ var text = cm.getRange(from, to);
+ var query = fullWord ? new RegExp("\\b" + text + "\\b") : text;
+ var cur = cm.getSearchCursor(query, to);
+ var found = cur.findNext();
+ if (!found) {
+ cur = cm.getSearchCursor(query, Pos(cm.firstLine(), 0));
+ found = cur.findNext();
+ }
+ if (!found || isSelectedRange(cm.listSelections(), cur.from(), cur.to())) return
+ cm.addSelection(cur.from(), cur.to());
+ }
+ if (fullWord)
+ cm.state.sublimeFindFullWord = cm.doc.sel;
+ };
+
+ cmds.skipAndSelectNextOccurrence = function(cm) {
+ var prevAnchor = cm.getCursor("anchor"), prevHead = cm.getCursor("head");
+ cmds.selectNextOccurrence(cm);
+ if (CodeMirror.cmpPos(prevAnchor, prevHead) != 0) {
+ cm.doc.setSelections(cm.doc.listSelections()
+ .filter(function (sel) {
+ return sel.anchor != prevAnchor || sel.head != prevHead;
+ }));
+ }
+ }
+
+ function addCursorToSelection(cm, dir) {
+ var ranges = cm.listSelections(), newRanges = [];
+ for (var i = 0; i < ranges.length; i++) {
+ var range = ranges[i];
+ var newAnchor = cm.findPosV(
+ range.anchor, dir, "line", range.anchor.goalColumn);
+ var newHead = cm.findPosV(
+ range.head, dir, "line", range.head.goalColumn);
+ newAnchor.goalColumn = range.anchor.goalColumn != null ?
+ range.anchor.goalColumn : cm.cursorCoords(range.anchor, "div").left;
+ newHead.goalColumn = range.head.goalColumn != null ?
+ range.head.goalColumn : cm.cursorCoords(range.head, "div").left;
+ var newRange = {anchor: newAnchor, head: newHead};
+ newRanges.push(range);
+ newRanges.push(newRange);
+ }
+ cm.setSelections(newRanges);
+ }
+ cmds.addCursorToPrevLine = function(cm) { addCursorToSelection(cm, -1); };
+ cmds.addCursorToNextLine = function(cm) { addCursorToSelection(cm, 1); };
+
+ function isSelectedRange(ranges, from, to) {
+ for (var i = 0; i < ranges.length; i++)
+ if (CodeMirror.cmpPos(ranges[i].from(), from) == 0 &&
+ CodeMirror.cmpPos(ranges[i].to(), to) == 0) return true
+ return false
+ }
+
+ var mirror = "(){}[]";
+ function selectBetweenBrackets(cm) {
+ var ranges = cm.listSelections(), newRanges = []
+ for (var i = 0; i < ranges.length; i++) {
+ var range = ranges[i], pos = range.head, opening = cm.scanForBracket(pos, -1);
+ if (!opening) return false;
+ for (;;) {
+ var closing = cm.scanForBracket(pos, 1);
+ if (!closing) return false;
+ if (closing.ch == mirror.charAt(mirror.indexOf(opening.ch) + 1)) {
+ var startPos = Pos(opening.pos.line, opening.pos.ch + 1);
+ if (CodeMirror.cmpPos(startPos, range.from()) == 0 &&
+ CodeMirror.cmpPos(closing.pos, range.to()) == 0) {
+ opening = cm.scanForBracket(opening.pos, -1);
+ if (!opening) return false;
+ } else {
+ newRanges.push({anchor: startPos, head: closing.pos});
+ break;
+ }
+ }
+ pos = Pos(closing.pos.line, closing.pos.ch + 1);
+ }
+ }
+ cm.setSelections(newRanges);
+ return true;
+ }
+
+ cmds.selectScope = function(cm) {
+ selectBetweenBrackets(cm) || cm.execCommand("selectAll");
+ };
+ cmds.selectBetweenBrackets = function(cm) {
+ if (!selectBetweenBrackets(cm)) return CodeMirror.Pass;
+ };
+
+ function puncType(type) {
+ return !type ? null : /\bpunctuation\b/.test(type) ? type : undefined
+ }
+
+ cmds.goToBracket = function(cm) {
+ cm.extendSelectionsBy(function(range) {
+ var next = cm.scanForBracket(range.head, 1, puncType(cm.getTokenTypeAt(range.head)));
+ if (next && CodeMirror.cmpPos(next.pos, range.head) != 0) return next.pos;
+ var prev = cm.scanForBracket(range.head, -1, puncType(cm.getTokenTypeAt(Pos(range.head.line, range.head.ch + 1))));
+ return prev && Pos(prev.pos.line, prev.pos.ch + 1) || range.head;
+ });
+ };
+
+ cmds.swapLineUp = function(cm) {
+ if (cm.isReadOnly()) return CodeMirror.Pass
+ var ranges = cm.listSelections(), linesToMove = [], at = cm.firstLine() - 1, newSels = [];
+ for (var i = 0; i < ranges.length; i++) {
+ var range = ranges[i], from = range.from().line - 1, to = range.to().line;
+ newSels.push({anchor: Pos(range.anchor.line - 1, range.anchor.ch),
+ head: Pos(range.head.line - 1, range.head.ch)});
+ if (range.to().ch == 0 && !range.empty()) --to;
+ if (from > at) linesToMove.push(from, to);
+ else if (linesToMove.length) linesToMove[linesToMove.length - 1] = to;
+ at = to;
+ }
+ cm.operation(function() {
+ for (var i = 0; i < linesToMove.length; i += 2) {
+ var from = linesToMove[i], to = linesToMove[i + 1];
+ var line = cm.getLine(from);
+ cm.replaceRange("", Pos(from, 0), Pos(from + 1, 0), "+swapLine");
+ if (to > cm.lastLine())
+ cm.replaceRange("\n" + line, Pos(cm.lastLine()), null, "+swapLine");
+ else
+ cm.replaceRange(line + "\n", Pos(to, 0), null, "+swapLine");
+ }
+ cm.setSelections(newSels);
+ cm.scrollIntoView();
+ });
+ };
+
+ cmds.swapLineDown = function(cm) {
+ if (cm.isReadOnly()) return CodeMirror.Pass
+ var ranges = cm.listSelections(), linesToMove = [], at = cm.lastLine() + 1;
+ for (var i = ranges.length - 1; i >= 0; i--) {
+ var range = ranges[i], from = range.to().line + 1, to = range.from().line;
+ if (range.to().ch == 0 && !range.empty()) from--;
+ if (from < at) linesToMove.push(from, to);
+ else if (linesToMove.length) linesToMove[linesToMove.length - 1] = to;
+ at = to;
+ }
+ cm.operation(function() {
+ for (var i = linesToMove.length - 2; i >= 0; i -= 2) {
+ var from = linesToMove[i], to = linesToMove[i + 1];
+ var line = cm.getLine(from);
+ if (from == cm.lastLine())
+ cm.replaceRange("", Pos(from - 1), Pos(from), "+swapLine");
+ else
+ cm.replaceRange("", Pos(from, 0), Pos(from + 1, 0), "+swapLine");
+ cm.replaceRange(line + "\n", Pos(to, 0), null, "+swapLine");
+ }
+ cm.scrollIntoView();
+ });
+ };
+
+ cmds.toggleCommentIndented = function(cm) {
+ cm.toggleComment({ indent: true });
+ }
+
+ cmds.joinLines = function(cm) {
+ var ranges = cm.listSelections(), joined = [];
+ for (var i = 0; i < ranges.length; i++) {
+ var range = ranges[i], from = range.from();
+ var start = from.line, end = range.to().line;
+ while (i < ranges.length - 1 && ranges[i + 1].from().line == end)
+ end = ranges[++i].to().line;
+ joined.push({start: start, end: end, anchor: !range.empty() && from});
+ }
+ cm.operation(function() {
+ var offset = 0, ranges = [];
+ for (var i = 0; i < joined.length; i++) {
+ var obj = joined[i];
+ var anchor = obj.anchor && Pos(obj.anchor.line - offset, obj.anchor.ch), head;
+ for (var line = obj.start; line <= obj.end; line++) {
+ var actual = line - offset;
+ if (line == obj.end) head = Pos(actual, cm.getLine(actual).length + 1);
+ if (actual < cm.lastLine()) {
+ cm.replaceRange(" ", Pos(actual), Pos(actual + 1, /^\s*/.exec(cm.getLine(actual + 1))[0].length));
+ ++offset;
+ }
+ }
+ ranges.push({anchor: anchor || head, head: head});
+ }
+ cm.setSelections(ranges, 0);
+ });
+ };
+
+ cmds.duplicateLine = function(cm) {
+ cm.operation(function() {
+ var rangeCount = cm.listSelections().length;
+ for (var i = 0; i < rangeCount; i++) {
+ var range = cm.listSelections()[i];
+ if (range.empty())
+ cm.replaceRange(cm.getLine(range.head.line) + "\n", Pos(range.head.line, 0));
+ else
+ cm.replaceRange(cm.getRange(range.from(), range.to()), range.from());
+ }
+ cm.scrollIntoView();
+ });
+ };
+
+
+ function sortLines(cm, caseSensitive) {
+ if (cm.isReadOnly()) return CodeMirror.Pass
+ var ranges = cm.listSelections(), toSort = [], selected;
+ for (var i = 0; i < ranges.length; i++) {
+ var range = ranges[i];
+ if (range.empty()) continue;
+ var from = range.from().line, to = range.to().line;
+ while (i < ranges.length - 1 && ranges[i + 1].from().line == to)
+ to = ranges[++i].to().line;
+ if (!ranges[i].to().ch) to--;
+ toSort.push(from, to);
+ }
+ if (toSort.length) selected = true;
+ else toSort.push(cm.firstLine(), cm.lastLine());
+
+ cm.operation(function() {
+ var ranges = [];
+ for (var i = 0; i < toSort.length; i += 2) {
+ var from = toSort[i], to = toSort[i + 1];
+ var start = Pos(from, 0), end = Pos(to);
+ var lines = cm.getRange(start, end, false);
+ if (caseSensitive)
+ lines.sort();
+ else
+ lines.sort(function(a, b) {
+ var au = a.toUpperCase(), bu = b.toUpperCase();
+ if (au != bu) { a = au; b = bu; }
+ return a < b ? -1 : a == b ? 0 : 1;
+ });
+ cm.replaceRange(lines, start, end);
+ if (selected) ranges.push({anchor: start, head: Pos(to + 1, 0)});
+ }
+ if (selected) cm.setSelections(ranges, 0);
+ });
+ }
+
+ cmds.sortLines = function(cm) { sortLines(cm, true); };
+ cmds.sortLinesInsensitive = function(cm) { sortLines(cm, false); };
+
+ cmds.nextBookmark = function(cm) {
+ var marks = cm.state.sublimeBookmarks;
+ if (marks) while (marks.length) {
+ var current = marks.shift();
+ var found = current.find();
+ if (found) {
+ marks.push(current);
+ return cm.setSelection(found.from, found.to);
+ }
+ }
+ };
+
+ cmds.prevBookmark = function(cm) {
+ var marks = cm.state.sublimeBookmarks;
+ if (marks) while (marks.length) {
+ marks.unshift(marks.pop());
+ var found = marks[marks.length - 1].find();
+ if (!found)
+ marks.pop();
+ else
+ return cm.setSelection(found.from, found.to);
+ }
+ };
+
+ cmds.toggleBookmark = function(cm) {
+ var ranges = cm.listSelections();
+ var marks = cm.state.sublimeBookmarks || (cm.state.sublimeBookmarks = []);
+ for (var i = 0; i < ranges.length; i++) {
+ var from = ranges[i].from(), to = ranges[i].to();
+ var found = ranges[i].empty() ? cm.findMarksAt(from) : cm.findMarks(from, to);
+ for (var j = 0; j < found.length; j++) {
+ if (found[j].sublimeBookmark) {
+ found[j].clear();
+ for (var k = 0; k < marks.length; k++)
+ if (marks[k] == found[j])
+ marks.splice(k--, 1);
+ break;
+ }
+ }
+ if (j == found.length)
+ marks.push(cm.markText(from, to, {sublimeBookmark: true, clearWhenEmpty: false}));
+ }
+ };
+
+ cmds.clearBookmarks = function(cm) {
+ var marks = cm.state.sublimeBookmarks;
+ if (marks) for (var i = 0; i < marks.length; i++) marks[i].clear();
+ marks.length = 0;
+ };
+
+ cmds.selectBookmarks = function(cm) {
+ var marks = cm.state.sublimeBookmarks, ranges = [];
+ if (marks) for (var i = 0; i < marks.length; i++) {
+ var found = marks[i].find();
+ if (!found)
+ marks.splice(i--, 0);
+ else
+ ranges.push({anchor: found.from, head: found.to});
+ }
+ if (ranges.length)
+ cm.setSelections(ranges, 0);
+ };
+
+ function modifyWordOrSelection(cm, mod) {
+ cm.operation(function() {
+ var ranges = cm.listSelections(), indices = [], replacements = [];
+ for (var i = 0; i < ranges.length; i++) {
+ var range = ranges[i];
+ if (range.empty()) { indices.push(i); replacements.push(""); }
+ else replacements.push(mod(cm.getRange(range.from(), range.to())));
+ }
+ cm.replaceSelections(replacements, "around", "case");
+ for (var i = indices.length - 1, at; i >= 0; i--) {
+ var range = ranges[indices[i]];
+ if (at && CodeMirror.cmpPos(range.head, at) > 0) continue;
+ var word = wordAt(cm, range.head);
+ at = word.from;
+ cm.replaceRange(mod(word.word), word.from, word.to);
+ }
+ });
+ }
+
+ cmds.smartBackspace = function(cm) {
+ if (cm.somethingSelected()) return CodeMirror.Pass;
+
+ cm.operation(function() {
+ var cursors = cm.listSelections();
+ var indentUnit = cm.getOption("indentUnit");
+
+ for (var i = cursors.length - 1; i >= 0; i--) {
+ var cursor = cursors[i].head;
+ var toStartOfLine = cm.getRange({line: cursor.line, ch: 0}, cursor);
+ var column = CodeMirror.countColumn(toStartOfLine, null, cm.getOption("tabSize"));
+
+ // Delete by one character by default
+ var deletePos = cm.findPosH(cursor, -1, "char", false);
+
+ if (toStartOfLine && !/\S/.test(toStartOfLine) && column % indentUnit == 0) {
+ var prevIndent = new Pos(cursor.line,
+ CodeMirror.findColumn(toStartOfLine, column - indentUnit, indentUnit));
+
+ // Smart delete only if we found a valid prevIndent location
+ if (prevIndent.ch != cursor.ch) deletePos = prevIndent;
+ }
+
+ cm.replaceRange("", deletePos, cursor, "+delete");
+ }
+ });
+ };
+
+ cmds.delLineRight = function(cm) {
+ cm.operation(function() {
+ var ranges = cm.listSelections();
+ for (var i = ranges.length - 1; i >= 0; i--)
+ cm.replaceRange("", ranges[i].anchor, Pos(ranges[i].to().line), "+delete");
+ cm.scrollIntoView();
+ });
+ };
+
+ cmds.upcaseAtCursor = function(cm) {
+ modifyWordOrSelection(cm, function(str) { return str.toUpperCase(); });
+ };
+ cmds.downcaseAtCursor = function(cm) {
+ modifyWordOrSelection(cm, function(str) { return str.toLowerCase(); });
+ };
+
+ cmds.setSublimeMark = function(cm) {
+ if (cm.state.sublimeMark) cm.state.sublimeMark.clear();
+ cm.state.sublimeMark = cm.setBookmark(cm.getCursor());
+ };
+ cmds.selectToSublimeMark = function(cm) {
+ var found = cm.state.sublimeMark && cm.state.sublimeMark.find();
+ if (found) cm.setSelection(cm.getCursor(), found);
+ };
+ cmds.deleteToSublimeMark = function(cm) {
+ var found = cm.state.sublimeMark && cm.state.sublimeMark.find();
+ if (found) {
+ var from = cm.getCursor(), to = found;
+ if (CodeMirror.cmpPos(from, to) > 0) { var tmp = to; to = from; from = tmp; }
+ cm.state.sublimeKilled = cm.getRange(from, to);
+ cm.replaceRange("", from, to);
+ }
+ };
+ cmds.swapWithSublimeMark = function(cm) {
+ var found = cm.state.sublimeMark && cm.state.sublimeMark.find();
+ if (found) {
+ cm.state.sublimeMark.clear();
+ cm.state.sublimeMark = cm.setBookmark(cm.getCursor());
+ cm.setCursor(found);
+ }
+ };
+ cmds.sublimeYank = function(cm) {
+ if (cm.state.sublimeKilled != null)
+ cm.replaceSelection(cm.state.sublimeKilled, null, "paste");
+ };
+
+ cmds.showInCenter = function(cm) {
+ var pos = cm.cursorCoords(null, "local");
+ cm.scrollTo(null, (pos.top + pos.bottom) / 2 - cm.getScrollInfo().clientHeight / 2);
+ };
+
+ function getTarget(cm) {
+ var from = cm.getCursor("from"), to = cm.getCursor("to");
+ if (CodeMirror.cmpPos(from, to) == 0) {
+ var word = wordAt(cm, from);
+ if (!word.word) return;
+ from = word.from;
+ to = word.to;
+ }
+ return {from: from, to: to, query: cm.getRange(from, to), word: word};
+ }
+
+ function findAndGoTo(cm, forward) {
+ var target = getTarget(cm);
+ if (!target) return;
+ var query = target.query;
+ var cur = cm.getSearchCursor(query, forward ? target.to : target.from);
+
+ if (forward ? cur.findNext() : cur.findPrevious()) {
+ cm.setSelection(cur.from(), cur.to());
+ } else {
+ cur = cm.getSearchCursor(query, forward ? Pos(cm.firstLine(), 0)
+ : cm.clipPos(Pos(cm.lastLine())));
+ if (forward ? cur.findNext() : cur.findPrevious())
+ cm.setSelection(cur.from(), cur.to());
+ else if (target.word)
+ cm.setSelection(target.from, target.to);
+ }
+ };
+ cmds.findUnder = function(cm) { findAndGoTo(cm, true); };
+ cmds.findUnderPrevious = function(cm) { findAndGoTo(cm,false); };
+ cmds.findAllUnder = function(cm) {
+ var target = getTarget(cm);
+ if (!target) return;
+ var cur = cm.getSearchCursor(target.query);
+ var matches = [];
+ var primaryIndex = -1;
+ while (cur.findNext()) {
+ matches.push({anchor: cur.from(), head: cur.to()});
+ if (cur.from().line <= target.from.line && cur.from().ch <= target.from.ch)
+ primaryIndex++;
+ }
+ cm.setSelections(matches, primaryIndex);
+ };
+
+
+ var keyMap = CodeMirror.keyMap;
+ keyMap.macSublime = {
+ "Cmd-Left": "goLineStartSmart",
+ "Shift-Tab": "indentLess",
+ "Shift-Ctrl-K": "deleteLine",
+ "Alt-Q": "wrapLines",
+ "Ctrl-Left": "goSubwordLeft",
+ "Ctrl-Right": "goSubwordRight",
+ "Ctrl-Alt-Up": "scrollLineUp",
+ "Ctrl-Alt-Down": "scrollLineDown",
+ "Cmd-L": "selectLine",
+ "Shift-Cmd-L": "splitSelectionByLine",
+ "Esc": "singleSelectionTop",
+ "Cmd-Enter": "insertLineAfter",
+ "Shift-Cmd-Enter": "insertLineBefore",
+ "Cmd-D": "selectNextOccurrence",
+ "Shift-Cmd-Space": "selectScope",
+ "Shift-Cmd-M": "selectBetweenBrackets",
+ "Cmd-M": "goToBracket",
+ "Cmd-Ctrl-Up": "swapLineUp",
+ "Cmd-Ctrl-Down": "swapLineDown",
+ "Cmd-/": "toggleCommentIndented",
+ "Cmd-J": "joinLines",
+ "Shift-Cmd-D": "duplicateLine",
+ "F5": "sortLines",
+ "Cmd-F5": "sortLinesInsensitive",
+ "F2": "nextBookmark",
+ "Shift-F2": "prevBookmark",
+ "Cmd-F2": "toggleBookmark",
+ "Shift-Cmd-F2": "clearBookmarks",
+ "Alt-F2": "selectBookmarks",
+ "Backspace": "smartBackspace",
+ "Cmd-K Cmd-D": "skipAndSelectNextOccurrence",
+ "Cmd-K Cmd-K": "delLineRight",
+ "Cmd-K Cmd-U": "upcaseAtCursor",
+ "Cmd-K Cmd-L": "downcaseAtCursor",
+ "Cmd-K Cmd-Space": "setSublimeMark",
+ "Cmd-K Cmd-A": "selectToSublimeMark",
+ "Cmd-K Cmd-W": "deleteToSublimeMark",
+ "Cmd-K Cmd-X": "swapWithSublimeMark",
+ "Cmd-K Cmd-Y": "sublimeYank",
+ "Cmd-K Cmd-C": "showInCenter",
+ "Cmd-K Cmd-G": "clearBookmarks",
+ "Cmd-K Cmd-Backspace": "delLineLeft",
+ "Cmd-K Cmd-1": "foldAll",
+ "Cmd-K Cmd-0": "unfoldAll",
+ "Cmd-K Cmd-J": "unfoldAll",
+ "Ctrl-Shift-Up": "addCursorToPrevLine",
+ "Ctrl-Shift-Down": "addCursorToNextLine",
+ "Cmd-F3": "findUnder",
+ "Shift-Cmd-F3": "findUnderPrevious",
+ "Alt-F3": "findAllUnder",
+ "Shift-Cmd-[": "fold",
+ "Shift-Cmd-]": "unfold",
+ "Cmd-I": "findIncremental",
+ "Shift-Cmd-I": "findIncrementalReverse",
+ "Cmd-H": "replace",
+ "F3": "findNext",
+ "Shift-F3": "findPrev",
+ "fallthrough": "macDefault"
+ };
+ CodeMirror.normalizeKeyMap(keyMap.macSublime);
+
+ keyMap.pcSublime = {
+ "Shift-Tab": "indentLess",
+ "Shift-Ctrl-K": "deleteLine",
+ "Alt-Q": "wrapLines",
+ "Ctrl-T": "transposeChars",
+ "Alt-Left": "goSubwordLeft",
+ "Alt-Right": "goSubwordRight",
+ "Ctrl-Up": "scrollLineUp",
+ "Ctrl-Down": "scrollLineDown",
+ "Ctrl-L": "selectLine",
+ "Shift-Ctrl-L": "splitSelectionByLine",
+ "Esc": "singleSelectionTop",
+ "Ctrl-Enter": "insertLineAfter",
+ "Shift-Ctrl-Enter": "insertLineBefore",
+ "Ctrl-D": "selectNextOccurrence",
+ "Shift-Ctrl-Space": "selectScope",
+ "Shift-Ctrl-M": "selectBetweenBrackets",
+ "Ctrl-M": "goToBracket",
+ "Shift-Ctrl-Up": "swapLineUp",
+ "Shift-Ctrl-Down": "swapLineDown",
+ "Ctrl-/": "toggleCommentIndented",
+ "Ctrl-J": "joinLines",
+ "Shift-Ctrl-D": "duplicateLine",
+ "F9": "sortLines",
+ "Ctrl-F9": "sortLinesInsensitive",
+ "F2": "nextBookmark",
+ "Shift-F2": "prevBookmark",
+ "Ctrl-F2": "toggleBookmark",
+ "Shift-Ctrl-F2": "clearBookmarks",
+ "Alt-F2": "selectBookmarks",
+ "Backspace": "smartBackspace",
+ "Ctrl-K Ctrl-D": "skipAndSelectNextOccurrence",
+ "Ctrl-K Ctrl-K": "delLineRight",
+ "Ctrl-K Ctrl-U": "upcaseAtCursor",
+ "Ctrl-K Ctrl-L": "downcaseAtCursor",
+ "Ctrl-K Ctrl-Space": "setSublimeMark",
+ "Ctrl-K Ctrl-A": "selectToSublimeMark",
+ "Ctrl-K Ctrl-W": "deleteToSublimeMark",
+ "Ctrl-K Ctrl-X": "swapWithSublimeMark",
+ "Ctrl-K Ctrl-Y": "sublimeYank",
+ "Ctrl-K Ctrl-C": "showInCenter",
+ "Ctrl-K Ctrl-G": "clearBookmarks",
+ "Ctrl-K Ctrl-Backspace": "delLineLeft",
+ "Ctrl-K Ctrl-1": "foldAll",
+ "Ctrl-K Ctrl-0": "unfoldAll",
+ "Ctrl-K Ctrl-J": "unfoldAll",
+ "Ctrl-Alt-Up": "addCursorToPrevLine",
+ "Ctrl-Alt-Down": "addCursorToNextLine",
+ "Ctrl-F3": "findUnder",
+ "Shift-Ctrl-F3": "findUnderPrevious",
+ "Alt-F3": "findAllUnder",
+ "Shift-Ctrl-[": "fold",
+ "Shift-Ctrl-]": "unfold",
+ "Ctrl-I": "findIncremental",
+ "Shift-Ctrl-I": "findIncrementalReverse",
+ "Ctrl-H": "replace",
+ "F3": "findNext",
+ "Shift-F3": "findPrev",
+ "fallthrough": "pcDefault"
+ };
+ CodeMirror.normalizeKeyMap(keyMap.pcSublime);
+
+ var mac = keyMap.default == keyMap.macDefault;
+ keyMap.sublime = mac ? keyMap.macSublime : keyMap.pcSublime;
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/keymap/vim.js b/modules/cookiesplus/lib/CodeMirror/keymap/vim.js
new file mode 100644
index 00000000..122ad4fa
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/keymap/vim.js
@@ -0,0 +1,5608 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+/**
+ * Supported keybindings:
+ * Too many to list. Refer to defaultKeymap below.
+ *
+ * Supported Ex commands:
+ * Refer to defaultExCommandMap below.
+ *
+ * Registers: unnamed, -, a-z, A-Z, 0-9
+ * (Does not respect the special case for number registers when delete
+ * operator is made with these commands: %, (, ), , /, ?, n, N, {, } )
+ * TODO: Implement the remaining registers.
+ *
+ * Marks: a-z, A-Z, and 0-9
+ * TODO: Implement the remaining special marks. They have more complex
+ * behavior.
+ *
+ * Events:
+ * 'vim-mode-change' - raised on the editor anytime the current mode changes,
+ * Event object: {mode: "visual", subMode: "linewise"}
+ *
+ * Code structure:
+ * 1. Default keymap
+ * 2. Variable declarations and short basic helpers
+ * 3. Instance (External API) implementation
+ * 4. Internal state tracking objects (input state, counter) implementation
+ * and instantiation
+ * 5. Key handler (the main command dispatcher) implementation
+ * 6. Motion, operator, and action implementations
+ * 7. Helper functions for the key handler, motions, operators, and actions
+ * 8. Set up Vim to work as a keymap for CodeMirror.
+ * 9. Ex command implementations.
+ */
+(function(mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../lib/codemirror"), require("../addon/search/searchcursor"), require("../addon/dialog/dialog"), require("../addon/edit/matchbrackets.js"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../lib/codemirror", "../addon/search/searchcursor", "../addon/dialog/dialog", "../addon/edit/matchbrackets"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function(CodeMirror) {
+ 'use strict';
+
+ var defaultKeymap = [
+ // Key to key mapping. This goes first to make it possible to override
+ // existing mappings.
+ { keys: '', type: 'keyToKey', toKeys: 'h' },
+ { keys: '', type: 'keyToKey', toKeys: 'l' },
+ { keys: '', type: 'keyToKey', toKeys: 'k' },
+ { keys: '', type: 'keyToKey', toKeys: 'j' },
+ { keys: '', type: 'keyToKey', toKeys: 'l' },
+ { keys: '', type: 'keyToKey', toKeys: 'h', context: 'normal'},
+ { keys: '', type: 'keyToKey', toKeys: 'x', context: 'normal'},
+ { keys: '', type: 'keyToKey', toKeys: 'W' },
+ { keys: '', type: 'keyToKey', toKeys: 'B', context: 'normal' },
+ { keys: '', type: 'keyToKey', toKeys: 'w' },
+ { keys: '', type: 'keyToKey', toKeys: 'b', context: 'normal' },
+ { keys: '', type: 'keyToKey', toKeys: 'j' },
+ { keys: '', type: 'keyToKey', toKeys: 'k' },
+ { keys: '', type: 'keyToKey', toKeys: '' },
+ { keys: '', type: 'keyToKey', toKeys: '' },
+ { keys: '', type: 'keyToKey', toKeys: '', context: 'insert' },
+ { keys: '', type: 'keyToKey', toKeys: '', context: 'insert' },
+ { keys: 's', type: 'keyToKey', toKeys: 'cl', context: 'normal' },
+ { keys: 's', type: 'keyToKey', toKeys: 'c', context: 'visual'},
+ { keys: 'S', type: 'keyToKey', toKeys: 'cc', context: 'normal' },
+ { keys: 'S', type: 'keyToKey', toKeys: 'VdO', context: 'visual' },
+ { keys: '', type: 'keyToKey', toKeys: '0' },
+ { keys: '', type: 'keyToKey', toKeys: '$' },
+ { keys: '', type: 'keyToKey', toKeys: '' },
+ { keys: '', type: 'keyToKey', toKeys: '' },
+ { keys: '', type: 'keyToKey', toKeys: 'j^', context: 'normal' },
+ { keys: '', type: 'action', action: 'toggleOverwrite', context: 'insert' },
+ // Motions
+ { keys: 'H', type: 'motion', motion: 'moveToTopLine', motionArgs: { linewise: true, toJumplist: true }},
+ { keys: 'M', type: 'motion', motion: 'moveToMiddleLine', motionArgs: { linewise: true, toJumplist: true }},
+ { keys: 'L', type: 'motion', motion: 'moveToBottomLine', motionArgs: { linewise: true, toJumplist: true }},
+ { keys: 'h', type: 'motion', motion: 'moveByCharacters', motionArgs: { forward: false }},
+ { keys: 'l', type: 'motion', motion: 'moveByCharacters', motionArgs: { forward: true }},
+ { keys: 'j', type: 'motion', motion: 'moveByLines', motionArgs: { forward: true, linewise: true }},
+ { keys: 'k', type: 'motion', motion: 'moveByLines', motionArgs: { forward: false, linewise: true }},
+ { keys: 'gj', type: 'motion', motion: 'moveByDisplayLines', motionArgs: { forward: true }},
+ { keys: 'gk', type: 'motion', motion: 'moveByDisplayLines', motionArgs: { forward: false }},
+ { keys: 'w', type: 'motion', motion: 'moveByWords', motionArgs: { forward: true, wordEnd: false }},
+ { keys: 'W', type: 'motion', motion: 'moveByWords', motionArgs: { forward: true, wordEnd: false, bigWord: true }},
+ { keys: 'e', type: 'motion', motion: 'moveByWords', motionArgs: { forward: true, wordEnd: true, inclusive: true }},
+ { keys: 'E', type: 'motion', motion: 'moveByWords', motionArgs: { forward: true, wordEnd: true, bigWord: true, inclusive: true }},
+ { keys: 'b', type: 'motion', motion: 'moveByWords', motionArgs: { forward: false, wordEnd: false }},
+ { keys: 'B', type: 'motion', motion: 'moveByWords', motionArgs: { forward: false, wordEnd: false, bigWord: true }},
+ { keys: 'ge', type: 'motion', motion: 'moveByWords', motionArgs: { forward: false, wordEnd: true, inclusive: true }},
+ { keys: 'gE', type: 'motion', motion: 'moveByWords', motionArgs: { forward: false, wordEnd: true, bigWord: true, inclusive: true }},
+ { keys: '{', type: 'motion', motion: 'moveByParagraph', motionArgs: { forward: false, toJumplist: true }},
+ { keys: '}', type: 'motion', motion: 'moveByParagraph', motionArgs: { forward: true, toJumplist: true }},
+ { keys: '(', type: 'motion', motion: 'moveBySentence', motionArgs: { forward: false }},
+ { keys: ')', type: 'motion', motion: 'moveBySentence', motionArgs: { forward: true }},
+ { keys: '', type: 'motion', motion: 'moveByPage', motionArgs: { forward: true }},
+ { keys: '', type: 'motion', motion: 'moveByPage', motionArgs: { forward: false }},
+ { keys: '', type: 'motion', motion: 'moveByScroll', motionArgs: { forward: true, explicitRepeat: true }},
+ { keys: '', type: 'motion', motion: 'moveByScroll', motionArgs: { forward: false, explicitRepeat: true }},
+ { keys: 'gg', type: 'motion', motion: 'moveToLineOrEdgeOfDocument', motionArgs: { forward: false, explicitRepeat: true, linewise: true, toJumplist: true }},
+ { keys: 'G', type: 'motion', motion: 'moveToLineOrEdgeOfDocument', motionArgs: { forward: true, explicitRepeat: true, linewise: true, toJumplist: true }},
+ { keys: '0', type: 'motion', motion: 'moveToStartOfLine' },
+ { keys: '^', type: 'motion', motion: 'moveToFirstNonWhiteSpaceCharacter' },
+ { keys: '+', type: 'motion', motion: 'moveByLines', motionArgs: { forward: true, toFirstChar:true }},
+ { keys: '-', type: 'motion', motion: 'moveByLines', motionArgs: { forward: false, toFirstChar:true }},
+ { keys: '_', type: 'motion', motion: 'moveByLines', motionArgs: { forward: true, toFirstChar:true, repeatOffset:-1 }},
+ { keys: '$', type: 'motion', motion: 'moveToEol', motionArgs: { inclusive: true }},
+ { keys: '%', type: 'motion', motion: 'moveToMatchedSymbol', motionArgs: { inclusive: true, toJumplist: true }},
+ { keys: 'f', type: 'motion', motion: 'moveToCharacter', motionArgs: { forward: true , inclusive: true }},
+ { keys: 'F', type: 'motion', motion: 'moveToCharacter', motionArgs: { forward: false }},
+ { keys: 't', type: 'motion', motion: 'moveTillCharacter', motionArgs: { forward: true, inclusive: true }},
+ { keys: 'T', type: 'motion', motion: 'moveTillCharacter', motionArgs: { forward: false }},
+ { keys: ';', type: 'motion', motion: 'repeatLastCharacterSearch', motionArgs: { forward: true }},
+ { keys: ',', type: 'motion', motion: 'repeatLastCharacterSearch', motionArgs: { forward: false }},
+ { keys: '\'', type: 'motion', motion: 'goToMark', motionArgs: {toJumplist: true, linewise: true}},
+ { keys: '`', type: 'motion', motion: 'goToMark', motionArgs: {toJumplist: true}},
+ { keys: ']`', type: 'motion', motion: 'jumpToMark', motionArgs: { forward: true } },
+ { keys: '[`', type: 'motion', motion: 'jumpToMark', motionArgs: { forward: false } },
+ { keys: ']\'', type: 'motion', motion: 'jumpToMark', motionArgs: { forward: true, linewise: true } },
+ { keys: '[\'', type: 'motion', motion: 'jumpToMark', motionArgs: { forward: false, linewise: true } },
+ // the next two aren't motions but must come before more general motion declarations
+ { keys: ']p', type: 'action', action: 'paste', isEdit: true, actionArgs: { after: true, isEdit: true, matchIndent: true}},
+ { keys: '[p', type: 'action', action: 'paste', isEdit: true, actionArgs: { after: false, isEdit: true, matchIndent: true}},
+ { keys: ']', type: 'motion', motion: 'moveToSymbol', motionArgs: { forward: true, toJumplist: true}},
+ { keys: '[', type: 'motion', motion: 'moveToSymbol', motionArgs: { forward: false, toJumplist: true}},
+ { keys: '|', type: 'motion', motion: 'moveToColumn'},
+ { keys: 'o', type: 'motion', motion: 'moveToOtherHighlightedEnd', context:'visual'},
+ { keys: 'O', type: 'motion', motion: 'moveToOtherHighlightedEnd', motionArgs: {sameLine: true}, context:'visual'},
+ // Operators
+ { keys: 'd', type: 'operator', operator: 'delete' },
+ { keys: 'y', type: 'operator', operator: 'yank' },
+ { keys: 'c', type: 'operator', operator: 'change' },
+ { keys: '=', type: 'operator', operator: 'indentAuto' },
+ { keys: '>', type: 'operator', operator: 'indent', operatorArgs: { indentRight: true }},
+ { keys: '<', type: 'operator', operator: 'indent', operatorArgs: { indentRight: false }},
+ { keys: 'g~', type: 'operator', operator: 'changeCase' },
+ { keys: 'gu', type: 'operator', operator: 'changeCase', operatorArgs: {toLower: true}, isEdit: true },
+ { keys: 'gU', type: 'operator', operator: 'changeCase', operatorArgs: {toLower: false}, isEdit: true },
+ { keys: 'n', type: 'motion', motion: 'findNext', motionArgs: { forward: true, toJumplist: true }},
+ { keys: 'N', type: 'motion', motion: 'findNext', motionArgs: { forward: false, toJumplist: true }},
+ // Operator-Motion dual commands
+ { keys: 'x', type: 'operatorMotion', operator: 'delete', motion: 'moveByCharacters', motionArgs: { forward: true }, operatorMotionArgs: { visualLine: false }},
+ { keys: 'X', type: 'operatorMotion', operator: 'delete', motion: 'moveByCharacters', motionArgs: { forward: false }, operatorMotionArgs: { visualLine: true }},
+ { keys: 'D', type: 'operatorMotion', operator: 'delete', motion: 'moveToEol', motionArgs: { inclusive: true }, context: 'normal'},
+ { keys: 'D', type: 'operator', operator: 'delete', operatorArgs: { linewise: true }, context: 'visual'},
+ { keys: 'Y', type: 'operatorMotion', operator: 'yank', motion: 'expandToLine', motionArgs: { linewise: true }, context: 'normal'},
+ { keys: 'Y', type: 'operator', operator: 'yank', operatorArgs: { linewise: true }, context: 'visual'},
+ { keys: 'C', type: 'operatorMotion', operator: 'change', motion: 'moveToEol', motionArgs: { inclusive: true }, context: 'normal'},
+ { keys: 'C', type: 'operator', operator: 'change', operatorArgs: { linewise: true }, context: 'visual'},
+ { keys: '~', type: 'operatorMotion', operator: 'changeCase', motion: 'moveByCharacters', motionArgs: { forward: true }, operatorArgs: { shouldMoveCursor: true }, context: 'normal'},
+ { keys: '~', type: 'operator', operator: 'changeCase', context: 'visual'},
+ { keys: '', type: 'operatorMotion', operator: 'delete', motion: 'moveByWords', motionArgs: { forward: false, wordEnd: false }, context: 'insert' },
+ // ignore C-w in normal mode
+ { keys: '', type: 'idle', context: 'normal' },
+ // Actions
+ { keys: '', type: 'action', action: 'jumpListWalk', actionArgs: { forward: true }},
+ { keys: '', type: 'action', action: 'jumpListWalk', actionArgs: { forward: false }},
+ { keys: '', type: 'action', action: 'scroll', actionArgs: { forward: true, linewise: true }},
+ { keys: '', type: 'action', action: 'scroll', actionArgs: { forward: false, linewise: true }},
+ { keys: 'a', type: 'action', action: 'enterInsertMode', isEdit: true, actionArgs: { insertAt: 'charAfter' }, context: 'normal' },
+ { keys: 'A', type: 'action', action: 'enterInsertMode', isEdit: true, actionArgs: { insertAt: 'eol' }, context: 'normal' },
+ { keys: 'A', type: 'action', action: 'enterInsertMode', isEdit: true, actionArgs: { insertAt: 'endOfSelectedArea' }, context: 'visual' },
+ { keys: 'i', type: 'action', action: 'enterInsertMode', isEdit: true, actionArgs: { insertAt: 'inplace' }, context: 'normal' },
+ { keys: 'gi', type: 'action', action: 'enterInsertMode', isEdit: true, actionArgs: { insertAt: 'lastEdit' }, context: 'normal' },
+ { keys: 'I', type: 'action', action: 'enterInsertMode', isEdit: true, actionArgs: { insertAt: 'firstNonBlank'}, context: 'normal' },
+ { keys: 'gI', type: 'action', action: 'enterInsertMode', isEdit: true, actionArgs: { insertAt: 'bol'}, context: 'normal' },
+ { keys: 'I', type: 'action', action: 'enterInsertMode', isEdit: true, actionArgs: { insertAt: 'startOfSelectedArea' }, context: 'visual' },
+ { keys: 'o', type: 'action', action: 'newLineAndEnterInsertMode', isEdit: true, interlaceInsertRepeat: true, actionArgs: { after: true }, context: 'normal' },
+ { keys: 'O', type: 'action', action: 'newLineAndEnterInsertMode', isEdit: true, interlaceInsertRepeat: true, actionArgs: { after: false }, context: 'normal' },
+ { keys: 'v', type: 'action', action: 'toggleVisualMode' },
+ { keys: 'V', type: 'action', action: 'toggleVisualMode', actionArgs: { linewise: true }},
+ { keys: '', type: 'action', action: 'toggleVisualMode', actionArgs: { blockwise: true }},
+ { keys: '', type: 'action', action: 'toggleVisualMode', actionArgs: { blockwise: true }},
+ { keys: 'gv', type: 'action', action: 'reselectLastSelection' },
+ { keys: 'J', type: 'action', action: 'joinLines', isEdit: true },
+ { keys: 'gJ', type: 'action', action: 'joinLines', actionArgs: { keepSpaces: true }, isEdit: true },
+ { keys: 'p', type: 'action', action: 'paste', isEdit: true, actionArgs: { after: true, isEdit: true }},
+ { keys: 'P', type: 'action', action: 'paste', isEdit: true, actionArgs: { after: false, isEdit: true }},
+ { keys: 'r', type: 'action', action: 'replace', isEdit: true },
+ { keys: '@', type: 'action', action: 'replayMacro' },
+ { keys: 'q', type: 'action', action: 'enterMacroRecordMode' },
+ // Handle Replace-mode as a special case of insert mode.
+ { keys: 'R', type: 'action', action: 'enterInsertMode', isEdit: true, actionArgs: { replace: true }, context: 'normal'},
+ { keys: 'R', type: 'operator', operator: 'change', operatorArgs: { linewise: true, fullLine: true }, context: 'visual', exitVisualBlock: true},
+ { keys: 'u', type: 'action', action: 'undo', context: 'normal' },
+ { keys: 'u', type: 'operator', operator: 'changeCase', operatorArgs: {toLower: true}, context: 'visual', isEdit: true },
+ { keys: 'U', type: 'operator', operator: 'changeCase', operatorArgs: {toLower: false}, context: 'visual', isEdit: true },
+ { keys: '', type: 'action', action: 'redo' },
+ { keys: 'm', type: 'action', action: 'setMark' },
+ { keys: '"', type: 'action', action: 'setRegister' },
+ { keys: 'zz', type: 'action', action: 'scrollToCursor', actionArgs: { position: 'center' }},
+ { keys: 'z.', type: 'action', action: 'scrollToCursor', actionArgs: { position: 'center' }, motion: 'moveToFirstNonWhiteSpaceCharacter' },
+ { keys: 'zt', type: 'action', action: 'scrollToCursor', actionArgs: { position: 'top' }},
+ { keys: 'z', type: 'action', action: 'scrollToCursor', actionArgs: { position: 'top' }, motion: 'moveToFirstNonWhiteSpaceCharacter' },
+ { keys: 'z-', type: 'action', action: 'scrollToCursor', actionArgs: { position: 'bottom' }},
+ { keys: 'zb', type: 'action', action: 'scrollToCursor', actionArgs: { position: 'bottom' }, motion: 'moveToFirstNonWhiteSpaceCharacter' },
+ { keys: '.', type: 'action', action: 'repeatLastEdit' },
+ { keys: '', type: 'action', action: 'incrementNumberToken', isEdit: true, actionArgs: {increase: true, backtrack: false}},
+ { keys: '', type: 'action', action: 'incrementNumberToken', isEdit: true, actionArgs: {increase: false, backtrack: false}},
+ { keys: '', type: 'action', action: 'indent', actionArgs: { indentRight: true }, context: 'insert' },
+ { keys: '', type: 'action', action: 'indent', actionArgs: { indentRight: false }, context: 'insert' },
+ // Text object motions
+ { keys: 'a', type: 'motion', motion: 'textObjectManipulation' },
+ { keys: 'i', type: 'motion', motion: 'textObjectManipulation', motionArgs: { textObjectInner: true }},
+ // Search
+ { keys: '/', type: 'search', searchArgs: { forward: true, querySrc: 'prompt', toJumplist: true }},
+ { keys: '?', type: 'search', searchArgs: { forward: false, querySrc: 'prompt', toJumplist: true }},
+ { keys: '*', type: 'search', searchArgs: { forward: true, querySrc: 'wordUnderCursor', wholeWordOnly: true, toJumplist: true }},
+ { keys: '#', type: 'search', searchArgs: { forward: false, querySrc: 'wordUnderCursor', wholeWordOnly: true, toJumplist: true }},
+ { keys: 'g*', type: 'search', searchArgs: { forward: true, querySrc: 'wordUnderCursor', toJumplist: true }},
+ { keys: 'g#', type: 'search', searchArgs: { forward: false, querySrc: 'wordUnderCursor', toJumplist: true }},
+ // Ex command
+ { keys: ':', type: 'ex' }
+ ];
+ var defaultKeymapLength = defaultKeymap.length;
+
+ /**
+ * Ex commands
+ * Care must be taken when adding to the default Ex command map. For any
+ * pair of commands that have a shared prefix, at least one of their
+ * shortNames must not match the prefix of the other command.
+ */
+ var defaultExCommandMap = [
+ { name: 'colorscheme', shortName: 'colo' },
+ { name: 'map' },
+ { name: 'imap', shortName: 'im' },
+ { name: 'nmap', shortName: 'nm' },
+ { name: 'vmap', shortName: 'vm' },
+ { name: 'unmap' },
+ { name: 'write', shortName: 'w' },
+ { name: 'undo', shortName: 'u' },
+ { name: 'redo', shortName: 'red' },
+ { name: 'set', shortName: 'se' },
+ { name: 'setlocal', shortName: 'setl' },
+ { name: 'setglobal', shortName: 'setg' },
+ { name: 'sort', shortName: 'sor' },
+ { name: 'substitute', shortName: 's', possiblyAsync: true },
+ { name: 'nohlsearch', shortName: 'noh' },
+ { name: 'yank', shortName: 'y' },
+ { name: 'delmarks', shortName: 'delm' },
+ { name: 'registers', shortName: 'reg', excludeFromCommandHistory: true },
+ { name: 'global', shortName: 'g' }
+ ];
+
+ var Pos = CodeMirror.Pos;
+
+ var Vim = function() {
+ function enterVimMode(cm) {
+ cm.setOption('disableInput', true);
+ cm.setOption('showCursorWhenSelecting', false);
+ CodeMirror.signal(cm, "vim-mode-change", {mode: "normal"});
+ cm.on('cursorActivity', onCursorActivity);
+ maybeInitVimState(cm);
+ CodeMirror.on(cm.getInputField(), 'paste', getOnPasteFn(cm));
+ }
+
+ function leaveVimMode(cm) {
+ cm.setOption('disableInput', false);
+ cm.off('cursorActivity', onCursorActivity);
+ CodeMirror.off(cm.getInputField(), 'paste', getOnPasteFn(cm));
+ cm.state.vim = null;
+ }
+
+ function detachVimMap(cm, next) {
+ if (this == CodeMirror.keyMap.vim) {
+ CodeMirror.rmClass(cm.getWrapperElement(), "cm-fat-cursor");
+ if (cm.getOption("inputStyle") == "contenteditable" && document.body.style.caretColor != null) {
+ disableFatCursorMark(cm);
+ cm.getInputField().style.caretColor = "";
+ }
+ }
+
+ if (!next || next.attach != attachVimMap)
+ leaveVimMode(cm);
+ }
+ function attachVimMap(cm, prev) {
+ if (this == CodeMirror.keyMap.vim) {
+ CodeMirror.addClass(cm.getWrapperElement(), "cm-fat-cursor");
+ if (cm.getOption("inputStyle") == "contenteditable" && document.body.style.caretColor != null) {
+ enableFatCursorMark(cm);
+ cm.getInputField().style.caretColor = "transparent";
+ }
+ }
+
+ if (!prev || prev.attach != attachVimMap)
+ enterVimMode(cm);
+ }
+
+ function updateFatCursorMark(cm) {
+ if (!cm.state.fatCursorMarks) return;
+ clearFatCursorMark(cm);
+ var ranges = cm.listSelections(), result = []
+ for (var i = 0; i < ranges.length; i++) {
+ var range = ranges[i];
+ if (range.empty()) {
+ var lineLength = cm.getLine(range.anchor.line).length;
+ if (range.anchor.ch < lineLength) {
+ result.push(cm.markText(range.anchor, Pos(range.anchor.line, range.anchor.ch + 1),
+ {className: "cm-fat-cursor-mark"}));
+ } else {
+ result.push(cm.markText(Pos(range.anchor.line, lineLength - 1),
+ Pos(range.anchor.line, lineLength),
+ {className: "cm-fat-cursor-mark"}));
+ }
+ }
+ }
+ cm.state.fatCursorMarks = result;
+ }
+
+ function clearFatCursorMark(cm) {
+ var marks = cm.state.fatCursorMarks;
+ if (marks) for (var i = 0; i < marks.length; i++) marks[i].clear();
+ }
+
+ function enableFatCursorMark(cm) {
+ cm.state.fatCursorMarks = [];
+ updateFatCursorMark(cm)
+ cm.on("cursorActivity", updateFatCursorMark)
+ }
+
+ function disableFatCursorMark(cm) {
+ clearFatCursorMark(cm);
+ cm.off("cursorActivity", updateFatCursorMark);
+ // explicitly set fatCursorMarks to null because event listener above
+ // can be invoke after removing it, if off is called from operation
+ cm.state.fatCursorMarks = null;
+ }
+
+ // Deprecated, simply setting the keymap works again.
+ CodeMirror.defineOption('vimMode', false, function(cm, val, prev) {
+ if (val && cm.getOption("keyMap") != "vim")
+ cm.setOption("keyMap", "vim");
+ else if (!val && prev != CodeMirror.Init && /^vim/.test(cm.getOption("keyMap")))
+ cm.setOption("keyMap", "default");
+ });
+
+ function cmKey(key, cm) {
+ if (!cm) { return undefined; }
+ if (this[key]) { return this[key]; }
+ var vimKey = cmKeyToVimKey(key);
+ if (!vimKey) {
+ return false;
+ }
+ var cmd = CodeMirror.Vim.findKey(cm, vimKey);
+ if (typeof cmd == 'function') {
+ CodeMirror.signal(cm, 'vim-keypress', vimKey);
+ }
+ return cmd;
+ }
+
+ var modifiers = {'Shift': 'S', 'Ctrl': 'C', 'Alt': 'A', 'Cmd': 'D', 'Mod': 'A'};
+ var specialKeys = {Enter:'CR',Backspace:'BS',Delete:'Del',Insert:'Ins'};
+ function cmKeyToVimKey(key) {
+ if (key.charAt(0) == '\'') {
+ // Keypress character binding of format "'a'"
+ return key.charAt(1);
+ }
+ var pieces = key.split(/-(?!$)/);
+ var lastPiece = pieces[pieces.length - 1];
+ if (pieces.length == 1 && pieces[0].length == 1) {
+ // No-modifier bindings use literal character bindings above. Skip.
+ return false;
+ } else if (pieces.length == 2 && pieces[0] == 'Shift' && lastPiece.length == 1) {
+ // Ignore Shift+char bindings as they should be handled by literal character.
+ return false;
+ }
+ var hasCharacter = false;
+ for (var i = 0; i < pieces.length; i++) {
+ var piece = pieces[i];
+ if (piece in modifiers) { pieces[i] = modifiers[piece]; }
+ else { hasCharacter = true; }
+ if (piece in specialKeys) { pieces[i] = specialKeys[piece]; }
+ }
+ if (!hasCharacter) {
+ // Vim does not support modifier only keys.
+ return false;
+ }
+ // TODO: Current bindings expect the character to be lower case, but
+ // it looks like vim key notation uses upper case.
+ if (isUpperCase(lastPiece)) {
+ pieces[pieces.length - 1] = lastPiece.toLowerCase();
+ }
+ return '<' + pieces.join('-') + '>';
+ }
+
+ function getOnPasteFn(cm) {
+ var vim = cm.state.vim;
+ if (!vim.onPasteFn) {
+ vim.onPasteFn = function() {
+ if (!vim.insertMode) {
+ cm.setCursor(offsetCursor(cm.getCursor(), 0, 1));
+ actions.enterInsertMode(cm, {}, vim);
+ }
+ };
+ }
+ return vim.onPasteFn;
+ }
+
+ var numberRegex = /[\d]/;
+ var wordCharTest = [CodeMirror.isWordChar, function(ch) {
+ return ch && !CodeMirror.isWordChar(ch) && !/\s/.test(ch);
+ }], bigWordCharTest = [function(ch) {
+ return /\S/.test(ch);
+ }];
+ function makeKeyRange(start, size) {
+ var keys = [];
+ for (var i = start; i < start + size; i++) {
+ keys.push(String.fromCharCode(i));
+ }
+ return keys;
+ }
+ var upperCaseAlphabet = makeKeyRange(65, 26);
+ var lowerCaseAlphabet = makeKeyRange(97, 26);
+ var numbers = makeKeyRange(48, 10);
+ var validMarks = [].concat(upperCaseAlphabet, lowerCaseAlphabet, numbers, ['<', '>']);
+ var validRegisters = [].concat(upperCaseAlphabet, lowerCaseAlphabet, numbers, ['-', '"', '.', ':', '/']);
+
+ function isLine(cm, line) {
+ return line >= cm.firstLine() && line <= cm.lastLine();
+ }
+ function isLowerCase(k) {
+ return (/^[a-z]$/).test(k);
+ }
+ function isMatchableSymbol(k) {
+ return '()[]{}'.indexOf(k) != -1;
+ }
+ function isNumber(k) {
+ return numberRegex.test(k);
+ }
+ function isUpperCase(k) {
+ return (/^[A-Z]$/).test(k);
+ }
+ function isWhiteSpaceString(k) {
+ return (/^\s*$/).test(k);
+ }
+ function isEndOfSentenceSymbol(k) {
+ return '.?!'.indexOf(k) != -1;
+ }
+ function inArray(val, arr) {
+ for (var i = 0; i < arr.length; i++) {
+ if (arr[i] == val) {
+ return true;
+ }
+ }
+ return false;
+ }
+
+ var options = {};
+ function defineOption(name, defaultValue, type, aliases, callback) {
+ if (defaultValue === undefined && !callback) {
+ throw Error('defaultValue is required unless callback is provided');
+ }
+ if (!type) { type = 'string'; }
+ options[name] = {
+ type: type,
+ defaultValue: defaultValue,
+ callback: callback
+ };
+ if (aliases) {
+ for (var i = 0; i < aliases.length; i++) {
+ options[aliases[i]] = options[name];
+ }
+ }
+ if (defaultValue) {
+ setOption(name, defaultValue);
+ }
+ }
+
+ function setOption(name, value, cm, cfg) {
+ var option = options[name];
+ cfg = cfg || {};
+ var scope = cfg.scope;
+ if (!option) {
+ return new Error('Unknown option: ' + name);
+ }
+ if (option.type == 'boolean') {
+ if (value && value !== true) {
+ return new Error('Invalid argument: ' + name + '=' + value);
+ } else if (value !== false) {
+ // Boolean options are set to true if value is not defined.
+ value = true;
+ }
+ }
+ if (option.callback) {
+ if (scope !== 'local') {
+ option.callback(value, undefined);
+ }
+ if (scope !== 'global' && cm) {
+ option.callback(value, cm);
+ }
+ } else {
+ if (scope !== 'local') {
+ option.value = option.type == 'boolean' ? !!value : value;
+ }
+ if (scope !== 'global' && cm) {
+ cm.state.vim.options[name] = {value: value};
+ }
+ }
+ }
+
+ function getOption(name, cm, cfg) {
+ var option = options[name];
+ cfg = cfg || {};
+ var scope = cfg.scope;
+ if (!option) {
+ return new Error('Unknown option: ' + name);
+ }
+ if (option.callback) {
+ var local = cm && option.callback(undefined, cm);
+ if (scope !== 'global' && local !== undefined) {
+ return local;
+ }
+ if (scope !== 'local') {
+ return option.callback();
+ }
+ return;
+ } else {
+ var local = (scope !== 'global') && (cm && cm.state.vim.options[name]);
+ return (local || (scope !== 'local') && option || {}).value;
+ }
+ }
+
+ defineOption('filetype', undefined, 'string', ['ft'], function(name, cm) {
+ // Option is local. Do nothing for global.
+ if (cm === undefined) {
+ return;
+ }
+ // The 'filetype' option proxies to the CodeMirror 'mode' option.
+ if (name === undefined) {
+ var mode = cm.getOption('mode');
+ return mode == 'null' ? '' : mode;
+ } else {
+ var mode = name == '' ? 'null' : name;
+ cm.setOption('mode', mode);
+ }
+ });
+
+ var createCircularJumpList = function() {
+ var size = 100;
+ var pointer = -1;
+ var head = 0;
+ var tail = 0;
+ var buffer = new Array(size);
+ function add(cm, oldCur, newCur) {
+ var current = pointer % size;
+ var curMark = buffer[current];
+ function useNextSlot(cursor) {
+ var next = ++pointer % size;
+ var trashMark = buffer[next];
+ if (trashMark) {
+ trashMark.clear();
+ }
+ buffer[next] = cm.setBookmark(cursor);
+ }
+ if (curMark) {
+ var markPos = curMark.find();
+ // avoid recording redundant cursor position
+ if (markPos && !cursorEqual(markPos, oldCur)) {
+ useNextSlot(oldCur);
+ }
+ } else {
+ useNextSlot(oldCur);
+ }
+ useNextSlot(newCur);
+ head = pointer;
+ tail = pointer - size + 1;
+ if (tail < 0) {
+ tail = 0;
+ }
+ }
+ function move(cm, offset) {
+ pointer += offset;
+ if (pointer > head) {
+ pointer = head;
+ } else if (pointer < tail) {
+ pointer = tail;
+ }
+ var mark = buffer[(size + pointer) % size];
+ // skip marks that are temporarily removed from text buffer
+ if (mark && !mark.find()) {
+ var inc = offset > 0 ? 1 : -1;
+ var newCur;
+ var oldCur = cm.getCursor();
+ do {
+ pointer += inc;
+ mark = buffer[(size + pointer) % size];
+ // skip marks that are the same as current position
+ if (mark &&
+ (newCur = mark.find()) &&
+ !cursorEqual(oldCur, newCur)) {
+ break;
+ }
+ } while (pointer < head && pointer > tail);
+ }
+ return mark;
+ }
+ function find(cm, offset) {
+ var oldPointer = pointer;
+ var mark = move(cm, offset);
+ pointer = oldPointer;
+ return mark && mark.find();
+ }
+ return {
+ cachedCursor: undefined, // used for # and * jumps
+ add: add,
+ find: find,
+ move: move
+ };
+ };
+
+ // Returns an object to track the changes associated insert mode. It
+ // clones the object that is passed in, or creates an empty object one if
+ // none is provided.
+ var createInsertModeChanges = function(c) {
+ if (c) {
+ // Copy construction
+ return {
+ changes: c.changes,
+ expectCursorActivityForChange: c.expectCursorActivityForChange
+ };
+ }
+ return {
+ // Change list
+ changes: [],
+ // Set to true on change, false on cursorActivity.
+ expectCursorActivityForChange: false
+ };
+ };
+
+ function MacroModeState() {
+ this.latestRegister = undefined;
+ this.isPlaying = false;
+ this.isRecording = false;
+ this.replaySearchQueries = [];
+ this.onRecordingDone = undefined;
+ this.lastInsertModeChanges = createInsertModeChanges();
+ }
+ MacroModeState.prototype = {
+ exitMacroRecordMode: function() {
+ var macroModeState = vimGlobalState.macroModeState;
+ if (macroModeState.onRecordingDone) {
+ macroModeState.onRecordingDone(); // close dialog
+ }
+ macroModeState.onRecordingDone = undefined;
+ macroModeState.isRecording = false;
+ },
+ enterMacroRecordMode: function(cm, registerName) {
+ var register =
+ vimGlobalState.registerController.getRegister(registerName);
+ if (register) {
+ register.clear();
+ this.latestRegister = registerName;
+ if (cm.openDialog) {
+ this.onRecordingDone = cm.openDialog(
+ '(recording)['+registerName+']', null, {bottom:true});
+ }
+ this.isRecording = true;
+ }
+ }
+ };
+
+ function maybeInitVimState(cm) {
+ if (!cm.state.vim) {
+ // Store instance state in the CodeMirror object.
+ cm.state.vim = {
+ inputState: new InputState(),
+ // Vim's input state that triggered the last edit, used to repeat
+ // motions and operators with '.'.
+ lastEditInputState: undefined,
+ // Vim's action command before the last edit, used to repeat actions
+ // with '.' and insert mode repeat.
+ lastEditActionCommand: undefined,
+ // When using jk for navigation, if you move from a longer line to a
+ // shorter line, the cursor may clip to the end of the shorter line.
+ // If j is pressed again and cursor goes to the next line, the
+ // cursor should go back to its horizontal position on the longer
+ // line if it can. This is to keep track of the horizontal position.
+ lastHPos: -1,
+ // Doing the same with screen-position for gj/gk
+ lastHSPos: -1,
+ // The last motion command run. Cleared if a non-motion command gets
+ // executed in between.
+ lastMotion: null,
+ marks: {},
+ // Mark for rendering fake cursor for visual mode.
+ fakeCursor: null,
+ insertMode: false,
+ // Repeat count for changes made in insert mode, triggered by key
+ // sequences like 3,i. Only exists when insertMode is true.
+ insertModeRepeat: undefined,
+ visualMode: false,
+ // If we are in visual line mode. No effect if visualMode is false.
+ visualLine: false,
+ visualBlock: false,
+ lastSelection: null,
+ lastPastedText: null,
+ sel: {},
+ // Buffer-local/window-local values of vim options.
+ options: {}
+ };
+ }
+ return cm.state.vim;
+ }
+ var vimGlobalState;
+ function resetVimGlobalState() {
+ vimGlobalState = {
+ // The current search query.
+ searchQuery: null,
+ // Whether we are searching backwards.
+ searchIsReversed: false,
+ // Replace part of the last substituted pattern
+ lastSubstituteReplacePart: undefined,
+ jumpList: createCircularJumpList(),
+ macroModeState: new MacroModeState,
+ // Recording latest f, t, F or T motion command.
+ lastCharacterSearch: {increment:0, forward:true, selectedCharacter:''},
+ registerController: new RegisterController({}),
+ // search history buffer
+ searchHistoryController: new HistoryController(),
+ // ex Command history buffer
+ exCommandHistoryController : new HistoryController()
+ };
+ for (var optionName in options) {
+ var option = options[optionName];
+ option.value = option.defaultValue;
+ }
+ }
+
+ var lastInsertModeKeyTimer;
+ var vimApi= {
+ buildKeyMap: function() {
+ // TODO: Convert keymap into dictionary format for fast lookup.
+ },
+ // Testing hook, though it might be useful to expose the register
+ // controller anyways.
+ getRegisterController: function() {
+ return vimGlobalState.registerController;
+ },
+ // Testing hook.
+ resetVimGlobalState_: resetVimGlobalState,
+
+ // Testing hook.
+ getVimGlobalState_: function() {
+ return vimGlobalState;
+ },
+
+ // Testing hook.
+ maybeInitVimState_: maybeInitVimState,
+
+ suppressErrorLogging: false,
+
+ InsertModeKey: InsertModeKey,
+ map: function(lhs, rhs, ctx) {
+ // Add user defined key bindings.
+ exCommandDispatcher.map(lhs, rhs, ctx);
+ },
+ unmap: function(lhs, ctx) {
+ exCommandDispatcher.unmap(lhs, ctx);
+ },
+ // Non-recursive map function.
+ // NOTE: This will not create mappings to key maps that aren't present
+ // in the default key map. See TODO at bottom of function.
+ noremap: function(lhs, rhs, ctx) {
+ function toCtxArray(ctx) {
+ return ctx ? [ctx] : ['normal', 'insert', 'visual'];
+ }
+ var ctxsToMap = toCtxArray(ctx);
+ // Look through all actual defaults to find a map candidate.
+ var actualLength = defaultKeymap.length, origLength = defaultKeymapLength;
+ for (var i = actualLength - origLength;
+ i < actualLength && ctxsToMap.length;
+ i++) {
+ var mapping = defaultKeymap[i];
+ // Omit mappings that operate in the wrong context(s) and those of invalid type.
+ if (mapping.keys == rhs &&
+ (!ctx || !mapping.context || mapping.context === ctx) &&
+ mapping.type.substr(0, 2) !== 'ex' &&
+ mapping.type.substr(0, 3) !== 'key') {
+ // Make a shallow copy of the original keymap entry.
+ var newMapping = {};
+ for (var key in mapping) {
+ newMapping[key] = mapping[key];
+ }
+ // Modify it point to the new mapping with the proper context.
+ newMapping.keys = lhs;
+ if (ctx && !newMapping.context) {
+ newMapping.context = ctx;
+ }
+ // Add it to the keymap with a higher priority than the original.
+ this._mapCommand(newMapping);
+ // Record the mapped contexts as complete.
+ var mappedCtxs = toCtxArray(mapping.context);
+ ctxsToMap = ctxsToMap.filter(function(el) { return mappedCtxs.indexOf(el) === -1; });
+ }
+ }
+ // TODO: Create non-recursive keyToKey mappings for the unmapped contexts once those exist.
+ },
+ // Remove all user-defined mappings for the provided context.
+ mapclear: function(ctx) {
+ // Partition the existing keymap into user-defined and true defaults.
+ var actualLength = defaultKeymap.length,
+ origLength = defaultKeymapLength;
+ var userKeymap = defaultKeymap.slice(0, actualLength - origLength);
+ defaultKeymap = defaultKeymap.slice(actualLength - origLength);
+ if (ctx) {
+ // If a specific context is being cleared, we need to keep mappings
+ // from all other contexts.
+ for (var i = userKeymap.length - 1; i >= 0; i--) {
+ var mapping = userKeymap[i];
+ if (ctx !== mapping.context) {
+ if (mapping.context) {
+ this._mapCommand(mapping);
+ } else {
+ // `mapping` applies to all contexts so create keymap copies
+ // for each context except the one being cleared.
+ var contexts = ['normal', 'insert', 'visual'];
+ for (var j in contexts) {
+ if (contexts[j] !== ctx) {
+ var newMapping = {};
+ for (var key in mapping) {
+ newMapping[key] = mapping[key];
+ }
+ newMapping.context = contexts[j];
+ this._mapCommand(newMapping);
+ }
+ }
+ }
+ }
+ }
+ }
+ },
+ // TODO: Expose setOption and getOption as instance methods. Need to decide how to namespace
+ // them, or somehow make them work with the existing CodeMirror setOption/getOption API.
+ setOption: setOption,
+ getOption: getOption,
+ defineOption: defineOption,
+ defineEx: function(name, prefix, func){
+ if (!prefix) {
+ prefix = name;
+ } else if (name.indexOf(prefix) !== 0) {
+ throw new Error('(Vim.defineEx) "'+prefix+'" is not a prefix of "'+name+'", command not registered');
+ }
+ exCommands[name]=func;
+ exCommandDispatcher.commandMap_[prefix]={name:name, shortName:prefix, type:'api'};
+ },
+ handleKey: function (cm, key, origin) {
+ var command = this.findKey(cm, key, origin);
+ if (typeof command === 'function') {
+ return command();
+ }
+ },
+ /**
+ * This is the outermost function called by CodeMirror, after keys have
+ * been mapped to their Vim equivalents.
+ *
+ * Finds a command based on the key (and cached keys if there is a
+ * multi-key sequence). Returns `undefined` if no key is matched, a noop
+ * function if a partial match is found (multi-key), and a function to
+ * execute the bound command if a a key is matched. The function always
+ * returns true.
+ */
+ findKey: function(cm, key, origin) {
+ var vim = maybeInitVimState(cm);
+ function handleMacroRecording() {
+ var macroModeState = vimGlobalState.macroModeState;
+ if (macroModeState.isRecording) {
+ if (key == 'q') {
+ macroModeState.exitMacroRecordMode();
+ clearInputState(cm);
+ return true;
+ }
+ if (origin != 'mapping') {
+ logKey(macroModeState, key);
+ }
+ }
+ }
+ function handleEsc() {
+ if (key == '') {
+ // Clear input state and get back to normal mode.
+ clearInputState(cm);
+ if (vim.visualMode) {
+ exitVisualMode(cm);
+ } else if (vim.insertMode) {
+ exitInsertMode(cm);
+ }
+ return true;
+ }
+ }
+ function doKeyToKey(keys) {
+ // TODO: prevent infinite recursion.
+ var match;
+ while (keys) {
+ // Pull off one command key, which is either a single character
+ // or a special sequence wrapped in '<' and '>', e.g. ''.
+ match = (/<\w+-.+?>|<\w+>|./).exec(keys);
+ key = match[0];
+ keys = keys.substring(match.index + key.length);
+ CodeMirror.Vim.handleKey(cm, key, 'mapping');
+ }
+ }
+
+ function handleKeyInsertMode() {
+ if (handleEsc()) { return true; }
+ var keys = vim.inputState.keyBuffer = vim.inputState.keyBuffer + key;
+ var keysAreChars = key.length == 1;
+ var match = commandDispatcher.matchCommand(keys, defaultKeymap, vim.inputState, 'insert');
+ // Need to check all key substrings in insert mode.
+ while (keys.length > 1 && match.type != 'full') {
+ var keys = vim.inputState.keyBuffer = keys.slice(1);
+ var thisMatch = commandDispatcher.matchCommand(keys, defaultKeymap, vim.inputState, 'insert');
+ if (thisMatch.type != 'none') { match = thisMatch; }
+ }
+ if (match.type == 'none') { clearInputState(cm); return false; }
+ else if (match.type == 'partial') {
+ if (lastInsertModeKeyTimer) { window.clearTimeout(lastInsertModeKeyTimer); }
+ lastInsertModeKeyTimer = window.setTimeout(
+ function() { if (vim.insertMode && vim.inputState.keyBuffer) { clearInputState(cm); } },
+ getOption('insertModeEscKeysTimeout'));
+ return !keysAreChars;
+ }
+
+ if (lastInsertModeKeyTimer) { window.clearTimeout(lastInsertModeKeyTimer); }
+ if (keysAreChars) {
+ var selections = cm.listSelections();
+ for (var i = 0; i < selections.length; i++) {
+ var here = selections[i].head;
+ cm.replaceRange('', offsetCursor(here, 0, -(keys.length - 1)), here, '+input');
+ }
+ vimGlobalState.macroModeState.lastInsertModeChanges.changes.pop();
+ }
+ clearInputState(cm);
+ return match.command;
+ }
+
+ function handleKeyNonInsertMode() {
+ if (handleMacroRecording() || handleEsc()) { return true; }
+
+ var keys = vim.inputState.keyBuffer = vim.inputState.keyBuffer + key;
+ if (/^[1-9]\d*$/.test(keys)) { return true; }
+
+ var keysMatcher = /^(\d*)(.*)$/.exec(keys);
+ if (!keysMatcher) { clearInputState(cm); return false; }
+ var context = vim.visualMode ? 'visual' :
+ 'normal';
+ var match = commandDispatcher.matchCommand(keysMatcher[2] || keysMatcher[1], defaultKeymap, vim.inputState, context);
+ if (match.type == 'none') { clearInputState(cm); return false; }
+ else if (match.type == 'partial') { return true; }
+
+ vim.inputState.keyBuffer = '';
+ var keysMatcher = /^(\d*)(.*)$/.exec(keys);
+ if (keysMatcher[1] && keysMatcher[1] != '0') {
+ vim.inputState.pushRepeatDigit(keysMatcher[1]);
+ }
+ return match.command;
+ }
+
+ var command;
+ if (vim.insertMode) { command = handleKeyInsertMode(); }
+ else { command = handleKeyNonInsertMode(); }
+ if (command === false) {
+ return !vim.insertMode && key.length === 1 ? function() { return true; } : undefined;
+ } else if (command === true) {
+ // TODO: Look into using CodeMirror's multi-key handling.
+ // Return no-op since we are caching the key. Counts as handled, but
+ // don't want act on it just yet.
+ return function() { return true; };
+ } else {
+ return function() {
+ return cm.operation(function() {
+ cm.curOp.isVimOp = true;
+ try {
+ if (command.type == 'keyToKey') {
+ doKeyToKey(command.toKeys);
+ } else {
+ commandDispatcher.processCommand(cm, vim, command);
+ }
+ } catch (e) {
+ // clear VIM state in case it's in a bad state.
+ cm.state.vim = undefined;
+ maybeInitVimState(cm);
+ if (!CodeMirror.Vim.suppressErrorLogging) {
+ console['log'](e);
+ }
+ throw e;
+ }
+ return true;
+ });
+ };
+ }
+ },
+ handleEx: function(cm, input) {
+ exCommandDispatcher.processCommand(cm, input);
+ },
+
+ defineMotion: defineMotion,
+ defineAction: defineAction,
+ defineOperator: defineOperator,
+ mapCommand: mapCommand,
+ _mapCommand: _mapCommand,
+
+ defineRegister: defineRegister,
+
+ exitVisualMode: exitVisualMode,
+ exitInsertMode: exitInsertMode
+ };
+
+ // Represents the current input state.
+ function InputState() {
+ this.prefixRepeat = [];
+ this.motionRepeat = [];
+
+ this.operator = null;
+ this.operatorArgs = null;
+ this.motion = null;
+ this.motionArgs = null;
+ this.keyBuffer = []; // For matching multi-key commands.
+ this.registerName = null; // Defaults to the unnamed register.
+ }
+ InputState.prototype.pushRepeatDigit = function(n) {
+ if (!this.operator) {
+ this.prefixRepeat = this.prefixRepeat.concat(n);
+ } else {
+ this.motionRepeat = this.motionRepeat.concat(n);
+ }
+ };
+ InputState.prototype.getRepeat = function() {
+ var repeat = 0;
+ if (this.prefixRepeat.length > 0 || this.motionRepeat.length > 0) {
+ repeat = 1;
+ if (this.prefixRepeat.length > 0) {
+ repeat *= parseInt(this.prefixRepeat.join(''), 10);
+ }
+ if (this.motionRepeat.length > 0) {
+ repeat *= parseInt(this.motionRepeat.join(''), 10);
+ }
+ }
+ return repeat;
+ };
+
+ function clearInputState(cm, reason) {
+ cm.state.vim.inputState = new InputState();
+ CodeMirror.signal(cm, 'vim-command-done', reason);
+ }
+
+ /*
+ * Register stores information about copy and paste registers. Besides
+ * text, a register must store whether it is linewise (i.e., when it is
+ * pasted, should it insert itself into a new line, or should the text be
+ * inserted at the cursor position.)
+ */
+ function Register(text, linewise, blockwise) {
+ this.clear();
+ this.keyBuffer = [text || ''];
+ this.insertModeChanges = [];
+ this.searchQueries = [];
+ this.linewise = !!linewise;
+ this.blockwise = !!blockwise;
+ }
+ Register.prototype = {
+ setText: function(text, linewise, blockwise) {
+ this.keyBuffer = [text || ''];
+ this.linewise = !!linewise;
+ this.blockwise = !!blockwise;
+ },
+ pushText: function(text, linewise) {
+ // if this register has ever been set to linewise, use linewise.
+ if (linewise) {
+ if (!this.linewise) {
+ this.keyBuffer.push('\n');
+ }
+ this.linewise = true;
+ }
+ this.keyBuffer.push(text);
+ },
+ pushInsertModeChanges: function(changes) {
+ this.insertModeChanges.push(createInsertModeChanges(changes));
+ },
+ pushSearchQuery: function(query) {
+ this.searchQueries.push(query);
+ },
+ clear: function() {
+ this.keyBuffer = [];
+ this.insertModeChanges = [];
+ this.searchQueries = [];
+ this.linewise = false;
+ },
+ toString: function() {
+ return this.keyBuffer.join('');
+ }
+ };
+
+ /**
+ * Defines an external register.
+ *
+ * The name should be a single character that will be used to reference the register.
+ * The register should support setText, pushText, clear, and toString(). See Register
+ * for a reference implementation.
+ */
+ function defineRegister(name, register) {
+ var registers = vimGlobalState.registerController.registers;
+ if (!name || name.length != 1) {
+ throw Error('Register name must be 1 character');
+ }
+ if (registers[name]) {
+ throw Error('Register already defined ' + name);
+ }
+ registers[name] = register;
+ validRegisters.push(name);
+ }
+
+ /*
+ * vim registers allow you to keep many independent copy and paste buffers.
+ * See http://usevim.com/2012/04/13/registers/ for an introduction.
+ *
+ * RegisterController keeps the state of all the registers. An initial
+ * state may be passed in. The unnamed register '"' will always be
+ * overridden.
+ */
+ function RegisterController(registers) {
+ this.registers = registers;
+ this.unnamedRegister = registers['"'] = new Register();
+ registers['.'] = new Register();
+ registers[':'] = new Register();
+ registers['/'] = new Register();
+ }
+ RegisterController.prototype = {
+ pushText: function(registerName, operator, text, linewise, blockwise) {
+ if (linewise && text.charAt(text.length - 1) !== '\n'){
+ text += '\n';
+ }
+ // Lowercase and uppercase registers refer to the same register.
+ // Uppercase just means append.
+ var register = this.isValidRegister(registerName) ?
+ this.getRegister(registerName) : null;
+ // if no register/an invalid register was specified, things go to the
+ // default registers
+ if (!register) {
+ switch (operator) {
+ case 'yank':
+ // The 0 register contains the text from the most recent yank.
+ this.registers['0'] = new Register(text, linewise, blockwise);
+ break;
+ case 'delete':
+ case 'change':
+ if (text.indexOf('\n') == -1) {
+ // Delete less than 1 line. Update the small delete register.
+ this.registers['-'] = new Register(text, linewise);
+ } else {
+ // Shift down the contents of the numbered registers and put the
+ // deleted text into register 1.
+ this.shiftNumericRegisters_();
+ this.registers['1'] = new Register(text, linewise);
+ }
+ break;
+ }
+ // Make sure the unnamed register is set to what just happened
+ this.unnamedRegister.setText(text, linewise, blockwise);
+ return;
+ }
+
+ // If we've gotten to this point, we've actually specified a register
+ var append = isUpperCase(registerName);
+ if (append) {
+ register.pushText(text, linewise);
+ } else {
+ register.setText(text, linewise, blockwise);
+ }
+ // The unnamed register always has the same value as the last used
+ // register.
+ this.unnamedRegister.setText(register.toString(), linewise);
+ },
+ // Gets the register named @name. If one of @name doesn't already exist,
+ // create it. If @name is invalid, return the unnamedRegister.
+ getRegister: function(name) {
+ if (!this.isValidRegister(name)) {
+ return this.unnamedRegister;
+ }
+ name = name.toLowerCase();
+ if (!this.registers[name]) {
+ this.registers[name] = new Register();
+ }
+ return this.registers[name];
+ },
+ isValidRegister: function(name) {
+ return name && inArray(name, validRegisters);
+ },
+ shiftNumericRegisters_: function() {
+ for (var i = 9; i >= 2; i--) {
+ this.registers[i] = this.getRegister('' + (i - 1));
+ }
+ }
+ };
+ function HistoryController() {
+ this.historyBuffer = [];
+ this.iterator = 0;
+ this.initialPrefix = null;
+ }
+ HistoryController.prototype = {
+ // the input argument here acts a user entered prefix for a small time
+ // until we start autocompletion in which case it is the autocompleted.
+ nextMatch: function (input, up) {
+ var historyBuffer = this.historyBuffer;
+ var dir = up ? -1 : 1;
+ if (this.initialPrefix === null) this.initialPrefix = input;
+ for (var i = this.iterator + dir; up ? i >= 0 : i < historyBuffer.length; i+= dir) {
+ var element = historyBuffer[i];
+ for (var j = 0; j <= element.length; j++) {
+ if (this.initialPrefix == element.substring(0, j)) {
+ this.iterator = i;
+ return element;
+ }
+ }
+ }
+ // should return the user input in case we reach the end of buffer.
+ if (i >= historyBuffer.length) {
+ this.iterator = historyBuffer.length;
+ return this.initialPrefix;
+ }
+ // return the last autocompleted query or exCommand as it is.
+ if (i < 0 ) return input;
+ },
+ pushInput: function(input) {
+ var index = this.historyBuffer.indexOf(input);
+ if (index > -1) this.historyBuffer.splice(index, 1);
+ if (input.length) this.historyBuffer.push(input);
+ },
+ reset: function() {
+ this.initialPrefix = null;
+ this.iterator = this.historyBuffer.length;
+ }
+ };
+ var commandDispatcher = {
+ matchCommand: function(keys, keyMap, inputState, context) {
+ var matches = commandMatches(keys, keyMap, context, inputState);
+ if (!matches.full && !matches.partial) {
+ return {type: 'none'};
+ } else if (!matches.full && matches.partial) {
+ return {type: 'partial'};
+ }
+
+ var bestMatch;
+ for (var i = 0; i < matches.full.length; i++) {
+ var match = matches.full[i];
+ if (!bestMatch) {
+ bestMatch = match;
+ }
+ }
+ if (bestMatch.keys.slice(-11) == '') {
+ var character = lastChar(keys);
+ if (!character) return {type: 'none'};
+ inputState.selectedCharacter = character;
+ }
+ return {type: 'full', command: bestMatch};
+ },
+ processCommand: function(cm, vim, command) {
+ vim.inputState.repeatOverride = command.repeatOverride;
+ switch (command.type) {
+ case 'motion':
+ this.processMotion(cm, vim, command);
+ break;
+ case 'operator':
+ this.processOperator(cm, vim, command);
+ break;
+ case 'operatorMotion':
+ this.processOperatorMotion(cm, vim, command);
+ break;
+ case 'action':
+ this.processAction(cm, vim, command);
+ break;
+ case 'search':
+ this.processSearch(cm, vim, command);
+ break;
+ case 'ex':
+ case 'keyToEx':
+ this.processEx(cm, vim, command);
+ break;
+ default:
+ break;
+ }
+ },
+ processMotion: function(cm, vim, command) {
+ vim.inputState.motion = command.motion;
+ vim.inputState.motionArgs = copyArgs(command.motionArgs);
+ this.evalInput(cm, vim);
+ },
+ processOperator: function(cm, vim, command) {
+ var inputState = vim.inputState;
+ if (inputState.operator) {
+ if (inputState.operator == command.operator) {
+ // Typing an operator twice like 'dd' makes the operator operate
+ // linewise
+ inputState.motion = 'expandToLine';
+ inputState.motionArgs = { linewise: true };
+ this.evalInput(cm, vim);
+ return;
+ } else {
+ // 2 different operators in a row doesn't make sense.
+ clearInputState(cm);
+ }
+ }
+ inputState.operator = command.operator;
+ inputState.operatorArgs = copyArgs(command.operatorArgs);
+ if (command.exitVisualBlock) {
+ vim.visualBlock = false;
+ updateCmSelection(cm);
+ }
+ if (vim.visualMode) {
+ // Operating on a selection in visual mode. We don't need a motion.
+ this.evalInput(cm, vim);
+ }
+ },
+ processOperatorMotion: function(cm, vim, command) {
+ var visualMode = vim.visualMode;
+ var operatorMotionArgs = copyArgs(command.operatorMotionArgs);
+ if (operatorMotionArgs) {
+ // Operator motions may have special behavior in visual mode.
+ if (visualMode && operatorMotionArgs.visualLine) {
+ vim.visualLine = true;
+ }
+ }
+ this.processOperator(cm, vim, command);
+ if (!visualMode) {
+ this.processMotion(cm, vim, command);
+ }
+ },
+ processAction: function(cm, vim, command) {
+ var inputState = vim.inputState;
+ var repeat = inputState.getRepeat();
+ var repeatIsExplicit = !!repeat;
+ var actionArgs = copyArgs(command.actionArgs) || {};
+ if (inputState.selectedCharacter) {
+ actionArgs.selectedCharacter = inputState.selectedCharacter;
+ }
+ // Actions may or may not have motions and operators. Do these first.
+ if (command.operator) {
+ this.processOperator(cm, vim, command);
+ }
+ if (command.motion) {
+ this.processMotion(cm, vim, command);
+ }
+ if (command.motion || command.operator) {
+ this.evalInput(cm, vim);
+ }
+ actionArgs.repeat = repeat || 1;
+ actionArgs.repeatIsExplicit = repeatIsExplicit;
+ actionArgs.registerName = inputState.registerName;
+ clearInputState(cm);
+ vim.lastMotion = null;
+ if (command.isEdit) {
+ this.recordLastEdit(vim, inputState, command);
+ }
+ actions[command.action](cm, actionArgs, vim);
+ },
+ processSearch: function(cm, vim, command) {
+ if (!cm.getSearchCursor) {
+ // Search depends on SearchCursor.
+ return;
+ }
+ var forward = command.searchArgs.forward;
+ var wholeWordOnly = command.searchArgs.wholeWordOnly;
+ getSearchState(cm).setReversed(!forward);
+ var promptPrefix = (forward) ? '/' : '?';
+ var originalQuery = getSearchState(cm).getQuery();
+ var originalScrollPos = cm.getScrollInfo();
+ function handleQuery(query, ignoreCase, smartCase) {
+ vimGlobalState.searchHistoryController.pushInput(query);
+ vimGlobalState.searchHistoryController.reset();
+ try {
+ updateSearchQuery(cm, query, ignoreCase, smartCase);
+ } catch (e) {
+ showConfirm(cm, 'Invalid regex: ' + query);
+ clearInputState(cm);
+ return;
+ }
+ commandDispatcher.processMotion(cm, vim, {
+ type: 'motion',
+ motion: 'findNext',
+ motionArgs: { forward: true, toJumplist: command.searchArgs.toJumplist }
+ });
+ }
+ function onPromptClose(query) {
+ cm.scrollTo(originalScrollPos.left, originalScrollPos.top);
+ handleQuery(query, true /** ignoreCase */, true /** smartCase */);
+ var macroModeState = vimGlobalState.macroModeState;
+ if (macroModeState.isRecording) {
+ logSearchQuery(macroModeState, query);
+ }
+ }
+ function onPromptKeyUp(e, query, close) {
+ var keyName = CodeMirror.keyName(e), up, offset;
+ if (keyName == 'Up' || keyName == 'Down') {
+ up = keyName == 'Up' ? true : false;
+ offset = e.target ? e.target.selectionEnd : 0;
+ query = vimGlobalState.searchHistoryController.nextMatch(query, up) || '';
+ close(query);
+ if (offset && e.target) e.target.selectionEnd = e.target.selectionStart = Math.min(offset, e.target.value.length);
+ } else {
+ if ( keyName != 'Left' && keyName != 'Right' && keyName != 'Ctrl' && keyName != 'Alt' && keyName != 'Shift')
+ vimGlobalState.searchHistoryController.reset();
+ }
+ var parsedQuery;
+ try {
+ parsedQuery = updateSearchQuery(cm, query,
+ true /** ignoreCase */, true /** smartCase */);
+ } catch (e) {
+ // Swallow bad regexes for incremental search.
+ }
+ if (parsedQuery) {
+ cm.scrollIntoView(findNext(cm, !forward, parsedQuery), 30);
+ } else {
+ clearSearchHighlight(cm);
+ cm.scrollTo(originalScrollPos.left, originalScrollPos.top);
+ }
+ }
+ function onPromptKeyDown(e, query, close) {
+ var keyName = CodeMirror.keyName(e);
+ if (keyName == 'Esc' || keyName == 'Ctrl-C' || keyName == 'Ctrl-[' ||
+ (keyName == 'Backspace' && query == '')) {
+ vimGlobalState.searchHistoryController.pushInput(query);
+ vimGlobalState.searchHistoryController.reset();
+ updateSearchQuery(cm, originalQuery);
+ clearSearchHighlight(cm);
+ cm.scrollTo(originalScrollPos.left, originalScrollPos.top);
+ CodeMirror.e_stop(e);
+ clearInputState(cm);
+ close();
+ cm.focus();
+ } else if (keyName == 'Up' || keyName == 'Down') {
+ CodeMirror.e_stop(e);
+ } else if (keyName == 'Ctrl-U') {
+ // Ctrl-U clears input.
+ CodeMirror.e_stop(e);
+ close('');
+ }
+ }
+ switch (command.searchArgs.querySrc) {
+ case 'prompt':
+ var macroModeState = vimGlobalState.macroModeState;
+ if (macroModeState.isPlaying) {
+ var query = macroModeState.replaySearchQueries.shift();
+ handleQuery(query, true /** ignoreCase */, false /** smartCase */);
+ } else {
+ showPrompt(cm, {
+ onClose: onPromptClose,
+ prefix: promptPrefix,
+ desc: searchPromptDesc,
+ onKeyUp: onPromptKeyUp,
+ onKeyDown: onPromptKeyDown
+ });
+ }
+ break;
+ case 'wordUnderCursor':
+ var word = expandWordUnderCursor(cm, false /** inclusive */,
+ true /** forward */, false /** bigWord */,
+ true /** noSymbol */);
+ var isKeyword = true;
+ if (!word) {
+ word = expandWordUnderCursor(cm, false /** inclusive */,
+ true /** forward */, false /** bigWord */,
+ false /** noSymbol */);
+ isKeyword = false;
+ }
+ if (!word) {
+ return;
+ }
+ var query = cm.getLine(word.start.line).substring(word.start.ch,
+ word.end.ch);
+ if (isKeyword && wholeWordOnly) {
+ query = '\\b' + query + '\\b';
+ } else {
+ query = escapeRegex(query);
+ }
+
+ // cachedCursor is used to save the old position of the cursor
+ // when * or # causes vim to seek for the nearest word and shift
+ // the cursor before entering the motion.
+ vimGlobalState.jumpList.cachedCursor = cm.getCursor();
+ cm.setCursor(word.start);
+
+ handleQuery(query, true /** ignoreCase */, false /** smartCase */);
+ break;
+ }
+ },
+ processEx: function(cm, vim, command) {
+ function onPromptClose(input) {
+ // Give the prompt some time to close so that if processCommand shows
+ // an error, the elements don't overlap.
+ vimGlobalState.exCommandHistoryController.pushInput(input);
+ vimGlobalState.exCommandHistoryController.reset();
+ exCommandDispatcher.processCommand(cm, input);
+ }
+ function onPromptKeyDown(e, input, close) {
+ var keyName = CodeMirror.keyName(e), up, offset;
+ if (keyName == 'Esc' || keyName == 'Ctrl-C' || keyName == 'Ctrl-[' ||
+ (keyName == 'Backspace' && input == '')) {
+ vimGlobalState.exCommandHistoryController.pushInput(input);
+ vimGlobalState.exCommandHistoryController.reset();
+ CodeMirror.e_stop(e);
+ clearInputState(cm);
+ close();
+ cm.focus();
+ }
+ if (keyName == 'Up' || keyName == 'Down') {
+ CodeMirror.e_stop(e);
+ up = keyName == 'Up' ? true : false;
+ offset = e.target ? e.target.selectionEnd : 0;
+ input = vimGlobalState.exCommandHistoryController.nextMatch(input, up) || '';
+ close(input);
+ if (offset && e.target) e.target.selectionEnd = e.target.selectionStart = Math.min(offset, e.target.value.length);
+ } else if (keyName == 'Ctrl-U') {
+ // Ctrl-U clears input.
+ CodeMirror.e_stop(e);
+ close('');
+ } else {
+ if ( keyName != 'Left' && keyName != 'Right' && keyName != 'Ctrl' && keyName != 'Alt' && keyName != 'Shift')
+ vimGlobalState.exCommandHistoryController.reset();
+ }
+ }
+ if (command.type == 'keyToEx') {
+ // Handle user defined Ex to Ex mappings
+ exCommandDispatcher.processCommand(cm, command.exArgs.input);
+ } else {
+ if (vim.visualMode) {
+ showPrompt(cm, { onClose: onPromptClose, prefix: ':', value: '\'<,\'>',
+ onKeyDown: onPromptKeyDown, selectValueOnOpen: false});
+ } else {
+ showPrompt(cm, { onClose: onPromptClose, prefix: ':',
+ onKeyDown: onPromptKeyDown});
+ }
+ }
+ },
+ evalInput: function(cm, vim) {
+ // If the motion command is set, execute both the operator and motion.
+ // Otherwise return.
+ var inputState = vim.inputState;
+ var motion = inputState.motion;
+ var motionArgs = inputState.motionArgs || {};
+ var operator = inputState.operator;
+ var operatorArgs = inputState.operatorArgs || {};
+ var registerName = inputState.registerName;
+ var sel = vim.sel;
+ // TODO: Make sure cm and vim selections are identical outside visual mode.
+ var origHead = copyCursor(vim.visualMode ? clipCursorToContent(cm, sel.head): cm.getCursor('head'));
+ var origAnchor = copyCursor(vim.visualMode ? clipCursorToContent(cm, sel.anchor) : cm.getCursor('anchor'));
+ var oldHead = copyCursor(origHead);
+ var oldAnchor = copyCursor(origAnchor);
+ var newHead, newAnchor;
+ var repeat;
+ if (operator) {
+ this.recordLastEdit(vim, inputState);
+ }
+ if (inputState.repeatOverride !== undefined) {
+ // If repeatOverride is specified, that takes precedence over the
+ // input state's repeat. Used by Ex mode and can be user defined.
+ repeat = inputState.repeatOverride;
+ } else {
+ repeat = inputState.getRepeat();
+ }
+ if (repeat > 0 && motionArgs.explicitRepeat) {
+ motionArgs.repeatIsExplicit = true;
+ } else if (motionArgs.noRepeat ||
+ (!motionArgs.explicitRepeat && repeat === 0)) {
+ repeat = 1;
+ motionArgs.repeatIsExplicit = false;
+ }
+ if (inputState.selectedCharacter) {
+ // If there is a character input, stick it in all of the arg arrays.
+ motionArgs.selectedCharacter = operatorArgs.selectedCharacter =
+ inputState.selectedCharacter;
+ }
+ motionArgs.repeat = repeat;
+ clearInputState(cm);
+ if (motion) {
+ var motionResult = motions[motion](cm, origHead, motionArgs, vim);
+ vim.lastMotion = motions[motion];
+ if (!motionResult) {
+ return;
+ }
+ if (motionArgs.toJumplist) {
+ var jumpList = vimGlobalState.jumpList;
+ // if the current motion is # or *, use cachedCursor
+ var cachedCursor = jumpList.cachedCursor;
+ if (cachedCursor) {
+ recordJumpPosition(cm, cachedCursor, motionResult);
+ delete jumpList.cachedCursor;
+ } else {
+ recordJumpPosition(cm, origHead, motionResult);
+ }
+ }
+ if (motionResult instanceof Array) {
+ newAnchor = motionResult[0];
+ newHead = motionResult[1];
+ } else {
+ newHead = motionResult;
+ }
+ // TODO: Handle null returns from motion commands better.
+ if (!newHead) {
+ newHead = copyCursor(origHead);
+ }
+ if (vim.visualMode) {
+ if (!(vim.visualBlock && newHead.ch === Infinity)) {
+ newHead = clipCursorToContent(cm, newHead);
+ }
+ if (newAnchor) {
+ newAnchor = clipCursorToContent(cm, newAnchor);
+ }
+ newAnchor = newAnchor || oldAnchor;
+ sel.anchor = newAnchor;
+ sel.head = newHead;
+ updateCmSelection(cm);
+ updateMark(cm, vim, '<',
+ cursorIsBefore(newAnchor, newHead) ? newAnchor
+ : newHead);
+ updateMark(cm, vim, '>',
+ cursorIsBefore(newAnchor, newHead) ? newHead
+ : newAnchor);
+ } else if (!operator) {
+ newHead = clipCursorToContent(cm, newHead);
+ cm.setCursor(newHead.line, newHead.ch);
+ }
+ }
+ if (operator) {
+ if (operatorArgs.lastSel) {
+ // Replaying a visual mode operation
+ newAnchor = oldAnchor;
+ var lastSel = operatorArgs.lastSel;
+ var lineOffset = Math.abs(lastSel.head.line - lastSel.anchor.line);
+ var chOffset = Math.abs(lastSel.head.ch - lastSel.anchor.ch);
+ if (lastSel.visualLine) {
+ // Linewise Visual mode: The same number of lines.
+ newHead = Pos(oldAnchor.line + lineOffset, oldAnchor.ch);
+ } else if (lastSel.visualBlock) {
+ // Blockwise Visual mode: The same number of lines and columns.
+ newHead = Pos(oldAnchor.line + lineOffset, oldAnchor.ch + chOffset);
+ } else if (lastSel.head.line == lastSel.anchor.line) {
+ // Normal Visual mode within one line: The same number of characters.
+ newHead = Pos(oldAnchor.line, oldAnchor.ch + chOffset);
+ } else {
+ // Normal Visual mode with several lines: The same number of lines, in the
+ // last line the same number of characters as in the last line the last time.
+ newHead = Pos(oldAnchor.line + lineOffset, oldAnchor.ch);
+ }
+ vim.visualMode = true;
+ vim.visualLine = lastSel.visualLine;
+ vim.visualBlock = lastSel.visualBlock;
+ sel = vim.sel = {
+ anchor: newAnchor,
+ head: newHead
+ };
+ updateCmSelection(cm);
+ } else if (vim.visualMode) {
+ operatorArgs.lastSel = {
+ anchor: copyCursor(sel.anchor),
+ head: copyCursor(sel.head),
+ visualBlock: vim.visualBlock,
+ visualLine: vim.visualLine
+ };
+ }
+ var curStart, curEnd, linewise, mode;
+ var cmSel;
+ if (vim.visualMode) {
+ // Init visual op
+ curStart = cursorMin(sel.head, sel.anchor);
+ curEnd = cursorMax(sel.head, sel.anchor);
+ linewise = vim.visualLine || operatorArgs.linewise;
+ mode = vim.visualBlock ? 'block' :
+ linewise ? 'line' :
+ 'char';
+ cmSel = makeCmSelection(cm, {
+ anchor: curStart,
+ head: curEnd
+ }, mode);
+ if (linewise) {
+ var ranges = cmSel.ranges;
+ if (mode == 'block') {
+ // Linewise operators in visual block mode extend to end of line
+ for (var i = 0; i < ranges.length; i++) {
+ ranges[i].head.ch = lineLength(cm, ranges[i].head.line);
+ }
+ } else if (mode == 'line') {
+ ranges[0].head = Pos(ranges[0].head.line + 1, 0);
+ }
+ }
+ } else {
+ // Init motion op
+ curStart = copyCursor(newAnchor || oldAnchor);
+ curEnd = copyCursor(newHead || oldHead);
+ if (cursorIsBefore(curEnd, curStart)) {
+ var tmp = curStart;
+ curStart = curEnd;
+ curEnd = tmp;
+ }
+ linewise = motionArgs.linewise || operatorArgs.linewise;
+ if (linewise) {
+ // Expand selection to entire line.
+ expandSelectionToLine(cm, curStart, curEnd);
+ } else if (motionArgs.forward) {
+ // Clip to trailing newlines only if the motion goes forward.
+ clipToLine(cm, curStart, curEnd);
+ }
+ mode = 'char';
+ var exclusive = !motionArgs.inclusive || linewise;
+ cmSel = makeCmSelection(cm, {
+ anchor: curStart,
+ head: curEnd
+ }, mode, exclusive);
+ }
+ cm.setSelections(cmSel.ranges, cmSel.primary);
+ vim.lastMotion = null;
+ operatorArgs.repeat = repeat; // For indent in visual mode.
+ operatorArgs.registerName = registerName;
+ // Keep track of linewise as it affects how paste and change behave.
+ operatorArgs.linewise = linewise;
+ var operatorMoveTo = operators[operator](
+ cm, operatorArgs, cmSel.ranges, oldAnchor, newHead);
+ if (vim.visualMode) {
+ exitVisualMode(cm, operatorMoveTo != null);
+ }
+ if (operatorMoveTo) {
+ cm.setCursor(operatorMoveTo);
+ }
+ }
+ },
+ recordLastEdit: function(vim, inputState, actionCommand) {
+ var macroModeState = vimGlobalState.macroModeState;
+ if (macroModeState.isPlaying) { return; }
+ vim.lastEditInputState = inputState;
+ vim.lastEditActionCommand = actionCommand;
+ macroModeState.lastInsertModeChanges.changes = [];
+ macroModeState.lastInsertModeChanges.expectCursorActivityForChange = false;
+ macroModeState.lastInsertModeChanges.visualBlock = vim.visualBlock ? vim.sel.head.line - vim.sel.anchor.line : 0;
+ }
+ };
+
+ /**
+ * typedef {Object{line:number,ch:number}} Cursor An object containing the
+ * position of the cursor.
+ */
+ // All of the functions below return Cursor objects.
+ var motions = {
+ moveToTopLine: function(cm, _head, motionArgs) {
+ var line = getUserVisibleLines(cm).top + motionArgs.repeat -1;
+ return Pos(line, findFirstNonWhiteSpaceCharacter(cm.getLine(line)));
+ },
+ moveToMiddleLine: function(cm) {
+ var range = getUserVisibleLines(cm);
+ var line = Math.floor((range.top + range.bottom) * 0.5);
+ return Pos(line, findFirstNonWhiteSpaceCharacter(cm.getLine(line)));
+ },
+ moveToBottomLine: function(cm, _head, motionArgs) {
+ var line = getUserVisibleLines(cm).bottom - motionArgs.repeat +1;
+ return Pos(line, findFirstNonWhiteSpaceCharacter(cm.getLine(line)));
+ },
+ expandToLine: function(_cm, head, motionArgs) {
+ // Expands forward to end of line, and then to next line if repeat is
+ // >1. Does not handle backward motion!
+ var cur = head;
+ return Pos(cur.line + motionArgs.repeat - 1, Infinity);
+ },
+ findNext: function(cm, _head, motionArgs) {
+ var state = getSearchState(cm);
+ var query = state.getQuery();
+ if (!query) {
+ return;
+ }
+ var prev = !motionArgs.forward;
+ // If search is initiated with ? instead of /, negate direction.
+ prev = (state.isReversed()) ? !prev : prev;
+ highlightSearchMatches(cm, query);
+ return findNext(cm, prev/** prev */, query, motionArgs.repeat);
+ },
+ goToMark: function(cm, _head, motionArgs, vim) {
+ var pos = getMarkPos(cm, vim, motionArgs.selectedCharacter);
+ if (pos) {
+ return motionArgs.linewise ? { line: pos.line, ch: findFirstNonWhiteSpaceCharacter(cm.getLine(pos.line)) } : pos;
+ }
+ return null;
+ },
+ moveToOtherHighlightedEnd: function(cm, _head, motionArgs, vim) {
+ if (vim.visualBlock && motionArgs.sameLine) {
+ var sel = vim.sel;
+ return [
+ clipCursorToContent(cm, Pos(sel.anchor.line, sel.head.ch)),
+ clipCursorToContent(cm, Pos(sel.head.line, sel.anchor.ch))
+ ];
+ } else {
+ return ([vim.sel.head, vim.sel.anchor]);
+ }
+ },
+ jumpToMark: function(cm, head, motionArgs, vim) {
+ var best = head;
+ for (var i = 0; i < motionArgs.repeat; i++) {
+ var cursor = best;
+ for (var key in vim.marks) {
+ if (!isLowerCase(key)) {
+ continue;
+ }
+ var mark = vim.marks[key].find();
+ var isWrongDirection = (motionArgs.forward) ?
+ cursorIsBefore(mark, cursor) : cursorIsBefore(cursor, mark);
+
+ if (isWrongDirection) {
+ continue;
+ }
+ if (motionArgs.linewise && (mark.line == cursor.line)) {
+ continue;
+ }
+
+ var equal = cursorEqual(cursor, best);
+ var between = (motionArgs.forward) ?
+ cursorIsBetween(cursor, mark, best) :
+ cursorIsBetween(best, mark, cursor);
+
+ if (equal || between) {
+ best = mark;
+ }
+ }
+ }
+
+ if (motionArgs.linewise) {
+ // Vim places the cursor on the first non-whitespace character of
+ // the line if there is one, else it places the cursor at the end
+ // of the line, regardless of whether a mark was found.
+ best = Pos(best.line, findFirstNonWhiteSpaceCharacter(cm.getLine(best.line)));
+ }
+ return best;
+ },
+ moveByCharacters: function(_cm, head, motionArgs) {
+ var cur = head;
+ var repeat = motionArgs.repeat;
+ var ch = motionArgs.forward ? cur.ch + repeat : cur.ch - repeat;
+ return Pos(cur.line, ch);
+ },
+ moveByLines: function(cm, head, motionArgs, vim) {
+ var cur = head;
+ var endCh = cur.ch;
+ // Depending what our last motion was, we may want to do different
+ // things. If our last motion was moving vertically, we want to
+ // preserve the HPos from our last horizontal move. If our last motion
+ // was going to the end of a line, moving vertically we should go to
+ // the end of the line, etc.
+ switch (vim.lastMotion) {
+ case this.moveByLines:
+ case this.moveByDisplayLines:
+ case this.moveByScroll:
+ case this.moveToColumn:
+ case this.moveToEol:
+ endCh = vim.lastHPos;
+ break;
+ default:
+ vim.lastHPos = endCh;
+ }
+ var repeat = motionArgs.repeat+(motionArgs.repeatOffset||0);
+ var line = motionArgs.forward ? cur.line + repeat : cur.line - repeat;
+ var first = cm.firstLine();
+ var last = cm.lastLine();
+ var posV = cm.findPosV(cur, (motionArgs.forward ? repeat : -repeat), 'line', vim.lastHSPos);
+ var hasMarkedText = motionArgs.forward ? posV.line > line : posV.line < line;
+ if (hasMarkedText) {
+ line = posV.line;
+ endCh = posV.ch;
+ }
+ // Vim go to line begin or line end when cursor at first/last line and
+ // move to previous/next line is triggered.
+ if (line < first && cur.line == first){
+ return this.moveToStartOfLine(cm, head, motionArgs, vim);
+ }else if (line > last && cur.line == last){
+ return this.moveToEol(cm, head, motionArgs, vim, true);
+ }
+ if (motionArgs.toFirstChar){
+ endCh=findFirstNonWhiteSpaceCharacter(cm.getLine(line));
+ vim.lastHPos = endCh;
+ }
+ vim.lastHSPos = cm.charCoords(Pos(line, endCh),'div').left;
+ return Pos(line, endCh);
+ },
+ moveByDisplayLines: function(cm, head, motionArgs, vim) {
+ var cur = head;
+ switch (vim.lastMotion) {
+ case this.moveByDisplayLines:
+ case this.moveByScroll:
+ case this.moveByLines:
+ case this.moveToColumn:
+ case this.moveToEol:
+ break;
+ default:
+ vim.lastHSPos = cm.charCoords(cur,'div').left;
+ }
+ var repeat = motionArgs.repeat;
+ var res=cm.findPosV(cur,(motionArgs.forward ? repeat : -repeat),'line',vim.lastHSPos);
+ if (res.hitSide) {
+ if (motionArgs.forward) {
+ var lastCharCoords = cm.charCoords(res, 'div');
+ var goalCoords = { top: lastCharCoords.top + 8, left: vim.lastHSPos };
+ var res = cm.coordsChar(goalCoords, 'div');
+ } else {
+ var resCoords = cm.charCoords(Pos(cm.firstLine(), 0), 'div');
+ resCoords.left = vim.lastHSPos;
+ res = cm.coordsChar(resCoords, 'div');
+ }
+ }
+ vim.lastHPos = res.ch;
+ return res;
+ },
+ moveByPage: function(cm, head, motionArgs) {
+ // CodeMirror only exposes functions that move the cursor page down, so
+ // doing this bad hack to move the cursor and move it back. evalInput
+ // will move the cursor to where it should be in the end.
+ var curStart = head;
+ var repeat = motionArgs.repeat;
+ return cm.findPosV(curStart, (motionArgs.forward ? repeat : -repeat), 'page');
+ },
+ moveByParagraph: function(cm, head, motionArgs) {
+ var dir = motionArgs.forward ? 1 : -1;
+ return findParagraph(cm, head, motionArgs.repeat, dir);
+ },
+ moveBySentence: function(cm, head, motionArgs) {
+ var dir = motionArgs.forward ? 1 : -1;
+ return findSentence(cm, head, motionArgs.repeat, dir);
+ },
+ moveByScroll: function(cm, head, motionArgs, vim) {
+ var scrollbox = cm.getScrollInfo();
+ var curEnd = null;
+ var repeat = motionArgs.repeat;
+ if (!repeat) {
+ repeat = scrollbox.clientHeight / (2 * cm.defaultTextHeight());
+ }
+ var orig = cm.charCoords(head, 'local');
+ motionArgs.repeat = repeat;
+ var curEnd = motions.moveByDisplayLines(cm, head, motionArgs, vim);
+ if (!curEnd) {
+ return null;
+ }
+ var dest = cm.charCoords(curEnd, 'local');
+ cm.scrollTo(null, scrollbox.top + dest.top - orig.top);
+ return curEnd;
+ },
+ moveByWords: function(cm, head, motionArgs) {
+ return moveToWord(cm, head, motionArgs.repeat, !!motionArgs.forward,
+ !!motionArgs.wordEnd, !!motionArgs.bigWord);
+ },
+ moveTillCharacter: function(cm, _head, motionArgs) {
+ var repeat = motionArgs.repeat;
+ var curEnd = moveToCharacter(cm, repeat, motionArgs.forward,
+ motionArgs.selectedCharacter);
+ var increment = motionArgs.forward ? -1 : 1;
+ recordLastCharacterSearch(increment, motionArgs);
+ if (!curEnd) return null;
+ curEnd.ch += increment;
+ return curEnd;
+ },
+ moveToCharacter: function(cm, head, motionArgs) {
+ var repeat = motionArgs.repeat;
+ recordLastCharacterSearch(0, motionArgs);
+ return moveToCharacter(cm, repeat, motionArgs.forward,
+ motionArgs.selectedCharacter) || head;
+ },
+ moveToSymbol: function(cm, head, motionArgs) {
+ var repeat = motionArgs.repeat;
+ return findSymbol(cm, repeat, motionArgs.forward,
+ motionArgs.selectedCharacter) || head;
+ },
+ moveToColumn: function(cm, head, motionArgs, vim) {
+ var repeat = motionArgs.repeat;
+ // repeat is equivalent to which column we want to move to!
+ vim.lastHPos = repeat - 1;
+ vim.lastHSPos = cm.charCoords(head,'div').left;
+ return moveToColumn(cm, repeat);
+ },
+ moveToEol: function(cm, head, motionArgs, vim, keepHPos) {
+ var cur = head;
+ var retval= Pos(cur.line + motionArgs.repeat - 1, Infinity);
+ var end=cm.clipPos(retval);
+ end.ch--;
+ if (!keepHPos) {
+ vim.lastHPos = Infinity;
+ vim.lastHSPos = cm.charCoords(end,'div').left;
+ }
+ return retval;
+ },
+ moveToFirstNonWhiteSpaceCharacter: function(cm, head) {
+ // Go to the start of the line where the text begins, or the end for
+ // whitespace-only lines
+ var cursor = head;
+ return Pos(cursor.line,
+ findFirstNonWhiteSpaceCharacter(cm.getLine(cursor.line)));
+ },
+ moveToMatchedSymbol: function(cm, head) {
+ var cursor = head;
+ var line = cursor.line;
+ var ch = cursor.ch;
+ var lineText = cm.getLine(line);
+ var symbol;
+ for (; ch < lineText.length; ch++) {
+ symbol = lineText.charAt(ch);
+ if (symbol && isMatchableSymbol(symbol)) {
+ var style = cm.getTokenTypeAt(Pos(line, ch + 1));
+ if (style !== "string" && style !== "comment") {
+ break;
+ }
+ }
+ }
+ if (ch < lineText.length) {
+ // Only include angle brackets in analysis if they are being matched.
+ var re = (ch === '<' || ch === '>') ? /[(){}[\]<>]/ : /[(){}[\]]/;
+ var matched = cm.findMatchingBracket(Pos(line, ch), {bracketRegex: re});
+ return matched.to;
+ } else {
+ return cursor;
+ }
+ },
+ moveToStartOfLine: function(_cm, head) {
+ return Pos(head.line, 0);
+ },
+ moveToLineOrEdgeOfDocument: function(cm, _head, motionArgs) {
+ var lineNum = motionArgs.forward ? cm.lastLine() : cm.firstLine();
+ if (motionArgs.repeatIsExplicit) {
+ lineNum = motionArgs.repeat - cm.getOption('firstLineNumber');
+ }
+ return Pos(lineNum,
+ findFirstNonWhiteSpaceCharacter(cm.getLine(lineNum)));
+ },
+ textObjectManipulation: function(cm, head, motionArgs, vim) {
+ // TODO: lots of possible exceptions that can be thrown here. Try da(
+ // outside of a () block.
+ var mirroredPairs = {'(': ')', ')': '(',
+ '{': '}', '}': '{',
+ '[': ']', ']': '[',
+ '<': '>', '>': '<'};
+ var selfPaired = {'\'': true, '"': true, '`': true};
+
+ var character = motionArgs.selectedCharacter;
+ // 'b' refers to '()' block.
+ // 'B' refers to '{}' block.
+ if (character == 'b') {
+ character = '(';
+ } else if (character == 'B') {
+ character = '{';
+ }
+
+ // Inclusive is the difference between a and i
+ // TODO: Instead of using the additional text object map to perform text
+ // object operations, merge the map into the defaultKeyMap and use
+ // motionArgs to define behavior. Define separate entries for 'aw',
+ // 'iw', 'a[', 'i[', etc.
+ var inclusive = !motionArgs.textObjectInner;
+
+ var tmp;
+ if (mirroredPairs[character]) {
+ tmp = selectCompanionObject(cm, head, character, inclusive);
+ } else if (selfPaired[character]) {
+ tmp = findBeginningAndEnd(cm, head, character, inclusive);
+ } else if (character === 'W') {
+ tmp = expandWordUnderCursor(cm, inclusive, true /** forward */,
+ true /** bigWord */);
+ } else if (character === 'w') {
+ tmp = expandWordUnderCursor(cm, inclusive, true /** forward */,
+ false /** bigWord */);
+ } else if (character === 'p') {
+ tmp = findParagraph(cm, head, motionArgs.repeat, 0, inclusive);
+ motionArgs.linewise = true;
+ if (vim.visualMode) {
+ if (!vim.visualLine) { vim.visualLine = true; }
+ } else {
+ var operatorArgs = vim.inputState.operatorArgs;
+ if (operatorArgs) { operatorArgs.linewise = true; }
+ tmp.end.line--;
+ }
+ } else if (character === 't') {
+ tmp = expandTagUnderCursor(cm, head, inclusive);
+ } else {
+ // No text object defined for this, don't move.
+ return null;
+ }
+
+ if (!cm.state.vim.visualMode) {
+ return [tmp.start, tmp.end];
+ } else {
+ return expandSelection(cm, tmp.start, tmp.end);
+ }
+ },
+
+ repeatLastCharacterSearch: function(cm, head, motionArgs) {
+ var lastSearch = vimGlobalState.lastCharacterSearch;
+ var repeat = motionArgs.repeat;
+ var forward = motionArgs.forward === lastSearch.forward;
+ var increment = (lastSearch.increment ? 1 : 0) * (forward ? -1 : 1);
+ cm.moveH(-increment, 'char');
+ motionArgs.inclusive = forward ? true : false;
+ var curEnd = moveToCharacter(cm, repeat, forward, lastSearch.selectedCharacter);
+ if (!curEnd) {
+ cm.moveH(increment, 'char');
+ return head;
+ }
+ curEnd.ch += increment;
+ return curEnd;
+ }
+ };
+
+ function defineMotion(name, fn) {
+ motions[name] = fn;
+ }
+
+ function fillArray(val, times) {
+ var arr = [];
+ for (var i = 0; i < times; i++) {
+ arr.push(val);
+ }
+ return arr;
+ }
+ /**
+ * An operator acts on a text selection. It receives the list of selections
+ * as input. The corresponding CodeMirror selection is guaranteed to
+ * match the input selection.
+ */
+ var operators = {
+ change: function(cm, args, ranges) {
+ var finalHead, text;
+ var vim = cm.state.vim;
+ var anchor = ranges[0].anchor,
+ head = ranges[0].head;
+ if (!vim.visualMode) {
+ text = cm.getRange(anchor, head);
+ var lastState = vim.lastEditInputState || {};
+ if (lastState.motion == "moveByWords" && !isWhiteSpaceString(text)) {
+ // Exclude trailing whitespace if the range is not all whitespace.
+ var match = (/\s+$/).exec(text);
+ if (match && lastState.motionArgs && lastState.motionArgs.forward) {
+ head = offsetCursor(head, 0, - match[0].length);
+ text = text.slice(0, - match[0].length);
+ }
+ }
+ var prevLineEnd = new Pos(anchor.line - 1, Number.MAX_VALUE);
+ var wasLastLine = cm.firstLine() == cm.lastLine();
+ if (head.line > cm.lastLine() && args.linewise && !wasLastLine) {
+ cm.replaceRange('', prevLineEnd, head);
+ } else {
+ cm.replaceRange('', anchor, head);
+ }
+ if (args.linewise) {
+ // Push the next line back down, if there is a next line.
+ if (!wasLastLine) {
+ cm.setCursor(prevLineEnd);
+ CodeMirror.commands.newlineAndIndent(cm);
+ }
+ // make sure cursor ends up at the end of the line.
+ anchor.ch = Number.MAX_VALUE;
+ }
+ finalHead = anchor;
+ } else if (args.fullLine) {
+ head.ch = Number.MAX_VALUE;
+ head.line--;
+ cm.setSelection(anchor, head)
+ text = cm.getSelection();
+ cm.replaceSelection("");
+ finalHead = anchor;
+ } else {
+ text = cm.getSelection();
+ var replacement = fillArray('', ranges.length);
+ cm.replaceSelections(replacement);
+ finalHead = cursorMin(ranges[0].head, ranges[0].anchor);
+ }
+ vimGlobalState.registerController.pushText(
+ args.registerName, 'change', text,
+ args.linewise, ranges.length > 1);
+ actions.enterInsertMode(cm, {head: finalHead}, cm.state.vim);
+ },
+ // delete is a javascript keyword.
+ 'delete': function(cm, args, ranges) {
+ var finalHead, text;
+ var vim = cm.state.vim;
+ if (!vim.visualBlock) {
+ var anchor = ranges[0].anchor,
+ head = ranges[0].head;
+ if (args.linewise &&
+ head.line != cm.firstLine() &&
+ anchor.line == cm.lastLine() &&
+ anchor.line == head.line - 1) {
+ // Special case for dd on last line (and first line).
+ if (anchor.line == cm.firstLine()) {
+ anchor.ch = 0;
+ } else {
+ anchor = Pos(anchor.line - 1, lineLength(cm, anchor.line - 1));
+ }
+ }
+ text = cm.getRange(anchor, head);
+ cm.replaceRange('', anchor, head);
+ finalHead = anchor;
+ if (args.linewise) {
+ finalHead = motions.moveToFirstNonWhiteSpaceCharacter(cm, anchor);
+ }
+ } else {
+ text = cm.getSelection();
+ var replacement = fillArray('', ranges.length);
+ cm.replaceSelections(replacement);
+ finalHead = ranges[0].anchor;
+ }
+ vimGlobalState.registerController.pushText(
+ args.registerName, 'delete', text,
+ args.linewise, vim.visualBlock);
+ return clipCursorToContent(cm, finalHead);
+ },
+ indent: function(cm, args, ranges) {
+ var vim = cm.state.vim;
+ var startLine = ranges[0].anchor.line;
+ var endLine = vim.visualBlock ?
+ ranges[ranges.length - 1].anchor.line :
+ ranges[0].head.line;
+ // In visual mode, n> shifts the selection right n times, instead of
+ // shifting n lines right once.
+ var repeat = (vim.visualMode) ? args.repeat : 1;
+ if (args.linewise) {
+ // The only way to delete a newline is to delete until the start of
+ // the next line, so in linewise mode evalInput will include the next
+ // line. We don't want this in indent, so we go back a line.
+ endLine--;
+ }
+ for (var i = startLine; i <= endLine; i++) {
+ for (var j = 0; j < repeat; j++) {
+ cm.indentLine(i, args.indentRight);
+ }
+ }
+ return motions.moveToFirstNonWhiteSpaceCharacter(cm, ranges[0].anchor);
+ },
+ indentAuto: function(cm, _args, ranges) {
+ cm.execCommand("indentAuto");
+ return motions.moveToFirstNonWhiteSpaceCharacter(cm, ranges[0].anchor);
+ },
+ changeCase: function(cm, args, ranges, oldAnchor, newHead) {
+ var selections = cm.getSelections();
+ var swapped = [];
+ var toLower = args.toLower;
+ for (var j = 0; j < selections.length; j++) {
+ var toSwap = selections[j];
+ var text = '';
+ if (toLower === true) {
+ text = toSwap.toLowerCase();
+ } else if (toLower === false) {
+ text = toSwap.toUpperCase();
+ } else {
+ for (var i = 0; i < toSwap.length; i++) {
+ var character = toSwap.charAt(i);
+ text += isUpperCase(character) ? character.toLowerCase() :
+ character.toUpperCase();
+ }
+ }
+ swapped.push(text);
+ }
+ cm.replaceSelections(swapped);
+ if (args.shouldMoveCursor){
+ return newHead;
+ } else if (!cm.state.vim.visualMode && args.linewise && ranges[0].anchor.line + 1 == ranges[0].head.line) {
+ return motions.moveToFirstNonWhiteSpaceCharacter(cm, oldAnchor);
+ } else if (args.linewise){
+ return oldAnchor;
+ } else {
+ return cursorMin(ranges[0].anchor, ranges[0].head);
+ }
+ },
+ yank: function(cm, args, ranges, oldAnchor) {
+ var vim = cm.state.vim;
+ var text = cm.getSelection();
+ var endPos = vim.visualMode
+ ? cursorMin(vim.sel.anchor, vim.sel.head, ranges[0].head, ranges[0].anchor)
+ : oldAnchor;
+ vimGlobalState.registerController.pushText(
+ args.registerName, 'yank',
+ text, args.linewise, vim.visualBlock);
+ return endPos;
+ }
+ };
+
+ function defineOperator(name, fn) {
+ operators[name] = fn;
+ }
+
+ var actions = {
+ jumpListWalk: function(cm, actionArgs, vim) {
+ if (vim.visualMode) {
+ return;
+ }
+ var repeat = actionArgs.repeat;
+ var forward = actionArgs.forward;
+ var jumpList = vimGlobalState.jumpList;
+
+ var mark = jumpList.move(cm, forward ? repeat : -repeat);
+ var markPos = mark ? mark.find() : undefined;
+ markPos = markPos ? markPos : cm.getCursor();
+ cm.setCursor(markPos);
+ },
+ scroll: function(cm, actionArgs, vim) {
+ if (vim.visualMode) {
+ return;
+ }
+ var repeat = actionArgs.repeat || 1;
+ var lineHeight = cm.defaultTextHeight();
+ var top = cm.getScrollInfo().top;
+ var delta = lineHeight * repeat;
+ var newPos = actionArgs.forward ? top + delta : top - delta;
+ var cursor = copyCursor(cm.getCursor());
+ var cursorCoords = cm.charCoords(cursor, 'local');
+ if (actionArgs.forward) {
+ if (newPos > cursorCoords.top) {
+ cursor.line += (newPos - cursorCoords.top) / lineHeight;
+ cursor.line = Math.ceil(cursor.line);
+ cm.setCursor(cursor);
+ cursorCoords = cm.charCoords(cursor, 'local');
+ cm.scrollTo(null, cursorCoords.top);
+ } else {
+ // Cursor stays within bounds. Just reposition the scroll window.
+ cm.scrollTo(null, newPos);
+ }
+ } else {
+ var newBottom = newPos + cm.getScrollInfo().clientHeight;
+ if (newBottom < cursorCoords.bottom) {
+ cursor.line -= (cursorCoords.bottom - newBottom) / lineHeight;
+ cursor.line = Math.floor(cursor.line);
+ cm.setCursor(cursor);
+ cursorCoords = cm.charCoords(cursor, 'local');
+ cm.scrollTo(
+ null, cursorCoords.bottom - cm.getScrollInfo().clientHeight);
+ } else {
+ // Cursor stays within bounds. Just reposition the scroll window.
+ cm.scrollTo(null, newPos);
+ }
+ }
+ },
+ scrollToCursor: function(cm, actionArgs) {
+ var lineNum = cm.getCursor().line;
+ var charCoords = cm.charCoords(Pos(lineNum, 0), 'local');
+ var height = cm.getScrollInfo().clientHeight;
+ var y = charCoords.top;
+ var lineHeight = charCoords.bottom - y;
+ switch (actionArgs.position) {
+ case 'center': y = y - (height / 2) + lineHeight;
+ break;
+ case 'bottom': y = y - height + lineHeight;
+ break;
+ }
+ cm.scrollTo(null, y);
+ },
+ replayMacro: function(cm, actionArgs, vim) {
+ var registerName = actionArgs.selectedCharacter;
+ var repeat = actionArgs.repeat;
+ var macroModeState = vimGlobalState.macroModeState;
+ if (registerName == '@') {
+ registerName = macroModeState.latestRegister;
+ } else {
+ macroModeState.latestRegister = registerName;
+ }
+ while(repeat--){
+ executeMacroRegister(cm, vim, macroModeState, registerName);
+ }
+ },
+ enterMacroRecordMode: function(cm, actionArgs) {
+ var macroModeState = vimGlobalState.macroModeState;
+ var registerName = actionArgs.selectedCharacter;
+ if (vimGlobalState.registerController.isValidRegister(registerName)) {
+ macroModeState.enterMacroRecordMode(cm, registerName);
+ }
+ },
+ toggleOverwrite: function(cm) {
+ if (!cm.state.overwrite) {
+ cm.toggleOverwrite(true);
+ cm.setOption('keyMap', 'vim-replace');
+ CodeMirror.signal(cm, "vim-mode-change", {mode: "replace"});
+ } else {
+ cm.toggleOverwrite(false);
+ cm.setOption('keyMap', 'vim-insert');
+ CodeMirror.signal(cm, "vim-mode-change", {mode: "insert"});
+ }
+ },
+ enterInsertMode: function(cm, actionArgs, vim) {
+ if (cm.getOption('readOnly')) { return; }
+ vim.insertMode = true;
+ vim.insertModeRepeat = actionArgs && actionArgs.repeat || 1;
+ var insertAt = (actionArgs) ? actionArgs.insertAt : null;
+ var sel = vim.sel;
+ var head = actionArgs.head || cm.getCursor('head');
+ var height = cm.listSelections().length;
+ if (insertAt == 'eol') {
+ head = Pos(head.line, lineLength(cm, head.line));
+ } else if (insertAt == 'bol') {
+ head = Pos(head.line, 0);
+ } else if (insertAt == 'charAfter') {
+ head = offsetCursor(head, 0, 1);
+ } else if (insertAt == 'firstNonBlank') {
+ head = motions.moveToFirstNonWhiteSpaceCharacter(cm, head);
+ } else if (insertAt == 'startOfSelectedArea') {
+ if (!vim.visualMode)
+ return;
+ if (!vim.visualBlock) {
+ if (sel.head.line < sel.anchor.line) {
+ head = sel.head;
+ } else {
+ head = Pos(sel.anchor.line, 0);
+ }
+ } else {
+ head = Pos(
+ Math.min(sel.head.line, sel.anchor.line),
+ Math.min(sel.head.ch, sel.anchor.ch));
+ height = Math.abs(sel.head.line - sel.anchor.line) + 1;
+ }
+ } else if (insertAt == 'endOfSelectedArea') {
+ if (!vim.visualMode)
+ return;
+ if (!vim.visualBlock) {
+ if (sel.head.line >= sel.anchor.line) {
+ head = offsetCursor(sel.head, 0, 1);
+ } else {
+ head = Pos(sel.anchor.line, 0);
+ }
+ } else {
+ head = Pos(
+ Math.min(sel.head.line, sel.anchor.line),
+ Math.max(sel.head.ch + 1, sel.anchor.ch));
+ height = Math.abs(sel.head.line - sel.anchor.line) + 1;
+ }
+ } else if (insertAt == 'inplace') {
+ if (vim.visualMode){
+ return;
+ }
+ } else if (insertAt == 'lastEdit') {
+ head = getLastEditPos(cm) || head;
+ }
+ cm.setOption('disableInput', false);
+ if (actionArgs && actionArgs.replace) {
+ // Handle Replace-mode as a special case of insert mode.
+ cm.toggleOverwrite(true);
+ cm.setOption('keyMap', 'vim-replace');
+ CodeMirror.signal(cm, "vim-mode-change", {mode: "replace"});
+ } else {
+ cm.toggleOverwrite(false);
+ cm.setOption('keyMap', 'vim-insert');
+ CodeMirror.signal(cm, "vim-mode-change", {mode: "insert"});
+ }
+ if (!vimGlobalState.macroModeState.isPlaying) {
+ // Only record if not replaying.
+ cm.on('change', onChange);
+ CodeMirror.on(cm.getInputField(), 'keydown', onKeyEventTargetKeyDown);
+ }
+ if (vim.visualMode) {
+ exitVisualMode(cm);
+ }
+ selectForInsert(cm, head, height);
+ },
+ toggleVisualMode: function(cm, actionArgs, vim) {
+ var repeat = actionArgs.repeat;
+ var anchor = cm.getCursor();
+ var head;
+ // TODO: The repeat should actually select number of characters/lines
+ // equal to the repeat times the size of the previous visual
+ // operation.
+ if (!vim.visualMode) {
+ // Entering visual mode
+ vim.visualMode = true;
+ vim.visualLine = !!actionArgs.linewise;
+ vim.visualBlock = !!actionArgs.blockwise;
+ head = clipCursorToContent(
+ cm, Pos(anchor.line, anchor.ch + repeat - 1));
+ vim.sel = {
+ anchor: anchor,
+ head: head
+ };
+ CodeMirror.signal(cm, "vim-mode-change", {mode: "visual", subMode: vim.visualLine ? "linewise" : vim.visualBlock ? "blockwise" : ""});
+ updateCmSelection(cm);
+ updateMark(cm, vim, '<', cursorMin(anchor, head));
+ updateMark(cm, vim, '>', cursorMax(anchor, head));
+ } else if (vim.visualLine ^ actionArgs.linewise ||
+ vim.visualBlock ^ actionArgs.blockwise) {
+ // Toggling between modes
+ vim.visualLine = !!actionArgs.linewise;
+ vim.visualBlock = !!actionArgs.blockwise;
+ CodeMirror.signal(cm, "vim-mode-change", {mode: "visual", subMode: vim.visualLine ? "linewise" : vim.visualBlock ? "blockwise" : ""});
+ updateCmSelection(cm);
+ } else {
+ exitVisualMode(cm);
+ }
+ },
+ reselectLastSelection: function(cm, _actionArgs, vim) {
+ var lastSelection = vim.lastSelection;
+ if (vim.visualMode) {
+ updateLastSelection(cm, vim);
+ }
+ if (lastSelection) {
+ var anchor = lastSelection.anchorMark.find();
+ var head = lastSelection.headMark.find();
+ if (!anchor || !head) {
+ // If the marks have been destroyed due to edits, do nothing.
+ return;
+ }
+ vim.sel = {
+ anchor: anchor,
+ head: head
+ };
+ vim.visualMode = true;
+ vim.visualLine = lastSelection.visualLine;
+ vim.visualBlock = lastSelection.visualBlock;
+ updateCmSelection(cm);
+ updateMark(cm, vim, '<', cursorMin(anchor, head));
+ updateMark(cm, vim, '>', cursorMax(anchor, head));
+ CodeMirror.signal(cm, 'vim-mode-change', {
+ mode: 'visual',
+ subMode: vim.visualLine ? 'linewise' :
+ vim.visualBlock ? 'blockwise' : ''});
+ }
+ },
+ joinLines: function(cm, actionArgs, vim) {
+ var curStart, curEnd;
+ if (vim.visualMode) {
+ curStart = cm.getCursor('anchor');
+ curEnd = cm.getCursor('head');
+ if (cursorIsBefore(curEnd, curStart)) {
+ var tmp = curEnd;
+ curEnd = curStart;
+ curStart = tmp;
+ }
+ curEnd.ch = lineLength(cm, curEnd.line) - 1;
+ } else {
+ // Repeat is the number of lines to join. Minimum 2 lines.
+ var repeat = Math.max(actionArgs.repeat, 2);
+ curStart = cm.getCursor();
+ curEnd = clipCursorToContent(cm, Pos(curStart.line + repeat - 1,
+ Infinity));
+ }
+ var finalCh = 0;
+ for (var i = curStart.line; i < curEnd.line; i++) {
+ finalCh = lineLength(cm, curStart.line);
+ var tmp = Pos(curStart.line + 1,
+ lineLength(cm, curStart.line + 1));
+ var text = cm.getRange(curStart, tmp);
+ text = actionArgs.keepSpaces
+ ? text.replace(/\n\r?/g, '')
+ : text.replace(/\n\s*/g, ' ');
+ cm.replaceRange(text, curStart, tmp);
+ }
+ var curFinalPos = Pos(curStart.line, finalCh);
+ if (vim.visualMode) {
+ exitVisualMode(cm, false);
+ }
+ cm.setCursor(curFinalPos);
+ },
+ newLineAndEnterInsertMode: function(cm, actionArgs, vim) {
+ vim.insertMode = true;
+ var insertAt = copyCursor(cm.getCursor());
+ if (insertAt.line === cm.firstLine() && !actionArgs.after) {
+ // Special case for inserting newline before start of document.
+ cm.replaceRange('\n', Pos(cm.firstLine(), 0));
+ cm.setCursor(cm.firstLine(), 0);
+ } else {
+ insertAt.line = (actionArgs.after) ? insertAt.line :
+ insertAt.line - 1;
+ insertAt.ch = lineLength(cm, insertAt.line);
+ cm.setCursor(insertAt);
+ var newlineFn = CodeMirror.commands.newlineAndIndentContinueComment ||
+ CodeMirror.commands.newlineAndIndent;
+ newlineFn(cm);
+ }
+ this.enterInsertMode(cm, { repeat: actionArgs.repeat }, vim);
+ },
+ paste: function(cm, actionArgs, vim) {
+ var cur = copyCursor(cm.getCursor());
+ var register = vimGlobalState.registerController.getRegister(
+ actionArgs.registerName);
+ var text = register.toString();
+ if (!text) {
+ return;
+ }
+ if (actionArgs.matchIndent) {
+ var tabSize = cm.getOption("tabSize");
+ // length that considers tabs and tabSize
+ var whitespaceLength = function(str) {
+ var tabs = (str.split("\t").length - 1);
+ var spaces = (str.split(" ").length - 1);
+ return tabs * tabSize + spaces * 1;
+ };
+ var currentLine = cm.getLine(cm.getCursor().line);
+ var indent = whitespaceLength(currentLine.match(/^\s*/)[0]);
+ // chomp last newline b/c don't want it to match /^\s*/gm
+ var chompedText = text.replace(/\n$/, '');
+ var wasChomped = text !== chompedText;
+ var firstIndent = whitespaceLength(text.match(/^\s*/)[0]);
+ var text = chompedText.replace(/^\s*/gm, function(wspace) {
+ var newIndent = indent + (whitespaceLength(wspace) - firstIndent);
+ if (newIndent < 0) {
+ return "";
+ }
+ else if (cm.getOption("indentWithTabs")) {
+ var quotient = Math.floor(newIndent / tabSize);
+ return Array(quotient + 1).join('\t');
+ }
+ else {
+ return Array(newIndent + 1).join(' ');
+ }
+ });
+ text += wasChomped ? "\n" : "";
+ }
+ if (actionArgs.repeat > 1) {
+ var text = Array(actionArgs.repeat + 1).join(text);
+ }
+ var linewise = register.linewise;
+ var blockwise = register.blockwise;
+ if (blockwise) {
+ text = text.split('\n');
+ if (linewise) {
+ text.pop();
+ }
+ for (var i = 0; i < text.length; i++) {
+ text[i] = (text[i] == '') ? ' ' : text[i];
+ }
+ cur.ch += actionArgs.after ? 1 : 0;
+ cur.ch = Math.min(lineLength(cm, cur.line), cur.ch);
+ } else if (linewise) {
+ if(vim.visualMode) {
+ text = vim.visualLine ? text.slice(0, -1) : '\n' + text.slice(0, text.length - 1) + '\n';
+ } else if (actionArgs.after) {
+ // Move the newline at the end to the start instead, and paste just
+ // before the newline character of the line we are on right now.
+ text = '\n' + text.slice(0, text.length - 1);
+ cur.ch = lineLength(cm, cur.line);
+ } else {
+ cur.ch = 0;
+ }
+ } else {
+ cur.ch += actionArgs.after ? 1 : 0;
+ }
+ var curPosFinal;
+ var idx;
+ if (vim.visualMode) {
+ // save the pasted text for reselection if the need arises
+ vim.lastPastedText = text;
+ var lastSelectionCurEnd;
+ var selectedArea = getSelectedAreaRange(cm, vim);
+ var selectionStart = selectedArea[0];
+ var selectionEnd = selectedArea[1];
+ var selectedText = cm.getSelection();
+ var selections = cm.listSelections();
+ var emptyStrings = new Array(selections.length).join('1').split('1');
+ // save the curEnd marker before it get cleared due to cm.replaceRange.
+ if (vim.lastSelection) {
+ lastSelectionCurEnd = vim.lastSelection.headMark.find();
+ }
+ // push the previously selected text to unnamed register
+ vimGlobalState.registerController.unnamedRegister.setText(selectedText);
+ if (blockwise) {
+ // first delete the selected text
+ cm.replaceSelections(emptyStrings);
+ // Set new selections as per the block length of the yanked text
+ selectionEnd = Pos(selectionStart.line + text.length-1, selectionStart.ch);
+ cm.setCursor(selectionStart);
+ selectBlock(cm, selectionEnd);
+ cm.replaceSelections(text);
+ curPosFinal = selectionStart;
+ } else if (vim.visualBlock) {
+ cm.replaceSelections(emptyStrings);
+ cm.setCursor(selectionStart);
+ cm.replaceRange(text, selectionStart, selectionStart);
+ curPosFinal = selectionStart;
+ } else {
+ cm.replaceRange(text, selectionStart, selectionEnd);
+ curPosFinal = cm.posFromIndex(cm.indexFromPos(selectionStart) + text.length - 1);
+ }
+ // restore the the curEnd marker
+ if(lastSelectionCurEnd) {
+ vim.lastSelection.headMark = cm.setBookmark(lastSelectionCurEnd);
+ }
+ if (linewise) {
+ curPosFinal.ch=0;
+ }
+ } else {
+ if (blockwise) {
+ cm.setCursor(cur);
+ for (var i = 0; i < text.length; i++) {
+ var line = cur.line+i;
+ if (line > cm.lastLine()) {
+ cm.replaceRange('\n', Pos(line, 0));
+ }
+ var lastCh = lineLength(cm, line);
+ if (lastCh < cur.ch) {
+ extendLineToColumn(cm, line, cur.ch);
+ }
+ }
+ cm.setCursor(cur);
+ selectBlock(cm, Pos(cur.line + text.length-1, cur.ch));
+ cm.replaceSelections(text);
+ curPosFinal = cur;
+ } else {
+ cm.replaceRange(text, cur);
+ // Now fine tune the cursor to where we want it.
+ if (linewise && actionArgs.after) {
+ curPosFinal = Pos(
+ cur.line + 1,
+ findFirstNonWhiteSpaceCharacter(cm.getLine(cur.line + 1)));
+ } else if (linewise && !actionArgs.after) {
+ curPosFinal = Pos(
+ cur.line,
+ findFirstNonWhiteSpaceCharacter(cm.getLine(cur.line)));
+ } else if (!linewise && actionArgs.after) {
+ idx = cm.indexFromPos(cur);
+ curPosFinal = cm.posFromIndex(idx + text.length - 1);
+ } else {
+ idx = cm.indexFromPos(cur);
+ curPosFinal = cm.posFromIndex(idx + text.length);
+ }
+ }
+ }
+ if (vim.visualMode) {
+ exitVisualMode(cm, false);
+ }
+ cm.setCursor(curPosFinal);
+ },
+ undo: function(cm, actionArgs) {
+ cm.operation(function() {
+ repeatFn(cm, CodeMirror.commands.undo, actionArgs.repeat)();
+ cm.setCursor(cm.getCursor('anchor'));
+ });
+ },
+ redo: function(cm, actionArgs) {
+ repeatFn(cm, CodeMirror.commands.redo, actionArgs.repeat)();
+ },
+ setRegister: function(_cm, actionArgs, vim) {
+ vim.inputState.registerName = actionArgs.selectedCharacter;
+ },
+ setMark: function(cm, actionArgs, vim) {
+ var markName = actionArgs.selectedCharacter;
+ updateMark(cm, vim, markName, cm.getCursor());
+ },
+ replace: function(cm, actionArgs, vim) {
+ var replaceWith = actionArgs.selectedCharacter;
+ var curStart = cm.getCursor();
+ var replaceTo;
+ var curEnd;
+ var selections = cm.listSelections();
+ if (vim.visualMode) {
+ curStart = cm.getCursor('start');
+ curEnd = cm.getCursor('end');
+ } else {
+ var line = cm.getLine(curStart.line);
+ replaceTo = curStart.ch + actionArgs.repeat;
+ if (replaceTo > line.length) {
+ replaceTo=line.length;
+ }
+ curEnd = Pos(curStart.line, replaceTo);
+ }
+ if (replaceWith=='\n') {
+ if (!vim.visualMode) cm.replaceRange('', curStart, curEnd);
+ // special case, where vim help says to replace by just one line-break
+ (CodeMirror.commands.newlineAndIndentContinueComment || CodeMirror.commands.newlineAndIndent)(cm);
+ } else {
+ var replaceWithStr = cm.getRange(curStart, curEnd);
+ // replace all characters in range by selected, but keep linebreaks
+ replaceWithStr = replaceWithStr.replace(/[^\n]/g, replaceWith);
+ if (vim.visualBlock) {
+ // Tabs are split in visua block before replacing
+ var spaces = new Array(cm.getOption("tabSize")+1).join(' ');
+ replaceWithStr = cm.getSelection();
+ replaceWithStr = replaceWithStr.replace(/\t/g, spaces).replace(/[^\n]/g, replaceWith).split('\n');
+ cm.replaceSelections(replaceWithStr);
+ } else {
+ cm.replaceRange(replaceWithStr, curStart, curEnd);
+ }
+ if (vim.visualMode) {
+ curStart = cursorIsBefore(selections[0].anchor, selections[0].head) ?
+ selections[0].anchor : selections[0].head;
+ cm.setCursor(curStart);
+ exitVisualMode(cm, false);
+ } else {
+ cm.setCursor(offsetCursor(curEnd, 0, -1));
+ }
+ }
+ },
+ incrementNumberToken: function(cm, actionArgs) {
+ var cur = cm.getCursor();
+ var lineStr = cm.getLine(cur.line);
+ var re = /(-?)(?:(0x)([\da-f]+)|(0b|0|)(\d+))/gi;
+ var match;
+ var start;
+ var end;
+ var numberStr;
+ while ((match = re.exec(lineStr)) !== null) {
+ start = match.index;
+ end = start + match[0].length;
+ if (cur.ch < end)break;
+ }
+ if (!actionArgs.backtrack && (end <= cur.ch))return;
+ if (match) {
+ var baseStr = match[2] || match[4]
+ var digits = match[3] || match[5]
+ var increment = actionArgs.increase ? 1 : -1;
+ var base = {'0b': 2, '0': 8, '': 10, '0x': 16}[baseStr.toLowerCase()];
+ var number = parseInt(match[1] + digits, base) + (increment * actionArgs.repeat);
+ numberStr = number.toString(base);
+ var zeroPadding = baseStr ? new Array(digits.length - numberStr.length + 1 + match[1].length).join('0') : ''
+ if (numberStr.charAt(0) === '-') {
+ numberStr = '-' + baseStr + zeroPadding + numberStr.substr(1);
+ } else {
+ numberStr = baseStr + zeroPadding + numberStr;
+ }
+ var from = Pos(cur.line, start);
+ var to = Pos(cur.line, end);
+ cm.replaceRange(numberStr, from, to);
+ } else {
+ return;
+ }
+ cm.setCursor(Pos(cur.line, start + numberStr.length - 1));
+ },
+ repeatLastEdit: function(cm, actionArgs, vim) {
+ var lastEditInputState = vim.lastEditInputState;
+ if (!lastEditInputState) { return; }
+ var repeat = actionArgs.repeat;
+ if (repeat && actionArgs.repeatIsExplicit) {
+ vim.lastEditInputState.repeatOverride = repeat;
+ } else {
+ repeat = vim.lastEditInputState.repeatOverride || repeat;
+ }
+ repeatLastEdit(cm, vim, repeat, false /** repeatForInsert */);
+ },
+ indent: function(cm, actionArgs) {
+ cm.indentLine(cm.getCursor().line, actionArgs.indentRight);
+ },
+ exitInsertMode: exitInsertMode
+ };
+
+ function defineAction(name, fn) {
+ actions[name] = fn;
+ }
+
+ /*
+ * Below are miscellaneous utility functions used by vim.js
+ */
+ /**
+ * Clips cursor to ensure that line is within the buffer's range
+ * If includeLineBreak is true, then allow cur.ch == lineLength.
+ */
+ function clipCursorToContent(cm, cur) {
+ var vim = cm.state.vim;
+ var includeLineBreak = vim.insertMode || vim.visualMode;
+ var line = Math.min(Math.max(cm.firstLine(), cur.line), cm.lastLine() );
+ var maxCh = lineLength(cm, line) - 1 + !!includeLineBreak;
+ var ch = Math.min(Math.max(0, cur.ch), maxCh);
+ return Pos(line, ch);
+ }
+ function copyArgs(args) {
+ var ret = {};
+ for (var prop in args) {
+ if (args.hasOwnProperty(prop)) {
+ ret[prop] = args[prop];
+ }
+ }
+ return ret;
+ }
+ function offsetCursor(cur, offsetLine, offsetCh) {
+ if (typeof offsetLine === 'object') {
+ offsetCh = offsetLine.ch;
+ offsetLine = offsetLine.line;
+ }
+ return Pos(cur.line + offsetLine, cur.ch + offsetCh);
+ }
+ function commandMatches(keys, keyMap, context, inputState) {
+ // Partial matches are not applied. They inform the key handler
+ // that the current key sequence is a subsequence of a valid key
+ // sequence, so that the key buffer is not cleared.
+ var match, partial = [], full = [];
+ for (var i = 0; i < keyMap.length; i++) {
+ var command = keyMap[i];
+ if (context == 'insert' && command.context != 'insert' ||
+ command.context && command.context != context ||
+ inputState.operator && command.type == 'action' ||
+ !(match = commandMatch(keys, command.keys))) { continue; }
+ if (match == 'partial') { partial.push(command); }
+ if (match == 'full') { full.push(command); }
+ }
+ return {
+ partial: partial.length && partial,
+ full: full.length && full
+ };
+ }
+ function commandMatch(pressed, mapped) {
+ if (mapped.slice(-11) == '') {
+ // Last character matches anything.
+ var prefixLen = mapped.length - 11;
+ var pressedPrefix = pressed.slice(0, prefixLen);
+ var mappedPrefix = mapped.slice(0, prefixLen);
+ return pressedPrefix == mappedPrefix && pressed.length > prefixLen ? 'full' :
+ mappedPrefix.indexOf(pressedPrefix) == 0 ? 'partial' : false;
+ } else {
+ return pressed == mapped ? 'full' :
+ mapped.indexOf(pressed) == 0 ? 'partial' : false;
+ }
+ }
+ function lastChar(keys) {
+ var match = /^.*(<[^>]+>)$/.exec(keys);
+ var selectedCharacter = match ? match[1] : keys.slice(-1);
+ if (selectedCharacter.length > 1){
+ switch(selectedCharacter){
+ case '':
+ selectedCharacter='\n';
+ break;
+ case '':
+ selectedCharacter=' ';
+ break;
+ default:
+ selectedCharacter='';
+ break;
+ }
+ }
+ return selectedCharacter;
+ }
+ function repeatFn(cm, fn, repeat) {
+ return function() {
+ for (var i = 0; i < repeat; i++) {
+ fn(cm);
+ }
+ };
+ }
+ function copyCursor(cur) {
+ return Pos(cur.line, cur.ch);
+ }
+ function cursorEqual(cur1, cur2) {
+ return cur1.ch == cur2.ch && cur1.line == cur2.line;
+ }
+ function cursorIsBefore(cur1, cur2) {
+ if (cur1.line < cur2.line) {
+ return true;
+ }
+ if (cur1.line == cur2.line && cur1.ch < cur2.ch) {
+ return true;
+ }
+ return false;
+ }
+ function cursorMin(cur1, cur2) {
+ if (arguments.length > 2) {
+ cur2 = cursorMin.apply(undefined, Array.prototype.slice.call(arguments, 1));
+ }
+ return cursorIsBefore(cur1, cur2) ? cur1 : cur2;
+ }
+ function cursorMax(cur1, cur2) {
+ if (arguments.length > 2) {
+ cur2 = cursorMax.apply(undefined, Array.prototype.slice.call(arguments, 1));
+ }
+ return cursorIsBefore(cur1, cur2) ? cur2 : cur1;
+ }
+ function cursorIsBetween(cur1, cur2, cur3) {
+ // returns true if cur2 is between cur1 and cur3.
+ var cur1before2 = cursorIsBefore(cur1, cur2);
+ var cur2before3 = cursorIsBefore(cur2, cur3);
+ return cur1before2 && cur2before3;
+ }
+ function lineLength(cm, lineNum) {
+ return cm.getLine(lineNum).length;
+ }
+ function trim(s) {
+ if (s.trim) {
+ return s.trim();
+ }
+ return s.replace(/^\s+|\s+$/g, '');
+ }
+ function escapeRegex(s) {
+ return s.replace(/([.?*+$\[\]\/\\(){}|\-])/g, '\\$1');
+ }
+ function extendLineToColumn(cm, lineNum, column) {
+ var endCh = lineLength(cm, lineNum);
+ var spaces = new Array(column-endCh+1).join(' ');
+ cm.setCursor(Pos(lineNum, endCh));
+ cm.replaceRange(spaces, cm.getCursor());
+ }
+ // This functions selects a rectangular block
+ // of text with selectionEnd as any of its corner
+ // Height of block:
+ // Difference in selectionEnd.line and first/last selection.line
+ // Width of the block:
+ // Distance between selectionEnd.ch and any(first considered here) selection.ch
+ function selectBlock(cm, selectionEnd) {
+ var selections = [], ranges = cm.listSelections();
+ var head = copyCursor(cm.clipPos(selectionEnd));
+ var isClipped = !cursorEqual(selectionEnd, head);
+ var curHead = cm.getCursor('head');
+ var primIndex = getIndex(ranges, curHead);
+ var wasClipped = cursorEqual(ranges[primIndex].head, ranges[primIndex].anchor);
+ var max = ranges.length - 1;
+ var index = max - primIndex > primIndex ? max : 0;
+ var base = ranges[index].anchor;
+
+ var firstLine = Math.min(base.line, head.line);
+ var lastLine = Math.max(base.line, head.line);
+ var baseCh = base.ch, headCh = head.ch;
+
+ var dir = ranges[index].head.ch - baseCh;
+ var newDir = headCh - baseCh;
+ if (dir > 0 && newDir <= 0) {
+ baseCh++;
+ if (!isClipped) { headCh--; }
+ } else if (dir < 0 && newDir >= 0) {
+ baseCh--;
+ if (!wasClipped) { headCh++; }
+ } else if (dir < 0 && newDir == -1) {
+ baseCh--;
+ headCh++;
+ }
+ for (var line = firstLine; line <= lastLine; line++) {
+ var range = {anchor: new Pos(line, baseCh), head: new Pos(line, headCh)};
+ selections.push(range);
+ }
+ cm.setSelections(selections);
+ selectionEnd.ch = headCh;
+ base.ch = baseCh;
+ return base;
+ }
+ function selectForInsert(cm, head, height) {
+ var sel = [];
+ for (var i = 0; i < height; i++) {
+ var lineHead = offsetCursor(head, i, 0);
+ sel.push({anchor: lineHead, head: lineHead});
+ }
+ cm.setSelections(sel, 0);
+ }
+ // getIndex returns the index of the cursor in the selections.
+ function getIndex(ranges, cursor, end) {
+ for (var i = 0; i < ranges.length; i++) {
+ var atAnchor = end != 'head' && cursorEqual(ranges[i].anchor, cursor);
+ var atHead = end != 'anchor' && cursorEqual(ranges[i].head, cursor);
+ if (atAnchor || atHead) {
+ return i;
+ }
+ }
+ return -1;
+ }
+ function getSelectedAreaRange(cm, vim) {
+ var lastSelection = vim.lastSelection;
+ var getCurrentSelectedAreaRange = function() {
+ var selections = cm.listSelections();
+ var start = selections[0];
+ var end = selections[selections.length-1];
+ var selectionStart = cursorIsBefore(start.anchor, start.head) ? start.anchor : start.head;
+ var selectionEnd = cursorIsBefore(end.anchor, end.head) ? end.head : end.anchor;
+ return [selectionStart, selectionEnd];
+ };
+ var getLastSelectedAreaRange = function() {
+ var selectionStart = cm.getCursor();
+ var selectionEnd = cm.getCursor();
+ var block = lastSelection.visualBlock;
+ if (block) {
+ var width = block.width;
+ var height = block.height;
+ selectionEnd = Pos(selectionStart.line + height, selectionStart.ch + width);
+ var selections = [];
+ // selectBlock creates a 'proper' rectangular block.
+ // We do not want that in all cases, so we manually set selections.
+ for (var i = selectionStart.line; i < selectionEnd.line; i++) {
+ var anchor = Pos(i, selectionStart.ch);
+ var head = Pos(i, selectionEnd.ch);
+ var range = {anchor: anchor, head: head};
+ selections.push(range);
+ }
+ cm.setSelections(selections);
+ } else {
+ var start = lastSelection.anchorMark.find();
+ var end = lastSelection.headMark.find();
+ var line = end.line - start.line;
+ var ch = end.ch - start.ch;
+ selectionEnd = {line: selectionEnd.line + line, ch: line ? selectionEnd.ch : ch + selectionEnd.ch};
+ if (lastSelection.visualLine) {
+ selectionStart = Pos(selectionStart.line, 0);
+ selectionEnd = Pos(selectionEnd.line, lineLength(cm, selectionEnd.line));
+ }
+ cm.setSelection(selectionStart, selectionEnd);
+ }
+ return [selectionStart, selectionEnd];
+ };
+ if (!vim.visualMode) {
+ // In case of replaying the action.
+ return getLastSelectedAreaRange();
+ } else {
+ return getCurrentSelectedAreaRange();
+ }
+ }
+ // Updates the previous selection with the current selection's values. This
+ // should only be called in visual mode.
+ function updateLastSelection(cm, vim) {
+ var anchor = vim.sel.anchor;
+ var head = vim.sel.head;
+ // To accommodate the effect of lastPastedText in the last selection
+ if (vim.lastPastedText) {
+ head = cm.posFromIndex(cm.indexFromPos(anchor) + vim.lastPastedText.length);
+ vim.lastPastedText = null;
+ }
+ vim.lastSelection = {'anchorMark': cm.setBookmark(anchor),
+ 'headMark': cm.setBookmark(head),
+ 'anchor': copyCursor(anchor),
+ 'head': copyCursor(head),
+ 'visualMode': vim.visualMode,
+ 'visualLine': vim.visualLine,
+ 'visualBlock': vim.visualBlock};
+ }
+ function expandSelection(cm, start, end) {
+ var sel = cm.state.vim.sel;
+ var head = sel.head;
+ var anchor = sel.anchor;
+ var tmp;
+ if (cursorIsBefore(end, start)) {
+ tmp = end;
+ end = start;
+ start = tmp;
+ }
+ if (cursorIsBefore(head, anchor)) {
+ head = cursorMin(start, head);
+ anchor = cursorMax(anchor, end);
+ } else {
+ anchor = cursorMin(start, anchor);
+ head = cursorMax(head, end);
+ head = offsetCursor(head, 0, -1);
+ if (head.ch == -1 && head.line != cm.firstLine()) {
+ head = Pos(head.line - 1, lineLength(cm, head.line - 1));
+ }
+ }
+ return [anchor, head];
+ }
+ /**
+ * Updates the CodeMirror selection to match the provided vim selection.
+ * If no arguments are given, it uses the current vim selection state.
+ */
+ function updateCmSelection(cm, sel, mode) {
+ var vim = cm.state.vim;
+ sel = sel || vim.sel;
+ var mode = mode ||
+ vim.visualLine ? 'line' : vim.visualBlock ? 'block' : 'char';
+ var cmSel = makeCmSelection(cm, sel, mode);
+ cm.setSelections(cmSel.ranges, cmSel.primary);
+ updateFakeCursor(cm);
+ }
+ function makeCmSelection(cm, sel, mode, exclusive) {
+ var head = copyCursor(sel.head);
+ var anchor = copyCursor(sel.anchor);
+ if (mode == 'char') {
+ var headOffset = !exclusive && !cursorIsBefore(sel.head, sel.anchor) ? 1 : 0;
+ var anchorOffset = cursorIsBefore(sel.head, sel.anchor) ? 1 : 0;
+ head = offsetCursor(sel.head, 0, headOffset);
+ anchor = offsetCursor(sel.anchor, 0, anchorOffset);
+ return {
+ ranges: [{anchor: anchor, head: head}],
+ primary: 0
+ };
+ } else if (mode == 'line') {
+ if (!cursorIsBefore(sel.head, sel.anchor)) {
+ anchor.ch = 0;
+
+ var lastLine = cm.lastLine();
+ if (head.line > lastLine) {
+ head.line = lastLine;
+ }
+ head.ch = lineLength(cm, head.line);
+ } else {
+ head.ch = 0;
+ anchor.ch = lineLength(cm, anchor.line);
+ }
+ return {
+ ranges: [{anchor: anchor, head: head}],
+ primary: 0
+ };
+ } else if (mode == 'block') {
+ var top = Math.min(anchor.line, head.line),
+ left = Math.min(anchor.ch, head.ch),
+ bottom = Math.max(anchor.line, head.line),
+ right = Math.max(anchor.ch, head.ch) + 1;
+ var height = bottom - top + 1;
+ var primary = head.line == top ? 0 : height - 1;
+ var ranges = [];
+ for (var i = 0; i < height; i++) {
+ ranges.push({
+ anchor: Pos(top + i, left),
+ head: Pos(top + i, right)
+ });
+ }
+ return {
+ ranges: ranges,
+ primary: primary
+ };
+ }
+ }
+ function getHead(cm) {
+ var cur = cm.getCursor('head');
+ if (cm.getSelection().length == 1) {
+ // Small corner case when only 1 character is selected. The "real"
+ // head is the left of head and anchor.
+ cur = cursorMin(cur, cm.getCursor('anchor'));
+ }
+ return cur;
+ }
+
+ /**
+ * If moveHead is set to false, the CodeMirror selection will not be
+ * touched. The caller assumes the responsibility of putting the cursor
+ * in the right place.
+ */
+ function exitVisualMode(cm, moveHead) {
+ var vim = cm.state.vim;
+ if (moveHead !== false) {
+ cm.setCursor(clipCursorToContent(cm, vim.sel.head));
+ }
+ updateLastSelection(cm, vim);
+ vim.visualMode = false;
+ vim.visualLine = false;
+ vim.visualBlock = false;
+ if (!vim.insertMode) CodeMirror.signal(cm, "vim-mode-change", {mode: "normal"});
+ clearFakeCursor(vim);
+ }
+
+ // Remove any trailing newlines from the selection. For
+ // example, with the caret at the start of the last word on the line,
+ // 'dw' should word, but not the newline, while 'w' should advance the
+ // caret to the first character of the next line.
+ function clipToLine(cm, curStart, curEnd) {
+ var selection = cm.getRange(curStart, curEnd);
+ // Only clip if the selection ends with trailing newline + whitespace
+ if (/\n\s*$/.test(selection)) {
+ var lines = selection.split('\n');
+ // We know this is all whitespace.
+ lines.pop();
+
+ // Cases:
+ // 1. Last word is an empty line - do not clip the trailing '\n'
+ // 2. Last word is not an empty line - clip the trailing '\n'
+ var line;
+ // Find the line containing the last word, and clip all whitespace up
+ // to it.
+ for (var line = lines.pop(); lines.length > 0 && line && isWhiteSpaceString(line); line = lines.pop()) {
+ curEnd.line--;
+ curEnd.ch = 0;
+ }
+ // If the last word is not an empty line, clip an additional newline
+ if (line) {
+ curEnd.line--;
+ curEnd.ch = lineLength(cm, curEnd.line);
+ } else {
+ curEnd.ch = 0;
+ }
+ }
+ }
+
+ // Expand the selection to line ends.
+ function expandSelectionToLine(_cm, curStart, curEnd) {
+ curStart.ch = 0;
+ curEnd.ch = 0;
+ curEnd.line++;
+ }
+
+ function findFirstNonWhiteSpaceCharacter(text) {
+ if (!text) {
+ return 0;
+ }
+ var firstNonWS = text.search(/\S/);
+ return firstNonWS == -1 ? text.length : firstNonWS;
+ }
+
+ function expandWordUnderCursor(cm, inclusive, _forward, bigWord, noSymbol) {
+ var cur = getHead(cm);
+ var line = cm.getLine(cur.line);
+ var idx = cur.ch;
+
+ // Seek to first word or non-whitespace character, depending on if
+ // noSymbol is true.
+ var test = noSymbol ? wordCharTest[0] : bigWordCharTest [0];
+ while (!test(line.charAt(idx))) {
+ idx++;
+ if (idx >= line.length) { return null; }
+ }
+
+ if (bigWord) {
+ test = bigWordCharTest[0];
+ } else {
+ test = wordCharTest[0];
+ if (!test(line.charAt(idx))) {
+ test = wordCharTest[1];
+ }
+ }
+
+ var end = idx, start = idx;
+ while (test(line.charAt(end)) && end < line.length) { end++; }
+ while (test(line.charAt(start)) && start >= 0) { start--; }
+ start++;
+
+ if (inclusive) {
+ // If present, include all whitespace after word.
+ // Otherwise, include all whitespace before word, except indentation.
+ var wordEnd = end;
+ while (/\s/.test(line.charAt(end)) && end < line.length) { end++; }
+ if (wordEnd == end) {
+ var wordStart = start;
+ while (/\s/.test(line.charAt(start - 1)) && start > 0) { start--; }
+ if (!start) { start = wordStart; }
+ }
+ }
+ return { start: Pos(cur.line, start), end: Pos(cur.line, end) };
+ }
+
+ /**
+ * Depends on the following:
+ *
+ * - editor mode should be htmlmixedmode / xml
+ * - mode/xml/xml.js should be loaded
+ * - addon/fold/xml-fold.js should be loaded
+ *
+ * If any of the above requirements are not true, this function noops.
+ *
+ * This is _NOT_ a 100% accurate implementation of vim tag text objects.
+ * The following caveats apply (based off cursory testing, I'm sure there
+ * are other discrepancies):
+ *
+ * - Does not work inside comments:
+ * ```
+ *
+ * ```
+ * - Does not work when tags have different cases:
+ * ```
+ *
broken
+ * ```
+ * - Does not work when cursor is inside a broken tag:
+ * ```
+ *
+ * ```
+ */
+ function expandTagUnderCursor(cm, head, inclusive) {
+ var cur = head;
+ if (!CodeMirror.findMatchingTag || !CodeMirror.findEnclosingTag) {
+ return { start: cur, end: cur };
+ }
+
+ var tags = CodeMirror.findMatchingTag(cm, head) || CodeMirror.findEnclosingTag(cm, head);
+ if (!tags || !tags.open || !tags.close) {
+ return { start: cur, end: cur };
+ }
+
+ if (inclusive) {
+ return { start: tags.open.from, end: tags.close.to };
+ }
+ return { start: tags.open.to, end: tags.close.from };
+ }
+
+ function recordJumpPosition(cm, oldCur, newCur) {
+ if (!cursorEqual(oldCur, newCur)) {
+ vimGlobalState.jumpList.add(cm, oldCur, newCur);
+ }
+ }
+
+ function recordLastCharacterSearch(increment, args) {
+ vimGlobalState.lastCharacterSearch.increment = increment;
+ vimGlobalState.lastCharacterSearch.forward = args.forward;
+ vimGlobalState.lastCharacterSearch.selectedCharacter = args.selectedCharacter;
+ }
+
+ var symbolToMode = {
+ '(': 'bracket', ')': 'bracket', '{': 'bracket', '}': 'bracket',
+ '[': 'section', ']': 'section',
+ '*': 'comment', '/': 'comment',
+ 'm': 'method', 'M': 'method',
+ '#': 'preprocess'
+ };
+ var findSymbolModes = {
+ bracket: {
+ isComplete: function(state) {
+ if (state.nextCh === state.symb) {
+ state.depth++;
+ if (state.depth >= 1)return true;
+ } else if (state.nextCh === state.reverseSymb) {
+ state.depth--;
+ }
+ return false;
+ }
+ },
+ section: {
+ init: function(state) {
+ state.curMoveThrough = true;
+ state.symb = (state.forward ? ']' : '[') === state.symb ? '{' : '}';
+ },
+ isComplete: function(state) {
+ return state.index === 0 && state.nextCh === state.symb;
+ }
+ },
+ comment: {
+ isComplete: function(state) {
+ var found = state.lastCh === '*' && state.nextCh === '/';
+ state.lastCh = state.nextCh;
+ return found;
+ }
+ },
+ // TODO: The original Vim implementation only operates on level 1 and 2.
+ // The current implementation doesn't check for code block level and
+ // therefore it operates on any levels.
+ method: {
+ init: function(state) {
+ state.symb = (state.symb === 'm' ? '{' : '}');
+ state.reverseSymb = state.symb === '{' ? '}' : '{';
+ },
+ isComplete: function(state) {
+ if (state.nextCh === state.symb)return true;
+ return false;
+ }
+ },
+ preprocess: {
+ init: function(state) {
+ state.index = 0;
+ },
+ isComplete: function(state) {
+ if (state.nextCh === '#') {
+ var token = state.lineText.match(/#(\w+)/)[1];
+ if (token === 'endif') {
+ if (state.forward && state.depth === 0) {
+ return true;
+ }
+ state.depth++;
+ } else if (token === 'if') {
+ if (!state.forward && state.depth === 0) {
+ return true;
+ }
+ state.depth--;
+ }
+ if (token === 'else' && state.depth === 0)return true;
+ }
+ return false;
+ }
+ }
+ };
+ function findSymbol(cm, repeat, forward, symb) {
+ var cur = copyCursor(cm.getCursor());
+ var increment = forward ? 1 : -1;
+ var endLine = forward ? cm.lineCount() : -1;
+ var curCh = cur.ch;
+ var line = cur.line;
+ var lineText = cm.getLine(line);
+ var state = {
+ lineText: lineText,
+ nextCh: lineText.charAt(curCh),
+ lastCh: null,
+ index: curCh,
+ symb: symb,
+ reverseSymb: (forward ? { ')': '(', '}': '{' } : { '(': ')', '{': '}' })[symb],
+ forward: forward,
+ depth: 0,
+ curMoveThrough: false
+ };
+ var mode = symbolToMode[symb];
+ if (!mode)return cur;
+ var init = findSymbolModes[mode].init;
+ var isComplete = findSymbolModes[mode].isComplete;
+ if (init) { init(state); }
+ while (line !== endLine && repeat) {
+ state.index += increment;
+ state.nextCh = state.lineText.charAt(state.index);
+ if (!state.nextCh) {
+ line += increment;
+ state.lineText = cm.getLine(line) || '';
+ if (increment > 0) {
+ state.index = 0;
+ } else {
+ var lineLen = state.lineText.length;
+ state.index = (lineLen > 0) ? (lineLen-1) : 0;
+ }
+ state.nextCh = state.lineText.charAt(state.index);
+ }
+ if (isComplete(state)) {
+ cur.line = line;
+ cur.ch = state.index;
+ repeat--;
+ }
+ }
+ if (state.nextCh || state.curMoveThrough) {
+ return Pos(line, state.index);
+ }
+ return cur;
+ }
+
+ /*
+ * Returns the boundaries of the next word. If the cursor in the middle of
+ * the word, then returns the boundaries of the current word, starting at
+ * the cursor. If the cursor is at the start/end of a word, and we are going
+ * forward/backward, respectively, find the boundaries of the next word.
+ *
+ * @param {CodeMirror} cm CodeMirror object.
+ * @param {Cursor} cur The cursor position.
+ * @param {boolean} forward True to search forward. False to search
+ * backward.
+ * @param {boolean} bigWord True if punctuation count as part of the word.
+ * False if only [a-zA-Z0-9] characters count as part of the word.
+ * @param {boolean} emptyLineIsWord True if empty lines should be treated
+ * as words.
+ * @return {Object{from:number, to:number, line: number}} The boundaries of
+ * the word, or null if there are no more words.
+ */
+ function findWord(cm, cur, forward, bigWord, emptyLineIsWord) {
+ var lineNum = cur.line;
+ var pos = cur.ch;
+ var line = cm.getLine(lineNum);
+ var dir = forward ? 1 : -1;
+ var charTests = bigWord ? bigWordCharTest: wordCharTest;
+
+ if (emptyLineIsWord && line == '') {
+ lineNum += dir;
+ line = cm.getLine(lineNum);
+ if (!isLine(cm, lineNum)) {
+ return null;
+ }
+ pos = (forward) ? 0 : line.length;
+ }
+
+ while (true) {
+ if (emptyLineIsWord && line == '') {
+ return { from: 0, to: 0, line: lineNum };
+ }
+ var stop = (dir > 0) ? line.length : -1;
+ var wordStart = stop, wordEnd = stop;
+ // Find bounds of next word.
+ while (pos != stop) {
+ var foundWord = false;
+ for (var i = 0; i < charTests.length && !foundWord; ++i) {
+ if (charTests[i](line.charAt(pos))) {
+ wordStart = pos;
+ // Advance to end of word.
+ while (pos != stop && charTests[i](line.charAt(pos))) {
+ pos += dir;
+ }
+ wordEnd = pos;
+ foundWord = wordStart != wordEnd;
+ if (wordStart == cur.ch && lineNum == cur.line &&
+ wordEnd == wordStart + dir) {
+ // We started at the end of a word. Find the next one.
+ continue;
+ } else {
+ return {
+ from: Math.min(wordStart, wordEnd + 1),
+ to: Math.max(wordStart, wordEnd),
+ line: lineNum };
+ }
+ }
+ }
+ if (!foundWord) {
+ pos += dir;
+ }
+ }
+ // Advance to next/prev line.
+ lineNum += dir;
+ if (!isLine(cm, lineNum)) {
+ return null;
+ }
+ line = cm.getLine(lineNum);
+ pos = (dir > 0) ? 0 : line.length;
+ }
+ }
+
+ /**
+ * @param {CodeMirror} cm CodeMirror object.
+ * @param {Pos} cur The position to start from.
+ * @param {int} repeat Number of words to move past.
+ * @param {boolean} forward True to search forward. False to search
+ * backward.
+ * @param {boolean} wordEnd True to move to end of word. False to move to
+ * beginning of word.
+ * @param {boolean} bigWord True if punctuation count as part of the word.
+ * False if only alphabet characters count as part of the word.
+ * @return {Cursor} The position the cursor should move to.
+ */
+ function moveToWord(cm, cur, repeat, forward, wordEnd, bigWord) {
+ var curStart = copyCursor(cur);
+ var words = [];
+ if (forward && !wordEnd || !forward && wordEnd) {
+ repeat++;
+ }
+ // For 'e', empty lines are not considered words, go figure.
+ var emptyLineIsWord = !(forward && wordEnd);
+ for (var i = 0; i < repeat; i++) {
+ var word = findWord(cm, cur, forward, bigWord, emptyLineIsWord);
+ if (!word) {
+ var eodCh = lineLength(cm, cm.lastLine());
+ words.push(forward
+ ? {line: cm.lastLine(), from: eodCh, to: eodCh}
+ : {line: 0, from: 0, to: 0});
+ break;
+ }
+ words.push(word);
+ cur = Pos(word.line, forward ? (word.to - 1) : word.from);
+ }
+ var shortCircuit = words.length != repeat;
+ var firstWord = words[0];
+ var lastWord = words.pop();
+ if (forward && !wordEnd) {
+ // w
+ if (!shortCircuit && (firstWord.from != curStart.ch || firstWord.line != curStart.line)) {
+ // We did not start in the middle of a word. Discard the extra word at the end.
+ lastWord = words.pop();
+ }
+ return Pos(lastWord.line, lastWord.from);
+ } else if (forward && wordEnd) {
+ return Pos(lastWord.line, lastWord.to - 1);
+ } else if (!forward && wordEnd) {
+ // ge
+ if (!shortCircuit && (firstWord.to != curStart.ch || firstWord.line != curStart.line)) {
+ // We did not start in the middle of a word. Discard the extra word at the end.
+ lastWord = words.pop();
+ }
+ return Pos(lastWord.line, lastWord.to);
+ } else {
+ // b
+ return Pos(lastWord.line, lastWord.from);
+ }
+ }
+
+ function moveToCharacter(cm, repeat, forward, character) {
+ var cur = cm.getCursor();
+ var start = cur.ch;
+ var idx;
+ for (var i = 0; i < repeat; i ++) {
+ var line = cm.getLine(cur.line);
+ idx = charIdxInLine(start, line, character, forward, true);
+ if (idx == -1) {
+ return null;
+ }
+ start = idx;
+ }
+ return Pos(cm.getCursor().line, idx);
+ }
+
+ function moveToColumn(cm, repeat) {
+ // repeat is always >= 1, so repeat - 1 always corresponds
+ // to the column we want to go to.
+ var line = cm.getCursor().line;
+ return clipCursorToContent(cm, Pos(line, repeat - 1));
+ }
+
+ function updateMark(cm, vim, markName, pos) {
+ if (!inArray(markName, validMarks)) {
+ return;
+ }
+ if (vim.marks[markName]) {
+ vim.marks[markName].clear();
+ }
+ vim.marks[markName] = cm.setBookmark(pos);
+ }
+
+ function charIdxInLine(start, line, character, forward, includeChar) {
+ // Search for char in line.
+ // motion_options: {forward, includeChar}
+ // If includeChar = true, include it too.
+ // If forward = true, search forward, else search backwards.
+ // If char is not found on this line, do nothing
+ var idx;
+ if (forward) {
+ idx = line.indexOf(character, start + 1);
+ if (idx != -1 && !includeChar) {
+ idx -= 1;
+ }
+ } else {
+ idx = line.lastIndexOf(character, start - 1);
+ if (idx != -1 && !includeChar) {
+ idx += 1;
+ }
+ }
+ return idx;
+ }
+
+ function findParagraph(cm, head, repeat, dir, inclusive) {
+ var line = head.line;
+ var min = cm.firstLine();
+ var max = cm.lastLine();
+ var start, end, i = line;
+ function isEmpty(i) { return !cm.getLine(i); }
+ function isBoundary(i, dir, any) {
+ if (any) { return isEmpty(i) != isEmpty(i + dir); }
+ return !isEmpty(i) && isEmpty(i + dir);
+ }
+ if (dir) {
+ while (min <= i && i <= max && repeat > 0) {
+ if (isBoundary(i, dir)) { repeat--; }
+ i += dir;
+ }
+ return new Pos(i, 0);
+ }
+
+ var vim = cm.state.vim;
+ if (vim.visualLine && isBoundary(line, 1, true)) {
+ var anchor = vim.sel.anchor;
+ if (isBoundary(anchor.line, -1, true)) {
+ if (!inclusive || anchor.line != line) {
+ line += 1;
+ }
+ }
+ }
+ var startState = isEmpty(line);
+ for (i = line; i <= max && repeat; i++) {
+ if (isBoundary(i, 1, true)) {
+ if (!inclusive || isEmpty(i) != startState) {
+ repeat--;
+ }
+ }
+ }
+ end = new Pos(i, 0);
+ // select boundary before paragraph for the last one
+ if (i > max && !startState) { startState = true; }
+ else { inclusive = false; }
+ for (i = line; i > min; i--) {
+ if (!inclusive || isEmpty(i) == startState || i == line) {
+ if (isBoundary(i, -1, true)) { break; }
+ }
+ }
+ start = new Pos(i, 0);
+ return { start: start, end: end };
+ }
+
+ function findSentence(cm, cur, repeat, dir) {
+
+ /*
+ Takes an index object
+ {
+ line: the line string,
+ ln: line number,
+ pos: index in line,
+ dir: direction of traversal (-1 or 1)
+ }
+ and modifies the line, ln, and pos members to represent the
+ next valid position or sets them to null if there are
+ no more valid positions.
+ */
+ function nextChar(cm, idx) {
+ if (idx.pos + idx.dir < 0 || idx.pos + idx.dir >= idx.line.length) {
+ idx.ln += idx.dir;
+ if (!isLine(cm, idx.ln)) {
+ idx.line = null;
+ idx.ln = null;
+ idx.pos = null;
+ return;
+ }
+ idx.line = cm.getLine(idx.ln);
+ idx.pos = (idx.dir > 0) ? 0 : idx.line.length - 1;
+ }
+ else {
+ idx.pos += idx.dir;
+ }
+ }
+
+ /*
+ Performs one iteration of traversal in forward direction
+ Returns an index object of the new location
+ */
+ function forward(cm, ln, pos, dir) {
+ var line = cm.getLine(ln);
+ var stop = (line === "");
+
+ var curr = {
+ line: line,
+ ln: ln,
+ pos: pos,
+ dir: dir,
+ }
+
+ var last_valid = {
+ ln: curr.ln,
+ pos: curr.pos,
+ }
+
+ var skip_empty_lines = (curr.line === "");
+
+ // Move one step to skip character we start on
+ nextChar(cm, curr);
+
+ while (curr.line !== null) {
+ last_valid.ln = curr.ln;
+ last_valid.pos = curr.pos;
+
+ if (curr.line === "" && !skip_empty_lines) {
+ return { ln: curr.ln, pos: curr.pos, };
+ }
+ else if (stop && curr.line !== "" && !isWhiteSpaceString(curr.line[curr.pos])) {
+ return { ln: curr.ln, pos: curr.pos, };
+ }
+ else if (isEndOfSentenceSymbol(curr.line[curr.pos])
+ && !stop
+ && (curr.pos === curr.line.length - 1
+ || isWhiteSpaceString(curr.line[curr.pos + 1]))) {
+ stop = true;
+ }
+
+ nextChar(cm, curr);
+ }
+
+ /*
+ Set the position to the last non whitespace character on the last
+ valid line in the case that we reach the end of the document.
+ */
+ var line = cm.getLine(last_valid.ln);
+ last_valid.pos = 0;
+ for(var i = line.length - 1; i >= 0; --i) {
+ if (!isWhiteSpaceString(line[i])) {
+ last_valid.pos = i;
+ break;
+ }
+ }
+
+ return last_valid;
+
+ }
+
+ /*
+ Performs one iteration of traversal in reverse direction
+ Returns an index object of the new location
+ */
+ function reverse(cm, ln, pos, dir) {
+ var line = cm.getLine(ln);
+
+ var curr = {
+ line: line,
+ ln: ln,
+ pos: pos,
+ dir: dir,
+ }
+
+ var last_valid = {
+ ln: curr.ln,
+ pos: null,
+ };
+
+ var skip_empty_lines = (curr.line === "");
+
+ // Move one step to skip character we start on
+ nextChar(cm, curr);
+
+ while (curr.line !== null) {
+
+ if (curr.line === "" && !skip_empty_lines) {
+ if (last_valid.pos !== null) {
+ return last_valid;
+ }
+ else {
+ return { ln: curr.ln, pos: curr.pos };
+ }
+ }
+ else if (isEndOfSentenceSymbol(curr.line[curr.pos])
+ && last_valid.pos !== null
+ && !(curr.ln === last_valid.ln && curr.pos + 1 === last_valid.pos)) {
+ return last_valid;
+ }
+ else if (curr.line !== "" && !isWhiteSpaceString(curr.line[curr.pos])) {
+ skip_empty_lines = false;
+ last_valid = { ln: curr.ln, pos: curr.pos }
+ }
+
+ nextChar(cm, curr);
+ }
+
+ /*
+ Set the position to the first non whitespace character on the last
+ valid line in the case that we reach the beginning of the document.
+ */
+ var line = cm.getLine(last_valid.ln);
+ last_valid.pos = 0;
+ for(var i = 0; i < line.length; ++i) {
+ if (!isWhiteSpaceString(line[i])) {
+ last_valid.pos = i;
+ break;
+ }
+ }
+ return last_valid;
+ }
+
+ var curr_index = {
+ ln: cur.line,
+ pos: cur.ch,
+ };
+
+ while (repeat > 0) {
+ if (dir < 0) {
+ curr_index = reverse(cm, curr_index.ln, curr_index.pos, dir);
+ }
+ else {
+ curr_index = forward(cm, curr_index.ln, curr_index.pos, dir);
+ }
+ repeat--;
+ }
+
+ return Pos(curr_index.ln, curr_index.pos);
+ }
+
+ // TODO: perhaps this finagling of start and end positions belongs
+ // in codemirror/replaceRange?
+ function selectCompanionObject(cm, head, symb, inclusive) {
+ var cur = head, start, end;
+
+ var bracketRegexp = ({
+ '(': /[()]/, ')': /[()]/,
+ '[': /[[\]]/, ']': /[[\]]/,
+ '{': /[{}]/, '}': /[{}]/,
+ '<': /[<>]/, '>': /[<>]/})[symb];
+ var openSym = ({
+ '(': '(', ')': '(',
+ '[': '[', ']': '[',
+ '{': '{', '}': '{',
+ '<': '<', '>': '<'})[symb];
+ var curChar = cm.getLine(cur.line).charAt(cur.ch);
+ // Due to the behavior of scanForBracket, we need to add an offset if the
+ // cursor is on a matching open bracket.
+ var offset = curChar === openSym ? 1 : 0;
+
+ start = cm.scanForBracket(Pos(cur.line, cur.ch + offset), -1, undefined, {'bracketRegex': bracketRegexp});
+ end = cm.scanForBracket(Pos(cur.line, cur.ch + offset), 1, undefined, {'bracketRegex': bracketRegexp});
+
+ if (!start || !end) {
+ return { start: cur, end: cur };
+ }
+
+ start = start.pos;
+ end = end.pos;
+
+ if ((start.line == end.line && start.ch > end.ch)
+ || (start.line > end.line)) {
+ var tmp = start;
+ start = end;
+ end = tmp;
+ }
+
+ if (inclusive) {
+ end.ch += 1;
+ } else {
+ start.ch += 1;
+ }
+
+ return { start: start, end: end };
+ }
+
+ // Takes in a symbol and a cursor and tries to simulate text objects that
+ // have identical opening and closing symbols
+ // TODO support across multiple lines
+ function findBeginningAndEnd(cm, head, symb, inclusive) {
+ var cur = copyCursor(head);
+ var line = cm.getLine(cur.line);
+ var chars = line.split('');
+ var start, end, i, len;
+ var firstIndex = chars.indexOf(symb);
+
+ // the decision tree is to always look backwards for the beginning first,
+ // but if the cursor is in front of the first instance of the symb,
+ // then move the cursor forward
+ if (cur.ch < firstIndex) {
+ cur.ch = firstIndex;
+ // Why is this line even here???
+ // cm.setCursor(cur.line, firstIndex+1);
+ }
+ // otherwise if the cursor is currently on the closing symbol
+ else if (firstIndex < cur.ch && chars[cur.ch] == symb) {
+ end = cur.ch; // assign end to the current cursor
+ --cur.ch; // make sure to look backwards
+ }
+
+ // if we're currently on the symbol, we've got a start
+ if (chars[cur.ch] == symb && !end) {
+ start = cur.ch + 1; // assign start to ahead of the cursor
+ } else {
+ // go backwards to find the start
+ for (i = cur.ch; i > -1 && !start; i--) {
+ if (chars[i] == symb) {
+ start = i + 1;
+ }
+ }
+ }
+
+ // look forwards for the end symbol
+ if (start && !end) {
+ for (i = start, len = chars.length; i < len && !end; i++) {
+ if (chars[i] == symb) {
+ end = i;
+ }
+ }
+ }
+
+ // nothing found
+ if (!start || !end) {
+ return { start: cur, end: cur };
+ }
+
+ // include the symbols
+ if (inclusive) {
+ --start; ++end;
+ }
+
+ return {
+ start: Pos(cur.line, start),
+ end: Pos(cur.line, end)
+ };
+ }
+
+ // Search functions
+ defineOption('pcre', true, 'boolean');
+ function SearchState() {}
+ SearchState.prototype = {
+ getQuery: function() {
+ return vimGlobalState.query;
+ },
+ setQuery: function(query) {
+ vimGlobalState.query = query;
+ },
+ getOverlay: function() {
+ return this.searchOverlay;
+ },
+ setOverlay: function(overlay) {
+ this.searchOverlay = overlay;
+ },
+ isReversed: function() {
+ return vimGlobalState.isReversed;
+ },
+ setReversed: function(reversed) {
+ vimGlobalState.isReversed = reversed;
+ },
+ getScrollbarAnnotate: function() {
+ return this.annotate;
+ },
+ setScrollbarAnnotate: function(annotate) {
+ this.annotate = annotate;
+ }
+ };
+ function getSearchState(cm) {
+ var vim = cm.state.vim;
+ return vim.searchState_ || (vim.searchState_ = new SearchState());
+ }
+ function dialog(cm, template, shortText, onClose, options) {
+ if (cm.openDialog) {
+ cm.openDialog(template, onClose, { bottom: true, value: options.value,
+ onKeyDown: options.onKeyDown, onKeyUp: options.onKeyUp,
+ selectValueOnOpen: false});
+ }
+ else {
+ onClose(prompt(shortText, ''));
+ }
+ }
+ function splitBySlash(argString) {
+ return splitBySeparator(argString, '/');
+ }
+
+ function findUnescapedSlashes(argString) {
+ return findUnescapedSeparators(argString, '/');
+ }
+
+ function splitBySeparator(argString, separator) {
+ var slashes = findUnescapedSeparators(argString, separator) || [];
+ if (!slashes.length) return [];
+ var tokens = [];
+ // in case of strings like foo/bar
+ if (slashes[0] !== 0) return;
+ for (var i = 0; i < slashes.length; i++) {
+ if (typeof slashes[i] == 'number')
+ tokens.push(argString.substring(slashes[i] + 1, slashes[i+1]));
+ }
+ return tokens;
+ }
+
+ function findUnescapedSeparators(str, separator) {
+ if (!separator)
+ separator = '/';
+
+ var escapeNextChar = false;
+ var slashes = [];
+ for (var i = 0; i < str.length; i++) {
+ var c = str.charAt(i);
+ if (!escapeNextChar && c == separator) {
+ slashes.push(i);
+ }
+ escapeNextChar = !escapeNextChar && (c == '\\');
+ }
+ return slashes;
+ }
+
+ // Translates a search string from ex (vim) syntax into javascript form.
+ function translateRegex(str) {
+ // When these match, add a '\' if unescaped or remove one if escaped.
+ var specials = '|(){';
+ // Remove, but never add, a '\' for these.
+ var unescape = '}';
+ var escapeNextChar = false;
+ var out = [];
+ for (var i = -1; i < str.length; i++) {
+ var c = str.charAt(i) || '';
+ var n = str.charAt(i+1) || '';
+ var specialComesNext = (n && specials.indexOf(n) != -1);
+ if (escapeNextChar) {
+ if (c !== '\\' || !specialComesNext) {
+ out.push(c);
+ }
+ escapeNextChar = false;
+ } else {
+ if (c === '\\') {
+ escapeNextChar = true;
+ // Treat the unescape list as special for removing, but not adding '\'.
+ if (n && unescape.indexOf(n) != -1) {
+ specialComesNext = true;
+ }
+ // Not passing this test means removing a '\'.
+ if (!specialComesNext || n === '\\') {
+ out.push(c);
+ }
+ } else {
+ out.push(c);
+ if (specialComesNext && n !== '\\') {
+ out.push('\\');
+ }
+ }
+ }
+ }
+ return out.join('');
+ }
+
+ // Translates the replace part of a search and replace from ex (vim) syntax into
+ // javascript form. Similar to translateRegex, but additionally fixes back references
+ // (translates '\[0..9]' to '$[0..9]') and follows different rules for escaping '$'.
+ var charUnescapes = {'\\n': '\n', '\\r': '\r', '\\t': '\t'};
+ function translateRegexReplace(str) {
+ var escapeNextChar = false;
+ var out = [];
+ for (var i = -1; i < str.length; i++) {
+ var c = str.charAt(i) || '';
+ var n = str.charAt(i+1) || '';
+ if (charUnescapes[c + n]) {
+ out.push(charUnescapes[c+n]);
+ i++;
+ } else if (escapeNextChar) {
+ // At any point in the loop, escapeNextChar is true if the previous
+ // character was a '\' and was not escaped.
+ out.push(c);
+ escapeNextChar = false;
+ } else {
+ if (c === '\\') {
+ escapeNextChar = true;
+ if ((isNumber(n) || n === '$')) {
+ out.push('$');
+ } else if (n !== '/' && n !== '\\') {
+ out.push('\\');
+ }
+ } else {
+ if (c === '$') {
+ out.push('$');
+ }
+ out.push(c);
+ if (n === '/') {
+ out.push('\\');
+ }
+ }
+ }
+ }
+ return out.join('');
+ }
+
+ // Unescape \ and / in the replace part, for PCRE mode.
+ var unescapes = {'\\/': '/', '\\\\': '\\', '\\n': '\n', '\\r': '\r', '\\t': '\t', '\\&':'&'};
+ function unescapeRegexReplace(str) {
+ var stream = new CodeMirror.StringStream(str);
+ var output = [];
+ while (!stream.eol()) {
+ // Search for \.
+ while (stream.peek() && stream.peek() != '\\') {
+ output.push(stream.next());
+ }
+ var matched = false;
+ for (var matcher in unescapes) {
+ if (stream.match(matcher, true)) {
+ matched = true;
+ output.push(unescapes[matcher]);
+ break;
+ }
+ }
+ if (!matched) {
+ // Don't change anything
+ output.push(stream.next());
+ }
+ }
+ return output.join('');
+ }
+
+ /**
+ * Extract the regular expression from the query and return a Regexp object.
+ * Returns null if the query is blank.
+ * If ignoreCase is passed in, the Regexp object will have the 'i' flag set.
+ * If smartCase is passed in, and the query contains upper case letters,
+ * then ignoreCase is overridden, and the 'i' flag will not be set.
+ * If the query contains the /i in the flag part of the regular expression,
+ * then both ignoreCase and smartCase are ignored, and 'i' will be passed
+ * through to the Regex object.
+ */
+ function parseQuery(query, ignoreCase, smartCase) {
+ // First update the last search register
+ var lastSearchRegister = vimGlobalState.registerController.getRegister('/');
+ lastSearchRegister.setText(query);
+ // Check if the query is already a regex.
+ if (query instanceof RegExp) { return query; }
+ // First try to extract regex + flags from the input. If no flags found,
+ // extract just the regex. IE does not accept flags directly defined in
+ // the regex string in the form /regex/flags
+ var slashes = findUnescapedSlashes(query);
+ var regexPart;
+ var forceIgnoreCase;
+ if (!slashes.length) {
+ // Query looks like 'regexp'
+ regexPart = query;
+ } else {
+ // Query looks like 'regexp/...'
+ regexPart = query.substring(0, slashes[0]);
+ var flagsPart = query.substring(slashes[0]);
+ forceIgnoreCase = (flagsPart.indexOf('i') != -1);
+ }
+ if (!regexPart) {
+ return null;
+ }
+ if (!getOption('pcre')) {
+ regexPart = translateRegex(regexPart);
+ }
+ if (smartCase) {
+ ignoreCase = (/^[^A-Z]*$/).test(regexPart);
+ }
+ var regexp = new RegExp(regexPart,
+ (ignoreCase || forceIgnoreCase) ? 'i' : undefined);
+ return regexp;
+ }
+ function showConfirm(cm, text) {
+ if (cm.openNotification) {
+ cm.openNotification('' + text + '',
+ {bottom: true, duration: 5000});
+ } else {
+ alert(text);
+ }
+ }
+ function makePrompt(prefix, desc) {
+ var raw = '' +
+ (prefix || "") + '';
+ if (desc)
+ raw += ' ' + desc + '';
+ return raw;
+ }
+ var searchPromptDesc = '(Javascript regexp)';
+ function showPrompt(cm, options) {
+ var shortText = (options.prefix || '') + ' ' + (options.desc || '');
+ var prompt = makePrompt(options.prefix, options.desc);
+ dialog(cm, prompt, shortText, options.onClose, options);
+ }
+ function regexEqual(r1, r2) {
+ if (r1 instanceof RegExp && r2 instanceof RegExp) {
+ var props = ['global', 'multiline', 'ignoreCase', 'source'];
+ for (var i = 0; i < props.length; i++) {
+ var prop = props[i];
+ if (r1[prop] !== r2[prop]) {
+ return false;
+ }
+ }
+ return true;
+ }
+ return false;
+ }
+ // Returns true if the query is valid.
+ function updateSearchQuery(cm, rawQuery, ignoreCase, smartCase) {
+ if (!rawQuery) {
+ return;
+ }
+ var state = getSearchState(cm);
+ var query = parseQuery(rawQuery, !!ignoreCase, !!smartCase);
+ if (!query) {
+ return;
+ }
+ highlightSearchMatches(cm, query);
+ if (regexEqual(query, state.getQuery())) {
+ return query;
+ }
+ state.setQuery(query);
+ return query;
+ }
+ function searchOverlay(query) {
+ if (query.source.charAt(0) == '^') {
+ var matchSol = true;
+ }
+ return {
+ token: function(stream) {
+ if (matchSol && !stream.sol()) {
+ stream.skipToEnd();
+ return;
+ }
+ var match = stream.match(query, false);
+ if (match) {
+ if (match[0].length == 0) {
+ // Matched empty string, skip to next.
+ stream.next();
+ return 'searching';
+ }
+ if (!stream.sol()) {
+ // Backtrack 1 to match \b
+ stream.backUp(1);
+ if (!query.exec(stream.next() + match[0])) {
+ stream.next();
+ return null;
+ }
+ }
+ stream.match(query);
+ return 'searching';
+ }
+ while (!stream.eol()) {
+ stream.next();
+ if (stream.match(query, false)) break;
+ }
+ },
+ query: query
+ };
+ }
+ var highlightTimeout = 0;
+ function highlightSearchMatches(cm, query) {
+ clearTimeout(highlightTimeout);
+ highlightTimeout = setTimeout(function() {
+ var searchState = getSearchState(cm);
+ var overlay = searchState.getOverlay();
+ if (!overlay || query != overlay.query) {
+ if (overlay) {
+ cm.removeOverlay(overlay);
+ }
+ overlay = searchOverlay(query);
+ cm.addOverlay(overlay);
+ if (cm.showMatchesOnScrollbar) {
+ if (searchState.getScrollbarAnnotate()) {
+ searchState.getScrollbarAnnotate().clear();
+ }
+ searchState.setScrollbarAnnotate(cm.showMatchesOnScrollbar(query));
+ }
+ searchState.setOverlay(overlay);
+ }
+ }, 50);
+ }
+ function findNext(cm, prev, query, repeat) {
+ if (repeat === undefined) { repeat = 1; }
+ return cm.operation(function() {
+ var pos = cm.getCursor();
+ var cursor = cm.getSearchCursor(query, pos);
+ for (var i = 0; i < repeat; i++) {
+ var found = cursor.find(prev);
+ if (i == 0 && found && cursorEqual(cursor.from(), pos)) { found = cursor.find(prev); }
+ if (!found) {
+ // SearchCursor may have returned null because it hit EOF, wrap
+ // around and try again.
+ cursor = cm.getSearchCursor(query,
+ (prev) ? Pos(cm.lastLine()) : Pos(cm.firstLine(), 0) );
+ if (!cursor.find(prev)) {
+ return;
+ }
+ }
+ }
+ return cursor.from();
+ });
+ }
+ function clearSearchHighlight(cm) {
+ var state = getSearchState(cm);
+ cm.removeOverlay(getSearchState(cm).getOverlay());
+ state.setOverlay(null);
+ if (state.getScrollbarAnnotate()) {
+ state.getScrollbarAnnotate().clear();
+ state.setScrollbarAnnotate(null);
+ }
+ }
+ /**
+ * Check if pos is in the specified range, INCLUSIVE.
+ * Range can be specified with 1 or 2 arguments.
+ * If the first range argument is an array, treat it as an array of line
+ * numbers. Match pos against any of the lines.
+ * If the first range argument is a number,
+ * if there is only 1 range argument, check if pos has the same line
+ * number
+ * if there are 2 range arguments, then check if pos is in between the two
+ * range arguments.
+ */
+ function isInRange(pos, start, end) {
+ if (typeof pos != 'number') {
+ // Assume it is a cursor position. Get the line number.
+ pos = pos.line;
+ }
+ if (start instanceof Array) {
+ return inArray(pos, start);
+ } else {
+ if (end) {
+ return (pos >= start && pos <= end);
+ } else {
+ return pos == start;
+ }
+ }
+ }
+ function getUserVisibleLines(cm) {
+ var scrollInfo = cm.getScrollInfo();
+ var occludeToleranceTop = 6;
+ var occludeToleranceBottom = 10;
+ var from = cm.coordsChar({left:0, top: occludeToleranceTop + scrollInfo.top}, 'local');
+ var bottomY = scrollInfo.clientHeight - occludeToleranceBottom + scrollInfo.top;
+ var to = cm.coordsChar({left:0, top: bottomY}, 'local');
+ return {top: from.line, bottom: to.line};
+ }
+
+ function getMarkPos(cm, vim, markName) {
+ if (markName == '\'' || markName == '`') {
+ return vimGlobalState.jumpList.find(cm, -1) || Pos(0, 0);
+ } else if (markName == '.') {
+ return getLastEditPos(cm);
+ }
+
+ var mark = vim.marks[markName];
+ return mark && mark.find();
+ }
+
+ function getLastEditPos(cm) {
+ var done = cm.doc.history.done;
+ for (var i = done.length; i--;) {
+ if (done[i].changes) {
+ return copyCursor(done[i].changes[0].to);
+ }
+ }
+ }
+
+ var ExCommandDispatcher = function() {
+ this.buildCommandMap_();
+ };
+ ExCommandDispatcher.prototype = {
+ processCommand: function(cm, input, opt_params) {
+ var that = this;
+ cm.operation(function () {
+ cm.curOp.isVimOp = true;
+ that._processCommand(cm, input, opt_params);
+ });
+ },
+ _processCommand: function(cm, input, opt_params) {
+ var vim = cm.state.vim;
+ var commandHistoryRegister = vimGlobalState.registerController.getRegister(':');
+ var previousCommand = commandHistoryRegister.toString();
+ if (vim.visualMode) {
+ exitVisualMode(cm);
+ }
+ var inputStream = new CodeMirror.StringStream(input);
+ // update ": with the latest command whether valid or invalid
+ commandHistoryRegister.setText(input);
+ var params = opt_params || {};
+ params.input = input;
+ try {
+ this.parseInput_(cm, inputStream, params);
+ } catch(e) {
+ showConfirm(cm, e);
+ throw e;
+ }
+ var command;
+ var commandName;
+ if (!params.commandName) {
+ // If only a line range is defined, move to the line.
+ if (params.line !== undefined) {
+ commandName = 'move';
+ }
+ } else {
+ command = this.matchCommand_(params.commandName);
+ if (command) {
+ commandName = command.name;
+ if (command.excludeFromCommandHistory) {
+ commandHistoryRegister.setText(previousCommand);
+ }
+ this.parseCommandArgs_(inputStream, params, command);
+ if (command.type == 'exToKey') {
+ // Handle Ex to Key mapping.
+ for (var i = 0; i < command.toKeys.length; i++) {
+ CodeMirror.Vim.handleKey(cm, command.toKeys[i], 'mapping');
+ }
+ return;
+ } else if (command.type == 'exToEx') {
+ // Handle Ex to Ex mapping.
+ this.processCommand(cm, command.toInput);
+ return;
+ }
+ }
+ }
+ if (!commandName) {
+ showConfirm(cm, 'Not an editor command ":' + input + '"');
+ return;
+ }
+ try {
+ exCommands[commandName](cm, params);
+ // Possibly asynchronous commands (e.g. substitute, which might have a
+ // user confirmation), are responsible for calling the callback when
+ // done. All others have it taken care of for them here.
+ if ((!command || !command.possiblyAsync) && params.callback) {
+ params.callback();
+ }
+ } catch(e) {
+ showConfirm(cm, e);
+ throw e;
+ }
+ },
+ parseInput_: function(cm, inputStream, result) {
+ inputStream.eatWhile(':');
+ // Parse range.
+ if (inputStream.eat('%')) {
+ result.line = cm.firstLine();
+ result.lineEnd = cm.lastLine();
+ } else {
+ result.line = this.parseLineSpec_(cm, inputStream);
+ if (result.line !== undefined && inputStream.eat(',')) {
+ result.lineEnd = this.parseLineSpec_(cm, inputStream);
+ }
+ }
+
+ // Parse command name.
+ var commandMatch = inputStream.match(/^(\w+|!!|@@|[!#&*<=>@~])/);
+ if (commandMatch) {
+ result.commandName = commandMatch[1];
+ } else {
+ result.commandName = inputStream.match(/.*/)[0];
+ }
+
+ return result;
+ },
+ parseLineSpec_: function(cm, inputStream) {
+ var numberMatch = inputStream.match(/^(\d+)/);
+ if (numberMatch) {
+ // Absolute line number plus offset (N+M or N-M) is probably a typo,
+ // not something the user actually wanted. (NB: vim does allow this.)
+ return parseInt(numberMatch[1], 10) - 1;
+ }
+ switch (inputStream.next()) {
+ case '.':
+ return this.parseLineSpecOffset_(inputStream, cm.getCursor().line);
+ case '$':
+ return this.parseLineSpecOffset_(inputStream, cm.lastLine());
+ case '\'':
+ var markName = inputStream.next();
+ var markPos = getMarkPos(cm, cm.state.vim, markName);
+ if (!markPos) throw new Error('Mark not set');
+ return this.parseLineSpecOffset_(inputStream, markPos.line);
+ case '-':
+ case '+':
+ inputStream.backUp(1);
+ // Offset is relative to current line if not otherwise specified.
+ return this.parseLineSpecOffset_(inputStream, cm.getCursor().line);
+ default:
+ inputStream.backUp(1);
+ return undefined;
+ }
+ },
+ parseLineSpecOffset_: function(inputStream, line) {
+ var offsetMatch = inputStream.match(/^([+-])?(\d+)/);
+ if (offsetMatch) {
+ var offset = parseInt(offsetMatch[2], 10);
+ if (offsetMatch[1] == "-") {
+ line -= offset;
+ } else {
+ line += offset;
+ }
+ }
+ return line;
+ },
+ parseCommandArgs_: function(inputStream, params, command) {
+ if (inputStream.eol()) {
+ return;
+ }
+ params.argString = inputStream.match(/.*/)[0];
+ // Parse command-line arguments
+ var delim = command.argDelimiter || /\s+/;
+ var args = trim(params.argString).split(delim);
+ if (args.length && args[0]) {
+ params.args = args;
+ }
+ },
+ matchCommand_: function(commandName) {
+ // Return the command in the command map that matches the shortest
+ // prefix of the passed in command name. The match is guaranteed to be
+ // unambiguous if the defaultExCommandMap's shortNames are set up
+ // correctly. (see @code{defaultExCommandMap}).
+ for (var i = commandName.length; i > 0; i--) {
+ var prefix = commandName.substring(0, i);
+ if (this.commandMap_[prefix]) {
+ var command = this.commandMap_[prefix];
+ if (command.name.indexOf(commandName) === 0) {
+ return command;
+ }
+ }
+ }
+ return null;
+ },
+ buildCommandMap_: function() {
+ this.commandMap_ = {};
+ for (var i = 0; i < defaultExCommandMap.length; i++) {
+ var command = defaultExCommandMap[i];
+ var key = command.shortName || command.name;
+ this.commandMap_[key] = command;
+ }
+ },
+ map: function(lhs, rhs, ctx) {
+ if (lhs != ':' && lhs.charAt(0) == ':') {
+ if (ctx) { throw Error('Mode not supported for ex mappings'); }
+ var commandName = lhs.substring(1);
+ if (rhs != ':' && rhs.charAt(0) == ':') {
+ // Ex to Ex mapping
+ this.commandMap_[commandName] = {
+ name: commandName,
+ type: 'exToEx',
+ toInput: rhs.substring(1),
+ user: true
+ };
+ } else {
+ // Ex to key mapping
+ this.commandMap_[commandName] = {
+ name: commandName,
+ type: 'exToKey',
+ toKeys: rhs,
+ user: true
+ };
+ }
+ } else {
+ if (rhs != ':' && rhs.charAt(0) == ':') {
+ // Key to Ex mapping.
+ var mapping = {
+ keys: lhs,
+ type: 'keyToEx',
+ exArgs: { input: rhs.substring(1) }
+ };
+ if (ctx) { mapping.context = ctx; }
+ defaultKeymap.unshift(mapping);
+ } else {
+ // Key to key mapping
+ var mapping = {
+ keys: lhs,
+ type: 'keyToKey',
+ toKeys: rhs
+ };
+ if (ctx) { mapping.context = ctx; }
+ defaultKeymap.unshift(mapping);
+ }
+ }
+ },
+ unmap: function(lhs, ctx) {
+ if (lhs != ':' && lhs.charAt(0) == ':') {
+ // Ex to Ex or Ex to key mapping
+ if (ctx) { throw Error('Mode not supported for ex mappings'); }
+ var commandName = lhs.substring(1);
+ if (this.commandMap_[commandName] && this.commandMap_[commandName].user) {
+ delete this.commandMap_[commandName];
+ return;
+ }
+ } else {
+ // Key to Ex or key to key mapping
+ var keys = lhs;
+ for (var i = 0; i < defaultKeymap.length; i++) {
+ if (keys == defaultKeymap[i].keys
+ && defaultKeymap[i].context === ctx) {
+ defaultKeymap.splice(i, 1);
+ return;
+ }
+ }
+ }
+ throw Error('No such mapping.');
+ }
+ };
+
+ var exCommands = {
+ colorscheme: function(cm, params) {
+ if (!params.args || params.args.length < 1) {
+ showConfirm(cm, cm.getOption('theme'));
+ return;
+ }
+ cm.setOption('theme', params.args[0]);
+ },
+ map: function(cm, params, ctx) {
+ var mapArgs = params.args;
+ if (!mapArgs || mapArgs.length < 2) {
+ if (cm) {
+ showConfirm(cm, 'Invalid mapping: ' + params.input);
+ }
+ return;
+ }
+ exCommandDispatcher.map(mapArgs[0], mapArgs[1], ctx);
+ },
+ imap: function(cm, params) { this.map(cm, params, 'insert'); },
+ nmap: function(cm, params) { this.map(cm, params, 'normal'); },
+ vmap: function(cm, params) { this.map(cm, params, 'visual'); },
+ unmap: function(cm, params, ctx) {
+ var mapArgs = params.args;
+ if (!mapArgs || mapArgs.length < 1) {
+ if (cm) {
+ showConfirm(cm, 'No such mapping: ' + params.input);
+ }
+ return;
+ }
+ exCommandDispatcher.unmap(mapArgs[0], ctx);
+ },
+ move: function(cm, params) {
+ commandDispatcher.processCommand(cm, cm.state.vim, {
+ type: 'motion',
+ motion: 'moveToLineOrEdgeOfDocument',
+ motionArgs: { forward: false, explicitRepeat: true,
+ linewise: true },
+ repeatOverride: params.line+1});
+ },
+ set: function(cm, params) {
+ var setArgs = params.args;
+ // Options passed through to the setOption/getOption calls. May be passed in by the
+ // local/global versions of the set command
+ var setCfg = params.setCfg || {};
+ if (!setArgs || setArgs.length < 1) {
+ if (cm) {
+ showConfirm(cm, 'Invalid mapping: ' + params.input);
+ }
+ return;
+ }
+ var expr = setArgs[0].split('=');
+ var optionName = expr[0];
+ var value = expr[1];
+ var forceGet = false;
+
+ if (optionName.charAt(optionName.length - 1) == '?') {
+ // If post-fixed with ?, then the set is actually a get.
+ if (value) { throw Error('Trailing characters: ' + params.argString); }
+ optionName = optionName.substring(0, optionName.length - 1);
+ forceGet = true;
+ }
+ if (value === undefined && optionName.substring(0, 2) == 'no') {
+ // To set boolean options to false, the option name is prefixed with
+ // 'no'.
+ optionName = optionName.substring(2);
+ value = false;
+ }
+
+ var optionIsBoolean = options[optionName] && options[optionName].type == 'boolean';
+ if (optionIsBoolean && value == undefined) {
+ // Calling set with a boolean option sets it to true.
+ value = true;
+ }
+ // If no value is provided, then we assume this is a get.
+ if (!optionIsBoolean && value === undefined || forceGet) {
+ var oldValue = getOption(optionName, cm, setCfg);
+ if (oldValue instanceof Error) {
+ showConfirm(cm, oldValue.message);
+ } else if (oldValue === true || oldValue === false) {
+ showConfirm(cm, ' ' + (oldValue ? '' : 'no') + optionName);
+ } else {
+ showConfirm(cm, ' ' + optionName + '=' + oldValue);
+ }
+ } else {
+ var setOptionReturn = setOption(optionName, value, cm, setCfg);
+ if (setOptionReturn instanceof Error) {
+ showConfirm(cm, setOptionReturn.message);
+ }
+ }
+ },
+ setlocal: function (cm, params) {
+ // setCfg is passed through to setOption
+ params.setCfg = {scope: 'local'};
+ this.set(cm, params);
+ },
+ setglobal: function (cm, params) {
+ // setCfg is passed through to setOption
+ params.setCfg = {scope: 'global'};
+ this.set(cm, params);
+ },
+ registers: function(cm, params) {
+ var regArgs = params.args;
+ var registers = vimGlobalState.registerController.registers;
+ var regInfo = '----------Registers----------
';
+ if (!regArgs) {
+ for (var registerName in registers) {
+ var text = registers[registerName].toString();
+ if (text.length) {
+ regInfo += '"' + registerName + ' ' + text + ' ';
+ }
+ }
+ } else {
+ var registerName;
+ regArgs = regArgs.join('');
+ for (var i = 0; i < regArgs.length; i++) {
+ registerName = regArgs.charAt(i);
+ if (!vimGlobalState.registerController.isValidRegister(registerName)) {
+ continue;
+ }
+ var register = registers[registerName] || new Register();
+ regInfo += '"' + registerName + ' ' + register.toString() + ' ';
+ }
+ }
+ showConfirm(cm, regInfo);
+ },
+ sort: function(cm, params) {
+ var reverse, ignoreCase, unique, number, pattern;
+ function parseArgs() {
+ if (params.argString) {
+ var args = new CodeMirror.StringStream(params.argString);
+ if (args.eat('!')) { reverse = true; }
+ if (args.eol()) { return; }
+ if (!args.eatSpace()) { return 'Invalid arguments'; }
+ var opts = args.match(/([dinuox]+)?\s*(\/.+\/)?\s*/);
+ if (!opts && !args.eol()) { return 'Invalid arguments'; }
+ if (opts[1]) {
+ ignoreCase = opts[1].indexOf('i') != -1;
+ unique = opts[1].indexOf('u') != -1;
+ var decimal = opts[1].indexOf('d') != -1 || opts[1].indexOf('n') != -1 && 1;
+ var hex = opts[1].indexOf('x') != -1 && 1;
+ var octal = opts[1].indexOf('o') != -1 && 1;
+ if (decimal + hex + octal > 1) { return 'Invalid arguments'; }
+ number = decimal && 'decimal' || hex && 'hex' || octal && 'octal';
+ }
+ if (opts[2]) {
+ pattern = new RegExp(opts[2].substr(1, opts[2].length - 2), ignoreCase ? 'i' : '');
+ }
+ }
+ }
+ var err = parseArgs();
+ if (err) {
+ showConfirm(cm, err + ': ' + params.argString);
+ return;
+ }
+ var lineStart = params.line || cm.firstLine();
+ var lineEnd = params.lineEnd || params.line || cm.lastLine();
+ if (lineStart == lineEnd) { return; }
+ var curStart = Pos(lineStart, 0);
+ var curEnd = Pos(lineEnd, lineLength(cm, lineEnd));
+ var text = cm.getRange(curStart, curEnd).split('\n');
+ var numberRegex = pattern ? pattern :
+ (number == 'decimal') ? /(-?)([\d]+)/ :
+ (number == 'hex') ? /(-?)(?:0x)?([0-9a-f]+)/i :
+ (number == 'octal') ? /([0-7]+)/ : null;
+ var radix = (number == 'decimal') ? 10 : (number == 'hex') ? 16 : (number == 'octal') ? 8 : null;
+ var numPart = [], textPart = [];
+ if (number || pattern) {
+ for (var i = 0; i < text.length; i++) {
+ var matchPart = pattern ? text[i].match(pattern) : null;
+ if (matchPart && matchPart[0] != '') {
+ numPart.push(matchPart);
+ } else if (!pattern && numberRegex.exec(text[i])) {
+ numPart.push(text[i]);
+ } else {
+ textPart.push(text[i]);
+ }
+ }
+ } else {
+ textPart = text;
+ }
+ function compareFn(a, b) {
+ if (reverse) { var tmp; tmp = a; a = b; b = tmp; }
+ if (ignoreCase) { a = a.toLowerCase(); b = b.toLowerCase(); }
+ var anum = number && numberRegex.exec(a);
+ var bnum = number && numberRegex.exec(b);
+ if (!anum) { return a < b ? -1 : 1; }
+ anum = parseInt((anum[1] + anum[2]).toLowerCase(), radix);
+ bnum = parseInt((bnum[1] + bnum[2]).toLowerCase(), radix);
+ return anum - bnum;
+ }
+ function comparePatternFn(a, b) {
+ if (reverse) { var tmp; tmp = a; a = b; b = tmp; }
+ if (ignoreCase) { a[0] = a[0].toLowerCase(); b[0] = b[0].toLowerCase(); }
+ return (a[0] < b[0]) ? -1 : 1;
+ }
+ numPart.sort(pattern ? comparePatternFn : compareFn);
+ if (pattern) {
+ for (var i = 0; i < numPart.length; i++) {
+ numPart[i] = numPart[i].input;
+ }
+ } else if (!number) { textPart.sort(compareFn); }
+ text = (!reverse) ? textPart.concat(numPart) : numPart.concat(textPart);
+ if (unique) { // Remove duplicate lines
+ var textOld = text;
+ var lastLine;
+ text = [];
+ for (var i = 0; i < textOld.length; i++) {
+ if (textOld[i] != lastLine) {
+ text.push(textOld[i]);
+ }
+ lastLine = textOld[i];
+ }
+ }
+ cm.replaceRange(text.join('\n'), curStart, curEnd);
+ },
+ global: function(cm, params) {
+ // a global command is of the form
+ // :[range]g/pattern/[cmd]
+ // argString holds the string /pattern/[cmd]
+ var argString = params.argString;
+ if (!argString) {
+ showConfirm(cm, 'Regular Expression missing from global');
+ return;
+ }
+ // range is specified here
+ var lineStart = (params.line !== undefined) ? params.line : cm.firstLine();
+ var lineEnd = params.lineEnd || params.line || cm.lastLine();
+ // get the tokens from argString
+ var tokens = splitBySlash(argString);
+ var regexPart = argString, cmd;
+ if (tokens.length) {
+ regexPart = tokens[0];
+ cmd = tokens.slice(1, tokens.length).join('/');
+ }
+ if (regexPart) {
+ // If regex part is empty, then use the previous query. Otherwise
+ // use the regex part as the new query.
+ try {
+ updateSearchQuery(cm, regexPart, true /** ignoreCase */,
+ true /** smartCase */);
+ } catch (e) {
+ showConfirm(cm, 'Invalid regex: ' + regexPart);
+ return;
+ }
+ }
+ // now that we have the regexPart, search for regex matches in the
+ // specified range of lines
+ var query = getSearchState(cm).getQuery();
+ var matchedLines = [], content = '';
+ for (var i = lineStart; i <= lineEnd; i++) {
+ var matched = query.test(cm.getLine(i));
+ if (matched) {
+ matchedLines.push(i+1);
+ content+= cm.getLine(i) + ' ';
+ }
+ }
+ // if there is no [cmd], just display the list of matched lines
+ if (!cmd) {
+ showConfirm(cm, content);
+ return;
+ }
+ var index = 0;
+ var nextCommand = function() {
+ if (index < matchedLines.length) {
+ var command = matchedLines[index] + cmd;
+ exCommandDispatcher.processCommand(cm, command, {
+ callback: nextCommand
+ });
+ }
+ index++;
+ };
+ nextCommand();
+ },
+ substitute: function(cm, params) {
+ if (!cm.getSearchCursor) {
+ throw new Error('Search feature not available. Requires searchcursor.js or ' +
+ 'any other getSearchCursor implementation.');
+ }
+ var argString = params.argString;
+ var tokens = argString ? splitBySeparator(argString, argString[0]) : [];
+ var regexPart, replacePart = '', trailing, flagsPart, count;
+ var confirm = false; // Whether to confirm each replace.
+ var global = false; // True to replace all instances on a line, false to replace only 1.
+ if (tokens.length) {
+ regexPart = tokens[0];
+ if (getOption('pcre') && regexPart !== '') {
+ regexPart = new RegExp(regexPart).source; // normalize not escaped characters
+ }
+ replacePart = tokens[1];
+ if (regexPart && regexPart[regexPart.length - 1] === '$') {
+ regexPart = regexPart.slice(0, regexPart.length - 1) + '\\n';
+ replacePart = replacePart ? replacePart + '\n' : '\n';
+ }
+ if (replacePart !== undefined) {
+ if (getOption('pcre')) {
+ replacePart = unescapeRegexReplace(replacePart.replace(/([^\\])&/g,"$1$$&"));
+ } else {
+ replacePart = translateRegexReplace(replacePart);
+ }
+ vimGlobalState.lastSubstituteReplacePart = replacePart;
+ }
+ trailing = tokens[2] ? tokens[2].split(' ') : [];
+ } else {
+ // either the argString is empty or its of the form ' hello/world'
+ // actually splitBySlash returns a list of tokens
+ // only if the string starts with a '/'
+ if (argString && argString.length) {
+ showConfirm(cm, 'Substitutions should be of the form ' +
+ ':s/pattern/replace/');
+ return;
+ }
+ }
+ // After the 3rd slash, we can have flags followed by a space followed
+ // by count.
+ if (trailing) {
+ flagsPart = trailing[0];
+ count = parseInt(trailing[1]);
+ if (flagsPart) {
+ if (flagsPart.indexOf('c') != -1) {
+ confirm = true;
+ flagsPart.replace('c', '');
+ }
+ if (flagsPart.indexOf('g') != -1) {
+ global = true;
+ flagsPart.replace('g', '');
+ }
+ if (getOption('pcre')) {
+ regexPart = regexPart + '/' + flagsPart;
+ } else {
+ regexPart = regexPart.replace(/\// g, "\\/") + '/' + flagsPart;
+ }
+ }
+ }
+ if (regexPart) {
+ // If regex part is empty, then use the previous query. Otherwise use
+ // the regex part as the new query.
+ try {
+ updateSearchQuery(cm, regexPart, true /** ignoreCase */,
+ true /** smartCase */);
+ } catch (e) {
+ showConfirm(cm, 'Invalid regex: ' + regexPart);
+ return;
+ }
+ }
+ replacePart = replacePart || vimGlobalState.lastSubstituteReplacePart;
+ if (replacePart === undefined) {
+ showConfirm(cm, 'No previous substitute regular expression');
+ return;
+ }
+ var state = getSearchState(cm);
+ var query = state.getQuery();
+ var lineStart = (params.line !== undefined) ? params.line : cm.getCursor().line;
+ var lineEnd = params.lineEnd || lineStart;
+ if (lineStart == cm.firstLine() && lineEnd == cm.lastLine()) {
+ lineEnd = Infinity;
+ }
+ if (count) {
+ lineStart = lineEnd;
+ lineEnd = lineStart + count - 1;
+ }
+ var startPos = clipCursorToContent(cm, Pos(lineStart, 0));
+ var cursor = cm.getSearchCursor(query, startPos);
+ doReplace(cm, confirm, global, lineStart, lineEnd, cursor, query, replacePart, params.callback);
+ },
+ redo: CodeMirror.commands.redo,
+ undo: CodeMirror.commands.undo,
+ write: function(cm) {
+ if (CodeMirror.commands.save) {
+ // If a save command is defined, call it.
+ CodeMirror.commands.save(cm);
+ } else if (cm.save) {
+ // Saves to text area if no save command is defined and cm.save() is available.
+ cm.save();
+ }
+ },
+ nohlsearch: function(cm) {
+ clearSearchHighlight(cm);
+ },
+ yank: function (cm) {
+ var cur = copyCursor(cm.getCursor());
+ var line = cur.line;
+ var lineText = cm.getLine(line);
+ vimGlobalState.registerController.pushText(
+ '0', 'yank', lineText, true, true);
+ },
+ delmarks: function(cm, params) {
+ if (!params.argString || !trim(params.argString)) {
+ showConfirm(cm, 'Argument required');
+ return;
+ }
+
+ var state = cm.state.vim;
+ var stream = new CodeMirror.StringStream(trim(params.argString));
+ while (!stream.eol()) {
+ stream.eatSpace();
+
+ // Record the streams position at the beginning of the loop for use
+ // in error messages.
+ var count = stream.pos;
+
+ if (!stream.match(/[a-zA-Z]/, false)) {
+ showConfirm(cm, 'Invalid argument: ' + params.argString.substring(count));
+ return;
+ }
+
+ var sym = stream.next();
+ // Check if this symbol is part of a range
+ if (stream.match('-', true)) {
+ // This symbol is part of a range.
+
+ // The range must terminate at an alphabetic character.
+ if (!stream.match(/[a-zA-Z]/, false)) {
+ showConfirm(cm, 'Invalid argument: ' + params.argString.substring(count));
+ return;
+ }
+
+ var startMark = sym;
+ var finishMark = stream.next();
+ // The range must terminate at an alphabetic character which
+ // shares the same case as the start of the range.
+ if (isLowerCase(startMark) && isLowerCase(finishMark) ||
+ isUpperCase(startMark) && isUpperCase(finishMark)) {
+ var start = startMark.charCodeAt(0);
+ var finish = finishMark.charCodeAt(0);
+ if (start >= finish) {
+ showConfirm(cm, 'Invalid argument: ' + params.argString.substring(count));
+ return;
+ }
+
+ // Because marks are always ASCII values, and we have
+ // determined that they are the same case, we can use
+ // their char codes to iterate through the defined range.
+ for (var j = 0; j <= finish - start; j++) {
+ var mark = String.fromCharCode(start + j);
+ delete state.marks[mark];
+ }
+ } else {
+ showConfirm(cm, 'Invalid argument: ' + startMark + '-');
+ return;
+ }
+ } else {
+ // This symbol is a valid mark, and is not part of a range.
+ delete state.marks[sym];
+ }
+ }
+ }
+ };
+
+ var exCommandDispatcher = new ExCommandDispatcher();
+
+ /**
+ * @param {CodeMirror} cm CodeMirror instance we are in.
+ * @param {boolean} confirm Whether to confirm each replace.
+ * @param {Cursor} lineStart Line to start replacing from.
+ * @param {Cursor} lineEnd Line to stop replacing at.
+ * @param {RegExp} query Query for performing matches with.
+ * @param {string} replaceWith Text to replace matches with. May contain $1,
+ * $2, etc for replacing captured groups using Javascript replace.
+ * @param {function()} callback A callback for when the replace is done.
+ */
+ function doReplace(cm, confirm, global, lineStart, lineEnd, searchCursor, query,
+ replaceWith, callback) {
+ // Set up all the functions.
+ cm.state.vim.exMode = true;
+ var done = false;
+ var lastPos = searchCursor.from();
+ function replaceAll() {
+ cm.operation(function() {
+ while (!done) {
+ replace();
+ next();
+ }
+ stop();
+ });
+ }
+ function replace() {
+ var text = cm.getRange(searchCursor.from(), searchCursor.to());
+ var newText = text.replace(query, replaceWith);
+ searchCursor.replace(newText);
+ }
+ function next() {
+ // The below only loops to skip over multiple occurrences on the same
+ // line when 'global' is not true.
+ while(searchCursor.findNext() &&
+ isInRange(searchCursor.from(), lineStart, lineEnd)) {
+ if (!global && lastPos && searchCursor.from().line == lastPos.line) {
+ continue;
+ }
+ cm.scrollIntoView(searchCursor.from(), 30);
+ cm.setSelection(searchCursor.from(), searchCursor.to());
+ lastPos = searchCursor.from();
+ done = false;
+ return;
+ }
+ done = true;
+ }
+ function stop(close) {
+ if (close) { close(); }
+ cm.focus();
+ if (lastPos) {
+ cm.setCursor(lastPos);
+ var vim = cm.state.vim;
+ vim.exMode = false;
+ vim.lastHPos = vim.lastHSPos = lastPos.ch;
+ }
+ if (callback) { callback(); }
+ }
+ function onPromptKeyDown(e, _value, close) {
+ // Swallow all keys.
+ CodeMirror.e_stop(e);
+ var keyName = CodeMirror.keyName(e);
+ switch (keyName) {
+ case 'Y':
+ replace(); next(); break;
+ case 'N':
+ next(); break;
+ case 'A':
+ // replaceAll contains a call to close of its own. We don't want it
+ // to fire too early or multiple times.
+ var savedCallback = callback;
+ callback = undefined;
+ cm.operation(replaceAll);
+ callback = savedCallback;
+ break;
+ case 'L':
+ replace();
+ // fall through and exit.
+ case 'Q':
+ case 'Esc':
+ case 'Ctrl-C':
+ case 'Ctrl-[':
+ stop(close);
+ break;
+ }
+ if (done) { stop(close); }
+ return true;
+ }
+
+ // Actually do replace.
+ next();
+ if (done) {
+ showConfirm(cm, 'No matches for ' + query.source);
+ return;
+ }
+ if (!confirm) {
+ replaceAll();
+ if (callback) { callback(); }
+ return;
+ }
+ showPrompt(cm, {
+ prefix: 'replace with ' + replaceWith + ' (y/n/a/q/l)',
+ onKeyDown: onPromptKeyDown
+ });
+ }
+
+ CodeMirror.keyMap.vim = {
+ attach: attachVimMap,
+ detach: detachVimMap,
+ call: cmKey
+ };
+
+ function exitInsertMode(cm) {
+ var vim = cm.state.vim;
+ var macroModeState = vimGlobalState.macroModeState;
+ var insertModeChangeRegister = vimGlobalState.registerController.getRegister('.');
+ var isPlaying = macroModeState.isPlaying;
+ var lastChange = macroModeState.lastInsertModeChanges;
+ if (!isPlaying) {
+ cm.off('change', onChange);
+ CodeMirror.off(cm.getInputField(), 'keydown', onKeyEventTargetKeyDown);
+ }
+ if (!isPlaying && vim.insertModeRepeat > 1) {
+ // Perform insert mode repeat for commands like 3,a and 3,o.
+ repeatLastEdit(cm, vim, vim.insertModeRepeat - 1,
+ true /** repeatForInsert */);
+ vim.lastEditInputState.repeatOverride = vim.insertModeRepeat;
+ }
+ delete vim.insertModeRepeat;
+ vim.insertMode = false;
+ cm.setCursor(cm.getCursor().line, cm.getCursor().ch-1);
+ cm.setOption('keyMap', 'vim');
+ cm.setOption('disableInput', true);
+ cm.toggleOverwrite(false); // exit replace mode if we were in it.
+ // update the ". register before exiting insert mode
+ insertModeChangeRegister.setText(lastChange.changes.join(''));
+ CodeMirror.signal(cm, "vim-mode-change", {mode: "normal"});
+ if (macroModeState.isRecording) {
+ logInsertModeChange(macroModeState);
+ }
+ }
+
+ function _mapCommand(command) {
+ defaultKeymap.unshift(command);
+ }
+
+ function mapCommand(keys, type, name, args, extra) {
+ var command = {keys: keys, type: type};
+ command[type] = name;
+ command[type + "Args"] = args;
+ for (var key in extra)
+ command[key] = extra[key];
+ _mapCommand(command);
+ }
+
+ // The timeout in milliseconds for the two-character ESC keymap should be
+ // adjusted according to your typing speed to prevent false positives.
+ defineOption('insertModeEscKeysTimeout', 200, 'number');
+
+ CodeMirror.keyMap['vim-insert'] = {
+ // TODO: override navigation keys so that Esc will cancel automatic
+ // indentation from o, O, i_
+ fallthrough: ['default'],
+ attach: attachVimMap,
+ detach: detachVimMap,
+ call: cmKey
+ };
+
+ CodeMirror.keyMap['vim-replace'] = {
+ 'Backspace': 'goCharLeft',
+ fallthrough: ['vim-insert'],
+ attach: attachVimMap,
+ detach: detachVimMap,
+ call: cmKey
+ };
+
+ function executeMacroRegister(cm, vim, macroModeState, registerName) {
+ var register = vimGlobalState.registerController.getRegister(registerName);
+ if (registerName == ':') {
+ // Read-only register containing last Ex command.
+ if (register.keyBuffer[0]) {
+ exCommandDispatcher.processCommand(cm, register.keyBuffer[0]);
+ }
+ macroModeState.isPlaying = false;
+ return;
+ }
+ var keyBuffer = register.keyBuffer;
+ var imc = 0;
+ macroModeState.isPlaying = true;
+ macroModeState.replaySearchQueries = register.searchQueries.slice(0);
+ for (var i = 0; i < keyBuffer.length; i++) {
+ var text = keyBuffer[i];
+ var match, key;
+ while (text) {
+ // Pull off one command key, which is either a single character
+ // or a special sequence wrapped in '<' and '>', e.g. ''.
+ match = (/<\w+-.+?>|<\w+>|./).exec(text);
+ key = match[0];
+ text = text.substring(match.index + key.length);
+ CodeMirror.Vim.handleKey(cm, key, 'macro');
+ if (vim.insertMode) {
+ var changes = register.insertModeChanges[imc++].changes;
+ vimGlobalState.macroModeState.lastInsertModeChanges.changes =
+ changes;
+ repeatInsertModeChanges(cm, changes, 1);
+ exitInsertMode(cm);
+ }
+ }
+ }
+ macroModeState.isPlaying = false;
+ }
+
+ function logKey(macroModeState, key) {
+ if (macroModeState.isPlaying) { return; }
+ var registerName = macroModeState.latestRegister;
+ var register = vimGlobalState.registerController.getRegister(registerName);
+ if (register) {
+ register.pushText(key);
+ }
+ }
+
+ function logInsertModeChange(macroModeState) {
+ if (macroModeState.isPlaying) { return; }
+ var registerName = macroModeState.latestRegister;
+ var register = vimGlobalState.registerController.getRegister(registerName);
+ if (register && register.pushInsertModeChanges) {
+ register.pushInsertModeChanges(macroModeState.lastInsertModeChanges);
+ }
+ }
+
+ function logSearchQuery(macroModeState, query) {
+ if (macroModeState.isPlaying) { return; }
+ var registerName = macroModeState.latestRegister;
+ var register = vimGlobalState.registerController.getRegister(registerName);
+ if (register && register.pushSearchQuery) {
+ register.pushSearchQuery(query);
+ }
+ }
+
+ /**
+ * Listens for changes made in insert mode.
+ * Should only be active in insert mode.
+ */
+ function onChange(cm, changeObj) {
+ var macroModeState = vimGlobalState.macroModeState;
+ var lastChange = macroModeState.lastInsertModeChanges;
+ if (!macroModeState.isPlaying) {
+ while(changeObj) {
+ lastChange.expectCursorActivityForChange = true;
+ if (lastChange.ignoreCount > 1) {
+ lastChange.ignoreCount--;
+ } else if (changeObj.origin == '+input' || changeObj.origin == 'paste'
+ || changeObj.origin === undefined /* only in testing */) {
+ var selectionCount = cm.listSelections().length;
+ if (selectionCount > 1)
+ lastChange.ignoreCount = selectionCount;
+ var text = changeObj.text.join('\n');
+ if (lastChange.maybeReset) {
+ lastChange.changes = [];
+ lastChange.maybeReset = false;
+ }
+ if (text) {
+ if (cm.state.overwrite && !/\n/.test(text)) {
+ lastChange.changes.push([text]);
+ } else {
+ lastChange.changes.push(text);
+ }
+ }
+ }
+ // Change objects may be chained with next.
+ changeObj = changeObj.next;
+ }
+ }
+ }
+
+ /**
+ * Listens for any kind of cursor activity on CodeMirror.
+ */
+ function onCursorActivity(cm) {
+ var vim = cm.state.vim;
+ if (vim.insertMode) {
+ // Tracking cursor activity in insert mode (for macro support).
+ var macroModeState = vimGlobalState.macroModeState;
+ if (macroModeState.isPlaying) { return; }
+ var lastChange = macroModeState.lastInsertModeChanges;
+ if (lastChange.expectCursorActivityForChange) {
+ lastChange.expectCursorActivityForChange = false;
+ } else {
+ // Cursor moved outside the context of an edit. Reset the change.
+ lastChange.maybeReset = true;
+ }
+ } else if (!cm.curOp.isVimOp) {
+ handleExternalSelection(cm, vim);
+ }
+ if (vim.visualMode) {
+ updateFakeCursor(cm);
+ }
+ }
+ /**
+ * Keeps track of a fake cursor to support visual mode cursor behavior.
+ */
+ function updateFakeCursor(cm) {
+ var className = 'cm-animate-fat-cursor';
+ var vim = cm.state.vim;
+ var from = clipCursorToContent(cm, copyCursor(vim.sel.head));
+ var to = offsetCursor(from, 0, 1);
+ clearFakeCursor(vim);
+ // In visual mode, the cursor may be positioned over EOL.
+ if (from.ch == cm.getLine(from.line).length) {
+ var widget = document.createElement("span");
+ widget.textContent = "\u00a0";
+ widget.className = className;
+ vim.fakeCursorBookmark = cm.setBookmark(from, {widget: widget});
+ } else {
+ vim.fakeCursor = cm.markText(from, to, {className: className});
+ }
+ }
+ function clearFakeCursor(vim) {
+ if (vim.fakeCursor) {
+ vim.fakeCursor.clear();
+ vim.fakeCursor = null;
+ }
+ if (vim.fakeCursorBookmark) {
+ vim.fakeCursorBookmark.clear();
+ vim.fakeCursorBookmark = null;
+ }
+ }
+ function handleExternalSelection(cm, vim) {
+ var anchor = cm.getCursor('anchor');
+ var head = cm.getCursor('head');
+ // Enter or exit visual mode to match mouse selection.
+ if (vim.visualMode && !cm.somethingSelected()) {
+ exitVisualMode(cm, false);
+ } else if (!vim.visualMode && !vim.insertMode && cm.somethingSelected()) {
+ vim.visualMode = true;
+ vim.visualLine = false;
+ CodeMirror.signal(cm, "vim-mode-change", {mode: "visual"});
+ }
+ if (vim.visualMode) {
+ // Bind CodeMirror selection model to vim selection model.
+ // Mouse selections are considered visual characterwise.
+ var headOffset = !cursorIsBefore(head, anchor) ? -1 : 0;
+ var anchorOffset = cursorIsBefore(head, anchor) ? -1 : 0;
+ head = offsetCursor(head, 0, headOffset);
+ anchor = offsetCursor(anchor, 0, anchorOffset);
+ vim.sel = {
+ anchor: anchor,
+ head: head
+ };
+ updateMark(cm, vim, '<', cursorMin(head, anchor));
+ updateMark(cm, vim, '>', cursorMax(head, anchor));
+ } else if (!vim.insertMode) {
+ // Reset lastHPos if selection was modified by something outside of vim mode e.g. by mouse.
+ vim.lastHPos = cm.getCursor().ch;
+ }
+ }
+
+ /** Wrapper for special keys pressed in insert mode */
+ function InsertModeKey(keyName) {
+ this.keyName = keyName;
+ }
+
+ /**
+ * Handles raw key down events from the text area.
+ * - Should only be active in insert mode.
+ * - For recording deletes in insert mode.
+ */
+ function onKeyEventTargetKeyDown(e) {
+ var macroModeState = vimGlobalState.macroModeState;
+ var lastChange = macroModeState.lastInsertModeChanges;
+ var keyName = CodeMirror.keyName(e);
+ if (!keyName) { return; }
+ function onKeyFound() {
+ if (lastChange.maybeReset) {
+ lastChange.changes = [];
+ lastChange.maybeReset = false;
+ }
+ lastChange.changes.push(new InsertModeKey(keyName));
+ return true;
+ }
+ if (keyName.indexOf('Delete') != -1 || keyName.indexOf('Backspace') != -1) {
+ CodeMirror.lookupKey(keyName, 'vim-insert', onKeyFound);
+ }
+ }
+
+ /**
+ * Repeats the last edit, which includes exactly 1 command and at most 1
+ * insert. Operator and motion commands are read from lastEditInputState,
+ * while action commands are read from lastEditActionCommand.
+ *
+ * If repeatForInsert is true, then the function was called by
+ * exitInsertMode to repeat the insert mode changes the user just made. The
+ * corresponding enterInsertMode call was made with a count.
+ */
+ function repeatLastEdit(cm, vim, repeat, repeatForInsert) {
+ var macroModeState = vimGlobalState.macroModeState;
+ macroModeState.isPlaying = true;
+ var isAction = !!vim.lastEditActionCommand;
+ var cachedInputState = vim.inputState;
+ function repeatCommand() {
+ if (isAction) {
+ commandDispatcher.processAction(cm, vim, vim.lastEditActionCommand);
+ } else {
+ commandDispatcher.evalInput(cm, vim);
+ }
+ }
+ function repeatInsert(repeat) {
+ if (macroModeState.lastInsertModeChanges.changes.length > 0) {
+ // For some reason, repeat cw in desktop VIM does not repeat
+ // insert mode changes. Will conform to that behavior.
+ repeat = !vim.lastEditActionCommand ? 1 : repeat;
+ var changeObject = macroModeState.lastInsertModeChanges;
+ repeatInsertModeChanges(cm, changeObject.changes, repeat);
+ }
+ }
+ vim.inputState = vim.lastEditInputState;
+ if (isAction && vim.lastEditActionCommand.interlaceInsertRepeat) {
+ // o and O repeat have to be interlaced with insert repeats so that the
+ // insertions appear on separate lines instead of the last line.
+ for (var i = 0; i < repeat; i++) {
+ repeatCommand();
+ repeatInsert(1);
+ }
+ } else {
+ if (!repeatForInsert) {
+ // Hack to get the cursor to end up at the right place. If I is
+ // repeated in insert mode repeat, cursor will be 1 insert
+ // change set left of where it should be.
+ repeatCommand();
+ }
+ repeatInsert(repeat);
+ }
+ vim.inputState = cachedInputState;
+ if (vim.insertMode && !repeatForInsert) {
+ // Don't exit insert mode twice. If repeatForInsert is set, then we
+ // were called by an exitInsertMode call lower on the stack.
+ exitInsertMode(cm);
+ }
+ macroModeState.isPlaying = false;
+ }
+
+ function repeatInsertModeChanges(cm, changes, repeat) {
+ function keyHandler(binding) {
+ if (typeof binding == 'string') {
+ CodeMirror.commands[binding](cm);
+ } else {
+ binding(cm);
+ }
+ return true;
+ }
+ var head = cm.getCursor('head');
+ var visualBlock = vimGlobalState.macroModeState.lastInsertModeChanges.visualBlock;
+ if (visualBlock) {
+ // Set up block selection again for repeating the changes.
+ selectForInsert(cm, head, visualBlock + 1);
+ repeat = cm.listSelections().length;
+ cm.setCursor(head);
+ }
+ for (var i = 0; i < repeat; i++) {
+ if (visualBlock) {
+ cm.setCursor(offsetCursor(head, i, 0));
+ }
+ for (var j = 0; j < changes.length; j++) {
+ var change = changes[j];
+ if (change instanceof InsertModeKey) {
+ CodeMirror.lookupKey(change.keyName, 'vim-insert', keyHandler);
+ } else if (typeof change == "string") {
+ var cur = cm.getCursor();
+ cm.replaceRange(change, cur, cur);
+ } else {
+ var start = cm.getCursor();
+ var end = offsetCursor(start, 0, change[0].length);
+ cm.replaceRange(change[0], start, end);
+ }
+ }
+ }
+ if (visualBlock) {
+ cm.setCursor(offsetCursor(head, 0, 1));
+ }
+ }
+
+ resetVimGlobalState();
+ return vimApi;
+ };
+ // Initialize Vim and make it available as an API.
+ CodeMirror.Vim = Vim();
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/lib/codemirror.css b/modules/cookiesplus/lib/CodeMirror/lib/codemirror.css
new file mode 100644
index 00000000..ebc36c06
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/lib/codemirror.css
@@ -0,0 +1,364 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+/* BASICS */
+.CodeMirror {
+ /* Set height, width, borders, and global font properties here */
+ font-family: monospace;
+ height: 300px;
+ color: black;
+ direction: ltr;
+}
+
+/* PADDING */
+.CodeMirror-lines {
+ padding: 4px 0; /* Vertical padding around content */
+}
+.CodeMirror pre.CodeMirror-line,
+.CodeMirror pre.CodeMirror-line-like {
+ padding: 0 4px; /* Horizontal padding of content */
+}
+
+.CodeMirror-scrollbar-filler, .CodeMirror-gutter-filler {
+ background-color: white; /* The little square between H and V scrollbars */
+}
+
+/* GUTTER */
+.CodeMirror-gutters {
+ border-right: 1px solid #ddd;
+ background-color: #f7f7f7;
+ white-space: nowrap;
+}
+.CodeMirror-linenumbers {}
+.CodeMirror-linenumber {
+ padding: 0 3px 0 5px;
+ min-width: 20px;
+ text-align: right;
+ color: #999;
+ white-space: nowrap;
+}
+
+.CodeMirror-guttermarker { color: black; }
+.CodeMirror-guttermarker-subtle { color: #999; }
+
+/* CURSOR */
+.CodeMirror-cursor {
+ border-left: 1px solid black;
+ border-right: none;
+ width: 0;
+}
+/* Shown when moving in bi-directional text */
+.CodeMirror div.CodeMirror-secondarycursor {
+ border-left: 1px solid silver;
+}
+.cm-fat-cursor .CodeMirror-cursor {
+ width: auto;
+ border: 0 !important;
+ background: #7e7;
+}
+.cm-fat-cursor div.CodeMirror-cursors {
+ z-index: 1;
+}
+.cm-fat-cursor-mark {
+ background-color: rgba(20, 255, 20, 0.5);
+ -webkit-animation: blink 1.06s steps(1) infinite;
+ -moz-animation: blink 1.06s steps(1) infinite;
+ animation: blink 1.06s steps(1) infinite;
+}
+.cm-animate-fat-cursor {
+ width: auto;
+ border: 0;
+ -webkit-animation: blink 1.06s steps(1) infinite;
+ -moz-animation: blink 1.06s steps(1) infinite;
+ animation: blink 1.06s steps(1) infinite;
+ background-color: #7e7;
+}
+@-moz-keyframes blink {
+ 0% {}
+ 50% { background-color: transparent; }
+ 100% {}
+}
+@-webkit-keyframes blink {
+ 0% {}
+ 50% { background-color: transparent; }
+ 100% {}
+}
+@keyframes blink {
+ 0% {}
+ 50% { background-color: transparent; }
+ 100% {}
+}
+
+/* Can style cursor different in overwrite (non-insert) mode */
+.CodeMirror-overwrite .CodeMirror-cursor {}
+
+.cm-tab { display: inline-block; text-decoration: inherit; }
+
+.CodeMirror-rulers {
+ position: absolute;
+ left: 0; right: 0; top: -50px; bottom: 0;
+ overflow: hidden;
+}
+.CodeMirror-ruler {
+ border-left: 1px solid #ccc;
+ top: 0; bottom: 0;
+ position: absolute;
+}
+
+/* DEFAULT THEME */
+.cm-s-default .cm-header {color: blue;}
+.cm-s-default .cm-quote {color: #090;}
+.cm-negative {color: #d44;}
+.cm-positive {color: #292;}
+.cm-header, .cm-strong {font-weight: bold;}
+.cm-em {font-style: italic;}
+.cm-link {text-decoration: underline;}
+.cm-strikethrough {text-decoration: line-through;}
+
+.cm-s-default .cm-keyword {color: #708;}
+.cm-s-default .cm-atom {color: #219;}
+.cm-s-default .cm-number {color: #164;}
+.cm-s-default .cm-def {color: #00f;}
+.cm-s-default .cm-variable,
+.cm-s-default .cm-punctuation,
+.cm-s-default .cm-property,
+.cm-s-default .cm-operator {}
+.cm-s-default .cm-variable-2 {color: #05a;}
+.cm-s-default .cm-variable-3, .cm-s-default .cm-type {color: #085;}
+.cm-s-default .cm-comment {color: #a50;}
+.cm-s-default .cm-string {color: #a11;}
+.cm-s-default .cm-string-2 {color: #f50;}
+.cm-s-default .cm-meta {color: #555;}
+.cm-s-default .cm-qualifier {color: #555;}
+.cm-s-default .cm-builtin {color: #30a;}
+.cm-s-default .cm-bracket {color: #997;}
+.cm-s-default .cm-tag {color: #170;}
+.cm-s-default .cm-attribute {color: #00c;}
+.cm-s-default .cm-hr {color: #999;}
+.cm-s-default .cm-link {color: #00c;}
+
+.cm-s-default .cm-error {color: #f00;}
+.cm-invalidchar {color: #f00;}
+
+.CodeMirror-composing { border-bottom: 2px solid; }
+
+/* Default styles for common addons */
+div.CodeMirror span.CodeMirror-matchingbracket {color: #0b0;}
+div.CodeMirror span.CodeMirror-nonmatchingbracket {color: #a22;}
+.CodeMirror-matchingtag { background: rgba(255, 150, 0, .3); }
+.CodeMirror-activeline-background {background: #e8f2ff;}
+
+/* STOP */
+/* The rest of this file contains styles related to the mechanics of
+ the editor. You probably shouldn't touch them. */
+.CodeMirror {
+ position: relative;
+ overflow: hidden;
+ background: white;
+}
+
+.CodeMirror-scroll {
+ overflow: scroll !important; /* Things will break if this is overridden */
+ /* 50px is the magic margin used to hide the element's real scrollbars */
+ /* See overflow: hidden in .CodeMirror */
+ margin-bottom: -50px; margin-right: -50px;
+ padding-bottom: 50px;
+ height: 100%;
+ outline: none; /* Prevent dragging from highlighting the element */
+ position: relative;
+}
+.CodeMirror-sizer {
+ position: relative;
+ border-right: 50px solid transparent;
+}
+
+/* The fake, visible scrollbars. Used to force redraw during scrolling
+ before actual scrolling happens, thus preventing shaking and
+ flickering artifacts. */
+.CodeMirror-vscrollbar, .CodeMirror-hscrollbar, .CodeMirror-scrollbar-filler, .CodeMirror-gutter-filler {
+ position: absolute;
+ z-index: 6;
+ display: none;
+}
+.CodeMirror-vscrollbar {
+ right: 0; top: 0;
+ overflow-x: hidden;
+ overflow-y: scroll;
+}
+.CodeMirror-hscrollbar {
+ bottom: 0; left: 0;
+ overflow-y: hidden;
+ overflow-x: scroll;
+}
+.CodeMirror-scrollbar-filler {
+ right: 0; bottom: 0;
+}
+.CodeMirror-gutter-filler {
+ left: 0; bottom: 0;
+}
+
+.CodeMirror-gutters {
+ position: absolute; left: 0; top: 0;
+ min-height: 100%;
+ z-index: 3;
+}
+.CodeMirror-gutter {
+ white-space: normal;
+ height: 100%;
+ display: inline-block;
+ vertical-align: top;
+ margin-bottom: -50px;
+}
+.CodeMirror-gutter-wrapper {
+ position: absolute;
+ z-index: 4;
+ background: none !important;
+ border: none !important;
+}
+.CodeMirror-gutter-background {
+ position: absolute;
+ top: 0; bottom: 0;
+ z-index: 4;
+}
+.CodeMirror-gutter-elt {
+ position: absolute;
+ cursor: default;
+ z-index: 4;
+}
+.CodeMirror-gutter-wrapper ::selection { background-color: transparent }
+.CodeMirror-gutter-wrapper ::-moz-selection { background-color: transparent }
+
+.CodeMirror-lines {
+ cursor: text;
+ min-height: 1px; /* prevents collapsing before first draw */
+}
+.CodeMirror pre.CodeMirror-line,
+.CodeMirror pre.CodeMirror-line-like {
+ /* Reset some styles that the rest of the page might have set */
+ -moz-border-radius: 0; -webkit-border-radius: 0; border-radius: 0;
+ border-width: 0;
+ background: transparent;
+ font-family: inherit;
+ font-size: inherit;
+ margin: 0;
+ white-space: pre;
+ word-wrap: normal;
+ line-height: inherit;
+ color: inherit;
+ z-index: 2;
+ position: relative;
+ overflow: visible;
+ -webkit-tap-highlight-color: transparent;
+ -webkit-font-variant-ligatures: contextual;
+ font-variant-ligatures: contextual;
+}
+.CodeMirror-wrap pre.CodeMirror-line,
+.CodeMirror-wrap pre.CodeMirror-line-like {
+ word-wrap: break-word;
+ white-space: pre-wrap;
+ word-break: normal;
+}
+
+.CodeMirror-linebackground {
+ position: absolute;
+ left: 0; right: 0; top: 0; bottom: 0;
+ z-index: 0;
+}
+
+.CodeMirror-linewidget {
+ position: relative;
+ z-index: 2;
+ padding: 0.1px; /* Force widget margins to stay inside of the container */
+}
+
+.CodeMirror-widget {}
+
+.CodeMirror-rtl pre { direction: rtl; }
+
+.CodeMirror-code {
+ outline: none;
+}
+
+/* Force content-box sizing for the elements where we expect it */
+.CodeMirror-scroll,
+.CodeMirror-sizer,
+.CodeMirror-gutter,
+.CodeMirror-gutters,
+.CodeMirror-linenumber {
+ -moz-box-sizing: content-box;
+ box-sizing: content-box;
+}
+
+.CodeMirror-measure {
+ position: absolute;
+ width: 100%;
+ height: 0;
+ overflow: hidden;
+ visibility: hidden;
+}
+
+.CodeMirror-cursor {
+ position: absolute;
+ pointer-events: none;
+}
+.CodeMirror-measure pre { position: static; }
+
+div.CodeMirror-cursors {
+ visibility: hidden;
+ position: relative;
+ z-index: 3;
+}
+div.CodeMirror-dragcursors {
+ visibility: visible;
+}
+
+.CodeMirror-focused div.CodeMirror-cursors {
+ visibility: visible;
+}
+
+.CodeMirror-selected { background: #d9d9d9; }
+.CodeMirror-focused .CodeMirror-selected { background: #d7d4f0; }
+.CodeMirror-crosshair { cursor: crosshair; }
+.CodeMirror-line::selection, .CodeMirror-line > span::selection, .CodeMirror-line > span > span::selection { background: #d7d4f0; }
+.CodeMirror-line::-moz-selection, .CodeMirror-line > span::-moz-selection, .CodeMirror-line > span > span::-moz-selection { background: #d7d4f0; }
+
+.cm-searching {
+ background-color: #ffa;
+ background-color: rgba(255, 255, 0, .4);
+}
+
+/* Used to force a border model for a node */
+.cm-force-border { padding-right: .1px; }
+
+@media print {
+ /* Hide the cursor when printing */
+ .CodeMirror div.CodeMirror-cursors {
+ visibility: hidden;
+ }
+}
+
+/* See issue #2901 */
+.cm-tab-wrap-hack:after { content: ''; }
+
+/* Help users use markselection to safely style text background */
+span.CodeMirror-selectedtext { background: none; }
diff --git a/modules/cookiesplus/lib/CodeMirror/lib/codemirror.js b/modules/cookiesplus/lib/CodeMirror/lib/codemirror.js
new file mode 100644
index 00000000..d1550446
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/lib/codemirror.js
@@ -0,0 +1,9798 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+// This is CodeMirror (https://codemirror.net), a code editor
+// implemented in JavaScript on top of the browser's DOM.
+//
+// You can find some technical background for some of the code below
+// at http://marijnhaverbeke.nl/blog/#cm-internals .
+
+(function (global, factory) {
+ typeof exports === 'object' && typeof module !== 'undefined' ? module.exports = factory() :
+ typeof define === 'function' && define.amd ? define(factory) :
+ (global = global || self, global.CodeMirror = factory());
+}(this, (function () { 'use strict';
+
+ // Kludges for bugs and behavior differences that can't be feature
+ // detected are enabled based on userAgent etc sniffing.
+ var userAgent = navigator.userAgent;
+ var platform = navigator.platform;
+
+ var gecko = /gecko\/\d/i.test(userAgent);
+ var ie_upto10 = /MSIE \d/.test(userAgent);
+ var ie_11up = /Trident\/(?:[7-9]|\d{2,})\..*rv:(\d+)/.exec(userAgent);
+ var edge = /Edge\/(\d+)/.exec(userAgent);
+ var ie = ie_upto10 || ie_11up || edge;
+ var ie_version = ie && (ie_upto10 ? document.documentMode || 6 : +(edge || ie_11up)[1]);
+ var webkit = !edge && /WebKit\// .test(userAgent);
+ var qtwebkit = webkit && /Qt\/\d+\.\d+/.test(userAgent);
+ var chrome = !edge && /Chrome\// .test(userAgent);
+ var presto = /Opera\// .test(userAgent);
+ var safari = /Apple Computer/.test(navigator.vendor);
+ var mac_geMountainLion = /Mac OS X 1\d\D([8-9]|\d\d)\D/.test(userAgent);
+ var phantom = /PhantomJS/.test(userAgent);
+
+ var ios = !edge && /AppleWebKit/.test(userAgent) && /Mobile\/\w+/.test(userAgent);
+ var android = /Android/.test(userAgent);
+ // This is woefully incomplete. Suggestions for alternative methods welcome.
+ var mobile = ios || android || /webOS|BlackBerry|Opera Mini|Opera Mobi|IEMobile/i.test(userAgent);
+ var mac = ios || /Mac/.test(platform);
+ var chromeOS = /\bCrOS\b/.test(userAgent);
+ var windows = /win/i.test(platform);
+
+ var presto_version = presto && userAgent.match(/Version\/(\d*\.\d*)/);
+ if (presto_version) { presto_version = Number(presto_version[1]); }
+ if (presto_version && presto_version >= 15) { presto = false; webkit = true; }
+ // Some browsers use the wrong event properties to signal cmd/ctrl on OS X
+ var flipCtrlCmd = mac && (qtwebkit || presto && (presto_version == null || presto_version < 12.11));
+ var captureRightClick = gecko || (ie && ie_version >= 9);
+
+ function classTest(cls) { return new RegExp("(^|\\s)" + cls + "(?:$|\\s)\\s*") }
+
+ var rmClass = function(node, cls) {
+ var current = node.className;
+ var match = classTest(cls).exec(current);
+ if (match) {
+ var after = current.slice(match.index + match[0].length);
+ node.className = current.slice(0, match.index) + (after ? match[1] + after : "");
+ }
+ };
+
+ function removeChildren(e) {
+ for (var count = e.childNodes.length; count > 0; --count)
+ { e.removeChild(e.firstChild); }
+ return e
+ }
+
+ function removeChildrenAndAdd(parent, e) {
+ return removeChildren(parent).appendChild(e)
+ }
+
+ function elt(tag, content, className, style) {
+ var e = document.createElement(tag);
+ if (className) { e.className = className; }
+ if (style) { e.style.cssText = style; }
+ if (typeof content == "string") { e.appendChild(document.createTextNode(content)); }
+ else if (content) { for (var i = 0; i < content.length; ++i) { e.appendChild(content[i]); } }
+ return e
+ }
+ // wrapper for elt, which removes the elt from the accessibility tree
+ function eltP(tag, content, className, style) {
+ var e = elt(tag, content, className, style);
+ e.setAttribute("role", "presentation");
+ return e
+ }
+
+ var range;
+ if (document.createRange) { range = function(node, start, end, endNode) {
+ var r = document.createRange();
+ r.setEnd(endNode || node, end);
+ r.setStart(node, start);
+ return r
+ }; }
+ else { range = function(node, start, end) {
+ var r = document.body.createTextRange();
+ try { r.moveToElementText(node.parentNode); }
+ catch(e) { return r }
+ r.collapse(true);
+ r.moveEnd("character", end);
+ r.moveStart("character", start);
+ return r
+ }; }
+
+ function contains(parent, child) {
+ if (child.nodeType == 3) // Android browser always returns false when child is a textnode
+ { child = child.parentNode; }
+ if (parent.contains)
+ { return parent.contains(child) }
+ do {
+ if (child.nodeType == 11) { child = child.host; }
+ if (child == parent) { return true }
+ } while (child = child.parentNode)
+ }
+
+ function activeElt() {
+ // IE and Edge may throw an "Unspecified Error" when accessing document.activeElement.
+ // IE < 10 will throw when accessed while the page is loading or in an iframe.
+ // IE > 9 and Edge will throw when accessed in an iframe if document.body is unavailable.
+ var activeElement;
+ try {
+ activeElement = document.activeElement;
+ } catch(e) {
+ activeElement = document.body || null;
+ }
+ while (activeElement && activeElement.shadowRoot && activeElement.shadowRoot.activeElement)
+ { activeElement = activeElement.shadowRoot.activeElement; }
+ return activeElement
+ }
+
+ function addClass(node, cls) {
+ var current = node.className;
+ if (!classTest(cls).test(current)) { node.className += (current ? " " : "") + cls; }
+ }
+ function joinClasses(a, b) {
+ var as = a.split(" ");
+ for (var i = 0; i < as.length; i++)
+ { if (as[i] && !classTest(as[i]).test(b)) { b += " " + as[i]; } }
+ return b
+ }
+
+ var selectInput = function(node) { node.select(); };
+ if (ios) // Mobile Safari apparently has a bug where select() is broken.
+ { selectInput = function(node) { node.selectionStart = 0; node.selectionEnd = node.value.length; }; }
+ else if (ie) // Suppress mysterious IE10 errors
+ { selectInput = function(node) { try { node.select(); } catch(_e) {} }; }
+
+ function bind(f) {
+ var args = Array.prototype.slice.call(arguments, 1);
+ return function(){return f.apply(null, args)}
+ }
+
+ function copyObj(obj, target, overwrite) {
+ if (!target) { target = {}; }
+ for (var prop in obj)
+ { if (obj.hasOwnProperty(prop) && (overwrite !== false || !target.hasOwnProperty(prop)))
+ { target[prop] = obj[prop]; } }
+ return target
+ }
+
+ // Counts the column offset in a string, taking tabs into account.
+ // Used mostly to find indentation.
+ function countColumn(string, end, tabSize, startIndex, startValue) {
+ if (end == null) {
+ end = string.search(/[^\s\u00a0]/);
+ if (end == -1) { end = string.length; }
+ }
+ for (var i = startIndex || 0, n = startValue || 0;;) {
+ var nextTab = string.indexOf("\t", i);
+ if (nextTab < 0 || nextTab >= end)
+ { return n + (end - i) }
+ n += nextTab - i;
+ n += tabSize - (n % tabSize);
+ i = nextTab + 1;
+ }
+ }
+
+ var Delayed = function() {
+ this.id = null;
+ this.f = null;
+ this.time = 0;
+ this.handler = bind(this.onTimeout, this);
+ };
+ Delayed.prototype.onTimeout = function (self) {
+ self.id = 0;
+ if (self.time <= +new Date) {
+ self.f();
+ } else {
+ setTimeout(self.handler, self.time - +new Date);
+ }
+ };
+ Delayed.prototype.set = function (ms, f) {
+ this.f = f;
+ var time = +new Date + ms;
+ if (!this.id || time < this.time) {
+ clearTimeout(this.id);
+ this.id = setTimeout(this.handler, ms);
+ this.time = time;
+ }
+ };
+
+ function indexOf(array, elt) {
+ for (var i = 0; i < array.length; ++i)
+ { if (array[i] == elt) { return i } }
+ return -1
+ }
+
+ // Number of pixels added to scroller and sizer to hide scrollbar
+ var scrollerGap = 50;
+
+ // Returned or thrown by various protocols to signal 'I'm not
+ // handling this'.
+ var Pass = {toString: function(){return "CodeMirror.Pass"}};
+
+ // Reused option objects for setSelection & friends
+ var sel_dontScroll = {scroll: false}, sel_mouse = {origin: "*mouse"}, sel_move = {origin: "+move"};
+
+ // The inverse of countColumn -- find the offset that corresponds to
+ // a particular column.
+ function findColumn(string, goal, tabSize) {
+ for (var pos = 0, col = 0;;) {
+ var nextTab = string.indexOf("\t", pos);
+ if (nextTab == -1) { nextTab = string.length; }
+ var skipped = nextTab - pos;
+ if (nextTab == string.length || col + skipped >= goal)
+ { return pos + Math.min(skipped, goal - col) }
+ col += nextTab - pos;
+ col += tabSize - (col % tabSize);
+ pos = nextTab + 1;
+ if (col >= goal) { return pos }
+ }
+ }
+
+ var spaceStrs = [""];
+ function spaceStr(n) {
+ while (spaceStrs.length <= n)
+ { spaceStrs.push(lst(spaceStrs) + " "); }
+ return spaceStrs[n]
+ }
+
+ function lst(arr) { return arr[arr.length-1] }
+
+ function map(array, f) {
+ var out = [];
+ for (var i = 0; i < array.length; i++) { out[i] = f(array[i], i); }
+ return out
+ }
+
+ function insertSorted(array, value, score) {
+ var pos = 0, priority = score(value);
+ while (pos < array.length && score(array[pos]) <= priority) { pos++; }
+ array.splice(pos, 0, value);
+ }
+
+ function nothing() {}
+
+ function createObj(base, props) {
+ var inst;
+ if (Object.create) {
+ inst = Object.create(base);
+ } else {
+ nothing.prototype = base;
+ inst = new nothing();
+ }
+ if (props) { copyObj(props, inst); }
+ return inst
+ }
+
+ var nonASCIISingleCaseWordChar = /[\u00df\u0587\u0590-\u05f4\u0600-\u06ff\u3040-\u309f\u30a0-\u30ff\u3400-\u4db5\u4e00-\u9fcc\uac00-\ud7af]/;
+ function isWordCharBasic(ch) {
+ return /\w/.test(ch) || ch > "\x80" &&
+ (ch.toUpperCase() != ch.toLowerCase() || nonASCIISingleCaseWordChar.test(ch))
+ }
+ function isWordChar(ch, helper) {
+ if (!helper) { return isWordCharBasic(ch) }
+ if (helper.source.indexOf("\\w") > -1 && isWordCharBasic(ch)) { return true }
+ return helper.test(ch)
+ }
+
+ function isEmpty(obj) {
+ for (var n in obj) { if (obj.hasOwnProperty(n) && obj[n]) { return false } }
+ return true
+ }
+
+ // Extending unicode characters. A series of a non-extending char +
+ // any number of extending chars is treated as a single unit as far
+ // as editing and measuring is concerned. This is not fully correct,
+ // since some scripts/fonts/browsers also treat other configurations
+ // of code points as a group.
+ var extendingChars = /[\u0300-\u036f\u0483-\u0489\u0591-\u05bd\u05bf\u05c1\u05c2\u05c4\u05c5\u05c7\u0610-\u061a\u064b-\u065e\u0670\u06d6-\u06dc\u06de-\u06e4\u06e7\u06e8\u06ea-\u06ed\u0711\u0730-\u074a\u07a6-\u07b0\u07eb-\u07f3\u0816-\u0819\u081b-\u0823\u0825-\u0827\u0829-\u082d\u0900-\u0902\u093c\u0941-\u0948\u094d\u0951-\u0955\u0962\u0963\u0981\u09bc\u09be\u09c1-\u09c4\u09cd\u09d7\u09e2\u09e3\u0a01\u0a02\u0a3c\u0a41\u0a42\u0a47\u0a48\u0a4b-\u0a4d\u0a51\u0a70\u0a71\u0a75\u0a81\u0a82\u0abc\u0ac1-\u0ac5\u0ac7\u0ac8\u0acd\u0ae2\u0ae3\u0b01\u0b3c\u0b3e\u0b3f\u0b41-\u0b44\u0b4d\u0b56\u0b57\u0b62\u0b63\u0b82\u0bbe\u0bc0\u0bcd\u0bd7\u0c3e-\u0c40\u0c46-\u0c48\u0c4a-\u0c4d\u0c55\u0c56\u0c62\u0c63\u0cbc\u0cbf\u0cc2\u0cc6\u0ccc\u0ccd\u0cd5\u0cd6\u0ce2\u0ce3\u0d3e\u0d41-\u0d44\u0d4d\u0d57\u0d62\u0d63\u0dca\u0dcf\u0dd2-\u0dd4\u0dd6\u0ddf\u0e31\u0e34-\u0e3a\u0e47-\u0e4e\u0eb1\u0eb4-\u0eb9\u0ebb\u0ebc\u0ec8-\u0ecd\u0f18\u0f19\u0f35\u0f37\u0f39\u0f71-\u0f7e\u0f80-\u0f84\u0f86\u0f87\u0f90-\u0f97\u0f99-\u0fbc\u0fc6\u102d-\u1030\u1032-\u1037\u1039\u103a\u103d\u103e\u1058\u1059\u105e-\u1060\u1071-\u1074\u1082\u1085\u1086\u108d\u109d\u135f\u1712-\u1714\u1732-\u1734\u1752\u1753\u1772\u1773\u17b7-\u17bd\u17c6\u17c9-\u17d3\u17dd\u180b-\u180d\u18a9\u1920-\u1922\u1927\u1928\u1932\u1939-\u193b\u1a17\u1a18\u1a56\u1a58-\u1a5e\u1a60\u1a62\u1a65-\u1a6c\u1a73-\u1a7c\u1a7f\u1b00-\u1b03\u1b34\u1b36-\u1b3a\u1b3c\u1b42\u1b6b-\u1b73\u1b80\u1b81\u1ba2-\u1ba5\u1ba8\u1ba9\u1c2c-\u1c33\u1c36\u1c37\u1cd0-\u1cd2\u1cd4-\u1ce0\u1ce2-\u1ce8\u1ced\u1dc0-\u1de6\u1dfd-\u1dff\u200c\u200d\u20d0-\u20f0\u2cef-\u2cf1\u2de0-\u2dff\u302a-\u302f\u3099\u309a\ua66f-\ua672\ua67c\ua67d\ua6f0\ua6f1\ua802\ua806\ua80b\ua825\ua826\ua8c4\ua8e0-\ua8f1\ua926-\ua92d\ua947-\ua951\ua980-\ua982\ua9b3\ua9b6-\ua9b9\ua9bc\uaa29-\uaa2e\uaa31\uaa32\uaa35\uaa36\uaa43\uaa4c\uaab0\uaab2-\uaab4\uaab7\uaab8\uaabe\uaabf\uaac1\uabe5\uabe8\uabed\udc00-\udfff\ufb1e\ufe00-\ufe0f\ufe20-\ufe26\uff9e\uff9f]/;
+ function isExtendingChar(ch) { return ch.charCodeAt(0) >= 768 && extendingChars.test(ch) }
+
+ // Returns a number from the range [`0`; `str.length`] unless `pos` is outside that range.
+ function skipExtendingChars(str, pos, dir) {
+ while ((dir < 0 ? pos > 0 : pos < str.length) && isExtendingChar(str.charAt(pos))) { pos += dir; }
+ return pos
+ }
+
+ // Returns the value from the range [`from`; `to`] that satisfies
+ // `pred` and is closest to `from`. Assumes that at least `to`
+ // satisfies `pred`. Supports `from` being greater than `to`.
+ function findFirst(pred, from, to) {
+ // At any point we are certain `to` satisfies `pred`, don't know
+ // whether `from` does.
+ var dir = from > to ? -1 : 1;
+ for (;;) {
+ if (from == to) { return from }
+ var midF = (from + to) / 2, mid = dir < 0 ? Math.ceil(midF) : Math.floor(midF);
+ if (mid == from) { return pred(mid) ? from : to }
+ if (pred(mid)) { to = mid; }
+ else { from = mid + dir; }
+ }
+ }
+
+ // BIDI HELPERS
+
+ function iterateBidiSections(order, from, to, f) {
+ if (!order) { return f(from, to, "ltr", 0) }
+ var found = false;
+ for (var i = 0; i < order.length; ++i) {
+ var part = order[i];
+ if (part.from < to && part.to > from || from == to && part.to == from) {
+ f(Math.max(part.from, from), Math.min(part.to, to), part.level == 1 ? "rtl" : "ltr", i);
+ found = true;
+ }
+ }
+ if (!found) { f(from, to, "ltr"); }
+ }
+
+ var bidiOther = null;
+ function getBidiPartAt(order, ch, sticky) {
+ var found;
+ bidiOther = null;
+ for (var i = 0; i < order.length; ++i) {
+ var cur = order[i];
+ if (cur.from < ch && cur.to > ch) { return i }
+ if (cur.to == ch) {
+ if (cur.from != cur.to && sticky == "before") { found = i; }
+ else { bidiOther = i; }
+ }
+ if (cur.from == ch) {
+ if (cur.from != cur.to && sticky != "before") { found = i; }
+ else { bidiOther = i; }
+ }
+ }
+ return found != null ? found : bidiOther
+ }
+
+ // Bidirectional ordering algorithm
+ // See http://unicode.org/reports/tr9/tr9-13.html for the algorithm
+ // that this (partially) implements.
+
+ // One-char codes used for character types:
+ // L (L): Left-to-Right
+ // R (R): Right-to-Left
+ // r (AL): Right-to-Left Arabic
+ // 1 (EN): European Number
+ // + (ES): European Number Separator
+ // % (ET): European Number Terminator
+ // n (AN): Arabic Number
+ // , (CS): Common Number Separator
+ // m (NSM): Non-Spacing Mark
+ // b (BN): Boundary Neutral
+ // s (B): Paragraph Separator
+ // t (S): Segment Separator
+ // w (WS): Whitespace
+ // N (ON): Other Neutrals
+
+ // Returns null if characters are ordered as they appear
+ // (left-to-right), or an array of sections ({from, to, level}
+ // objects) in the order in which they occur visually.
+ var bidiOrdering = (function() {
+ // Character types for codepoints 0 to 0xff
+ var lowTypes = "bbbbbbbbbtstwsbbbbbbbbbbbbbbssstwNN%%%NNNNNN,N,N1111111111NNNNNNNLLLLLLLLLLLLLLLLLLLLLLLLLLNNNNNNLLLLLLLLLLLLLLLLLLLLLLLLLLNNNNbbbbbbsbbbbbbbbbbbbbbbbbbbbbbbbbb,N%%%%NNNNLNNNNN%%11NLNNN1LNNNNNLLLLLLLLLLLLLLLLLLLLLLLNLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLN";
+ // Character types for codepoints 0x600 to 0x6f9
+ var arabicTypes = "nnnnnnNNr%%r,rNNmmmmmmmmmmmrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrmmmmmmmmmmmmmmmmmmmmmnnnnnnnnnn%nnrrrmrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrrmmmmmmmnNmmmmmmrrmmNmmmmrr1111111111";
+ function charType(code) {
+ if (code <= 0xf7) { return lowTypes.charAt(code) }
+ else if (0x590 <= code && code <= 0x5f4) { return "R" }
+ else if (0x600 <= code && code <= 0x6f9) { return arabicTypes.charAt(code - 0x600) }
+ else if (0x6ee <= code && code <= 0x8ac) { return "r" }
+ else if (0x2000 <= code && code <= 0x200b) { return "w" }
+ else if (code == 0x200c) { return "b" }
+ else { return "L" }
+ }
+
+ var bidiRE = /[\u0590-\u05f4\u0600-\u06ff\u0700-\u08ac]/;
+ var isNeutral = /[stwN]/, isStrong = /[LRr]/, countsAsLeft = /[Lb1n]/, countsAsNum = /[1n]/;
+
+ function BidiSpan(level, from, to) {
+ this.level = level;
+ this.from = from; this.to = to;
+ }
+
+ return function(str, direction) {
+ var outerType = direction == "ltr" ? "L" : "R";
+
+ if (str.length == 0 || direction == "ltr" && !bidiRE.test(str)) { return false }
+ var len = str.length, types = [];
+ for (var i = 0; i < len; ++i)
+ { types.push(charType(str.charCodeAt(i))); }
+
+ // W1. Examine each non-spacing mark (NSM) in the level run, and
+ // change the type of the NSM to the type of the previous
+ // character. If the NSM is at the start of the level run, it will
+ // get the type of sor.
+ for (var i$1 = 0, prev = outerType; i$1 < len; ++i$1) {
+ var type = types[i$1];
+ if (type == "m") { types[i$1] = prev; }
+ else { prev = type; }
+ }
+
+ // W2. Search backwards from each instance of a European number
+ // until the first strong type (R, L, AL, or sor) is found. If an
+ // AL is found, change the type of the European number to Arabic
+ // number.
+ // W3. Change all ALs to R.
+ for (var i$2 = 0, cur = outerType; i$2 < len; ++i$2) {
+ var type$1 = types[i$2];
+ if (type$1 == "1" && cur == "r") { types[i$2] = "n"; }
+ else if (isStrong.test(type$1)) { cur = type$1; if (type$1 == "r") { types[i$2] = "R"; } }
+ }
+
+ // W4. A single European separator between two European numbers
+ // changes to a European number. A single common separator between
+ // two numbers of the same type changes to that type.
+ for (var i$3 = 1, prev$1 = types[0]; i$3 < len - 1; ++i$3) {
+ var type$2 = types[i$3];
+ if (type$2 == "+" && prev$1 == "1" && types[i$3+1] == "1") { types[i$3] = "1"; }
+ else if (type$2 == "," && prev$1 == types[i$3+1] &&
+ (prev$1 == "1" || prev$1 == "n")) { types[i$3] = prev$1; }
+ prev$1 = type$2;
+ }
+
+ // W5. A sequence of European terminators adjacent to European
+ // numbers changes to all European numbers.
+ // W6. Otherwise, separators and terminators change to Other
+ // Neutral.
+ for (var i$4 = 0; i$4 < len; ++i$4) {
+ var type$3 = types[i$4];
+ if (type$3 == ",") { types[i$4] = "N"; }
+ else if (type$3 == "%") {
+ var end = (void 0);
+ for (end = i$4 + 1; end < len && types[end] == "%"; ++end) {}
+ var replace = (i$4 && types[i$4-1] == "!") || (end < len && types[end] == "1") ? "1" : "N";
+ for (var j = i$4; j < end; ++j) { types[j] = replace; }
+ i$4 = end - 1;
+ }
+ }
+
+ // W7. Search backwards from each instance of a European number
+ // until the first strong type (R, L, or sor) is found. If an L is
+ // found, then change the type of the European number to L.
+ for (var i$5 = 0, cur$1 = outerType; i$5 < len; ++i$5) {
+ var type$4 = types[i$5];
+ if (cur$1 == "L" && type$4 == "1") { types[i$5] = "L"; }
+ else if (isStrong.test(type$4)) { cur$1 = type$4; }
+ }
+
+ // N1. A sequence of neutrals takes the direction of the
+ // surrounding strong text if the text on both sides has the same
+ // direction. European and Arabic numbers act as if they were R in
+ // terms of their influence on neutrals. Start-of-level-run (sor)
+ // and end-of-level-run (eor) are used at level run boundaries.
+ // N2. Any remaining neutrals take the embedding direction.
+ for (var i$6 = 0; i$6 < len; ++i$6) {
+ if (isNeutral.test(types[i$6])) {
+ var end$1 = (void 0);
+ for (end$1 = i$6 + 1; end$1 < len && isNeutral.test(types[end$1]); ++end$1) {}
+ var before = (i$6 ? types[i$6-1] : outerType) == "L";
+ var after = (end$1 < len ? types[end$1] : outerType) == "L";
+ var replace$1 = before == after ? (before ? "L" : "R") : outerType;
+ for (var j$1 = i$6; j$1 < end$1; ++j$1) { types[j$1] = replace$1; }
+ i$6 = end$1 - 1;
+ }
+ }
+
+ // Here we depart from the documented algorithm, in order to avoid
+ // building up an actual levels array. Since there are only three
+ // levels (0, 1, 2) in an implementation that doesn't take
+ // explicit embedding into account, we can build up the order on
+ // the fly, without following the level-based algorithm.
+ var order = [], m;
+ for (var i$7 = 0; i$7 < len;) {
+ if (countsAsLeft.test(types[i$7])) {
+ var start = i$7;
+ for (++i$7; i$7 < len && countsAsLeft.test(types[i$7]); ++i$7) {}
+ order.push(new BidiSpan(0, start, i$7));
+ } else {
+ var pos = i$7, at = order.length, isRTL = direction == "rtl" ? 1 : 0;
+ for (++i$7; i$7 < len && types[i$7] != "L"; ++i$7) {}
+ for (var j$2 = pos; j$2 < i$7;) {
+ if (countsAsNum.test(types[j$2])) {
+ if (pos < j$2) { order.splice(at, 0, new BidiSpan(1, pos, j$2)); at += isRTL; }
+ var nstart = j$2;
+ for (++j$2; j$2 < i$7 && countsAsNum.test(types[j$2]); ++j$2) {}
+ order.splice(at, 0, new BidiSpan(2, nstart, j$2));
+ at += isRTL;
+ pos = j$2;
+ } else { ++j$2; }
+ }
+ if (pos < i$7) { order.splice(at, 0, new BidiSpan(1, pos, i$7)); }
+ }
+ }
+ if (direction == "ltr") {
+ if (order[0].level == 1 && (m = str.match(/^\s+/))) {
+ order[0].from = m[0].length;
+ order.unshift(new BidiSpan(0, 0, m[0].length));
+ }
+ if (lst(order).level == 1 && (m = str.match(/\s+$/))) {
+ lst(order).to -= m[0].length;
+ order.push(new BidiSpan(0, len - m[0].length, len));
+ }
+ }
+
+ return direction == "rtl" ? order.reverse() : order
+ }
+ })();
+
+ // Get the bidi ordering for the given line (and cache it). Returns
+ // false for lines that are fully left-to-right, and an array of
+ // BidiSpan objects otherwise.
+ function getOrder(line, direction) {
+ var order = line.order;
+ if (order == null) { order = line.order = bidiOrdering(line.text, direction); }
+ return order
+ }
+
+ // EVENT HANDLING
+
+ // Lightweight event framework. on/off also work on DOM nodes,
+ // registering native DOM handlers.
+
+ var noHandlers = [];
+
+ var on = function(emitter, type, f) {
+ if (emitter.addEventListener) {
+ emitter.addEventListener(type, f, false);
+ } else if (emitter.attachEvent) {
+ emitter.attachEvent("on" + type, f);
+ } else {
+ var map = emitter._handlers || (emitter._handlers = {});
+ map[type] = (map[type] || noHandlers).concat(f);
+ }
+ };
+
+ function getHandlers(emitter, type) {
+ return emitter._handlers && emitter._handlers[type] || noHandlers
+ }
+
+ function off(emitter, type, f) {
+ if (emitter.removeEventListener) {
+ emitter.removeEventListener(type, f, false);
+ } else if (emitter.detachEvent) {
+ emitter.detachEvent("on" + type, f);
+ } else {
+ var map = emitter._handlers, arr = map && map[type];
+ if (arr) {
+ var index = indexOf(arr, f);
+ if (index > -1)
+ { map[type] = arr.slice(0, index).concat(arr.slice(index + 1)); }
+ }
+ }
+ }
+
+ function signal(emitter, type /*, values...*/) {
+ var handlers = getHandlers(emitter, type);
+ if (!handlers.length) { return }
+ var args = Array.prototype.slice.call(arguments, 2);
+ for (var i = 0; i < handlers.length; ++i) { handlers[i].apply(null, args); }
+ }
+
+ // The DOM events that CodeMirror handles can be overridden by
+ // registering a (non-DOM) handler on the editor for the event name,
+ // and preventDefault-ing the event in that handler.
+ function signalDOMEvent(cm, e, override) {
+ if (typeof e == "string")
+ { e = {type: e, preventDefault: function() { this.defaultPrevented = true; }}; }
+ signal(cm, override || e.type, cm, e);
+ return e_defaultPrevented(e) || e.codemirrorIgnore
+ }
+
+ function signalCursorActivity(cm) {
+ var arr = cm._handlers && cm._handlers.cursorActivity;
+ if (!arr) { return }
+ var set = cm.curOp.cursorActivityHandlers || (cm.curOp.cursorActivityHandlers = []);
+ for (var i = 0; i < arr.length; ++i) { if (indexOf(set, arr[i]) == -1)
+ { set.push(arr[i]); } }
+ }
+
+ function hasHandler(emitter, type) {
+ return getHandlers(emitter, type).length > 0
+ }
+
+ // Add on and off methods to a constructor's prototype, to make
+ // registering events on such objects more convenient.
+ function eventMixin(ctor) {
+ ctor.prototype.on = function(type, f) {on(this, type, f);};
+ ctor.prototype.off = function(type, f) {off(this, type, f);};
+ }
+
+ // Due to the fact that we still support jurassic IE versions, some
+ // compatibility wrappers are needed.
+
+ function e_preventDefault(e) {
+ if (e.preventDefault) { e.preventDefault(); }
+ else { e.returnValue = false; }
+ }
+ function e_stopPropagation(e) {
+ if (e.stopPropagation) { e.stopPropagation(); }
+ else { e.cancelBubble = true; }
+ }
+ function e_defaultPrevented(e) {
+ return e.defaultPrevented != null ? e.defaultPrevented : e.returnValue == false
+ }
+ function e_stop(e) {e_preventDefault(e); e_stopPropagation(e);}
+
+ function e_target(e) {return e.target || e.srcElement}
+ function e_button(e) {
+ var b = e.which;
+ if (b == null) {
+ if (e.button & 1) { b = 1; }
+ else if (e.button & 2) { b = 3; }
+ else if (e.button & 4) { b = 2; }
+ }
+ if (mac && e.ctrlKey && b == 1) { b = 3; }
+ return b
+ }
+
+ // Detect drag-and-drop
+ var dragAndDrop = function() {
+ // There is *some* kind of drag-and-drop support in IE6-8, but I
+ // couldn't get it to work yet.
+ if (ie && ie_version < 9) { return false }
+ var div = elt('div');
+ return "draggable" in div || "dragDrop" in div
+ }();
+
+ var zwspSupported;
+ function zeroWidthElement(measure) {
+ if (zwspSupported == null) {
+ var test = elt("span", "\u200b");
+ removeChildrenAndAdd(measure, elt("span", [test, document.createTextNode("x")]));
+ if (measure.firstChild.offsetHeight != 0)
+ { zwspSupported = test.offsetWidth <= 1 && test.offsetHeight > 2 && !(ie && ie_version < 8); }
+ }
+ var node = zwspSupported ? elt("span", "\u200b") :
+ elt("span", "\u00a0", null, "display: inline-block; width: 1px; margin-right: -1px");
+ node.setAttribute("cm-text", "");
+ return node
+ }
+
+ // Feature-detect IE's crummy client rect reporting for bidi text
+ var badBidiRects;
+ function hasBadBidiRects(measure) {
+ if (badBidiRects != null) { return badBidiRects }
+ var txt = removeChildrenAndAdd(measure, document.createTextNode("A\u062eA"));
+ var r0 = range(txt, 0, 1).getBoundingClientRect();
+ var r1 = range(txt, 1, 2).getBoundingClientRect();
+ removeChildren(measure);
+ if (!r0 || r0.left == r0.right) { return false } // Safari returns null in some cases (#2780)
+ return badBidiRects = (r1.right - r0.right < 3)
+ }
+
+ // See if "".split is the broken IE version, if so, provide an
+ // alternative way to split lines.
+ var splitLinesAuto = "\n\nb".split(/\n/).length != 3 ? function (string) {
+ var pos = 0, result = [], l = string.length;
+ while (pos <= l) {
+ var nl = string.indexOf("\n", pos);
+ if (nl == -1) { nl = string.length; }
+ var line = string.slice(pos, string.charAt(nl - 1) == "\r" ? nl - 1 : nl);
+ var rt = line.indexOf("\r");
+ if (rt != -1) {
+ result.push(line.slice(0, rt));
+ pos += rt + 1;
+ } else {
+ result.push(line);
+ pos = nl + 1;
+ }
+ }
+ return result
+ } : function (string) { return string.split(/\r\n?|\n/); };
+
+ var hasSelection = window.getSelection ? function (te) {
+ try { return te.selectionStart != te.selectionEnd }
+ catch(e) { return false }
+ } : function (te) {
+ var range;
+ try {range = te.ownerDocument.selection.createRange();}
+ catch(e) {}
+ if (!range || range.parentElement() != te) { return false }
+ return range.compareEndPoints("StartToEnd", range) != 0
+ };
+
+ var hasCopyEvent = (function () {
+ var e = elt("div");
+ if ("oncopy" in e) { return true }
+ e.setAttribute("oncopy", "return;");
+ return typeof e.oncopy == "function"
+ })();
+
+ var badZoomedRects = null;
+ function hasBadZoomedRects(measure) {
+ if (badZoomedRects != null) { return badZoomedRects }
+ var node = removeChildrenAndAdd(measure, elt("span", "x"));
+ var normal = node.getBoundingClientRect();
+ var fromRange = range(node, 0, 1).getBoundingClientRect();
+ return badZoomedRects = Math.abs(normal.left - fromRange.left) > 1
+ }
+
+ // Known modes, by name and by MIME
+ var modes = {}, mimeModes = {};
+
+ // Extra arguments are stored as the mode's dependencies, which is
+ // used by (legacy) mechanisms like loadmode.js to automatically
+ // load a mode. (Preferred mechanism is the require/define calls.)
+ function defineMode(name, mode) {
+ if (arguments.length > 2)
+ { mode.dependencies = Array.prototype.slice.call(arguments, 2); }
+ modes[name] = mode;
+ }
+
+ function defineMIME(mime, spec) {
+ mimeModes[mime] = spec;
+ }
+
+ // Given a MIME type, a {name, ...options} config object, or a name
+ // string, return a mode config object.
+ function resolveMode(spec) {
+ if (typeof spec == "string" && mimeModes.hasOwnProperty(spec)) {
+ spec = mimeModes[spec];
+ } else if (spec && typeof spec.name == "string" && mimeModes.hasOwnProperty(spec.name)) {
+ var found = mimeModes[spec.name];
+ if (typeof found == "string") { found = {name: found}; }
+ spec = createObj(found, spec);
+ spec.name = found.name;
+ } else if (typeof spec == "string" && /^[\w\-]+\/[\w\-]+\+xml$/.test(spec)) {
+ return resolveMode("application/xml")
+ } else if (typeof spec == "string" && /^[\w\-]+\/[\w\-]+\+json$/.test(spec)) {
+ return resolveMode("application/json")
+ }
+ if (typeof spec == "string") { return {name: spec} }
+ else { return spec || {name: "null"} }
+ }
+
+ // Given a mode spec (anything that resolveMode accepts), find and
+ // initialize an actual mode object.
+ function getMode(options, spec) {
+ spec = resolveMode(spec);
+ var mfactory = modes[spec.name];
+ if (!mfactory) { return getMode(options, "text/plain") }
+ var modeObj = mfactory(options, spec);
+ if (modeExtensions.hasOwnProperty(spec.name)) {
+ var exts = modeExtensions[spec.name];
+ for (var prop in exts) {
+ if (!exts.hasOwnProperty(prop)) { continue }
+ if (modeObj.hasOwnProperty(prop)) { modeObj["_" + prop] = modeObj[prop]; }
+ modeObj[prop] = exts[prop];
+ }
+ }
+ modeObj.name = spec.name;
+ if (spec.helperType) { modeObj.helperType = spec.helperType; }
+ if (spec.modeProps) { for (var prop$1 in spec.modeProps)
+ { modeObj[prop$1] = spec.modeProps[prop$1]; } }
+
+ return modeObj
+ }
+
+ // This can be used to attach properties to mode objects from
+ // outside the actual mode definition.
+ var modeExtensions = {};
+ function extendMode(mode, properties) {
+ var exts = modeExtensions.hasOwnProperty(mode) ? modeExtensions[mode] : (modeExtensions[mode] = {});
+ copyObj(properties, exts);
+ }
+
+ function copyState(mode, state) {
+ if (state === true) { return state }
+ if (mode.copyState) { return mode.copyState(state) }
+ var nstate = {};
+ for (var n in state) {
+ var val = state[n];
+ if (val instanceof Array) { val = val.concat([]); }
+ nstate[n] = val;
+ }
+ return nstate
+ }
+
+ // Given a mode and a state (for that mode), find the inner mode and
+ // state at the position that the state refers to.
+ function innerMode(mode, state) {
+ var info;
+ while (mode.innerMode) {
+ info = mode.innerMode(state);
+ if (!info || info.mode == mode) { break }
+ state = info.state;
+ mode = info.mode;
+ }
+ return info || {mode: mode, state: state}
+ }
+
+ function startState(mode, a1, a2) {
+ return mode.startState ? mode.startState(a1, a2) : true
+ }
+
+ // STRING STREAM
+
+ // Fed to the mode parsers, provides helper functions to make
+ // parsers more succinct.
+
+ var StringStream = function(string, tabSize, lineOracle) {
+ this.pos = this.start = 0;
+ this.string = string;
+ this.tabSize = tabSize || 8;
+ this.lastColumnPos = this.lastColumnValue = 0;
+ this.lineStart = 0;
+ this.lineOracle = lineOracle;
+ };
+
+ StringStream.prototype.eol = function () {return this.pos >= this.string.length};
+ StringStream.prototype.sol = function () {return this.pos == this.lineStart};
+ StringStream.prototype.peek = function () {return this.string.charAt(this.pos) || undefined};
+ StringStream.prototype.next = function () {
+ if (this.pos < this.string.length)
+ { return this.string.charAt(this.pos++) }
+ };
+ StringStream.prototype.eat = function (match) {
+ var ch = this.string.charAt(this.pos);
+ var ok;
+ if (typeof match == "string") { ok = ch == match; }
+ else { ok = ch && (match.test ? match.test(ch) : match(ch)); }
+ if (ok) {++this.pos; return ch}
+ };
+ StringStream.prototype.eatWhile = function (match) {
+ var start = this.pos;
+ while (this.eat(match)){}
+ return this.pos > start
+ };
+ StringStream.prototype.eatSpace = function () {
+ var start = this.pos;
+ while (/[\s\u00a0]/.test(this.string.charAt(this.pos))) { ++this.pos; }
+ return this.pos > start
+ };
+ StringStream.prototype.skipToEnd = function () {this.pos = this.string.length;};
+ StringStream.prototype.skipTo = function (ch) {
+ var found = this.string.indexOf(ch, this.pos);
+ if (found > -1) {this.pos = found; return true}
+ };
+ StringStream.prototype.backUp = function (n) {this.pos -= n;};
+ StringStream.prototype.column = function () {
+ if (this.lastColumnPos < this.start) {
+ this.lastColumnValue = countColumn(this.string, this.start, this.tabSize, this.lastColumnPos, this.lastColumnValue);
+ this.lastColumnPos = this.start;
+ }
+ return this.lastColumnValue - (this.lineStart ? countColumn(this.string, this.lineStart, this.tabSize) : 0)
+ };
+ StringStream.prototype.indentation = function () {
+ return countColumn(this.string, null, this.tabSize) -
+ (this.lineStart ? countColumn(this.string, this.lineStart, this.tabSize) : 0)
+ };
+ StringStream.prototype.match = function (pattern, consume, caseInsensitive) {
+ if (typeof pattern == "string") {
+ var cased = function (str) { return caseInsensitive ? str.toLowerCase() : str; };
+ var substr = this.string.substr(this.pos, pattern.length);
+ if (cased(substr) == cased(pattern)) {
+ if (consume !== false) { this.pos += pattern.length; }
+ return true
+ }
+ } else {
+ var match = this.string.slice(this.pos).match(pattern);
+ if (match && match.index > 0) { return null }
+ if (match && consume !== false) { this.pos += match[0].length; }
+ return match
+ }
+ };
+ StringStream.prototype.current = function (){return this.string.slice(this.start, this.pos)};
+ StringStream.prototype.hideFirstChars = function (n, inner) {
+ this.lineStart += n;
+ try { return inner() }
+ finally { this.lineStart -= n; }
+ };
+ StringStream.prototype.lookAhead = function (n) {
+ var oracle = this.lineOracle;
+ return oracle && oracle.lookAhead(n)
+ };
+ StringStream.prototype.baseToken = function () {
+ var oracle = this.lineOracle;
+ return oracle && oracle.baseToken(this.pos)
+ };
+
+ // Find the line object corresponding to the given line number.
+ function getLine(doc, n) {
+ n -= doc.first;
+ if (n < 0 || n >= doc.size) { throw new Error("There is no line " + (n + doc.first) + " in the document.") }
+ var chunk = doc;
+ while (!chunk.lines) {
+ for (var i = 0;; ++i) {
+ var child = chunk.children[i], sz = child.chunkSize();
+ if (n < sz) { chunk = child; break }
+ n -= sz;
+ }
+ }
+ return chunk.lines[n]
+ }
+
+ // Get the part of a document between two positions, as an array of
+ // strings.
+ function getBetween(doc, start, end) {
+ var out = [], n = start.line;
+ doc.iter(start.line, end.line + 1, function (line) {
+ var text = line.text;
+ if (n == end.line) { text = text.slice(0, end.ch); }
+ if (n == start.line) { text = text.slice(start.ch); }
+ out.push(text);
+ ++n;
+ });
+ return out
+ }
+ // Get the lines between from and to, as array of strings.
+ function getLines(doc, from, to) {
+ var out = [];
+ doc.iter(from, to, function (line) { out.push(line.text); }); // iter aborts when callback returns truthy value
+ return out
+ }
+
+ // Update the height of a line, propagating the height change
+ // upwards to parent nodes.
+ function updateLineHeight(line, height) {
+ var diff = height - line.height;
+ if (diff) { for (var n = line; n; n = n.parent) { n.height += diff; } }
+ }
+
+ // Given a line object, find its line number by walking up through
+ // its parent links.
+ function lineNo(line) {
+ if (line.parent == null) { return null }
+ var cur = line.parent, no = indexOf(cur.lines, line);
+ for (var chunk = cur.parent; chunk; cur = chunk, chunk = chunk.parent) {
+ for (var i = 0;; ++i) {
+ if (chunk.children[i] == cur) { break }
+ no += chunk.children[i].chunkSize();
+ }
+ }
+ return no + cur.first
+ }
+
+ // Find the line at the given vertical position, using the height
+ // information in the document tree.
+ function lineAtHeight(chunk, h) {
+ var n = chunk.first;
+ outer: do {
+ for (var i$1 = 0; i$1 < chunk.children.length; ++i$1) {
+ var child = chunk.children[i$1], ch = child.height;
+ if (h < ch) { chunk = child; continue outer }
+ h -= ch;
+ n += child.chunkSize();
+ }
+ return n
+ } while (!chunk.lines)
+ var i = 0;
+ for (; i < chunk.lines.length; ++i) {
+ var line = chunk.lines[i], lh = line.height;
+ if (h < lh) { break }
+ h -= lh;
+ }
+ return n + i
+ }
+
+ function isLine(doc, l) {return l >= doc.first && l < doc.first + doc.size}
+
+ function lineNumberFor(options, i) {
+ return String(options.lineNumberFormatter(i + options.firstLineNumber))
+ }
+
+ // A Pos instance represents a position within the text.
+ function Pos(line, ch, sticky) {
+ if ( sticky === void 0 ) sticky = null;
+
+ if (!(this instanceof Pos)) { return new Pos(line, ch, sticky) }
+ this.line = line;
+ this.ch = ch;
+ this.sticky = sticky;
+ }
+
+ // Compare two positions, return 0 if they are the same, a negative
+ // number when a is less, and a positive number otherwise.
+ function cmp(a, b) { return a.line - b.line || a.ch - b.ch }
+
+ function equalCursorPos(a, b) { return a.sticky == b.sticky && cmp(a, b) == 0 }
+
+ function copyPos(x) {return Pos(x.line, x.ch)}
+ function maxPos(a, b) { return cmp(a, b) < 0 ? b : a }
+ function minPos(a, b) { return cmp(a, b) < 0 ? a : b }
+
+ // Most of the external API clips given positions to make sure they
+ // actually exist within the document.
+ function clipLine(doc, n) {return Math.max(doc.first, Math.min(n, doc.first + doc.size - 1))}
+ function clipPos(doc, pos) {
+ if (pos.line < doc.first) { return Pos(doc.first, 0) }
+ var last = doc.first + doc.size - 1;
+ if (pos.line > last) { return Pos(last, getLine(doc, last).text.length) }
+ return clipToLen(pos, getLine(doc, pos.line).text.length)
+ }
+ function clipToLen(pos, linelen) {
+ var ch = pos.ch;
+ if (ch == null || ch > linelen) { return Pos(pos.line, linelen) }
+ else if (ch < 0) { return Pos(pos.line, 0) }
+ else { return pos }
+ }
+ function clipPosArray(doc, array) {
+ var out = [];
+ for (var i = 0; i < array.length; i++) { out[i] = clipPos(doc, array[i]); }
+ return out
+ }
+
+ var SavedContext = function(state, lookAhead) {
+ this.state = state;
+ this.lookAhead = lookAhead;
+ };
+
+ var Context = function(doc, state, line, lookAhead) {
+ this.state = state;
+ this.doc = doc;
+ this.line = line;
+ this.maxLookAhead = lookAhead || 0;
+ this.baseTokens = null;
+ this.baseTokenPos = 1;
+ };
+
+ Context.prototype.lookAhead = function (n) {
+ var line = this.doc.getLine(this.line + n);
+ if (line != null && n > this.maxLookAhead) { this.maxLookAhead = n; }
+ return line
+ };
+
+ Context.prototype.baseToken = function (n) {
+ if (!this.baseTokens) { return null }
+ while (this.baseTokens[this.baseTokenPos] <= n)
+ { this.baseTokenPos += 2; }
+ var type = this.baseTokens[this.baseTokenPos + 1];
+ return {type: type && type.replace(/( |^)overlay .*/, ""),
+ size: this.baseTokens[this.baseTokenPos] - n}
+ };
+
+ Context.prototype.nextLine = function () {
+ this.line++;
+ if (this.maxLookAhead > 0) { this.maxLookAhead--; }
+ };
+
+ Context.fromSaved = function (doc, saved, line) {
+ if (saved instanceof SavedContext)
+ { return new Context(doc, copyState(doc.mode, saved.state), line, saved.lookAhead) }
+ else
+ { return new Context(doc, copyState(doc.mode, saved), line) }
+ };
+
+ Context.prototype.save = function (copy) {
+ var state = copy !== false ? copyState(this.doc.mode, this.state) : this.state;
+ return this.maxLookAhead > 0 ? new SavedContext(state, this.maxLookAhead) : state
+ };
+
+
+ // Compute a style array (an array starting with a mode generation
+ // -- for invalidation -- followed by pairs of end positions and
+ // style strings), which is used to highlight the tokens on the
+ // line.
+ function highlightLine(cm, line, context, forceToEnd) {
+ // A styles array always starts with a number identifying the
+ // mode/overlays that it is based on (for easy invalidation).
+ var st = [cm.state.modeGen], lineClasses = {};
+ // Compute the base array of styles
+ runMode(cm, line.text, cm.doc.mode, context, function (end, style) { return st.push(end, style); },
+ lineClasses, forceToEnd);
+ var state = context.state;
+
+ // Run overlays, adjust style array.
+ var loop = function ( o ) {
+ context.baseTokens = st;
+ var overlay = cm.state.overlays[o], i = 1, at = 0;
+ context.state = true;
+ runMode(cm, line.text, overlay.mode, context, function (end, style) {
+ var start = i;
+ // Ensure there's a token end at the current position, and that i points at it
+ while (at < end) {
+ var i_end = st[i];
+ if (i_end > end)
+ { st.splice(i, 1, end, st[i+1], i_end); }
+ i += 2;
+ at = Math.min(end, i_end);
+ }
+ if (!style) { return }
+ if (overlay.opaque) {
+ st.splice(start, i - start, end, "overlay " + style);
+ i = start + 2;
+ } else {
+ for (; start < i; start += 2) {
+ var cur = st[start+1];
+ st[start+1] = (cur ? cur + " " : "") + "overlay " + style;
+ }
+ }
+ }, lineClasses);
+ context.state = state;
+ context.baseTokens = null;
+ context.baseTokenPos = 1;
+ };
+
+ for (var o = 0; o < cm.state.overlays.length; ++o) loop( o );
+
+ return {styles: st, classes: lineClasses.bgClass || lineClasses.textClass ? lineClasses : null}
+ }
+
+ function getLineStyles(cm, line, updateFrontier) {
+ if (!line.styles || line.styles[0] != cm.state.modeGen) {
+ var context = getContextBefore(cm, lineNo(line));
+ var resetState = line.text.length > cm.options.maxHighlightLength && copyState(cm.doc.mode, context.state);
+ var result = highlightLine(cm, line, context);
+ if (resetState) { context.state = resetState; }
+ line.stateAfter = context.save(!resetState);
+ line.styles = result.styles;
+ if (result.classes) { line.styleClasses = result.classes; }
+ else if (line.styleClasses) { line.styleClasses = null; }
+ if (updateFrontier === cm.doc.highlightFrontier)
+ { cm.doc.modeFrontier = Math.max(cm.doc.modeFrontier, ++cm.doc.highlightFrontier); }
+ }
+ return line.styles
+ }
+
+ function getContextBefore(cm, n, precise) {
+ var doc = cm.doc, display = cm.display;
+ if (!doc.mode.startState) { return new Context(doc, true, n) }
+ var start = findStartLine(cm, n, precise);
+ var saved = start > doc.first && getLine(doc, start - 1).stateAfter;
+ var context = saved ? Context.fromSaved(doc, saved, start) : new Context(doc, startState(doc.mode), start);
+
+ doc.iter(start, n, function (line) {
+ processLine(cm, line.text, context);
+ var pos = context.line;
+ line.stateAfter = pos == n - 1 || pos % 5 == 0 || pos >= display.viewFrom && pos < display.viewTo ? context.save() : null;
+ context.nextLine();
+ });
+ if (precise) { doc.modeFrontier = context.line; }
+ return context
+ }
+
+ // Lightweight form of highlight -- proceed over this line and
+ // update state, but don't save a style array. Used for lines that
+ // aren't currently visible.
+ function processLine(cm, text, context, startAt) {
+ var mode = cm.doc.mode;
+ var stream = new StringStream(text, cm.options.tabSize, context);
+ stream.start = stream.pos = startAt || 0;
+ if (text == "") { callBlankLine(mode, context.state); }
+ while (!stream.eol()) {
+ readToken(mode, stream, context.state);
+ stream.start = stream.pos;
+ }
+ }
+
+ function callBlankLine(mode, state) {
+ if (mode.blankLine) { return mode.blankLine(state) }
+ if (!mode.innerMode) { return }
+ var inner = innerMode(mode, state);
+ if (inner.mode.blankLine) { return inner.mode.blankLine(inner.state) }
+ }
+
+ function readToken(mode, stream, state, inner) {
+ for (var i = 0; i < 10; i++) {
+ if (inner) { inner[0] = innerMode(mode, state).mode; }
+ var style = mode.token(stream, state);
+ if (stream.pos > stream.start) { return style }
+ }
+ throw new Error("Mode " + mode.name + " failed to advance stream.")
+ }
+
+ var Token = function(stream, type, state) {
+ this.start = stream.start; this.end = stream.pos;
+ this.string = stream.current();
+ this.type = type || null;
+ this.state = state;
+ };
+
+ // Utility for getTokenAt and getLineTokens
+ function takeToken(cm, pos, precise, asArray) {
+ var doc = cm.doc, mode = doc.mode, style;
+ pos = clipPos(doc, pos);
+ var line = getLine(doc, pos.line), context = getContextBefore(cm, pos.line, precise);
+ var stream = new StringStream(line.text, cm.options.tabSize, context), tokens;
+ if (asArray) { tokens = []; }
+ while ((asArray || stream.pos < pos.ch) && !stream.eol()) {
+ stream.start = stream.pos;
+ style = readToken(mode, stream, context.state);
+ if (asArray) { tokens.push(new Token(stream, style, copyState(doc.mode, context.state))); }
+ }
+ return asArray ? tokens : new Token(stream, style, context.state)
+ }
+
+ function extractLineClasses(type, output) {
+ if (type) { for (;;) {
+ var lineClass = type.match(/(?:^|\s+)line-(background-)?(\S+)/);
+ if (!lineClass) { break }
+ type = type.slice(0, lineClass.index) + type.slice(lineClass.index + lineClass[0].length);
+ var prop = lineClass[1] ? "bgClass" : "textClass";
+ if (output[prop] == null)
+ { output[prop] = lineClass[2]; }
+ else if (!(new RegExp("(?:^|\\s)" + lineClass[2] + "(?:$|\\s)")).test(output[prop]))
+ { output[prop] += " " + lineClass[2]; }
+ } }
+ return type
+ }
+
+ // Run the given mode's parser over a line, calling f for each token.
+ function runMode(cm, text, mode, context, f, lineClasses, forceToEnd) {
+ var flattenSpans = mode.flattenSpans;
+ if (flattenSpans == null) { flattenSpans = cm.options.flattenSpans; }
+ var curStart = 0, curStyle = null;
+ var stream = new StringStream(text, cm.options.tabSize, context), style;
+ var inner = cm.options.addModeClass && [null];
+ if (text == "") { extractLineClasses(callBlankLine(mode, context.state), lineClasses); }
+ while (!stream.eol()) {
+ if (stream.pos > cm.options.maxHighlightLength) {
+ flattenSpans = false;
+ if (forceToEnd) { processLine(cm, text, context, stream.pos); }
+ stream.pos = text.length;
+ style = null;
+ } else {
+ style = extractLineClasses(readToken(mode, stream, context.state, inner), lineClasses);
+ }
+ if (inner) {
+ var mName = inner[0].name;
+ if (mName) { style = "m-" + (style ? mName + " " + style : mName); }
+ }
+ if (!flattenSpans || curStyle != style) {
+ while (curStart < stream.start) {
+ curStart = Math.min(stream.start, curStart + 5000);
+ f(curStart, curStyle);
+ }
+ curStyle = style;
+ }
+ stream.start = stream.pos;
+ }
+ while (curStart < stream.pos) {
+ // Webkit seems to refuse to render text nodes longer than 57444
+ // characters, and returns inaccurate measurements in nodes
+ // starting around 5000 chars.
+ var pos = Math.min(stream.pos, curStart + 5000);
+ f(pos, curStyle);
+ curStart = pos;
+ }
+ }
+
+ // Finds the line to start with when starting a parse. Tries to
+ // find a line with a stateAfter, so that it can start with a
+ // valid state. If that fails, it returns the line with the
+ // smallest indentation, which tends to need the least context to
+ // parse correctly.
+ function findStartLine(cm, n, precise) {
+ var minindent, minline, doc = cm.doc;
+ var lim = precise ? -1 : n - (cm.doc.mode.innerMode ? 1000 : 100);
+ for (var search = n; search > lim; --search) {
+ if (search <= doc.first) { return doc.first }
+ var line = getLine(doc, search - 1), after = line.stateAfter;
+ if (after && (!precise || search + (after instanceof SavedContext ? after.lookAhead : 0) <= doc.modeFrontier))
+ { return search }
+ var indented = countColumn(line.text, null, cm.options.tabSize);
+ if (minline == null || minindent > indented) {
+ minline = search - 1;
+ minindent = indented;
+ }
+ }
+ return minline
+ }
+
+ function retreatFrontier(doc, n) {
+ doc.modeFrontier = Math.min(doc.modeFrontier, n);
+ if (doc.highlightFrontier < n - 10) { return }
+ var start = doc.first;
+ for (var line = n - 1; line > start; line--) {
+ var saved = getLine(doc, line).stateAfter;
+ // change is on 3
+ // state on line 1 looked ahead 2 -- so saw 3
+ // test 1 + 2 < 3 should cover this
+ if (saved && (!(saved instanceof SavedContext) || line + saved.lookAhead < n)) {
+ start = line + 1;
+ break
+ }
+ }
+ doc.highlightFrontier = Math.min(doc.highlightFrontier, start);
+ }
+
+ // Optimize some code when these features are not used.
+ var sawReadOnlySpans = false, sawCollapsedSpans = false;
+
+ function seeReadOnlySpans() {
+ sawReadOnlySpans = true;
+ }
+
+ function seeCollapsedSpans() {
+ sawCollapsedSpans = true;
+ }
+
+ // TEXTMARKER SPANS
+
+ function MarkedSpan(marker, from, to) {
+ this.marker = marker;
+ this.from = from; this.to = to;
+ }
+
+ // Search an array of spans for a span matching the given marker.
+ function getMarkedSpanFor(spans, marker) {
+ if (spans) { for (var i = 0; i < spans.length; ++i) {
+ var span = spans[i];
+ if (span.marker == marker) { return span }
+ } }
+ }
+ // Remove a span from an array, returning undefined if no spans are
+ // left (we don't store arrays for lines without spans).
+ function removeMarkedSpan(spans, span) {
+ var r;
+ for (var i = 0; i < spans.length; ++i)
+ { if (spans[i] != span) { (r || (r = [])).push(spans[i]); } }
+ return r
+ }
+ // Add a span to a line.
+ function addMarkedSpan(line, span) {
+ line.markedSpans = line.markedSpans ? line.markedSpans.concat([span]) : [span];
+ span.marker.attachLine(line);
+ }
+
+ // Used for the algorithm that adjusts markers for a change in the
+ // document. These functions cut an array of spans at a given
+ // character position, returning an array of remaining chunks (or
+ // undefined if nothing remains).
+ function markedSpansBefore(old, startCh, isInsert) {
+ var nw;
+ if (old) { for (var i = 0; i < old.length; ++i) {
+ var span = old[i], marker = span.marker;
+ var startsBefore = span.from == null || (marker.inclusiveLeft ? span.from <= startCh : span.from < startCh);
+ if (startsBefore || span.from == startCh && marker.type == "bookmark" && (!isInsert || !span.marker.insertLeft)) {
+ var endsAfter = span.to == null || (marker.inclusiveRight ? span.to >= startCh : span.to > startCh)
+ ;(nw || (nw = [])).push(new MarkedSpan(marker, span.from, endsAfter ? null : span.to));
+ }
+ } }
+ return nw
+ }
+ function markedSpansAfter(old, endCh, isInsert) {
+ var nw;
+ if (old) { for (var i = 0; i < old.length; ++i) {
+ var span = old[i], marker = span.marker;
+ var endsAfter = span.to == null || (marker.inclusiveRight ? span.to >= endCh : span.to > endCh);
+ if (endsAfter || span.from == endCh && marker.type == "bookmark" && (!isInsert || span.marker.insertLeft)) {
+ var startsBefore = span.from == null || (marker.inclusiveLeft ? span.from <= endCh : span.from < endCh)
+ ;(nw || (nw = [])).push(new MarkedSpan(marker, startsBefore ? null : span.from - endCh,
+ span.to == null ? null : span.to - endCh));
+ }
+ } }
+ return nw
+ }
+
+ // Given a change object, compute the new set of marker spans that
+ // cover the line in which the change took place. Removes spans
+ // entirely within the change, reconnects spans belonging to the
+ // same marker that appear on both sides of the change, and cuts off
+ // spans partially within the change. Returns an array of span
+ // arrays with one element for each line in (after) the change.
+ function stretchSpansOverChange(doc, change) {
+ if (change.full) { return null }
+ var oldFirst = isLine(doc, change.from.line) && getLine(doc, change.from.line).markedSpans;
+ var oldLast = isLine(doc, change.to.line) && getLine(doc, change.to.line).markedSpans;
+ if (!oldFirst && !oldLast) { return null }
+
+ var startCh = change.from.ch, endCh = change.to.ch, isInsert = cmp(change.from, change.to) == 0;
+ // Get the spans that 'stick out' on both sides
+ var first = markedSpansBefore(oldFirst, startCh, isInsert);
+ var last = markedSpansAfter(oldLast, endCh, isInsert);
+
+ // Next, merge those two ends
+ var sameLine = change.text.length == 1, offset = lst(change.text).length + (sameLine ? startCh : 0);
+ if (first) {
+ // Fix up .to properties of first
+ for (var i = 0; i < first.length; ++i) {
+ var span = first[i];
+ if (span.to == null) {
+ var found = getMarkedSpanFor(last, span.marker);
+ if (!found) { span.to = startCh; }
+ else if (sameLine) { span.to = found.to == null ? null : found.to + offset; }
+ }
+ }
+ }
+ if (last) {
+ // Fix up .from in last (or move them into first in case of sameLine)
+ for (var i$1 = 0; i$1 < last.length; ++i$1) {
+ var span$1 = last[i$1];
+ if (span$1.to != null) { span$1.to += offset; }
+ if (span$1.from == null) {
+ var found$1 = getMarkedSpanFor(first, span$1.marker);
+ if (!found$1) {
+ span$1.from = offset;
+ if (sameLine) { (first || (first = [])).push(span$1); }
+ }
+ } else {
+ span$1.from += offset;
+ if (sameLine) { (first || (first = [])).push(span$1); }
+ }
+ }
+ }
+ // Make sure we didn't create any zero-length spans
+ if (first) { first = clearEmptySpans(first); }
+ if (last && last != first) { last = clearEmptySpans(last); }
+
+ var newMarkers = [first];
+ if (!sameLine) {
+ // Fill gap with whole-line-spans
+ var gap = change.text.length - 2, gapMarkers;
+ if (gap > 0 && first)
+ { for (var i$2 = 0; i$2 < first.length; ++i$2)
+ { if (first[i$2].to == null)
+ { (gapMarkers || (gapMarkers = [])).push(new MarkedSpan(first[i$2].marker, null, null)); } } }
+ for (var i$3 = 0; i$3 < gap; ++i$3)
+ { newMarkers.push(gapMarkers); }
+ newMarkers.push(last);
+ }
+ return newMarkers
+ }
+
+ // Remove spans that are empty and don't have a clearWhenEmpty
+ // option of false.
+ function clearEmptySpans(spans) {
+ for (var i = 0; i < spans.length; ++i) {
+ var span = spans[i];
+ if (span.from != null && span.from == span.to && span.marker.clearWhenEmpty !== false)
+ { spans.splice(i--, 1); }
+ }
+ if (!spans.length) { return null }
+ return spans
+ }
+
+ // Used to 'clip' out readOnly ranges when making a change.
+ function removeReadOnlyRanges(doc, from, to) {
+ var markers = null;
+ doc.iter(from.line, to.line + 1, function (line) {
+ if (line.markedSpans) { for (var i = 0; i < line.markedSpans.length; ++i) {
+ var mark = line.markedSpans[i].marker;
+ if (mark.readOnly && (!markers || indexOf(markers, mark) == -1))
+ { (markers || (markers = [])).push(mark); }
+ } }
+ });
+ if (!markers) { return null }
+ var parts = [{from: from, to: to}];
+ for (var i = 0; i < markers.length; ++i) {
+ var mk = markers[i], m = mk.find(0);
+ for (var j = 0; j < parts.length; ++j) {
+ var p = parts[j];
+ if (cmp(p.to, m.from) < 0 || cmp(p.from, m.to) > 0) { continue }
+ var newParts = [j, 1], dfrom = cmp(p.from, m.from), dto = cmp(p.to, m.to);
+ if (dfrom < 0 || !mk.inclusiveLeft && !dfrom)
+ { newParts.push({from: p.from, to: m.from}); }
+ if (dto > 0 || !mk.inclusiveRight && !dto)
+ { newParts.push({from: m.to, to: p.to}); }
+ parts.splice.apply(parts, newParts);
+ j += newParts.length - 3;
+ }
+ }
+ return parts
+ }
+
+ // Connect or disconnect spans from a line.
+ function detachMarkedSpans(line) {
+ var spans = line.markedSpans;
+ if (!spans) { return }
+ for (var i = 0; i < spans.length; ++i)
+ { spans[i].marker.detachLine(line); }
+ line.markedSpans = null;
+ }
+ function attachMarkedSpans(line, spans) {
+ if (!spans) { return }
+ for (var i = 0; i < spans.length; ++i)
+ { spans[i].marker.attachLine(line); }
+ line.markedSpans = spans;
+ }
+
+ // Helpers used when computing which overlapping collapsed span
+ // counts as the larger one.
+ function extraLeft(marker) { return marker.inclusiveLeft ? -1 : 0 }
+ function extraRight(marker) { return marker.inclusiveRight ? 1 : 0 }
+
+ // Returns a number indicating which of two overlapping collapsed
+ // spans is larger (and thus includes the other). Falls back to
+ // comparing ids when the spans cover exactly the same range.
+ function compareCollapsedMarkers(a, b) {
+ var lenDiff = a.lines.length - b.lines.length;
+ if (lenDiff != 0) { return lenDiff }
+ var aPos = a.find(), bPos = b.find();
+ var fromCmp = cmp(aPos.from, bPos.from) || extraLeft(a) - extraLeft(b);
+ if (fromCmp) { return -fromCmp }
+ var toCmp = cmp(aPos.to, bPos.to) || extraRight(a) - extraRight(b);
+ if (toCmp) { return toCmp }
+ return b.id - a.id
+ }
+
+ // Find out whether a line ends or starts in a collapsed span. If
+ // so, return the marker for that span.
+ function collapsedSpanAtSide(line, start) {
+ var sps = sawCollapsedSpans && line.markedSpans, found;
+ if (sps) { for (var sp = (void 0), i = 0; i < sps.length; ++i) {
+ sp = sps[i];
+ if (sp.marker.collapsed && (start ? sp.from : sp.to) == null &&
+ (!found || compareCollapsedMarkers(found, sp.marker) < 0))
+ { found = sp.marker; }
+ } }
+ return found
+ }
+ function collapsedSpanAtStart(line) { return collapsedSpanAtSide(line, true) }
+ function collapsedSpanAtEnd(line) { return collapsedSpanAtSide(line, false) }
+
+ function collapsedSpanAround(line, ch) {
+ var sps = sawCollapsedSpans && line.markedSpans, found;
+ if (sps) { for (var i = 0; i < sps.length; ++i) {
+ var sp = sps[i];
+ if (sp.marker.collapsed && (sp.from == null || sp.from < ch) && (sp.to == null || sp.to > ch) &&
+ (!found || compareCollapsedMarkers(found, sp.marker) < 0)) { found = sp.marker; }
+ } }
+ return found
+ }
+
+ // Test whether there exists a collapsed span that partially
+ // overlaps (covers the start or end, but not both) of a new span.
+ // Such overlap is not allowed.
+ function conflictingCollapsedRange(doc, lineNo, from, to, marker) {
+ var line = getLine(doc, lineNo);
+ var sps = sawCollapsedSpans && line.markedSpans;
+ if (sps) { for (var i = 0; i < sps.length; ++i) {
+ var sp = sps[i];
+ if (!sp.marker.collapsed) { continue }
+ var found = sp.marker.find(0);
+ var fromCmp = cmp(found.from, from) || extraLeft(sp.marker) - extraLeft(marker);
+ var toCmp = cmp(found.to, to) || extraRight(sp.marker) - extraRight(marker);
+ if (fromCmp >= 0 && toCmp <= 0 || fromCmp <= 0 && toCmp >= 0) { continue }
+ if (fromCmp <= 0 && (sp.marker.inclusiveRight && marker.inclusiveLeft ? cmp(found.to, from) >= 0 : cmp(found.to, from) > 0) ||
+ fromCmp >= 0 && (sp.marker.inclusiveRight && marker.inclusiveLeft ? cmp(found.from, to) <= 0 : cmp(found.from, to) < 0))
+ { return true }
+ } }
+ }
+
+ // A visual line is a line as drawn on the screen. Folding, for
+ // example, can cause multiple logical lines to appear on the same
+ // visual line. This finds the start of the visual line that the
+ // given line is part of (usually that is the line itself).
+ function visualLine(line) {
+ var merged;
+ while (merged = collapsedSpanAtStart(line))
+ { line = merged.find(-1, true).line; }
+ return line
+ }
+
+ function visualLineEnd(line) {
+ var merged;
+ while (merged = collapsedSpanAtEnd(line))
+ { line = merged.find(1, true).line; }
+ return line
+ }
+
+ // Returns an array of logical lines that continue the visual line
+ // started by the argument, or undefined if there are no such lines.
+ function visualLineContinued(line) {
+ var merged, lines;
+ while (merged = collapsedSpanAtEnd(line)) {
+ line = merged.find(1, true).line
+ ;(lines || (lines = [])).push(line);
+ }
+ return lines
+ }
+
+ // Get the line number of the start of the visual line that the
+ // given line number is part of.
+ function visualLineNo(doc, lineN) {
+ var line = getLine(doc, lineN), vis = visualLine(line);
+ if (line == vis) { return lineN }
+ return lineNo(vis)
+ }
+
+ // Get the line number of the start of the next visual line after
+ // the given line.
+ function visualLineEndNo(doc, lineN) {
+ if (lineN > doc.lastLine()) { return lineN }
+ var line = getLine(doc, lineN), merged;
+ if (!lineIsHidden(doc, line)) { return lineN }
+ while (merged = collapsedSpanAtEnd(line))
+ { line = merged.find(1, true).line; }
+ return lineNo(line) + 1
+ }
+
+ // Compute whether a line is hidden. Lines count as hidden when they
+ // are part of a visual line that starts with another line, or when
+ // they are entirely covered by collapsed, non-widget span.
+ function lineIsHidden(doc, line) {
+ var sps = sawCollapsedSpans && line.markedSpans;
+ if (sps) { for (var sp = (void 0), i = 0; i < sps.length; ++i) {
+ sp = sps[i];
+ if (!sp.marker.collapsed) { continue }
+ if (sp.from == null) { return true }
+ if (sp.marker.widgetNode) { continue }
+ if (sp.from == 0 && sp.marker.inclusiveLeft && lineIsHiddenInner(doc, line, sp))
+ { return true }
+ } }
+ }
+ function lineIsHiddenInner(doc, line, span) {
+ if (span.to == null) {
+ var end = span.marker.find(1, true);
+ return lineIsHiddenInner(doc, end.line, getMarkedSpanFor(end.line.markedSpans, span.marker))
+ }
+ if (span.marker.inclusiveRight && span.to == line.text.length)
+ { return true }
+ for (var sp = (void 0), i = 0; i < line.markedSpans.length; ++i) {
+ sp = line.markedSpans[i];
+ if (sp.marker.collapsed && !sp.marker.widgetNode && sp.from == span.to &&
+ (sp.to == null || sp.to != span.from) &&
+ (sp.marker.inclusiveLeft || span.marker.inclusiveRight) &&
+ lineIsHiddenInner(doc, line, sp)) { return true }
+ }
+ }
+
+ // Find the height above the given line.
+ function heightAtLine(lineObj) {
+ lineObj = visualLine(lineObj);
+
+ var h = 0, chunk = lineObj.parent;
+ for (var i = 0; i < chunk.lines.length; ++i) {
+ var line = chunk.lines[i];
+ if (line == lineObj) { break }
+ else { h += line.height; }
+ }
+ for (var p = chunk.parent; p; chunk = p, p = chunk.parent) {
+ for (var i$1 = 0; i$1 < p.children.length; ++i$1) {
+ var cur = p.children[i$1];
+ if (cur == chunk) { break }
+ else { h += cur.height; }
+ }
+ }
+ return h
+ }
+
+ // Compute the character length of a line, taking into account
+ // collapsed ranges (see markText) that might hide parts, and join
+ // other lines onto it.
+ function lineLength(line) {
+ if (line.height == 0) { return 0 }
+ var len = line.text.length, merged, cur = line;
+ while (merged = collapsedSpanAtStart(cur)) {
+ var found = merged.find(0, true);
+ cur = found.from.line;
+ len += found.from.ch - found.to.ch;
+ }
+ cur = line;
+ while (merged = collapsedSpanAtEnd(cur)) {
+ var found$1 = merged.find(0, true);
+ len -= cur.text.length - found$1.from.ch;
+ cur = found$1.to.line;
+ len += cur.text.length - found$1.to.ch;
+ }
+ return len
+ }
+
+ // Find the longest line in the document.
+ function findMaxLine(cm) {
+ var d = cm.display, doc = cm.doc;
+ d.maxLine = getLine(doc, doc.first);
+ d.maxLineLength = lineLength(d.maxLine);
+ d.maxLineChanged = true;
+ doc.iter(function (line) {
+ var len = lineLength(line);
+ if (len > d.maxLineLength) {
+ d.maxLineLength = len;
+ d.maxLine = line;
+ }
+ });
+ }
+
+ // LINE DATA STRUCTURE
+
+ // Line objects. These hold state related to a line, including
+ // highlighting info (the styles array).
+ var Line = function(text, markedSpans, estimateHeight) {
+ this.text = text;
+ attachMarkedSpans(this, markedSpans);
+ this.height = estimateHeight ? estimateHeight(this) : 1;
+ };
+
+ Line.prototype.lineNo = function () { return lineNo(this) };
+ eventMixin(Line);
+
+ // Change the content (text, markers) of a line. Automatically
+ // invalidates cached information and tries to re-estimate the
+ // line's height.
+ function updateLine(line, text, markedSpans, estimateHeight) {
+ line.text = text;
+ if (line.stateAfter) { line.stateAfter = null; }
+ if (line.styles) { line.styles = null; }
+ if (line.order != null) { line.order = null; }
+ detachMarkedSpans(line);
+ attachMarkedSpans(line, markedSpans);
+ var estHeight = estimateHeight ? estimateHeight(line) : 1;
+ if (estHeight != line.height) { updateLineHeight(line, estHeight); }
+ }
+
+ // Detach a line from the document tree and its markers.
+ function cleanUpLine(line) {
+ line.parent = null;
+ detachMarkedSpans(line);
+ }
+
+ // Convert a style as returned by a mode (either null, or a string
+ // containing one or more styles) to a CSS style. This is cached,
+ // and also looks for line-wide styles.
+ var styleToClassCache = {}, styleToClassCacheWithMode = {};
+ function interpretTokenStyle(style, options) {
+ if (!style || /^\s*$/.test(style)) { return null }
+ var cache = options.addModeClass ? styleToClassCacheWithMode : styleToClassCache;
+ return cache[style] ||
+ (cache[style] = style.replace(/\S+/g, "cm-$&"))
+ }
+
+ // Render the DOM representation of the text of a line. Also builds
+ // up a 'line map', which points at the DOM nodes that represent
+ // specific stretches of text, and is used by the measuring code.
+ // The returned object contains the DOM node, this map, and
+ // information about line-wide styles that were set by the mode.
+ function buildLineContent(cm, lineView) {
+ // The padding-right forces the element to have a 'border', which
+ // is needed on Webkit to be able to get line-level bounding
+ // rectangles for it (in measureChar).
+ var content = eltP("span", null, null, webkit ? "padding-right: .1px" : null);
+ var builder = {pre: eltP("pre", [content], "CodeMirror-line"), content: content,
+ col: 0, pos: 0, cm: cm,
+ trailingSpace: false,
+ splitSpaces: cm.getOption("lineWrapping")};
+ lineView.measure = {};
+
+ // Iterate over the logical lines that make up this visual line.
+ for (var i = 0; i <= (lineView.rest ? lineView.rest.length : 0); i++) {
+ var line = i ? lineView.rest[i - 1] : lineView.line, order = (void 0);
+ builder.pos = 0;
+ builder.addToken = buildToken;
+ // Optionally wire in some hacks into the token-rendering
+ // algorithm, to deal with browser quirks.
+ if (hasBadBidiRects(cm.display.measure) && (order = getOrder(line, cm.doc.direction)))
+ { builder.addToken = buildTokenBadBidi(builder.addToken, order); }
+ builder.map = [];
+ var allowFrontierUpdate = lineView != cm.display.externalMeasured && lineNo(line);
+ insertLineContent(line, builder, getLineStyles(cm, line, allowFrontierUpdate));
+ if (line.styleClasses) {
+ if (line.styleClasses.bgClass)
+ { builder.bgClass = joinClasses(line.styleClasses.bgClass, builder.bgClass || ""); }
+ if (line.styleClasses.textClass)
+ { builder.textClass = joinClasses(line.styleClasses.textClass, builder.textClass || ""); }
+ }
+
+ // Ensure at least a single node is present, for measuring.
+ if (builder.map.length == 0)
+ { builder.map.push(0, 0, builder.content.appendChild(zeroWidthElement(cm.display.measure))); }
+
+ // Store the map and a cache object for the current logical line
+ if (i == 0) {
+ lineView.measure.map = builder.map;
+ lineView.measure.cache = {};
+ } else {
+ (lineView.measure.maps || (lineView.measure.maps = [])).push(builder.map)
+ ;(lineView.measure.caches || (lineView.measure.caches = [])).push({});
+ }
+ }
+
+ // See issue #2901
+ if (webkit) {
+ var last = builder.content.lastChild;
+ if (/\bcm-tab\b/.test(last.className) || (last.querySelector && last.querySelector(".cm-tab")))
+ { builder.content.className = "cm-tab-wrap-hack"; }
+ }
+
+ signal(cm, "renderLine", cm, lineView.line, builder.pre);
+ if (builder.pre.className)
+ { builder.textClass = joinClasses(builder.pre.className, builder.textClass || ""); }
+
+ return builder
+ }
+
+ function defaultSpecialCharPlaceholder(ch) {
+ var token = elt("span", "\u2022", "cm-invalidchar");
+ token.title = "\\u" + ch.charCodeAt(0).toString(16);
+ token.setAttribute("aria-label", token.title);
+ return token
+ }
+
+ // Build up the DOM representation for a single token, and add it to
+ // the line map. Takes care to render special characters separately.
+ function buildToken(builder, text, style, startStyle, endStyle, css, attributes) {
+ if (!text) { return }
+ var displayText = builder.splitSpaces ? splitSpaces(text, builder.trailingSpace) : text;
+ var special = builder.cm.state.specialChars, mustWrap = false;
+ var content;
+ if (!special.test(text)) {
+ builder.col += text.length;
+ content = document.createTextNode(displayText);
+ builder.map.push(builder.pos, builder.pos + text.length, content);
+ if (ie && ie_version < 9) { mustWrap = true; }
+ builder.pos += text.length;
+ } else {
+ content = document.createDocumentFragment();
+ var pos = 0;
+ while (true) {
+ special.lastIndex = pos;
+ var m = special.exec(text);
+ var skipped = m ? m.index - pos : text.length - pos;
+ if (skipped) {
+ var txt = document.createTextNode(displayText.slice(pos, pos + skipped));
+ if (ie && ie_version < 9) { content.appendChild(elt("span", [txt])); }
+ else { content.appendChild(txt); }
+ builder.map.push(builder.pos, builder.pos + skipped, txt);
+ builder.col += skipped;
+ builder.pos += skipped;
+ }
+ if (!m) { break }
+ pos += skipped + 1;
+ var txt$1 = (void 0);
+ if (m[0] == "\t") {
+ var tabSize = builder.cm.options.tabSize, tabWidth = tabSize - builder.col % tabSize;
+ txt$1 = content.appendChild(elt("span", spaceStr(tabWidth), "cm-tab"));
+ txt$1.setAttribute("role", "presentation");
+ txt$1.setAttribute("cm-text", "\t");
+ builder.col += tabWidth;
+ } else if (m[0] == "\r" || m[0] == "\n") {
+ txt$1 = content.appendChild(elt("span", m[0] == "\r" ? "\u240d" : "\u2424", "cm-invalidchar"));
+ txt$1.setAttribute("cm-text", m[0]);
+ builder.col += 1;
+ } else {
+ txt$1 = builder.cm.options.specialCharPlaceholder(m[0]);
+ txt$1.setAttribute("cm-text", m[0]);
+ if (ie && ie_version < 9) { content.appendChild(elt("span", [txt$1])); }
+ else { content.appendChild(txt$1); }
+ builder.col += 1;
+ }
+ builder.map.push(builder.pos, builder.pos + 1, txt$1);
+ builder.pos++;
+ }
+ }
+ builder.trailingSpace = displayText.charCodeAt(text.length - 1) == 32;
+ if (style || startStyle || endStyle || mustWrap || css) {
+ var fullStyle = style || "";
+ if (startStyle) { fullStyle += startStyle; }
+ if (endStyle) { fullStyle += endStyle; }
+ var token = elt("span", [content], fullStyle, css);
+ if (attributes) {
+ for (var attr in attributes) { if (attributes.hasOwnProperty(attr) && attr != "style" && attr != "class")
+ { token.setAttribute(attr, attributes[attr]); } }
+ }
+ return builder.content.appendChild(token)
+ }
+ builder.content.appendChild(content);
+ }
+
+ // Change some spaces to NBSP to prevent the browser from collapsing
+ // trailing spaces at the end of a line when rendering text (issue #1362).
+ function splitSpaces(text, trailingBefore) {
+ if (text.length > 1 && !/ /.test(text)) { return text }
+ var spaceBefore = trailingBefore, result = "";
+ for (var i = 0; i < text.length; i++) {
+ var ch = text.charAt(i);
+ if (ch == " " && spaceBefore && (i == text.length - 1 || text.charCodeAt(i + 1) == 32))
+ { ch = "\u00a0"; }
+ result += ch;
+ spaceBefore = ch == " ";
+ }
+ return result
+ }
+
+ // Work around nonsense dimensions being reported for stretches of
+ // right-to-left text.
+ function buildTokenBadBidi(inner, order) {
+ return function (builder, text, style, startStyle, endStyle, css, attributes) {
+ style = style ? style + " cm-force-border" : "cm-force-border";
+ var start = builder.pos, end = start + text.length;
+ for (;;) {
+ // Find the part that overlaps with the start of this text
+ var part = (void 0);
+ for (var i = 0; i < order.length; i++) {
+ part = order[i];
+ if (part.to > start && part.from <= start) { break }
+ }
+ if (part.to >= end) { return inner(builder, text, style, startStyle, endStyle, css, attributes) }
+ inner(builder, text.slice(0, part.to - start), style, startStyle, null, css, attributes);
+ startStyle = null;
+ text = text.slice(part.to - start);
+ start = part.to;
+ }
+ }
+ }
+
+ function buildCollapsedSpan(builder, size, marker, ignoreWidget) {
+ var widget = !ignoreWidget && marker.widgetNode;
+ if (widget) { builder.map.push(builder.pos, builder.pos + size, widget); }
+ if (!ignoreWidget && builder.cm.display.input.needsContentAttribute) {
+ if (!widget)
+ { widget = builder.content.appendChild(document.createElement("span")); }
+ widget.setAttribute("cm-marker", marker.id);
+ }
+ if (widget) {
+ builder.cm.display.input.setUneditable(widget);
+ builder.content.appendChild(widget);
+ }
+ builder.pos += size;
+ builder.trailingSpace = false;
+ }
+
+ // Outputs a number of spans to make up a line, taking highlighting
+ // and marked text into account.
+ function insertLineContent(line, builder, styles) {
+ var spans = line.markedSpans, allText = line.text, at = 0;
+ if (!spans) {
+ for (var i$1 = 1; i$1 < styles.length; i$1+=2)
+ { builder.addToken(builder, allText.slice(at, at = styles[i$1]), interpretTokenStyle(styles[i$1+1], builder.cm.options)); }
+ return
+ }
+
+ var len = allText.length, pos = 0, i = 1, text = "", style, css;
+ var nextChange = 0, spanStyle, spanEndStyle, spanStartStyle, collapsed, attributes;
+ for (;;) {
+ if (nextChange == pos) { // Update current marker set
+ spanStyle = spanEndStyle = spanStartStyle = css = "";
+ attributes = null;
+ collapsed = null; nextChange = Infinity;
+ var foundBookmarks = [], endStyles = (void 0);
+ for (var j = 0; j < spans.length; ++j) {
+ var sp = spans[j], m = sp.marker;
+ if (m.type == "bookmark" && sp.from == pos && m.widgetNode) {
+ foundBookmarks.push(m);
+ } else if (sp.from <= pos && (sp.to == null || sp.to > pos || m.collapsed && sp.to == pos && sp.from == pos)) {
+ if (sp.to != null && sp.to != pos && nextChange > sp.to) {
+ nextChange = sp.to;
+ spanEndStyle = "";
+ }
+ if (m.className) { spanStyle += " " + m.className; }
+ if (m.css) { css = (css ? css + ";" : "") + m.css; }
+ if (m.startStyle && sp.from == pos) { spanStartStyle += " " + m.startStyle; }
+ if (m.endStyle && sp.to == nextChange) { (endStyles || (endStyles = [])).push(m.endStyle, sp.to); }
+ // support for the old title property
+ // https://github.com/codemirror/CodeMirror/pull/5673
+ if (m.title) { (attributes || (attributes = {})).title = m.title; }
+ if (m.attributes) {
+ for (var attr in m.attributes)
+ { (attributes || (attributes = {}))[attr] = m.attributes[attr]; }
+ }
+ if (m.collapsed && (!collapsed || compareCollapsedMarkers(collapsed.marker, m) < 0))
+ { collapsed = sp; }
+ } else if (sp.from > pos && nextChange > sp.from) {
+ nextChange = sp.from;
+ }
+ }
+ if (endStyles) { for (var j$1 = 0; j$1 < endStyles.length; j$1 += 2)
+ { if (endStyles[j$1 + 1] == nextChange) { spanEndStyle += " " + endStyles[j$1]; } } }
+
+ if (!collapsed || collapsed.from == pos) { for (var j$2 = 0; j$2 < foundBookmarks.length; ++j$2)
+ { buildCollapsedSpan(builder, 0, foundBookmarks[j$2]); } }
+ if (collapsed && (collapsed.from || 0) == pos) {
+ buildCollapsedSpan(builder, (collapsed.to == null ? len + 1 : collapsed.to) - pos,
+ collapsed.marker, collapsed.from == null);
+ if (collapsed.to == null) { return }
+ if (collapsed.to == pos) { collapsed = false; }
+ }
+ }
+ if (pos >= len) { break }
+
+ var upto = Math.min(len, nextChange);
+ while (true) {
+ if (text) {
+ var end = pos + text.length;
+ if (!collapsed) {
+ var tokenText = end > upto ? text.slice(0, upto - pos) : text;
+ builder.addToken(builder, tokenText, style ? style + spanStyle : spanStyle,
+ spanStartStyle, pos + tokenText.length == nextChange ? spanEndStyle : "", css, attributes);
+ }
+ if (end >= upto) {text = text.slice(upto - pos); pos = upto; break}
+ pos = end;
+ spanStartStyle = "";
+ }
+ text = allText.slice(at, at = styles[i++]);
+ style = interpretTokenStyle(styles[i++], builder.cm.options);
+ }
+ }
+ }
+
+
+ // These objects are used to represent the visible (currently drawn)
+ // part of the document. A LineView may correspond to multiple
+ // logical lines, if those are connected by collapsed ranges.
+ function LineView(doc, line, lineN) {
+ // The starting line
+ this.line = line;
+ // Continuing lines, if any
+ this.rest = visualLineContinued(line);
+ // Number of logical lines in this visual line
+ this.size = this.rest ? lineNo(lst(this.rest)) - lineN + 1 : 1;
+ this.node = this.text = null;
+ this.hidden = lineIsHidden(doc, line);
+ }
+
+ // Create a range of LineView objects for the given lines.
+ function buildViewArray(cm, from, to) {
+ var array = [], nextPos;
+ for (var pos = from; pos < to; pos = nextPos) {
+ var view = new LineView(cm.doc, getLine(cm.doc, pos), pos);
+ nextPos = pos + view.size;
+ array.push(view);
+ }
+ return array
+ }
+
+ var operationGroup = null;
+
+ function pushOperation(op) {
+ if (operationGroup) {
+ operationGroup.ops.push(op);
+ } else {
+ op.ownsGroup = operationGroup = {
+ ops: [op],
+ delayedCallbacks: []
+ };
+ }
+ }
+
+ function fireCallbacksForOps(group) {
+ // Calls delayed callbacks and cursorActivity handlers until no
+ // new ones appear
+ var callbacks = group.delayedCallbacks, i = 0;
+ do {
+ for (; i < callbacks.length; i++)
+ { callbacks[i].call(null); }
+ for (var j = 0; j < group.ops.length; j++) {
+ var op = group.ops[j];
+ if (op.cursorActivityHandlers)
+ { while (op.cursorActivityCalled < op.cursorActivityHandlers.length)
+ { op.cursorActivityHandlers[op.cursorActivityCalled++].call(null, op.cm); } }
+ }
+ } while (i < callbacks.length)
+ }
+
+ function finishOperation(op, endCb) {
+ var group = op.ownsGroup;
+ if (!group) { return }
+
+ try { fireCallbacksForOps(group); }
+ finally {
+ operationGroup = null;
+ endCb(group);
+ }
+ }
+
+ var orphanDelayedCallbacks = null;
+
+ // Often, we want to signal events at a point where we are in the
+ // middle of some work, but don't want the handler to start calling
+ // other methods on the editor, which might be in an inconsistent
+ // state or simply not expect any other events to happen.
+ // signalLater looks whether there are any handlers, and schedules
+ // them to be executed when the last operation ends, or, if no
+ // operation is active, when a timeout fires.
+ function signalLater(emitter, type /*, values...*/) {
+ var arr = getHandlers(emitter, type);
+ if (!arr.length) { return }
+ var args = Array.prototype.slice.call(arguments, 2), list;
+ if (operationGroup) {
+ list = operationGroup.delayedCallbacks;
+ } else if (orphanDelayedCallbacks) {
+ list = orphanDelayedCallbacks;
+ } else {
+ list = orphanDelayedCallbacks = [];
+ setTimeout(fireOrphanDelayed, 0);
+ }
+ var loop = function ( i ) {
+ list.push(function () { return arr[i].apply(null, args); });
+ };
+
+ for (var i = 0; i < arr.length; ++i)
+ loop( i );
+ }
+
+ function fireOrphanDelayed() {
+ var delayed = orphanDelayedCallbacks;
+ orphanDelayedCallbacks = null;
+ for (var i = 0; i < delayed.length; ++i) { delayed[i](); }
+ }
+
+ // When an aspect of a line changes, a string is added to
+ // lineView.changes. This updates the relevant part of the line's
+ // DOM structure.
+ function updateLineForChanges(cm, lineView, lineN, dims) {
+ for (var j = 0; j < lineView.changes.length; j++) {
+ var type = lineView.changes[j];
+ if (type == "text") { updateLineText(cm, lineView); }
+ else if (type == "gutter") { updateLineGutter(cm, lineView, lineN, dims); }
+ else if (type == "class") { updateLineClasses(cm, lineView); }
+ else if (type == "widget") { updateLineWidgets(cm, lineView, dims); }
+ }
+ lineView.changes = null;
+ }
+
+ // Lines with gutter elements, widgets or a background class need to
+ // be wrapped, and have the extra elements added to the wrapper div
+ function ensureLineWrapped(lineView) {
+ if (lineView.node == lineView.text) {
+ lineView.node = elt("div", null, null, "position: relative");
+ if (lineView.text.parentNode)
+ { lineView.text.parentNode.replaceChild(lineView.node, lineView.text); }
+ lineView.node.appendChild(lineView.text);
+ if (ie && ie_version < 8) { lineView.node.style.zIndex = 2; }
+ }
+ return lineView.node
+ }
+
+ function updateLineBackground(cm, lineView) {
+ var cls = lineView.bgClass ? lineView.bgClass + " " + (lineView.line.bgClass || "") : lineView.line.bgClass;
+ if (cls) { cls += " CodeMirror-linebackground"; }
+ if (lineView.background) {
+ if (cls) { lineView.background.className = cls; }
+ else { lineView.background.parentNode.removeChild(lineView.background); lineView.background = null; }
+ } else if (cls) {
+ var wrap = ensureLineWrapped(lineView);
+ lineView.background = wrap.insertBefore(elt("div", null, cls), wrap.firstChild);
+ cm.display.input.setUneditable(lineView.background);
+ }
+ }
+
+ // Wrapper around buildLineContent which will reuse the structure
+ // in display.externalMeasured when possible.
+ function getLineContent(cm, lineView) {
+ var ext = cm.display.externalMeasured;
+ if (ext && ext.line == lineView.line) {
+ cm.display.externalMeasured = null;
+ lineView.measure = ext.measure;
+ return ext.built
+ }
+ return buildLineContent(cm, lineView)
+ }
+
+ // Redraw the line's text. Interacts with the background and text
+ // classes because the mode may output tokens that influence these
+ // classes.
+ function updateLineText(cm, lineView) {
+ var cls = lineView.text.className;
+ var built = getLineContent(cm, lineView);
+ if (lineView.text == lineView.node) { lineView.node = built.pre; }
+ lineView.text.parentNode.replaceChild(built.pre, lineView.text);
+ lineView.text = built.pre;
+ if (built.bgClass != lineView.bgClass || built.textClass != lineView.textClass) {
+ lineView.bgClass = built.bgClass;
+ lineView.textClass = built.textClass;
+ updateLineClasses(cm, lineView);
+ } else if (cls) {
+ lineView.text.className = cls;
+ }
+ }
+
+ function updateLineClasses(cm, lineView) {
+ updateLineBackground(cm, lineView);
+ if (lineView.line.wrapClass)
+ { ensureLineWrapped(lineView).className = lineView.line.wrapClass; }
+ else if (lineView.node != lineView.text)
+ { lineView.node.className = ""; }
+ var textClass = lineView.textClass ? lineView.textClass + " " + (lineView.line.textClass || "") : lineView.line.textClass;
+ lineView.text.className = textClass || "";
+ }
+
+ function updateLineGutter(cm, lineView, lineN, dims) {
+ if (lineView.gutter) {
+ lineView.node.removeChild(lineView.gutter);
+ lineView.gutter = null;
+ }
+ if (lineView.gutterBackground) {
+ lineView.node.removeChild(lineView.gutterBackground);
+ lineView.gutterBackground = null;
+ }
+ if (lineView.line.gutterClass) {
+ var wrap = ensureLineWrapped(lineView);
+ lineView.gutterBackground = elt("div", null, "CodeMirror-gutter-background " + lineView.line.gutterClass,
+ ("left: " + (cm.options.fixedGutter ? dims.fixedPos : -dims.gutterTotalWidth) + "px; width: " + (dims.gutterTotalWidth) + "px"));
+ cm.display.input.setUneditable(lineView.gutterBackground);
+ wrap.insertBefore(lineView.gutterBackground, lineView.text);
+ }
+ var markers = lineView.line.gutterMarkers;
+ if (cm.options.lineNumbers || markers) {
+ var wrap$1 = ensureLineWrapped(lineView);
+ var gutterWrap = lineView.gutter = elt("div", null, "CodeMirror-gutter-wrapper", ("left: " + (cm.options.fixedGutter ? dims.fixedPos : -dims.gutterTotalWidth) + "px"));
+ cm.display.input.setUneditable(gutterWrap);
+ wrap$1.insertBefore(gutterWrap, lineView.text);
+ if (lineView.line.gutterClass)
+ { gutterWrap.className += " " + lineView.line.gutterClass; }
+ if (cm.options.lineNumbers && (!markers || !markers["CodeMirror-linenumbers"]))
+ { lineView.lineNumber = gutterWrap.appendChild(
+ elt("div", lineNumberFor(cm.options, lineN),
+ "CodeMirror-linenumber CodeMirror-gutter-elt",
+ ("left: " + (dims.gutterLeft["CodeMirror-linenumbers"]) + "px; width: " + (cm.display.lineNumInnerWidth) + "px"))); }
+ if (markers) { for (var k = 0; k < cm.display.gutterSpecs.length; ++k) {
+ var id = cm.display.gutterSpecs[k].className, found = markers.hasOwnProperty(id) && markers[id];
+ if (found)
+ { gutterWrap.appendChild(elt("div", [found], "CodeMirror-gutter-elt",
+ ("left: " + (dims.gutterLeft[id]) + "px; width: " + (dims.gutterWidth[id]) + "px"))); }
+ } }
+ }
+ }
+
+ function updateLineWidgets(cm, lineView, dims) {
+ if (lineView.alignable) { lineView.alignable = null; }
+ var isWidget = classTest("CodeMirror-linewidget");
+ for (var node = lineView.node.firstChild, next = (void 0); node; node = next) {
+ next = node.nextSibling;
+ if (isWidget.test(node.className)) { lineView.node.removeChild(node); }
+ }
+ insertLineWidgets(cm, lineView, dims);
+ }
+
+ // Build a line's DOM representation from scratch
+ function buildLineElement(cm, lineView, lineN, dims) {
+ var built = getLineContent(cm, lineView);
+ lineView.text = lineView.node = built.pre;
+ if (built.bgClass) { lineView.bgClass = built.bgClass; }
+ if (built.textClass) { lineView.textClass = built.textClass; }
+
+ updateLineClasses(cm, lineView);
+ updateLineGutter(cm, lineView, lineN, dims);
+ insertLineWidgets(cm, lineView, dims);
+ return lineView.node
+ }
+
+ // A lineView may contain multiple logical lines (when merged by
+ // collapsed spans). The widgets for all of them need to be drawn.
+ function insertLineWidgets(cm, lineView, dims) {
+ insertLineWidgetsFor(cm, lineView.line, lineView, dims, true);
+ if (lineView.rest) { for (var i = 0; i < lineView.rest.length; i++)
+ { insertLineWidgetsFor(cm, lineView.rest[i], lineView, dims, false); } }
+ }
+
+ function insertLineWidgetsFor(cm, line, lineView, dims, allowAbove) {
+ if (!line.widgets) { return }
+ var wrap = ensureLineWrapped(lineView);
+ for (var i = 0, ws = line.widgets; i < ws.length; ++i) {
+ var widget = ws[i], node = elt("div", [widget.node], "CodeMirror-linewidget" + (widget.className ? " " + widget.className : ""));
+ if (!widget.handleMouseEvents) { node.setAttribute("cm-ignore-events", "true"); }
+ positionLineWidget(widget, node, lineView, dims);
+ cm.display.input.setUneditable(node);
+ if (allowAbove && widget.above)
+ { wrap.insertBefore(node, lineView.gutter || lineView.text); }
+ else
+ { wrap.appendChild(node); }
+ signalLater(widget, "redraw");
+ }
+ }
+
+ function positionLineWidget(widget, node, lineView, dims) {
+ if (widget.noHScroll) {
+ (lineView.alignable || (lineView.alignable = [])).push(node);
+ var width = dims.wrapperWidth;
+ node.style.left = dims.fixedPos + "px";
+ if (!widget.coverGutter) {
+ width -= dims.gutterTotalWidth;
+ node.style.paddingLeft = dims.gutterTotalWidth + "px";
+ }
+ node.style.width = width + "px";
+ }
+ if (widget.coverGutter) {
+ node.style.zIndex = 5;
+ node.style.position = "relative";
+ if (!widget.noHScroll) { node.style.marginLeft = -dims.gutterTotalWidth + "px"; }
+ }
+ }
+
+ function widgetHeight(widget) {
+ if (widget.height != null) { return widget.height }
+ var cm = widget.doc.cm;
+ if (!cm) { return 0 }
+ if (!contains(document.body, widget.node)) {
+ var parentStyle = "position: relative;";
+ if (widget.coverGutter)
+ { parentStyle += "margin-left: -" + cm.display.gutters.offsetWidth + "px;"; }
+ if (widget.noHScroll)
+ { parentStyle += "width: " + cm.display.wrapper.clientWidth + "px;"; }
+ removeChildrenAndAdd(cm.display.measure, elt("div", [widget.node], null, parentStyle));
+ }
+ return widget.height = widget.node.parentNode.offsetHeight
+ }
+
+ // Return true when the given mouse event happened in a widget
+ function eventInWidget(display, e) {
+ for (var n = e_target(e); n != display.wrapper; n = n.parentNode) {
+ if (!n || (n.nodeType == 1 && n.getAttribute("cm-ignore-events") == "true") ||
+ (n.parentNode == display.sizer && n != display.mover))
+ { return true }
+ }
+ }
+
+ // POSITION MEASUREMENT
+
+ function paddingTop(display) {return display.lineSpace.offsetTop}
+ function paddingVert(display) {return display.mover.offsetHeight - display.lineSpace.offsetHeight}
+ function paddingH(display) {
+ if (display.cachedPaddingH) { return display.cachedPaddingH }
+ var e = removeChildrenAndAdd(display.measure, elt("pre", "x", "CodeMirror-line-like"));
+ var style = window.getComputedStyle ? window.getComputedStyle(e) : e.currentStyle;
+ var data = {left: parseInt(style.paddingLeft), right: parseInt(style.paddingRight)};
+ if (!isNaN(data.left) && !isNaN(data.right)) { display.cachedPaddingH = data; }
+ return data
+ }
+
+ function scrollGap(cm) { return scrollerGap - cm.display.nativeBarWidth }
+ function displayWidth(cm) {
+ return cm.display.scroller.clientWidth - scrollGap(cm) - cm.display.barWidth
+ }
+ function displayHeight(cm) {
+ return cm.display.scroller.clientHeight - scrollGap(cm) - cm.display.barHeight
+ }
+
+ // Ensure the lineView.wrapping.heights array is populated. This is
+ // an array of bottom offsets for the lines that make up a drawn
+ // line. When lineWrapping is on, there might be more than one
+ // height.
+ function ensureLineHeights(cm, lineView, rect) {
+ var wrapping = cm.options.lineWrapping;
+ var curWidth = wrapping && displayWidth(cm);
+ if (!lineView.measure.heights || wrapping && lineView.measure.width != curWidth) {
+ var heights = lineView.measure.heights = [];
+ if (wrapping) {
+ lineView.measure.width = curWidth;
+ var rects = lineView.text.firstChild.getClientRects();
+ for (var i = 0; i < rects.length - 1; i++) {
+ var cur = rects[i], next = rects[i + 1];
+ if (Math.abs(cur.bottom - next.bottom) > 2)
+ { heights.push((cur.bottom + next.top) / 2 - rect.top); }
+ }
+ }
+ heights.push(rect.bottom - rect.top);
+ }
+ }
+
+ // Find a line map (mapping character offsets to text nodes) and a
+ // measurement cache for the given line number. (A line view might
+ // contain multiple lines when collapsed ranges are present.)
+ function mapFromLineView(lineView, line, lineN) {
+ if (lineView.line == line)
+ { return {map: lineView.measure.map, cache: lineView.measure.cache} }
+ for (var i = 0; i < lineView.rest.length; i++)
+ { if (lineView.rest[i] == line)
+ { return {map: lineView.measure.maps[i], cache: lineView.measure.caches[i]} } }
+ for (var i$1 = 0; i$1 < lineView.rest.length; i$1++)
+ { if (lineNo(lineView.rest[i$1]) > lineN)
+ { return {map: lineView.measure.maps[i$1], cache: lineView.measure.caches[i$1], before: true} } }
+ }
+
+ // Render a line into the hidden node display.externalMeasured. Used
+ // when measurement is needed for a line that's not in the viewport.
+ function updateExternalMeasurement(cm, line) {
+ line = visualLine(line);
+ var lineN = lineNo(line);
+ var view = cm.display.externalMeasured = new LineView(cm.doc, line, lineN);
+ view.lineN = lineN;
+ var built = view.built = buildLineContent(cm, view);
+ view.text = built.pre;
+ removeChildrenAndAdd(cm.display.lineMeasure, built.pre);
+ return view
+ }
+
+ // Get a {top, bottom, left, right} box (in line-local coordinates)
+ // for a given character.
+ function measureChar(cm, line, ch, bias) {
+ return measureCharPrepared(cm, prepareMeasureForLine(cm, line), ch, bias)
+ }
+
+ // Find a line view that corresponds to the given line number.
+ function findViewForLine(cm, lineN) {
+ if (lineN >= cm.display.viewFrom && lineN < cm.display.viewTo)
+ { return cm.display.view[findViewIndex(cm, lineN)] }
+ var ext = cm.display.externalMeasured;
+ if (ext && lineN >= ext.lineN && lineN < ext.lineN + ext.size)
+ { return ext }
+ }
+
+ // Measurement can be split in two steps, the set-up work that
+ // applies to the whole line, and the measurement of the actual
+ // character. Functions like coordsChar, that need to do a lot of
+ // measurements in a row, can thus ensure that the set-up work is
+ // only done once.
+ function prepareMeasureForLine(cm, line) {
+ var lineN = lineNo(line);
+ var view = findViewForLine(cm, lineN);
+ if (view && !view.text) {
+ view = null;
+ } else if (view && view.changes) {
+ updateLineForChanges(cm, view, lineN, getDimensions(cm));
+ cm.curOp.forceUpdate = true;
+ }
+ if (!view)
+ { view = updateExternalMeasurement(cm, line); }
+
+ var info = mapFromLineView(view, line, lineN);
+ return {
+ line: line, view: view, rect: null,
+ map: info.map, cache: info.cache, before: info.before,
+ hasHeights: false
+ }
+ }
+
+ // Given a prepared measurement object, measures the position of an
+ // actual character (or fetches it from the cache).
+ function measureCharPrepared(cm, prepared, ch, bias, varHeight) {
+ if (prepared.before) { ch = -1; }
+ var key = ch + (bias || ""), found;
+ if (prepared.cache.hasOwnProperty(key)) {
+ found = prepared.cache[key];
+ } else {
+ if (!prepared.rect)
+ { prepared.rect = prepared.view.text.getBoundingClientRect(); }
+ if (!prepared.hasHeights) {
+ ensureLineHeights(cm, prepared.view, prepared.rect);
+ prepared.hasHeights = true;
+ }
+ found = measureCharInner(cm, prepared, ch, bias);
+ if (!found.bogus) { prepared.cache[key] = found; }
+ }
+ return {left: found.left, right: found.right,
+ top: varHeight ? found.rtop : found.top,
+ bottom: varHeight ? found.rbottom : found.bottom}
+ }
+
+ var nullRect = {left: 0, right: 0, top: 0, bottom: 0};
+
+ function nodeAndOffsetInLineMap(map, ch, bias) {
+ var node, start, end, collapse, mStart, mEnd;
+ // First, search the line map for the text node corresponding to,
+ // or closest to, the target character.
+ for (var i = 0; i < map.length; i += 3) {
+ mStart = map[i];
+ mEnd = map[i + 1];
+ if (ch < mStart) {
+ start = 0; end = 1;
+ collapse = "left";
+ } else if (ch < mEnd) {
+ start = ch - mStart;
+ end = start + 1;
+ } else if (i == map.length - 3 || ch == mEnd && map[i + 3] > ch) {
+ end = mEnd - mStart;
+ start = end - 1;
+ if (ch >= mEnd) { collapse = "right"; }
+ }
+ if (start != null) {
+ node = map[i + 2];
+ if (mStart == mEnd && bias == (node.insertLeft ? "left" : "right"))
+ { collapse = bias; }
+ if (bias == "left" && start == 0)
+ { while (i && map[i - 2] == map[i - 3] && map[i - 1].insertLeft) {
+ node = map[(i -= 3) + 2];
+ collapse = "left";
+ } }
+ if (bias == "right" && start == mEnd - mStart)
+ { while (i < map.length - 3 && map[i + 3] == map[i + 4] && !map[i + 5].insertLeft) {
+ node = map[(i += 3) + 2];
+ collapse = "right";
+ } }
+ break
+ }
+ }
+ return {node: node, start: start, end: end, collapse: collapse, coverStart: mStart, coverEnd: mEnd}
+ }
+
+ function getUsefulRect(rects, bias) {
+ var rect = nullRect;
+ if (bias == "left") { for (var i = 0; i < rects.length; i++) {
+ if ((rect = rects[i]).left != rect.right) { break }
+ } } else { for (var i$1 = rects.length - 1; i$1 >= 0; i$1--) {
+ if ((rect = rects[i$1]).left != rect.right) { break }
+ } }
+ return rect
+ }
+
+ function measureCharInner(cm, prepared, ch, bias) {
+ var place = nodeAndOffsetInLineMap(prepared.map, ch, bias);
+ var node = place.node, start = place.start, end = place.end, collapse = place.collapse;
+
+ var rect;
+ if (node.nodeType == 3) { // If it is a text node, use a range to retrieve the coordinates.
+ for (var i$1 = 0; i$1 < 4; i$1++) { // Retry a maximum of 4 times when nonsense rectangles are returned
+ while (start && isExtendingChar(prepared.line.text.charAt(place.coverStart + start))) { --start; }
+ while (place.coverStart + end < place.coverEnd && isExtendingChar(prepared.line.text.charAt(place.coverStart + end))) { ++end; }
+ if (ie && ie_version < 9 && start == 0 && end == place.coverEnd - place.coverStart)
+ { rect = node.parentNode.getBoundingClientRect(); }
+ else
+ { rect = getUsefulRect(range(node, start, end).getClientRects(), bias); }
+ if (rect.left || rect.right || start == 0) { break }
+ end = start;
+ start = start - 1;
+ collapse = "right";
+ }
+ if (ie && ie_version < 11) { rect = maybeUpdateRectForZooming(cm.display.measure, rect); }
+ } else { // If it is a widget, simply get the box for the whole widget.
+ if (start > 0) { collapse = bias = "right"; }
+ var rects;
+ if (cm.options.lineWrapping && (rects = node.getClientRects()).length > 1)
+ { rect = rects[bias == "right" ? rects.length - 1 : 0]; }
+ else
+ { rect = node.getBoundingClientRect(); }
+ }
+ if (ie && ie_version < 9 && !start && (!rect || !rect.left && !rect.right)) {
+ var rSpan = node.parentNode.getClientRects()[0];
+ if (rSpan)
+ { rect = {left: rSpan.left, right: rSpan.left + charWidth(cm.display), top: rSpan.top, bottom: rSpan.bottom}; }
+ else
+ { rect = nullRect; }
+ }
+
+ var rtop = rect.top - prepared.rect.top, rbot = rect.bottom - prepared.rect.top;
+ var mid = (rtop + rbot) / 2;
+ var heights = prepared.view.measure.heights;
+ var i = 0;
+ for (; i < heights.length - 1; i++)
+ { if (mid < heights[i]) { break } }
+ var top = i ? heights[i - 1] : 0, bot = heights[i];
+ var result = {left: (collapse == "right" ? rect.right : rect.left) - prepared.rect.left,
+ right: (collapse == "left" ? rect.left : rect.right) - prepared.rect.left,
+ top: top, bottom: bot};
+ if (!rect.left && !rect.right) { result.bogus = true; }
+ if (!cm.options.singleCursorHeightPerLine) { result.rtop = rtop; result.rbottom = rbot; }
+
+ return result
+ }
+
+ // Work around problem with bounding client rects on ranges being
+ // returned incorrectly when zoomed on IE10 and below.
+ function maybeUpdateRectForZooming(measure, rect) {
+ if (!window.screen || screen.logicalXDPI == null ||
+ screen.logicalXDPI == screen.deviceXDPI || !hasBadZoomedRects(measure))
+ { return rect }
+ var scaleX = screen.logicalXDPI / screen.deviceXDPI;
+ var scaleY = screen.logicalYDPI / screen.deviceYDPI;
+ return {left: rect.left * scaleX, right: rect.right * scaleX,
+ top: rect.top * scaleY, bottom: rect.bottom * scaleY}
+ }
+
+ function clearLineMeasurementCacheFor(lineView) {
+ if (lineView.measure) {
+ lineView.measure.cache = {};
+ lineView.measure.heights = null;
+ if (lineView.rest) { for (var i = 0; i < lineView.rest.length; i++)
+ { lineView.measure.caches[i] = {}; } }
+ }
+ }
+
+ function clearLineMeasurementCache(cm) {
+ cm.display.externalMeasure = null;
+ removeChildren(cm.display.lineMeasure);
+ for (var i = 0; i < cm.display.view.length; i++)
+ { clearLineMeasurementCacheFor(cm.display.view[i]); }
+ }
+
+ function clearCaches(cm) {
+ clearLineMeasurementCache(cm);
+ cm.display.cachedCharWidth = cm.display.cachedTextHeight = cm.display.cachedPaddingH = null;
+ if (!cm.options.lineWrapping) { cm.display.maxLineChanged = true; }
+ cm.display.lineNumChars = null;
+ }
+
+ function pageScrollX() {
+ // Work around https://bugs.chromium.org/p/chromium/issues/detail?id=489206
+ // which causes page_Offset and bounding client rects to use
+ // different reference viewports and invalidate our calculations.
+ if (chrome && android) { return -(document.body.getBoundingClientRect().left - parseInt(getComputedStyle(document.body).marginLeft)) }
+ return window.pageXOffset || (document.documentElement || document.body).scrollLeft
+ }
+ function pageScrollY() {
+ if (chrome && android) { return -(document.body.getBoundingClientRect().top - parseInt(getComputedStyle(document.body).marginTop)) }
+ return window.pageYOffset || (document.documentElement || document.body).scrollTop
+ }
+
+ function widgetTopHeight(lineObj) {
+ var height = 0;
+ if (lineObj.widgets) { for (var i = 0; i < lineObj.widgets.length; ++i) { if (lineObj.widgets[i].above)
+ { height += widgetHeight(lineObj.widgets[i]); } } }
+ return height
+ }
+
+ // Converts a {top, bottom, left, right} box from line-local
+ // coordinates into another coordinate system. Context may be one of
+ // "line", "div" (display.lineDiv), "local"./null (editor), "window",
+ // or "page".
+ function intoCoordSystem(cm, lineObj, rect, context, includeWidgets) {
+ if (!includeWidgets) {
+ var height = widgetTopHeight(lineObj);
+ rect.top += height; rect.bottom += height;
+ }
+ if (context == "line") { return rect }
+ if (!context) { context = "local"; }
+ var yOff = heightAtLine(lineObj);
+ if (context == "local") { yOff += paddingTop(cm.display); }
+ else { yOff -= cm.display.viewOffset; }
+ if (context == "page" || context == "window") {
+ var lOff = cm.display.lineSpace.getBoundingClientRect();
+ yOff += lOff.top + (context == "window" ? 0 : pageScrollY());
+ var xOff = lOff.left + (context == "window" ? 0 : pageScrollX());
+ rect.left += xOff; rect.right += xOff;
+ }
+ rect.top += yOff; rect.bottom += yOff;
+ return rect
+ }
+
+ // Coverts a box from "div" coords to another coordinate system.
+ // Context may be "window", "page", "div", or "local"./null.
+ function fromCoordSystem(cm, coords, context) {
+ if (context == "div") { return coords }
+ var left = coords.left, top = coords.top;
+ // First move into "page" coordinate system
+ if (context == "page") {
+ left -= pageScrollX();
+ top -= pageScrollY();
+ } else if (context == "local" || !context) {
+ var localBox = cm.display.sizer.getBoundingClientRect();
+ left += localBox.left;
+ top += localBox.top;
+ }
+
+ var lineSpaceBox = cm.display.lineSpace.getBoundingClientRect();
+ return {left: left - lineSpaceBox.left, top: top - lineSpaceBox.top}
+ }
+
+ function charCoords(cm, pos, context, lineObj, bias) {
+ if (!lineObj) { lineObj = getLine(cm.doc, pos.line); }
+ return intoCoordSystem(cm, lineObj, measureChar(cm, lineObj, pos.ch, bias), context)
+ }
+
+ // Returns a box for a given cursor position, which may have an
+ // 'other' property containing the position of the secondary cursor
+ // on a bidi boundary.
+ // A cursor Pos(line, char, "before") is on the same visual line as `char - 1`
+ // and after `char - 1` in writing order of `char - 1`
+ // A cursor Pos(line, char, "after") is on the same visual line as `char`
+ // and before `char` in writing order of `char`
+ // Examples (upper-case letters are RTL, lower-case are LTR):
+ // Pos(0, 1, ...)
+ // before after
+ // ab a|b a|b
+ // aB a|B aB|
+ // Ab |Ab A|b
+ // AB B|A B|A
+ // Every position after the last character on a line is considered to stick
+ // to the last character on the line.
+ function cursorCoords(cm, pos, context, lineObj, preparedMeasure, varHeight) {
+ lineObj = lineObj || getLine(cm.doc, pos.line);
+ if (!preparedMeasure) { preparedMeasure = prepareMeasureForLine(cm, lineObj); }
+ function get(ch, right) {
+ var m = measureCharPrepared(cm, preparedMeasure, ch, right ? "right" : "left", varHeight);
+ if (right) { m.left = m.right; } else { m.right = m.left; }
+ return intoCoordSystem(cm, lineObj, m, context)
+ }
+ var order = getOrder(lineObj, cm.doc.direction), ch = pos.ch, sticky = pos.sticky;
+ if (ch >= lineObj.text.length) {
+ ch = lineObj.text.length;
+ sticky = "before";
+ } else if (ch <= 0) {
+ ch = 0;
+ sticky = "after";
+ }
+ if (!order) { return get(sticky == "before" ? ch - 1 : ch, sticky == "before") }
+
+ function getBidi(ch, partPos, invert) {
+ var part = order[partPos], right = part.level == 1;
+ return get(invert ? ch - 1 : ch, right != invert)
+ }
+ var partPos = getBidiPartAt(order, ch, sticky);
+ var other = bidiOther;
+ var val = getBidi(ch, partPos, sticky == "before");
+ if (other != null) { val.other = getBidi(ch, other, sticky != "before"); }
+ return val
+ }
+
+ // Used to cheaply estimate the coordinates for a position. Used for
+ // intermediate scroll updates.
+ function estimateCoords(cm, pos) {
+ var left = 0;
+ pos = clipPos(cm.doc, pos);
+ if (!cm.options.lineWrapping) { left = charWidth(cm.display) * pos.ch; }
+ var lineObj = getLine(cm.doc, pos.line);
+ var top = heightAtLine(lineObj) + paddingTop(cm.display);
+ return {left: left, right: left, top: top, bottom: top + lineObj.height}
+ }
+
+ // Positions returned by coordsChar contain some extra information.
+ // xRel is the relative x position of the input coordinates compared
+ // to the found position (so xRel > 0 means the coordinates are to
+ // the right of the character position, for example). When outside
+ // is true, that means the coordinates lie outside the line's
+ // vertical range.
+ function PosWithInfo(line, ch, sticky, outside, xRel) {
+ var pos = Pos(line, ch, sticky);
+ pos.xRel = xRel;
+ if (outside) { pos.outside = outside; }
+ return pos
+ }
+
+ // Compute the character position closest to the given coordinates.
+ // Input must be lineSpace-local ("div" coordinate system).
+ function coordsChar(cm, x, y) {
+ var doc = cm.doc;
+ y += cm.display.viewOffset;
+ if (y < 0) { return PosWithInfo(doc.first, 0, null, -1, -1) }
+ var lineN = lineAtHeight(doc, y), last = doc.first + doc.size - 1;
+ if (lineN > last)
+ { return PosWithInfo(doc.first + doc.size - 1, getLine(doc, last).text.length, null, 1, 1) }
+ if (x < 0) { x = 0; }
+
+ var lineObj = getLine(doc, lineN);
+ for (;;) {
+ var found = coordsCharInner(cm, lineObj, lineN, x, y);
+ var collapsed = collapsedSpanAround(lineObj, found.ch + (found.xRel > 0 || found.outside > 0 ? 1 : 0));
+ if (!collapsed) { return found }
+ var rangeEnd = collapsed.find(1);
+ if (rangeEnd.line == lineN) { return rangeEnd }
+ lineObj = getLine(doc, lineN = rangeEnd.line);
+ }
+ }
+
+ function wrappedLineExtent(cm, lineObj, preparedMeasure, y) {
+ y -= widgetTopHeight(lineObj);
+ var end = lineObj.text.length;
+ var begin = findFirst(function (ch) { return measureCharPrepared(cm, preparedMeasure, ch - 1).bottom <= y; }, end, 0);
+ end = findFirst(function (ch) { return measureCharPrepared(cm, preparedMeasure, ch).top > y; }, begin, end);
+ return {begin: begin, end: end}
+ }
+
+ function wrappedLineExtentChar(cm, lineObj, preparedMeasure, target) {
+ if (!preparedMeasure) { preparedMeasure = prepareMeasureForLine(cm, lineObj); }
+ var targetTop = intoCoordSystem(cm, lineObj, measureCharPrepared(cm, preparedMeasure, target), "line").top;
+ return wrappedLineExtent(cm, lineObj, preparedMeasure, targetTop)
+ }
+
+ // Returns true if the given side of a box is after the given
+ // coordinates, in top-to-bottom, left-to-right order.
+ function boxIsAfter(box, x, y, left) {
+ return box.bottom <= y ? false : box.top > y ? true : (left ? box.left : box.right) > x
+ }
+
+ function coordsCharInner(cm, lineObj, lineNo, x, y) {
+ // Move y into line-local coordinate space
+ y -= heightAtLine(lineObj);
+ var preparedMeasure = prepareMeasureForLine(cm, lineObj);
+ // When directly calling `measureCharPrepared`, we have to adjust
+ // for the widgets at this line.
+ var widgetHeight = widgetTopHeight(lineObj);
+ var begin = 0, end = lineObj.text.length, ltr = true;
+
+ var order = getOrder(lineObj, cm.doc.direction);
+ // If the line isn't plain left-to-right text, first figure out
+ // which bidi section the coordinates fall into.
+ if (order) {
+ var part = (cm.options.lineWrapping ? coordsBidiPartWrapped : coordsBidiPart)
+ (cm, lineObj, lineNo, preparedMeasure, order, x, y);
+ ltr = part.level != 1;
+ // The awkward -1 offsets are needed because findFirst (called
+ // on these below) will treat its first bound as inclusive,
+ // second as exclusive, but we want to actually address the
+ // characters in the part's range
+ begin = ltr ? part.from : part.to - 1;
+ end = ltr ? part.to : part.from - 1;
+ }
+
+ // A binary search to find the first character whose bounding box
+ // starts after the coordinates. If we run across any whose box wrap
+ // the coordinates, store that.
+ var chAround = null, boxAround = null;
+ var ch = findFirst(function (ch) {
+ var box = measureCharPrepared(cm, preparedMeasure, ch);
+ box.top += widgetHeight; box.bottom += widgetHeight;
+ if (!boxIsAfter(box, x, y, false)) { return false }
+ if (box.top <= y && box.left <= x) {
+ chAround = ch;
+ boxAround = box;
+ }
+ return true
+ }, begin, end);
+
+ var baseX, sticky, outside = false;
+ // If a box around the coordinates was found, use that
+ if (boxAround) {
+ // Distinguish coordinates nearer to the left or right side of the box
+ var atLeft = x - boxAround.left < boxAround.right - x, atStart = atLeft == ltr;
+ ch = chAround + (atStart ? 0 : 1);
+ sticky = atStart ? "after" : "before";
+ baseX = atLeft ? boxAround.left : boxAround.right;
+ } else {
+ // (Adjust for extended bound, if necessary.)
+ if (!ltr && (ch == end || ch == begin)) { ch++; }
+ // To determine which side to associate with, get the box to the
+ // left of the character and compare it's vertical position to the
+ // coordinates
+ sticky = ch == 0 ? "after" : ch == lineObj.text.length ? "before" :
+ (measureCharPrepared(cm, preparedMeasure, ch - (ltr ? 1 : 0)).bottom + widgetHeight <= y) == ltr ?
+ "after" : "before";
+ // Now get accurate coordinates for this place, in order to get a
+ // base X position
+ var coords = cursorCoords(cm, Pos(lineNo, ch, sticky), "line", lineObj, preparedMeasure);
+ baseX = coords.left;
+ outside = y < coords.top ? -1 : y >= coords.bottom ? 1 : 0;
+ }
+
+ ch = skipExtendingChars(lineObj.text, ch, 1);
+ return PosWithInfo(lineNo, ch, sticky, outside, x - baseX)
+ }
+
+ function coordsBidiPart(cm, lineObj, lineNo, preparedMeasure, order, x, y) {
+ // Bidi parts are sorted left-to-right, and in a non-line-wrapping
+ // situation, we can take this ordering to correspond to the visual
+ // ordering. This finds the first part whose end is after the given
+ // coordinates.
+ var index = findFirst(function (i) {
+ var part = order[i], ltr = part.level != 1;
+ return boxIsAfter(cursorCoords(cm, Pos(lineNo, ltr ? part.to : part.from, ltr ? "before" : "after"),
+ "line", lineObj, preparedMeasure), x, y, true)
+ }, 0, order.length - 1);
+ var part = order[index];
+ // If this isn't the first part, the part's start is also after
+ // the coordinates, and the coordinates aren't on the same line as
+ // that start, move one part back.
+ if (index > 0) {
+ var ltr = part.level != 1;
+ var start = cursorCoords(cm, Pos(lineNo, ltr ? part.from : part.to, ltr ? "after" : "before"),
+ "line", lineObj, preparedMeasure);
+ if (boxIsAfter(start, x, y, true) && start.top > y)
+ { part = order[index - 1]; }
+ }
+ return part
+ }
+
+ function coordsBidiPartWrapped(cm, lineObj, _lineNo, preparedMeasure, order, x, y) {
+ // In a wrapped line, rtl text on wrapping boundaries can do things
+ // that don't correspond to the ordering in our `order` array at
+ // all, so a binary search doesn't work, and we want to return a
+ // part that only spans one line so that the binary search in
+ // coordsCharInner is safe. As such, we first find the extent of the
+ // wrapped line, and then do a flat search in which we discard any
+ // spans that aren't on the line.
+ var ref = wrappedLineExtent(cm, lineObj, preparedMeasure, y);
+ var begin = ref.begin;
+ var end = ref.end;
+ if (/\s/.test(lineObj.text.charAt(end - 1))) { end--; }
+ var part = null, closestDist = null;
+ for (var i = 0; i < order.length; i++) {
+ var p = order[i];
+ if (p.from >= end || p.to <= begin) { continue }
+ var ltr = p.level != 1;
+ var endX = measureCharPrepared(cm, preparedMeasure, ltr ? Math.min(end, p.to) - 1 : Math.max(begin, p.from)).right;
+ // Weigh against spans ending before this, so that they are only
+ // picked if nothing ends after
+ var dist = endX < x ? x - endX + 1e9 : endX - x;
+ if (!part || closestDist > dist) {
+ part = p;
+ closestDist = dist;
+ }
+ }
+ if (!part) { part = order[order.length - 1]; }
+ // Clip the part to the wrapped line.
+ if (part.from < begin) { part = {from: begin, to: part.to, level: part.level}; }
+ if (part.to > end) { part = {from: part.from, to: end, level: part.level}; }
+ return part
+ }
+
+ var measureText;
+ // Compute the default text height.
+ function textHeight(display) {
+ if (display.cachedTextHeight != null) { return display.cachedTextHeight }
+ if (measureText == null) {
+ measureText = elt("pre", null, "CodeMirror-line-like");
+ // Measure a bunch of lines, for browsers that compute
+ // fractional heights.
+ for (var i = 0; i < 49; ++i) {
+ measureText.appendChild(document.createTextNode("x"));
+ measureText.appendChild(elt("br"));
+ }
+ measureText.appendChild(document.createTextNode("x"));
+ }
+ removeChildrenAndAdd(display.measure, measureText);
+ var height = measureText.offsetHeight / 50;
+ if (height > 3) { display.cachedTextHeight = height; }
+ removeChildren(display.measure);
+ return height || 1
+ }
+
+ // Compute the default character width.
+ function charWidth(display) {
+ if (display.cachedCharWidth != null) { return display.cachedCharWidth }
+ var anchor = elt("span", "xxxxxxxxxx");
+ var pre = elt("pre", [anchor], "CodeMirror-line-like");
+ removeChildrenAndAdd(display.measure, pre);
+ var rect = anchor.getBoundingClientRect(), width = (rect.right - rect.left) / 10;
+ if (width > 2) { display.cachedCharWidth = width; }
+ return width || 10
+ }
+
+ // Do a bulk-read of the DOM positions and sizes needed to draw the
+ // view, so that we don't interleave reading and writing to the DOM.
+ function getDimensions(cm) {
+ var d = cm.display, left = {}, width = {};
+ var gutterLeft = d.gutters.clientLeft;
+ for (var n = d.gutters.firstChild, i = 0; n; n = n.nextSibling, ++i) {
+ var id = cm.display.gutterSpecs[i].className;
+ left[id] = n.offsetLeft + n.clientLeft + gutterLeft;
+ width[id] = n.clientWidth;
+ }
+ return {fixedPos: compensateForHScroll(d),
+ gutterTotalWidth: d.gutters.offsetWidth,
+ gutterLeft: left,
+ gutterWidth: width,
+ wrapperWidth: d.wrapper.clientWidth}
+ }
+
+ // Computes display.scroller.scrollLeft + display.gutters.offsetWidth,
+ // but using getBoundingClientRect to get a sub-pixel-accurate
+ // result.
+ function compensateForHScroll(display) {
+ return display.scroller.getBoundingClientRect().left - display.sizer.getBoundingClientRect().left
+ }
+
+ // Returns a function that estimates the height of a line, to use as
+ // first approximation until the line becomes visible (and is thus
+ // properly measurable).
+ function estimateHeight(cm) {
+ var th = textHeight(cm.display), wrapping = cm.options.lineWrapping;
+ var perLine = wrapping && Math.max(5, cm.display.scroller.clientWidth / charWidth(cm.display) - 3);
+ return function (line) {
+ if (lineIsHidden(cm.doc, line)) { return 0 }
+
+ var widgetsHeight = 0;
+ if (line.widgets) { for (var i = 0; i < line.widgets.length; i++) {
+ if (line.widgets[i].height) { widgetsHeight += line.widgets[i].height; }
+ } }
+
+ if (wrapping)
+ { return widgetsHeight + (Math.ceil(line.text.length / perLine) || 1) * th }
+ else
+ { return widgetsHeight + th }
+ }
+ }
+
+ function estimateLineHeights(cm) {
+ var doc = cm.doc, est = estimateHeight(cm);
+ doc.iter(function (line) {
+ var estHeight = est(line);
+ if (estHeight != line.height) { updateLineHeight(line, estHeight); }
+ });
+ }
+
+ // Given a mouse event, find the corresponding position. If liberal
+ // is false, it checks whether a gutter or scrollbar was clicked,
+ // and returns null if it was. forRect is used by rectangular
+ // selections, and tries to estimate a character position even for
+ // coordinates beyond the right of the text.
+ function posFromMouse(cm, e, liberal, forRect) {
+ var display = cm.display;
+ if (!liberal && e_target(e).getAttribute("cm-not-content") == "true") { return null }
+
+ var x, y, space = display.lineSpace.getBoundingClientRect();
+ // Fails unpredictably on IE[67] when mouse is dragged around quickly.
+ try { x = e.clientX - space.left; y = e.clientY - space.top; }
+ catch (e$1) { return null }
+ var coords = coordsChar(cm, x, y), line;
+ if (forRect && coords.xRel > 0 && (line = getLine(cm.doc, coords.line).text).length == coords.ch) {
+ var colDiff = countColumn(line, line.length, cm.options.tabSize) - line.length;
+ coords = Pos(coords.line, Math.max(0, Math.round((x - paddingH(cm.display).left) / charWidth(cm.display)) - colDiff));
+ }
+ return coords
+ }
+
+ // Find the view element corresponding to a given line. Return null
+ // when the line isn't visible.
+ function findViewIndex(cm, n) {
+ if (n >= cm.display.viewTo) { return null }
+ n -= cm.display.viewFrom;
+ if (n < 0) { return null }
+ var view = cm.display.view;
+ for (var i = 0; i < view.length; i++) {
+ n -= view[i].size;
+ if (n < 0) { return i }
+ }
+ }
+
+ // Updates the display.view data structure for a given change to the
+ // document. From and to are in pre-change coordinates. Lendiff is
+ // the amount of lines added or subtracted by the change. This is
+ // used for changes that span multiple lines, or change the way
+ // lines are divided into visual lines. regLineChange (below)
+ // registers single-line changes.
+ function regChange(cm, from, to, lendiff) {
+ if (from == null) { from = cm.doc.first; }
+ if (to == null) { to = cm.doc.first + cm.doc.size; }
+ if (!lendiff) { lendiff = 0; }
+
+ var display = cm.display;
+ if (lendiff && to < display.viewTo &&
+ (display.updateLineNumbers == null || display.updateLineNumbers > from))
+ { display.updateLineNumbers = from; }
+
+ cm.curOp.viewChanged = true;
+
+ if (from >= display.viewTo) { // Change after
+ if (sawCollapsedSpans && visualLineNo(cm.doc, from) < display.viewTo)
+ { resetView(cm); }
+ } else if (to <= display.viewFrom) { // Change before
+ if (sawCollapsedSpans && visualLineEndNo(cm.doc, to + lendiff) > display.viewFrom) {
+ resetView(cm);
+ } else {
+ display.viewFrom += lendiff;
+ display.viewTo += lendiff;
+ }
+ } else if (from <= display.viewFrom && to >= display.viewTo) { // Full overlap
+ resetView(cm);
+ } else if (from <= display.viewFrom) { // Top overlap
+ var cut = viewCuttingPoint(cm, to, to + lendiff, 1);
+ if (cut) {
+ display.view = display.view.slice(cut.index);
+ display.viewFrom = cut.lineN;
+ display.viewTo += lendiff;
+ } else {
+ resetView(cm);
+ }
+ } else if (to >= display.viewTo) { // Bottom overlap
+ var cut$1 = viewCuttingPoint(cm, from, from, -1);
+ if (cut$1) {
+ display.view = display.view.slice(0, cut$1.index);
+ display.viewTo = cut$1.lineN;
+ } else {
+ resetView(cm);
+ }
+ } else { // Gap in the middle
+ var cutTop = viewCuttingPoint(cm, from, from, -1);
+ var cutBot = viewCuttingPoint(cm, to, to + lendiff, 1);
+ if (cutTop && cutBot) {
+ display.view = display.view.slice(0, cutTop.index)
+ .concat(buildViewArray(cm, cutTop.lineN, cutBot.lineN))
+ .concat(display.view.slice(cutBot.index));
+ display.viewTo += lendiff;
+ } else {
+ resetView(cm);
+ }
+ }
+
+ var ext = display.externalMeasured;
+ if (ext) {
+ if (to < ext.lineN)
+ { ext.lineN += lendiff; }
+ else if (from < ext.lineN + ext.size)
+ { display.externalMeasured = null; }
+ }
+ }
+
+ // Register a change to a single line. Type must be one of "text",
+ // "gutter", "class", "widget"
+ function regLineChange(cm, line, type) {
+ cm.curOp.viewChanged = true;
+ var display = cm.display, ext = cm.display.externalMeasured;
+ if (ext && line >= ext.lineN && line < ext.lineN + ext.size)
+ { display.externalMeasured = null; }
+
+ if (line < display.viewFrom || line >= display.viewTo) { return }
+ var lineView = display.view[findViewIndex(cm, line)];
+ if (lineView.node == null) { return }
+ var arr = lineView.changes || (lineView.changes = []);
+ if (indexOf(arr, type) == -1) { arr.push(type); }
+ }
+
+ // Clear the view.
+ function resetView(cm) {
+ cm.display.viewFrom = cm.display.viewTo = cm.doc.first;
+ cm.display.view = [];
+ cm.display.viewOffset = 0;
+ }
+
+ function viewCuttingPoint(cm, oldN, newN, dir) {
+ var index = findViewIndex(cm, oldN), diff, view = cm.display.view;
+ if (!sawCollapsedSpans || newN == cm.doc.first + cm.doc.size)
+ { return {index: index, lineN: newN} }
+ var n = cm.display.viewFrom;
+ for (var i = 0; i < index; i++)
+ { n += view[i].size; }
+ if (n != oldN) {
+ if (dir > 0) {
+ if (index == view.length - 1) { return null }
+ diff = (n + view[index].size) - oldN;
+ index++;
+ } else {
+ diff = n - oldN;
+ }
+ oldN += diff; newN += diff;
+ }
+ while (visualLineNo(cm.doc, newN) != newN) {
+ if (index == (dir < 0 ? 0 : view.length - 1)) { return null }
+ newN += dir * view[index - (dir < 0 ? 1 : 0)].size;
+ index += dir;
+ }
+ return {index: index, lineN: newN}
+ }
+
+ // Force the view to cover a given range, adding empty view element
+ // or clipping off existing ones as needed.
+ function adjustView(cm, from, to) {
+ var display = cm.display, view = display.view;
+ if (view.length == 0 || from >= display.viewTo || to <= display.viewFrom) {
+ display.view = buildViewArray(cm, from, to);
+ display.viewFrom = from;
+ } else {
+ if (display.viewFrom > from)
+ { display.view = buildViewArray(cm, from, display.viewFrom).concat(display.view); }
+ else if (display.viewFrom < from)
+ { display.view = display.view.slice(findViewIndex(cm, from)); }
+ display.viewFrom = from;
+ if (display.viewTo < to)
+ { display.view = display.view.concat(buildViewArray(cm, display.viewTo, to)); }
+ else if (display.viewTo > to)
+ { display.view = display.view.slice(0, findViewIndex(cm, to)); }
+ }
+ display.viewTo = to;
+ }
+
+ // Count the number of lines in the view whose DOM representation is
+ // out of date (or nonexistent).
+ function countDirtyView(cm) {
+ var view = cm.display.view, dirty = 0;
+ for (var i = 0; i < view.length; i++) {
+ var lineView = view[i];
+ if (!lineView.hidden && (!lineView.node || lineView.changes)) { ++dirty; }
+ }
+ return dirty
+ }
+
+ function updateSelection(cm) {
+ cm.display.input.showSelection(cm.display.input.prepareSelection());
+ }
+
+ function prepareSelection(cm, primary) {
+ if ( primary === void 0 ) primary = true;
+
+ var doc = cm.doc, result = {};
+ var curFragment = result.cursors = document.createDocumentFragment();
+ var selFragment = result.selection = document.createDocumentFragment();
+
+ for (var i = 0; i < doc.sel.ranges.length; i++) {
+ if (!primary && i == doc.sel.primIndex) { continue }
+ var range = doc.sel.ranges[i];
+ if (range.from().line >= cm.display.viewTo || range.to().line < cm.display.viewFrom) { continue }
+ var collapsed = range.empty();
+ if (collapsed || cm.options.showCursorWhenSelecting)
+ { drawSelectionCursor(cm, range.head, curFragment); }
+ if (!collapsed)
+ { drawSelectionRange(cm, range, selFragment); }
+ }
+ return result
+ }
+
+ // Draws a cursor for the given range
+ function drawSelectionCursor(cm, head, output) {
+ var pos = cursorCoords(cm, head, "div", null, null, !cm.options.singleCursorHeightPerLine);
+
+ var cursor = output.appendChild(elt("div", "\u00a0", "CodeMirror-cursor"));
+ cursor.style.left = pos.left + "px";
+ cursor.style.top = pos.top + "px";
+ cursor.style.height = Math.max(0, pos.bottom - pos.top) * cm.options.cursorHeight + "px";
+
+ if (pos.other) {
+ // Secondary cursor, shown when on a 'jump' in bi-directional text
+ var otherCursor = output.appendChild(elt("div", "\u00a0", "CodeMirror-cursor CodeMirror-secondarycursor"));
+ otherCursor.style.display = "";
+ otherCursor.style.left = pos.other.left + "px";
+ otherCursor.style.top = pos.other.top + "px";
+ otherCursor.style.height = (pos.other.bottom - pos.other.top) * .85 + "px";
+ }
+ }
+
+ function cmpCoords(a, b) { return a.top - b.top || a.left - b.left }
+
+ // Draws the given range as a highlighted selection
+ function drawSelectionRange(cm, range, output) {
+ var display = cm.display, doc = cm.doc;
+ var fragment = document.createDocumentFragment();
+ var padding = paddingH(cm.display), leftSide = padding.left;
+ var rightSide = Math.max(display.sizerWidth, displayWidth(cm) - display.sizer.offsetLeft) - padding.right;
+ var docLTR = doc.direction == "ltr";
+
+ function add(left, top, width, bottom) {
+ if (top < 0) { top = 0; }
+ top = Math.round(top);
+ bottom = Math.round(bottom);
+ fragment.appendChild(elt("div", null, "CodeMirror-selected", ("position: absolute; left: " + left + "px;\n top: " + top + "px; width: " + (width == null ? rightSide - left : width) + "px;\n height: " + (bottom - top) + "px")));
+ }
+
+ function drawForLine(line, fromArg, toArg) {
+ var lineObj = getLine(doc, line);
+ var lineLen = lineObj.text.length;
+ var start, end;
+ function coords(ch, bias) {
+ return charCoords(cm, Pos(line, ch), "div", lineObj, bias)
+ }
+
+ function wrapX(pos, dir, side) {
+ var extent = wrappedLineExtentChar(cm, lineObj, null, pos);
+ var prop = (dir == "ltr") == (side == "after") ? "left" : "right";
+ var ch = side == "after" ? extent.begin : extent.end - (/\s/.test(lineObj.text.charAt(extent.end - 1)) ? 2 : 1);
+ return coords(ch, prop)[prop]
+ }
+
+ var order = getOrder(lineObj, doc.direction);
+ iterateBidiSections(order, fromArg || 0, toArg == null ? lineLen : toArg, function (from, to, dir, i) {
+ var ltr = dir == "ltr";
+ var fromPos = coords(from, ltr ? "left" : "right");
+ var toPos = coords(to - 1, ltr ? "right" : "left");
+
+ var openStart = fromArg == null && from == 0, openEnd = toArg == null && to == lineLen;
+ var first = i == 0, last = !order || i == order.length - 1;
+ if (toPos.top - fromPos.top <= 3) { // Single line
+ var openLeft = (docLTR ? openStart : openEnd) && first;
+ var openRight = (docLTR ? openEnd : openStart) && last;
+ var left = openLeft ? leftSide : (ltr ? fromPos : toPos).left;
+ var right = openRight ? rightSide : (ltr ? toPos : fromPos).right;
+ add(left, fromPos.top, right - left, fromPos.bottom);
+ } else { // Multiple lines
+ var topLeft, topRight, botLeft, botRight;
+ if (ltr) {
+ topLeft = docLTR && openStart && first ? leftSide : fromPos.left;
+ topRight = docLTR ? rightSide : wrapX(from, dir, "before");
+ botLeft = docLTR ? leftSide : wrapX(to, dir, "after");
+ botRight = docLTR && openEnd && last ? rightSide : toPos.right;
+ } else {
+ topLeft = !docLTR ? leftSide : wrapX(from, dir, "before");
+ topRight = !docLTR && openStart && first ? rightSide : fromPos.right;
+ botLeft = !docLTR && openEnd && last ? leftSide : toPos.left;
+ botRight = !docLTR ? rightSide : wrapX(to, dir, "after");
+ }
+ add(topLeft, fromPos.top, topRight - topLeft, fromPos.bottom);
+ if (fromPos.bottom < toPos.top) { add(leftSide, fromPos.bottom, null, toPos.top); }
+ add(botLeft, toPos.top, botRight - botLeft, toPos.bottom);
+ }
+
+ if (!start || cmpCoords(fromPos, start) < 0) { start = fromPos; }
+ if (cmpCoords(toPos, start) < 0) { start = toPos; }
+ if (!end || cmpCoords(fromPos, end) < 0) { end = fromPos; }
+ if (cmpCoords(toPos, end) < 0) { end = toPos; }
+ });
+ return {start: start, end: end}
+ }
+
+ var sFrom = range.from(), sTo = range.to();
+ if (sFrom.line == sTo.line) {
+ drawForLine(sFrom.line, sFrom.ch, sTo.ch);
+ } else {
+ var fromLine = getLine(doc, sFrom.line), toLine = getLine(doc, sTo.line);
+ var singleVLine = visualLine(fromLine) == visualLine(toLine);
+ var leftEnd = drawForLine(sFrom.line, sFrom.ch, singleVLine ? fromLine.text.length + 1 : null).end;
+ var rightStart = drawForLine(sTo.line, singleVLine ? 0 : null, sTo.ch).start;
+ if (singleVLine) {
+ if (leftEnd.top < rightStart.top - 2) {
+ add(leftEnd.right, leftEnd.top, null, leftEnd.bottom);
+ add(leftSide, rightStart.top, rightStart.left, rightStart.bottom);
+ } else {
+ add(leftEnd.right, leftEnd.top, rightStart.left - leftEnd.right, leftEnd.bottom);
+ }
+ }
+ if (leftEnd.bottom < rightStart.top)
+ { add(leftSide, leftEnd.bottom, null, rightStart.top); }
+ }
+
+ output.appendChild(fragment);
+ }
+
+ // Cursor-blinking
+ function restartBlink(cm) {
+ if (!cm.state.focused) { return }
+ var display = cm.display;
+ clearInterval(display.blinker);
+ var on = true;
+ display.cursorDiv.style.visibility = "";
+ if (cm.options.cursorBlinkRate > 0)
+ { display.blinker = setInterval(function () { return display.cursorDiv.style.visibility = (on = !on) ? "" : "hidden"; },
+ cm.options.cursorBlinkRate); }
+ else if (cm.options.cursorBlinkRate < 0)
+ { display.cursorDiv.style.visibility = "hidden"; }
+ }
+
+ function ensureFocus(cm) {
+ if (!cm.state.focused) { cm.display.input.focus(); onFocus(cm); }
+ }
+
+ function delayBlurEvent(cm) {
+ cm.state.delayingBlurEvent = true;
+ setTimeout(function () { if (cm.state.delayingBlurEvent) {
+ cm.state.delayingBlurEvent = false;
+ onBlur(cm);
+ } }, 100);
+ }
+
+ function onFocus(cm, e) {
+ if (cm.state.delayingBlurEvent) { cm.state.delayingBlurEvent = false; }
+
+ if (cm.options.readOnly == "nocursor") { return }
+ if (!cm.state.focused) {
+ signal(cm, "focus", cm, e);
+ cm.state.focused = true;
+ addClass(cm.display.wrapper, "CodeMirror-focused");
+ // This test prevents this from firing when a context
+ // menu is closed (since the input reset would kill the
+ // select-all detection hack)
+ if (!cm.curOp && cm.display.selForContextMenu != cm.doc.sel) {
+ cm.display.input.reset();
+ if (webkit) { setTimeout(function () { return cm.display.input.reset(true); }, 20); } // Issue #1730
+ }
+ cm.display.input.receivedFocus();
+ }
+ restartBlink(cm);
+ }
+ function onBlur(cm, e) {
+ if (cm.state.delayingBlurEvent) { return }
+
+ if (cm.state.focused) {
+ signal(cm, "blur", cm, e);
+ cm.state.focused = false;
+ rmClass(cm.display.wrapper, "CodeMirror-focused");
+ }
+ clearInterval(cm.display.blinker);
+ setTimeout(function () { if (!cm.state.focused) { cm.display.shift = false; } }, 150);
+ }
+
+ // Read the actual heights of the rendered lines, and update their
+ // stored heights to match.
+ function updateHeightsInViewport(cm) {
+ var display = cm.display;
+ var prevBottom = display.lineDiv.offsetTop;
+ for (var i = 0; i < display.view.length; i++) {
+ var cur = display.view[i], wrapping = cm.options.lineWrapping;
+ var height = (void 0), width = 0;
+ if (cur.hidden) { continue }
+ if (ie && ie_version < 8) {
+ var bot = cur.node.offsetTop + cur.node.offsetHeight;
+ height = bot - prevBottom;
+ prevBottom = bot;
+ } else {
+ var box = cur.node.getBoundingClientRect();
+ height = box.bottom - box.top;
+ // Check that lines don't extend past the right of the current
+ // editor width
+ if (!wrapping && cur.text.firstChild)
+ { width = cur.text.firstChild.getBoundingClientRect().right - box.left - 1; }
+ }
+ var diff = cur.line.height - height;
+ if (diff > .005 || diff < -.005) {
+ updateLineHeight(cur.line, height);
+ updateWidgetHeight(cur.line);
+ if (cur.rest) { for (var j = 0; j < cur.rest.length; j++)
+ { updateWidgetHeight(cur.rest[j]); } }
+ }
+ if (width > cm.display.sizerWidth) {
+ var chWidth = Math.ceil(width / charWidth(cm.display));
+ if (chWidth > cm.display.maxLineLength) {
+ cm.display.maxLineLength = chWidth;
+ cm.display.maxLine = cur.line;
+ cm.display.maxLineChanged = true;
+ }
+ }
+ }
+ }
+
+ // Read and store the height of line widgets associated with the
+ // given line.
+ function updateWidgetHeight(line) {
+ if (line.widgets) { for (var i = 0; i < line.widgets.length; ++i) {
+ var w = line.widgets[i], parent = w.node.parentNode;
+ if (parent) { w.height = parent.offsetHeight; }
+ } }
+ }
+
+ // Compute the lines that are visible in a given viewport (defaults
+ // the the current scroll position). viewport may contain top,
+ // height, and ensure (see op.scrollToPos) properties.
+ function visibleLines(display, doc, viewport) {
+ var top = viewport && viewport.top != null ? Math.max(0, viewport.top) : display.scroller.scrollTop;
+ top = Math.floor(top - paddingTop(display));
+ var bottom = viewport && viewport.bottom != null ? viewport.bottom : top + display.wrapper.clientHeight;
+
+ var from = lineAtHeight(doc, top), to = lineAtHeight(doc, bottom);
+ // Ensure is a {from: {line, ch}, to: {line, ch}} object, and
+ // forces those lines into the viewport (if possible).
+ if (viewport && viewport.ensure) {
+ var ensureFrom = viewport.ensure.from.line, ensureTo = viewport.ensure.to.line;
+ if (ensureFrom < from) {
+ from = ensureFrom;
+ to = lineAtHeight(doc, heightAtLine(getLine(doc, ensureFrom)) + display.wrapper.clientHeight);
+ } else if (Math.min(ensureTo, doc.lastLine()) >= to) {
+ from = lineAtHeight(doc, heightAtLine(getLine(doc, ensureTo)) - display.wrapper.clientHeight);
+ to = ensureTo;
+ }
+ }
+ return {from: from, to: Math.max(to, from + 1)}
+ }
+
+ // SCROLLING THINGS INTO VIEW
+
+ // If an editor sits on the top or bottom of the window, partially
+ // scrolled out of view, this ensures that the cursor is visible.
+ function maybeScrollWindow(cm, rect) {
+ if (signalDOMEvent(cm, "scrollCursorIntoView")) { return }
+
+ var display = cm.display, box = display.sizer.getBoundingClientRect(), doScroll = null;
+ if (rect.top + box.top < 0) { doScroll = true; }
+ else if (rect.bottom + box.top > (window.innerHeight || document.documentElement.clientHeight)) { doScroll = false; }
+ if (doScroll != null && !phantom) {
+ var scrollNode = elt("div", "\u200b", null, ("position: absolute;\n top: " + (rect.top - display.viewOffset - paddingTop(cm.display)) + "px;\n height: " + (rect.bottom - rect.top + scrollGap(cm) + display.barHeight) + "px;\n left: " + (rect.left) + "px; width: " + (Math.max(2, rect.right - rect.left)) + "px;"));
+ cm.display.lineSpace.appendChild(scrollNode);
+ scrollNode.scrollIntoView(doScroll);
+ cm.display.lineSpace.removeChild(scrollNode);
+ }
+ }
+
+ // Scroll a given position into view (immediately), verifying that
+ // it actually became visible (as line heights are accurately
+ // measured, the position of something may 'drift' during drawing).
+ function scrollPosIntoView(cm, pos, end, margin) {
+ if (margin == null) { margin = 0; }
+ var rect;
+ if (!cm.options.lineWrapping && pos == end) {
+ // Set pos and end to the cursor positions around the character pos sticks to
+ // If pos.sticky == "before", that is around pos.ch - 1, otherwise around pos.ch
+ // If pos == Pos(_, 0, "before"), pos and end are unchanged
+ pos = pos.ch ? Pos(pos.line, pos.sticky == "before" ? pos.ch - 1 : pos.ch, "after") : pos;
+ end = pos.sticky == "before" ? Pos(pos.line, pos.ch + 1, "before") : pos;
+ }
+ for (var limit = 0; limit < 5; limit++) {
+ var changed = false;
+ var coords = cursorCoords(cm, pos);
+ var endCoords = !end || end == pos ? coords : cursorCoords(cm, end);
+ rect = {left: Math.min(coords.left, endCoords.left),
+ top: Math.min(coords.top, endCoords.top) - margin,
+ right: Math.max(coords.left, endCoords.left),
+ bottom: Math.max(coords.bottom, endCoords.bottom) + margin};
+ var scrollPos = calculateScrollPos(cm, rect);
+ var startTop = cm.doc.scrollTop, startLeft = cm.doc.scrollLeft;
+ if (scrollPos.scrollTop != null) {
+ updateScrollTop(cm, scrollPos.scrollTop);
+ if (Math.abs(cm.doc.scrollTop - startTop) > 1) { changed = true; }
+ }
+ if (scrollPos.scrollLeft != null) {
+ setScrollLeft(cm, scrollPos.scrollLeft);
+ if (Math.abs(cm.doc.scrollLeft - startLeft) > 1) { changed = true; }
+ }
+ if (!changed) { break }
+ }
+ return rect
+ }
+
+ // Scroll a given set of coordinates into view (immediately).
+ function scrollIntoView(cm, rect) {
+ var scrollPos = calculateScrollPos(cm, rect);
+ if (scrollPos.scrollTop != null) { updateScrollTop(cm, scrollPos.scrollTop); }
+ if (scrollPos.scrollLeft != null) { setScrollLeft(cm, scrollPos.scrollLeft); }
+ }
+
+ // Calculate a new scroll position needed to scroll the given
+ // rectangle into view. Returns an object with scrollTop and
+ // scrollLeft properties. When these are undefined, the
+ // vertical/horizontal position does not need to be adjusted.
+ function calculateScrollPos(cm, rect) {
+ var display = cm.display, snapMargin = textHeight(cm.display);
+ if (rect.top < 0) { rect.top = 0; }
+ var screentop = cm.curOp && cm.curOp.scrollTop != null ? cm.curOp.scrollTop : display.scroller.scrollTop;
+ var screen = displayHeight(cm), result = {};
+ if (rect.bottom - rect.top > screen) { rect.bottom = rect.top + screen; }
+ var docBottom = cm.doc.height + paddingVert(display);
+ var atTop = rect.top < snapMargin, atBottom = rect.bottom > docBottom - snapMargin;
+ if (rect.top < screentop) {
+ result.scrollTop = atTop ? 0 : rect.top;
+ } else if (rect.bottom > screentop + screen) {
+ var newTop = Math.min(rect.top, (atBottom ? docBottom : rect.bottom) - screen);
+ if (newTop != screentop) { result.scrollTop = newTop; }
+ }
+
+ var screenleft = cm.curOp && cm.curOp.scrollLeft != null ? cm.curOp.scrollLeft : display.scroller.scrollLeft;
+ var screenw = displayWidth(cm) - (cm.options.fixedGutter ? display.gutters.offsetWidth : 0);
+ var tooWide = rect.right - rect.left > screenw;
+ if (tooWide) { rect.right = rect.left + screenw; }
+ if (rect.left < 10)
+ { result.scrollLeft = 0; }
+ else if (rect.left < screenleft)
+ { result.scrollLeft = Math.max(0, rect.left - (tooWide ? 0 : 10)); }
+ else if (rect.right > screenw + screenleft - 3)
+ { result.scrollLeft = rect.right + (tooWide ? 0 : 10) - screenw; }
+ return result
+ }
+
+ // Store a relative adjustment to the scroll position in the current
+ // operation (to be applied when the operation finishes).
+ function addToScrollTop(cm, top) {
+ if (top == null) { return }
+ resolveScrollToPos(cm);
+ cm.curOp.scrollTop = (cm.curOp.scrollTop == null ? cm.doc.scrollTop : cm.curOp.scrollTop) + top;
+ }
+
+ // Make sure that at the end of the operation the current cursor is
+ // shown.
+ function ensureCursorVisible(cm) {
+ resolveScrollToPos(cm);
+ var cur = cm.getCursor();
+ cm.curOp.scrollToPos = {from: cur, to: cur, margin: cm.options.cursorScrollMargin};
+ }
+
+ function scrollToCoords(cm, x, y) {
+ if (x != null || y != null) { resolveScrollToPos(cm); }
+ if (x != null) { cm.curOp.scrollLeft = x; }
+ if (y != null) { cm.curOp.scrollTop = y; }
+ }
+
+ function scrollToRange(cm, range) {
+ resolveScrollToPos(cm);
+ cm.curOp.scrollToPos = range;
+ }
+
+ // When an operation has its scrollToPos property set, and another
+ // scroll action is applied before the end of the operation, this
+ // 'simulates' scrolling that position into view in a cheap way, so
+ // that the effect of intermediate scroll commands is not ignored.
+ function resolveScrollToPos(cm) {
+ var range = cm.curOp.scrollToPos;
+ if (range) {
+ cm.curOp.scrollToPos = null;
+ var from = estimateCoords(cm, range.from), to = estimateCoords(cm, range.to);
+ scrollToCoordsRange(cm, from, to, range.margin);
+ }
+ }
+
+ function scrollToCoordsRange(cm, from, to, margin) {
+ var sPos = calculateScrollPos(cm, {
+ left: Math.min(from.left, to.left),
+ top: Math.min(from.top, to.top) - margin,
+ right: Math.max(from.right, to.right),
+ bottom: Math.max(from.bottom, to.bottom) + margin
+ });
+ scrollToCoords(cm, sPos.scrollLeft, sPos.scrollTop);
+ }
+
+ // Sync the scrollable area and scrollbars, ensure the viewport
+ // covers the visible area.
+ function updateScrollTop(cm, val) {
+ if (Math.abs(cm.doc.scrollTop - val) < 2) { return }
+ if (!gecko) { updateDisplaySimple(cm, {top: val}); }
+ setScrollTop(cm, val, true);
+ if (gecko) { updateDisplaySimple(cm); }
+ startWorker(cm, 100);
+ }
+
+ function setScrollTop(cm, val, forceScroll) {
+ val = Math.max(0, Math.min(cm.display.scroller.scrollHeight - cm.display.scroller.clientHeight, val));
+ if (cm.display.scroller.scrollTop == val && !forceScroll) { return }
+ cm.doc.scrollTop = val;
+ cm.display.scrollbars.setScrollTop(val);
+ if (cm.display.scroller.scrollTop != val) { cm.display.scroller.scrollTop = val; }
+ }
+
+ // Sync scroller and scrollbar, ensure the gutter elements are
+ // aligned.
+ function setScrollLeft(cm, val, isScroller, forceScroll) {
+ val = Math.max(0, Math.min(val, cm.display.scroller.scrollWidth - cm.display.scroller.clientWidth));
+ if ((isScroller ? val == cm.doc.scrollLeft : Math.abs(cm.doc.scrollLeft - val) < 2) && !forceScroll) { return }
+ cm.doc.scrollLeft = val;
+ alignHorizontally(cm);
+ if (cm.display.scroller.scrollLeft != val) { cm.display.scroller.scrollLeft = val; }
+ cm.display.scrollbars.setScrollLeft(val);
+ }
+
+ // SCROLLBARS
+
+ // Prepare DOM reads needed to update the scrollbars. Done in one
+ // shot to minimize update/measure roundtrips.
+ function measureForScrollbars(cm) {
+ var d = cm.display, gutterW = d.gutters.offsetWidth;
+ var docH = Math.round(cm.doc.height + paddingVert(cm.display));
+ return {
+ clientHeight: d.scroller.clientHeight,
+ viewHeight: d.wrapper.clientHeight,
+ scrollWidth: d.scroller.scrollWidth, clientWidth: d.scroller.clientWidth,
+ viewWidth: d.wrapper.clientWidth,
+ barLeft: cm.options.fixedGutter ? gutterW : 0,
+ docHeight: docH,
+ scrollHeight: docH + scrollGap(cm) + d.barHeight,
+ nativeBarWidth: d.nativeBarWidth,
+ gutterWidth: gutterW
+ }
+ }
+
+ var NativeScrollbars = function(place, scroll, cm) {
+ this.cm = cm;
+ var vert = this.vert = elt("div", [elt("div", null, null, "min-width: 1px")], "CodeMirror-vscrollbar");
+ var horiz = this.horiz = elt("div", [elt("div", null, null, "height: 100%; min-height: 1px")], "CodeMirror-hscrollbar");
+ vert.tabIndex = horiz.tabIndex = -1;
+ place(vert); place(horiz);
+
+ on(vert, "scroll", function () {
+ if (vert.clientHeight) { scroll(vert.scrollTop, "vertical"); }
+ });
+ on(horiz, "scroll", function () {
+ if (horiz.clientWidth) { scroll(horiz.scrollLeft, "horizontal"); }
+ });
+
+ this.checkedZeroWidth = false;
+ // Need to set a minimum width to see the scrollbar on IE7 (but must not set it on IE8).
+ if (ie && ie_version < 8) { this.horiz.style.minHeight = this.vert.style.minWidth = "18px"; }
+ };
+
+ NativeScrollbars.prototype.update = function (measure) {
+ var needsH = measure.scrollWidth > measure.clientWidth + 1;
+ var needsV = measure.scrollHeight > measure.clientHeight + 1;
+ var sWidth = measure.nativeBarWidth;
+
+ if (needsV) {
+ this.vert.style.display = "block";
+ this.vert.style.bottom = needsH ? sWidth + "px" : "0";
+ var totalHeight = measure.viewHeight - (needsH ? sWidth : 0);
+ // A bug in IE8 can cause this value to be negative, so guard it.
+ this.vert.firstChild.style.height =
+ Math.max(0, measure.scrollHeight - measure.clientHeight + totalHeight) + "px";
+ } else {
+ this.vert.style.display = "";
+ this.vert.firstChild.style.height = "0";
+ }
+
+ if (needsH) {
+ this.horiz.style.display = "block";
+ this.horiz.style.right = needsV ? sWidth + "px" : "0";
+ this.horiz.style.left = measure.barLeft + "px";
+ var totalWidth = measure.viewWidth - measure.barLeft - (needsV ? sWidth : 0);
+ this.horiz.firstChild.style.width =
+ Math.max(0, measure.scrollWidth - measure.clientWidth + totalWidth) + "px";
+ } else {
+ this.horiz.style.display = "";
+ this.horiz.firstChild.style.width = "0";
+ }
+
+ if (!this.checkedZeroWidth && measure.clientHeight > 0) {
+ if (sWidth == 0) { this.zeroWidthHack(); }
+ this.checkedZeroWidth = true;
+ }
+
+ return {right: needsV ? sWidth : 0, bottom: needsH ? sWidth : 0}
+ };
+
+ NativeScrollbars.prototype.setScrollLeft = function (pos) {
+ if (this.horiz.scrollLeft != pos) { this.horiz.scrollLeft = pos; }
+ if (this.disableHoriz) { this.enableZeroWidthBar(this.horiz, this.disableHoriz, "horiz"); }
+ };
+
+ NativeScrollbars.prototype.setScrollTop = function (pos) {
+ if (this.vert.scrollTop != pos) { this.vert.scrollTop = pos; }
+ if (this.disableVert) { this.enableZeroWidthBar(this.vert, this.disableVert, "vert"); }
+ };
+
+ NativeScrollbars.prototype.zeroWidthHack = function () {
+ var w = mac && !mac_geMountainLion ? "12px" : "18px";
+ this.horiz.style.height = this.vert.style.width = w;
+ this.horiz.style.pointerEvents = this.vert.style.pointerEvents = "none";
+ this.disableHoriz = new Delayed;
+ this.disableVert = new Delayed;
+ };
+
+ NativeScrollbars.prototype.enableZeroWidthBar = function (bar, delay, type) {
+ bar.style.pointerEvents = "auto";
+ function maybeDisable() {
+ // To find out whether the scrollbar is still visible, we
+ // check whether the element under the pixel in the bottom
+ // right corner of the scrollbar box is the scrollbar box
+ // itself (when the bar is still visible) or its filler child
+ // (when the bar is hidden). If it is still visible, we keep
+ // it enabled, if it's hidden, we disable pointer events.
+ var box = bar.getBoundingClientRect();
+ var elt = type == "vert" ? document.elementFromPoint(box.right - 1, (box.top + box.bottom) / 2)
+ : document.elementFromPoint((box.right + box.left) / 2, box.bottom - 1);
+ if (elt != bar) { bar.style.pointerEvents = "none"; }
+ else { delay.set(1000, maybeDisable); }
+ }
+ delay.set(1000, maybeDisable);
+ };
+
+ NativeScrollbars.prototype.clear = function () {
+ var parent = this.horiz.parentNode;
+ parent.removeChild(this.horiz);
+ parent.removeChild(this.vert);
+ };
+
+ var NullScrollbars = function () {};
+
+ NullScrollbars.prototype.update = function () { return {bottom: 0, right: 0} };
+ NullScrollbars.prototype.setScrollLeft = function () {};
+ NullScrollbars.prototype.setScrollTop = function () {};
+ NullScrollbars.prototype.clear = function () {};
+
+ function updateScrollbars(cm, measure) {
+ if (!measure) { measure = measureForScrollbars(cm); }
+ var startWidth = cm.display.barWidth, startHeight = cm.display.barHeight;
+ updateScrollbarsInner(cm, measure);
+ for (var i = 0; i < 4 && startWidth != cm.display.barWidth || startHeight != cm.display.barHeight; i++) {
+ if (startWidth != cm.display.barWidth && cm.options.lineWrapping)
+ { updateHeightsInViewport(cm); }
+ updateScrollbarsInner(cm, measureForScrollbars(cm));
+ startWidth = cm.display.barWidth; startHeight = cm.display.barHeight;
+ }
+ }
+
+ // Re-synchronize the fake scrollbars with the actual size of the
+ // content.
+ function updateScrollbarsInner(cm, measure) {
+ var d = cm.display;
+ var sizes = d.scrollbars.update(measure);
+
+ d.sizer.style.paddingRight = (d.barWidth = sizes.right) + "px";
+ d.sizer.style.paddingBottom = (d.barHeight = sizes.bottom) + "px";
+ d.heightForcer.style.borderBottom = sizes.bottom + "px solid transparent";
+
+ if (sizes.right && sizes.bottom) {
+ d.scrollbarFiller.style.display = "block";
+ d.scrollbarFiller.style.height = sizes.bottom + "px";
+ d.scrollbarFiller.style.width = sizes.right + "px";
+ } else { d.scrollbarFiller.style.display = ""; }
+ if (sizes.bottom && cm.options.coverGutterNextToScrollbar && cm.options.fixedGutter) {
+ d.gutterFiller.style.display = "block";
+ d.gutterFiller.style.height = sizes.bottom + "px";
+ d.gutterFiller.style.width = measure.gutterWidth + "px";
+ } else { d.gutterFiller.style.display = ""; }
+ }
+
+ var scrollbarModel = {"native": NativeScrollbars, "null": NullScrollbars};
+
+ function initScrollbars(cm) {
+ if (cm.display.scrollbars) {
+ cm.display.scrollbars.clear();
+ if (cm.display.scrollbars.addClass)
+ { rmClass(cm.display.wrapper, cm.display.scrollbars.addClass); }
+ }
+
+ cm.display.scrollbars = new scrollbarModel[cm.options.scrollbarStyle](function (node) {
+ cm.display.wrapper.insertBefore(node, cm.display.scrollbarFiller);
+ // Prevent clicks in the scrollbars from killing focus
+ on(node, "mousedown", function () {
+ if (cm.state.focused) { setTimeout(function () { return cm.display.input.focus(); }, 0); }
+ });
+ node.setAttribute("cm-not-content", "true");
+ }, function (pos, axis) {
+ if (axis == "horizontal") { setScrollLeft(cm, pos); }
+ else { updateScrollTop(cm, pos); }
+ }, cm);
+ if (cm.display.scrollbars.addClass)
+ { addClass(cm.display.wrapper, cm.display.scrollbars.addClass); }
+ }
+
+ // Operations are used to wrap a series of changes to the editor
+ // state in such a way that each change won't have to update the
+ // cursor and display (which would be awkward, slow, and
+ // error-prone). Instead, display updates are batched and then all
+ // combined and executed at once.
+
+ var nextOpId = 0;
+ // Start a new operation.
+ function startOperation(cm) {
+ cm.curOp = {
+ cm: cm,
+ viewChanged: false, // Flag that indicates that lines might need to be redrawn
+ startHeight: cm.doc.height, // Used to detect need to update scrollbar
+ forceUpdate: false, // Used to force a redraw
+ updateInput: 0, // Whether to reset the input textarea
+ typing: false, // Whether this reset should be careful to leave existing text (for compositing)
+ changeObjs: null, // Accumulated changes, for firing change events
+ cursorActivityHandlers: null, // Set of handlers to fire cursorActivity on
+ cursorActivityCalled: 0, // Tracks which cursorActivity handlers have been called already
+ selectionChanged: false, // Whether the selection needs to be redrawn
+ updateMaxLine: false, // Set when the widest line needs to be determined anew
+ scrollLeft: null, scrollTop: null, // Intermediate scroll position, not pushed to DOM yet
+ scrollToPos: null, // Used to scroll to a specific position
+ focus: false,
+ id: ++nextOpId // Unique ID
+ };
+ pushOperation(cm.curOp);
+ }
+
+ // Finish an operation, updating the display and signalling delayed events
+ function endOperation(cm) {
+ var op = cm.curOp;
+ if (op) { finishOperation(op, function (group) {
+ for (var i = 0; i < group.ops.length; i++)
+ { group.ops[i].cm.curOp = null; }
+ endOperations(group);
+ }); }
+ }
+
+ // The DOM updates done when an operation finishes are batched so
+ // that the minimum number of relayouts are required.
+ function endOperations(group) {
+ var ops = group.ops;
+ for (var i = 0; i < ops.length; i++) // Read DOM
+ { endOperation_R1(ops[i]); }
+ for (var i$1 = 0; i$1 < ops.length; i$1++) // Write DOM (maybe)
+ { endOperation_W1(ops[i$1]); }
+ for (var i$2 = 0; i$2 < ops.length; i$2++) // Read DOM
+ { endOperation_R2(ops[i$2]); }
+ for (var i$3 = 0; i$3 < ops.length; i$3++) // Write DOM (maybe)
+ { endOperation_W2(ops[i$3]); }
+ for (var i$4 = 0; i$4 < ops.length; i$4++) // Read DOM
+ { endOperation_finish(ops[i$4]); }
+ }
+
+ function endOperation_R1(op) {
+ var cm = op.cm, display = cm.display;
+ maybeClipScrollbars(cm);
+ if (op.updateMaxLine) { findMaxLine(cm); }
+
+ op.mustUpdate = op.viewChanged || op.forceUpdate || op.scrollTop != null ||
+ op.scrollToPos && (op.scrollToPos.from.line < display.viewFrom ||
+ op.scrollToPos.to.line >= display.viewTo) ||
+ display.maxLineChanged && cm.options.lineWrapping;
+ op.update = op.mustUpdate &&
+ new DisplayUpdate(cm, op.mustUpdate && {top: op.scrollTop, ensure: op.scrollToPos}, op.forceUpdate);
+ }
+
+ function endOperation_W1(op) {
+ op.updatedDisplay = op.mustUpdate && updateDisplayIfNeeded(op.cm, op.update);
+ }
+
+ function endOperation_R2(op) {
+ var cm = op.cm, display = cm.display;
+ if (op.updatedDisplay) { updateHeightsInViewport(cm); }
+
+ op.barMeasure = measureForScrollbars(cm);
+
+ // If the max line changed since it was last measured, measure it,
+ // and ensure the document's width matches it.
+ // updateDisplay_W2 will use these properties to do the actual resizing
+ if (display.maxLineChanged && !cm.options.lineWrapping) {
+ op.adjustWidthTo = measureChar(cm, display.maxLine, display.maxLine.text.length).left + 3;
+ cm.display.sizerWidth = op.adjustWidthTo;
+ op.barMeasure.scrollWidth =
+ Math.max(display.scroller.clientWidth, display.sizer.offsetLeft + op.adjustWidthTo + scrollGap(cm) + cm.display.barWidth);
+ op.maxScrollLeft = Math.max(0, display.sizer.offsetLeft + op.adjustWidthTo - displayWidth(cm));
+ }
+
+ if (op.updatedDisplay || op.selectionChanged)
+ { op.preparedSelection = display.input.prepareSelection(); }
+ }
+
+ function endOperation_W2(op) {
+ var cm = op.cm;
+
+ if (op.adjustWidthTo != null) {
+ cm.display.sizer.style.minWidth = op.adjustWidthTo + "px";
+ if (op.maxScrollLeft < cm.doc.scrollLeft)
+ { setScrollLeft(cm, Math.min(cm.display.scroller.scrollLeft, op.maxScrollLeft), true); }
+ cm.display.maxLineChanged = false;
+ }
+
+ var takeFocus = op.focus && op.focus == activeElt();
+ if (op.preparedSelection)
+ { cm.display.input.showSelection(op.preparedSelection, takeFocus); }
+ if (op.updatedDisplay || op.startHeight != cm.doc.height)
+ { updateScrollbars(cm, op.barMeasure); }
+ if (op.updatedDisplay)
+ { setDocumentHeight(cm, op.barMeasure); }
+
+ if (op.selectionChanged) { restartBlink(cm); }
+
+ if (cm.state.focused && op.updateInput)
+ { cm.display.input.reset(op.typing); }
+ if (takeFocus) { ensureFocus(op.cm); }
+ }
+
+ function endOperation_finish(op) {
+ var cm = op.cm, display = cm.display, doc = cm.doc;
+
+ if (op.updatedDisplay) { postUpdateDisplay(cm, op.update); }
+
+ // Abort mouse wheel delta measurement, when scrolling explicitly
+ if (display.wheelStartX != null && (op.scrollTop != null || op.scrollLeft != null || op.scrollToPos))
+ { display.wheelStartX = display.wheelStartY = null; }
+
+ // Propagate the scroll position to the actual DOM scroller
+ if (op.scrollTop != null) { setScrollTop(cm, op.scrollTop, op.forceScroll); }
+
+ if (op.scrollLeft != null) { setScrollLeft(cm, op.scrollLeft, true, true); }
+ // If we need to scroll a specific position into view, do so.
+ if (op.scrollToPos) {
+ var rect = scrollPosIntoView(cm, clipPos(doc, op.scrollToPos.from),
+ clipPos(doc, op.scrollToPos.to), op.scrollToPos.margin);
+ maybeScrollWindow(cm, rect);
+ }
+
+ // Fire events for markers that are hidden/unidden by editing or
+ // undoing
+ var hidden = op.maybeHiddenMarkers, unhidden = op.maybeUnhiddenMarkers;
+ if (hidden) { for (var i = 0; i < hidden.length; ++i)
+ { if (!hidden[i].lines.length) { signal(hidden[i], "hide"); } } }
+ if (unhidden) { for (var i$1 = 0; i$1 < unhidden.length; ++i$1)
+ { if (unhidden[i$1].lines.length) { signal(unhidden[i$1], "unhide"); } } }
+
+ if (display.wrapper.offsetHeight)
+ { doc.scrollTop = cm.display.scroller.scrollTop; }
+
+ // Fire change events, and delayed event handlers
+ if (op.changeObjs)
+ { signal(cm, "changes", cm, op.changeObjs); }
+ if (op.update)
+ { op.update.finish(); }
+ }
+
+ // Run the given function in an operation
+ function runInOp(cm, f) {
+ if (cm.curOp) { return f() }
+ startOperation(cm);
+ try { return f() }
+ finally { endOperation(cm); }
+ }
+ // Wraps a function in an operation. Returns the wrapped function.
+ function operation(cm, f) {
+ return function() {
+ if (cm.curOp) { return f.apply(cm, arguments) }
+ startOperation(cm);
+ try { return f.apply(cm, arguments) }
+ finally { endOperation(cm); }
+ }
+ }
+ // Used to add methods to editor and doc instances, wrapping them in
+ // operations.
+ function methodOp(f) {
+ return function() {
+ if (this.curOp) { return f.apply(this, arguments) }
+ startOperation(this);
+ try { return f.apply(this, arguments) }
+ finally { endOperation(this); }
+ }
+ }
+ function docMethodOp(f) {
+ return function() {
+ var cm = this.cm;
+ if (!cm || cm.curOp) { return f.apply(this, arguments) }
+ startOperation(cm);
+ try { return f.apply(this, arguments) }
+ finally { endOperation(cm); }
+ }
+ }
+
+ // HIGHLIGHT WORKER
+
+ function startWorker(cm, time) {
+ if (cm.doc.highlightFrontier < cm.display.viewTo)
+ { cm.state.highlight.set(time, bind(highlightWorker, cm)); }
+ }
+
+ function highlightWorker(cm) {
+ var doc = cm.doc;
+ if (doc.highlightFrontier >= cm.display.viewTo) { return }
+ var end = +new Date + cm.options.workTime;
+ var context = getContextBefore(cm, doc.highlightFrontier);
+ var changedLines = [];
+
+ doc.iter(context.line, Math.min(doc.first + doc.size, cm.display.viewTo + 500), function (line) {
+ if (context.line >= cm.display.viewFrom) { // Visible
+ var oldStyles = line.styles;
+ var resetState = line.text.length > cm.options.maxHighlightLength ? copyState(doc.mode, context.state) : null;
+ var highlighted = highlightLine(cm, line, context, true);
+ if (resetState) { context.state = resetState; }
+ line.styles = highlighted.styles;
+ var oldCls = line.styleClasses, newCls = highlighted.classes;
+ if (newCls) { line.styleClasses = newCls; }
+ else if (oldCls) { line.styleClasses = null; }
+ var ischange = !oldStyles || oldStyles.length != line.styles.length ||
+ oldCls != newCls && (!oldCls || !newCls || oldCls.bgClass != newCls.bgClass || oldCls.textClass != newCls.textClass);
+ for (var i = 0; !ischange && i < oldStyles.length; ++i) { ischange = oldStyles[i] != line.styles[i]; }
+ if (ischange) { changedLines.push(context.line); }
+ line.stateAfter = context.save();
+ context.nextLine();
+ } else {
+ if (line.text.length <= cm.options.maxHighlightLength)
+ { processLine(cm, line.text, context); }
+ line.stateAfter = context.line % 5 == 0 ? context.save() : null;
+ context.nextLine();
+ }
+ if (+new Date > end) {
+ startWorker(cm, cm.options.workDelay);
+ return true
+ }
+ });
+ doc.highlightFrontier = context.line;
+ doc.modeFrontier = Math.max(doc.modeFrontier, context.line);
+ if (changedLines.length) { runInOp(cm, function () {
+ for (var i = 0; i < changedLines.length; i++)
+ { regLineChange(cm, changedLines[i], "text"); }
+ }); }
+ }
+
+ // DISPLAY DRAWING
+
+ var DisplayUpdate = function(cm, viewport, force) {
+ var display = cm.display;
+
+ this.viewport = viewport;
+ // Store some values that we'll need later (but don't want to force a relayout for)
+ this.visible = visibleLines(display, cm.doc, viewport);
+ this.editorIsHidden = !display.wrapper.offsetWidth;
+ this.wrapperHeight = display.wrapper.clientHeight;
+ this.wrapperWidth = display.wrapper.clientWidth;
+ this.oldDisplayWidth = displayWidth(cm);
+ this.force = force;
+ this.dims = getDimensions(cm);
+ this.events = [];
+ };
+
+ DisplayUpdate.prototype.signal = function (emitter, type) {
+ if (hasHandler(emitter, type))
+ { this.events.push(arguments); }
+ };
+ DisplayUpdate.prototype.finish = function () {
+ for (var i = 0; i < this.events.length; i++)
+ { signal.apply(null, this.events[i]); }
+ };
+
+ function maybeClipScrollbars(cm) {
+ var display = cm.display;
+ if (!display.scrollbarsClipped && display.scroller.offsetWidth) {
+ display.nativeBarWidth = display.scroller.offsetWidth - display.scroller.clientWidth;
+ display.heightForcer.style.height = scrollGap(cm) + "px";
+ display.sizer.style.marginBottom = -display.nativeBarWidth + "px";
+ display.sizer.style.borderRightWidth = scrollGap(cm) + "px";
+ display.scrollbarsClipped = true;
+ }
+ }
+
+ function selectionSnapshot(cm) {
+ if (cm.hasFocus()) { return null }
+ var active = activeElt();
+ if (!active || !contains(cm.display.lineDiv, active)) { return null }
+ var result = {activeElt: active};
+ if (window.getSelection) {
+ var sel = window.getSelection();
+ if (sel.anchorNode && sel.extend && contains(cm.display.lineDiv, sel.anchorNode)) {
+ result.anchorNode = sel.anchorNode;
+ result.anchorOffset = sel.anchorOffset;
+ result.focusNode = sel.focusNode;
+ result.focusOffset = sel.focusOffset;
+ }
+ }
+ return result
+ }
+
+ function restoreSelection(snapshot) {
+ if (!snapshot || !snapshot.activeElt || snapshot.activeElt == activeElt()) { return }
+ snapshot.activeElt.focus();
+ if (!/^(INPUT|TEXTAREA)$/.test(snapshot.activeElt.nodeName) &&
+ snapshot.anchorNode && contains(document.body, snapshot.anchorNode) && contains(document.body, snapshot.focusNode)) {
+ var sel = window.getSelection(), range = document.createRange();
+ range.setEnd(snapshot.anchorNode, snapshot.anchorOffset);
+ range.collapse(false);
+ sel.removeAllRanges();
+ sel.addRange(range);
+ sel.extend(snapshot.focusNode, snapshot.focusOffset);
+ }
+ }
+
+ // Does the actual updating of the line display. Bails out
+ // (returning false) when there is nothing to be done and forced is
+ // false.
+ function updateDisplayIfNeeded(cm, update) {
+ var display = cm.display, doc = cm.doc;
+
+ if (update.editorIsHidden) {
+ resetView(cm);
+ return false
+ }
+
+ // Bail out if the visible area is already rendered and nothing changed.
+ if (!update.force &&
+ update.visible.from >= display.viewFrom && update.visible.to <= display.viewTo &&
+ (display.updateLineNumbers == null || display.updateLineNumbers >= display.viewTo) &&
+ display.renderedView == display.view && countDirtyView(cm) == 0)
+ { return false }
+
+ if (maybeUpdateLineNumberWidth(cm)) {
+ resetView(cm);
+ update.dims = getDimensions(cm);
+ }
+
+ // Compute a suitable new viewport (from & to)
+ var end = doc.first + doc.size;
+ var from = Math.max(update.visible.from - cm.options.viewportMargin, doc.first);
+ var to = Math.min(end, update.visible.to + cm.options.viewportMargin);
+ if (display.viewFrom < from && from - display.viewFrom < 20) { from = Math.max(doc.first, display.viewFrom); }
+ if (display.viewTo > to && display.viewTo - to < 20) { to = Math.min(end, display.viewTo); }
+ if (sawCollapsedSpans) {
+ from = visualLineNo(cm.doc, from);
+ to = visualLineEndNo(cm.doc, to);
+ }
+
+ var different = from != display.viewFrom || to != display.viewTo ||
+ display.lastWrapHeight != update.wrapperHeight || display.lastWrapWidth != update.wrapperWidth;
+ adjustView(cm, from, to);
+
+ display.viewOffset = heightAtLine(getLine(cm.doc, display.viewFrom));
+ // Position the mover div to align with the current scroll position
+ cm.display.mover.style.top = display.viewOffset + "px";
+
+ var toUpdate = countDirtyView(cm);
+ if (!different && toUpdate == 0 && !update.force && display.renderedView == display.view &&
+ (display.updateLineNumbers == null || display.updateLineNumbers >= display.viewTo))
+ { return false }
+
+ // For big changes, we hide the enclosing element during the
+ // update, since that speeds up the operations on most browsers.
+ var selSnapshot = selectionSnapshot(cm);
+ if (toUpdate > 4) { display.lineDiv.style.display = "none"; }
+ patchDisplay(cm, display.updateLineNumbers, update.dims);
+ if (toUpdate > 4) { display.lineDiv.style.display = ""; }
+ display.renderedView = display.view;
+ // There might have been a widget with a focused element that got
+ // hidden or updated, if so re-focus it.
+ restoreSelection(selSnapshot);
+
+ // Prevent selection and cursors from interfering with the scroll
+ // width and height.
+ removeChildren(display.cursorDiv);
+ removeChildren(display.selectionDiv);
+ display.gutters.style.height = display.sizer.style.minHeight = 0;
+
+ if (different) {
+ display.lastWrapHeight = update.wrapperHeight;
+ display.lastWrapWidth = update.wrapperWidth;
+ startWorker(cm, 400);
+ }
+
+ display.updateLineNumbers = null;
+
+ return true
+ }
+
+ function postUpdateDisplay(cm, update) {
+ var viewport = update.viewport;
+
+ for (var first = true;; first = false) {
+ if (!first || !cm.options.lineWrapping || update.oldDisplayWidth == displayWidth(cm)) {
+ // Clip forced viewport to actual scrollable area.
+ if (viewport && viewport.top != null)
+ { viewport = {top: Math.min(cm.doc.height + paddingVert(cm.display) - displayHeight(cm), viewport.top)}; }
+ // Updated line heights might result in the drawn area not
+ // actually covering the viewport. Keep looping until it does.
+ update.visible = visibleLines(cm.display, cm.doc, viewport);
+ if (update.visible.from >= cm.display.viewFrom && update.visible.to <= cm.display.viewTo)
+ { break }
+ } else if (first) {
+ update.visible = visibleLines(cm.display, cm.doc, viewport);
+ }
+ if (!updateDisplayIfNeeded(cm, update)) { break }
+ updateHeightsInViewport(cm);
+ var barMeasure = measureForScrollbars(cm);
+ updateSelection(cm);
+ updateScrollbars(cm, barMeasure);
+ setDocumentHeight(cm, barMeasure);
+ update.force = false;
+ }
+
+ update.signal(cm, "update", cm);
+ if (cm.display.viewFrom != cm.display.reportedViewFrom || cm.display.viewTo != cm.display.reportedViewTo) {
+ update.signal(cm, "viewportChange", cm, cm.display.viewFrom, cm.display.viewTo);
+ cm.display.reportedViewFrom = cm.display.viewFrom; cm.display.reportedViewTo = cm.display.viewTo;
+ }
+ }
+
+ function updateDisplaySimple(cm, viewport) {
+ var update = new DisplayUpdate(cm, viewport);
+ if (updateDisplayIfNeeded(cm, update)) {
+ updateHeightsInViewport(cm);
+ postUpdateDisplay(cm, update);
+ var barMeasure = measureForScrollbars(cm);
+ updateSelection(cm);
+ updateScrollbars(cm, barMeasure);
+ setDocumentHeight(cm, barMeasure);
+ update.finish();
+ }
+ }
+
+ // Sync the actual display DOM structure with display.view, removing
+ // nodes for lines that are no longer in view, and creating the ones
+ // that are not there yet, and updating the ones that are out of
+ // date.
+ function patchDisplay(cm, updateNumbersFrom, dims) {
+ var display = cm.display, lineNumbers = cm.options.lineNumbers;
+ var container = display.lineDiv, cur = container.firstChild;
+
+ function rm(node) {
+ var next = node.nextSibling;
+ // Works around a throw-scroll bug in OS X Webkit
+ if (webkit && mac && cm.display.currentWheelTarget == node)
+ { node.style.display = "none"; }
+ else
+ { node.parentNode.removeChild(node); }
+ return next
+ }
+
+ var view = display.view, lineN = display.viewFrom;
+ // Loop over the elements in the view, syncing cur (the DOM nodes
+ // in display.lineDiv) with the view as we go.
+ for (var i = 0; i < view.length; i++) {
+ var lineView = view[i];
+ if (lineView.hidden) ; else if (!lineView.node || lineView.node.parentNode != container) { // Not drawn yet
+ var node = buildLineElement(cm, lineView, lineN, dims);
+ container.insertBefore(node, cur);
+ } else { // Already drawn
+ while (cur != lineView.node) { cur = rm(cur); }
+ var updateNumber = lineNumbers && updateNumbersFrom != null &&
+ updateNumbersFrom <= lineN && lineView.lineNumber;
+ if (lineView.changes) {
+ if (indexOf(lineView.changes, "gutter") > -1) { updateNumber = false; }
+ updateLineForChanges(cm, lineView, lineN, dims);
+ }
+ if (updateNumber) {
+ removeChildren(lineView.lineNumber);
+ lineView.lineNumber.appendChild(document.createTextNode(lineNumberFor(cm.options, lineN)));
+ }
+ cur = lineView.node.nextSibling;
+ }
+ lineN += lineView.size;
+ }
+ while (cur) { cur = rm(cur); }
+ }
+
+ function updateGutterSpace(display) {
+ var width = display.gutters.offsetWidth;
+ display.sizer.style.marginLeft = width + "px";
+ }
+
+ function setDocumentHeight(cm, measure) {
+ cm.display.sizer.style.minHeight = measure.docHeight + "px";
+ cm.display.heightForcer.style.top = measure.docHeight + "px";
+ cm.display.gutters.style.height = (measure.docHeight + cm.display.barHeight + scrollGap(cm)) + "px";
+ }
+
+ // Re-align line numbers and gutter marks to compensate for
+ // horizontal scrolling.
+ function alignHorizontally(cm) {
+ var display = cm.display, view = display.view;
+ if (!display.alignWidgets && (!display.gutters.firstChild || !cm.options.fixedGutter)) { return }
+ var comp = compensateForHScroll(display) - display.scroller.scrollLeft + cm.doc.scrollLeft;
+ var gutterW = display.gutters.offsetWidth, left = comp + "px";
+ for (var i = 0; i < view.length; i++) { if (!view[i].hidden) {
+ if (cm.options.fixedGutter) {
+ if (view[i].gutter)
+ { view[i].gutter.style.left = left; }
+ if (view[i].gutterBackground)
+ { view[i].gutterBackground.style.left = left; }
+ }
+ var align = view[i].alignable;
+ if (align) { for (var j = 0; j < align.length; j++)
+ { align[j].style.left = left; } }
+ } }
+ if (cm.options.fixedGutter)
+ { display.gutters.style.left = (comp + gutterW) + "px"; }
+ }
+
+ // Used to ensure that the line number gutter is still the right
+ // size for the current document size. Returns true when an update
+ // is needed.
+ function maybeUpdateLineNumberWidth(cm) {
+ if (!cm.options.lineNumbers) { return false }
+ var doc = cm.doc, last = lineNumberFor(cm.options, doc.first + doc.size - 1), display = cm.display;
+ if (last.length != display.lineNumChars) {
+ var test = display.measure.appendChild(elt("div", [elt("div", last)],
+ "CodeMirror-linenumber CodeMirror-gutter-elt"));
+ var innerW = test.firstChild.offsetWidth, padding = test.offsetWidth - innerW;
+ display.lineGutter.style.width = "";
+ display.lineNumInnerWidth = Math.max(innerW, display.lineGutter.offsetWidth - padding) + 1;
+ display.lineNumWidth = display.lineNumInnerWidth + padding;
+ display.lineNumChars = display.lineNumInnerWidth ? last.length : -1;
+ display.lineGutter.style.width = display.lineNumWidth + "px";
+ updateGutterSpace(cm.display);
+ return true
+ }
+ return false
+ }
+
+ function getGutters(gutters, lineNumbers) {
+ var result = [], sawLineNumbers = false;
+ for (var i = 0; i < gutters.length; i++) {
+ var name = gutters[i], style = null;
+ if (typeof name != "string") { style = name.style; name = name.className; }
+ if (name == "CodeMirror-linenumbers") {
+ if (!lineNumbers) { continue }
+ else { sawLineNumbers = true; }
+ }
+ result.push({className: name, style: style});
+ }
+ if (lineNumbers && !sawLineNumbers) { result.push({className: "CodeMirror-linenumbers", style: null}); }
+ return result
+ }
+
+ // Rebuild the gutter elements, ensure the margin to the left of the
+ // code matches their width.
+ function renderGutters(display) {
+ var gutters = display.gutters, specs = display.gutterSpecs;
+ removeChildren(gutters);
+ display.lineGutter = null;
+ for (var i = 0; i < specs.length; ++i) {
+ var ref = specs[i];
+ var className = ref.className;
+ var style = ref.style;
+ var gElt = gutters.appendChild(elt("div", null, "CodeMirror-gutter " + className));
+ if (style) { gElt.style.cssText = style; }
+ if (className == "CodeMirror-linenumbers") {
+ display.lineGutter = gElt;
+ gElt.style.width = (display.lineNumWidth || 1) + "px";
+ }
+ }
+ gutters.style.display = specs.length ? "" : "none";
+ updateGutterSpace(display);
+ }
+
+ function updateGutters(cm) {
+ renderGutters(cm.display);
+ regChange(cm);
+ alignHorizontally(cm);
+ }
+
+ // The display handles the DOM integration, both for input reading
+ // and content drawing. It holds references to DOM nodes and
+ // display-related state.
+
+ function Display(place, doc, input, options) {
+ var d = this;
+ this.input = input;
+
+ // Covers bottom-right square when both scrollbars are present.
+ d.scrollbarFiller = elt("div", null, "CodeMirror-scrollbar-filler");
+ d.scrollbarFiller.setAttribute("cm-not-content", "true");
+ // Covers bottom of gutter when coverGutterNextToScrollbar is on
+ // and h scrollbar is present.
+ d.gutterFiller = elt("div", null, "CodeMirror-gutter-filler");
+ d.gutterFiller.setAttribute("cm-not-content", "true");
+ // Will contain the actual code, positioned to cover the viewport.
+ d.lineDiv = eltP("div", null, "CodeMirror-code");
+ // Elements are added to these to represent selection and cursors.
+ d.selectionDiv = elt("div", null, null, "position: relative; z-index: 1");
+ d.cursorDiv = elt("div", null, "CodeMirror-cursors");
+ // A visibility: hidden element used to find the size of things.
+ d.measure = elt("div", null, "CodeMirror-measure");
+ // When lines outside of the viewport are measured, they are drawn in this.
+ d.lineMeasure = elt("div", null, "CodeMirror-measure");
+ // Wraps everything that needs to exist inside the vertically-padded coordinate system
+ d.lineSpace = eltP("div", [d.measure, d.lineMeasure, d.selectionDiv, d.cursorDiv, d.lineDiv],
+ null, "position: relative; outline: none");
+ var lines = eltP("div", [d.lineSpace], "CodeMirror-lines");
+ // Moved around its parent to cover visible view.
+ d.mover = elt("div", [lines], null, "position: relative");
+ // Set to the height of the document, allowing scrolling.
+ d.sizer = elt("div", [d.mover], "CodeMirror-sizer");
+ d.sizerWidth = null;
+ // Behavior of elts with overflow: auto and padding is
+ // inconsistent across browsers. This is used to ensure the
+ // scrollable area is big enough.
+ d.heightForcer = elt("div", null, null, "position: absolute; height: " + scrollerGap + "px; width: 1px;");
+ // Will contain the gutters, if any.
+ d.gutters = elt("div", null, "CodeMirror-gutters");
+ d.lineGutter = null;
+ // Actual scrollable element.
+ d.scroller = elt("div", [d.sizer, d.heightForcer, d.gutters], "CodeMirror-scroll");
+ d.scroller.setAttribute("tabIndex", "-1");
+ // The element in which the editor lives.
+ d.wrapper = elt("div", [d.scrollbarFiller, d.gutterFiller, d.scroller], "CodeMirror");
+
+ // Work around IE7 z-index bug (not perfect, hence IE7 not really being supported)
+ if (ie && ie_version < 8) { d.gutters.style.zIndex = -1; d.scroller.style.paddingRight = 0; }
+ if (!webkit && !(gecko && mobile)) { d.scroller.draggable = true; }
+
+ if (place) {
+ if (place.appendChild) { place.appendChild(d.wrapper); }
+ else { place(d.wrapper); }
+ }
+
+ // Current rendered range (may be bigger than the view window).
+ d.viewFrom = d.viewTo = doc.first;
+ d.reportedViewFrom = d.reportedViewTo = doc.first;
+ // Information about the rendered lines.
+ d.view = [];
+ d.renderedView = null;
+ // Holds info about a single rendered line when it was rendered
+ // for measurement, while not in view.
+ d.externalMeasured = null;
+ // Empty space (in pixels) above the view
+ d.viewOffset = 0;
+ d.lastWrapHeight = d.lastWrapWidth = 0;
+ d.updateLineNumbers = null;
+
+ d.nativeBarWidth = d.barHeight = d.barWidth = 0;
+ d.scrollbarsClipped = false;
+
+ // Used to only resize the line number gutter when necessary (when
+ // the amount of lines crosses a boundary that makes its width change)
+ d.lineNumWidth = d.lineNumInnerWidth = d.lineNumChars = null;
+ // Set to true when a non-horizontal-scrolling line widget is
+ // added. As an optimization, line widget aligning is skipped when
+ // this is false.
+ d.alignWidgets = false;
+
+ d.cachedCharWidth = d.cachedTextHeight = d.cachedPaddingH = null;
+
+ // Tracks the maximum line length so that the horizontal scrollbar
+ // can be kept static when scrolling.
+ d.maxLine = null;
+ d.maxLineLength = 0;
+ d.maxLineChanged = false;
+
+ // Used for measuring wheel scrolling granularity
+ d.wheelDX = d.wheelDY = d.wheelStartX = d.wheelStartY = null;
+
+ // True when shift is held down.
+ d.shift = false;
+
+ // Used to track whether anything happened since the context menu
+ // was opened.
+ d.selForContextMenu = null;
+
+ d.activeTouch = null;
+
+ d.gutterSpecs = getGutters(options.gutters, options.lineNumbers);
+ renderGutters(d);
+
+ input.init(d);
+ }
+
+ // Since the delta values reported on mouse wheel events are
+ // unstandardized between browsers and even browser versions, and
+ // generally horribly unpredictable, this code starts by measuring
+ // the scroll effect that the first few mouse wheel events have,
+ // and, from that, detects the way it can convert deltas to pixel
+ // offsets afterwards.
+ //
+ // The reason we want to know the amount a wheel event will scroll
+ // is that it gives us a chance to update the display before the
+ // actual scrolling happens, reducing flickering.
+
+ var wheelSamples = 0, wheelPixelsPerUnit = null;
+ // Fill in a browser-detected starting value on browsers where we
+ // know one. These don't have to be accurate -- the result of them
+ // being wrong would just be a slight flicker on the first wheel
+ // scroll (if it is large enough).
+ if (ie) { wheelPixelsPerUnit = -.53; }
+ else if (gecko) { wheelPixelsPerUnit = 15; }
+ else if (chrome) { wheelPixelsPerUnit = -.7; }
+ else if (safari) { wheelPixelsPerUnit = -1/3; }
+
+ function wheelEventDelta(e) {
+ var dx = e.wheelDeltaX, dy = e.wheelDeltaY;
+ if (dx == null && e.detail && e.axis == e.HORIZONTAL_AXIS) { dx = e.detail; }
+ if (dy == null && e.detail && e.axis == e.VERTICAL_AXIS) { dy = e.detail; }
+ else if (dy == null) { dy = e.wheelDelta; }
+ return {x: dx, y: dy}
+ }
+ function wheelEventPixels(e) {
+ var delta = wheelEventDelta(e);
+ delta.x *= wheelPixelsPerUnit;
+ delta.y *= wheelPixelsPerUnit;
+ return delta
+ }
+
+ function onScrollWheel(cm, e) {
+ var delta = wheelEventDelta(e), dx = delta.x, dy = delta.y;
+
+ var display = cm.display, scroll = display.scroller;
+ // Quit if there's nothing to scroll here
+ var canScrollX = scroll.scrollWidth > scroll.clientWidth;
+ var canScrollY = scroll.scrollHeight > scroll.clientHeight;
+ if (!(dx && canScrollX || dy && canScrollY)) { return }
+
+ // Webkit browsers on OS X abort momentum scrolls when the target
+ // of the scroll event is removed from the scrollable element.
+ // This hack (see related code in patchDisplay) makes sure the
+ // element is kept around.
+ if (dy && mac && webkit) {
+ outer: for (var cur = e.target, view = display.view; cur != scroll; cur = cur.parentNode) {
+ for (var i = 0; i < view.length; i++) {
+ if (view[i].node == cur) {
+ cm.display.currentWheelTarget = cur;
+ break outer
+ }
+ }
+ }
+ }
+
+ // On some browsers, horizontal scrolling will cause redraws to
+ // happen before the gutter has been realigned, causing it to
+ // wriggle around in a most unseemly way. When we have an
+ // estimated pixels/delta value, we just handle horizontal
+ // scrolling entirely here. It'll be slightly off from native, but
+ // better than glitching out.
+ if (dx && !gecko && !presto && wheelPixelsPerUnit != null) {
+ if (dy && canScrollY)
+ { updateScrollTop(cm, Math.max(0, scroll.scrollTop + dy * wheelPixelsPerUnit)); }
+ setScrollLeft(cm, Math.max(0, scroll.scrollLeft + dx * wheelPixelsPerUnit));
+ // Only prevent default scrolling if vertical scrolling is
+ // actually possible. Otherwise, it causes vertical scroll
+ // jitter on OSX trackpads when deltaX is small and deltaY
+ // is large (issue #3579)
+ if (!dy || (dy && canScrollY))
+ { e_preventDefault(e); }
+ display.wheelStartX = null; // Abort measurement, if in progress
+ return
+ }
+
+ // 'Project' the visible viewport to cover the area that is being
+ // scrolled into view (if we know enough to estimate it).
+ if (dy && wheelPixelsPerUnit != null) {
+ var pixels = dy * wheelPixelsPerUnit;
+ var top = cm.doc.scrollTop, bot = top + display.wrapper.clientHeight;
+ if (pixels < 0) { top = Math.max(0, top + pixels - 50); }
+ else { bot = Math.min(cm.doc.height, bot + pixels + 50); }
+ updateDisplaySimple(cm, {top: top, bottom: bot});
+ }
+
+ if (wheelSamples < 20) {
+ if (display.wheelStartX == null) {
+ display.wheelStartX = scroll.scrollLeft; display.wheelStartY = scroll.scrollTop;
+ display.wheelDX = dx; display.wheelDY = dy;
+ setTimeout(function () {
+ if (display.wheelStartX == null) { return }
+ var movedX = scroll.scrollLeft - display.wheelStartX;
+ var movedY = scroll.scrollTop - display.wheelStartY;
+ var sample = (movedY && display.wheelDY && movedY / display.wheelDY) ||
+ (movedX && display.wheelDX && movedX / display.wheelDX);
+ display.wheelStartX = display.wheelStartY = null;
+ if (!sample) { return }
+ wheelPixelsPerUnit = (wheelPixelsPerUnit * wheelSamples + sample) / (wheelSamples + 1);
+ ++wheelSamples;
+ }, 200);
+ } else {
+ display.wheelDX += dx; display.wheelDY += dy;
+ }
+ }
+ }
+
+ // Selection objects are immutable. A new one is created every time
+ // the selection changes. A selection is one or more non-overlapping
+ // (and non-touching) ranges, sorted, and an integer that indicates
+ // which one is the primary selection (the one that's scrolled into
+ // view, that getCursor returns, etc).
+ var Selection = function(ranges, primIndex) {
+ this.ranges = ranges;
+ this.primIndex = primIndex;
+ };
+
+ Selection.prototype.primary = function () { return this.ranges[this.primIndex] };
+
+ Selection.prototype.equals = function (other) {
+ if (other == this) { return true }
+ if (other.primIndex != this.primIndex || other.ranges.length != this.ranges.length) { return false }
+ for (var i = 0; i < this.ranges.length; i++) {
+ var here = this.ranges[i], there = other.ranges[i];
+ if (!equalCursorPos(here.anchor, there.anchor) || !equalCursorPos(here.head, there.head)) { return false }
+ }
+ return true
+ };
+
+ Selection.prototype.deepCopy = function () {
+ var out = [];
+ for (var i = 0; i < this.ranges.length; i++)
+ { out[i] = new Range(copyPos(this.ranges[i].anchor), copyPos(this.ranges[i].head)); }
+ return new Selection(out, this.primIndex)
+ };
+
+ Selection.prototype.somethingSelected = function () {
+ for (var i = 0; i < this.ranges.length; i++)
+ { if (!this.ranges[i].empty()) { return true } }
+ return false
+ };
+
+ Selection.prototype.contains = function (pos, end) {
+ if (!end) { end = pos; }
+ for (var i = 0; i < this.ranges.length; i++) {
+ var range = this.ranges[i];
+ if (cmp(end, range.from()) >= 0 && cmp(pos, range.to()) <= 0)
+ { return i }
+ }
+ return -1
+ };
+
+ var Range = function(anchor, head) {
+ this.anchor = anchor; this.head = head;
+ };
+
+ Range.prototype.from = function () { return minPos(this.anchor, this.head) };
+ Range.prototype.to = function () { return maxPos(this.anchor, this.head) };
+ Range.prototype.empty = function () { return this.head.line == this.anchor.line && this.head.ch == this.anchor.ch };
+
+ // Take an unsorted, potentially overlapping set of ranges, and
+ // build a selection out of it. 'Consumes' ranges array (modifying
+ // it).
+ function normalizeSelection(cm, ranges, primIndex) {
+ var mayTouch = cm && cm.options.selectionsMayTouch;
+ var prim = ranges[primIndex];
+ ranges.sort(function (a, b) { return cmp(a.from(), b.from()); });
+ primIndex = indexOf(ranges, prim);
+ for (var i = 1; i < ranges.length; i++) {
+ var cur = ranges[i], prev = ranges[i - 1];
+ var diff = cmp(prev.to(), cur.from());
+ if (mayTouch && !cur.empty() ? diff > 0 : diff >= 0) {
+ var from = minPos(prev.from(), cur.from()), to = maxPos(prev.to(), cur.to());
+ var inv = prev.empty() ? cur.from() == cur.head : prev.from() == prev.head;
+ if (i <= primIndex) { --primIndex; }
+ ranges.splice(--i, 2, new Range(inv ? to : from, inv ? from : to));
+ }
+ }
+ return new Selection(ranges, primIndex)
+ }
+
+ function simpleSelection(anchor, head) {
+ return new Selection([new Range(anchor, head || anchor)], 0)
+ }
+
+ // Compute the position of the end of a change (its 'to' property
+ // refers to the pre-change end).
+ function changeEnd(change) {
+ if (!change.text) { return change.to }
+ return Pos(change.from.line + change.text.length - 1,
+ lst(change.text).length + (change.text.length == 1 ? change.from.ch : 0))
+ }
+
+ // Adjust a position to refer to the post-change position of the
+ // same text, or the end of the change if the change covers it.
+ function adjustForChange(pos, change) {
+ if (cmp(pos, change.from) < 0) { return pos }
+ if (cmp(pos, change.to) <= 0) { return changeEnd(change) }
+
+ var line = pos.line + change.text.length - (change.to.line - change.from.line) - 1, ch = pos.ch;
+ if (pos.line == change.to.line) { ch += changeEnd(change).ch - change.to.ch; }
+ return Pos(line, ch)
+ }
+
+ function computeSelAfterChange(doc, change) {
+ var out = [];
+ for (var i = 0; i < doc.sel.ranges.length; i++) {
+ var range = doc.sel.ranges[i];
+ out.push(new Range(adjustForChange(range.anchor, change),
+ adjustForChange(range.head, change)));
+ }
+ return normalizeSelection(doc.cm, out, doc.sel.primIndex)
+ }
+
+ function offsetPos(pos, old, nw) {
+ if (pos.line == old.line)
+ { return Pos(nw.line, pos.ch - old.ch + nw.ch) }
+ else
+ { return Pos(nw.line + (pos.line - old.line), pos.ch) }
+ }
+
+ // Used by replaceSelections to allow moving the selection to the
+ // start or around the replaced test. Hint may be "start" or "around".
+ function computeReplacedSel(doc, changes, hint) {
+ var out = [];
+ var oldPrev = Pos(doc.first, 0), newPrev = oldPrev;
+ for (var i = 0; i < changes.length; i++) {
+ var change = changes[i];
+ var from = offsetPos(change.from, oldPrev, newPrev);
+ var to = offsetPos(changeEnd(change), oldPrev, newPrev);
+ oldPrev = change.to;
+ newPrev = to;
+ if (hint == "around") {
+ var range = doc.sel.ranges[i], inv = cmp(range.head, range.anchor) < 0;
+ out[i] = new Range(inv ? to : from, inv ? from : to);
+ } else {
+ out[i] = new Range(from, from);
+ }
+ }
+ return new Selection(out, doc.sel.primIndex)
+ }
+
+ // Used to get the editor into a consistent state again when options change.
+
+ function loadMode(cm) {
+ cm.doc.mode = getMode(cm.options, cm.doc.modeOption);
+ resetModeState(cm);
+ }
+
+ function resetModeState(cm) {
+ cm.doc.iter(function (line) {
+ if (line.stateAfter) { line.stateAfter = null; }
+ if (line.styles) { line.styles = null; }
+ });
+ cm.doc.modeFrontier = cm.doc.highlightFrontier = cm.doc.first;
+ startWorker(cm, 100);
+ cm.state.modeGen++;
+ if (cm.curOp) { regChange(cm); }
+ }
+
+ // DOCUMENT DATA STRUCTURE
+
+ // By default, updates that start and end at the beginning of a line
+ // are treated specially, in order to make the association of line
+ // widgets and marker elements with the text behave more intuitive.
+ function isWholeLineUpdate(doc, change) {
+ return change.from.ch == 0 && change.to.ch == 0 && lst(change.text) == "" &&
+ (!doc.cm || doc.cm.options.wholeLineUpdateBefore)
+ }
+
+ // Perform a change on the document data structure.
+ function updateDoc(doc, change, markedSpans, estimateHeight) {
+ function spansFor(n) {return markedSpans ? markedSpans[n] : null}
+ function update(line, text, spans) {
+ updateLine(line, text, spans, estimateHeight);
+ signalLater(line, "change", line, change);
+ }
+ function linesFor(start, end) {
+ var result = [];
+ for (var i = start; i < end; ++i)
+ { result.push(new Line(text[i], spansFor(i), estimateHeight)); }
+ return result
+ }
+
+ var from = change.from, to = change.to, text = change.text;
+ var firstLine = getLine(doc, from.line), lastLine = getLine(doc, to.line);
+ var lastText = lst(text), lastSpans = spansFor(text.length - 1), nlines = to.line - from.line;
+
+ // Adjust the line structure
+ if (change.full) {
+ doc.insert(0, linesFor(0, text.length));
+ doc.remove(text.length, doc.size - text.length);
+ } else if (isWholeLineUpdate(doc, change)) {
+ // This is a whole-line replace. Treated specially to make
+ // sure line objects move the way they are supposed to.
+ var added = linesFor(0, text.length - 1);
+ update(lastLine, lastLine.text, lastSpans);
+ if (nlines) { doc.remove(from.line, nlines); }
+ if (added.length) { doc.insert(from.line, added); }
+ } else if (firstLine == lastLine) {
+ if (text.length == 1) {
+ update(firstLine, firstLine.text.slice(0, from.ch) + lastText + firstLine.text.slice(to.ch), lastSpans);
+ } else {
+ var added$1 = linesFor(1, text.length - 1);
+ added$1.push(new Line(lastText + firstLine.text.slice(to.ch), lastSpans, estimateHeight));
+ update(firstLine, firstLine.text.slice(0, from.ch) + text[0], spansFor(0));
+ doc.insert(from.line + 1, added$1);
+ }
+ } else if (text.length == 1) {
+ update(firstLine, firstLine.text.slice(0, from.ch) + text[0] + lastLine.text.slice(to.ch), spansFor(0));
+ doc.remove(from.line + 1, nlines);
+ } else {
+ update(firstLine, firstLine.text.slice(0, from.ch) + text[0], spansFor(0));
+ update(lastLine, lastText + lastLine.text.slice(to.ch), lastSpans);
+ var added$2 = linesFor(1, text.length - 1);
+ if (nlines > 1) { doc.remove(from.line + 1, nlines - 1); }
+ doc.insert(from.line + 1, added$2);
+ }
+
+ signalLater(doc, "change", doc, change);
+ }
+
+ // Call f for all linked documents.
+ function linkedDocs(doc, f, sharedHistOnly) {
+ function propagate(doc, skip, sharedHist) {
+ if (doc.linked) { for (var i = 0; i < doc.linked.length; ++i) {
+ var rel = doc.linked[i];
+ if (rel.doc == skip) { continue }
+ var shared = sharedHist && rel.sharedHist;
+ if (sharedHistOnly && !shared) { continue }
+ f(rel.doc, shared);
+ propagate(rel.doc, doc, shared);
+ } }
+ }
+ propagate(doc, null, true);
+ }
+
+ // Attach a document to an editor.
+ function attachDoc(cm, doc) {
+ if (doc.cm) { throw new Error("This document is already in use.") }
+ cm.doc = doc;
+ doc.cm = cm;
+ estimateLineHeights(cm);
+ loadMode(cm);
+ setDirectionClass(cm);
+ if (!cm.options.lineWrapping) { findMaxLine(cm); }
+ cm.options.mode = doc.modeOption;
+ regChange(cm);
+ }
+
+ function setDirectionClass(cm) {
+ (cm.doc.direction == "rtl" ? addClass : rmClass)(cm.display.lineDiv, "CodeMirror-rtl");
+ }
+
+ function directionChanged(cm) {
+ runInOp(cm, function () {
+ setDirectionClass(cm);
+ regChange(cm);
+ });
+ }
+
+ function History(startGen) {
+ // Arrays of change events and selections. Doing something adds an
+ // event to done and clears undo. Undoing moves events from done
+ // to undone, redoing moves them in the other direction.
+ this.done = []; this.undone = [];
+ this.undoDepth = Infinity;
+ // Used to track when changes can be merged into a single undo
+ // event
+ this.lastModTime = this.lastSelTime = 0;
+ this.lastOp = this.lastSelOp = null;
+ this.lastOrigin = this.lastSelOrigin = null;
+ // Used by the isClean() method
+ this.generation = this.maxGeneration = startGen || 1;
+ }
+
+ // Create a history change event from an updateDoc-style change
+ // object.
+ function historyChangeFromChange(doc, change) {
+ var histChange = {from: copyPos(change.from), to: changeEnd(change), text: getBetween(doc, change.from, change.to)};
+ attachLocalSpans(doc, histChange, change.from.line, change.to.line + 1);
+ linkedDocs(doc, function (doc) { return attachLocalSpans(doc, histChange, change.from.line, change.to.line + 1); }, true);
+ return histChange
+ }
+
+ // Pop all selection events off the end of a history array. Stop at
+ // a change event.
+ function clearSelectionEvents(array) {
+ while (array.length) {
+ var last = lst(array);
+ if (last.ranges) { array.pop(); }
+ else { break }
+ }
+ }
+
+ // Find the top change event in the history. Pop off selection
+ // events that are in the way.
+ function lastChangeEvent(hist, force) {
+ if (force) {
+ clearSelectionEvents(hist.done);
+ return lst(hist.done)
+ } else if (hist.done.length && !lst(hist.done).ranges) {
+ return lst(hist.done)
+ } else if (hist.done.length > 1 && !hist.done[hist.done.length - 2].ranges) {
+ hist.done.pop();
+ return lst(hist.done)
+ }
+ }
+
+ // Register a change in the history. Merges changes that are within
+ // a single operation, or are close together with an origin that
+ // allows merging (starting with "+") into a single event.
+ function addChangeToHistory(doc, change, selAfter, opId) {
+ var hist = doc.history;
+ hist.undone.length = 0;
+ var time = +new Date, cur;
+ var last;
+
+ if ((hist.lastOp == opId ||
+ hist.lastOrigin == change.origin && change.origin &&
+ ((change.origin.charAt(0) == "+" && hist.lastModTime > time - (doc.cm ? doc.cm.options.historyEventDelay : 500)) ||
+ change.origin.charAt(0) == "*")) &&
+ (cur = lastChangeEvent(hist, hist.lastOp == opId))) {
+ // Merge this change into the last event
+ last = lst(cur.changes);
+ if (cmp(change.from, change.to) == 0 && cmp(change.from, last.to) == 0) {
+ // Optimized case for simple insertion -- don't want to add
+ // new changesets for every character typed
+ last.to = changeEnd(change);
+ } else {
+ // Add new sub-event
+ cur.changes.push(historyChangeFromChange(doc, change));
+ }
+ } else {
+ // Can not be merged, start a new event.
+ var before = lst(hist.done);
+ if (!before || !before.ranges)
+ { pushSelectionToHistory(doc.sel, hist.done); }
+ cur = {changes: [historyChangeFromChange(doc, change)],
+ generation: hist.generation};
+ hist.done.push(cur);
+ while (hist.done.length > hist.undoDepth) {
+ hist.done.shift();
+ if (!hist.done[0].ranges) { hist.done.shift(); }
+ }
+ }
+ hist.done.push(selAfter);
+ hist.generation = ++hist.maxGeneration;
+ hist.lastModTime = hist.lastSelTime = time;
+ hist.lastOp = hist.lastSelOp = opId;
+ hist.lastOrigin = hist.lastSelOrigin = change.origin;
+
+ if (!last) { signal(doc, "historyAdded"); }
+ }
+
+ function selectionEventCanBeMerged(doc, origin, prev, sel) {
+ var ch = origin.charAt(0);
+ return ch == "*" ||
+ ch == "+" &&
+ prev.ranges.length == sel.ranges.length &&
+ prev.somethingSelected() == sel.somethingSelected() &&
+ new Date - doc.history.lastSelTime <= (doc.cm ? doc.cm.options.historyEventDelay : 500)
+ }
+
+ // Called whenever the selection changes, sets the new selection as
+ // the pending selection in the history, and pushes the old pending
+ // selection into the 'done' array when it was significantly
+ // different (in number of selected ranges, emptiness, or time).
+ function addSelectionToHistory(doc, sel, opId, options) {
+ var hist = doc.history, origin = options && options.origin;
+
+ // A new event is started when the previous origin does not match
+ // the current, or the origins don't allow matching. Origins
+ // starting with * are always merged, those starting with + are
+ // merged when similar and close together in time.
+ if (opId == hist.lastSelOp ||
+ (origin && hist.lastSelOrigin == origin &&
+ (hist.lastModTime == hist.lastSelTime && hist.lastOrigin == origin ||
+ selectionEventCanBeMerged(doc, origin, lst(hist.done), sel))))
+ { hist.done[hist.done.length - 1] = sel; }
+ else
+ { pushSelectionToHistory(sel, hist.done); }
+
+ hist.lastSelTime = +new Date;
+ hist.lastSelOrigin = origin;
+ hist.lastSelOp = opId;
+ if (options && options.clearRedo !== false)
+ { clearSelectionEvents(hist.undone); }
+ }
+
+ function pushSelectionToHistory(sel, dest) {
+ var top = lst(dest);
+ if (!(top && top.ranges && top.equals(sel)))
+ { dest.push(sel); }
+ }
+
+ // Used to store marked span information in the history.
+ function attachLocalSpans(doc, change, from, to) {
+ var existing = change["spans_" + doc.id], n = 0;
+ doc.iter(Math.max(doc.first, from), Math.min(doc.first + doc.size, to), function (line) {
+ if (line.markedSpans)
+ { (existing || (existing = change["spans_" + doc.id] = {}))[n] = line.markedSpans; }
+ ++n;
+ });
+ }
+
+ // When un/re-doing restores text containing marked spans, those
+ // that have been explicitly cleared should not be restored.
+ function removeClearedSpans(spans) {
+ if (!spans) { return null }
+ var out;
+ for (var i = 0; i < spans.length; ++i) {
+ if (spans[i].marker.explicitlyCleared) { if (!out) { out = spans.slice(0, i); } }
+ else if (out) { out.push(spans[i]); }
+ }
+ return !out ? spans : out.length ? out : null
+ }
+
+ // Retrieve and filter the old marked spans stored in a change event.
+ function getOldSpans(doc, change) {
+ var found = change["spans_" + doc.id];
+ if (!found) { return null }
+ var nw = [];
+ for (var i = 0; i < change.text.length; ++i)
+ { nw.push(removeClearedSpans(found[i])); }
+ return nw
+ }
+
+ // Used for un/re-doing changes from the history. Combines the
+ // result of computing the existing spans with the set of spans that
+ // existed in the history (so that deleting around a span and then
+ // undoing brings back the span).
+ function mergeOldSpans(doc, change) {
+ var old = getOldSpans(doc, change);
+ var stretched = stretchSpansOverChange(doc, change);
+ if (!old) { return stretched }
+ if (!stretched) { return old }
+
+ for (var i = 0; i < old.length; ++i) {
+ var oldCur = old[i], stretchCur = stretched[i];
+ if (oldCur && stretchCur) {
+ spans: for (var j = 0; j < stretchCur.length; ++j) {
+ var span = stretchCur[j];
+ for (var k = 0; k < oldCur.length; ++k)
+ { if (oldCur[k].marker == span.marker) { continue spans } }
+ oldCur.push(span);
+ }
+ } else if (stretchCur) {
+ old[i] = stretchCur;
+ }
+ }
+ return old
+ }
+
+ // Used both to provide a JSON-safe object in .getHistory, and, when
+ // detaching a document, to split the history in two
+ function copyHistoryArray(events, newGroup, instantiateSel) {
+ var copy = [];
+ for (var i = 0; i < events.length; ++i) {
+ var event = events[i];
+ if (event.ranges) {
+ copy.push(instantiateSel ? Selection.prototype.deepCopy.call(event) : event);
+ continue
+ }
+ var changes = event.changes, newChanges = [];
+ copy.push({changes: newChanges});
+ for (var j = 0; j < changes.length; ++j) {
+ var change = changes[j], m = (void 0);
+ newChanges.push({from: change.from, to: change.to, text: change.text});
+ if (newGroup) { for (var prop in change) { if (m = prop.match(/^spans_(\d+)$/)) {
+ if (indexOf(newGroup, Number(m[1])) > -1) {
+ lst(newChanges)[prop] = change[prop];
+ delete change[prop];
+ }
+ } } }
+ }
+ }
+ return copy
+ }
+
+ // The 'scroll' parameter given to many of these indicated whether
+ // the new cursor position should be scrolled into view after
+ // modifying the selection.
+
+ // If shift is held or the extend flag is set, extends a range to
+ // include a given position (and optionally a second position).
+ // Otherwise, simply returns the range between the given positions.
+ // Used for cursor motion and such.
+ function extendRange(range, head, other, extend) {
+ if (extend) {
+ var anchor = range.anchor;
+ if (other) {
+ var posBefore = cmp(head, anchor) < 0;
+ if (posBefore != (cmp(other, anchor) < 0)) {
+ anchor = head;
+ head = other;
+ } else if (posBefore != (cmp(head, other) < 0)) {
+ head = other;
+ }
+ }
+ return new Range(anchor, head)
+ } else {
+ return new Range(other || head, head)
+ }
+ }
+
+ // Extend the primary selection range, discard the rest.
+ function extendSelection(doc, head, other, options, extend) {
+ if (extend == null) { extend = doc.cm && (doc.cm.display.shift || doc.extend); }
+ setSelection(doc, new Selection([extendRange(doc.sel.primary(), head, other, extend)], 0), options);
+ }
+
+ // Extend all selections (pos is an array of selections with length
+ // equal the number of selections)
+ function extendSelections(doc, heads, options) {
+ var out = [];
+ var extend = doc.cm && (doc.cm.display.shift || doc.extend);
+ for (var i = 0; i < doc.sel.ranges.length; i++)
+ { out[i] = extendRange(doc.sel.ranges[i], heads[i], null, extend); }
+ var newSel = normalizeSelection(doc.cm, out, doc.sel.primIndex);
+ setSelection(doc, newSel, options);
+ }
+
+ // Updates a single range in the selection.
+ function replaceOneSelection(doc, i, range, options) {
+ var ranges = doc.sel.ranges.slice(0);
+ ranges[i] = range;
+ setSelection(doc, normalizeSelection(doc.cm, ranges, doc.sel.primIndex), options);
+ }
+
+ // Reset the selection to a single range.
+ function setSimpleSelection(doc, anchor, head, options) {
+ setSelection(doc, simpleSelection(anchor, head), options);
+ }
+
+ // Give beforeSelectionChange handlers a change to influence a
+ // selection update.
+ function filterSelectionChange(doc, sel, options) {
+ var obj = {
+ ranges: sel.ranges,
+ update: function(ranges) {
+ this.ranges = [];
+ for (var i = 0; i < ranges.length; i++)
+ { this.ranges[i] = new Range(clipPos(doc, ranges[i].anchor),
+ clipPos(doc, ranges[i].head)); }
+ },
+ origin: options && options.origin
+ };
+ signal(doc, "beforeSelectionChange", doc, obj);
+ if (doc.cm) { signal(doc.cm, "beforeSelectionChange", doc.cm, obj); }
+ if (obj.ranges != sel.ranges) { return normalizeSelection(doc.cm, obj.ranges, obj.ranges.length - 1) }
+ else { return sel }
+ }
+
+ function setSelectionReplaceHistory(doc, sel, options) {
+ var done = doc.history.done, last = lst(done);
+ if (last && last.ranges) {
+ done[done.length - 1] = sel;
+ setSelectionNoUndo(doc, sel, options);
+ } else {
+ setSelection(doc, sel, options);
+ }
+ }
+
+ // Set a new selection.
+ function setSelection(doc, sel, options) {
+ setSelectionNoUndo(doc, sel, options);
+ addSelectionToHistory(doc, doc.sel, doc.cm ? doc.cm.curOp.id : NaN, options);
+ }
+
+ function setSelectionNoUndo(doc, sel, options) {
+ if (hasHandler(doc, "beforeSelectionChange") || doc.cm && hasHandler(doc.cm, "beforeSelectionChange"))
+ { sel = filterSelectionChange(doc, sel, options); }
+
+ var bias = options && options.bias ||
+ (cmp(sel.primary().head, doc.sel.primary().head) < 0 ? -1 : 1);
+ setSelectionInner(doc, skipAtomicInSelection(doc, sel, bias, true));
+
+ if (!(options && options.scroll === false) && doc.cm)
+ { ensureCursorVisible(doc.cm); }
+ }
+
+ function setSelectionInner(doc, sel) {
+ if (sel.equals(doc.sel)) { return }
+
+ doc.sel = sel;
+
+ if (doc.cm) {
+ doc.cm.curOp.updateInput = 1;
+ doc.cm.curOp.selectionChanged = true;
+ signalCursorActivity(doc.cm);
+ }
+ signalLater(doc, "cursorActivity", doc);
+ }
+
+ // Verify that the selection does not partially select any atomic
+ // marked ranges.
+ function reCheckSelection(doc) {
+ setSelectionInner(doc, skipAtomicInSelection(doc, doc.sel, null, false));
+ }
+
+ // Return a selection that does not partially select any atomic
+ // ranges.
+ function skipAtomicInSelection(doc, sel, bias, mayClear) {
+ var out;
+ for (var i = 0; i < sel.ranges.length; i++) {
+ var range = sel.ranges[i];
+ var old = sel.ranges.length == doc.sel.ranges.length && doc.sel.ranges[i];
+ var newAnchor = skipAtomic(doc, range.anchor, old && old.anchor, bias, mayClear);
+ var newHead = skipAtomic(doc, range.head, old && old.head, bias, mayClear);
+ if (out || newAnchor != range.anchor || newHead != range.head) {
+ if (!out) { out = sel.ranges.slice(0, i); }
+ out[i] = new Range(newAnchor, newHead);
+ }
+ }
+ return out ? normalizeSelection(doc.cm, out, sel.primIndex) : sel
+ }
+
+ function skipAtomicInner(doc, pos, oldPos, dir, mayClear) {
+ var line = getLine(doc, pos.line);
+ if (line.markedSpans) { for (var i = 0; i < line.markedSpans.length; ++i) {
+ var sp = line.markedSpans[i], m = sp.marker;
+
+ // Determine if we should prevent the cursor being placed to the left/right of an atomic marker
+ // Historically this was determined using the inclusiveLeft/Right option, but the new way to control it
+ // is with selectLeft/Right
+ var preventCursorLeft = ("selectLeft" in m) ? !m.selectLeft : m.inclusiveLeft;
+ var preventCursorRight = ("selectRight" in m) ? !m.selectRight : m.inclusiveRight;
+
+ if ((sp.from == null || (preventCursorLeft ? sp.from <= pos.ch : sp.from < pos.ch)) &&
+ (sp.to == null || (preventCursorRight ? sp.to >= pos.ch : sp.to > pos.ch))) {
+ if (mayClear) {
+ signal(m, "beforeCursorEnter");
+ if (m.explicitlyCleared) {
+ if (!line.markedSpans) { break }
+ else {--i; continue}
+ }
+ }
+ if (!m.atomic) { continue }
+
+ if (oldPos) {
+ var near = m.find(dir < 0 ? 1 : -1), diff = (void 0);
+ if (dir < 0 ? preventCursorRight : preventCursorLeft)
+ { near = movePos(doc, near, -dir, near && near.line == pos.line ? line : null); }
+ if (near && near.line == pos.line && (diff = cmp(near, oldPos)) && (dir < 0 ? diff < 0 : diff > 0))
+ { return skipAtomicInner(doc, near, pos, dir, mayClear) }
+ }
+
+ var far = m.find(dir < 0 ? -1 : 1);
+ if (dir < 0 ? preventCursorLeft : preventCursorRight)
+ { far = movePos(doc, far, dir, far.line == pos.line ? line : null); }
+ return far ? skipAtomicInner(doc, far, pos, dir, mayClear) : null
+ }
+ } }
+ return pos
+ }
+
+ // Ensure a given position is not inside an atomic range.
+ function skipAtomic(doc, pos, oldPos, bias, mayClear) {
+ var dir = bias || 1;
+ var found = skipAtomicInner(doc, pos, oldPos, dir, mayClear) ||
+ (!mayClear && skipAtomicInner(doc, pos, oldPos, dir, true)) ||
+ skipAtomicInner(doc, pos, oldPos, -dir, mayClear) ||
+ (!mayClear && skipAtomicInner(doc, pos, oldPos, -dir, true));
+ if (!found) {
+ doc.cantEdit = true;
+ return Pos(doc.first, 0)
+ }
+ return found
+ }
+
+ function movePos(doc, pos, dir, line) {
+ if (dir < 0 && pos.ch == 0) {
+ if (pos.line > doc.first) { return clipPos(doc, Pos(pos.line - 1)) }
+ else { return null }
+ } else if (dir > 0 && pos.ch == (line || getLine(doc, pos.line)).text.length) {
+ if (pos.line < doc.first + doc.size - 1) { return Pos(pos.line + 1, 0) }
+ else { return null }
+ } else {
+ return new Pos(pos.line, pos.ch + dir)
+ }
+ }
+
+ function selectAll(cm) {
+ cm.setSelection(Pos(cm.firstLine(), 0), Pos(cm.lastLine()), sel_dontScroll);
+ }
+
+ // UPDATING
+
+ // Allow "beforeChange" event handlers to influence a change
+ function filterChange(doc, change, update) {
+ var obj = {
+ canceled: false,
+ from: change.from,
+ to: change.to,
+ text: change.text,
+ origin: change.origin,
+ cancel: function () { return obj.canceled = true; }
+ };
+ if (update) { obj.update = function (from, to, text, origin) {
+ if (from) { obj.from = clipPos(doc, from); }
+ if (to) { obj.to = clipPos(doc, to); }
+ if (text) { obj.text = text; }
+ if (origin !== undefined) { obj.origin = origin; }
+ }; }
+ signal(doc, "beforeChange", doc, obj);
+ if (doc.cm) { signal(doc.cm, "beforeChange", doc.cm, obj); }
+
+ if (obj.canceled) {
+ if (doc.cm) { doc.cm.curOp.updateInput = 2; }
+ return null
+ }
+ return {from: obj.from, to: obj.to, text: obj.text, origin: obj.origin}
+ }
+
+ // Apply a change to a document, and add it to the document's
+ // history, and propagating it to all linked documents.
+ function makeChange(doc, change, ignoreReadOnly) {
+ if (doc.cm) {
+ if (!doc.cm.curOp) { return operation(doc.cm, makeChange)(doc, change, ignoreReadOnly) }
+ if (doc.cm.state.suppressEdits) { return }
+ }
+
+ if (hasHandler(doc, "beforeChange") || doc.cm && hasHandler(doc.cm, "beforeChange")) {
+ change = filterChange(doc, change, true);
+ if (!change) { return }
+ }
+
+ // Possibly split or suppress the update based on the presence
+ // of read-only spans in its range.
+ var split = sawReadOnlySpans && !ignoreReadOnly && removeReadOnlyRanges(doc, change.from, change.to);
+ if (split) {
+ for (var i = split.length - 1; i >= 0; --i)
+ { makeChangeInner(doc, {from: split[i].from, to: split[i].to, text: i ? [""] : change.text, origin: change.origin}); }
+ } else {
+ makeChangeInner(doc, change);
+ }
+ }
+
+ function makeChangeInner(doc, change) {
+ if (change.text.length == 1 && change.text[0] == "" && cmp(change.from, change.to) == 0) { return }
+ var selAfter = computeSelAfterChange(doc, change);
+ addChangeToHistory(doc, change, selAfter, doc.cm ? doc.cm.curOp.id : NaN);
+
+ makeChangeSingleDoc(doc, change, selAfter, stretchSpansOverChange(doc, change));
+ var rebased = [];
+
+ linkedDocs(doc, function (doc, sharedHist) {
+ if (!sharedHist && indexOf(rebased, doc.history) == -1) {
+ rebaseHist(doc.history, change);
+ rebased.push(doc.history);
+ }
+ makeChangeSingleDoc(doc, change, null, stretchSpansOverChange(doc, change));
+ });
+ }
+
+ // Revert a change stored in a document's history.
+ function makeChangeFromHistory(doc, type, allowSelectionOnly) {
+ var suppress = doc.cm && doc.cm.state.suppressEdits;
+ if (suppress && !allowSelectionOnly) { return }
+
+ var hist = doc.history, event, selAfter = doc.sel;
+ var source = type == "undo" ? hist.done : hist.undone, dest = type == "undo" ? hist.undone : hist.done;
+
+ // Verify that there is a useable event (so that ctrl-z won't
+ // needlessly clear selection events)
+ var i = 0;
+ for (; i < source.length; i++) {
+ event = source[i];
+ if (allowSelectionOnly ? event.ranges && !event.equals(doc.sel) : !event.ranges)
+ { break }
+ }
+ if (i == source.length) { return }
+ hist.lastOrigin = hist.lastSelOrigin = null;
+
+ for (;;) {
+ event = source.pop();
+ if (event.ranges) {
+ pushSelectionToHistory(event, dest);
+ if (allowSelectionOnly && !event.equals(doc.sel)) {
+ setSelection(doc, event, {clearRedo: false});
+ return
+ }
+ selAfter = event;
+ } else if (suppress) {
+ source.push(event);
+ return
+ } else { break }
+ }
+
+ // Build up a reverse change object to add to the opposite history
+ // stack (redo when undoing, and vice versa).
+ var antiChanges = [];
+ pushSelectionToHistory(selAfter, dest);
+ dest.push({changes: antiChanges, generation: hist.generation});
+ hist.generation = event.generation || ++hist.maxGeneration;
+
+ var filter = hasHandler(doc, "beforeChange") || doc.cm && hasHandler(doc.cm, "beforeChange");
+
+ var loop = function ( i ) {
+ var change = event.changes[i];
+ change.origin = type;
+ if (filter && !filterChange(doc, change, false)) {
+ source.length = 0;
+ return {}
+ }
+
+ antiChanges.push(historyChangeFromChange(doc, change));
+
+ var after = i ? computeSelAfterChange(doc, change) : lst(source);
+ makeChangeSingleDoc(doc, change, after, mergeOldSpans(doc, change));
+ if (!i && doc.cm) { doc.cm.scrollIntoView({from: change.from, to: changeEnd(change)}); }
+ var rebased = [];
+
+ // Propagate to the linked documents
+ linkedDocs(doc, function (doc, sharedHist) {
+ if (!sharedHist && indexOf(rebased, doc.history) == -1) {
+ rebaseHist(doc.history, change);
+ rebased.push(doc.history);
+ }
+ makeChangeSingleDoc(doc, change, null, mergeOldSpans(doc, change));
+ });
+ };
+
+ for (var i$1 = event.changes.length - 1; i$1 >= 0; --i$1) {
+ var returned = loop( i$1 );
+
+ if ( returned ) return returned.v;
+ }
+ }
+
+ // Sub-views need their line numbers shifted when text is added
+ // above or below them in the parent document.
+ function shiftDoc(doc, distance) {
+ if (distance == 0) { return }
+ doc.first += distance;
+ doc.sel = new Selection(map(doc.sel.ranges, function (range) { return new Range(
+ Pos(range.anchor.line + distance, range.anchor.ch),
+ Pos(range.head.line + distance, range.head.ch)
+ ); }), doc.sel.primIndex);
+ if (doc.cm) {
+ regChange(doc.cm, doc.first, doc.first - distance, distance);
+ for (var d = doc.cm.display, l = d.viewFrom; l < d.viewTo; l++)
+ { regLineChange(doc.cm, l, "gutter"); }
+ }
+ }
+
+ // More lower-level change function, handling only a single document
+ // (not linked ones).
+ function makeChangeSingleDoc(doc, change, selAfter, spans) {
+ if (doc.cm && !doc.cm.curOp)
+ { return operation(doc.cm, makeChangeSingleDoc)(doc, change, selAfter, spans) }
+
+ if (change.to.line < doc.first) {
+ shiftDoc(doc, change.text.length - 1 - (change.to.line - change.from.line));
+ return
+ }
+ if (change.from.line > doc.lastLine()) { return }
+
+ // Clip the change to the size of this doc
+ if (change.from.line < doc.first) {
+ var shift = change.text.length - 1 - (doc.first - change.from.line);
+ shiftDoc(doc, shift);
+ change = {from: Pos(doc.first, 0), to: Pos(change.to.line + shift, change.to.ch),
+ text: [lst(change.text)], origin: change.origin};
+ }
+ var last = doc.lastLine();
+ if (change.to.line > last) {
+ change = {from: change.from, to: Pos(last, getLine(doc, last).text.length),
+ text: [change.text[0]], origin: change.origin};
+ }
+
+ change.removed = getBetween(doc, change.from, change.to);
+
+ if (!selAfter) { selAfter = computeSelAfterChange(doc, change); }
+ if (doc.cm) { makeChangeSingleDocInEditor(doc.cm, change, spans); }
+ else { updateDoc(doc, change, spans); }
+ setSelectionNoUndo(doc, selAfter, sel_dontScroll);
+
+ if (doc.cantEdit && skipAtomic(doc, Pos(doc.firstLine(), 0)))
+ { doc.cantEdit = false; }
+ }
+
+ // Handle the interaction of a change to a document with the editor
+ // that this document is part of.
+ function makeChangeSingleDocInEditor(cm, change, spans) {
+ var doc = cm.doc, display = cm.display, from = change.from, to = change.to;
+
+ var recomputeMaxLength = false, checkWidthStart = from.line;
+ if (!cm.options.lineWrapping) {
+ checkWidthStart = lineNo(visualLine(getLine(doc, from.line)));
+ doc.iter(checkWidthStart, to.line + 1, function (line) {
+ if (line == display.maxLine) {
+ recomputeMaxLength = true;
+ return true
+ }
+ });
+ }
+
+ if (doc.sel.contains(change.from, change.to) > -1)
+ { signalCursorActivity(cm); }
+
+ updateDoc(doc, change, spans, estimateHeight(cm));
+
+ if (!cm.options.lineWrapping) {
+ doc.iter(checkWidthStart, from.line + change.text.length, function (line) {
+ var len = lineLength(line);
+ if (len > display.maxLineLength) {
+ display.maxLine = line;
+ display.maxLineLength = len;
+ display.maxLineChanged = true;
+ recomputeMaxLength = false;
+ }
+ });
+ if (recomputeMaxLength) { cm.curOp.updateMaxLine = true; }
+ }
+
+ retreatFrontier(doc, from.line);
+ startWorker(cm, 400);
+
+ var lendiff = change.text.length - (to.line - from.line) - 1;
+ // Remember that these lines changed, for updating the display
+ if (change.full)
+ { regChange(cm); }
+ else if (from.line == to.line && change.text.length == 1 && !isWholeLineUpdate(cm.doc, change))
+ { regLineChange(cm, from.line, "text"); }
+ else
+ { regChange(cm, from.line, to.line + 1, lendiff); }
+
+ var changesHandler = hasHandler(cm, "changes"), changeHandler = hasHandler(cm, "change");
+ if (changeHandler || changesHandler) {
+ var obj = {
+ from: from, to: to,
+ text: change.text,
+ removed: change.removed,
+ origin: change.origin
+ };
+ if (changeHandler) { signalLater(cm, "change", cm, obj); }
+ if (changesHandler) { (cm.curOp.changeObjs || (cm.curOp.changeObjs = [])).push(obj); }
+ }
+ cm.display.selForContextMenu = null;
+ }
+
+ function replaceRange(doc, code, from, to, origin) {
+ var assign;
+
+ if (!to) { to = from; }
+ if (cmp(to, from) < 0) { (assign = [to, from], from = assign[0], to = assign[1]); }
+ if (typeof code == "string") { code = doc.splitLines(code); }
+ makeChange(doc, {from: from, to: to, text: code, origin: origin});
+ }
+
+ // Rebasing/resetting history to deal with externally-sourced changes
+
+ function rebaseHistSelSingle(pos, from, to, diff) {
+ if (to < pos.line) {
+ pos.line += diff;
+ } else if (from < pos.line) {
+ pos.line = from;
+ pos.ch = 0;
+ }
+ }
+
+ // Tries to rebase an array of history events given a change in the
+ // document. If the change touches the same lines as the event, the
+ // event, and everything 'behind' it, is discarded. If the change is
+ // before the event, the event's positions are updated. Uses a
+ // copy-on-write scheme for the positions, to avoid having to
+ // reallocate them all on every rebase, but also avoid problems with
+ // shared position objects being unsafely updated.
+ function rebaseHistArray(array, from, to, diff) {
+ for (var i = 0; i < array.length; ++i) {
+ var sub = array[i], ok = true;
+ if (sub.ranges) {
+ if (!sub.copied) { sub = array[i] = sub.deepCopy(); sub.copied = true; }
+ for (var j = 0; j < sub.ranges.length; j++) {
+ rebaseHistSelSingle(sub.ranges[j].anchor, from, to, diff);
+ rebaseHistSelSingle(sub.ranges[j].head, from, to, diff);
+ }
+ continue
+ }
+ for (var j$1 = 0; j$1 < sub.changes.length; ++j$1) {
+ var cur = sub.changes[j$1];
+ if (to < cur.from.line) {
+ cur.from = Pos(cur.from.line + diff, cur.from.ch);
+ cur.to = Pos(cur.to.line + diff, cur.to.ch);
+ } else if (from <= cur.to.line) {
+ ok = false;
+ break
+ }
+ }
+ if (!ok) {
+ array.splice(0, i + 1);
+ i = 0;
+ }
+ }
+ }
+
+ function rebaseHist(hist, change) {
+ var from = change.from.line, to = change.to.line, diff = change.text.length - (to - from) - 1;
+ rebaseHistArray(hist.done, from, to, diff);
+ rebaseHistArray(hist.undone, from, to, diff);
+ }
+
+ // Utility for applying a change to a line by handle or number,
+ // returning the number and optionally registering the line as
+ // changed.
+ function changeLine(doc, handle, changeType, op) {
+ var no = handle, line = handle;
+ if (typeof handle == "number") { line = getLine(doc, clipLine(doc, handle)); }
+ else { no = lineNo(handle); }
+ if (no == null) { return null }
+ if (op(line, no) && doc.cm) { regLineChange(doc.cm, no, changeType); }
+ return line
+ }
+
+ // The document is represented as a BTree consisting of leaves, with
+ // chunk of lines in them, and branches, with up to ten leaves or
+ // other branch nodes below them. The top node is always a branch
+ // node, and is the document object itself (meaning it has
+ // additional methods and properties).
+ //
+ // All nodes have parent links. The tree is used both to go from
+ // line numbers to line objects, and to go from objects to numbers.
+ // It also indexes by height, and is used to convert between height
+ // and line object, and to find the total height of the document.
+ //
+ // See also http://marijnhaverbeke.nl/blog/codemirror-line-tree.html
+
+ function LeafChunk(lines) {
+ this.lines = lines;
+ this.parent = null;
+ var height = 0;
+ for (var i = 0; i < lines.length; ++i) {
+ lines[i].parent = this;
+ height += lines[i].height;
+ }
+ this.height = height;
+ }
+
+ LeafChunk.prototype = {
+ chunkSize: function() { return this.lines.length },
+
+ // Remove the n lines at offset 'at'.
+ removeInner: function(at, n) {
+ for (var i = at, e = at + n; i < e; ++i) {
+ var line = this.lines[i];
+ this.height -= line.height;
+ cleanUpLine(line);
+ signalLater(line, "delete");
+ }
+ this.lines.splice(at, n);
+ },
+
+ // Helper used to collapse a small branch into a single leaf.
+ collapse: function(lines) {
+ lines.push.apply(lines, this.lines);
+ },
+
+ // Insert the given array of lines at offset 'at', count them as
+ // having the given height.
+ insertInner: function(at, lines, height) {
+ this.height += height;
+ this.lines = this.lines.slice(0, at).concat(lines).concat(this.lines.slice(at));
+ for (var i = 0; i < lines.length; ++i) { lines[i].parent = this; }
+ },
+
+ // Used to iterate over a part of the tree.
+ iterN: function(at, n, op) {
+ for (var e = at + n; at < e; ++at)
+ { if (op(this.lines[at])) { return true } }
+ }
+ };
+
+ function BranchChunk(children) {
+ this.children = children;
+ var size = 0, height = 0;
+ for (var i = 0; i < children.length; ++i) {
+ var ch = children[i];
+ size += ch.chunkSize(); height += ch.height;
+ ch.parent = this;
+ }
+ this.size = size;
+ this.height = height;
+ this.parent = null;
+ }
+
+ BranchChunk.prototype = {
+ chunkSize: function() { return this.size },
+
+ removeInner: function(at, n) {
+ this.size -= n;
+ for (var i = 0; i < this.children.length; ++i) {
+ var child = this.children[i], sz = child.chunkSize();
+ if (at < sz) {
+ var rm = Math.min(n, sz - at), oldHeight = child.height;
+ child.removeInner(at, rm);
+ this.height -= oldHeight - child.height;
+ if (sz == rm) { this.children.splice(i--, 1); child.parent = null; }
+ if ((n -= rm) == 0) { break }
+ at = 0;
+ } else { at -= sz; }
+ }
+ // If the result is smaller than 25 lines, ensure that it is a
+ // single leaf node.
+ if (this.size - n < 25 &&
+ (this.children.length > 1 || !(this.children[0] instanceof LeafChunk))) {
+ var lines = [];
+ this.collapse(lines);
+ this.children = [new LeafChunk(lines)];
+ this.children[0].parent = this;
+ }
+ },
+
+ collapse: function(lines) {
+ for (var i = 0; i < this.children.length; ++i) { this.children[i].collapse(lines); }
+ },
+
+ insertInner: function(at, lines, height) {
+ this.size += lines.length;
+ this.height += height;
+ for (var i = 0; i < this.children.length; ++i) {
+ var child = this.children[i], sz = child.chunkSize();
+ if (at <= sz) {
+ child.insertInner(at, lines, height);
+ if (child.lines && child.lines.length > 50) {
+ // To avoid memory thrashing when child.lines is huge (e.g. first view of a large file), it's never spliced.
+ // Instead, small slices are taken. They're taken in order because sequential memory accesses are fastest.
+ var remaining = child.lines.length % 25 + 25;
+ for (var pos = remaining; pos < child.lines.length;) {
+ var leaf = new LeafChunk(child.lines.slice(pos, pos += 25));
+ child.height -= leaf.height;
+ this.children.splice(++i, 0, leaf);
+ leaf.parent = this;
+ }
+ child.lines = child.lines.slice(0, remaining);
+ this.maybeSpill();
+ }
+ break
+ }
+ at -= sz;
+ }
+ },
+
+ // When a node has grown, check whether it should be split.
+ maybeSpill: function() {
+ if (this.children.length <= 10) { return }
+ var me = this;
+ do {
+ var spilled = me.children.splice(me.children.length - 5, 5);
+ var sibling = new BranchChunk(spilled);
+ if (!me.parent) { // Become the parent node
+ var copy = new BranchChunk(me.children);
+ copy.parent = me;
+ me.children = [copy, sibling];
+ me = copy;
+ } else {
+ me.size -= sibling.size;
+ me.height -= sibling.height;
+ var myIndex = indexOf(me.parent.children, me);
+ me.parent.children.splice(myIndex + 1, 0, sibling);
+ }
+ sibling.parent = me.parent;
+ } while (me.children.length > 10)
+ me.parent.maybeSpill();
+ },
+
+ iterN: function(at, n, op) {
+ for (var i = 0; i < this.children.length; ++i) {
+ var child = this.children[i], sz = child.chunkSize();
+ if (at < sz) {
+ var used = Math.min(n, sz - at);
+ if (child.iterN(at, used, op)) { return true }
+ if ((n -= used) == 0) { break }
+ at = 0;
+ } else { at -= sz; }
+ }
+ }
+ };
+
+ // Line widgets are block elements displayed above or below a line.
+
+ var LineWidget = function(doc, node, options) {
+ if (options) { for (var opt in options) { if (options.hasOwnProperty(opt))
+ { this[opt] = options[opt]; } } }
+ this.doc = doc;
+ this.node = node;
+ };
+
+ LineWidget.prototype.clear = function () {
+ var cm = this.doc.cm, ws = this.line.widgets, line = this.line, no = lineNo(line);
+ if (no == null || !ws) { return }
+ for (var i = 0; i < ws.length; ++i) { if (ws[i] == this) { ws.splice(i--, 1); } }
+ if (!ws.length) { line.widgets = null; }
+ var height = widgetHeight(this);
+ updateLineHeight(line, Math.max(0, line.height - height));
+ if (cm) {
+ runInOp(cm, function () {
+ adjustScrollWhenAboveVisible(cm, line, -height);
+ regLineChange(cm, no, "widget");
+ });
+ signalLater(cm, "lineWidgetCleared", cm, this, no);
+ }
+ };
+
+ LineWidget.prototype.changed = function () {
+ var this$1 = this;
+
+ var oldH = this.height, cm = this.doc.cm, line = this.line;
+ this.height = null;
+ var diff = widgetHeight(this) - oldH;
+ if (!diff) { return }
+ if (!lineIsHidden(this.doc, line)) { updateLineHeight(line, line.height + diff); }
+ if (cm) {
+ runInOp(cm, function () {
+ cm.curOp.forceUpdate = true;
+ adjustScrollWhenAboveVisible(cm, line, diff);
+ signalLater(cm, "lineWidgetChanged", cm, this$1, lineNo(line));
+ });
+ }
+ };
+ eventMixin(LineWidget);
+
+ function adjustScrollWhenAboveVisible(cm, line, diff) {
+ if (heightAtLine(line) < ((cm.curOp && cm.curOp.scrollTop) || cm.doc.scrollTop))
+ { addToScrollTop(cm, diff); }
+ }
+
+ function addLineWidget(doc, handle, node, options) {
+ var widget = new LineWidget(doc, node, options);
+ var cm = doc.cm;
+ if (cm && widget.noHScroll) { cm.display.alignWidgets = true; }
+ changeLine(doc, handle, "widget", function (line) {
+ var widgets = line.widgets || (line.widgets = []);
+ if (widget.insertAt == null) { widgets.push(widget); }
+ else { widgets.splice(Math.min(widgets.length - 1, Math.max(0, widget.insertAt)), 0, widget); }
+ widget.line = line;
+ if (cm && !lineIsHidden(doc, line)) {
+ var aboveVisible = heightAtLine(line) < doc.scrollTop;
+ updateLineHeight(line, line.height + widgetHeight(widget));
+ if (aboveVisible) { addToScrollTop(cm, widget.height); }
+ cm.curOp.forceUpdate = true;
+ }
+ return true
+ });
+ if (cm) { signalLater(cm, "lineWidgetAdded", cm, widget, typeof handle == "number" ? handle : lineNo(handle)); }
+ return widget
+ }
+
+ // TEXTMARKERS
+
+ // Created with markText and setBookmark methods. A TextMarker is a
+ // handle that can be used to clear or find a marked position in the
+ // document. Line objects hold arrays (markedSpans) containing
+ // {from, to, marker} object pointing to such marker objects, and
+ // indicating that such a marker is present on that line. Multiple
+ // lines may point to the same marker when it spans across lines.
+ // The spans will have null for their from/to properties when the
+ // marker continues beyond the start/end of the line. Markers have
+ // links back to the lines they currently touch.
+
+ // Collapsed markers have unique ids, in order to be able to order
+ // them, which is needed for uniquely determining an outer marker
+ // when they overlap (they may nest, but not partially overlap).
+ var nextMarkerId = 0;
+
+ var TextMarker = function(doc, type) {
+ this.lines = [];
+ this.type = type;
+ this.doc = doc;
+ this.id = ++nextMarkerId;
+ };
+
+ // Clear the marker.
+ TextMarker.prototype.clear = function () {
+ if (this.explicitlyCleared) { return }
+ var cm = this.doc.cm, withOp = cm && !cm.curOp;
+ if (withOp) { startOperation(cm); }
+ if (hasHandler(this, "clear")) {
+ var found = this.find();
+ if (found) { signalLater(this, "clear", found.from, found.to); }
+ }
+ var min = null, max = null;
+ for (var i = 0; i < this.lines.length; ++i) {
+ var line = this.lines[i];
+ var span = getMarkedSpanFor(line.markedSpans, this);
+ if (cm && !this.collapsed) { regLineChange(cm, lineNo(line), "text"); }
+ else if (cm) {
+ if (span.to != null) { max = lineNo(line); }
+ if (span.from != null) { min = lineNo(line); }
+ }
+ line.markedSpans = removeMarkedSpan(line.markedSpans, span);
+ if (span.from == null && this.collapsed && !lineIsHidden(this.doc, line) && cm)
+ { updateLineHeight(line, textHeight(cm.display)); }
+ }
+ if (cm && this.collapsed && !cm.options.lineWrapping) { for (var i$1 = 0; i$1 < this.lines.length; ++i$1) {
+ var visual = visualLine(this.lines[i$1]), len = lineLength(visual);
+ if (len > cm.display.maxLineLength) {
+ cm.display.maxLine = visual;
+ cm.display.maxLineLength = len;
+ cm.display.maxLineChanged = true;
+ }
+ } }
+
+ if (min != null && cm && this.collapsed) { regChange(cm, min, max + 1); }
+ this.lines.length = 0;
+ this.explicitlyCleared = true;
+ if (this.atomic && this.doc.cantEdit) {
+ this.doc.cantEdit = false;
+ if (cm) { reCheckSelection(cm.doc); }
+ }
+ if (cm) { signalLater(cm, "markerCleared", cm, this, min, max); }
+ if (withOp) { endOperation(cm); }
+ if (this.parent) { this.parent.clear(); }
+ };
+
+ // Find the position of the marker in the document. Returns a {from,
+ // to} object by default. Side can be passed to get a specific side
+ // -- 0 (both), -1 (left), or 1 (right). When lineObj is true, the
+ // Pos objects returned contain a line object, rather than a line
+ // number (used to prevent looking up the same line twice).
+ TextMarker.prototype.find = function (side, lineObj) {
+ if (side == null && this.type == "bookmark") { side = 1; }
+ var from, to;
+ for (var i = 0; i < this.lines.length; ++i) {
+ var line = this.lines[i];
+ var span = getMarkedSpanFor(line.markedSpans, this);
+ if (span.from != null) {
+ from = Pos(lineObj ? line : lineNo(line), span.from);
+ if (side == -1) { return from }
+ }
+ if (span.to != null) {
+ to = Pos(lineObj ? line : lineNo(line), span.to);
+ if (side == 1) { return to }
+ }
+ }
+ return from && {from: from, to: to}
+ };
+
+ // Signals that the marker's widget changed, and surrounding layout
+ // should be recomputed.
+ TextMarker.prototype.changed = function () {
+ var this$1 = this;
+
+ var pos = this.find(-1, true), widget = this, cm = this.doc.cm;
+ if (!pos || !cm) { return }
+ runInOp(cm, function () {
+ var line = pos.line, lineN = lineNo(pos.line);
+ var view = findViewForLine(cm, lineN);
+ if (view) {
+ clearLineMeasurementCacheFor(view);
+ cm.curOp.selectionChanged = cm.curOp.forceUpdate = true;
+ }
+ cm.curOp.updateMaxLine = true;
+ if (!lineIsHidden(widget.doc, line) && widget.height != null) {
+ var oldHeight = widget.height;
+ widget.height = null;
+ var dHeight = widgetHeight(widget) - oldHeight;
+ if (dHeight)
+ { updateLineHeight(line, line.height + dHeight); }
+ }
+ signalLater(cm, "markerChanged", cm, this$1);
+ });
+ };
+
+ TextMarker.prototype.attachLine = function (line) {
+ if (!this.lines.length && this.doc.cm) {
+ var op = this.doc.cm.curOp;
+ if (!op.maybeHiddenMarkers || indexOf(op.maybeHiddenMarkers, this) == -1)
+ { (op.maybeUnhiddenMarkers || (op.maybeUnhiddenMarkers = [])).push(this); }
+ }
+ this.lines.push(line);
+ };
+
+ TextMarker.prototype.detachLine = function (line) {
+ this.lines.splice(indexOf(this.lines, line), 1);
+ if (!this.lines.length && this.doc.cm) {
+ var op = this.doc.cm.curOp
+ ;(op.maybeHiddenMarkers || (op.maybeHiddenMarkers = [])).push(this);
+ }
+ };
+ eventMixin(TextMarker);
+
+ // Create a marker, wire it up to the right lines, and
+ function markText(doc, from, to, options, type) {
+ // Shared markers (across linked documents) are handled separately
+ // (markTextShared will call out to this again, once per
+ // document).
+ if (options && options.shared) { return markTextShared(doc, from, to, options, type) }
+ // Ensure we are in an operation.
+ if (doc.cm && !doc.cm.curOp) { return operation(doc.cm, markText)(doc, from, to, options, type) }
+
+ var marker = new TextMarker(doc, type), diff = cmp(from, to);
+ if (options) { copyObj(options, marker, false); }
+ // Don't connect empty markers unless clearWhenEmpty is false
+ if (diff > 0 || diff == 0 && marker.clearWhenEmpty !== false)
+ { return marker }
+ if (marker.replacedWith) {
+ // Showing up as a widget implies collapsed (widget replaces text)
+ marker.collapsed = true;
+ marker.widgetNode = eltP("span", [marker.replacedWith], "CodeMirror-widget");
+ if (!options.handleMouseEvents) { marker.widgetNode.setAttribute("cm-ignore-events", "true"); }
+ if (options.insertLeft) { marker.widgetNode.insertLeft = true; }
+ }
+ if (marker.collapsed) {
+ if (conflictingCollapsedRange(doc, from.line, from, to, marker) ||
+ from.line != to.line && conflictingCollapsedRange(doc, to.line, from, to, marker))
+ { throw new Error("Inserting collapsed marker partially overlapping an existing one") }
+ seeCollapsedSpans();
+ }
+
+ if (marker.addToHistory)
+ { addChangeToHistory(doc, {from: from, to: to, origin: "markText"}, doc.sel, NaN); }
+
+ var curLine = from.line, cm = doc.cm, updateMaxLine;
+ doc.iter(curLine, to.line + 1, function (line) {
+ if (cm && marker.collapsed && !cm.options.lineWrapping && visualLine(line) == cm.display.maxLine)
+ { updateMaxLine = true; }
+ if (marker.collapsed && curLine != from.line) { updateLineHeight(line, 0); }
+ addMarkedSpan(line, new MarkedSpan(marker,
+ curLine == from.line ? from.ch : null,
+ curLine == to.line ? to.ch : null));
+ ++curLine;
+ });
+ // lineIsHidden depends on the presence of the spans, so needs a second pass
+ if (marker.collapsed) { doc.iter(from.line, to.line + 1, function (line) {
+ if (lineIsHidden(doc, line)) { updateLineHeight(line, 0); }
+ }); }
+
+ if (marker.clearOnEnter) { on(marker, "beforeCursorEnter", function () { return marker.clear(); }); }
+
+ if (marker.readOnly) {
+ seeReadOnlySpans();
+ if (doc.history.done.length || doc.history.undone.length)
+ { doc.clearHistory(); }
+ }
+ if (marker.collapsed) {
+ marker.id = ++nextMarkerId;
+ marker.atomic = true;
+ }
+ if (cm) {
+ // Sync editor state
+ if (updateMaxLine) { cm.curOp.updateMaxLine = true; }
+ if (marker.collapsed)
+ { regChange(cm, from.line, to.line + 1); }
+ else if (marker.className || marker.startStyle || marker.endStyle || marker.css ||
+ marker.attributes || marker.title)
+ { for (var i = from.line; i <= to.line; i++) { regLineChange(cm, i, "text"); } }
+ if (marker.atomic) { reCheckSelection(cm.doc); }
+ signalLater(cm, "markerAdded", cm, marker);
+ }
+ return marker
+ }
+
+ // SHARED TEXTMARKERS
+
+ // A shared marker spans multiple linked documents. It is
+ // implemented as a meta-marker-object controlling multiple normal
+ // markers.
+ var SharedTextMarker = function(markers, primary) {
+ this.markers = markers;
+ this.primary = primary;
+ for (var i = 0; i < markers.length; ++i)
+ { markers[i].parent = this; }
+ };
+
+ SharedTextMarker.prototype.clear = function () {
+ if (this.explicitlyCleared) { return }
+ this.explicitlyCleared = true;
+ for (var i = 0; i < this.markers.length; ++i)
+ { this.markers[i].clear(); }
+ signalLater(this, "clear");
+ };
+
+ SharedTextMarker.prototype.find = function (side, lineObj) {
+ return this.primary.find(side, lineObj)
+ };
+ eventMixin(SharedTextMarker);
+
+ function markTextShared(doc, from, to, options, type) {
+ options = copyObj(options);
+ options.shared = false;
+ var markers = [markText(doc, from, to, options, type)], primary = markers[0];
+ var widget = options.widgetNode;
+ linkedDocs(doc, function (doc) {
+ if (widget) { options.widgetNode = widget.cloneNode(true); }
+ markers.push(markText(doc, clipPos(doc, from), clipPos(doc, to), options, type));
+ for (var i = 0; i < doc.linked.length; ++i)
+ { if (doc.linked[i].isParent) { return } }
+ primary = lst(markers);
+ });
+ return new SharedTextMarker(markers, primary)
+ }
+
+ function findSharedMarkers(doc) {
+ return doc.findMarks(Pos(doc.first, 0), doc.clipPos(Pos(doc.lastLine())), function (m) { return m.parent; })
+ }
+
+ function copySharedMarkers(doc, markers) {
+ for (var i = 0; i < markers.length; i++) {
+ var marker = markers[i], pos = marker.find();
+ var mFrom = doc.clipPos(pos.from), mTo = doc.clipPos(pos.to);
+ if (cmp(mFrom, mTo)) {
+ var subMark = markText(doc, mFrom, mTo, marker.primary, marker.primary.type);
+ marker.markers.push(subMark);
+ subMark.parent = marker;
+ }
+ }
+ }
+
+ function detachSharedMarkers(markers) {
+ var loop = function ( i ) {
+ var marker = markers[i], linked = [marker.primary.doc];
+ linkedDocs(marker.primary.doc, function (d) { return linked.push(d); });
+ for (var j = 0; j < marker.markers.length; j++) {
+ var subMarker = marker.markers[j];
+ if (indexOf(linked, subMarker.doc) == -1) {
+ subMarker.parent = null;
+ marker.markers.splice(j--, 1);
+ }
+ }
+ };
+
+ for (var i = 0; i < markers.length; i++) loop( i );
+ }
+
+ var nextDocId = 0;
+ var Doc = function(text, mode, firstLine, lineSep, direction) {
+ if (!(this instanceof Doc)) { return new Doc(text, mode, firstLine, lineSep, direction) }
+ if (firstLine == null) { firstLine = 0; }
+
+ BranchChunk.call(this, [new LeafChunk([new Line("", null)])]);
+ this.first = firstLine;
+ this.scrollTop = this.scrollLeft = 0;
+ this.cantEdit = false;
+ this.cleanGeneration = 1;
+ this.modeFrontier = this.highlightFrontier = firstLine;
+ var start = Pos(firstLine, 0);
+ this.sel = simpleSelection(start);
+ this.history = new History(null);
+ this.id = ++nextDocId;
+ this.modeOption = mode;
+ this.lineSep = lineSep;
+ this.direction = (direction == "rtl") ? "rtl" : "ltr";
+ this.extend = false;
+
+ if (typeof text == "string") { text = this.splitLines(text); }
+ updateDoc(this, {from: start, to: start, text: text});
+ setSelection(this, simpleSelection(start), sel_dontScroll);
+ };
+
+ Doc.prototype = createObj(BranchChunk.prototype, {
+ constructor: Doc,
+ // Iterate over the document. Supports two forms -- with only one
+ // argument, it calls that for each line in the document. With
+ // three, it iterates over the range given by the first two (with
+ // the second being non-inclusive).
+ iter: function(from, to, op) {
+ if (op) { this.iterN(from - this.first, to - from, op); }
+ else { this.iterN(this.first, this.first + this.size, from); }
+ },
+
+ // Non-public interface for adding and removing lines.
+ insert: function(at, lines) {
+ var height = 0;
+ for (var i = 0; i < lines.length; ++i) { height += lines[i].height; }
+ this.insertInner(at - this.first, lines, height);
+ },
+ remove: function(at, n) { this.removeInner(at - this.first, n); },
+
+ // From here, the methods are part of the public interface. Most
+ // are also available from CodeMirror (editor) instances.
+
+ getValue: function(lineSep) {
+ var lines = getLines(this, this.first, this.first + this.size);
+ if (lineSep === false) { return lines }
+ return lines.join(lineSep || this.lineSeparator())
+ },
+ setValue: docMethodOp(function(code) {
+ var top = Pos(this.first, 0), last = this.first + this.size - 1;
+ makeChange(this, {from: top, to: Pos(last, getLine(this, last).text.length),
+ text: this.splitLines(code), origin: "setValue", full: true}, true);
+ if (this.cm) { scrollToCoords(this.cm, 0, 0); }
+ setSelection(this, simpleSelection(top), sel_dontScroll);
+ }),
+ replaceRange: function(code, from, to, origin) {
+ from = clipPos(this, from);
+ to = to ? clipPos(this, to) : from;
+ replaceRange(this, code, from, to, origin);
+ },
+ getRange: function(from, to, lineSep) {
+ var lines = getBetween(this, clipPos(this, from), clipPos(this, to));
+ if (lineSep === false) { return lines }
+ return lines.join(lineSep || this.lineSeparator())
+ },
+
+ getLine: function(line) {var l = this.getLineHandle(line); return l && l.text},
+
+ getLineHandle: function(line) {if (isLine(this, line)) { return getLine(this, line) }},
+ getLineNumber: function(line) {return lineNo(line)},
+
+ getLineHandleVisualStart: function(line) {
+ if (typeof line == "number") { line = getLine(this, line); }
+ return visualLine(line)
+ },
+
+ lineCount: function() {return this.size},
+ firstLine: function() {return this.first},
+ lastLine: function() {return this.first + this.size - 1},
+
+ clipPos: function(pos) {return clipPos(this, pos)},
+
+ getCursor: function(start) {
+ var range = this.sel.primary(), pos;
+ if (start == null || start == "head") { pos = range.head; }
+ else if (start == "anchor") { pos = range.anchor; }
+ else if (start == "end" || start == "to" || start === false) { pos = range.to(); }
+ else { pos = range.from(); }
+ return pos
+ },
+ listSelections: function() { return this.sel.ranges },
+ somethingSelected: function() {return this.sel.somethingSelected()},
+
+ setCursor: docMethodOp(function(line, ch, options) {
+ setSimpleSelection(this, clipPos(this, typeof line == "number" ? Pos(line, ch || 0) : line), null, options);
+ }),
+ setSelection: docMethodOp(function(anchor, head, options) {
+ setSimpleSelection(this, clipPos(this, anchor), clipPos(this, head || anchor), options);
+ }),
+ extendSelection: docMethodOp(function(head, other, options) {
+ extendSelection(this, clipPos(this, head), other && clipPos(this, other), options);
+ }),
+ extendSelections: docMethodOp(function(heads, options) {
+ extendSelections(this, clipPosArray(this, heads), options);
+ }),
+ extendSelectionsBy: docMethodOp(function(f, options) {
+ var heads = map(this.sel.ranges, f);
+ extendSelections(this, clipPosArray(this, heads), options);
+ }),
+ setSelections: docMethodOp(function(ranges, primary, options) {
+ if (!ranges.length) { return }
+ var out = [];
+ for (var i = 0; i < ranges.length; i++)
+ { out[i] = new Range(clipPos(this, ranges[i].anchor),
+ clipPos(this, ranges[i].head)); }
+ if (primary == null) { primary = Math.min(ranges.length - 1, this.sel.primIndex); }
+ setSelection(this, normalizeSelection(this.cm, out, primary), options);
+ }),
+ addSelection: docMethodOp(function(anchor, head, options) {
+ var ranges = this.sel.ranges.slice(0);
+ ranges.push(new Range(clipPos(this, anchor), clipPos(this, head || anchor)));
+ setSelection(this, normalizeSelection(this.cm, ranges, ranges.length - 1), options);
+ }),
+
+ getSelection: function(lineSep) {
+ var ranges = this.sel.ranges, lines;
+ for (var i = 0; i < ranges.length; i++) {
+ var sel = getBetween(this, ranges[i].from(), ranges[i].to());
+ lines = lines ? lines.concat(sel) : sel;
+ }
+ if (lineSep === false) { return lines }
+ else { return lines.join(lineSep || this.lineSeparator()) }
+ },
+ getSelections: function(lineSep) {
+ var parts = [], ranges = this.sel.ranges;
+ for (var i = 0; i < ranges.length; i++) {
+ var sel = getBetween(this, ranges[i].from(), ranges[i].to());
+ if (lineSep !== false) { sel = sel.join(lineSep || this.lineSeparator()); }
+ parts[i] = sel;
+ }
+ return parts
+ },
+ replaceSelection: function(code, collapse, origin) {
+ var dup = [];
+ for (var i = 0; i < this.sel.ranges.length; i++)
+ { dup[i] = code; }
+ this.replaceSelections(dup, collapse, origin || "+input");
+ },
+ replaceSelections: docMethodOp(function(code, collapse, origin) {
+ var changes = [], sel = this.sel;
+ for (var i = 0; i < sel.ranges.length; i++) {
+ var range = sel.ranges[i];
+ changes[i] = {from: range.from(), to: range.to(), text: this.splitLines(code[i]), origin: origin};
+ }
+ var newSel = collapse && collapse != "end" && computeReplacedSel(this, changes, collapse);
+ for (var i$1 = changes.length - 1; i$1 >= 0; i$1--)
+ { makeChange(this, changes[i$1]); }
+ if (newSel) { setSelectionReplaceHistory(this, newSel); }
+ else if (this.cm) { ensureCursorVisible(this.cm); }
+ }),
+ undo: docMethodOp(function() {makeChangeFromHistory(this, "undo");}),
+ redo: docMethodOp(function() {makeChangeFromHistory(this, "redo");}),
+ undoSelection: docMethodOp(function() {makeChangeFromHistory(this, "undo", true);}),
+ redoSelection: docMethodOp(function() {makeChangeFromHistory(this, "redo", true);}),
+
+ setExtending: function(val) {this.extend = val;},
+ getExtending: function() {return this.extend},
+
+ historySize: function() {
+ var hist = this.history, done = 0, undone = 0;
+ for (var i = 0; i < hist.done.length; i++) { if (!hist.done[i].ranges) { ++done; } }
+ for (var i$1 = 0; i$1 < hist.undone.length; i$1++) { if (!hist.undone[i$1].ranges) { ++undone; } }
+ return {undo: done, redo: undone}
+ },
+ clearHistory: function() {
+ var this$1 = this;
+
+ this.history = new History(this.history.maxGeneration);
+ linkedDocs(this, function (doc) { return doc.history = this$1.history; }, true);
+ },
+
+ markClean: function() {
+ this.cleanGeneration = this.changeGeneration(true);
+ },
+ changeGeneration: function(forceSplit) {
+ if (forceSplit)
+ { this.history.lastOp = this.history.lastSelOp = this.history.lastOrigin = null; }
+ return this.history.generation
+ },
+ isClean: function (gen) {
+ return this.history.generation == (gen || this.cleanGeneration)
+ },
+
+ getHistory: function() {
+ return {done: copyHistoryArray(this.history.done),
+ undone: copyHistoryArray(this.history.undone)}
+ },
+ setHistory: function(histData) {
+ var hist = this.history = new History(this.history.maxGeneration);
+ hist.done = copyHistoryArray(histData.done.slice(0), null, true);
+ hist.undone = copyHistoryArray(histData.undone.slice(0), null, true);
+ },
+
+ setGutterMarker: docMethodOp(function(line, gutterID, value) {
+ return changeLine(this, line, "gutter", function (line) {
+ var markers = line.gutterMarkers || (line.gutterMarkers = {});
+ markers[gutterID] = value;
+ if (!value && isEmpty(markers)) { line.gutterMarkers = null; }
+ return true
+ })
+ }),
+
+ clearGutter: docMethodOp(function(gutterID) {
+ var this$1 = this;
+
+ this.iter(function (line) {
+ if (line.gutterMarkers && line.gutterMarkers[gutterID]) {
+ changeLine(this$1, line, "gutter", function () {
+ line.gutterMarkers[gutterID] = null;
+ if (isEmpty(line.gutterMarkers)) { line.gutterMarkers = null; }
+ return true
+ });
+ }
+ });
+ }),
+
+ lineInfo: function(line) {
+ var n;
+ if (typeof line == "number") {
+ if (!isLine(this, line)) { return null }
+ n = line;
+ line = getLine(this, line);
+ if (!line) { return null }
+ } else {
+ n = lineNo(line);
+ if (n == null) { return null }
+ }
+ return {line: n, handle: line, text: line.text, gutterMarkers: line.gutterMarkers,
+ textClass: line.textClass, bgClass: line.bgClass, wrapClass: line.wrapClass,
+ widgets: line.widgets}
+ },
+
+ addLineClass: docMethodOp(function(handle, where, cls) {
+ return changeLine(this, handle, where == "gutter" ? "gutter" : "class", function (line) {
+ var prop = where == "text" ? "textClass"
+ : where == "background" ? "bgClass"
+ : where == "gutter" ? "gutterClass" : "wrapClass";
+ if (!line[prop]) { line[prop] = cls; }
+ else if (classTest(cls).test(line[prop])) { return false }
+ else { line[prop] += " " + cls; }
+ return true
+ })
+ }),
+ removeLineClass: docMethodOp(function(handle, where, cls) {
+ return changeLine(this, handle, where == "gutter" ? "gutter" : "class", function (line) {
+ var prop = where == "text" ? "textClass"
+ : where == "background" ? "bgClass"
+ : where == "gutter" ? "gutterClass" : "wrapClass";
+ var cur = line[prop];
+ if (!cur) { return false }
+ else if (cls == null) { line[prop] = null; }
+ else {
+ var found = cur.match(classTest(cls));
+ if (!found) { return false }
+ var end = found.index + found[0].length;
+ line[prop] = cur.slice(0, found.index) + (!found.index || end == cur.length ? "" : " ") + cur.slice(end) || null;
+ }
+ return true
+ })
+ }),
+
+ addLineWidget: docMethodOp(function(handle, node, options) {
+ return addLineWidget(this, handle, node, options)
+ }),
+ removeLineWidget: function(widget) { widget.clear(); },
+
+ markText: function(from, to, options) {
+ return markText(this, clipPos(this, from), clipPos(this, to), options, options && options.type || "range")
+ },
+ setBookmark: function(pos, options) {
+ var realOpts = {replacedWith: options && (options.nodeType == null ? options.widget : options),
+ insertLeft: options && options.insertLeft,
+ clearWhenEmpty: false, shared: options && options.shared,
+ handleMouseEvents: options && options.handleMouseEvents};
+ pos = clipPos(this, pos);
+ return markText(this, pos, pos, realOpts, "bookmark")
+ },
+ findMarksAt: function(pos) {
+ pos = clipPos(this, pos);
+ var markers = [], spans = getLine(this, pos.line).markedSpans;
+ if (spans) { for (var i = 0; i < spans.length; ++i) {
+ var span = spans[i];
+ if ((span.from == null || span.from <= pos.ch) &&
+ (span.to == null || span.to >= pos.ch))
+ { markers.push(span.marker.parent || span.marker); }
+ } }
+ return markers
+ },
+ findMarks: function(from, to, filter) {
+ from = clipPos(this, from); to = clipPos(this, to);
+ var found = [], lineNo = from.line;
+ this.iter(from.line, to.line + 1, function (line) {
+ var spans = line.markedSpans;
+ if (spans) { for (var i = 0; i < spans.length; i++) {
+ var span = spans[i];
+ if (!(span.to != null && lineNo == from.line && from.ch >= span.to ||
+ span.from == null && lineNo != from.line ||
+ span.from != null && lineNo == to.line && span.from >= to.ch) &&
+ (!filter || filter(span.marker)))
+ { found.push(span.marker.parent || span.marker); }
+ } }
+ ++lineNo;
+ });
+ return found
+ },
+ getAllMarks: function() {
+ var markers = [];
+ this.iter(function (line) {
+ var sps = line.markedSpans;
+ if (sps) { for (var i = 0; i < sps.length; ++i)
+ { if (sps[i].from != null) { markers.push(sps[i].marker); } } }
+ });
+ return markers
+ },
+
+ posFromIndex: function(off) {
+ var ch, lineNo = this.first, sepSize = this.lineSeparator().length;
+ this.iter(function (line) {
+ var sz = line.text.length + sepSize;
+ if (sz > off) { ch = off; return true }
+ off -= sz;
+ ++lineNo;
+ });
+ return clipPos(this, Pos(lineNo, ch))
+ },
+ indexFromPos: function (coords) {
+ coords = clipPos(this, coords);
+ var index = coords.ch;
+ if (coords.line < this.first || coords.ch < 0) { return 0 }
+ var sepSize = this.lineSeparator().length;
+ this.iter(this.first, coords.line, function (line) { // iter aborts when callback returns a truthy value
+ index += line.text.length + sepSize;
+ });
+ return index
+ },
+
+ copy: function(copyHistory) {
+ var doc = new Doc(getLines(this, this.first, this.first + this.size),
+ this.modeOption, this.first, this.lineSep, this.direction);
+ doc.scrollTop = this.scrollTop; doc.scrollLeft = this.scrollLeft;
+ doc.sel = this.sel;
+ doc.extend = false;
+ if (copyHistory) {
+ doc.history.undoDepth = this.history.undoDepth;
+ doc.setHistory(this.getHistory());
+ }
+ return doc
+ },
+
+ linkedDoc: function(options) {
+ if (!options) { options = {}; }
+ var from = this.first, to = this.first + this.size;
+ if (options.from != null && options.from > from) { from = options.from; }
+ if (options.to != null && options.to < to) { to = options.to; }
+ var copy = new Doc(getLines(this, from, to), options.mode || this.modeOption, from, this.lineSep, this.direction);
+ if (options.sharedHist) { copy.history = this.history
+ ; }(this.linked || (this.linked = [])).push({doc: copy, sharedHist: options.sharedHist});
+ copy.linked = [{doc: this, isParent: true, sharedHist: options.sharedHist}];
+ copySharedMarkers(copy, findSharedMarkers(this));
+ return copy
+ },
+ unlinkDoc: function(other) {
+ if (other instanceof CodeMirror) { other = other.doc; }
+ if (this.linked) { for (var i = 0; i < this.linked.length; ++i) {
+ var link = this.linked[i];
+ if (link.doc != other) { continue }
+ this.linked.splice(i, 1);
+ other.unlinkDoc(this);
+ detachSharedMarkers(findSharedMarkers(this));
+ break
+ } }
+ // If the histories were shared, split them again
+ if (other.history == this.history) {
+ var splitIds = [other.id];
+ linkedDocs(other, function (doc) { return splitIds.push(doc.id); }, true);
+ other.history = new History(null);
+ other.history.done = copyHistoryArray(this.history.done, splitIds);
+ other.history.undone = copyHistoryArray(this.history.undone, splitIds);
+ }
+ },
+ iterLinkedDocs: function(f) {linkedDocs(this, f);},
+
+ getMode: function() {return this.mode},
+ getEditor: function() {return this.cm},
+
+ splitLines: function(str) {
+ if (this.lineSep) { return str.split(this.lineSep) }
+ return splitLinesAuto(str)
+ },
+ lineSeparator: function() { return this.lineSep || "\n" },
+
+ setDirection: docMethodOp(function (dir) {
+ if (dir != "rtl") { dir = "ltr"; }
+ if (dir == this.direction) { return }
+ this.direction = dir;
+ this.iter(function (line) { return line.order = null; });
+ if (this.cm) { directionChanged(this.cm); }
+ })
+ });
+
+ // Public alias.
+ Doc.prototype.eachLine = Doc.prototype.iter;
+
+ // Kludge to work around strange IE behavior where it'll sometimes
+ // re-fire a series of drag-related events right after the drop (#1551)
+ var lastDrop = 0;
+
+ function onDrop(e) {
+ var cm = this;
+ clearDragCursor(cm);
+ if (signalDOMEvent(cm, e) || eventInWidget(cm.display, e))
+ { return }
+ e_preventDefault(e);
+ if (ie) { lastDrop = +new Date; }
+ var pos = posFromMouse(cm, e, true), files = e.dataTransfer.files;
+ if (!pos || cm.isReadOnly()) { return }
+ // Might be a file drop, in which case we simply extract the text
+ // and insert it.
+ if (files && files.length && window.FileReader && window.File) {
+ var n = files.length, text = Array(n), read = 0;
+ var markAsReadAndPasteIfAllFilesAreRead = function () {
+ if (++read == n) {
+ operation(cm, function () {
+ pos = clipPos(cm.doc, pos);
+ var change = {from: pos, to: pos,
+ text: cm.doc.splitLines(
+ text.filter(function (t) { return t != null; }).join(cm.doc.lineSeparator())),
+ origin: "paste"};
+ makeChange(cm.doc, change);
+ setSelectionReplaceHistory(cm.doc, simpleSelection(clipPos(cm.doc, pos), clipPos(cm.doc, changeEnd(change))));
+ })();
+ }
+ };
+ var readTextFromFile = function (file, i) {
+ if (cm.options.allowDropFileTypes &&
+ indexOf(cm.options.allowDropFileTypes, file.type) == -1) {
+ markAsReadAndPasteIfAllFilesAreRead();
+ return
+ }
+ var reader = new FileReader;
+ reader.onerror = function () { return markAsReadAndPasteIfAllFilesAreRead(); };
+ reader.onload = function () {
+ var content = reader.result;
+ if (/[\x00-\x08\x0e-\x1f]{2}/.test(content)) {
+ markAsReadAndPasteIfAllFilesAreRead();
+ return
+ }
+ text[i] = content;
+ markAsReadAndPasteIfAllFilesAreRead();
+ };
+ reader.readAsText(file);
+ };
+ for (var i = 0; i < files.length; i++) { readTextFromFile(files[i], i); }
+ } else { // Normal drop
+ // Don't do a replace if the drop happened inside of the selected text.
+ if (cm.state.draggingText && cm.doc.sel.contains(pos) > -1) {
+ cm.state.draggingText(e);
+ // Ensure the editor is re-focused
+ setTimeout(function () { return cm.display.input.focus(); }, 20);
+ return
+ }
+ try {
+ var text$1 = e.dataTransfer.getData("Text");
+ if (text$1) {
+ var selected;
+ if (cm.state.draggingText && !cm.state.draggingText.copy)
+ { selected = cm.listSelections(); }
+ setSelectionNoUndo(cm.doc, simpleSelection(pos, pos));
+ if (selected) { for (var i$1 = 0; i$1 < selected.length; ++i$1)
+ { replaceRange(cm.doc, "", selected[i$1].anchor, selected[i$1].head, "drag"); } }
+ cm.replaceSelection(text$1, "around", "paste");
+ cm.display.input.focus();
+ }
+ }
+ catch(e$1){}
+ }
+ }
+
+ function onDragStart(cm, e) {
+ if (ie && (!cm.state.draggingText || +new Date - lastDrop < 100)) { e_stop(e); return }
+ if (signalDOMEvent(cm, e) || eventInWidget(cm.display, e)) { return }
+
+ e.dataTransfer.setData("Text", cm.getSelection());
+ e.dataTransfer.effectAllowed = "copyMove";
+
+ // Use dummy image instead of default browsers image.
+ // Recent Safari (~6.0.2) have a tendency to segfault when this happens, so we don't do it there.
+ if (e.dataTransfer.setDragImage && !safari) {
+ var img = elt("img", null, null, "position: fixed; left: 0; top: 0;");
+ img.src = "data:image/gif;base64,R0lGODlhAQABAAAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==";
+ if (presto) {
+ img.width = img.height = 1;
+ cm.display.wrapper.appendChild(img);
+ // Force a relayout, or Opera won't use our image for some obscure reason
+ img._top = img.offsetTop;
+ }
+ e.dataTransfer.setDragImage(img, 0, 0);
+ if (presto) { img.parentNode.removeChild(img); }
+ }
+ }
+
+ function onDragOver(cm, e) {
+ var pos = posFromMouse(cm, e);
+ if (!pos) { return }
+ var frag = document.createDocumentFragment();
+ drawSelectionCursor(cm, pos, frag);
+ if (!cm.display.dragCursor) {
+ cm.display.dragCursor = elt("div", null, "CodeMirror-cursors CodeMirror-dragcursors");
+ cm.display.lineSpace.insertBefore(cm.display.dragCursor, cm.display.cursorDiv);
+ }
+ removeChildrenAndAdd(cm.display.dragCursor, frag);
+ }
+
+ function clearDragCursor(cm) {
+ if (cm.display.dragCursor) {
+ cm.display.lineSpace.removeChild(cm.display.dragCursor);
+ cm.display.dragCursor = null;
+ }
+ }
+
+ // These must be handled carefully, because naively registering a
+ // handler for each editor will cause the editors to never be
+ // garbage collected.
+
+ function forEachCodeMirror(f) {
+ if (!document.getElementsByClassName) { return }
+ var byClass = document.getElementsByClassName("CodeMirror"), editors = [];
+ for (var i = 0; i < byClass.length; i++) {
+ var cm = byClass[i].CodeMirror;
+ if (cm) { editors.push(cm); }
+ }
+ if (editors.length) { editors[0].operation(function () {
+ for (var i = 0; i < editors.length; i++) { f(editors[i]); }
+ }); }
+ }
+
+ var globalsRegistered = false;
+ function ensureGlobalHandlers() {
+ if (globalsRegistered) { return }
+ registerGlobalHandlers();
+ globalsRegistered = true;
+ }
+ function registerGlobalHandlers() {
+ // When the window resizes, we need to refresh active editors.
+ var resizeTimer;
+ on(window, "resize", function () {
+ if (resizeTimer == null) { resizeTimer = setTimeout(function () {
+ resizeTimer = null;
+ forEachCodeMirror(onResize);
+ }, 100); }
+ });
+ // When the window loses focus, we want to show the editor as blurred
+ on(window, "blur", function () { return forEachCodeMirror(onBlur); });
+ }
+ // Called when the window resizes
+ function onResize(cm) {
+ var d = cm.display;
+ // Might be a text scaling operation, clear size caches.
+ d.cachedCharWidth = d.cachedTextHeight = d.cachedPaddingH = null;
+ d.scrollbarsClipped = false;
+ cm.setSize();
+ }
+
+ var keyNames = {
+ 3: "Pause", 8: "Backspace", 9: "Tab", 13: "Enter", 16: "Shift", 17: "Ctrl", 18: "Alt",
+ 19: "Pause", 20: "CapsLock", 27: "Esc", 32: "Space", 33: "PageUp", 34: "PageDown", 35: "End",
+ 36: "Home", 37: "Left", 38: "Up", 39: "Right", 40: "Down", 44: "PrintScrn", 45: "Insert",
+ 46: "Delete", 59: ";", 61: "=", 91: "Mod", 92: "Mod", 93: "Mod",
+ 106: "*", 107: "=", 109: "-", 110: ".", 111: "/", 145: "ScrollLock",
+ 173: "-", 186: ";", 187: "=", 188: ",", 189: "-", 190: ".", 191: "/", 192: "`", 219: "[", 220: "\\",
+ 221: "]", 222: "'", 224: "Mod", 63232: "Up", 63233: "Down", 63234: "Left", 63235: "Right", 63272: "Delete",
+ 63273: "Home", 63275: "End", 63276: "PageUp", 63277: "PageDown", 63302: "Insert"
+ };
+
+ // Number keys
+ for (var i = 0; i < 10; i++) { keyNames[i + 48] = keyNames[i + 96] = String(i); }
+ // Alphabetic keys
+ for (var i$1 = 65; i$1 <= 90; i$1++) { keyNames[i$1] = String.fromCharCode(i$1); }
+ // Function keys
+ for (var i$2 = 1; i$2 <= 12; i$2++) { keyNames[i$2 + 111] = keyNames[i$2 + 63235] = "F" + i$2; }
+
+ var keyMap = {};
+
+ keyMap.basic = {
+ "Left": "goCharLeft", "Right": "goCharRight", "Up": "goLineUp", "Down": "goLineDown",
+ "End": "goLineEnd", "Home": "goLineStartSmart", "PageUp": "goPageUp", "PageDown": "goPageDown",
+ "Delete": "delCharAfter", "Backspace": "delCharBefore", "Shift-Backspace": "delCharBefore",
+ "Tab": "defaultTab", "Shift-Tab": "indentAuto",
+ "Enter": "newlineAndIndent", "Insert": "toggleOverwrite",
+ "Esc": "singleSelection"
+ };
+ // Note that the save and find-related commands aren't defined by
+ // default. User code or addons can define them. Unknown commands
+ // are simply ignored.
+ keyMap.pcDefault = {
+ "Ctrl-A": "selectAll", "Ctrl-D": "deleteLine", "Ctrl-Z": "undo", "Shift-Ctrl-Z": "redo", "Ctrl-Y": "redo",
+ "Ctrl-Home": "goDocStart", "Ctrl-End": "goDocEnd", "Ctrl-Up": "goLineUp", "Ctrl-Down": "goLineDown",
+ "Ctrl-Left": "goGroupLeft", "Ctrl-Right": "goGroupRight", "Alt-Left": "goLineStart", "Alt-Right": "goLineEnd",
+ "Ctrl-Backspace": "delGroupBefore", "Ctrl-Delete": "delGroupAfter", "Ctrl-S": "save", "Ctrl-F": "find",
+ "Ctrl-G": "findNext", "Shift-Ctrl-G": "findPrev", "Shift-Ctrl-F": "replace", "Shift-Ctrl-R": "replaceAll",
+ "Ctrl-[": "indentLess", "Ctrl-]": "indentMore",
+ "Ctrl-U": "undoSelection", "Shift-Ctrl-U": "redoSelection", "Alt-U": "redoSelection",
+ "fallthrough": "basic"
+ };
+ // Very basic readline/emacs-style bindings, which are standard on Mac.
+ keyMap.emacsy = {
+ "Ctrl-F": "goCharRight", "Ctrl-B": "goCharLeft", "Ctrl-P": "goLineUp", "Ctrl-N": "goLineDown",
+ "Alt-F": "goWordRight", "Alt-B": "goWordLeft", "Ctrl-A": "goLineStart", "Ctrl-E": "goLineEnd",
+ "Ctrl-V": "goPageDown", "Shift-Ctrl-V": "goPageUp", "Ctrl-D": "delCharAfter", "Ctrl-H": "delCharBefore",
+ "Alt-D": "delWordAfter", "Alt-Backspace": "delWordBefore", "Ctrl-K": "killLine", "Ctrl-T": "transposeChars",
+ "Ctrl-O": "openLine"
+ };
+ keyMap.macDefault = {
+ "Cmd-A": "selectAll", "Cmd-D": "deleteLine", "Cmd-Z": "undo", "Shift-Cmd-Z": "redo", "Cmd-Y": "redo",
+ "Cmd-Home": "goDocStart", "Cmd-Up": "goDocStart", "Cmd-End": "goDocEnd", "Cmd-Down": "goDocEnd", "Alt-Left": "goGroupLeft",
+ "Alt-Right": "goGroupRight", "Cmd-Left": "goLineLeft", "Cmd-Right": "goLineRight", "Alt-Backspace": "delGroupBefore",
+ "Ctrl-Alt-Backspace": "delGroupAfter", "Alt-Delete": "delGroupAfter", "Cmd-S": "save", "Cmd-F": "find",
+ "Cmd-G": "findNext", "Shift-Cmd-G": "findPrev", "Cmd-Alt-F": "replace", "Shift-Cmd-Alt-F": "replaceAll",
+ "Cmd-[": "indentLess", "Cmd-]": "indentMore", "Cmd-Backspace": "delWrappedLineLeft", "Cmd-Delete": "delWrappedLineRight",
+ "Cmd-U": "undoSelection", "Shift-Cmd-U": "redoSelection", "Ctrl-Up": "goDocStart", "Ctrl-Down": "goDocEnd",
+ "fallthrough": ["basic", "emacsy"]
+ };
+ keyMap["default"] = mac ? keyMap.macDefault : keyMap.pcDefault;
+
+ // KEYMAP DISPATCH
+
+ function normalizeKeyName(name) {
+ var parts = name.split(/-(?!$)/);
+ name = parts[parts.length - 1];
+ var alt, ctrl, shift, cmd;
+ for (var i = 0; i < parts.length - 1; i++) {
+ var mod = parts[i];
+ if (/^(cmd|meta|m)$/i.test(mod)) { cmd = true; }
+ else if (/^a(lt)?$/i.test(mod)) { alt = true; }
+ else if (/^(c|ctrl|control)$/i.test(mod)) { ctrl = true; }
+ else if (/^s(hift)?$/i.test(mod)) { shift = true; }
+ else { throw new Error("Unrecognized modifier name: " + mod) }
+ }
+ if (alt) { name = "Alt-" + name; }
+ if (ctrl) { name = "Ctrl-" + name; }
+ if (cmd) { name = "Cmd-" + name; }
+ if (shift) { name = "Shift-" + name; }
+ return name
+ }
+
+ // This is a kludge to keep keymaps mostly working as raw objects
+ // (backwards compatibility) while at the same time support features
+ // like normalization and multi-stroke key bindings. It compiles a
+ // new normalized keymap, and then updates the old object to reflect
+ // this.
+ function normalizeKeyMap(keymap) {
+ var copy = {};
+ for (var keyname in keymap) { if (keymap.hasOwnProperty(keyname)) {
+ var value = keymap[keyname];
+ if (/^(name|fallthrough|(de|at)tach)$/.test(keyname)) { continue }
+ if (value == "...") { delete keymap[keyname]; continue }
+
+ var keys = map(keyname.split(" "), normalizeKeyName);
+ for (var i = 0; i < keys.length; i++) {
+ var val = (void 0), name = (void 0);
+ if (i == keys.length - 1) {
+ name = keys.join(" ");
+ val = value;
+ } else {
+ name = keys.slice(0, i + 1).join(" ");
+ val = "...";
+ }
+ var prev = copy[name];
+ if (!prev) { copy[name] = val; }
+ else if (prev != val) { throw new Error("Inconsistent bindings for " + name) }
+ }
+ delete keymap[keyname];
+ } }
+ for (var prop in copy) { keymap[prop] = copy[prop]; }
+ return keymap
+ }
+
+ function lookupKey(key, map, handle, context) {
+ map = getKeyMap(map);
+ var found = map.call ? map.call(key, context) : map[key];
+ if (found === false) { return "nothing" }
+ if (found === "...") { return "multi" }
+ if (found != null && handle(found)) { return "handled" }
+
+ if (map.fallthrough) {
+ if (Object.prototype.toString.call(map.fallthrough) != "[object Array]")
+ { return lookupKey(key, map.fallthrough, handle, context) }
+ for (var i = 0; i < map.fallthrough.length; i++) {
+ var result = lookupKey(key, map.fallthrough[i], handle, context);
+ if (result) { return result }
+ }
+ }
+ }
+
+ // Modifier key presses don't count as 'real' key presses for the
+ // purpose of keymap fallthrough.
+ function isModifierKey(value) {
+ var name = typeof value == "string" ? value : keyNames[value.keyCode];
+ return name == "Ctrl" || name == "Alt" || name == "Shift" || name == "Mod"
+ }
+
+ function addModifierNames(name, event, noShift) {
+ var base = name;
+ if (event.altKey && base != "Alt") { name = "Alt-" + name; }
+ if ((flipCtrlCmd ? event.metaKey : event.ctrlKey) && base != "Ctrl") { name = "Ctrl-" + name; }
+ if ((flipCtrlCmd ? event.ctrlKey : event.metaKey) && base != "Mod") { name = "Cmd-" + name; }
+ if (!noShift && event.shiftKey && base != "Shift") { name = "Shift-" + name; }
+ return name
+ }
+
+ // Look up the name of a key as indicated by an event object.
+ function keyName(event, noShift) {
+ if (presto && event.keyCode == 34 && event["char"]) { return false }
+ var name = keyNames[event.keyCode];
+ if (name == null || event.altGraphKey) { return false }
+ // Ctrl-ScrollLock has keyCode 3, same as Ctrl-Pause,
+ // so we'll use event.code when available (Chrome 48+, FF 38+, Safari 10.1+)
+ if (event.keyCode == 3 && event.code) { name = event.code; }
+ return addModifierNames(name, event, noShift)
+ }
+
+ function getKeyMap(val) {
+ return typeof val == "string" ? keyMap[val] : val
+ }
+
+ // Helper for deleting text near the selection(s), used to implement
+ // backspace, delete, and similar functionality.
+ function deleteNearSelection(cm, compute) {
+ var ranges = cm.doc.sel.ranges, kill = [];
+ // Build up a set of ranges to kill first, merging overlapping
+ // ranges.
+ for (var i = 0; i < ranges.length; i++) {
+ var toKill = compute(ranges[i]);
+ while (kill.length && cmp(toKill.from, lst(kill).to) <= 0) {
+ var replaced = kill.pop();
+ if (cmp(replaced.from, toKill.from) < 0) {
+ toKill.from = replaced.from;
+ break
+ }
+ }
+ kill.push(toKill);
+ }
+ // Next, remove those actual ranges.
+ runInOp(cm, function () {
+ for (var i = kill.length - 1; i >= 0; i--)
+ { replaceRange(cm.doc, "", kill[i].from, kill[i].to, "+delete"); }
+ ensureCursorVisible(cm);
+ });
+ }
+
+ function moveCharLogically(line, ch, dir) {
+ var target = skipExtendingChars(line.text, ch + dir, dir);
+ return target < 0 || target > line.text.length ? null : target
+ }
+
+ function moveLogically(line, start, dir) {
+ var ch = moveCharLogically(line, start.ch, dir);
+ return ch == null ? null : new Pos(start.line, ch, dir < 0 ? "after" : "before")
+ }
+
+ function endOfLine(visually, cm, lineObj, lineNo, dir) {
+ if (visually) {
+ if (cm.doc.direction == "rtl") { dir = -dir; }
+ var order = getOrder(lineObj, cm.doc.direction);
+ if (order) {
+ var part = dir < 0 ? lst(order) : order[0];
+ var moveInStorageOrder = (dir < 0) == (part.level == 1);
+ var sticky = moveInStorageOrder ? "after" : "before";
+ var ch;
+ // With a wrapped rtl chunk (possibly spanning multiple bidi parts),
+ // it could be that the last bidi part is not on the last visual line,
+ // since visual lines contain content order-consecutive chunks.
+ // Thus, in rtl, we are looking for the first (content-order) character
+ // in the rtl chunk that is on the last line (that is, the same line
+ // as the last (content-order) character).
+ if (part.level > 0 || cm.doc.direction == "rtl") {
+ var prep = prepareMeasureForLine(cm, lineObj);
+ ch = dir < 0 ? lineObj.text.length - 1 : 0;
+ var targetTop = measureCharPrepared(cm, prep, ch).top;
+ ch = findFirst(function (ch) { return measureCharPrepared(cm, prep, ch).top == targetTop; }, (dir < 0) == (part.level == 1) ? part.from : part.to - 1, ch);
+ if (sticky == "before") { ch = moveCharLogically(lineObj, ch, 1); }
+ } else { ch = dir < 0 ? part.to : part.from; }
+ return new Pos(lineNo, ch, sticky)
+ }
+ }
+ return new Pos(lineNo, dir < 0 ? lineObj.text.length : 0, dir < 0 ? "before" : "after")
+ }
+
+ function moveVisually(cm, line, start, dir) {
+ var bidi = getOrder(line, cm.doc.direction);
+ if (!bidi) { return moveLogically(line, start, dir) }
+ if (start.ch >= line.text.length) {
+ start.ch = line.text.length;
+ start.sticky = "before";
+ } else if (start.ch <= 0) {
+ start.ch = 0;
+ start.sticky = "after";
+ }
+ var partPos = getBidiPartAt(bidi, start.ch, start.sticky), part = bidi[partPos];
+ if (cm.doc.direction == "ltr" && part.level % 2 == 0 && (dir > 0 ? part.to > start.ch : part.from < start.ch)) {
+ // Case 1: We move within an ltr part in an ltr editor. Even with wrapped lines,
+ // nothing interesting happens.
+ return moveLogically(line, start, dir)
+ }
+
+ var mv = function (pos, dir) { return moveCharLogically(line, pos instanceof Pos ? pos.ch : pos, dir); };
+ var prep;
+ var getWrappedLineExtent = function (ch) {
+ if (!cm.options.lineWrapping) { return {begin: 0, end: line.text.length} }
+ prep = prep || prepareMeasureForLine(cm, line);
+ return wrappedLineExtentChar(cm, line, prep, ch)
+ };
+ var wrappedLineExtent = getWrappedLineExtent(start.sticky == "before" ? mv(start, -1) : start.ch);
+
+ if (cm.doc.direction == "rtl" || part.level == 1) {
+ var moveInStorageOrder = (part.level == 1) == (dir < 0);
+ var ch = mv(start, moveInStorageOrder ? 1 : -1);
+ if (ch != null && (!moveInStorageOrder ? ch >= part.from && ch >= wrappedLineExtent.begin : ch <= part.to && ch <= wrappedLineExtent.end)) {
+ // Case 2: We move within an rtl part or in an rtl editor on the same visual line
+ var sticky = moveInStorageOrder ? "before" : "after";
+ return new Pos(start.line, ch, sticky)
+ }
+ }
+
+ // Case 3: Could not move within this bidi part in this visual line, so leave
+ // the current bidi part
+
+ var searchInVisualLine = function (partPos, dir, wrappedLineExtent) {
+ var getRes = function (ch, moveInStorageOrder) { return moveInStorageOrder
+ ? new Pos(start.line, mv(ch, 1), "before")
+ : new Pos(start.line, ch, "after"); };
+
+ for (; partPos >= 0 && partPos < bidi.length; partPos += dir) {
+ var part = bidi[partPos];
+ var moveInStorageOrder = (dir > 0) == (part.level != 1);
+ var ch = moveInStorageOrder ? wrappedLineExtent.begin : mv(wrappedLineExtent.end, -1);
+ if (part.from <= ch && ch < part.to) { return getRes(ch, moveInStorageOrder) }
+ ch = moveInStorageOrder ? part.from : mv(part.to, -1);
+ if (wrappedLineExtent.begin <= ch && ch < wrappedLineExtent.end) { return getRes(ch, moveInStorageOrder) }
+ }
+ };
+
+ // Case 3a: Look for other bidi parts on the same visual line
+ var res = searchInVisualLine(partPos + dir, dir, wrappedLineExtent);
+ if (res) { return res }
+
+ // Case 3b: Look for other bidi parts on the next visual line
+ var nextCh = dir > 0 ? wrappedLineExtent.end : mv(wrappedLineExtent.begin, -1);
+ if (nextCh != null && !(dir > 0 && nextCh == line.text.length)) {
+ res = searchInVisualLine(dir > 0 ? 0 : bidi.length - 1, dir, getWrappedLineExtent(nextCh));
+ if (res) { return res }
+ }
+
+ // Case 4: Nowhere to move
+ return null
+ }
+
+ // Commands are parameter-less actions that can be performed on an
+ // editor, mostly used for keybindings.
+ var commands = {
+ selectAll: selectAll,
+ singleSelection: function (cm) { return cm.setSelection(cm.getCursor("anchor"), cm.getCursor("head"), sel_dontScroll); },
+ killLine: function (cm) { return deleteNearSelection(cm, function (range) {
+ if (range.empty()) {
+ var len = getLine(cm.doc, range.head.line).text.length;
+ if (range.head.ch == len && range.head.line < cm.lastLine())
+ { return {from: range.head, to: Pos(range.head.line + 1, 0)} }
+ else
+ { return {from: range.head, to: Pos(range.head.line, len)} }
+ } else {
+ return {from: range.from(), to: range.to()}
+ }
+ }); },
+ deleteLine: function (cm) { return deleteNearSelection(cm, function (range) { return ({
+ from: Pos(range.from().line, 0),
+ to: clipPos(cm.doc, Pos(range.to().line + 1, 0))
+ }); }); },
+ delLineLeft: function (cm) { return deleteNearSelection(cm, function (range) { return ({
+ from: Pos(range.from().line, 0), to: range.from()
+ }); }); },
+ delWrappedLineLeft: function (cm) { return deleteNearSelection(cm, function (range) {
+ var top = cm.charCoords(range.head, "div").top + 5;
+ var leftPos = cm.coordsChar({left: 0, top: top}, "div");
+ return {from: leftPos, to: range.from()}
+ }); },
+ delWrappedLineRight: function (cm) { return deleteNearSelection(cm, function (range) {
+ var top = cm.charCoords(range.head, "div").top + 5;
+ var rightPos = cm.coordsChar({left: cm.display.lineDiv.offsetWidth + 100, top: top}, "div");
+ return {from: range.from(), to: rightPos }
+ }); },
+ undo: function (cm) { return cm.undo(); },
+ redo: function (cm) { return cm.redo(); },
+ undoSelection: function (cm) { return cm.undoSelection(); },
+ redoSelection: function (cm) { return cm.redoSelection(); },
+ goDocStart: function (cm) { return cm.extendSelection(Pos(cm.firstLine(), 0)); },
+ goDocEnd: function (cm) { return cm.extendSelection(Pos(cm.lastLine())); },
+ goLineStart: function (cm) { return cm.extendSelectionsBy(function (range) { return lineStart(cm, range.head.line); },
+ {origin: "+move", bias: 1}
+ ); },
+ goLineStartSmart: function (cm) { return cm.extendSelectionsBy(function (range) { return lineStartSmart(cm, range.head); },
+ {origin: "+move", bias: 1}
+ ); },
+ goLineEnd: function (cm) { return cm.extendSelectionsBy(function (range) { return lineEnd(cm, range.head.line); },
+ {origin: "+move", bias: -1}
+ ); },
+ goLineRight: function (cm) { return cm.extendSelectionsBy(function (range) {
+ var top = cm.cursorCoords(range.head, "div").top + 5;
+ return cm.coordsChar({left: cm.display.lineDiv.offsetWidth + 100, top: top}, "div")
+ }, sel_move); },
+ goLineLeft: function (cm) { return cm.extendSelectionsBy(function (range) {
+ var top = cm.cursorCoords(range.head, "div").top + 5;
+ return cm.coordsChar({left: 0, top: top}, "div")
+ }, sel_move); },
+ goLineLeftSmart: function (cm) { return cm.extendSelectionsBy(function (range) {
+ var top = cm.cursorCoords(range.head, "div").top + 5;
+ var pos = cm.coordsChar({left: 0, top: top}, "div");
+ if (pos.ch < cm.getLine(pos.line).search(/\S/)) { return lineStartSmart(cm, range.head) }
+ return pos
+ }, sel_move); },
+ goLineUp: function (cm) { return cm.moveV(-1, "line"); },
+ goLineDown: function (cm) { return cm.moveV(1, "line"); },
+ goPageUp: function (cm) { return cm.moveV(-1, "page"); },
+ goPageDown: function (cm) { return cm.moveV(1, "page"); },
+ goCharLeft: function (cm) { return cm.moveH(-1, "char"); },
+ goCharRight: function (cm) { return cm.moveH(1, "char"); },
+ goColumnLeft: function (cm) { return cm.moveH(-1, "column"); },
+ goColumnRight: function (cm) { return cm.moveH(1, "column"); },
+ goWordLeft: function (cm) { return cm.moveH(-1, "word"); },
+ goGroupRight: function (cm) { return cm.moveH(1, "group"); },
+ goGroupLeft: function (cm) { return cm.moveH(-1, "group"); },
+ goWordRight: function (cm) { return cm.moveH(1, "word"); },
+ delCharBefore: function (cm) { return cm.deleteH(-1, "char"); },
+ delCharAfter: function (cm) { return cm.deleteH(1, "char"); },
+ delWordBefore: function (cm) { return cm.deleteH(-1, "word"); },
+ delWordAfter: function (cm) { return cm.deleteH(1, "word"); },
+ delGroupBefore: function (cm) { return cm.deleteH(-1, "group"); },
+ delGroupAfter: function (cm) { return cm.deleteH(1, "group"); },
+ indentAuto: function (cm) { return cm.indentSelection("smart"); },
+ indentMore: function (cm) { return cm.indentSelection("add"); },
+ indentLess: function (cm) { return cm.indentSelection("subtract"); },
+ insertTab: function (cm) { return cm.replaceSelection("\t"); },
+ insertSoftTab: function (cm) {
+ var spaces = [], ranges = cm.listSelections(), tabSize = cm.options.tabSize;
+ for (var i = 0; i < ranges.length; i++) {
+ var pos = ranges[i].from();
+ var col = countColumn(cm.getLine(pos.line), pos.ch, tabSize);
+ spaces.push(spaceStr(tabSize - col % tabSize));
+ }
+ cm.replaceSelections(spaces);
+ },
+ defaultTab: function (cm) {
+ if (cm.somethingSelected()) { cm.indentSelection("add"); }
+ else { cm.execCommand("insertTab"); }
+ },
+ // Swap the two chars left and right of each selection's head.
+ // Move cursor behind the two swapped characters afterwards.
+ //
+ // Doesn't consider line feeds a character.
+ // Doesn't scan more than one line above to find a character.
+ // Doesn't do anything on an empty line.
+ // Doesn't do anything with non-empty selections.
+ transposeChars: function (cm) { return runInOp(cm, function () {
+ var ranges = cm.listSelections(), newSel = [];
+ for (var i = 0; i < ranges.length; i++) {
+ if (!ranges[i].empty()) { continue }
+ var cur = ranges[i].head, line = getLine(cm.doc, cur.line).text;
+ if (line) {
+ if (cur.ch == line.length) { cur = new Pos(cur.line, cur.ch - 1); }
+ if (cur.ch > 0) {
+ cur = new Pos(cur.line, cur.ch + 1);
+ cm.replaceRange(line.charAt(cur.ch - 1) + line.charAt(cur.ch - 2),
+ Pos(cur.line, cur.ch - 2), cur, "+transpose");
+ } else if (cur.line > cm.doc.first) {
+ var prev = getLine(cm.doc, cur.line - 1).text;
+ if (prev) {
+ cur = new Pos(cur.line, 1);
+ cm.replaceRange(line.charAt(0) + cm.doc.lineSeparator() +
+ prev.charAt(prev.length - 1),
+ Pos(cur.line - 1, prev.length - 1), cur, "+transpose");
+ }
+ }
+ }
+ newSel.push(new Range(cur, cur));
+ }
+ cm.setSelections(newSel);
+ }); },
+ newlineAndIndent: function (cm) { return runInOp(cm, function () {
+ var sels = cm.listSelections();
+ for (var i = sels.length - 1; i >= 0; i--)
+ { cm.replaceRange(cm.doc.lineSeparator(), sels[i].anchor, sels[i].head, "+input"); }
+ sels = cm.listSelections();
+ for (var i$1 = 0; i$1 < sels.length; i$1++)
+ { cm.indentLine(sels[i$1].from().line, null, true); }
+ ensureCursorVisible(cm);
+ }); },
+ openLine: function (cm) { return cm.replaceSelection("\n", "start"); },
+ toggleOverwrite: function (cm) { return cm.toggleOverwrite(); }
+ };
+
+
+ function lineStart(cm, lineN) {
+ var line = getLine(cm.doc, lineN);
+ var visual = visualLine(line);
+ if (visual != line) { lineN = lineNo(visual); }
+ return endOfLine(true, cm, visual, lineN, 1)
+ }
+ function lineEnd(cm, lineN) {
+ var line = getLine(cm.doc, lineN);
+ var visual = visualLineEnd(line);
+ if (visual != line) { lineN = lineNo(visual); }
+ return endOfLine(true, cm, line, lineN, -1)
+ }
+ function lineStartSmart(cm, pos) {
+ var start = lineStart(cm, pos.line);
+ var line = getLine(cm.doc, start.line);
+ var order = getOrder(line, cm.doc.direction);
+ if (!order || order[0].level == 0) {
+ var firstNonWS = Math.max(start.ch, line.text.search(/\S/));
+ var inWS = pos.line == start.line && pos.ch <= firstNonWS && pos.ch;
+ return Pos(start.line, inWS ? 0 : firstNonWS, start.sticky)
+ }
+ return start
+ }
+
+ // Run a handler that was bound to a key.
+ function doHandleBinding(cm, bound, dropShift) {
+ if (typeof bound == "string") {
+ bound = commands[bound];
+ if (!bound) { return false }
+ }
+ // Ensure previous input has been read, so that the handler sees a
+ // consistent view of the document
+ cm.display.input.ensurePolled();
+ var prevShift = cm.display.shift, done = false;
+ try {
+ if (cm.isReadOnly()) { cm.state.suppressEdits = true; }
+ if (dropShift) { cm.display.shift = false; }
+ done = bound(cm) != Pass;
+ } finally {
+ cm.display.shift = prevShift;
+ cm.state.suppressEdits = false;
+ }
+ return done
+ }
+
+ function lookupKeyForEditor(cm, name, handle) {
+ for (var i = 0; i < cm.state.keyMaps.length; i++) {
+ var result = lookupKey(name, cm.state.keyMaps[i], handle, cm);
+ if (result) { return result }
+ }
+ return (cm.options.extraKeys && lookupKey(name, cm.options.extraKeys, handle, cm))
+ || lookupKey(name, cm.options.keyMap, handle, cm)
+ }
+
+ // Note that, despite the name, this function is also used to check
+ // for bound mouse clicks.
+
+ var stopSeq = new Delayed;
+
+ function dispatchKey(cm, name, e, handle) {
+ var seq = cm.state.keySeq;
+ if (seq) {
+ if (isModifierKey(name)) { return "handled" }
+ if (/\'$/.test(name))
+ { cm.state.keySeq = null; }
+ else
+ { stopSeq.set(50, function () {
+ if (cm.state.keySeq == seq) {
+ cm.state.keySeq = null;
+ cm.display.input.reset();
+ }
+ }); }
+ if (dispatchKeyInner(cm, seq + " " + name, e, handle)) { return true }
+ }
+ return dispatchKeyInner(cm, name, e, handle)
+ }
+
+ function dispatchKeyInner(cm, name, e, handle) {
+ var result = lookupKeyForEditor(cm, name, handle);
+
+ if (result == "multi")
+ { cm.state.keySeq = name; }
+ if (result == "handled")
+ { signalLater(cm, "keyHandled", cm, name, e); }
+
+ if (result == "handled" || result == "multi") {
+ e_preventDefault(e);
+ restartBlink(cm);
+ }
+
+ return !!result
+ }
+
+ // Handle a key from the keydown event.
+ function handleKeyBinding(cm, e) {
+ var name = keyName(e, true);
+ if (!name) { return false }
+
+ if (e.shiftKey && !cm.state.keySeq) {
+ // First try to resolve full name (including 'Shift-'). Failing
+ // that, see if there is a cursor-motion command (starting with
+ // 'go') bound to the keyname without 'Shift-'.
+ return dispatchKey(cm, "Shift-" + name, e, function (b) { return doHandleBinding(cm, b, true); })
+ || dispatchKey(cm, name, e, function (b) {
+ if (typeof b == "string" ? /^go[A-Z]/.test(b) : b.motion)
+ { return doHandleBinding(cm, b) }
+ })
+ } else {
+ return dispatchKey(cm, name, e, function (b) { return doHandleBinding(cm, b); })
+ }
+ }
+
+ // Handle a key from the keypress event
+ function handleCharBinding(cm, e, ch) {
+ return dispatchKey(cm, "'" + ch + "'", e, function (b) { return doHandleBinding(cm, b, true); })
+ }
+
+ var lastStoppedKey = null;
+ function onKeyDown(e) {
+ var cm = this;
+ if (e.target && e.target != cm.display.input.getField()) { return }
+ cm.curOp.focus = activeElt();
+ if (signalDOMEvent(cm, e)) { return }
+ // IE does strange things with escape.
+ if (ie && ie_version < 11 && e.keyCode == 27) { e.returnValue = false; }
+ var code = e.keyCode;
+ cm.display.shift = code == 16 || e.shiftKey;
+ var handled = handleKeyBinding(cm, e);
+ if (presto) {
+ lastStoppedKey = handled ? code : null;
+ // Opera has no cut event... we try to at least catch the key combo
+ if (!handled && code == 88 && !hasCopyEvent && (mac ? e.metaKey : e.ctrlKey))
+ { cm.replaceSelection("", null, "cut"); }
+ }
+ if (gecko && !mac && !handled && code == 46 && e.shiftKey && !e.ctrlKey && document.execCommand)
+ { document.execCommand("cut"); }
+
+ // Turn mouse into crosshair when Alt is held on Mac.
+ if (code == 18 && !/\bCodeMirror-crosshair\b/.test(cm.display.lineDiv.className))
+ { showCrossHair(cm); }
+ }
+
+ function showCrossHair(cm) {
+ var lineDiv = cm.display.lineDiv;
+ addClass(lineDiv, "CodeMirror-crosshair");
+
+ function up(e) {
+ if (e.keyCode == 18 || !e.altKey) {
+ rmClass(lineDiv, "CodeMirror-crosshair");
+ off(document, "keyup", up);
+ off(document, "mouseover", up);
+ }
+ }
+ on(document, "keyup", up);
+ on(document, "mouseover", up);
+ }
+
+ function onKeyUp(e) {
+ if (e.keyCode == 16) { this.doc.sel.shift = false; }
+ signalDOMEvent(this, e);
+ }
+
+ function onKeyPress(e) {
+ var cm = this;
+ if (e.target && e.target != cm.display.input.getField()) { return }
+ if (eventInWidget(cm.display, e) || signalDOMEvent(cm, e) || e.ctrlKey && !e.altKey || mac && e.metaKey) { return }
+ var keyCode = e.keyCode, charCode = e.charCode;
+ if (presto && keyCode == lastStoppedKey) {lastStoppedKey = null; e_preventDefault(e); return}
+ if ((presto && (!e.which || e.which < 10)) && handleKeyBinding(cm, e)) { return }
+ var ch = String.fromCharCode(charCode == null ? keyCode : charCode);
+ // Some browsers fire keypress events for backspace
+ if (ch == "\x08") { return }
+ if (handleCharBinding(cm, e, ch)) { return }
+ cm.display.input.onKeyPress(e);
+ }
+
+ var DOUBLECLICK_DELAY = 400;
+
+ var PastClick = function(time, pos, button) {
+ this.time = time;
+ this.pos = pos;
+ this.button = button;
+ };
+
+ PastClick.prototype.compare = function (time, pos, button) {
+ return this.time + DOUBLECLICK_DELAY > time &&
+ cmp(pos, this.pos) == 0 && button == this.button
+ };
+
+ var lastClick, lastDoubleClick;
+ function clickRepeat(pos, button) {
+ var now = +new Date;
+ if (lastDoubleClick && lastDoubleClick.compare(now, pos, button)) {
+ lastClick = lastDoubleClick = null;
+ return "triple"
+ } else if (lastClick && lastClick.compare(now, pos, button)) {
+ lastDoubleClick = new PastClick(now, pos, button);
+ lastClick = null;
+ return "double"
+ } else {
+ lastClick = new PastClick(now, pos, button);
+ lastDoubleClick = null;
+ return "single"
+ }
+ }
+
+ // A mouse down can be a single click, double click, triple click,
+ // start of selection drag, start of text drag, new cursor
+ // (ctrl-click), rectangle drag (alt-drag), or xwin
+ // middle-click-paste. Or it might be a click on something we should
+ // not interfere with, such as a scrollbar or widget.
+ function onMouseDown(e) {
+ var cm = this, display = cm.display;
+ if (signalDOMEvent(cm, e) || display.activeTouch && display.input.supportsTouch()) { return }
+ display.input.ensurePolled();
+ display.shift = e.shiftKey;
+
+ if (eventInWidget(display, e)) {
+ if (!webkit) {
+ // Briefly turn off draggability, to allow widgets to do
+ // normal dragging things.
+ display.scroller.draggable = false;
+ setTimeout(function () { return display.scroller.draggable = true; }, 100);
+ }
+ return
+ }
+ if (clickInGutter(cm, e)) { return }
+ var pos = posFromMouse(cm, e), button = e_button(e), repeat = pos ? clickRepeat(pos, button) : "single";
+ window.focus();
+
+ // #3261: make sure, that we're not starting a second selection
+ if (button == 1 && cm.state.selectingText)
+ { cm.state.selectingText(e); }
+
+ if (pos && handleMappedButton(cm, button, pos, repeat, e)) { return }
+
+ if (button == 1) {
+ if (pos) { leftButtonDown(cm, pos, repeat, e); }
+ else if (e_target(e) == display.scroller) { e_preventDefault(e); }
+ } else if (button == 2) {
+ if (pos) { extendSelection(cm.doc, pos); }
+ setTimeout(function () { return display.input.focus(); }, 20);
+ } else if (button == 3) {
+ if (captureRightClick) { cm.display.input.onContextMenu(e); }
+ else { delayBlurEvent(cm); }
+ }
+ }
+
+ function handleMappedButton(cm, button, pos, repeat, event) {
+ var name = "Click";
+ if (repeat == "double") { name = "Double" + name; }
+ else if (repeat == "triple") { name = "Triple" + name; }
+ name = (button == 1 ? "Left" : button == 2 ? "Middle" : "Right") + name;
+
+ return dispatchKey(cm, addModifierNames(name, event), event, function (bound) {
+ if (typeof bound == "string") { bound = commands[bound]; }
+ if (!bound) { return false }
+ var done = false;
+ try {
+ if (cm.isReadOnly()) { cm.state.suppressEdits = true; }
+ done = bound(cm, pos) != Pass;
+ } finally {
+ cm.state.suppressEdits = false;
+ }
+ return done
+ })
+ }
+
+ function configureMouse(cm, repeat, event) {
+ var option = cm.getOption("configureMouse");
+ var value = option ? option(cm, repeat, event) : {};
+ if (value.unit == null) {
+ var rect = chromeOS ? event.shiftKey && event.metaKey : event.altKey;
+ value.unit = rect ? "rectangle" : repeat == "single" ? "char" : repeat == "double" ? "word" : "line";
+ }
+ if (value.extend == null || cm.doc.extend) { value.extend = cm.doc.extend || event.shiftKey; }
+ if (value.addNew == null) { value.addNew = mac ? event.metaKey : event.ctrlKey; }
+ if (value.moveOnDrag == null) { value.moveOnDrag = !(mac ? event.altKey : event.ctrlKey); }
+ return value
+ }
+
+ function leftButtonDown(cm, pos, repeat, event) {
+ if (ie) { setTimeout(bind(ensureFocus, cm), 0); }
+ else { cm.curOp.focus = activeElt(); }
+
+ var behavior = configureMouse(cm, repeat, event);
+
+ var sel = cm.doc.sel, contained;
+ if (cm.options.dragDrop && dragAndDrop && !cm.isReadOnly() &&
+ repeat == "single" && (contained = sel.contains(pos)) > -1 &&
+ (cmp((contained = sel.ranges[contained]).from(), pos) < 0 || pos.xRel > 0) &&
+ (cmp(contained.to(), pos) > 0 || pos.xRel < 0))
+ { leftButtonStartDrag(cm, event, pos, behavior); }
+ else
+ { leftButtonSelect(cm, event, pos, behavior); }
+ }
+
+ // Start a text drag. When it ends, see if any dragging actually
+ // happen, and treat as a click if it didn't.
+ function leftButtonStartDrag(cm, event, pos, behavior) {
+ var display = cm.display, moved = false;
+ var dragEnd = operation(cm, function (e) {
+ if (webkit) { display.scroller.draggable = false; }
+ cm.state.draggingText = false;
+ off(display.wrapper.ownerDocument, "mouseup", dragEnd);
+ off(display.wrapper.ownerDocument, "mousemove", mouseMove);
+ off(display.scroller, "dragstart", dragStart);
+ off(display.scroller, "drop", dragEnd);
+ if (!moved) {
+ e_preventDefault(e);
+ if (!behavior.addNew)
+ { extendSelection(cm.doc, pos, null, null, behavior.extend); }
+ // Work around unexplainable focus problem in IE9 (#2127) and Chrome (#3081)
+ if ((webkit && !safari) || ie && ie_version == 9)
+ { setTimeout(function () {display.wrapper.ownerDocument.body.focus({preventScroll: true}); display.input.focus();}, 20); }
+ else
+ { display.input.focus(); }
+ }
+ });
+ var mouseMove = function(e2) {
+ moved = moved || Math.abs(event.clientX - e2.clientX) + Math.abs(event.clientY - e2.clientY) >= 10;
+ };
+ var dragStart = function () { return moved = true; };
+ // Let the drag handler handle this.
+ if (webkit) { display.scroller.draggable = true; }
+ cm.state.draggingText = dragEnd;
+ dragEnd.copy = !behavior.moveOnDrag;
+ // IE's approach to draggable
+ if (display.scroller.dragDrop) { display.scroller.dragDrop(); }
+ on(display.wrapper.ownerDocument, "mouseup", dragEnd);
+ on(display.wrapper.ownerDocument, "mousemove", mouseMove);
+ on(display.scroller, "dragstart", dragStart);
+ on(display.scroller, "drop", dragEnd);
+
+ delayBlurEvent(cm);
+ setTimeout(function () { return display.input.focus(); }, 20);
+ }
+
+ function rangeForUnit(cm, pos, unit) {
+ if (unit == "char") { return new Range(pos, pos) }
+ if (unit == "word") { return cm.findWordAt(pos) }
+ if (unit == "line") { return new Range(Pos(pos.line, 0), clipPos(cm.doc, Pos(pos.line + 1, 0))) }
+ var result = unit(cm, pos);
+ return new Range(result.from, result.to)
+ }
+
+ // Normal selection, as opposed to text dragging.
+ function leftButtonSelect(cm, event, start, behavior) {
+ var display = cm.display, doc = cm.doc;
+ e_preventDefault(event);
+
+ var ourRange, ourIndex, startSel = doc.sel, ranges = startSel.ranges;
+ if (behavior.addNew && !behavior.extend) {
+ ourIndex = doc.sel.contains(start);
+ if (ourIndex > -1)
+ { ourRange = ranges[ourIndex]; }
+ else
+ { ourRange = new Range(start, start); }
+ } else {
+ ourRange = doc.sel.primary();
+ ourIndex = doc.sel.primIndex;
+ }
+
+ if (behavior.unit == "rectangle") {
+ if (!behavior.addNew) { ourRange = new Range(start, start); }
+ start = posFromMouse(cm, event, true, true);
+ ourIndex = -1;
+ } else {
+ var range = rangeForUnit(cm, start, behavior.unit);
+ if (behavior.extend)
+ { ourRange = extendRange(ourRange, range.anchor, range.head, behavior.extend); }
+ else
+ { ourRange = range; }
+ }
+
+ if (!behavior.addNew) {
+ ourIndex = 0;
+ setSelection(doc, new Selection([ourRange], 0), sel_mouse);
+ startSel = doc.sel;
+ } else if (ourIndex == -1) {
+ ourIndex = ranges.length;
+ setSelection(doc, normalizeSelection(cm, ranges.concat([ourRange]), ourIndex),
+ {scroll: false, origin: "*mouse"});
+ } else if (ranges.length > 1 && ranges[ourIndex].empty() && behavior.unit == "char" && !behavior.extend) {
+ setSelection(doc, normalizeSelection(cm, ranges.slice(0, ourIndex).concat(ranges.slice(ourIndex + 1)), 0),
+ {scroll: false, origin: "*mouse"});
+ startSel = doc.sel;
+ } else {
+ replaceOneSelection(doc, ourIndex, ourRange, sel_mouse);
+ }
+
+ var lastPos = start;
+ function extendTo(pos) {
+ if (cmp(lastPos, pos) == 0) { return }
+ lastPos = pos;
+
+ if (behavior.unit == "rectangle") {
+ var ranges = [], tabSize = cm.options.tabSize;
+ var startCol = countColumn(getLine(doc, start.line).text, start.ch, tabSize);
+ var posCol = countColumn(getLine(doc, pos.line).text, pos.ch, tabSize);
+ var left = Math.min(startCol, posCol), right = Math.max(startCol, posCol);
+ for (var line = Math.min(start.line, pos.line), end = Math.min(cm.lastLine(), Math.max(start.line, pos.line));
+ line <= end; line++) {
+ var text = getLine(doc, line).text, leftPos = findColumn(text, left, tabSize);
+ if (left == right)
+ { ranges.push(new Range(Pos(line, leftPos), Pos(line, leftPos))); }
+ else if (text.length > leftPos)
+ { ranges.push(new Range(Pos(line, leftPos), Pos(line, findColumn(text, right, tabSize)))); }
+ }
+ if (!ranges.length) { ranges.push(new Range(start, start)); }
+ setSelection(doc, normalizeSelection(cm, startSel.ranges.slice(0, ourIndex).concat(ranges), ourIndex),
+ {origin: "*mouse", scroll: false});
+ cm.scrollIntoView(pos);
+ } else {
+ var oldRange = ourRange;
+ var range = rangeForUnit(cm, pos, behavior.unit);
+ var anchor = oldRange.anchor, head;
+ if (cmp(range.anchor, anchor) > 0) {
+ head = range.head;
+ anchor = minPos(oldRange.from(), range.anchor);
+ } else {
+ head = range.anchor;
+ anchor = maxPos(oldRange.to(), range.head);
+ }
+ var ranges$1 = startSel.ranges.slice(0);
+ ranges$1[ourIndex] = bidiSimplify(cm, new Range(clipPos(doc, anchor), head));
+ setSelection(doc, normalizeSelection(cm, ranges$1, ourIndex), sel_mouse);
+ }
+ }
+
+ var editorSize = display.wrapper.getBoundingClientRect();
+ // Used to ensure timeout re-tries don't fire when another extend
+ // happened in the meantime (clearTimeout isn't reliable -- at
+ // least on Chrome, the timeouts still happen even when cleared,
+ // if the clear happens after their scheduled firing time).
+ var counter = 0;
+
+ function extend(e) {
+ var curCount = ++counter;
+ var cur = posFromMouse(cm, e, true, behavior.unit == "rectangle");
+ if (!cur) { return }
+ if (cmp(cur, lastPos) != 0) {
+ cm.curOp.focus = activeElt();
+ extendTo(cur);
+ var visible = visibleLines(display, doc);
+ if (cur.line >= visible.to || cur.line < visible.from)
+ { setTimeout(operation(cm, function () {if (counter == curCount) { extend(e); }}), 150); }
+ } else {
+ var outside = e.clientY < editorSize.top ? -20 : e.clientY > editorSize.bottom ? 20 : 0;
+ if (outside) { setTimeout(operation(cm, function () {
+ if (counter != curCount) { return }
+ display.scroller.scrollTop += outside;
+ extend(e);
+ }), 50); }
+ }
+ }
+
+ function done(e) {
+ cm.state.selectingText = false;
+ counter = Infinity;
+ // If e is null or undefined we interpret this as someone trying
+ // to explicitly cancel the selection rather than the user
+ // letting go of the mouse button.
+ if (e) {
+ e_preventDefault(e);
+ display.input.focus();
+ }
+ off(display.wrapper.ownerDocument, "mousemove", move);
+ off(display.wrapper.ownerDocument, "mouseup", up);
+ doc.history.lastSelOrigin = null;
+ }
+
+ var move = operation(cm, function (e) {
+ if (e.buttons === 0 || !e_button(e)) { done(e); }
+ else { extend(e); }
+ });
+ var up = operation(cm, done);
+ cm.state.selectingText = up;
+ on(display.wrapper.ownerDocument, "mousemove", move);
+ on(display.wrapper.ownerDocument, "mouseup", up);
+ }
+
+ // Used when mouse-selecting to adjust the anchor to the proper side
+ // of a bidi jump depending on the visual position of the head.
+ function bidiSimplify(cm, range) {
+ var anchor = range.anchor;
+ var head = range.head;
+ var anchorLine = getLine(cm.doc, anchor.line);
+ if (cmp(anchor, head) == 0 && anchor.sticky == head.sticky) { return range }
+ var order = getOrder(anchorLine);
+ if (!order) { return range }
+ var index = getBidiPartAt(order, anchor.ch, anchor.sticky), part = order[index];
+ if (part.from != anchor.ch && part.to != anchor.ch) { return range }
+ var boundary = index + ((part.from == anchor.ch) == (part.level != 1) ? 0 : 1);
+ if (boundary == 0 || boundary == order.length) { return range }
+
+ // Compute the relative visual position of the head compared to the
+ // anchor (<0 is to the left, >0 to the right)
+ var leftSide;
+ if (head.line != anchor.line) {
+ leftSide = (head.line - anchor.line) * (cm.doc.direction == "ltr" ? 1 : -1) > 0;
+ } else {
+ var headIndex = getBidiPartAt(order, head.ch, head.sticky);
+ var dir = headIndex - index || (head.ch - anchor.ch) * (part.level == 1 ? -1 : 1);
+ if (headIndex == boundary - 1 || headIndex == boundary)
+ { leftSide = dir < 0; }
+ else
+ { leftSide = dir > 0; }
+ }
+
+ var usePart = order[boundary + (leftSide ? -1 : 0)];
+ var from = leftSide == (usePart.level == 1);
+ var ch = from ? usePart.from : usePart.to, sticky = from ? "after" : "before";
+ return anchor.ch == ch && anchor.sticky == sticky ? range : new Range(new Pos(anchor.line, ch, sticky), head)
+ }
+
+
+ // Determines whether an event happened in the gutter, and fires the
+ // handlers for the corresponding event.
+ function gutterEvent(cm, e, type, prevent) {
+ var mX, mY;
+ if (e.touches) {
+ mX = e.touches[0].clientX;
+ mY = e.touches[0].clientY;
+ } else {
+ try { mX = e.clientX; mY = e.clientY; }
+ catch(e$1) { return false }
+ }
+ if (mX >= Math.floor(cm.display.gutters.getBoundingClientRect().right)) { return false }
+ if (prevent) { e_preventDefault(e); }
+
+ var display = cm.display;
+ var lineBox = display.lineDiv.getBoundingClientRect();
+
+ if (mY > lineBox.bottom || !hasHandler(cm, type)) { return e_defaultPrevented(e) }
+ mY -= lineBox.top - display.viewOffset;
+
+ for (var i = 0; i < cm.display.gutterSpecs.length; ++i) {
+ var g = display.gutters.childNodes[i];
+ if (g && g.getBoundingClientRect().right >= mX) {
+ var line = lineAtHeight(cm.doc, mY);
+ var gutter = cm.display.gutterSpecs[i];
+ signal(cm, type, cm, line, gutter.className, e);
+ return e_defaultPrevented(e)
+ }
+ }
+ }
+
+ function clickInGutter(cm, e) {
+ return gutterEvent(cm, e, "gutterClick", true)
+ }
+
+ // CONTEXT MENU HANDLING
+
+ // To make the context menu work, we need to briefly unhide the
+ // textarea (making it as unobtrusive as possible) to let the
+ // right-click take effect on it.
+ function onContextMenu(cm, e) {
+ if (eventInWidget(cm.display, e) || contextMenuInGutter(cm, e)) { return }
+ if (signalDOMEvent(cm, e, "contextmenu")) { return }
+ if (!captureRightClick) { cm.display.input.onContextMenu(e); }
+ }
+
+ function contextMenuInGutter(cm, e) {
+ if (!hasHandler(cm, "gutterContextMenu")) { return false }
+ return gutterEvent(cm, e, "gutterContextMenu", false)
+ }
+
+ function themeChanged(cm) {
+ cm.display.wrapper.className = cm.display.wrapper.className.replace(/\s*cm-s-\S+/g, "") +
+ cm.options.theme.replace(/(^|\s)\s*/g, " cm-s-");
+ clearCaches(cm);
+ }
+
+ var Init = {toString: function(){return "CodeMirror.Init"}};
+
+ var defaults = {};
+ var optionHandlers = {};
+
+ function defineOptions(CodeMirror) {
+ var optionHandlers = CodeMirror.optionHandlers;
+
+ function option(name, deflt, handle, notOnInit) {
+ CodeMirror.defaults[name] = deflt;
+ if (handle) { optionHandlers[name] =
+ notOnInit ? function (cm, val, old) {if (old != Init) { handle(cm, val, old); }} : handle; }
+ }
+
+ CodeMirror.defineOption = option;
+
+ // Passed to option handlers when there is no old value.
+ CodeMirror.Init = Init;
+
+ // These two are, on init, called from the constructor because they
+ // have to be initialized before the editor can start at all.
+ option("value", "", function (cm, val) { return cm.setValue(val); }, true);
+ option("mode", null, function (cm, val) {
+ cm.doc.modeOption = val;
+ loadMode(cm);
+ }, true);
+
+ option("indentUnit", 2, loadMode, true);
+ option("indentWithTabs", false);
+ option("smartIndent", true);
+ option("tabSize", 4, function (cm) {
+ resetModeState(cm);
+ clearCaches(cm);
+ regChange(cm);
+ }, true);
+
+ option("lineSeparator", null, function (cm, val) {
+ cm.doc.lineSep = val;
+ if (!val) { return }
+ var newBreaks = [], lineNo = cm.doc.first;
+ cm.doc.iter(function (line) {
+ for (var pos = 0;;) {
+ var found = line.text.indexOf(val, pos);
+ if (found == -1) { break }
+ pos = found + val.length;
+ newBreaks.push(Pos(lineNo, found));
+ }
+ lineNo++;
+ });
+ for (var i = newBreaks.length - 1; i >= 0; i--)
+ { replaceRange(cm.doc, val, newBreaks[i], Pos(newBreaks[i].line, newBreaks[i].ch + val.length)); }
+ });
+ option("specialChars", /[\u0000-\u001f\u007f-\u009f\u00ad\u061c\u200b-\u200c\u200e\u200f\u2028\u2029\ufeff\ufff9-\ufffc]/g, function (cm, val, old) {
+ cm.state.specialChars = new RegExp(val.source + (val.test("\t") ? "" : "|\t"), "g");
+ if (old != Init) { cm.refresh(); }
+ });
+ option("specialCharPlaceholder", defaultSpecialCharPlaceholder, function (cm) { return cm.refresh(); }, true);
+ option("electricChars", true);
+ option("inputStyle", mobile ? "contenteditable" : "textarea", function () {
+ throw new Error("inputStyle can not (yet) be changed in a running editor") // FIXME
+ }, true);
+ option("spellcheck", false, function (cm, val) { return cm.getInputField().spellcheck = val; }, true);
+ option("autocorrect", false, function (cm, val) { return cm.getInputField().autocorrect = val; }, true);
+ option("autocapitalize", false, function (cm, val) { return cm.getInputField().autocapitalize = val; }, true);
+ option("rtlMoveVisually", !windows);
+ option("wholeLineUpdateBefore", true);
+
+ option("theme", "default", function (cm) {
+ themeChanged(cm);
+ updateGutters(cm);
+ }, true);
+ option("keyMap", "default", function (cm, val, old) {
+ var next = getKeyMap(val);
+ var prev = old != Init && getKeyMap(old);
+ if (prev && prev.detach) { prev.detach(cm, next); }
+ if (next.attach) { next.attach(cm, prev || null); }
+ });
+ option("extraKeys", null);
+ option("configureMouse", null);
+
+ option("lineWrapping", false, wrappingChanged, true);
+ option("gutters", [], function (cm, val) {
+ cm.display.gutterSpecs = getGutters(val, cm.options.lineNumbers);
+ updateGutters(cm);
+ }, true);
+ option("fixedGutter", true, function (cm, val) {
+ cm.display.gutters.style.left = val ? compensateForHScroll(cm.display) + "px" : "0";
+ cm.refresh();
+ }, true);
+ option("coverGutterNextToScrollbar", false, function (cm) { return updateScrollbars(cm); }, true);
+ option("scrollbarStyle", "native", function (cm) {
+ initScrollbars(cm);
+ updateScrollbars(cm);
+ cm.display.scrollbars.setScrollTop(cm.doc.scrollTop);
+ cm.display.scrollbars.setScrollLeft(cm.doc.scrollLeft);
+ }, true);
+ option("lineNumbers", false, function (cm, val) {
+ cm.display.gutterSpecs = getGutters(cm.options.gutters, val);
+ updateGutters(cm);
+ }, true);
+ option("firstLineNumber", 1, updateGutters, true);
+ option("lineNumberFormatter", function (integer) { return integer; }, updateGutters, true);
+ option("showCursorWhenSelecting", false, updateSelection, true);
+
+ option("resetSelectionOnContextMenu", true);
+ option("lineWiseCopyCut", true);
+ option("pasteLinesPerSelection", true);
+ option("selectionsMayTouch", false);
+
+ option("readOnly", false, function (cm, val) {
+ if (val == "nocursor") {
+ onBlur(cm);
+ cm.display.input.blur();
+ }
+ cm.display.input.readOnlyChanged(val);
+ });
+
+ option("screenReaderLabel", null, function (cm, val) {
+ val = (val === '') ? null : val;
+ cm.display.input.screenReaderLabelChanged(val);
+ });
+
+ option("disableInput", false, function (cm, val) {if (!val) { cm.display.input.reset(); }}, true);
+ option("dragDrop", true, dragDropChanged);
+ option("allowDropFileTypes", null);
+
+ option("cursorBlinkRate", 530);
+ option("cursorScrollMargin", 0);
+ option("cursorHeight", 1, updateSelection, true);
+ option("singleCursorHeightPerLine", true, updateSelection, true);
+ option("workTime", 100);
+ option("workDelay", 100);
+ option("flattenSpans", true, resetModeState, true);
+ option("addModeClass", false, resetModeState, true);
+ option("pollInterval", 100);
+ option("undoDepth", 200, function (cm, val) { return cm.doc.history.undoDepth = val; });
+ option("historyEventDelay", 1250);
+ option("viewportMargin", 10, function (cm) { return cm.refresh(); }, true);
+ option("maxHighlightLength", 10000, resetModeState, true);
+ option("moveInputWithCursor", true, function (cm, val) {
+ if (!val) { cm.display.input.resetPosition(); }
+ });
+
+ option("tabindex", null, function (cm, val) { return cm.display.input.getField().tabIndex = val || ""; });
+ option("autofocus", null);
+ option("direction", "ltr", function (cm, val) { return cm.doc.setDirection(val); }, true);
+ option("phrases", null);
+ }
+
+ function dragDropChanged(cm, value, old) {
+ var wasOn = old && old != Init;
+ if (!value != !wasOn) {
+ var funcs = cm.display.dragFunctions;
+ var toggle = value ? on : off;
+ toggle(cm.display.scroller, "dragstart", funcs.start);
+ toggle(cm.display.scroller, "dragenter", funcs.enter);
+ toggle(cm.display.scroller, "dragover", funcs.over);
+ toggle(cm.display.scroller, "dragleave", funcs.leave);
+ toggle(cm.display.scroller, "drop", funcs.drop);
+ }
+ }
+
+ function wrappingChanged(cm) {
+ if (cm.options.lineWrapping) {
+ addClass(cm.display.wrapper, "CodeMirror-wrap");
+ cm.display.sizer.style.minWidth = "";
+ cm.display.sizerWidth = null;
+ } else {
+ rmClass(cm.display.wrapper, "CodeMirror-wrap");
+ findMaxLine(cm);
+ }
+ estimateLineHeights(cm);
+ regChange(cm);
+ clearCaches(cm);
+ setTimeout(function () { return updateScrollbars(cm); }, 100);
+ }
+
+ // A CodeMirror instance represents an editor. This is the object
+ // that user code is usually dealing with.
+
+ function CodeMirror(place, options) {
+ var this$1 = this;
+
+ if (!(this instanceof CodeMirror)) { return new CodeMirror(place, options) }
+
+ this.options = options = options ? copyObj(options) : {};
+ // Determine effective options based on given values and defaults.
+ copyObj(defaults, options, false);
+
+ var doc = options.value;
+ if (typeof doc == "string") { doc = new Doc(doc, options.mode, null, options.lineSeparator, options.direction); }
+ else if (options.mode) { doc.modeOption = options.mode; }
+ this.doc = doc;
+
+ var input = new CodeMirror.inputStyles[options.inputStyle](this);
+ var display = this.display = new Display(place, doc, input, options);
+ display.wrapper.CodeMirror = this;
+ themeChanged(this);
+ if (options.lineWrapping)
+ { this.display.wrapper.className += " CodeMirror-wrap"; }
+ initScrollbars(this);
+
+ this.state = {
+ keyMaps: [], // stores maps added by addKeyMap
+ overlays: [], // highlighting overlays, as added by addOverlay
+ modeGen: 0, // bumped when mode/overlay changes, used to invalidate highlighting info
+ overwrite: false,
+ delayingBlurEvent: false,
+ focused: false,
+ suppressEdits: false, // used to disable editing during key handlers when in readOnly mode
+ pasteIncoming: -1, cutIncoming: -1, // help recognize paste/cut edits in input.poll
+ selectingText: false,
+ draggingText: false,
+ highlight: new Delayed(), // stores highlight worker timeout
+ keySeq: null, // Unfinished key sequence
+ specialChars: null
+ };
+
+ if (options.autofocus && !mobile) { display.input.focus(); }
+
+ // Override magic textarea content restore that IE sometimes does
+ // on our hidden textarea on reload
+ if (ie && ie_version < 11) { setTimeout(function () { return this$1.display.input.reset(true); }, 20); }
+
+ registerEventHandlers(this);
+ ensureGlobalHandlers();
+
+ startOperation(this);
+ this.curOp.forceUpdate = true;
+ attachDoc(this, doc);
+
+ if ((options.autofocus && !mobile) || this.hasFocus())
+ { setTimeout(bind(onFocus, this), 20); }
+ else
+ { onBlur(this); }
+
+ for (var opt in optionHandlers) { if (optionHandlers.hasOwnProperty(opt))
+ { optionHandlers[opt](this, options[opt], Init); } }
+ maybeUpdateLineNumberWidth(this);
+ if (options.finishInit) { options.finishInit(this); }
+ for (var i = 0; i < initHooks.length; ++i) { initHooks[i](this); }
+ endOperation(this);
+ // Suppress optimizelegibility in Webkit, since it breaks text
+ // measuring on line wrapping boundaries.
+ if (webkit && options.lineWrapping &&
+ getComputedStyle(display.lineDiv).textRendering == "optimizelegibility")
+ { display.lineDiv.style.textRendering = "auto"; }
+ }
+
+ // The default configuration options.
+ CodeMirror.defaults = defaults;
+ // Functions to run when options are changed.
+ CodeMirror.optionHandlers = optionHandlers;
+
+ // Attach the necessary event handlers when initializing the editor
+ function registerEventHandlers(cm) {
+ var d = cm.display;
+ on(d.scroller, "mousedown", operation(cm, onMouseDown));
+ // Older IE's will not fire a second mousedown for a double click
+ if (ie && ie_version < 11)
+ { on(d.scroller, "dblclick", operation(cm, function (e) {
+ if (signalDOMEvent(cm, e)) { return }
+ var pos = posFromMouse(cm, e);
+ if (!pos || clickInGutter(cm, e) || eventInWidget(cm.display, e)) { return }
+ e_preventDefault(e);
+ var word = cm.findWordAt(pos);
+ extendSelection(cm.doc, word.anchor, word.head);
+ })); }
+ else
+ { on(d.scroller, "dblclick", function (e) { return signalDOMEvent(cm, e) || e_preventDefault(e); }); }
+ // Some browsers fire contextmenu *after* opening the menu, at
+ // which point we can't mess with it anymore. Context menu is
+ // handled in onMouseDown for these browsers.
+ on(d.scroller, "contextmenu", function (e) { return onContextMenu(cm, e); });
+ on(d.input.getField(), "contextmenu", function (e) {
+ if (!d.scroller.contains(e.target)) { onContextMenu(cm, e); }
+ });
+
+ // Used to suppress mouse event handling when a touch happens
+ var touchFinished, prevTouch = {end: 0};
+ function finishTouch() {
+ if (d.activeTouch) {
+ touchFinished = setTimeout(function () { return d.activeTouch = null; }, 1000);
+ prevTouch = d.activeTouch;
+ prevTouch.end = +new Date;
+ }
+ }
+ function isMouseLikeTouchEvent(e) {
+ if (e.touches.length != 1) { return false }
+ var touch = e.touches[0];
+ return touch.radiusX <= 1 && touch.radiusY <= 1
+ }
+ function farAway(touch, other) {
+ if (other.left == null) { return true }
+ var dx = other.left - touch.left, dy = other.top - touch.top;
+ return dx * dx + dy * dy > 20 * 20
+ }
+ on(d.scroller, "touchstart", function (e) {
+ if (!signalDOMEvent(cm, e) && !isMouseLikeTouchEvent(e) && !clickInGutter(cm, e)) {
+ d.input.ensurePolled();
+ clearTimeout(touchFinished);
+ var now = +new Date;
+ d.activeTouch = {start: now, moved: false,
+ prev: now - prevTouch.end <= 300 ? prevTouch : null};
+ if (e.touches.length == 1) {
+ d.activeTouch.left = e.touches[0].pageX;
+ d.activeTouch.top = e.touches[0].pageY;
+ }
+ }
+ });
+ on(d.scroller, "touchmove", function () {
+ if (d.activeTouch) { d.activeTouch.moved = true; }
+ });
+ on(d.scroller, "touchend", function (e) {
+ var touch = d.activeTouch;
+ if (touch && !eventInWidget(d, e) && touch.left != null &&
+ !touch.moved && new Date - touch.start < 300) {
+ var pos = cm.coordsChar(d.activeTouch, "page"), range;
+ if (!touch.prev || farAway(touch, touch.prev)) // Single tap
+ { range = new Range(pos, pos); }
+ else if (!touch.prev.prev || farAway(touch, touch.prev.prev)) // Double tap
+ { range = cm.findWordAt(pos); }
+ else // Triple tap
+ { range = new Range(Pos(pos.line, 0), clipPos(cm.doc, Pos(pos.line + 1, 0))); }
+ cm.setSelection(range.anchor, range.head);
+ cm.focus();
+ e_preventDefault(e);
+ }
+ finishTouch();
+ });
+ on(d.scroller, "touchcancel", finishTouch);
+
+ // Sync scrolling between fake scrollbars and real scrollable
+ // area, ensure viewport is updated when scrolling.
+ on(d.scroller, "scroll", function () {
+ if (d.scroller.clientHeight) {
+ updateScrollTop(cm, d.scroller.scrollTop);
+ setScrollLeft(cm, d.scroller.scrollLeft, true);
+ signal(cm, "scroll", cm);
+ }
+ });
+
+ // Listen to wheel events in order to try and update the viewport on time.
+ on(d.scroller, "mousewheel", function (e) { return onScrollWheel(cm, e); });
+ on(d.scroller, "DOMMouseScroll", function (e) { return onScrollWheel(cm, e); });
+
+ // Prevent wrapper from ever scrolling
+ on(d.wrapper, "scroll", function () { return d.wrapper.scrollTop = d.wrapper.scrollLeft = 0; });
+
+ d.dragFunctions = {
+ enter: function (e) {if (!signalDOMEvent(cm, e)) { e_stop(e); }},
+ over: function (e) {if (!signalDOMEvent(cm, e)) { onDragOver(cm, e); e_stop(e); }},
+ start: function (e) { return onDragStart(cm, e); },
+ drop: operation(cm, onDrop),
+ leave: function (e) {if (!signalDOMEvent(cm, e)) { clearDragCursor(cm); }}
+ };
+
+ var inp = d.input.getField();
+ on(inp, "keyup", function (e) { return onKeyUp.call(cm, e); });
+ on(inp, "keydown", operation(cm, onKeyDown));
+ on(inp, "keypress", operation(cm, onKeyPress));
+ on(inp, "focus", function (e) { return onFocus(cm, e); });
+ on(inp, "blur", function (e) { return onBlur(cm, e); });
+ }
+
+ var initHooks = [];
+ CodeMirror.defineInitHook = function (f) { return initHooks.push(f); };
+
+ // Indent the given line. The how parameter can be "smart",
+ // "add"/null, "subtract", or "prev". When aggressive is false
+ // (typically set to true for forced single-line indents), empty
+ // lines are not indented, and places where the mode returns Pass
+ // are left alone.
+ function indentLine(cm, n, how, aggressive) {
+ var doc = cm.doc, state;
+ if (how == null) { how = "add"; }
+ if (how == "smart") {
+ // Fall back to "prev" when the mode doesn't have an indentation
+ // method.
+ if (!doc.mode.indent) { how = "prev"; }
+ else { state = getContextBefore(cm, n).state; }
+ }
+
+ var tabSize = cm.options.tabSize;
+ var line = getLine(doc, n), curSpace = countColumn(line.text, null, tabSize);
+ if (line.stateAfter) { line.stateAfter = null; }
+ var curSpaceString = line.text.match(/^\s*/)[0], indentation;
+ if (!aggressive && !/\S/.test(line.text)) {
+ indentation = 0;
+ how = "not";
+ } else if (how == "smart") {
+ indentation = doc.mode.indent(state, line.text.slice(curSpaceString.length), line.text);
+ if (indentation == Pass || indentation > 150) {
+ if (!aggressive) { return }
+ how = "prev";
+ }
+ }
+ if (how == "prev") {
+ if (n > doc.first) { indentation = countColumn(getLine(doc, n-1).text, null, tabSize); }
+ else { indentation = 0; }
+ } else if (how == "add") {
+ indentation = curSpace + cm.options.indentUnit;
+ } else if (how == "subtract") {
+ indentation = curSpace - cm.options.indentUnit;
+ } else if (typeof how == "number") {
+ indentation = curSpace + how;
+ }
+ indentation = Math.max(0, indentation);
+
+ var indentString = "", pos = 0;
+ if (cm.options.indentWithTabs)
+ { for (var i = Math.floor(indentation / tabSize); i; --i) {pos += tabSize; indentString += "\t";} }
+ if (pos < indentation) { indentString += spaceStr(indentation - pos); }
+
+ if (indentString != curSpaceString) {
+ replaceRange(doc, indentString, Pos(n, 0), Pos(n, curSpaceString.length), "+input");
+ line.stateAfter = null;
+ return true
+ } else {
+ // Ensure that, if the cursor was in the whitespace at the start
+ // of the line, it is moved to the end of that space.
+ for (var i$1 = 0; i$1 < doc.sel.ranges.length; i$1++) {
+ var range = doc.sel.ranges[i$1];
+ if (range.head.line == n && range.head.ch < curSpaceString.length) {
+ var pos$1 = Pos(n, curSpaceString.length);
+ replaceOneSelection(doc, i$1, new Range(pos$1, pos$1));
+ break
+ }
+ }
+ }
+ }
+
+ // This will be set to a {lineWise: bool, text: [string]} object, so
+ // that, when pasting, we know what kind of selections the copied
+ // text was made out of.
+ var lastCopied = null;
+
+ function setLastCopied(newLastCopied) {
+ lastCopied = newLastCopied;
+ }
+
+ function applyTextInput(cm, inserted, deleted, sel, origin) {
+ var doc = cm.doc;
+ cm.display.shift = false;
+ if (!sel) { sel = doc.sel; }
+
+ var recent = +new Date - 200;
+ var paste = origin == "paste" || cm.state.pasteIncoming > recent;
+ var textLines = splitLinesAuto(inserted), multiPaste = null;
+ // When pasting N lines into N selections, insert one line per selection
+ if (paste && sel.ranges.length > 1) {
+ if (lastCopied && lastCopied.text.join("\n") == inserted) {
+ if (sel.ranges.length % lastCopied.text.length == 0) {
+ multiPaste = [];
+ for (var i = 0; i < lastCopied.text.length; i++)
+ { multiPaste.push(doc.splitLines(lastCopied.text[i])); }
+ }
+ } else if (textLines.length == sel.ranges.length && cm.options.pasteLinesPerSelection) {
+ multiPaste = map(textLines, function (l) { return [l]; });
+ }
+ }
+
+ var updateInput = cm.curOp.updateInput;
+ // Normal behavior is to insert the new text into every selection
+ for (var i$1 = sel.ranges.length - 1; i$1 >= 0; i$1--) {
+ var range = sel.ranges[i$1];
+ var from = range.from(), to = range.to();
+ if (range.empty()) {
+ if (deleted && deleted > 0) // Handle deletion
+ { from = Pos(from.line, from.ch - deleted); }
+ else if (cm.state.overwrite && !paste) // Handle overwrite
+ { to = Pos(to.line, Math.min(getLine(doc, to.line).text.length, to.ch + lst(textLines).length)); }
+ else if (paste && lastCopied && lastCopied.lineWise && lastCopied.text.join("\n") == textLines.join("\n"))
+ { from = to = Pos(from.line, 0); }
+ }
+ var changeEvent = {from: from, to: to, text: multiPaste ? multiPaste[i$1 % multiPaste.length] : textLines,
+ origin: origin || (paste ? "paste" : cm.state.cutIncoming > recent ? "cut" : "+input")};
+ makeChange(cm.doc, changeEvent);
+ signalLater(cm, "inputRead", cm, changeEvent);
+ }
+ if (inserted && !paste)
+ { triggerElectric(cm, inserted); }
+
+ ensureCursorVisible(cm);
+ if (cm.curOp.updateInput < 2) { cm.curOp.updateInput = updateInput; }
+ cm.curOp.typing = true;
+ cm.state.pasteIncoming = cm.state.cutIncoming = -1;
+ }
+
+ function handlePaste(e, cm) {
+ var pasted = e.clipboardData && e.clipboardData.getData("Text");
+ if (pasted) {
+ e.preventDefault();
+ if (!cm.isReadOnly() && !cm.options.disableInput)
+ { runInOp(cm, function () { return applyTextInput(cm, pasted, 0, null, "paste"); }); }
+ return true
+ }
+ }
+
+ function triggerElectric(cm, inserted) {
+ // When an 'electric' character is inserted, immediately trigger a reindent
+ if (!cm.options.electricChars || !cm.options.smartIndent) { return }
+ var sel = cm.doc.sel;
+
+ for (var i = sel.ranges.length - 1; i >= 0; i--) {
+ var range = sel.ranges[i];
+ if (range.head.ch > 100 || (i && sel.ranges[i - 1].head.line == range.head.line)) { continue }
+ var mode = cm.getModeAt(range.head);
+ var indented = false;
+ if (mode.electricChars) {
+ for (var j = 0; j < mode.electricChars.length; j++)
+ { if (inserted.indexOf(mode.electricChars.charAt(j)) > -1) {
+ indented = indentLine(cm, range.head.line, "smart");
+ break
+ } }
+ } else if (mode.electricInput) {
+ if (mode.electricInput.test(getLine(cm.doc, range.head.line).text.slice(0, range.head.ch)))
+ { indented = indentLine(cm, range.head.line, "smart"); }
+ }
+ if (indented) { signalLater(cm, "electricInput", cm, range.head.line); }
+ }
+ }
+
+ function copyableRanges(cm) {
+ var text = [], ranges = [];
+ for (var i = 0; i < cm.doc.sel.ranges.length; i++) {
+ var line = cm.doc.sel.ranges[i].head.line;
+ var lineRange = {anchor: Pos(line, 0), head: Pos(line + 1, 0)};
+ ranges.push(lineRange);
+ text.push(cm.getRange(lineRange.anchor, lineRange.head));
+ }
+ return {text: text, ranges: ranges}
+ }
+
+ function disableBrowserMagic(field, spellcheck, autocorrect, autocapitalize) {
+ field.setAttribute("autocorrect", autocorrect ? "" : "off");
+ field.setAttribute("autocapitalize", autocapitalize ? "" : "off");
+ field.setAttribute("spellcheck", !!spellcheck);
+ }
+
+ function hiddenTextarea() {
+ var te = elt("textarea", null, null, "position: absolute; bottom: -1em; padding: 0; width: 1px; height: 1em; outline: none");
+ var div = elt("div", [te], null, "overflow: hidden; position: relative; width: 3px; height: 0px;");
+ // The textarea is kept positioned near the cursor to prevent the
+ // fact that it'll be scrolled into view on input from scrolling
+ // our fake cursor out of view. On webkit, when wrap=off, paste is
+ // very slow. So make the area wide instead.
+ if (webkit) { te.style.width = "1000px"; }
+ else { te.setAttribute("wrap", "off"); }
+ // If border: 0; -- iOS fails to open keyboard (issue #1287)
+ if (ios) { te.style.border = "1px solid black"; }
+ disableBrowserMagic(te);
+ return div
+ }
+
+ // The publicly visible API. Note that methodOp(f) means
+ // 'wrap f in an operation, performed on its `this` parameter'.
+
+ // This is not the complete set of editor methods. Most of the
+ // methods defined on the Doc type are also injected into
+ // CodeMirror.prototype, for backwards compatibility and
+ // convenience.
+
+ function addEditorMethods(CodeMirror) {
+ var optionHandlers = CodeMirror.optionHandlers;
+
+ var helpers = CodeMirror.helpers = {};
+
+ CodeMirror.prototype = {
+ constructor: CodeMirror,
+ focus: function(){window.focus(); this.display.input.focus();},
+
+ setOption: function(option, value) {
+ var options = this.options, old = options[option];
+ if (options[option] == value && option != "mode") { return }
+ options[option] = value;
+ if (optionHandlers.hasOwnProperty(option))
+ { operation(this, optionHandlers[option])(this, value, old); }
+ signal(this, "optionChange", this, option);
+ },
+
+ getOption: function(option) {return this.options[option]},
+ getDoc: function() {return this.doc},
+
+ addKeyMap: function(map, bottom) {
+ this.state.keyMaps[bottom ? "push" : "unshift"](getKeyMap(map));
+ },
+ removeKeyMap: function(map) {
+ var maps = this.state.keyMaps;
+ for (var i = 0; i < maps.length; ++i)
+ { if (maps[i] == map || maps[i].name == map) {
+ maps.splice(i, 1);
+ return true
+ } }
+ },
+
+ addOverlay: methodOp(function(spec, options) {
+ var mode = spec.token ? spec : CodeMirror.getMode(this.options, spec);
+ if (mode.startState) { throw new Error("Overlays may not be stateful.") }
+ insertSorted(this.state.overlays,
+ {mode: mode, modeSpec: spec, opaque: options && options.opaque,
+ priority: (options && options.priority) || 0},
+ function (overlay) { return overlay.priority; });
+ this.state.modeGen++;
+ regChange(this);
+ }),
+ removeOverlay: methodOp(function(spec) {
+ var overlays = this.state.overlays;
+ for (var i = 0; i < overlays.length; ++i) {
+ var cur = overlays[i].modeSpec;
+ if (cur == spec || typeof spec == "string" && cur.name == spec) {
+ overlays.splice(i, 1);
+ this.state.modeGen++;
+ regChange(this);
+ return
+ }
+ }
+ }),
+
+ indentLine: methodOp(function(n, dir, aggressive) {
+ if (typeof dir != "string" && typeof dir != "number") {
+ if (dir == null) { dir = this.options.smartIndent ? "smart" : "prev"; }
+ else { dir = dir ? "add" : "subtract"; }
+ }
+ if (isLine(this.doc, n)) { indentLine(this, n, dir, aggressive); }
+ }),
+ indentSelection: methodOp(function(how) {
+ var ranges = this.doc.sel.ranges, end = -1;
+ for (var i = 0; i < ranges.length; i++) {
+ var range = ranges[i];
+ if (!range.empty()) {
+ var from = range.from(), to = range.to();
+ var start = Math.max(end, from.line);
+ end = Math.min(this.lastLine(), to.line - (to.ch ? 0 : 1)) + 1;
+ for (var j = start; j < end; ++j)
+ { indentLine(this, j, how); }
+ var newRanges = this.doc.sel.ranges;
+ if (from.ch == 0 && ranges.length == newRanges.length && newRanges[i].from().ch > 0)
+ { replaceOneSelection(this.doc, i, new Range(from, newRanges[i].to()), sel_dontScroll); }
+ } else if (range.head.line > end) {
+ indentLine(this, range.head.line, how, true);
+ end = range.head.line;
+ if (i == this.doc.sel.primIndex) { ensureCursorVisible(this); }
+ }
+ }
+ }),
+
+ // Fetch the parser token for a given character. Useful for hacks
+ // that want to inspect the mode state (say, for completion).
+ getTokenAt: function(pos, precise) {
+ return takeToken(this, pos, precise)
+ },
+
+ getLineTokens: function(line, precise) {
+ return takeToken(this, Pos(line), precise, true)
+ },
+
+ getTokenTypeAt: function(pos) {
+ pos = clipPos(this.doc, pos);
+ var styles = getLineStyles(this, getLine(this.doc, pos.line));
+ var before = 0, after = (styles.length - 1) / 2, ch = pos.ch;
+ var type;
+ if (ch == 0) { type = styles[2]; }
+ else { for (;;) {
+ var mid = (before + after) >> 1;
+ if ((mid ? styles[mid * 2 - 1] : 0) >= ch) { after = mid; }
+ else if (styles[mid * 2 + 1] < ch) { before = mid + 1; }
+ else { type = styles[mid * 2 + 2]; break }
+ } }
+ var cut = type ? type.indexOf("overlay ") : -1;
+ return cut < 0 ? type : cut == 0 ? null : type.slice(0, cut - 1)
+ },
+
+ getModeAt: function(pos) {
+ var mode = this.doc.mode;
+ if (!mode.innerMode) { return mode }
+ return CodeMirror.innerMode(mode, this.getTokenAt(pos).state).mode
+ },
+
+ getHelper: function(pos, type) {
+ return this.getHelpers(pos, type)[0]
+ },
+
+ getHelpers: function(pos, type) {
+ var found = [];
+ if (!helpers.hasOwnProperty(type)) { return found }
+ var help = helpers[type], mode = this.getModeAt(pos);
+ if (typeof mode[type] == "string") {
+ if (help[mode[type]]) { found.push(help[mode[type]]); }
+ } else if (mode[type]) {
+ for (var i = 0; i < mode[type].length; i++) {
+ var val = help[mode[type][i]];
+ if (val) { found.push(val); }
+ }
+ } else if (mode.helperType && help[mode.helperType]) {
+ found.push(help[mode.helperType]);
+ } else if (help[mode.name]) {
+ found.push(help[mode.name]);
+ }
+ for (var i$1 = 0; i$1 < help._global.length; i$1++) {
+ var cur = help._global[i$1];
+ if (cur.pred(mode, this) && indexOf(found, cur.val) == -1)
+ { found.push(cur.val); }
+ }
+ return found
+ },
+
+ getStateAfter: function(line, precise) {
+ var doc = this.doc;
+ line = clipLine(doc, line == null ? doc.first + doc.size - 1: line);
+ return getContextBefore(this, line + 1, precise).state
+ },
+
+ cursorCoords: function(start, mode) {
+ var pos, range = this.doc.sel.primary();
+ if (start == null) { pos = range.head; }
+ else if (typeof start == "object") { pos = clipPos(this.doc, start); }
+ else { pos = start ? range.from() : range.to(); }
+ return cursorCoords(this, pos, mode || "page")
+ },
+
+ charCoords: function(pos, mode) {
+ return charCoords(this, clipPos(this.doc, pos), mode || "page")
+ },
+
+ coordsChar: function(coords, mode) {
+ coords = fromCoordSystem(this, coords, mode || "page");
+ return coordsChar(this, coords.left, coords.top)
+ },
+
+ lineAtHeight: function(height, mode) {
+ height = fromCoordSystem(this, {top: height, left: 0}, mode || "page").top;
+ return lineAtHeight(this.doc, height + this.display.viewOffset)
+ },
+ heightAtLine: function(line, mode, includeWidgets) {
+ var end = false, lineObj;
+ if (typeof line == "number") {
+ var last = this.doc.first + this.doc.size - 1;
+ if (line < this.doc.first) { line = this.doc.first; }
+ else if (line > last) { line = last; end = true; }
+ lineObj = getLine(this.doc, line);
+ } else {
+ lineObj = line;
+ }
+ return intoCoordSystem(this, lineObj, {top: 0, left: 0}, mode || "page", includeWidgets || end).top +
+ (end ? this.doc.height - heightAtLine(lineObj) : 0)
+ },
+
+ defaultTextHeight: function() { return textHeight(this.display) },
+ defaultCharWidth: function() { return charWidth(this.display) },
+
+ getViewport: function() { return {from: this.display.viewFrom, to: this.display.viewTo}},
+
+ addWidget: function(pos, node, scroll, vert, horiz) {
+ var display = this.display;
+ pos = cursorCoords(this, clipPos(this.doc, pos));
+ var top = pos.bottom, left = pos.left;
+ node.style.position = "absolute";
+ node.setAttribute("cm-ignore-events", "true");
+ this.display.input.setUneditable(node);
+ display.sizer.appendChild(node);
+ if (vert == "over") {
+ top = pos.top;
+ } else if (vert == "above" || vert == "near") {
+ var vspace = Math.max(display.wrapper.clientHeight, this.doc.height),
+ hspace = Math.max(display.sizer.clientWidth, display.lineSpace.clientWidth);
+ // Default to positioning above (if specified and possible); otherwise default to positioning below
+ if ((vert == 'above' || pos.bottom + node.offsetHeight > vspace) && pos.top > node.offsetHeight)
+ { top = pos.top - node.offsetHeight; }
+ else if (pos.bottom + node.offsetHeight <= vspace)
+ { top = pos.bottom; }
+ if (left + node.offsetWidth > hspace)
+ { left = hspace - node.offsetWidth; }
+ }
+ node.style.top = top + "px";
+ node.style.left = node.style.right = "";
+ if (horiz == "right") {
+ left = display.sizer.clientWidth - node.offsetWidth;
+ node.style.right = "0px";
+ } else {
+ if (horiz == "left") { left = 0; }
+ else if (horiz == "middle") { left = (display.sizer.clientWidth - node.offsetWidth) / 2; }
+ node.style.left = left + "px";
+ }
+ if (scroll)
+ { scrollIntoView(this, {left: left, top: top, right: left + node.offsetWidth, bottom: top + node.offsetHeight}); }
+ },
+
+ triggerOnKeyDown: methodOp(onKeyDown),
+ triggerOnKeyPress: methodOp(onKeyPress),
+ triggerOnKeyUp: onKeyUp,
+ triggerOnMouseDown: methodOp(onMouseDown),
+
+ execCommand: function(cmd) {
+ if (commands.hasOwnProperty(cmd))
+ { return commands[cmd].call(null, this) }
+ },
+
+ triggerElectric: methodOp(function(text) { triggerElectric(this, text); }),
+
+ findPosH: function(from, amount, unit, visually) {
+ var dir = 1;
+ if (amount < 0) { dir = -1; amount = -amount; }
+ var cur = clipPos(this.doc, from);
+ for (var i = 0; i < amount; ++i) {
+ cur = findPosH(this.doc, cur, dir, unit, visually);
+ if (cur.hitSide) { break }
+ }
+ return cur
+ },
+
+ moveH: methodOp(function(dir, unit) {
+ var this$1 = this;
+
+ this.extendSelectionsBy(function (range) {
+ if (this$1.display.shift || this$1.doc.extend || range.empty())
+ { return findPosH(this$1.doc, range.head, dir, unit, this$1.options.rtlMoveVisually) }
+ else
+ { return dir < 0 ? range.from() : range.to() }
+ }, sel_move);
+ }),
+
+ deleteH: methodOp(function(dir, unit) {
+ var sel = this.doc.sel, doc = this.doc;
+ if (sel.somethingSelected())
+ { doc.replaceSelection("", null, "+delete"); }
+ else
+ { deleteNearSelection(this, function (range) {
+ var other = findPosH(doc, range.head, dir, unit, false);
+ return dir < 0 ? {from: other, to: range.head} : {from: range.head, to: other}
+ }); }
+ }),
+
+ findPosV: function(from, amount, unit, goalColumn) {
+ var dir = 1, x = goalColumn;
+ if (amount < 0) { dir = -1; amount = -amount; }
+ var cur = clipPos(this.doc, from);
+ for (var i = 0; i < amount; ++i) {
+ var coords = cursorCoords(this, cur, "div");
+ if (x == null) { x = coords.left; }
+ else { coords.left = x; }
+ cur = findPosV(this, coords, dir, unit);
+ if (cur.hitSide) { break }
+ }
+ return cur
+ },
+
+ moveV: methodOp(function(dir, unit) {
+ var this$1 = this;
+
+ var doc = this.doc, goals = [];
+ var collapse = !this.display.shift && !doc.extend && doc.sel.somethingSelected();
+ doc.extendSelectionsBy(function (range) {
+ if (collapse)
+ { return dir < 0 ? range.from() : range.to() }
+ var headPos = cursorCoords(this$1, range.head, "div");
+ if (range.goalColumn != null) { headPos.left = range.goalColumn; }
+ goals.push(headPos.left);
+ var pos = findPosV(this$1, headPos, dir, unit);
+ if (unit == "page" && range == doc.sel.primary())
+ { addToScrollTop(this$1, charCoords(this$1, pos, "div").top - headPos.top); }
+ return pos
+ }, sel_move);
+ if (goals.length) { for (var i = 0; i < doc.sel.ranges.length; i++)
+ { doc.sel.ranges[i].goalColumn = goals[i]; } }
+ }),
+
+ // Find the word at the given position (as returned by coordsChar).
+ findWordAt: function(pos) {
+ var doc = this.doc, line = getLine(doc, pos.line).text;
+ var start = pos.ch, end = pos.ch;
+ if (line) {
+ var helper = this.getHelper(pos, "wordChars");
+ if ((pos.sticky == "before" || end == line.length) && start) { --start; } else { ++end; }
+ var startChar = line.charAt(start);
+ var check = isWordChar(startChar, helper)
+ ? function (ch) { return isWordChar(ch, helper); }
+ : /\s/.test(startChar) ? function (ch) { return /\s/.test(ch); }
+ : function (ch) { return (!/\s/.test(ch) && !isWordChar(ch)); };
+ while (start > 0 && check(line.charAt(start - 1))) { --start; }
+ while (end < line.length && check(line.charAt(end))) { ++end; }
+ }
+ return new Range(Pos(pos.line, start), Pos(pos.line, end))
+ },
+
+ toggleOverwrite: function(value) {
+ if (value != null && value == this.state.overwrite) { return }
+ if (this.state.overwrite = !this.state.overwrite)
+ { addClass(this.display.cursorDiv, "CodeMirror-overwrite"); }
+ else
+ { rmClass(this.display.cursorDiv, "CodeMirror-overwrite"); }
+
+ signal(this, "overwriteToggle", this, this.state.overwrite);
+ },
+ hasFocus: function() { return this.display.input.getField() == activeElt() },
+ isReadOnly: function() { return !!(this.options.readOnly || this.doc.cantEdit) },
+
+ scrollTo: methodOp(function (x, y) { scrollToCoords(this, x, y); }),
+ getScrollInfo: function() {
+ var scroller = this.display.scroller;
+ return {left: scroller.scrollLeft, top: scroller.scrollTop,
+ height: scroller.scrollHeight - scrollGap(this) - this.display.barHeight,
+ width: scroller.scrollWidth - scrollGap(this) - this.display.barWidth,
+ clientHeight: displayHeight(this), clientWidth: displayWidth(this)}
+ },
+
+ scrollIntoView: methodOp(function(range, margin) {
+ if (range == null) {
+ range = {from: this.doc.sel.primary().head, to: null};
+ if (margin == null) { margin = this.options.cursorScrollMargin; }
+ } else if (typeof range == "number") {
+ range = {from: Pos(range, 0), to: null};
+ } else if (range.from == null) {
+ range = {from: range, to: null};
+ }
+ if (!range.to) { range.to = range.from; }
+ range.margin = margin || 0;
+
+ if (range.from.line != null) {
+ scrollToRange(this, range);
+ } else {
+ scrollToCoordsRange(this, range.from, range.to, range.margin);
+ }
+ }),
+
+ setSize: methodOp(function(width, height) {
+ var this$1 = this;
+
+ var interpret = function (val) { return typeof val == "number" || /^\d+$/.test(String(val)) ? val + "px" : val; };
+ if (width != null) { this.display.wrapper.style.width = interpret(width); }
+ if (height != null) { this.display.wrapper.style.height = interpret(height); }
+ if (this.options.lineWrapping) { clearLineMeasurementCache(this); }
+ var lineNo = this.display.viewFrom;
+ this.doc.iter(lineNo, this.display.viewTo, function (line) {
+ if (line.widgets) { for (var i = 0; i < line.widgets.length; i++)
+ { if (line.widgets[i].noHScroll) { regLineChange(this$1, lineNo, "widget"); break } } }
+ ++lineNo;
+ });
+ this.curOp.forceUpdate = true;
+ signal(this, "refresh", this);
+ }),
+
+ operation: function(f){return runInOp(this, f)},
+ startOperation: function(){return startOperation(this)},
+ endOperation: function(){return endOperation(this)},
+
+ refresh: methodOp(function() {
+ var oldHeight = this.display.cachedTextHeight;
+ regChange(this);
+ this.curOp.forceUpdate = true;
+ clearCaches(this);
+ scrollToCoords(this, this.doc.scrollLeft, this.doc.scrollTop);
+ updateGutterSpace(this.display);
+ if (oldHeight == null || Math.abs(oldHeight - textHeight(this.display)) > .5 || this.options.lineWrapping)
+ { estimateLineHeights(this); }
+ signal(this, "refresh", this);
+ }),
+
+ swapDoc: methodOp(function(doc) {
+ var old = this.doc;
+ old.cm = null;
+ // Cancel the current text selection if any (#5821)
+ if (this.state.selectingText) { this.state.selectingText(); }
+ attachDoc(this, doc);
+ clearCaches(this);
+ this.display.input.reset();
+ scrollToCoords(this, doc.scrollLeft, doc.scrollTop);
+ this.curOp.forceScroll = true;
+ signalLater(this, "swapDoc", this, old);
+ return old
+ }),
+
+ phrase: function(phraseText) {
+ var phrases = this.options.phrases;
+ return phrases && Object.prototype.hasOwnProperty.call(phrases, phraseText) ? phrases[phraseText] : phraseText
+ },
+
+ getInputField: function(){return this.display.input.getField()},
+ getWrapperElement: function(){return this.display.wrapper},
+ getScrollerElement: function(){return this.display.scroller},
+ getGutterElement: function(){return this.display.gutters}
+ };
+ eventMixin(CodeMirror);
+
+ CodeMirror.registerHelper = function(type, name, value) {
+ if (!helpers.hasOwnProperty(type)) { helpers[type] = CodeMirror[type] = {_global: []}; }
+ helpers[type][name] = value;
+ };
+ CodeMirror.registerGlobalHelper = function(type, name, predicate, value) {
+ CodeMirror.registerHelper(type, name, value);
+ helpers[type]._global.push({pred: predicate, val: value});
+ };
+ }
+
+ // Used for horizontal relative motion. Dir is -1 or 1 (left or
+ // right), unit can be "char", "column" (like char, but doesn't
+ // cross line boundaries), "word" (across next word), or "group" (to
+ // the start of next group of word or non-word-non-whitespace
+ // chars). The visually param controls whether, in right-to-left
+ // text, direction 1 means to move towards the next index in the
+ // string, or towards the character to the right of the current
+ // position. The resulting position will have a hitSide=true
+ // property if it reached the end of the document.
+ function findPosH(doc, pos, dir, unit, visually) {
+ var oldPos = pos;
+ var origDir = dir;
+ var lineObj = getLine(doc, pos.line);
+ var lineDir = visually && doc.direction == "rtl" ? -dir : dir;
+ function findNextLine() {
+ var l = pos.line + lineDir;
+ if (l < doc.first || l >= doc.first + doc.size) { return false }
+ pos = new Pos(l, pos.ch, pos.sticky);
+ return lineObj = getLine(doc, l)
+ }
+ function moveOnce(boundToLine) {
+ var next;
+ if (visually) {
+ next = moveVisually(doc.cm, lineObj, pos, dir);
+ } else {
+ next = moveLogically(lineObj, pos, dir);
+ }
+ if (next == null) {
+ if (!boundToLine && findNextLine())
+ { pos = endOfLine(visually, doc.cm, lineObj, pos.line, lineDir); }
+ else
+ { return false }
+ } else {
+ pos = next;
+ }
+ return true
+ }
+
+ if (unit == "char") {
+ moveOnce();
+ } else if (unit == "column") {
+ moveOnce(true);
+ } else if (unit == "word" || unit == "group") {
+ var sawType = null, group = unit == "group";
+ var helper = doc.cm && doc.cm.getHelper(pos, "wordChars");
+ for (var first = true;; first = false) {
+ if (dir < 0 && !moveOnce(!first)) { break }
+ var cur = lineObj.text.charAt(pos.ch) || "\n";
+ var type = isWordChar(cur, helper) ? "w"
+ : group && cur == "\n" ? "n"
+ : !group || /\s/.test(cur) ? null
+ : "p";
+ if (group && !first && !type) { type = "s"; }
+ if (sawType && sawType != type) {
+ if (dir < 0) {dir = 1; moveOnce(); pos.sticky = "after";}
+ break
+ }
+
+ if (type) { sawType = type; }
+ if (dir > 0 && !moveOnce(!first)) { break }
+ }
+ }
+ var result = skipAtomic(doc, pos, oldPos, origDir, true);
+ if (equalCursorPos(oldPos, result)) { result.hitSide = true; }
+ return result
+ }
+
+ // For relative vertical movement. Dir may be -1 or 1. Unit can be
+ // "page" or "line". The resulting position will have a hitSide=true
+ // property if it reached the end of the document.
+ function findPosV(cm, pos, dir, unit) {
+ var doc = cm.doc, x = pos.left, y;
+ if (unit == "page") {
+ var pageSize = Math.min(cm.display.wrapper.clientHeight, window.innerHeight || document.documentElement.clientHeight);
+ var moveAmount = Math.max(pageSize - .5 * textHeight(cm.display), 3);
+ y = (dir > 0 ? pos.bottom : pos.top) + dir * moveAmount;
+
+ } else if (unit == "line") {
+ y = dir > 0 ? pos.bottom + 3 : pos.top - 3;
+ }
+ var target;
+ for (;;) {
+ target = coordsChar(cm, x, y);
+ if (!target.outside) { break }
+ if (dir < 0 ? y <= 0 : y >= doc.height) { target.hitSide = true; break }
+ y += dir * 5;
+ }
+ return target
+ }
+
+ // CONTENTEDITABLE INPUT STYLE
+
+ var ContentEditableInput = function(cm) {
+ this.cm = cm;
+ this.lastAnchorNode = this.lastAnchorOffset = this.lastFocusNode = this.lastFocusOffset = null;
+ this.polling = new Delayed();
+ this.composing = null;
+ this.gracePeriod = false;
+ this.readDOMTimeout = null;
+ };
+
+ ContentEditableInput.prototype.init = function (display) {
+ var this$1 = this;
+
+ var input = this, cm = input.cm;
+ var div = input.div = display.lineDiv;
+ disableBrowserMagic(div, cm.options.spellcheck, cm.options.autocorrect, cm.options.autocapitalize);
+
+ function belongsToInput(e) {
+ for (var t = e.target; t; t = t.parentNode) {
+ if (t == div) { return true }
+ if (/\bCodeMirror-(?:line)?widget\b/.test(t.className)) { break }
+ }
+ return false
+ }
+
+ on(div, "paste", function (e) {
+ if (!belongsToInput(e) || signalDOMEvent(cm, e) || handlePaste(e, cm)) { return }
+ // IE doesn't fire input events, so we schedule a read for the pasted content in this way
+ if (ie_version <= 11) { setTimeout(operation(cm, function () { return this$1.updateFromDOM(); }), 20); }
+ });
+
+ on(div, "compositionstart", function (e) {
+ this$1.composing = {data: e.data, done: false};
+ });
+ on(div, "compositionupdate", function (e) {
+ if (!this$1.composing) { this$1.composing = {data: e.data, done: false}; }
+ });
+ on(div, "compositionend", function (e) {
+ if (this$1.composing) {
+ if (e.data != this$1.composing.data) { this$1.readFromDOMSoon(); }
+ this$1.composing.done = true;
+ }
+ });
+
+ on(div, "touchstart", function () { return input.forceCompositionEnd(); });
+
+ on(div, "input", function () {
+ if (!this$1.composing) { this$1.readFromDOMSoon(); }
+ });
+
+ function onCopyCut(e) {
+ if (!belongsToInput(e) || signalDOMEvent(cm, e)) { return }
+ if (cm.somethingSelected()) {
+ setLastCopied({lineWise: false, text: cm.getSelections()});
+ if (e.type == "cut") { cm.replaceSelection("", null, "cut"); }
+ } else if (!cm.options.lineWiseCopyCut) {
+ return
+ } else {
+ var ranges = copyableRanges(cm);
+ setLastCopied({lineWise: true, text: ranges.text});
+ if (e.type == "cut") {
+ cm.operation(function () {
+ cm.setSelections(ranges.ranges, 0, sel_dontScroll);
+ cm.replaceSelection("", null, "cut");
+ });
+ }
+ }
+ if (e.clipboardData) {
+ e.clipboardData.clearData();
+ var content = lastCopied.text.join("\n");
+ // iOS exposes the clipboard API, but seems to discard content inserted into it
+ e.clipboardData.setData("Text", content);
+ if (e.clipboardData.getData("Text") == content) {
+ e.preventDefault();
+ return
+ }
+ }
+ // Old-fashioned briefly-focus-a-textarea hack
+ var kludge = hiddenTextarea(), te = kludge.firstChild;
+ cm.display.lineSpace.insertBefore(kludge, cm.display.lineSpace.firstChild);
+ te.value = lastCopied.text.join("\n");
+ var hadFocus = document.activeElement;
+ selectInput(te);
+ setTimeout(function () {
+ cm.display.lineSpace.removeChild(kludge);
+ hadFocus.focus();
+ if (hadFocus == div) { input.showPrimarySelection(); }
+ }, 50);
+ }
+ on(div, "copy", onCopyCut);
+ on(div, "cut", onCopyCut);
+ };
+
+ ContentEditableInput.prototype.screenReaderLabelChanged = function (label) {
+ // Label for screenreaders, accessibility
+ if(label) {
+ this.div.setAttribute('aria-label', label);
+ } else {
+ this.div.removeAttribute('aria-label');
+ }
+ };
+
+ ContentEditableInput.prototype.prepareSelection = function () {
+ var result = prepareSelection(this.cm, false);
+ result.focus = document.activeElement == this.div;
+ return result
+ };
+
+ ContentEditableInput.prototype.showSelection = function (info, takeFocus) {
+ if (!info || !this.cm.display.view.length) { return }
+ if (info.focus || takeFocus) { this.showPrimarySelection(); }
+ this.showMultipleSelections(info);
+ };
+
+ ContentEditableInput.prototype.getSelection = function () {
+ return this.cm.display.wrapper.ownerDocument.getSelection()
+ };
+
+ ContentEditableInput.prototype.showPrimarySelection = function () {
+ var sel = this.getSelection(), cm = this.cm, prim = cm.doc.sel.primary();
+ var from = prim.from(), to = prim.to();
+
+ if (cm.display.viewTo == cm.display.viewFrom || from.line >= cm.display.viewTo || to.line < cm.display.viewFrom) {
+ sel.removeAllRanges();
+ return
+ }
+
+ var curAnchor = domToPos(cm, sel.anchorNode, sel.anchorOffset);
+ var curFocus = domToPos(cm, sel.focusNode, sel.focusOffset);
+ if (curAnchor && !curAnchor.bad && curFocus && !curFocus.bad &&
+ cmp(minPos(curAnchor, curFocus), from) == 0 &&
+ cmp(maxPos(curAnchor, curFocus), to) == 0)
+ { return }
+
+ var view = cm.display.view;
+ var start = (from.line >= cm.display.viewFrom && posToDOM(cm, from)) ||
+ {node: view[0].measure.map[2], offset: 0};
+ var end = to.line < cm.display.viewTo && posToDOM(cm, to);
+ if (!end) {
+ var measure = view[view.length - 1].measure;
+ var map = measure.maps ? measure.maps[measure.maps.length - 1] : measure.map;
+ end = {node: map[map.length - 1], offset: map[map.length - 2] - map[map.length - 3]};
+ }
+
+ if (!start || !end) {
+ sel.removeAllRanges();
+ return
+ }
+
+ var old = sel.rangeCount && sel.getRangeAt(0), rng;
+ try { rng = range(start.node, start.offset, end.offset, end.node); }
+ catch(e) {} // Our model of the DOM might be outdated, in which case the range we try to set can be impossible
+ if (rng) {
+ if (!gecko && cm.state.focused) {
+ sel.collapse(start.node, start.offset);
+ if (!rng.collapsed) {
+ sel.removeAllRanges();
+ sel.addRange(rng);
+ }
+ } else {
+ sel.removeAllRanges();
+ sel.addRange(rng);
+ }
+ if (old && sel.anchorNode == null) { sel.addRange(old); }
+ else if (gecko) { this.startGracePeriod(); }
+ }
+ this.rememberSelection();
+ };
+
+ ContentEditableInput.prototype.startGracePeriod = function () {
+ var this$1 = this;
+
+ clearTimeout(this.gracePeriod);
+ this.gracePeriod = setTimeout(function () {
+ this$1.gracePeriod = false;
+ if (this$1.selectionChanged())
+ { this$1.cm.operation(function () { return this$1.cm.curOp.selectionChanged = true; }); }
+ }, 20);
+ };
+
+ ContentEditableInput.prototype.showMultipleSelections = function (info) {
+ removeChildrenAndAdd(this.cm.display.cursorDiv, info.cursors);
+ removeChildrenAndAdd(this.cm.display.selectionDiv, info.selection);
+ };
+
+ ContentEditableInput.prototype.rememberSelection = function () {
+ var sel = this.getSelection();
+ this.lastAnchorNode = sel.anchorNode; this.lastAnchorOffset = sel.anchorOffset;
+ this.lastFocusNode = sel.focusNode; this.lastFocusOffset = sel.focusOffset;
+ };
+
+ ContentEditableInput.prototype.selectionInEditor = function () {
+ var sel = this.getSelection();
+ if (!sel.rangeCount) { return false }
+ var node = sel.getRangeAt(0).commonAncestorContainer;
+ return contains(this.div, node)
+ };
+
+ ContentEditableInput.prototype.focus = function () {
+ if (this.cm.options.readOnly != "nocursor") {
+ if (!this.selectionInEditor() || document.activeElement != this.div)
+ { this.showSelection(this.prepareSelection(), true); }
+ this.div.focus();
+ }
+ };
+ ContentEditableInput.prototype.blur = function () { this.div.blur(); };
+ ContentEditableInput.prototype.getField = function () { return this.div };
+
+ ContentEditableInput.prototype.supportsTouch = function () { return true };
+
+ ContentEditableInput.prototype.receivedFocus = function () {
+ var input = this;
+ if (this.selectionInEditor())
+ { this.pollSelection(); }
+ else
+ { runInOp(this.cm, function () { return input.cm.curOp.selectionChanged = true; }); }
+
+ function poll() {
+ if (input.cm.state.focused) {
+ input.pollSelection();
+ input.polling.set(input.cm.options.pollInterval, poll);
+ }
+ }
+ this.polling.set(this.cm.options.pollInterval, poll);
+ };
+
+ ContentEditableInput.prototype.selectionChanged = function () {
+ var sel = this.getSelection();
+ return sel.anchorNode != this.lastAnchorNode || sel.anchorOffset != this.lastAnchorOffset ||
+ sel.focusNode != this.lastFocusNode || sel.focusOffset != this.lastFocusOffset
+ };
+
+ ContentEditableInput.prototype.pollSelection = function () {
+ if (this.readDOMTimeout != null || this.gracePeriod || !this.selectionChanged()) { return }
+ var sel = this.getSelection(), cm = this.cm;
+ // On Android Chrome (version 56, at least), backspacing into an
+ // uneditable block element will put the cursor in that element,
+ // and then, because it's not editable, hide the virtual keyboard.
+ // Because Android doesn't allow us to actually detect backspace
+ // presses in a sane way, this code checks for when that happens
+ // and simulates a backspace press in this case.
+ if (android && chrome && this.cm.display.gutterSpecs.length && isInGutter(sel.anchorNode)) {
+ this.cm.triggerOnKeyDown({type: "keydown", keyCode: 8, preventDefault: Math.abs});
+ this.blur();
+ this.focus();
+ return
+ }
+ if (this.composing) { return }
+ this.rememberSelection();
+ var anchor = domToPos(cm, sel.anchorNode, sel.anchorOffset);
+ var head = domToPos(cm, sel.focusNode, sel.focusOffset);
+ if (anchor && head) { runInOp(cm, function () {
+ setSelection(cm.doc, simpleSelection(anchor, head), sel_dontScroll);
+ if (anchor.bad || head.bad) { cm.curOp.selectionChanged = true; }
+ }); }
+ };
+
+ ContentEditableInput.prototype.pollContent = function () {
+ if (this.readDOMTimeout != null) {
+ clearTimeout(this.readDOMTimeout);
+ this.readDOMTimeout = null;
+ }
+
+ var cm = this.cm, display = cm.display, sel = cm.doc.sel.primary();
+ var from = sel.from(), to = sel.to();
+ if (from.ch == 0 && from.line > cm.firstLine())
+ { from = Pos(from.line - 1, getLine(cm.doc, from.line - 1).length); }
+ if (to.ch == getLine(cm.doc, to.line).text.length && to.line < cm.lastLine())
+ { to = Pos(to.line + 1, 0); }
+ if (from.line < display.viewFrom || to.line > display.viewTo - 1) { return false }
+
+ var fromIndex, fromLine, fromNode;
+ if (from.line == display.viewFrom || (fromIndex = findViewIndex(cm, from.line)) == 0) {
+ fromLine = lineNo(display.view[0].line);
+ fromNode = display.view[0].node;
+ } else {
+ fromLine = lineNo(display.view[fromIndex].line);
+ fromNode = display.view[fromIndex - 1].node.nextSibling;
+ }
+ var toIndex = findViewIndex(cm, to.line);
+ var toLine, toNode;
+ if (toIndex == display.view.length - 1) {
+ toLine = display.viewTo - 1;
+ toNode = display.lineDiv.lastChild;
+ } else {
+ toLine = lineNo(display.view[toIndex + 1].line) - 1;
+ toNode = display.view[toIndex + 1].node.previousSibling;
+ }
+
+ if (!fromNode) { return false }
+ var newText = cm.doc.splitLines(domTextBetween(cm, fromNode, toNode, fromLine, toLine));
+ var oldText = getBetween(cm.doc, Pos(fromLine, 0), Pos(toLine, getLine(cm.doc, toLine).text.length));
+ while (newText.length > 1 && oldText.length > 1) {
+ if (lst(newText) == lst(oldText)) { newText.pop(); oldText.pop(); toLine--; }
+ else if (newText[0] == oldText[0]) { newText.shift(); oldText.shift(); fromLine++; }
+ else { break }
+ }
+
+ var cutFront = 0, cutEnd = 0;
+ var newTop = newText[0], oldTop = oldText[0], maxCutFront = Math.min(newTop.length, oldTop.length);
+ while (cutFront < maxCutFront && newTop.charCodeAt(cutFront) == oldTop.charCodeAt(cutFront))
+ { ++cutFront; }
+ var newBot = lst(newText), oldBot = lst(oldText);
+ var maxCutEnd = Math.min(newBot.length - (newText.length == 1 ? cutFront : 0),
+ oldBot.length - (oldText.length == 1 ? cutFront : 0));
+ while (cutEnd < maxCutEnd &&
+ newBot.charCodeAt(newBot.length - cutEnd - 1) == oldBot.charCodeAt(oldBot.length - cutEnd - 1))
+ { ++cutEnd; }
+ // Try to move start of change to start of selection if ambiguous
+ if (newText.length == 1 && oldText.length == 1 && fromLine == from.line) {
+ while (cutFront && cutFront > from.ch &&
+ newBot.charCodeAt(newBot.length - cutEnd - 1) == oldBot.charCodeAt(oldBot.length - cutEnd - 1)) {
+ cutFront--;
+ cutEnd++;
+ }
+ }
+
+ newText[newText.length - 1] = newBot.slice(0, newBot.length - cutEnd).replace(/^\u200b+/, "");
+ newText[0] = newText[0].slice(cutFront).replace(/\u200b+$/, "");
+
+ var chFrom = Pos(fromLine, cutFront);
+ var chTo = Pos(toLine, oldText.length ? lst(oldText).length - cutEnd : 0);
+ if (newText.length > 1 || newText[0] || cmp(chFrom, chTo)) {
+ replaceRange(cm.doc, newText, chFrom, chTo, "+input");
+ return true
+ }
+ };
+
+ ContentEditableInput.prototype.ensurePolled = function () {
+ this.forceCompositionEnd();
+ };
+ ContentEditableInput.prototype.reset = function () {
+ this.forceCompositionEnd();
+ };
+ ContentEditableInput.prototype.forceCompositionEnd = function () {
+ if (!this.composing) { return }
+ clearTimeout(this.readDOMTimeout);
+ this.composing = null;
+ this.updateFromDOM();
+ this.div.blur();
+ this.div.focus();
+ };
+ ContentEditableInput.prototype.readFromDOMSoon = function () {
+ var this$1 = this;
+
+ if (this.readDOMTimeout != null) { return }
+ this.readDOMTimeout = setTimeout(function () {
+ this$1.readDOMTimeout = null;
+ if (this$1.composing) {
+ if (this$1.composing.done) { this$1.composing = null; }
+ else { return }
+ }
+ this$1.updateFromDOM();
+ }, 80);
+ };
+
+ ContentEditableInput.prototype.updateFromDOM = function () {
+ var this$1 = this;
+
+ if (this.cm.isReadOnly() || !this.pollContent())
+ { runInOp(this.cm, function () { return regChange(this$1.cm); }); }
+ };
+
+ ContentEditableInput.prototype.setUneditable = function (node) {
+ node.contentEditable = "false";
+ };
+
+ ContentEditableInput.prototype.onKeyPress = function (e) {
+ if (e.charCode == 0 || this.composing) { return }
+ e.preventDefault();
+ if (!this.cm.isReadOnly())
+ { operation(this.cm, applyTextInput)(this.cm, String.fromCharCode(e.charCode == null ? e.keyCode : e.charCode), 0); }
+ };
+
+ ContentEditableInput.prototype.readOnlyChanged = function (val) {
+ this.div.contentEditable = String(val != "nocursor");
+ };
+
+ ContentEditableInput.prototype.onContextMenu = function () {};
+ ContentEditableInput.prototype.resetPosition = function () {};
+
+ ContentEditableInput.prototype.needsContentAttribute = true;
+
+ function posToDOM(cm, pos) {
+ var view = findViewForLine(cm, pos.line);
+ if (!view || view.hidden) { return null }
+ var line = getLine(cm.doc, pos.line);
+ var info = mapFromLineView(view, line, pos.line);
+
+ var order = getOrder(line, cm.doc.direction), side = "left";
+ if (order) {
+ var partPos = getBidiPartAt(order, pos.ch);
+ side = partPos % 2 ? "right" : "left";
+ }
+ var result = nodeAndOffsetInLineMap(info.map, pos.ch, side);
+ result.offset = result.collapse == "right" ? result.end : result.start;
+ return result
+ }
+
+ function isInGutter(node) {
+ for (var scan = node; scan; scan = scan.parentNode)
+ { if (/CodeMirror-gutter-wrapper/.test(scan.className)) { return true } }
+ return false
+ }
+
+ function badPos(pos, bad) { if (bad) { pos.bad = true; } return pos }
+
+ function domTextBetween(cm, from, to, fromLine, toLine) {
+ var text = "", closing = false, lineSep = cm.doc.lineSeparator(), extraLinebreak = false;
+ function recognizeMarker(id) { return function (marker) { return marker.id == id; } }
+ function close() {
+ if (closing) {
+ text += lineSep;
+ if (extraLinebreak) { text += lineSep; }
+ closing = extraLinebreak = false;
+ }
+ }
+ function addText(str) {
+ if (str) {
+ close();
+ text += str;
+ }
+ }
+ function walk(node) {
+ if (node.nodeType == 1) {
+ var cmText = node.getAttribute("cm-text");
+ if (cmText) {
+ addText(cmText);
+ return
+ }
+ var markerID = node.getAttribute("cm-marker"), range;
+ if (markerID) {
+ var found = cm.findMarks(Pos(fromLine, 0), Pos(toLine + 1, 0), recognizeMarker(+markerID));
+ if (found.length && (range = found[0].find(0)))
+ { addText(getBetween(cm.doc, range.from, range.to).join(lineSep)); }
+ return
+ }
+ if (node.getAttribute("contenteditable") == "false") { return }
+ var isBlock = /^(pre|div|p|li|table|br)$/i.test(node.nodeName);
+ if (!/^br$/i.test(node.nodeName) && node.textContent.length == 0) { return }
+
+ if (isBlock) { close(); }
+ for (var i = 0; i < node.childNodes.length; i++)
+ { walk(node.childNodes[i]); }
+
+ if (/^(pre|p)$/i.test(node.nodeName)) { extraLinebreak = true; }
+ if (isBlock) { closing = true; }
+ } else if (node.nodeType == 3) {
+ addText(node.nodeValue.replace(/\u200b/g, "").replace(/\u00a0/g, " "));
+ }
+ }
+ for (;;) {
+ walk(from);
+ if (from == to) { break }
+ from = from.nextSibling;
+ extraLinebreak = false;
+ }
+ return text
+ }
+
+ function domToPos(cm, node, offset) {
+ var lineNode;
+ if (node == cm.display.lineDiv) {
+ lineNode = cm.display.lineDiv.childNodes[offset];
+ if (!lineNode) { return badPos(cm.clipPos(Pos(cm.display.viewTo - 1)), true) }
+ node = null; offset = 0;
+ } else {
+ for (lineNode = node;; lineNode = lineNode.parentNode) {
+ if (!lineNode || lineNode == cm.display.lineDiv) { return null }
+ if (lineNode.parentNode && lineNode.parentNode == cm.display.lineDiv) { break }
+ }
+ }
+ for (var i = 0; i < cm.display.view.length; i++) {
+ var lineView = cm.display.view[i];
+ if (lineView.node == lineNode)
+ { return locateNodeInLineView(lineView, node, offset) }
+ }
+ }
+
+ function locateNodeInLineView(lineView, node, offset) {
+ var wrapper = lineView.text.firstChild, bad = false;
+ if (!node || !contains(wrapper, node)) { return badPos(Pos(lineNo(lineView.line), 0), true) }
+ if (node == wrapper) {
+ bad = true;
+ node = wrapper.childNodes[offset];
+ offset = 0;
+ if (!node) {
+ var line = lineView.rest ? lst(lineView.rest) : lineView.line;
+ return badPos(Pos(lineNo(line), line.text.length), bad)
+ }
+ }
+
+ var textNode = node.nodeType == 3 ? node : null, topNode = node;
+ if (!textNode && node.childNodes.length == 1 && node.firstChild.nodeType == 3) {
+ textNode = node.firstChild;
+ if (offset) { offset = textNode.nodeValue.length; }
+ }
+ while (topNode.parentNode != wrapper) { topNode = topNode.parentNode; }
+ var measure = lineView.measure, maps = measure.maps;
+
+ function find(textNode, topNode, offset) {
+ for (var i = -1; i < (maps ? maps.length : 0); i++) {
+ var map = i < 0 ? measure.map : maps[i];
+ for (var j = 0; j < map.length; j += 3) {
+ var curNode = map[j + 2];
+ if (curNode == textNode || curNode == topNode) {
+ var line = lineNo(i < 0 ? lineView.line : lineView.rest[i]);
+ var ch = map[j] + offset;
+ if (offset < 0 || curNode != textNode) { ch = map[j + (offset ? 1 : 0)]; }
+ return Pos(line, ch)
+ }
+ }
+ }
+ }
+ var found = find(textNode, topNode, offset);
+ if (found) { return badPos(found, bad) }
+
+ // FIXME this is all really shaky. might handle the few cases it needs to handle, but likely to cause problems
+ for (var after = topNode.nextSibling, dist = textNode ? textNode.nodeValue.length - offset : 0; after; after = after.nextSibling) {
+ found = find(after, after.firstChild, 0);
+ if (found)
+ { return badPos(Pos(found.line, found.ch - dist), bad) }
+ else
+ { dist += after.textContent.length; }
+ }
+ for (var before = topNode.previousSibling, dist$1 = offset; before; before = before.previousSibling) {
+ found = find(before, before.firstChild, -1);
+ if (found)
+ { return badPos(Pos(found.line, found.ch + dist$1), bad) }
+ else
+ { dist$1 += before.textContent.length; }
+ }
+ }
+
+ // TEXTAREA INPUT STYLE
+
+ var TextareaInput = function(cm) {
+ this.cm = cm;
+ // See input.poll and input.reset
+ this.prevInput = "";
+
+ // Flag that indicates whether we expect input to appear real soon
+ // now (after some event like 'keypress' or 'input') and are
+ // polling intensively.
+ this.pollingFast = false;
+ // Self-resetting timeout for the poller
+ this.polling = new Delayed();
+ // Used to work around IE issue with selection being forgotten when focus moves away from textarea
+ this.hasSelection = false;
+ this.composing = null;
+ };
+
+ TextareaInput.prototype.init = function (display) {
+ var this$1 = this;
+
+ var input = this, cm = this.cm;
+ this.createField(display);
+ var te = this.textarea;
+
+ display.wrapper.insertBefore(this.wrapper, display.wrapper.firstChild);
+
+ // Needed to hide big blue blinking cursor on Mobile Safari (doesn't seem to work in iOS 8 anymore)
+ if (ios) { te.style.width = "0px"; }
+
+ on(te, "input", function () {
+ if (ie && ie_version >= 9 && this$1.hasSelection) { this$1.hasSelection = null; }
+ input.poll();
+ });
+
+ on(te, "paste", function (e) {
+ if (signalDOMEvent(cm, e) || handlePaste(e, cm)) { return }
+
+ cm.state.pasteIncoming = +new Date;
+ input.fastPoll();
+ });
+
+ function prepareCopyCut(e) {
+ if (signalDOMEvent(cm, e)) { return }
+ if (cm.somethingSelected()) {
+ setLastCopied({lineWise: false, text: cm.getSelections()});
+ } else if (!cm.options.lineWiseCopyCut) {
+ return
+ } else {
+ var ranges = copyableRanges(cm);
+ setLastCopied({lineWise: true, text: ranges.text});
+ if (e.type == "cut") {
+ cm.setSelections(ranges.ranges, null, sel_dontScroll);
+ } else {
+ input.prevInput = "";
+ te.value = ranges.text.join("\n");
+ selectInput(te);
+ }
+ }
+ if (e.type == "cut") { cm.state.cutIncoming = +new Date; }
+ }
+ on(te, "cut", prepareCopyCut);
+ on(te, "copy", prepareCopyCut);
+
+ on(display.scroller, "paste", function (e) {
+ if (eventInWidget(display, e) || signalDOMEvent(cm, e)) { return }
+ if (!te.dispatchEvent) {
+ cm.state.pasteIncoming = +new Date;
+ input.focus();
+ return
+ }
+
+ // Pass the `paste` event to the textarea so it's handled by its event listener.
+ var event = new Event("paste");
+ event.clipboardData = e.clipboardData;
+ te.dispatchEvent(event);
+ });
+
+ // Prevent normal selection in the editor (we handle our own)
+ on(display.lineSpace, "selectstart", function (e) {
+ if (!eventInWidget(display, e)) { e_preventDefault(e); }
+ });
+
+ on(te, "compositionstart", function () {
+ var start = cm.getCursor("from");
+ if (input.composing) { input.composing.range.clear(); }
+ input.composing = {
+ start: start,
+ range: cm.markText(start, cm.getCursor("to"), {className: "CodeMirror-composing"})
+ };
+ });
+ on(te, "compositionend", function () {
+ if (input.composing) {
+ input.poll();
+ input.composing.range.clear();
+ input.composing = null;
+ }
+ });
+ };
+
+ TextareaInput.prototype.createField = function (_display) {
+ // Wraps and hides input textarea
+ this.wrapper = hiddenTextarea();
+ // The semihidden textarea that is focused when the editor is
+ // focused, and receives input.
+ this.textarea = this.wrapper.firstChild;
+ };
+
+ TextareaInput.prototype.screenReaderLabelChanged = function (label) {
+ // Label for screenreaders, accessibility
+ if(label) {
+ this.textarea.setAttribute('aria-label', label);
+ } else {
+ this.textarea.removeAttribute('aria-label');
+ }
+ };
+
+ TextareaInput.prototype.prepareSelection = function () {
+ // Redraw the selection and/or cursor
+ var cm = this.cm, display = cm.display, doc = cm.doc;
+ var result = prepareSelection(cm);
+
+ // Move the hidden textarea near the cursor to prevent scrolling artifacts
+ if (cm.options.moveInputWithCursor) {
+ var headPos = cursorCoords(cm, doc.sel.primary().head, "div");
+ var wrapOff = display.wrapper.getBoundingClientRect(), lineOff = display.lineDiv.getBoundingClientRect();
+ result.teTop = Math.max(0, Math.min(display.wrapper.clientHeight - 10,
+ headPos.top + lineOff.top - wrapOff.top));
+ result.teLeft = Math.max(0, Math.min(display.wrapper.clientWidth - 10,
+ headPos.left + lineOff.left - wrapOff.left));
+ }
+
+ return result
+ };
+
+ TextareaInput.prototype.showSelection = function (drawn) {
+ var cm = this.cm, display = cm.display;
+ removeChildrenAndAdd(display.cursorDiv, drawn.cursors);
+ removeChildrenAndAdd(display.selectionDiv, drawn.selection);
+ if (drawn.teTop != null) {
+ this.wrapper.style.top = drawn.teTop + "px";
+ this.wrapper.style.left = drawn.teLeft + "px";
+ }
+ };
+
+ // Reset the input to correspond to the selection (or to be empty,
+ // when not typing and nothing is selected)
+ TextareaInput.prototype.reset = function (typing) {
+ if (this.contextMenuPending || this.composing) { return }
+ var cm = this.cm;
+ if (cm.somethingSelected()) {
+ this.prevInput = "";
+ var content = cm.getSelection();
+ this.textarea.value = content;
+ if (cm.state.focused) { selectInput(this.textarea); }
+ if (ie && ie_version >= 9) { this.hasSelection = content; }
+ } else if (!typing) {
+ this.prevInput = this.textarea.value = "";
+ if (ie && ie_version >= 9) { this.hasSelection = null; }
+ }
+ };
+
+ TextareaInput.prototype.getField = function () { return this.textarea };
+
+ TextareaInput.prototype.supportsTouch = function () { return false };
+
+ TextareaInput.prototype.focus = function () {
+ if (this.cm.options.readOnly != "nocursor" && (!mobile || activeElt() != this.textarea)) {
+ try { this.textarea.focus(); }
+ catch (e) {} // IE8 will throw if the textarea is display: none or not in DOM
+ }
+ };
+
+ TextareaInput.prototype.blur = function () { this.textarea.blur(); };
+
+ TextareaInput.prototype.resetPosition = function () {
+ this.wrapper.style.top = this.wrapper.style.left = 0;
+ };
+
+ TextareaInput.prototype.receivedFocus = function () { this.slowPoll(); };
+
+ // Poll for input changes, using the normal rate of polling. This
+ // runs as long as the editor is focused.
+ TextareaInput.prototype.slowPoll = function () {
+ var this$1 = this;
+
+ if (this.pollingFast) { return }
+ this.polling.set(this.cm.options.pollInterval, function () {
+ this$1.poll();
+ if (this$1.cm.state.focused) { this$1.slowPoll(); }
+ });
+ };
+
+ // When an event has just come in that is likely to add or change
+ // something in the input textarea, we poll faster, to ensure that
+ // the change appears on the screen quickly.
+ TextareaInput.prototype.fastPoll = function () {
+ var missed = false, input = this;
+ input.pollingFast = true;
+ function p() {
+ var changed = input.poll();
+ if (!changed && !missed) {missed = true; input.polling.set(60, p);}
+ else {input.pollingFast = false; input.slowPoll();}
+ }
+ input.polling.set(20, p);
+ };
+
+ // Read input from the textarea, and update the document to match.
+ // When something is selected, it is present in the textarea, and
+ // selected (unless it is huge, in which case a placeholder is
+ // used). When nothing is selected, the cursor sits after previously
+ // seen text (can be empty), which is stored in prevInput (we must
+ // not reset the textarea when typing, because that breaks IME).
+ TextareaInput.prototype.poll = function () {
+ var this$1 = this;
+
+ var cm = this.cm, input = this.textarea, prevInput = this.prevInput;
+ // Since this is called a *lot*, try to bail out as cheaply as
+ // possible when it is clear that nothing happened. hasSelection
+ // will be the case when there is a lot of text in the textarea,
+ // in which case reading its value would be expensive.
+ if (this.contextMenuPending || !cm.state.focused ||
+ (hasSelection(input) && !prevInput && !this.composing) ||
+ cm.isReadOnly() || cm.options.disableInput || cm.state.keySeq)
+ { return false }
+
+ var text = input.value;
+ // If nothing changed, bail.
+ if (text == prevInput && !cm.somethingSelected()) { return false }
+ // Work around nonsensical selection resetting in IE9/10, and
+ // inexplicable appearance of private area unicode characters on
+ // some key combos in Mac (#2689).
+ if (ie && ie_version >= 9 && this.hasSelection === text ||
+ mac && /[\uf700-\uf7ff]/.test(text)) {
+ cm.display.input.reset();
+ return false
+ }
+
+ if (cm.doc.sel == cm.display.selForContextMenu) {
+ var first = text.charCodeAt(0);
+ if (first == 0x200b && !prevInput) { prevInput = "\u200b"; }
+ if (first == 0x21da) { this.reset(); return this.cm.execCommand("undo") }
+ }
+ // Find the part of the input that is actually new
+ var same = 0, l = Math.min(prevInput.length, text.length);
+ while (same < l && prevInput.charCodeAt(same) == text.charCodeAt(same)) { ++same; }
+
+ runInOp(cm, function () {
+ applyTextInput(cm, text.slice(same), prevInput.length - same,
+ null, this$1.composing ? "*compose" : null);
+
+ // Don't leave long text in the textarea, since it makes further polling slow
+ if (text.length > 1000 || text.indexOf("\n") > -1) { input.value = this$1.prevInput = ""; }
+ else { this$1.prevInput = text; }
+
+ if (this$1.composing) {
+ this$1.composing.range.clear();
+ this$1.composing.range = cm.markText(this$1.composing.start, cm.getCursor("to"),
+ {className: "CodeMirror-composing"});
+ }
+ });
+ return true
+ };
+
+ TextareaInput.prototype.ensurePolled = function () {
+ if (this.pollingFast && this.poll()) { this.pollingFast = false; }
+ };
+
+ TextareaInput.prototype.onKeyPress = function () {
+ if (ie && ie_version >= 9) { this.hasSelection = null; }
+ this.fastPoll();
+ };
+
+ TextareaInput.prototype.onContextMenu = function (e) {
+ var input = this, cm = input.cm, display = cm.display, te = input.textarea;
+ if (input.contextMenuPending) { input.contextMenuPending(); }
+ var pos = posFromMouse(cm, e), scrollPos = display.scroller.scrollTop;
+ if (!pos || presto) { return } // Opera is difficult.
+
+ // Reset the current text selection only if the click is done outside of the selection
+ // and 'resetSelectionOnContextMenu' option is true.
+ var reset = cm.options.resetSelectionOnContextMenu;
+ if (reset && cm.doc.sel.contains(pos) == -1)
+ { operation(cm, setSelection)(cm.doc, simpleSelection(pos), sel_dontScroll); }
+
+ var oldCSS = te.style.cssText, oldWrapperCSS = input.wrapper.style.cssText;
+ var wrapperBox = input.wrapper.offsetParent.getBoundingClientRect();
+ input.wrapper.style.cssText = "position: static";
+ te.style.cssText = "position: absolute; width: 30px; height: 30px;\n top: " + (e.clientY - wrapperBox.top - 5) + "px; left: " + (e.clientX - wrapperBox.left - 5) + "px;\n z-index: 1000; background: " + (ie ? "rgba(255, 255, 255, .05)" : "transparent") + ";\n outline: none; border-width: 0; outline: none; overflow: hidden; opacity: .05; filter: alpha(opacity=5);";
+ var oldScrollY;
+ if (webkit) { oldScrollY = window.scrollY; } // Work around Chrome issue (#2712)
+ display.input.focus();
+ if (webkit) { window.scrollTo(null, oldScrollY); }
+ display.input.reset();
+ // Adds "Select all" to context menu in FF
+ if (!cm.somethingSelected()) { te.value = input.prevInput = " "; }
+ input.contextMenuPending = rehide;
+ display.selForContextMenu = cm.doc.sel;
+ clearTimeout(display.detectingSelectAll);
+
+ // Select-all will be greyed out if there's nothing to select, so
+ // this adds a zero-width space so that we can later check whether
+ // it got selected.
+ function prepareSelectAllHack() {
+ if (te.selectionStart != null) {
+ var selected = cm.somethingSelected();
+ var extval = "\u200b" + (selected ? te.value : "");
+ te.value = "\u21da"; // Used to catch context-menu undo
+ te.value = extval;
+ input.prevInput = selected ? "" : "\u200b";
+ te.selectionStart = 1; te.selectionEnd = extval.length;
+ // Re-set this, in case some other handler touched the
+ // selection in the meantime.
+ display.selForContextMenu = cm.doc.sel;
+ }
+ }
+ function rehide() {
+ if (input.contextMenuPending != rehide) { return }
+ input.contextMenuPending = false;
+ input.wrapper.style.cssText = oldWrapperCSS;
+ te.style.cssText = oldCSS;
+ if (ie && ie_version < 9) { display.scrollbars.setScrollTop(display.scroller.scrollTop = scrollPos); }
+
+ // Try to detect the user choosing select-all
+ if (te.selectionStart != null) {
+ if (!ie || (ie && ie_version < 9)) { prepareSelectAllHack(); }
+ var i = 0, poll = function () {
+ if (display.selForContextMenu == cm.doc.sel && te.selectionStart == 0 &&
+ te.selectionEnd > 0 && input.prevInput == "\u200b") {
+ operation(cm, selectAll)(cm);
+ } else if (i++ < 10) {
+ display.detectingSelectAll = setTimeout(poll, 500);
+ } else {
+ display.selForContextMenu = null;
+ display.input.reset();
+ }
+ };
+ display.detectingSelectAll = setTimeout(poll, 200);
+ }
+ }
+
+ if (ie && ie_version >= 9) { prepareSelectAllHack(); }
+ if (captureRightClick) {
+ e_stop(e);
+ var mouseup = function () {
+ off(window, "mouseup", mouseup);
+ setTimeout(rehide, 20);
+ };
+ on(window, "mouseup", mouseup);
+ } else {
+ setTimeout(rehide, 50);
+ }
+ };
+
+ TextareaInput.prototype.readOnlyChanged = function (val) {
+ if (!val) { this.reset(); }
+ this.textarea.disabled = val == "nocursor";
+ };
+
+ TextareaInput.prototype.setUneditable = function () {};
+
+ TextareaInput.prototype.needsContentAttribute = false;
+
+ function fromTextArea(textarea, options) {
+ options = options ? copyObj(options) : {};
+ options.value = textarea.value;
+ if (!options.tabindex && textarea.tabIndex)
+ { options.tabindex = textarea.tabIndex; }
+ if (!options.placeholder && textarea.placeholder)
+ { options.placeholder = textarea.placeholder; }
+ // Set autofocus to true if this textarea is focused, or if it has
+ // autofocus and no other element is focused.
+ if (options.autofocus == null) {
+ var hasFocus = activeElt();
+ options.autofocus = hasFocus == textarea ||
+ textarea.getAttribute("autofocus") != null && hasFocus == document.body;
+ }
+
+ function save() {textarea.value = cm.getValue();}
+
+ var realSubmit;
+ if (textarea.form) {
+ on(textarea.form, "submit", save);
+ // Deplorable hack to make the submit method do the right thing.
+ if (!options.leaveSubmitMethodAlone) {
+ var form = textarea.form;
+ realSubmit = form.submit;
+ try {
+ var wrappedSubmit = form.submit = function () {
+ save();
+ form.submit = realSubmit;
+ form.submit();
+ form.submit = wrappedSubmit;
+ };
+ } catch(e) {}
+ }
+ }
+
+ options.finishInit = function (cm) {
+ cm.save = save;
+ cm.getTextArea = function () { return textarea; };
+ cm.toTextArea = function () {
+ cm.toTextArea = isNaN; // Prevent this from being ran twice
+ save();
+ textarea.parentNode.removeChild(cm.getWrapperElement());
+ textarea.style.display = "";
+ if (textarea.form) {
+ off(textarea.form, "submit", save);
+ if (!options.leaveSubmitMethodAlone && typeof textarea.form.submit == "function")
+ { textarea.form.submit = realSubmit; }
+ }
+ };
+ };
+
+ textarea.style.display = "none";
+ var cm = CodeMirror(function (node) { return textarea.parentNode.insertBefore(node, textarea.nextSibling); },
+ options);
+ return cm
+ }
+
+ function addLegacyProps(CodeMirror) {
+ CodeMirror.off = off;
+ CodeMirror.on = on;
+ CodeMirror.wheelEventPixels = wheelEventPixels;
+ CodeMirror.Doc = Doc;
+ CodeMirror.splitLines = splitLinesAuto;
+ CodeMirror.countColumn = countColumn;
+ CodeMirror.findColumn = findColumn;
+ CodeMirror.isWordChar = isWordCharBasic;
+ CodeMirror.Pass = Pass;
+ CodeMirror.signal = signal;
+ CodeMirror.Line = Line;
+ CodeMirror.changeEnd = changeEnd;
+ CodeMirror.scrollbarModel = scrollbarModel;
+ CodeMirror.Pos = Pos;
+ CodeMirror.cmpPos = cmp;
+ CodeMirror.modes = modes;
+ CodeMirror.mimeModes = mimeModes;
+ CodeMirror.resolveMode = resolveMode;
+ CodeMirror.getMode = getMode;
+ CodeMirror.modeExtensions = modeExtensions;
+ CodeMirror.extendMode = extendMode;
+ CodeMirror.copyState = copyState;
+ CodeMirror.startState = startState;
+ CodeMirror.innerMode = innerMode;
+ CodeMirror.commands = commands;
+ CodeMirror.keyMap = keyMap;
+ CodeMirror.keyName = keyName;
+ CodeMirror.isModifierKey = isModifierKey;
+ CodeMirror.lookupKey = lookupKey;
+ CodeMirror.normalizeKeyMap = normalizeKeyMap;
+ CodeMirror.StringStream = StringStream;
+ CodeMirror.SharedTextMarker = SharedTextMarker;
+ CodeMirror.TextMarker = TextMarker;
+ CodeMirror.LineWidget = LineWidget;
+ CodeMirror.e_preventDefault = e_preventDefault;
+ CodeMirror.e_stopPropagation = e_stopPropagation;
+ CodeMirror.e_stop = e_stop;
+ CodeMirror.addClass = addClass;
+ CodeMirror.contains = contains;
+ CodeMirror.rmClass = rmClass;
+ CodeMirror.keyNames = keyNames;
+ }
+
+ // EDITOR CONSTRUCTOR
+
+ defineOptions(CodeMirror);
+
+ addEditorMethods(CodeMirror);
+
+ // Set up methods on CodeMirror's prototype to redirect to the editor's document.
+ var dontDelegate = "iter insert remove copy getEditor constructor".split(" ");
+ for (var prop in Doc.prototype) { if (Doc.prototype.hasOwnProperty(prop) && indexOf(dontDelegate, prop) < 0)
+ { CodeMirror.prototype[prop] = (function(method) {
+ return function() {return method.apply(this.doc, arguments)}
+ })(Doc.prototype[prop]); } }
+
+ eventMixin(Doc);
+ CodeMirror.inputStyles = {"textarea": TextareaInput, "contenteditable": ContentEditableInput};
+
+ // Extra arguments are stored as the mode's dependencies, which is
+ // used by (legacy) mechanisms like loadmode.js to automatically
+ // load a mode. (Preferred mechanism is the require/define calls.)
+ CodeMirror.defineMode = function(name/*, mode, …*/) {
+ if (!CodeMirror.defaults.mode && name != "null") { CodeMirror.defaults.mode = name; }
+ defineMode.apply(this, arguments);
+ };
+
+ CodeMirror.defineMIME = defineMIME;
+
+ // Minimal default mode.
+ CodeMirror.defineMode("null", function () { return ({token: function (stream) { return stream.skipToEnd(); }}); });
+ CodeMirror.defineMIME("text/plain", "null");
+
+ // EXTENSIONS
+
+ CodeMirror.defineExtension = function (name, func) {
+ CodeMirror.prototype[name] = func;
+ };
+ CodeMirror.defineDocExtension = function (name, func) {
+ Doc.prototype[name] = func;
+ };
+
+ CodeMirror.fromTextArea = fromTextArea;
+
+ addLegacyProps(CodeMirror);
+
+ CodeMirror.version = "5.57.0";
+
+ return CodeMirror;
+
+})));
diff --git a/modules/cookiesplus/lib/CodeMirror/lib/index.php b/modules/cookiesplus/lib/CodeMirror/lib/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/lib/index.php
@@ -0,0 +1,32 @@
+*\/]/.test(ch)) {
+ return ret(null, "select-op");
+ } else if (ch == "." && stream.match(/^-?[_a-z][_a-z0-9-]*/i)) {
+ return ret("qualifier", "qualifier");
+ } else if (/[:;{}\[\]\(\)]/.test(ch)) {
+ return ret(null, ch);
+ } else if (stream.match(/[\w-.]+(?=\()/)) {
+ if (/^(url(-prefix)?|domain|regexp)$/.test(stream.current().toLowerCase())) {
+ state.tokenize = tokenParenthesized;
+ }
+ return ret("variable callee", "variable");
+ } else if (/[\w\\\-]/.test(ch)) {
+ stream.eatWhile(/[\w\\\-]/);
+ return ret("property", "word");
+ } else {
+ return ret(null, null);
+ }
+ }
+
+ function tokenString(quote) {
+ return function(stream, state) {
+ var escaped = false, ch;
+ while ((ch = stream.next()) != null) {
+ if (ch == quote && !escaped) {
+ if (quote == ")") stream.backUp(1);
+ break;
+ }
+ escaped = !escaped && ch == "\\";
+ }
+ if (ch == quote || !escaped && quote != ")") state.tokenize = null;
+ return ret("string", "string");
+ };
+ }
+
+ function tokenParenthesized(stream, state) {
+ stream.next(); // Must be '('
+ if (!stream.match(/\s*[\"\')]/, false))
+ state.tokenize = tokenString(")");
+ else
+ state.tokenize = null;
+ return ret(null, "(");
+ }
+
+ // Context management
+
+ function Context(type, indent, prev) {
+ this.type = type;
+ this.indent = indent;
+ this.prev = prev;
+ }
+
+ function pushContext(state, stream, type, indent) {
+ state.context = new Context(type, stream.indentation() + (indent === false ? 0 : indentUnit), state.context);
+ return type;
+ }
+
+ function popContext(state) {
+ if (state.context.prev)
+ state.context = state.context.prev;
+ return state.context.type;
+ }
+
+ function pass(type, stream, state) {
+ return states[state.context.type](type, stream, state);
+ }
+ function popAndPass(type, stream, state, n) {
+ for (var i = n || 1; i > 0; i--)
+ state.context = state.context.prev;
+ return pass(type, stream, state);
+ }
+
+ // Parser
+
+ function wordAsValue(stream) {
+ var word = stream.current().toLowerCase();
+ if (valueKeywords.hasOwnProperty(word))
+ override = "atom";
+ else if (colorKeywords.hasOwnProperty(word))
+ override = "keyword";
+ else
+ override = "variable";
+ }
+
+ var states = {};
+
+ states.top = function(type, stream, state) {
+ if (type == "{") {
+ return pushContext(state, stream, "block");
+ } else if (type == "}" && state.context.prev) {
+ return popContext(state);
+ } else if (supportsAtComponent && /@component/i.test(type)) {
+ return pushContext(state, stream, "atComponentBlock");
+ } else if (/^@(-moz-)?document$/i.test(type)) {
+ return pushContext(state, stream, "documentTypes");
+ } else if (/^@(media|supports|(-moz-)?document|import)$/i.test(type)) {
+ return pushContext(state, stream, "atBlock");
+ } else if (/^@(font-face|counter-style)/i.test(type)) {
+ state.stateArg = type;
+ return "restricted_atBlock_before";
+ } else if (/^@(-(moz|ms|o|webkit)-)?keyframes$/i.test(type)) {
+ return "keyframes";
+ } else if (type && type.charAt(0) == "@") {
+ return pushContext(state, stream, "at");
+ } else if (type == "hash") {
+ override = "builtin";
+ } else if (type == "word") {
+ override = "tag";
+ } else if (type == "variable-definition") {
+ return "maybeprop";
+ } else if (type == "interpolation") {
+ return pushContext(state, stream, "interpolation");
+ } else if (type == ":") {
+ return "pseudo";
+ } else if (allowNested && type == "(") {
+ return pushContext(state, stream, "parens");
+ }
+ return state.context.type;
+ };
+
+ states.block = function(type, stream, state) {
+ if (type == "word") {
+ var word = stream.current().toLowerCase();
+ if (propertyKeywords.hasOwnProperty(word)) {
+ override = "property";
+ return "maybeprop";
+ } else if (nonStandardPropertyKeywords.hasOwnProperty(word)) {
+ override = "string-2";
+ return "maybeprop";
+ } else if (allowNested) {
+ override = stream.match(/^\s*:(?:\s|$)/, false) ? "property" : "tag";
+ return "block";
+ } else {
+ override += " error";
+ return "maybeprop";
+ }
+ } else if (type == "meta") {
+ return "block";
+ } else if (!allowNested && (type == "hash" || type == "qualifier")) {
+ override = "error";
+ return "block";
+ } else {
+ return states.top(type, stream, state);
+ }
+ };
+
+ states.maybeprop = function(type, stream, state) {
+ if (type == ":") return pushContext(state, stream, "prop");
+ return pass(type, stream, state);
+ };
+
+ states.prop = function(type, stream, state) {
+ if (type == ";") return popContext(state);
+ if (type == "{" && allowNested) return pushContext(state, stream, "propBlock");
+ if (type == "}" || type == "{") return popAndPass(type, stream, state);
+ if (type == "(") return pushContext(state, stream, "parens");
+
+ if (type == "hash" && !/^#([0-9a-fA-f]{3,4}|[0-9a-fA-f]{6}|[0-9a-fA-f]{8})$/.test(stream.current())) {
+ override += " error";
+ } else if (type == "word") {
+ wordAsValue(stream);
+ } else if (type == "interpolation") {
+ return pushContext(state, stream, "interpolation");
+ }
+ return "prop";
+ };
+
+ states.propBlock = function(type, _stream, state) {
+ if (type == "}") return popContext(state);
+ if (type == "word") { override = "property"; return "maybeprop"; }
+ return state.context.type;
+ };
+
+ states.parens = function(type, stream, state) {
+ if (type == "{" || type == "}") return popAndPass(type, stream, state);
+ if (type == ")") return popContext(state);
+ if (type == "(") return pushContext(state, stream, "parens");
+ if (type == "interpolation") return pushContext(state, stream, "interpolation");
+ if (type == "word") wordAsValue(stream);
+ return "parens";
+ };
+
+ states.pseudo = function(type, stream, state) {
+ if (type == "meta") return "pseudo";
+
+ if (type == "word") {
+ override = "variable-3";
+ return state.context.type;
+ }
+ return pass(type, stream, state);
+ };
+
+ states.documentTypes = function(type, stream, state) {
+ if (type == "word" && documentTypes.hasOwnProperty(stream.current())) {
+ override = "tag";
+ return state.context.type;
+ } else {
+ return states.atBlock(type, stream, state);
+ }
+ };
+
+ states.atBlock = function(type, stream, state) {
+ if (type == "(") return pushContext(state, stream, "atBlock_parens");
+ if (type == "}" || type == ";") return popAndPass(type, stream, state);
+ if (type == "{") return popContext(state) && pushContext(state, stream, allowNested ? "block" : "top");
+
+ if (type == "interpolation") return pushContext(state, stream, "interpolation");
+
+ if (type == "word") {
+ var word = stream.current().toLowerCase();
+ if (word == "only" || word == "not" || word == "and" || word == "or")
+ override = "keyword";
+ else if (mediaTypes.hasOwnProperty(word))
+ override = "attribute";
+ else if (mediaFeatures.hasOwnProperty(word))
+ override = "property";
+ else if (mediaValueKeywords.hasOwnProperty(word))
+ override = "keyword";
+ else if (propertyKeywords.hasOwnProperty(word))
+ override = "property";
+ else if (nonStandardPropertyKeywords.hasOwnProperty(word))
+ override = "string-2";
+ else if (valueKeywords.hasOwnProperty(word))
+ override = "atom";
+ else if (colorKeywords.hasOwnProperty(word))
+ override = "keyword";
+ else
+ override = "error";
+ }
+ return state.context.type;
+ };
+
+ states.atComponentBlock = function(type, stream, state) {
+ if (type == "}")
+ return popAndPass(type, stream, state);
+ if (type == "{")
+ return popContext(state) && pushContext(state, stream, allowNested ? "block" : "top", false);
+ if (type == "word")
+ override = "error";
+ return state.context.type;
+ };
+
+ states.atBlock_parens = function(type, stream, state) {
+ if (type == ")") return popContext(state);
+ if (type == "{" || type == "}") return popAndPass(type, stream, state, 2);
+ return states.atBlock(type, stream, state);
+ };
+
+ states.restricted_atBlock_before = function(type, stream, state) {
+ if (type == "{")
+ return pushContext(state, stream, "restricted_atBlock");
+ if (type == "word" && state.stateArg == "@counter-style") {
+ override = "variable";
+ return "restricted_atBlock_before";
+ }
+ return pass(type, stream, state);
+ };
+
+ states.restricted_atBlock = function(type, stream, state) {
+ if (type == "}") {
+ state.stateArg = null;
+ return popContext(state);
+ }
+ if (type == "word") {
+ if ((state.stateArg == "@font-face" && !fontProperties.hasOwnProperty(stream.current().toLowerCase())) ||
+ (state.stateArg == "@counter-style" && !counterDescriptors.hasOwnProperty(stream.current().toLowerCase())))
+ override = "error";
+ else
+ override = "property";
+ return "maybeprop";
+ }
+ return "restricted_atBlock";
+ };
+
+ states.keyframes = function(type, stream, state) {
+ if (type == "word") { override = "variable"; return "keyframes"; }
+ if (type == "{") return pushContext(state, stream, "top");
+ return pass(type, stream, state);
+ };
+
+ states.at = function(type, stream, state) {
+ if (type == ";") return popContext(state);
+ if (type == "{" || type == "}") return popAndPass(type, stream, state);
+ if (type == "word") override = "tag";
+ else if (type == "hash") override = "builtin";
+ return "at";
+ };
+
+ states.interpolation = function(type, stream, state) {
+ if (type == "}") return popContext(state);
+ if (type == "{" || type == ";") return popAndPass(type, stream, state);
+ if (type == "word") override = "variable";
+ else if (type != "variable" && type != "(" && type != ")") override = "error";
+ return "interpolation";
+ };
+
+ return {
+ startState: function(base) {
+ return {tokenize: null,
+ state: inline ? "block" : "top",
+ stateArg: null,
+ context: new Context(inline ? "block" : "top", base || 0, null)};
+ },
+
+ token: function(stream, state) {
+ if (!state.tokenize && stream.eatSpace()) return null;
+ var style = (state.tokenize || tokenBase)(stream, state);
+ if (style && typeof style == "object") {
+ type = style[1];
+ style = style[0];
+ }
+ override = style;
+ if (type != "comment")
+ state.state = states[state.state](type, stream, state);
+ return override;
+ },
+
+ indent: function(state, textAfter) {
+ var cx = state.context, ch = textAfter && textAfter.charAt(0);
+ var indent = cx.indent;
+ if (cx.type == "prop" && (ch == "}" || ch == ")")) cx = cx.prev;
+ if (cx.prev) {
+ if (ch == "}" && (cx.type == "block" || cx.type == "top" ||
+ cx.type == "interpolation" || cx.type == "restricted_atBlock")) {
+ // Resume indentation from parent context.
+ cx = cx.prev;
+ indent = cx.indent;
+ } else if (ch == ")" && (cx.type == "parens" || cx.type == "atBlock_parens") ||
+ ch == "{" && (cx.type == "at" || cx.type == "atBlock")) {
+ // Dedent relative to current context.
+ indent = Math.max(0, cx.indent - indentUnit);
+ }
+ }
+ return indent;
+ },
+
+ electricChars: "}",
+ blockCommentStart: "/*",
+ blockCommentEnd: "*/",
+ blockCommentContinue: " * ",
+ lineComment: lineComment,
+ fold: "brace"
+ };
+});
+
+ function keySet(array) {
+ var keys = {};
+ for (var i = 0; i < array.length; ++i) {
+ keys[array[i].toLowerCase()] = true;
+ }
+ return keys;
+ }
+
+ var documentTypes_ = [
+ "domain", "regexp", "url", "url-prefix"
+ ], documentTypes = keySet(documentTypes_);
+
+ var mediaTypes_ = [
+ "all", "aural", "braille", "handheld", "print", "projection", "screen",
+ "tty", "tv", "embossed"
+ ], mediaTypes = keySet(mediaTypes_);
+
+ var mediaFeatures_ = [
+ "width", "min-width", "max-width", "height", "min-height", "max-height",
+ "device-width", "min-device-width", "max-device-width", "device-height",
+ "min-device-height", "max-device-height", "aspect-ratio",
+ "min-aspect-ratio", "max-aspect-ratio", "device-aspect-ratio",
+ "min-device-aspect-ratio", "max-device-aspect-ratio", "color", "min-color",
+ "max-color", "color-index", "min-color-index", "max-color-index",
+ "monochrome", "min-monochrome", "max-monochrome", "resolution",
+ "min-resolution", "max-resolution", "scan", "grid", "orientation",
+ "device-pixel-ratio", "min-device-pixel-ratio", "max-device-pixel-ratio",
+ "pointer", "any-pointer", "hover", "any-hover", "prefers-color-scheme"
+ ], mediaFeatures = keySet(mediaFeatures_);
+
+ var mediaValueKeywords_ = [
+ "landscape", "portrait", "none", "coarse", "fine", "on-demand", "hover",
+ "interlace", "progressive",
+ "dark", "light"
+ ], mediaValueKeywords = keySet(mediaValueKeywords_);
+
+ var propertyKeywords_ = [
+ "align-content", "align-items", "align-self", "alignment-adjust",
+ "alignment-baseline", "all", "anchor-point", "animation", "animation-delay",
+ "animation-direction", "animation-duration", "animation-fill-mode",
+ "animation-iteration-count", "animation-name", "animation-play-state",
+ "animation-timing-function", "appearance", "azimuth", "backdrop-filter",
+ "backface-visibility", "background", "background-attachment",
+ "background-blend-mode", "background-clip", "background-color",
+ "background-image", "background-origin", "background-position",
+ "background-position-x", "background-position-y", "background-repeat",
+ "background-size", "baseline-shift", "binding", "bleed", "block-size",
+ "bookmark-label", "bookmark-level", "bookmark-state", "bookmark-target",
+ "border", "border-bottom", "border-bottom-color", "border-bottom-left-radius",
+ "border-bottom-right-radius", "border-bottom-style", "border-bottom-width",
+ "border-collapse", "border-color", "border-image", "border-image-outset",
+ "border-image-repeat", "border-image-slice", "border-image-source",
+ "border-image-width", "border-left", "border-left-color", "border-left-style",
+ "border-left-width", "border-radius", "border-right", "border-right-color",
+ "border-right-style", "border-right-width", "border-spacing", "border-style",
+ "border-top", "border-top-color", "border-top-left-radius",
+ "border-top-right-radius", "border-top-style", "border-top-width",
+ "border-width", "bottom", "box-decoration-break", "box-shadow", "box-sizing",
+ "break-after", "break-before", "break-inside", "caption-side", "caret-color",
+ "clear", "clip", "color", "color-profile", "column-count", "column-fill",
+ "column-gap", "column-rule", "column-rule-color", "column-rule-style",
+ "column-rule-width", "column-span", "column-width", "columns", "contain",
+ "content", "counter-increment", "counter-reset", "crop", "cue", "cue-after",
+ "cue-before", "cursor", "direction", "display", "dominant-baseline",
+ "drop-initial-after-adjust", "drop-initial-after-align",
+ "drop-initial-before-adjust", "drop-initial-before-align", "drop-initial-size",
+ "drop-initial-value", "elevation", "empty-cells", "fit", "fit-position",
+ "flex", "flex-basis", "flex-direction", "flex-flow", "flex-grow",
+ "flex-shrink", "flex-wrap", "float", "float-offset", "flow-from", "flow-into",
+ "font", "font-family", "font-feature-settings", "font-kerning",
+ "font-language-override", "font-optical-sizing", "font-size",
+ "font-size-adjust", "font-stretch", "font-style", "font-synthesis",
+ "font-variant", "font-variant-alternates", "font-variant-caps",
+ "font-variant-east-asian", "font-variant-ligatures", "font-variant-numeric",
+ "font-variant-position", "font-variation-settings", "font-weight", "gap",
+ "grid", "grid-area", "grid-auto-columns", "grid-auto-flow", "grid-auto-rows",
+ "grid-column", "grid-column-end", "grid-column-gap", "grid-column-start",
+ "grid-gap", "grid-row", "grid-row-end", "grid-row-gap", "grid-row-start",
+ "grid-template", "grid-template-areas", "grid-template-columns",
+ "grid-template-rows", "hanging-punctuation", "height", "hyphens", "icon",
+ "image-orientation", "image-rendering", "image-resolution", "inline-box-align",
+ "inset", "inset-block", "inset-block-end", "inset-block-start", "inset-inline",
+ "inset-inline-end", "inset-inline-start", "isolation", "justify-content",
+ "justify-items", "justify-self", "left", "letter-spacing", "line-break",
+ "line-height", "line-height-step", "line-stacking", "line-stacking-ruby",
+ "line-stacking-shift", "line-stacking-strategy", "list-style",
+ "list-style-image", "list-style-position", "list-style-type", "margin",
+ "margin-bottom", "margin-left", "margin-right", "margin-top", "marks",
+ "marquee-direction", "marquee-loop", "marquee-play-count", "marquee-speed",
+ "marquee-style", "mask-clip", "mask-composite", "mask-image", "mask-mode",
+ "mask-origin", "mask-position", "mask-repeat", "mask-size","mask-type",
+ "max-block-size", "max-height", "max-inline-size",
+ "max-width", "min-block-size", "min-height", "min-inline-size", "min-width",
+ "mix-blend-mode", "move-to", "nav-down", "nav-index", "nav-left", "nav-right",
+ "nav-up", "object-fit", "object-position", "offset", "offset-anchor",
+ "offset-distance", "offset-path", "offset-position", "offset-rotate",
+ "opacity", "order", "orphans", "outline", "outline-color", "outline-offset",
+ "outline-style", "outline-width", "overflow", "overflow-style",
+ "overflow-wrap", "overflow-x", "overflow-y", "padding", "padding-bottom",
+ "padding-left", "padding-right", "padding-top", "page", "page-break-after",
+ "page-break-before", "page-break-inside", "page-policy", "pause",
+ "pause-after", "pause-before", "perspective", "perspective-origin", "pitch",
+ "pitch-range", "place-content", "place-items", "place-self", "play-during",
+ "position", "presentation-level", "punctuation-trim", "quotes",
+ "region-break-after", "region-break-before", "region-break-inside",
+ "region-fragment", "rendering-intent", "resize", "rest", "rest-after",
+ "rest-before", "richness", "right", "rotate", "rotation", "rotation-point",
+ "row-gap", "ruby-align", "ruby-overhang", "ruby-position", "ruby-span",
+ "scale", "scroll-behavior", "scroll-margin", "scroll-margin-block",
+ "scroll-margin-block-end", "scroll-margin-block-start", "scroll-margin-bottom",
+ "scroll-margin-inline", "scroll-margin-inline-end",
+ "scroll-margin-inline-start", "scroll-margin-left", "scroll-margin-right",
+ "scroll-margin-top", "scroll-padding", "scroll-padding-block",
+ "scroll-padding-block-end", "scroll-padding-block-start",
+ "scroll-padding-bottom", "scroll-padding-inline", "scroll-padding-inline-end",
+ "scroll-padding-inline-start", "scroll-padding-left", "scroll-padding-right",
+ "scroll-padding-top", "scroll-snap-align", "scroll-snap-type",
+ "shape-image-threshold", "shape-inside", "shape-margin", "shape-outside",
+ "size", "speak", "speak-as", "speak-header", "speak-numeral",
+ "speak-punctuation", "speech-rate", "stress", "string-set", "tab-size",
+ "table-layout", "target", "target-name", "target-new", "target-position",
+ "text-align", "text-align-last", "text-combine-upright", "text-decoration",
+ "text-decoration-color", "text-decoration-line", "text-decoration-skip",
+ "text-decoration-skip-ink", "text-decoration-style", "text-emphasis",
+ "text-emphasis-color", "text-emphasis-position", "text-emphasis-style",
+ "text-height", "text-indent", "text-justify", "text-orientation",
+ "text-outline", "text-overflow", "text-rendering", "text-shadow",
+ "text-size-adjust", "text-space-collapse", "text-transform",
+ "text-underline-position", "text-wrap", "top", "touch-action", "transform", "transform-origin",
+ "transform-style", "transition", "transition-delay", "transition-duration",
+ "transition-property", "transition-timing-function", "translate",
+ "unicode-bidi", "user-select", "vertical-align", "visibility", "voice-balance",
+ "voice-duration", "voice-family", "voice-pitch", "voice-range", "voice-rate",
+ "voice-stress", "voice-volume", "volume", "white-space", "widows", "width",
+ "will-change", "word-break", "word-spacing", "word-wrap", "writing-mode", "z-index",
+ // SVG-specific
+ "clip-path", "clip-rule", "mask", "enable-background", "filter", "flood-color",
+ "flood-opacity", "lighting-color", "stop-color", "stop-opacity", "pointer-events",
+ "color-interpolation", "color-interpolation-filters",
+ "color-rendering", "fill", "fill-opacity", "fill-rule", "image-rendering",
+ "marker", "marker-end", "marker-mid", "marker-start", "paint-order", "shape-rendering", "stroke",
+ "stroke-dasharray", "stroke-dashoffset", "stroke-linecap", "stroke-linejoin",
+ "stroke-miterlimit", "stroke-opacity", "stroke-width", "text-rendering",
+ "baseline-shift", "dominant-baseline", "glyph-orientation-horizontal",
+ "glyph-orientation-vertical", "text-anchor", "writing-mode",
+ ], propertyKeywords = keySet(propertyKeywords_);
+
+ var nonStandardPropertyKeywords_ = [
+ "border-block", "border-block-color", "border-block-end",
+ "border-block-end-color", "border-block-end-style", "border-block-end-width",
+ "border-block-start", "border-block-start-color", "border-block-start-style",
+ "border-block-start-width", "border-block-style", "border-block-width",
+ "border-inline", "border-inline-color", "border-inline-end",
+ "border-inline-end-color", "border-inline-end-style",
+ "border-inline-end-width", "border-inline-start", "border-inline-start-color",
+ "border-inline-start-style", "border-inline-start-width",
+ "border-inline-style", "border-inline-width", "margin-block",
+ "margin-block-end", "margin-block-start", "margin-inline", "margin-inline-end",
+ "margin-inline-start", "padding-block", "padding-block-end",
+ "padding-block-start", "padding-inline", "padding-inline-end",
+ "padding-inline-start", "scroll-snap-stop", "scrollbar-3d-light-color",
+ "scrollbar-arrow-color", "scrollbar-base-color", "scrollbar-dark-shadow-color",
+ "scrollbar-face-color", "scrollbar-highlight-color", "scrollbar-shadow-color",
+ "scrollbar-track-color", "searchfield-cancel-button", "searchfield-decoration",
+ "searchfield-results-button", "searchfield-results-decoration", "shape-inside", "zoom"
+ ], nonStandardPropertyKeywords = keySet(nonStandardPropertyKeywords_);
+
+ var fontProperties_ = [
+ "font-display", "font-family", "src", "unicode-range", "font-variant",
+ "font-feature-settings", "font-stretch", "font-weight", "font-style"
+ ], fontProperties = keySet(fontProperties_);
+
+ var counterDescriptors_ = [
+ "additive-symbols", "fallback", "negative", "pad", "prefix", "range",
+ "speak-as", "suffix", "symbols", "system"
+ ], counterDescriptors = keySet(counterDescriptors_);
+
+ var colorKeywords_ = [
+ "aliceblue", "antiquewhite", "aqua", "aquamarine", "azure", "beige",
+ "bisque", "black", "blanchedalmond", "blue", "blueviolet", "brown",
+ "burlywood", "cadetblue", "chartreuse", "chocolate", "coral", "cornflowerblue",
+ "cornsilk", "crimson", "cyan", "darkblue", "darkcyan", "darkgoldenrod",
+ "darkgray", "darkgreen", "darkkhaki", "darkmagenta", "darkolivegreen",
+ "darkorange", "darkorchid", "darkred", "darksalmon", "darkseagreen",
+ "darkslateblue", "darkslategray", "darkturquoise", "darkviolet",
+ "deeppink", "deepskyblue", "dimgray", "dodgerblue", "firebrick",
+ "floralwhite", "forestgreen", "fuchsia", "gainsboro", "ghostwhite",
+ "gold", "goldenrod", "gray", "grey", "green", "greenyellow", "honeydew",
+ "hotpink", "indianred", "indigo", "ivory", "khaki", "lavender",
+ "lavenderblush", "lawngreen", "lemonchiffon", "lightblue", "lightcoral",
+ "lightcyan", "lightgoldenrodyellow", "lightgray", "lightgreen", "lightpink",
+ "lightsalmon", "lightseagreen", "lightskyblue", "lightslategray",
+ "lightsteelblue", "lightyellow", "lime", "limegreen", "linen", "magenta",
+ "maroon", "mediumaquamarine", "mediumblue", "mediumorchid", "mediumpurple",
+ "mediumseagreen", "mediumslateblue", "mediumspringgreen", "mediumturquoise",
+ "mediumvioletred", "midnightblue", "mintcream", "mistyrose", "moccasin",
+ "navajowhite", "navy", "oldlace", "olive", "olivedrab", "orange", "orangered",
+ "orchid", "palegoldenrod", "palegreen", "paleturquoise", "palevioletred",
+ "papayawhip", "peachpuff", "peru", "pink", "plum", "powderblue",
+ "purple", "rebeccapurple", "red", "rosybrown", "royalblue", "saddlebrown",
+ "salmon", "sandybrown", "seagreen", "seashell", "sienna", "silver", "skyblue",
+ "slateblue", "slategray", "snow", "springgreen", "steelblue", "tan",
+ "teal", "thistle", "tomato", "turquoise", "violet", "wheat", "white",
+ "whitesmoke", "yellow", "yellowgreen"
+ ], colorKeywords = keySet(colorKeywords_);
+
+ var valueKeywords_ = [
+ "above", "absolute", "activeborder", "additive", "activecaption", "afar",
+ "after-white-space", "ahead", "alias", "all", "all-scroll", "alphabetic", "alternate",
+ "always", "amharic", "amharic-abegede", "antialiased", "appworkspace",
+ "arabic-indic", "armenian", "asterisks", "attr", "auto", "auto-flow", "avoid", "avoid-column", "avoid-page",
+ "avoid-region", "axis-pan", "background", "backwards", "baseline", "below", "bidi-override", "binary",
+ "bengali", "blink", "block", "block-axis", "bold", "bolder", "border", "border-box",
+ "both", "bottom", "break", "break-all", "break-word", "bullets", "button", "button-bevel",
+ "buttonface", "buttonhighlight", "buttonshadow", "buttontext", "calc", "cambodian",
+ "capitalize", "caps-lock-indicator", "caption", "captiontext", "caret",
+ "cell", "center", "checkbox", "circle", "cjk-decimal", "cjk-earthly-branch",
+ "cjk-heavenly-stem", "cjk-ideographic", "clear", "clip", "close-quote",
+ "col-resize", "collapse", "color", "color-burn", "color-dodge", "column", "column-reverse",
+ "compact", "condensed", "contain", "content", "contents",
+ "content-box", "context-menu", "continuous", "copy", "counter", "counters", "cover", "crop",
+ "cross", "crosshair", "currentcolor", "cursive", "cyclic", "darken", "dashed", "decimal",
+ "decimal-leading-zero", "default", "default-button", "dense", "destination-atop",
+ "destination-in", "destination-out", "destination-over", "devanagari", "difference",
+ "disc", "discard", "disclosure-closed", "disclosure-open", "document",
+ "dot-dash", "dot-dot-dash",
+ "dotted", "double", "down", "e-resize", "ease", "ease-in", "ease-in-out", "ease-out",
+ "element", "ellipse", "ellipsis", "embed", "end", "ethiopic", "ethiopic-abegede",
+ "ethiopic-abegede-am-et", "ethiopic-abegede-gez", "ethiopic-abegede-ti-er",
+ "ethiopic-abegede-ti-et", "ethiopic-halehame-aa-er",
+ "ethiopic-halehame-aa-et", "ethiopic-halehame-am-et",
+ "ethiopic-halehame-gez", "ethiopic-halehame-om-et",
+ "ethiopic-halehame-sid-et", "ethiopic-halehame-so-et",
+ "ethiopic-halehame-ti-er", "ethiopic-halehame-ti-et", "ethiopic-halehame-tig",
+ "ethiopic-numeric", "ew-resize", "exclusion", "expanded", "extends", "extra-condensed",
+ "extra-expanded", "fantasy", "fast", "fill", "fill-box", "fixed", "flat", "flex", "flex-end", "flex-start", "footnotes",
+ "forwards", "from", "geometricPrecision", "georgian", "graytext", "grid", "groove",
+ "gujarati", "gurmukhi", "hand", "hangul", "hangul-consonant", "hard-light", "hebrew",
+ "help", "hidden", "hide", "higher", "highlight", "highlighttext",
+ "hiragana", "hiragana-iroha", "horizontal", "hsl", "hsla", "hue", "icon", "ignore",
+ "inactiveborder", "inactivecaption", "inactivecaptiontext", "infinite",
+ "infobackground", "infotext", "inherit", "initial", "inline", "inline-axis",
+ "inline-block", "inline-flex", "inline-grid", "inline-table", "inset", "inside", "intrinsic", "invert",
+ "italic", "japanese-formal", "japanese-informal", "justify", "kannada",
+ "katakana", "katakana-iroha", "keep-all", "khmer",
+ "korean-hangul-formal", "korean-hanja-formal", "korean-hanja-informal",
+ "landscape", "lao", "large", "larger", "left", "level", "lighter", "lighten",
+ "line-through", "linear", "linear-gradient", "lines", "list-item", "listbox", "listitem",
+ "local", "logical", "loud", "lower", "lower-alpha", "lower-armenian",
+ "lower-greek", "lower-hexadecimal", "lower-latin", "lower-norwegian",
+ "lower-roman", "lowercase", "ltr", "luminosity", "malayalam", "manipulation", "match", "matrix", "matrix3d",
+ "media-controls-background", "media-current-time-display",
+ "media-fullscreen-button", "media-mute-button", "media-play-button",
+ "media-return-to-realtime-button", "media-rewind-button",
+ "media-seek-back-button", "media-seek-forward-button", "media-slider",
+ "media-sliderthumb", "media-time-remaining-display", "media-volume-slider",
+ "media-volume-slider-container", "media-volume-sliderthumb", "medium",
+ "menu", "menulist", "menulist-button", "menulist-text",
+ "menulist-textfield", "menutext", "message-box", "middle", "min-intrinsic",
+ "mix", "mongolian", "monospace", "move", "multiple", "multiple_mask_images", "multiply", "myanmar", "n-resize",
+ "narrower", "ne-resize", "nesw-resize", "no-close-quote", "no-drop",
+ "no-open-quote", "no-repeat", "none", "normal", "not-allowed", "nowrap",
+ "ns-resize", "numbers", "numeric", "nw-resize", "nwse-resize", "oblique", "octal", "opacity", "open-quote",
+ "optimizeLegibility", "optimizeSpeed", "oriya", "oromo", "outset",
+ "outside", "outside-shape", "overlay", "overline", "padding", "padding-box",
+ "painted", "page", "paused", "persian", "perspective", "pinch-zoom", "plus-darker", "plus-lighter",
+ "pointer", "polygon", "portrait", "pre", "pre-line", "pre-wrap", "preserve-3d",
+ "progress", "push-button", "radial-gradient", "radio", "read-only",
+ "read-write", "read-write-plaintext-only", "rectangle", "region",
+ "relative", "repeat", "repeating-linear-gradient",
+ "repeating-radial-gradient", "repeat-x", "repeat-y", "reset", "reverse",
+ "rgb", "rgba", "ridge", "right", "rotate", "rotate3d", "rotateX", "rotateY",
+ "rotateZ", "round", "row", "row-resize", "row-reverse", "rtl", "run-in", "running",
+ "s-resize", "sans-serif", "saturation", "scale", "scale3d", "scaleX", "scaleY", "scaleZ", "screen",
+ "scroll", "scrollbar", "scroll-position", "se-resize", "searchfield",
+ "searchfield-cancel-button", "searchfield-decoration",
+ "searchfield-results-button", "searchfield-results-decoration", "self-start", "self-end",
+ "semi-condensed", "semi-expanded", "separate", "serif", "show", "sidama",
+ "simp-chinese-formal", "simp-chinese-informal", "single",
+ "skew", "skewX", "skewY", "skip-white-space", "slide", "slider-horizontal",
+ "slider-vertical", "sliderthumb-horizontal", "sliderthumb-vertical", "slow",
+ "small", "small-caps", "small-caption", "smaller", "soft-light", "solid", "somali",
+ "source-atop", "source-in", "source-out", "source-over", "space", "space-around", "space-between", "space-evenly", "spell-out", "square",
+ "square-button", "start", "static", "status-bar", "stretch", "stroke", "stroke-box", "sub",
+ "subpixel-antialiased", "svg_masks", "super", "sw-resize", "symbolic", "symbols", "system-ui", "table",
+ "table-caption", "table-cell", "table-column", "table-column-group",
+ "table-footer-group", "table-header-group", "table-row", "table-row-group",
+ "tamil",
+ "telugu", "text", "text-bottom", "text-top", "textarea", "textfield", "thai",
+ "thick", "thin", "threeddarkshadow", "threedface", "threedhighlight",
+ "threedlightshadow", "threedshadow", "tibetan", "tigre", "tigrinya-er",
+ "tigrinya-er-abegede", "tigrinya-et", "tigrinya-et-abegede", "to", "top",
+ "trad-chinese-formal", "trad-chinese-informal", "transform",
+ "translate", "translate3d", "translateX", "translateY", "translateZ",
+ "transparent", "ultra-condensed", "ultra-expanded", "underline", "unidirectional-pan", "unset", "up",
+ "upper-alpha", "upper-armenian", "upper-greek", "upper-hexadecimal",
+ "upper-latin", "upper-norwegian", "upper-roman", "uppercase", "urdu", "url",
+ "var", "vertical", "vertical-text", "view-box", "visible", "visibleFill", "visiblePainted",
+ "visibleStroke", "visual", "w-resize", "wait", "wave", "wider",
+ "window", "windowframe", "windowtext", "words", "wrap", "wrap-reverse", "x-large", "x-small", "xor",
+ "xx-large", "xx-small"
+ ], valueKeywords = keySet(valueKeywords_);
+
+ var allWords = documentTypes_.concat(mediaTypes_).concat(mediaFeatures_).concat(mediaValueKeywords_)
+ .concat(propertyKeywords_).concat(nonStandardPropertyKeywords_).concat(colorKeywords_)
+ .concat(valueKeywords_);
+ CodeMirror.registerHelper("hintWords", "css", allWords);
+
+ function tokenCComment(stream, state) {
+ var maybeEnd = false, ch;
+ while ((ch = stream.next()) != null) {
+ if (maybeEnd && ch == "/") {
+ state.tokenize = null;
+ break;
+ }
+ maybeEnd = (ch == "*");
+ }
+ return ["comment", "comment"];
+ }
+
+ CodeMirror.defineMIME("text/css", {
+ documentTypes: documentTypes,
+ mediaTypes: mediaTypes,
+ mediaFeatures: mediaFeatures,
+ mediaValueKeywords: mediaValueKeywords,
+ propertyKeywords: propertyKeywords,
+ nonStandardPropertyKeywords: nonStandardPropertyKeywords,
+ fontProperties: fontProperties,
+ counterDescriptors: counterDescriptors,
+ colorKeywords: colorKeywords,
+ valueKeywords: valueKeywords,
+ tokenHooks: {
+ "/": function(stream, state) {
+ if (!stream.eat("*")) return false;
+ state.tokenize = tokenCComment;
+ return tokenCComment(stream, state);
+ }
+ },
+ name: "css"
+ });
+
+ CodeMirror.defineMIME("text/x-scss", {
+ mediaTypes: mediaTypes,
+ mediaFeatures: mediaFeatures,
+ mediaValueKeywords: mediaValueKeywords,
+ propertyKeywords: propertyKeywords,
+ nonStandardPropertyKeywords: nonStandardPropertyKeywords,
+ colorKeywords: colorKeywords,
+ valueKeywords: valueKeywords,
+ fontProperties: fontProperties,
+ allowNested: true,
+ lineComment: "// ",
+ tokenHooks: {
+ "/": function(stream, state) {
+ if (stream.eat("/")) {
+ stream.skipToEnd();
+ return ["comment", "comment"];
+ } else if (stream.eat("*")) {
+ state.tokenize = tokenCComment;
+ return tokenCComment(stream, state);
+ } else {
+ return ["operator", "operator"];
+ }
+ },
+ ":": function(stream) {
+ if (stream.match(/\s*\{/, false))
+ return [null, null]
+ return false;
+ },
+ "$": function(stream) {
+ stream.match(/^[\w-]+/);
+ if (stream.match(/^\s*:/, false))
+ return ["variable-2", "variable-definition"];
+ return ["variable-2", "variable"];
+ },
+ "#": function(stream) {
+ if (!stream.eat("{")) return false;
+ return [null, "interpolation"];
+ }
+ },
+ name: "css",
+ helperType: "scss"
+ });
+
+ CodeMirror.defineMIME("text/x-less", {
+ mediaTypes: mediaTypes,
+ mediaFeatures: mediaFeatures,
+ mediaValueKeywords: mediaValueKeywords,
+ propertyKeywords: propertyKeywords,
+ nonStandardPropertyKeywords: nonStandardPropertyKeywords,
+ colorKeywords: colorKeywords,
+ valueKeywords: valueKeywords,
+ fontProperties: fontProperties,
+ allowNested: true,
+ lineComment: "// ",
+ tokenHooks: {
+ "/": function(stream, state) {
+ if (stream.eat("/")) {
+ stream.skipToEnd();
+ return ["comment", "comment"];
+ } else if (stream.eat("*")) {
+ state.tokenize = tokenCComment;
+ return tokenCComment(stream, state);
+ } else {
+ return ["operator", "operator"];
+ }
+ },
+ "@": function(stream) {
+ if (stream.eat("{")) return [null, "interpolation"];
+ if (stream.match(/^(charset|document|font-face|import|(-(moz|ms|o|webkit)-)?keyframes|media|namespace|page|supports)\b/i, false)) return false;
+ stream.eatWhile(/[\w\\\-]/);
+ if (stream.match(/^\s*:/, false))
+ return ["variable-2", "variable-definition"];
+ return ["variable-2", "variable"];
+ },
+ "&": function() {
+ return ["atom", "atom"];
+ }
+ },
+ name: "css",
+ helperType: "less"
+ });
+
+ CodeMirror.defineMIME("text/x-gss", {
+ documentTypes: documentTypes,
+ mediaTypes: mediaTypes,
+ mediaFeatures: mediaFeatures,
+ propertyKeywords: propertyKeywords,
+ nonStandardPropertyKeywords: nonStandardPropertyKeywords,
+ fontProperties: fontProperties,
+ counterDescriptors: counterDescriptors,
+ colorKeywords: colorKeywords,
+ valueKeywords: valueKeywords,
+ supportsAtComponent: true,
+ tokenHooks: {
+ "/": function(stream, state) {
+ if (!stream.eat("*")) return false;
+ state.tokenize = tokenCComment;
+ return tokenCComment(stream, state);
+ }
+ },
+ name: "css",
+ helperType: "gss"
+ });
+
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/mode/css/gss.html b/modules/cookiesplus/lib/CodeMirror/mode/css/gss.html
new file mode 100644
index 00000000..4f540573
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/mode/css/gss.html
@@ -0,0 +1,125 @@
+
+
+
+
+CodeMirror: Closure Stylesheets (GSS) mode
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff --git a/modules/cookiesplus/lib/CodeMirror/mode/css/gss_test.js b/modules/cookiesplus/lib/CodeMirror/mode/css/gss_test.js
new file mode 100644
index 00000000..afbad233
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/mode/css/gss_test.js
@@ -0,0 +1,37 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+(function() {
+ "use strict";
+
+ var mode = CodeMirror.getMode({indentUnit: 2}, "text/x-gss");
+ function MT(name) { test.mode(name, mode, Array.prototype.slice.call(arguments, 1), "gss"); }
+
+ MT("atComponent",
+ "[def @component] {",
+ "[tag foo] {",
+ " [property color]: [keyword black];",
+ "}",
+ "}");
+
+})();
diff --git a/modules/cookiesplus/lib/CodeMirror/mode/css/index.html b/modules/cookiesplus/lib/CodeMirror/mode/css/index.html
new file mode 100644
index 00000000..942de2a7
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/mode/css/index.html
@@ -0,0 +1,97 @@
+
+
+
+
+CodeMirror: CSS mode
+
+
+
+
+
+
+
+
+
+
+
The HTML mixed mode depends on the XML, JavaScript, and CSS modes.
+
+
It takes an optional mode configuration
+ option, tags, which can be used to add custom
+ behavior for specific tags. When given, it should be an object
+ mapping tag names (for example script) to arrays or
+ three-element arrays. Those inner arrays indicate [attributeName,
+ valueRegexp, modeSpec]
+ specifications. For example, you could use ["type", /^foo$/,
+ "foo"] to map the attribute type="foo" to
+ the foo mode. When the first two fields are null
+ ([null, null, "mode"]), the given mode is used for
+ any such tag that doesn't match any of the previously given
+ attributes. For example:
This is a list of every mode in the distribution. Each mode lives
+in a subdirectory of the mode/ directory, and typically
+defines a single JavaScript file that implements the mode. Loading
+such file will make the language available to CodeMirror, through
+the mode
+option.
+ JavaScript mode supports several configuration options:
+
+
json which will set the mode to expect JSON
+ data rather than a JavaScript program.
+
jsonld which will set the mode to expect
+ JSON-LD linked data rather
+ than a JavaScript program (demo).
+
typescript which will activate additional
+ syntax highlighting and some other things for TypeScript code
+ (demo).
+
statementIndent which (given a number) will
+ determine the amount of indentation to use for statements
+ continued on a new line.
+
wordCharacters, a regexp that indicates which
+ characters should be considered part of an identifier.
+ Defaults to /[\w$]/, which does not handle
+ non-ASCII identifiers. Can be set to something more elaborate
+ to improve Unicode support.
The XML mode supports these configuration parameters:
+
+
htmlMode (boolean)
+
This switches the mode to parse HTML instead of XML. This
+ means attributes do not have to be quoted, and some elements
+ (such as br) do not require a closing tag.
+
+
matchClosing (boolean)
+
Controls whether the mode checks that close tags match the
+ corresponding opening tag, and highlights mismatches as errors.
+ Defaults to true.
+
+
alignCDATA (boolean)
+
Setting this to true will force the opening tag of CDATA
+ blocks to not be indented.
+
+
+
+
MIME types defined:application/xml, text/html.
+
diff --git a/modules/cookiesplus/lib/CodeMirror/mode/xml/index.php b/modules/cookiesplus/lib/CodeMirror/mode/xml/index.php
new file mode 100644
index 00000000..327dc6bf
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/mode/xml/index.php
@@ -0,0 +1,32 @@
+]",
+ " text",
+ " [tag&bracket <][tag inner][tag&bracket />]",
+ "[tag&bracket ]");
+
+ MT("nonmatching",
+ "[tag&bracket <][tag top][tag&bracket >]",
+ " [tag&bracket <][tag inner][tag&bracket />]",
+ " [tag&bracket ]");
+
+ MT("doctype",
+ "[meta ]",
+ "[tag&bracket <][tag top][tag&bracket />]");
+
+ MT("cdata",
+ "[tag&bracket <][tag top][tag&bracket >]",
+ " [atom ]",
+ "[tag&bracket ]");
+
+ // HTML tests
+ mode = CodeMirror.getMode({indentUnit: 2}, "text/html");
+
+ MT("selfclose",
+ "[tag&bracket <][tag html][tag&bracket >]",
+ " [tag&bracket <][tag link] [attribute rel]=[string stylesheet] [attribute href]=[string \"/foobar\"][tag&bracket >]",
+ "[tag&bracket ]");
+
+ MT("list",
+ "[tag&bracket <][tag ol][tag&bracket >]",
+ " [tag&bracket <][tag li][tag&bracket >]one",
+ " [tag&bracket <][tag li][tag&bracket >]two",
+ "[tag&bracket ]");
+
+ MT("valueless",
+ "[tag&bracket <][tag input] [attribute type]=[string checkbox] [attribute checked][tag&bracket />]");
+
+ MT("pThenArticle",
+ "[tag&bracket <][tag p][tag&bracket >]",
+ " foo",
+ "[tag&bracket <][tag article][tag&bracket >]bar");
+
+})();
diff --git a/modules/cookiesplus/lib/CodeMirror/mode/xml/xml.js b/modules/cookiesplus/lib/CodeMirror/mode/xml/xml.js
new file mode 100644
index 00000000..5de56bbc
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/mode/xml/xml.js
@@ -0,0 +1,441 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+(function (mod) {
+ if (typeof exports == "object" && typeof module == "object") // CommonJS
+ mod(require("../../lib/codemirror"));
+ else if (typeof define == "function" && define.amd) // AMD
+ define(["../../lib/codemirror"], mod);
+ else // Plain browser env
+ mod(CodeMirror);
+})(function (CodeMirror) {
+ "use strict";
+
+ var htmlConfig = {
+ autoSelfClosers: {
+ 'area': true, 'base': true, 'br': true, 'col': true, 'command': true,
+ 'embed': true, 'frame': true, 'hr': true, 'img': true, 'input': true,
+ 'keygen': true, 'link': true, 'meta': true, 'param': true, 'source': true,
+ 'track': true, 'wbr': true, 'menuitem': true
+ },
+ implicitlyClosed: {
+ 'dd': true, 'li': true, 'optgroup': true, 'option': true, 'p': true,
+ 'rp': true, 'rt': true, 'tbody': true, 'td': true, 'tfoot': true,
+ 'th': true, 'tr': true
+ },
+ contextGrabbers: {
+ 'dd': {'dd': true, 'dt': true},
+ 'dt': {'dd': true, 'dt': true},
+ 'li': {'li': true},
+ 'option': {'option': true, 'optgroup': true},
+ 'optgroup': {'optgroup': true},
+ 'p': {
+ 'address': true, 'article': true, 'aside': true, 'blockquote': true, 'dir': true,
+ 'div': true, 'dl': true, 'fieldset': true, 'footer': true, 'form': true,
+ 'h1': true, 'h2': true, 'h3': true, 'h4': true, 'h5': true, 'h6': true,
+ 'header': true, 'hgroup': true, 'hr': true, 'menu': true, 'nav': true, 'ol': true,
+ 'p': true, 'pre': true, 'section': true, 'table': true, 'ul': true
+ },
+ 'rp': {'rp': true, 'rt': true},
+ 'rt': {'rp': true, 'rt': true},
+ 'tbody': {'tbody': true, 'tfoot': true},
+ 'td': {'td': true, 'th': true},
+ 'tfoot': {'tbody': true},
+ 'th': {'td': true, 'th': true},
+ 'thead': {'tbody': true, 'tfoot': true},
+ 'tr': {'tr': true}
+ },
+ doNotIndent: {"pre": true},
+ allowUnquoted: true,
+ allowMissing: true,
+ caseFold: true
+ }
+
+ var xmlConfig = {
+ autoSelfClosers: {},
+ implicitlyClosed: {},
+ contextGrabbers: {},
+ doNotIndent: {},
+ allowUnquoted: false,
+ allowMissing: false,
+ allowMissingTagName: false,
+ caseFold: false
+ }
+
+ CodeMirror.defineMode("xml", function (editorConf, config_) {
+ var indentUnit = editorConf.indentUnit
+ var config = {}
+ var defaults = config_.htmlMode ? htmlConfig : xmlConfig
+ for (var prop in defaults) config[prop] = defaults[prop]
+ for (var prop in config_) config[prop] = config_[prop]
+
+ // Return variables for tokenizers
+ var type, setStyle;
+
+ function inText(stream, state) {
+ function chain(parser) {
+ state.tokenize = parser;
+ return parser(stream, state);
+ }
+
+ var ch = stream.next();
+ if (ch == "<") {
+ if (stream.eat("!")) {
+ if (stream.eat("[")) {
+ if (stream.match("CDATA[")) return chain(inBlock("atom", "]]>"));
+ else return null;
+ } else if (stream.match("--")) {
+ return chain(inBlock("comment", "-->"));
+ } else if (stream.match("DOCTYPE", true, true)) {
+ stream.eatWhile(/[\w\._\-]/);
+ return chain(doctype(1));
+ } else {
+ return null;
+ }
+ } else if (stream.eat("?")) {
+ stream.eatWhile(/[\w\._\-]/);
+ state.tokenize = inBlock("meta", "?>");
+ return "meta";
+ } else {
+ type = stream.eat("/") ? "closeTag" : "openTag";
+ state.tokenize = inTag;
+ return "tag bracket";
+ }
+ } else if (ch == "&") {
+ var ok;
+ if (stream.eat("#")) {
+ if (stream.eat("x")) {
+ ok = stream.eatWhile(/[a-fA-F\d]/) && stream.eat(";");
+ } else {
+ ok = stream.eatWhile(/[\d]/) && stream.eat(";");
+ }
+ } else {
+ ok = stream.eatWhile(/[\w\.\-:]/) && stream.eat(";");
+ }
+ return ok ? "atom" : "error";
+ } else {
+ stream.eatWhile(/[^&<]/);
+ return null;
+ }
+ }
+
+ inText.isInText = true;
+
+ function inTag(stream, state) {
+ var ch = stream.next();
+ if (ch == ">" || (ch == "/" && stream.eat(">"))) {
+ state.tokenize = inText;
+ type = ch == ">" ? "endTag" : "selfcloseTag";
+ return "tag bracket";
+ } else if (ch == "=") {
+ type = "equals";
+ return null;
+ } else if (ch == "<") {
+ state.tokenize = inText;
+ state.state = baseState;
+ state.tagName = state.tagStart = null;
+ var next = state.tokenize(stream, state);
+ return next ? next + " tag error" : "tag error";
+ } else if (/[\'\"]/.test(ch)) {
+ state.tokenize = inAttribute(ch);
+ state.stringStartCol = stream.column();
+ return state.tokenize(stream, state);
+ } else {
+ stream.match(/^[^\s\u00a0=<>\"\']*[^\s\u00a0=<>\"\'\/]/);
+ return "word";
+ }
+ }
+
+ function inAttribute(quote) {
+ var closure = function (stream, state) {
+ while (!stream.eol()) {
+ if (stream.next() == quote) {
+ state.tokenize = inTag;
+ break;
+ }
+ }
+ return "string";
+ };
+ closure.isInAttribute = true;
+ return closure;
+ }
+
+ function inBlock(style, terminator) {
+ return function (stream, state) {
+ while (!stream.eol()) {
+ if (stream.match(terminator)) {
+ state.tokenize = inText;
+ break;
+ }
+ stream.next();
+ }
+ return style;
+ }
+ }
+
+ function doctype(depth) {
+ return function (stream, state) {
+ var ch;
+ while ((ch = stream.next()) != null) {
+ if (ch == "<") {
+ state.tokenize = doctype(depth + 1);
+ return state.tokenize(stream, state);
+ } else if (ch == ">") {
+ if (depth == 1) {
+ state.tokenize = inText;
+ break;
+ } else {
+ state.tokenize = doctype(depth - 1);
+ return state.tokenize(stream, state);
+ }
+ }
+ }
+ return "meta";
+ };
+ }
+
+ function Context(state, tagName, startOfLine) {
+ this.prev = state.context;
+ this.tagName = tagName;
+ this.indent = state.indented;
+ this.startOfLine = startOfLine;
+ if (config.doNotIndent.hasOwnProperty(tagName) || (state.context && state.context.noIndent))
+ this.noIndent = true;
+ }
+
+ function popContext(state) {
+ if (state.context) state.context = state.context.prev;
+ }
+
+ function maybePopContext(state, nextTagName) {
+ var parentTagName;
+ while (true) {
+ if (!state.context) {
+ return;
+ }
+ parentTagName = state.context.tagName;
+ if (!config.contextGrabbers.hasOwnProperty(parentTagName) ||
+ !config.contextGrabbers[parentTagName].hasOwnProperty(nextTagName)) {
+ return;
+ }
+ popContext(state);
+ }
+ }
+
+ function baseState(type, stream, state) {
+ if (type == "openTag") {
+ state.tagStart = stream.column();
+ return tagNameState;
+ } else if (type == "closeTag") {
+ return closeTagNameState;
+ } else {
+ return baseState;
+ }
+ }
+
+ function tagNameState(type, stream, state) {
+ if (type == "word") {
+ state.tagName = stream.current();
+ setStyle = "tag";
+ return attrState;
+ } else if (config.allowMissingTagName && type == "endTag") {
+ setStyle = "tag bracket";
+ return attrState(type, stream, state);
+ } else {
+ setStyle = "error";
+ return tagNameState;
+ }
+ }
+
+ function closeTagNameState(type, stream, state) {
+ if (type == "word") {
+ var tagName = stream.current();
+ if (state.context && state.context.tagName != tagName &&
+ config.implicitlyClosed.hasOwnProperty(state.context.tagName))
+ popContext(state);
+ if ((state.context && state.context.tagName == tagName) || config.matchClosing === false) {
+ setStyle = "tag";
+ return closeState;
+ } else {
+ setStyle = "tag error";
+ return closeStateErr;
+ }
+ } else if (config.allowMissingTagName && type == "endTag") {
+ setStyle = "tag bracket";
+ return closeState(type, stream, state);
+ } else {
+ setStyle = "error";
+ return closeStateErr;
+ }
+ }
+
+ function closeState(type, _stream, state) {
+ if (type != "endTag") {
+ setStyle = "error";
+ return closeState;
+ }
+ popContext(state);
+ return baseState;
+ }
+
+ function closeStateErr(type, stream, state) {
+ setStyle = "error";
+ return closeState(type, stream, state);
+ }
+
+ function attrState(type, _stream, state) {
+ if (type == "word") {
+ setStyle = "attribute";
+ return attrEqState;
+ } else if (type == "endTag" || type == "selfcloseTag") {
+ var tagName = state.tagName, tagStart = state.tagStart;
+ state.tagName = state.tagStart = null;
+ if (type == "selfcloseTag" ||
+ config.autoSelfClosers.hasOwnProperty(tagName)) {
+ maybePopContext(state, tagName);
+ } else {
+ maybePopContext(state, tagName);
+ state.context = new Context(state, tagName, tagStart == state.indented);
+ }
+ return baseState;
+ }
+ setStyle = "error";
+ return attrState;
+ }
+
+ function attrEqState(type, stream, state) {
+ if (type == "equals") return attrValueState;
+ if (!config.allowMissing) setStyle = "error";
+ return attrState(type, stream, state);
+ }
+
+ function attrValueState(type, stream, state) {
+ if (type == "string") return attrContinuedState;
+ if (type == "word" && config.allowUnquoted) {
+ setStyle = "string";
+ return attrState;
+ }
+ setStyle = "error";
+ return attrState(type, stream, state);
+ }
+
+ function attrContinuedState(type, stream, state) {
+ if (type == "string") return attrContinuedState;
+ return attrState(type, stream, state);
+ }
+
+ return {
+ startState: function (baseIndent) {
+ var state = {
+ tokenize: inText,
+ state: baseState,
+ indented: baseIndent || 0,
+ tagName: null, tagStart: null,
+ context: null
+ }
+ if (baseIndent != null) state.baseIndent = baseIndent
+ return state
+ },
+
+ token: function (stream, state) {
+ if (!state.tagName && stream.sol())
+ state.indented = stream.indentation();
+
+ if (stream.eatSpace()) return null;
+ type = null;
+ var style = state.tokenize(stream, state);
+ if ((style || type) && style != "comment") {
+ setStyle = null;
+ state.state = state.state(type || style, stream, state);
+ if (setStyle)
+ style = setStyle == "error" ? style + " error" : setStyle;
+ }
+ return style;
+ },
+
+ indent: function (state, textAfter, fullLine) {
+ var context = state.context;
+ // Indent multi-line strings (e.g. css).
+ if (state.tokenize.isInAttribute) {
+ if (state.tagStart == state.indented)
+ return state.stringStartCol + 1;
+ else
+ return state.indented + indentUnit;
+ }
+ if (context && context.noIndent) return CodeMirror.Pass;
+ if (state.tokenize != inTag && state.tokenize != inText)
+ return fullLine ? fullLine.match(/^(\s*)/)[0].length : 0;
+ // Indent the starts of attribute names.
+ if (state.tagName) {
+ if (config.multilineTagIndentPastTag !== false)
+ return state.tagStart + state.tagName.length + 2;
+ else
+ return state.tagStart + indentUnit * (config.multilineTagIndentFactor || 1);
+ }
+ if (config.alignCDATA && /$/,
+ blockCommentStart: "",
+
+ configuration: config.htmlMode ? "html" : "xml",
+ helperType: config.htmlMode ? "html" : "xml",
+
+ skipAttribute: function (state) {
+ if (state.state == attrValueState)
+ state.state = attrState
+ }
+ };
+ });
+
+ CodeMirror.defineMIME("text/xml", "xml");
+ CodeMirror.defineMIME("application/xml", "xml");
+ if (!CodeMirror.mimeModes.hasOwnProperty("text/html"))
+ CodeMirror.defineMIME("text/html", {name: "xml", htmlMode: true});
+
+});
diff --git a/modules/cookiesplus/lib/CodeMirror/package.json b/modules/cookiesplus/lib/CodeMirror/package.json
new file mode 100644
index 00000000..faf0ca08
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/package.json
@@ -0,0 +1,47 @@
+{
+ "name": "codemirror",
+ "version": "5.57.0",
+ "main": "lib/codemirror.js",
+ "style": "lib/codemirror.css",
+ "author": {
+ "name": "Marijn Haverbeke",
+ "email": "marijnh@gmail.com",
+ "url": "http://marijnhaverbeke.nl"
+ },
+ "description": "Full-featured in-browser code editor",
+ "license": "MIT",
+ "directories": {
+ "lib": "./lib"
+ },
+ "scripts": {
+ "build": "rollup -c",
+ "watch": "rollup -w -c",
+ "prepare": "npm run-script build",
+ "test": "node ./test/run.js",
+ "lint": "bin/lint"
+ },
+ "devDependencies": {
+ "@rollup/plugin-buble": "^0.21.3",
+ "blint": "^1.1.0",
+ "node-static": "0.7.11",
+ "puppeteer": "^1.20.0",
+ "rollup": "^1.26.3"
+ },
+ "bugs": "http://github.com/codemirror/CodeMirror/issues",
+ "keywords": [
+ "JavaScript",
+ "CodeMirror",
+ "Editor"
+ ],
+ "homepage": "https://codemirror.net",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/codemirror/CodeMirror.git"
+ },
+ "jspm": {
+ "directories": {},
+ "dependencies": {},
+ "devDependencies": {}
+ },
+ "dependencies": {}
+}
diff --git a/modules/cookiesplus/lib/CodeMirror/rollup.config.js b/modules/cookiesplus/lib/CodeMirror/rollup.config.js
new file mode 100644
index 00000000..85e45feb
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/rollup.config.js
@@ -0,0 +1,65 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+import buble from '@rollup/plugin-buble';
+
+export default [
+ {
+ input: "src/codemirror.js",
+ output: {
+ banner: `// CodeMirror, copyright (c) by Marijn Haverbeke and others
+// Distributed under an MIT license: https://codemirror.net/LICENSE
+
+// This is CodeMirror (https://codemirror.net), a code editor
+// implemented in JavaScript on top of the browser's DOM.
+//
+// You can find some technical background for some of the code below
+// at http://marijnhaverbeke.nl/blog/#cm-internals .
+`,
+ format: "umd",
+ file: "lib/codemirror.js",
+ name: "CodeMirror"
+ },
+ plugins: [ buble({namedFunctionExpressions: false}) ]
+ },
+ {
+ input: ["src/addon/runmode/runmode-standalone.js"],
+ output: {
+ format: "iife",
+ file: "addon/runmode/runmode-standalone.js",
+ name: "CodeMirror",
+ freeze: false, // IE8 doesn't support Object.freeze.
+ },
+ plugins: [ buble({namedFunctionExpressions: false}) ]
+ },
+ {
+ input: ["src/addon/runmode/runmode.node.js"],
+ output: {
+ format: "cjs",
+ file: "addon/runmode/runmode.node.js",
+ name: "CodeMirror",
+ freeze: false, // IE8 doesn't support Object.freeze.
+ },
+ plugins: [ buble({namedFunctionExpressions: false}) ]
+ },
+];
diff --git a/modules/cookiesplus/lib/CodeMirror/theme/index.php b/modules/cookiesplus/lib/CodeMirror/theme/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/CodeMirror/theme/index.php
@@ -0,0 +1,32 @@
+ span::selection, .cm-s-monokai .CodeMirror-line > span > span::selection { background: rgba(73, 72, 62, .99); }
+.cm-s-monokai .CodeMirror-line::-moz-selection, .cm-s-monokai .CodeMirror-line > span::-moz-selection, .cm-s-monokai .CodeMirror-line > span > span::-moz-selection { background: rgba(73, 72, 62, .99); }
+.cm-s-monokai .CodeMirror-gutters { background: #272822; border-right: 0px; }
+.cm-s-monokai .CodeMirror-guttermarker { color: white; }
+.cm-s-monokai .CodeMirror-guttermarker-subtle { color: #d0d0d0; }
+.cm-s-monokai .CodeMirror-linenumber { color: #d0d0d0; }
+.cm-s-monokai .CodeMirror-cursor { border-left: 1px solid #f8f8f0; }
+
+.cm-s-monokai span.cm-comment { color: #75715e; }
+.cm-s-monokai span.cm-atom { color: #ae81ff; }
+.cm-s-monokai span.cm-number { color: #ae81ff; }
+
+.cm-s-monokai span.cm-comment.cm-attribute { color: #97b757; }
+.cm-s-monokai span.cm-comment.cm-def { color: #bc9262; }
+.cm-s-monokai span.cm-comment.cm-tag { color: #bc6283; }
+.cm-s-monokai span.cm-comment.cm-type { color: #5998a6; }
+
+.cm-s-monokai span.cm-property, .cm-s-monokai span.cm-attribute { color: #a6e22e; }
+.cm-s-monokai span.cm-keyword { color: #f92672; }
+.cm-s-monokai span.cm-builtin { color: #66d9ef; }
+.cm-s-monokai span.cm-string { color: #e6db74; }
+
+.cm-s-monokai span.cm-variable { color: #f8f8f2; }
+.cm-s-monokai span.cm-variable-2 { color: #9effff; }
+.cm-s-monokai span.cm-variable-3, .cm-s-monokai span.cm-type { color: #66d9ef; }
+.cm-s-monokai span.cm-def { color: #fd971f; }
+.cm-s-monokai span.cm-bracket { color: #f8f8f2; }
+.cm-s-monokai span.cm-tag { color: #f92672; }
+.cm-s-monokai span.cm-header { color: #ae81ff; }
+.cm-s-monokai span.cm-link { color: #ae81ff; }
+.cm-s-monokai span.cm-error { background: #f92672; color: #f8f8f0; }
+
+.cm-s-monokai .CodeMirror-activeline-background { background: #373831; }
+.cm-s-monokai .CodeMirror-matchingbracket {
+ text-decoration: underline;
+ color: white !important;
+}
diff --git a/modules/cookiesplus/lib/index.php b/modules/cookiesplus/lib/index.php
new file mode 100644
index 00000000..89097f3f
--- /dev/null
+++ b/modules/cookiesplus/lib/index.php
@@ -0,0 +1,32 @@
+.shepherd-arrow {
+ bottom: -8px
+}
+
+.shepherd-element[data-popper-placement^=bottom]>.shepherd-arrow {
+ top: -8px
+}
+
+.shepherd-element[data-popper-placement^=left]>.shepherd-arrow {
+ right: -8px
+}
+
+.shepherd-element[data-popper-placement^=right]>.shepherd-arrow {
+ left: -8px
+}
+
+.shepherd-element.shepherd-centered>.shepherd-arrow {
+ opacity: 0
+}
+
+.shepherd-element.shepherd-has-title[data-popper-placement^=bottom]>.shepherd-arrow:before {
+ background-color: #e6e6e6
+}
+
+.shepherd-target-click-disabled.shepherd-enabled.shepherd-target,
+.shepherd-target-click-disabled.shepherd-enabled.shepherd-target * {
+ pointer-events: none
+}
+
+.shepherd-modal-overlay-container {
+ -ms-filter: progid:dximagetransform.microsoft.gradient.alpha(Opacity=50);
+ filter: alpha(opacity=50);
+ height: 0;
+ left: 0;
+ opacity: 0;
+ overflow: hidden;
+ pointer-events: none;
+ position: fixed;
+ top: 0;
+ transition: all .3s ease-out, height 0ms .3s, opacity .3s 0ms;
+ width: 100vw;
+ z-index: 9997
+}
+
+.shepherd-modal-overlay-container.shepherd-modal-is-visible {
+ height: 100vh;
+ opacity: .5;
+ transition: all .3s ease-out, height 0s 0s, opacity .3s 0s
+}
+
+.shepherd-modal-overlay-container.shepherd-modal-is-visible path {
+ pointer-events: all
+}
+
+.shepherd-content {
+ border-radius: 5px;
+ outline: none;
+ padding: 0
+}
+
+.shepherd-footer {
+ border-bottom-left-radius: 5px;
+ border-bottom-right-radius: 5px;
+ display: flex;
+ justify-content: flex-end;
+ padding: 0 .75rem .75rem
+}
+
+.shepherd-footer .shepherd-button:last-child {
+ margin-right: 0
+}
+
+.shepherd-header {
+ align-items: center;
+ border-top-left-radius: 5px;
+ border-top-right-radius: 5px;
+ display: flex;
+ justify-content: flex-end;
+ line-height: 2em;
+ padding: .75rem .75rem 0
+}
+
+.shepherd-has-title .shepherd-content .shepherd-header {
+ background: #e6e6e6;
+ padding: 1em
+}
+
+.shepherd-text {
+ /*color: rgba(0, 0, 0, .75);
+ font-size: 1rem;
+ line-height: 1.3em;*/
+ padding: 1em
+}
+
+.shepherd-text p {
+ margin-top: 0
+}
+
+.shepherd-text p:last-child {
+ margin-bottom: 0
+}
+
+.shepherd-button {
+ background: #3288e6;
+ border: 0;
+ border-radius: 3px;
+ color: white;
+ cursor: pointer;
+ margin-right: .5rem;
+ padding: .5rem 1.5rem;
+ transition: all .5s ease
+}
+
+.shepherd-button:not(:disabled):hover {
+ background: #196fcc;
+ color: white
+}
+
+.shepherd-button.shepherd-button-secondary {
+ background: #f1f2f3;
+ color: rgba(0, 0, 0, .75)
+}
+
+.shepherd-button.shepherd-button-secondary:not(:disabled):hover {
+ background: #d6d9db;
+ color: rgba(0, 0, 0, .75)
+}
+
+.shepherd-button:disabled {
+ cursor: not-allowed
+}
+
+.shepherd-cancel-icon {
+ background: transparent;
+ border: none;
+ color: black;
+ font-size: 2em;
+ cursor: pointer;
+ font-weight: 400;
+ margin: 0;
+ padding: 0;
+ transition: color .5s ease
+}
+
+.shepherd-cancel-icon:hover {
+ color: rgba(0, 0, 0, .75)
+}
+
+.shepherd-has-title .shepherd-content .shepherd-cancel-icon {
+ color: black
+}
+
+.shepherd-has-title .shepherd-content .shepherd-cancel-icon:hover {
+ color: rgba(0, 0, 0, .75)
+}
+
+.shepherd-title {
+ color: rgba(0, 0, 0, .75);
+ display: flex;
+ font-size: 1rem;
+ font-weight: 400;
+ flex: 1 0 auto;
+ margin: 0;
+ padding: 0
+}
diff --git a/modules/cookiesplus/lib/shepherd/shepherd.js b/modules/cookiesplus/lib/shepherd/shepherd.js
new file mode 100644
index 00000000..39c57a41
--- /dev/null
+++ b/modules/cookiesplus/lib/shepherd/shepherd.js
@@ -0,0 +1,5861 @@
+/*
+ * ISC License
+ *
+ * Copyright (c) 2024 idnovate.com
+ * idnovate is a Registered Trademark & Property of idnovate.com, innovación y desarrollo SCP
+ *
+ * Permission to use, copy, modify, and/or distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
+ * REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
+ * AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
+ * INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
+ * LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
+ * OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
+ * PERFORMANCE OF THIS SOFTWARE.
+ *
+ * @author idnovate
+ * @copyright 2024 idnovate
+ * @license https://www.isc.org/licenses/ https://opensource.org/licenses/ISC ISC License
+ */
+
+/*! shepherd.js 8.1.0 */
+(function (global, factory) {
+ typeof exports === 'object' && typeof module !== 'undefined' ? module.exports = factory() :
+ typeof define === 'function' && define.amd ? define(factory) :
+ (global = typeof globalThis !== 'undefined' ? globalThis : global || self, global.Shepherd = factory());
+}(this, (function () { 'use strict';
+
+ var isMergeableObject = function isMergeableObject(value) {
+ return isNonNullObject(value) && !isSpecial(value);
+ };
+
+ function isNonNullObject(value) {
+ return !!value && typeof value === 'object';
+ }
+
+ function isSpecial(value) {
+ var stringValue = Object.prototype.toString.call(value);
+ return stringValue === '[object RegExp]' || stringValue === '[object Date]' || isReactElement(value);
+ } // see https://github.com/facebook/react/blob/b5ac963fb791d1298e7f396236383bc955f916c1/src/isomorphic/classic/element/ReactElement.js#L21-L25
+
+
+ var canUseSymbol = typeof Symbol === 'function' && Symbol.for;
+ var REACT_ELEMENT_TYPE = canUseSymbol ? Symbol.for('react.element') : 0xeac7;
+
+ function isReactElement(value) {
+ return value.$$typeof === REACT_ELEMENT_TYPE;
+ }
+
+ function emptyTarget(val) {
+ return Array.isArray(val) ? [] : {};
+ }
+
+ function cloneUnlessOtherwiseSpecified(value, options) {
+ return options.clone !== false && options.isMergeableObject(value) ? deepmerge(emptyTarget(value), value, options) : value;
+ }
+
+ function defaultArrayMerge(target, source, options) {
+ return target.concat(source).map(function (element) {
+ return cloneUnlessOtherwiseSpecified(element, options);
+ });
+ }
+
+ function getMergeFunction(key, options) {
+ if (!options.customMerge) {
+ return deepmerge;
+ }
+
+ var customMerge = options.customMerge(key);
+ return typeof customMerge === 'function' ? customMerge : deepmerge;
+ }
+
+ function getEnumerableOwnPropertySymbols(target) {
+ return Object.getOwnPropertySymbols ? Object.getOwnPropertySymbols(target).filter(function (symbol) {
+ return target.propertyIsEnumerable(symbol);
+ }) : [];
+ }
+
+ function getKeys(target) {
+ return Object.keys(target).concat(getEnumerableOwnPropertySymbols(target));
+ }
+
+ function propertyIsOnObject(object, property) {
+ try {
+ return property in object;
+ } catch (_) {
+ return false;
+ }
+ } // Protects from prototype poisoning and unexpected merging up the prototype chain.
+
+
+ function propertyIsUnsafe(target, key) {
+ return propertyIsOnObject(target, key) // Properties are safe to merge if they don't exist in the target yet,
+ && !(Object.hasOwnProperty.call(target, key) // unsafe if they exist up the prototype chain,
+ && Object.propertyIsEnumerable.call(target, key)); // and also unsafe if they're nonenumerable.
+ }
+
+ function mergeObject(target, source, options) {
+ var destination = {};
+
+ if (options.isMergeableObject(target)) {
+ getKeys(target).forEach(function (key) {
+ destination[key] = cloneUnlessOtherwiseSpecified(target[key], options);
+ });
+ }
+
+ getKeys(source).forEach(function (key) {
+ if (propertyIsUnsafe(target, key)) {
+ return;
+ }
+
+ if (propertyIsOnObject(target, key) && options.isMergeableObject(source[key])) {
+ destination[key] = getMergeFunction(key, options)(target[key], source[key], options);
+ } else {
+ destination[key] = cloneUnlessOtherwiseSpecified(source[key], options);
+ }
+ });
+ return destination;
+ }
+
+ function deepmerge(target, source, options) {
+ options = options || {};
+ options.arrayMerge = options.arrayMerge || defaultArrayMerge;
+ options.isMergeableObject = options.isMergeableObject || isMergeableObject; // cloneUnlessOtherwiseSpecified is added to `options` so that custom arrayMerge()
+ // implementations can use it. The caller may not replace it.
+
+ options.cloneUnlessOtherwiseSpecified = cloneUnlessOtherwiseSpecified;
+ var sourceIsArray = Array.isArray(source);
+ var targetIsArray = Array.isArray(target);
+ var sourceAndTargetTypesMatch = sourceIsArray === targetIsArray;
+
+ if (!sourceAndTargetTypesMatch) {
+ return cloneUnlessOtherwiseSpecified(source, options);
+ } else if (sourceIsArray) {
+ return options.arrayMerge(target, source, options);
+ } else {
+ return mergeObject(target, source, options);
+ }
+ }
+
+ deepmerge.all = function deepmergeAll(array, options) {
+ if (!Array.isArray(array)) {
+ throw new Error('first argument should be an array');
+ }
+
+ return array.reduce(function (prev, next) {
+ return deepmerge(prev, next, options);
+ }, {});
+ };
+
+ var deepmerge_1 = deepmerge;
+ var cjs = deepmerge_1;
+
+ /**
+ * Checks if `value` is classified as an `Element`.
+ * @param {*} value The param to check if it is an Element
+ */
+ function isElement(value) {
+ return value instanceof Element;
+ }
+ /**
+ * Checks if `value` is classified as an `HTMLElement`.
+ * @param {*} value The param to check if it is an HTMLElement
+ */
+ function isHTMLElement(value) {
+ return value instanceof HTMLElement;
+ }
+ /**
+ * Checks if `value` is classified as a `Function` object.
+ * @param {*} value The param to check if it is a function
+ */
+ function isFunction(value) {
+ return typeof value === 'function';
+ }
+ /**
+ * Checks if `value` is classified as a `String` object.
+ * @param {*} value The param to check if it is a string
+ */
+ function isString(value) {
+ return typeof value === 'string';
+ }
+ /**
+ * Checks if `value` is undefined.
+ * @param {*} value The param to check if it is undefined
+ */
+ function isUndefined(value) {
+ return value === undefined;
+ }
+
+ class Evented {
+ on(event, handler, ctx, once = false) {
+ if (isUndefined(this.bindings)) {
+ this.bindings = {};
+ }
+
+ if (isUndefined(this.bindings[event])) {
+ this.bindings[event] = [];
+ }
+
+ this.bindings[event].push({
+ handler,
+ ctx,
+ once
+ });
+ return this;
+ }
+
+ once(event, handler, ctx) {
+ return this.on(event, handler, ctx, true);
+ }
+
+ off(event, handler) {
+ if (isUndefined(this.bindings) || isUndefined(this.bindings[event])) {
+ return this;
+ }
+
+ if (isUndefined(handler)) {
+ delete this.bindings[event];
+ } else {
+ this.bindings[event].forEach((binding, index) => {
+ if (binding.handler === handler) {
+ this.bindings[event].splice(index, 1);
+ }
+ });
+ }
+
+ return this;
+ }
+
+ trigger(event, ...args) {
+ if (!isUndefined(this.bindings) && this.bindings[event]) {
+ this.bindings[event].forEach((binding, index) => {
+ const {
+ ctx,
+ handler,
+ once
+ } = binding;
+ const context = ctx || this;
+ handler.apply(context, args);
+
+ if (once) {
+ this.bindings[event].splice(index, 1);
+ }
+ });
+ }
+
+ return this;
+ }
+
+ }
+
+ /**
+ * Binds all the methods on a JS Class to the `this` context of the class.
+ * Adapted from https://github.com/sindresorhus/auto-bind
+ * @param {object} self The `this` context of the class
+ * @return {object} The `this` context of the class
+ */
+ function autoBind(self) {
+ const keys = Object.getOwnPropertyNames(self.constructor.prototype);
+
+ for (let i = 0; i < keys.length; i++) {
+ const key = keys[i];
+ const val = self[key];
+
+ if (key !== 'constructor' && typeof val === 'function') {
+ self[key] = val.bind(self);
+ }
+ }
+
+ return self;
+ }
+
+ /**
+ * Sets up the handler to determine if we should advance the tour
+ * @param {string} selector
+ * @param {Step} step The step instance
+ * @return {Function}
+ * @private
+ */
+ function _setupAdvanceOnHandler(selector, step) {
+ return event => {
+ if (step.isOpen()) {
+ const targetIsEl = step.el && event.currentTarget === step.el;
+ const targetIsSelector = !isUndefined(selector) && event.currentTarget.matches(selector);
+
+ if (targetIsSelector || targetIsEl) {
+ step.tour.next();
+ }
+ }
+ };
+ }
+ /**
+ * Bind the event handler for advanceOn
+ * @param {Step} step The step instance
+ */
+
+ function bindAdvance(step) {
+ // An empty selector matches the step element
+ const {
+ event,
+ selector
+ } = step.options.advanceOn || {};
+
+ if (event) {
+ const handler = _setupAdvanceOnHandler(selector, step); // TODO: this should also bind/unbind on show/hide
+
+
+ let el;
+
+ try {
+ el = document.querySelector(selector);
+ } catch (e) {// TODO
+ }
+
+ if (!isUndefined(selector) && !el) {
+ return console.error(`No element was found for the selector supplied to advanceOn: ${selector}`);
+ } else if (el) {
+ el.addEventListener(event, handler);
+ step.on('destroy', () => {
+ return el.removeEventListener(event, handler);
+ });
+ } else {
+ document.body.addEventListener(event, handler, true);
+ step.on('destroy', () => {
+ return document.body.removeEventListener(event, handler, true);
+ });
+ }
+ } else {
+ return console.error('advanceOn was defined, but no event name was passed.');
+ }
+ }
+
+ var top = 'top';
+ var bottom = 'bottom';
+ var right = 'right';
+ var left = 'left';
+ var auto = 'auto';
+ var basePlacements = [top, bottom, right, left];
+ var start = 'start';
+ var end = 'end';
+ var clippingParents = 'clippingParents';
+ var viewport = 'viewport';
+ var popper = 'popper';
+ var reference = 'reference';
+ var variationPlacements = /*#__PURE__*/basePlacements.reduce(function (acc, placement) {
+ return acc.concat([placement + "-" + start, placement + "-" + end]);
+ }, []);
+ var placements = /*#__PURE__*/[].concat(basePlacements, [auto]).reduce(function (acc, placement) {
+ return acc.concat([placement, placement + "-" + start, placement + "-" + end]);
+ }, []); // modifiers that need to read the DOM
+
+ var beforeRead = 'beforeRead';
+ var read = 'read';
+ var afterRead = 'afterRead'; // pure-logic modifiers
+
+ var beforeMain = 'beforeMain';
+ var main = 'main';
+ var afterMain = 'afterMain'; // modifier with the purpose to write to the DOM (or write into a framework state)
+
+ var beforeWrite = 'beforeWrite';
+ var write = 'write';
+ var afterWrite = 'afterWrite';
+ var modifierPhases = [beforeRead, read, afterRead, beforeMain, main, afterMain, beforeWrite, write, afterWrite];
+
+ function getNodeName(element) {
+ return element ? (element.nodeName || '').toLowerCase() : null;
+ }
+
+ /*:: import type { Window } from '../types'; */
+ /*:: declare function getWindow(node: Node | Window): Window; */
+ function getWindow(node) {
+ if (node.toString() !== '[object Window]') {
+ var ownerDocument = node.ownerDocument;
+ return ownerDocument ? ownerDocument.defaultView || window : window;
+ }
+
+ return node;
+ }
+
+ /*:: declare function isElement(node: mixed): boolean %checks(node instanceof
+ Element); */
+ function isElement$1(node) {
+ var OwnElement = getWindow(node).Element;
+ return node instanceof OwnElement || node instanceof Element;
+ }
+ /*:: declare function isHTMLElement(node: mixed): boolean %checks(node instanceof
+ HTMLElement); */
+
+ function isHTMLElement$1(node) {
+ var OwnElement = getWindow(node).HTMLElement;
+ return node instanceof OwnElement || node instanceof HTMLElement;
+ }
+ /*:: declare function isShadowRoot(node: mixed): boolean %checks(node instanceof
+ ShadowRoot); */
+
+ function isShadowRoot(node) {
+ var OwnElement = getWindow(node).ShadowRoot;
+ return node instanceof OwnElement || node instanceof ShadowRoot;
+ }
+
+ // and applies them to the HTMLElements such as popper and arrow
+
+ function applyStyles(_ref) {
+ var state = _ref.state;
+ Object.keys(state.elements).forEach(function (name) {
+ var style = state.styles[name] || {};
+ var attributes = state.attributes[name] || {};
+ var element = state.elements[name]; // arrow is optional + virtual elements
+
+ if (!isHTMLElement$1(element) || !getNodeName(element)) {
+ return;
+ } // Flow doesn't support to extend this property, but it's the most
+ // effective way to apply styles to an HTMLElement
+ // $FlowFixMe
+
+
+ Object.assign(element.style, style);
+ Object.keys(attributes).forEach(function (name) {
+ var value = attributes[name];
+
+ if (value === false) {
+ element.removeAttribute(name);
+ } else {
+ element.setAttribute(name, value === true ? '' : value);
+ }
+ });
+ });
+ }
+
+ function effect(_ref2) {
+ var state = _ref2.state;
+ var initialStyles = {
+ popper: {
+ position: state.options.strategy,
+ left: '0',
+ top: '0',
+ margin: '0'
+ },
+ arrow: {
+ position: 'absolute'
+ },
+ reference: {}
+ };
+ Object.assign(state.elements.popper.style, initialStyles.popper);
+
+ if (state.elements.arrow) {
+ Object.assign(state.elements.arrow.style, initialStyles.arrow);
+ }
+
+ return function () {
+ Object.keys(state.elements).forEach(function (name) {
+ var element = state.elements[name];
+ var attributes = state.attributes[name] || {};
+ var styleProperties = Object.keys(state.styles.hasOwnProperty(name) ? state.styles[name] : initialStyles[name]); // Set all values to an empty string to unset them
+
+ var style = styleProperties.reduce(function (style, property) {
+ style[property] = '';
+ return style;
+ }, {}); // arrow is optional + virtual elements
+
+ if (!isHTMLElement$1(element) || !getNodeName(element)) {
+ return;
+ } // Flow doesn't support to extend this property, but it's the most
+ // effective way to apply styles to an HTMLElement
+ // $FlowFixMe
+
+
+ Object.assign(element.style, style);
+ Object.keys(attributes).forEach(function (attribute) {
+ element.removeAttribute(attribute);
+ });
+ });
+ };
+ } // eslint-disable-next-line import/no-unused-modules
+
+
+ var applyStyles$1 = {
+ name: 'applyStyles',
+ enabled: true,
+ phase: 'write',
+ fn: applyStyles,
+ effect: effect,
+ requires: ['computeStyles']
+ };
+
+ function getBasePlacement(placement) {
+ return placement.split('-')[0];
+ }
+
+ // Returns the layout rect of an element relative to its offsetParent. Layout
+ // means it doesn't take into account transforms.
+ function getLayoutRect(element) {
+ return {
+ x: element.offsetLeft,
+ y: element.offsetTop,
+ width: element.offsetWidth,
+ height: element.offsetHeight
+ };
+ }
+
+ function contains(parent, child) {
+ var rootNode = child.getRootNode && child.getRootNode(); // First, attempt with faster native method
+
+ if (parent.contains(child)) {
+ return true;
+ } // then fallback to custom implementation with Shadow DOM support
+ else if (rootNode && isShadowRoot(rootNode)) {
+ var next = child;
+
+ do {
+ if (next && parent.isSameNode(next)) {
+ return true;
+ } // $FlowFixMe: need a better way to handle this...
+
+
+ next = next.parentNode || next.host;
+ } while (next);
+ } // Give up, the result is false
+
+
+ return false;
+ }
+
+ function getComputedStyle(element) {
+ return getWindow(element).getComputedStyle(element);
+ }
+
+ function isTableElement(element) {
+ return ['table', 'td', 'th'].indexOf(getNodeName(element)) >= 0;
+ }
+
+ function getDocumentElement(element) {
+ // $FlowFixMe: assume body is always available
+ return ((isElement$1(element) ? element.ownerDocument : element.document) || window.document).documentElement;
+ }
+
+ function getParentNode(element) {
+ if (getNodeName(element) === 'html') {
+ return element;
+ }
+
+ return (// $FlowFixMe: this is a quicker (but less type safe) way to save quite some bytes from the bundle
+ element.assignedSlot || // step into the shadow DOM of the parent of a slotted node
+ element.parentNode || // DOM Element detected
+ // $FlowFixMe: need a better way to handle this...
+ element.host || // ShadowRoot detected
+ // $FlowFixMe: HTMLElement is a Node
+ getDocumentElement(element) // fallback
+
+ );
+ }
+
+ function getTrueOffsetParent(element) {
+ if (!isHTMLElement$1(element) || // https://github.com/popperjs/popper-core/issues/837
+ getComputedStyle(element).position === 'fixed') {
+ return null;
+ }
+
+ var offsetParent = element.offsetParent;
+
+ if (offsetParent) {
+ var html = getDocumentElement(offsetParent);
+
+ if (getNodeName(offsetParent) === 'body' && getComputedStyle(offsetParent).position === 'static' && getComputedStyle(html).position !== 'static') {
+ return html;
+ }
+ }
+
+ return offsetParent;
+ } // `.offsetParent` reports `null` for fixed elements, while absolute elements
+ // return the containing block
+
+
+ function getContainingBlock(element) {
+ var currentNode = getParentNode(element);
+
+ while (isHTMLElement$1(currentNode) && ['html', 'body'].indexOf(getNodeName(currentNode)) < 0) {
+ var css = getComputedStyle(currentNode); // This is non-exhaustive but covers the most common CSS properties that
+ // create a containing block.
+
+ if (css.transform !== 'none' || css.perspective !== 'none' || css.willChange && css.willChange !== 'auto') {
+ return currentNode;
+ } else {
+ currentNode = currentNode.parentNode;
+ }
+ }
+
+ return null;
+ } // Gets the closest ancestor positioned element. Handles some edge cases,
+ // such as table ancestors and cross browser bugs.
+
+
+ function getOffsetParent(element) {
+ var window = getWindow(element);
+ var offsetParent = getTrueOffsetParent(element);
+
+ while (offsetParent && isTableElement(offsetParent) && getComputedStyle(offsetParent).position === 'static') {
+ offsetParent = getTrueOffsetParent(offsetParent);
+ }
+
+ if (offsetParent && getNodeName(offsetParent) === 'body' && getComputedStyle(offsetParent).position === 'static') {
+ return window;
+ }
+
+ return offsetParent || getContainingBlock(element) || window;
+ }
+
+ function getMainAxisFromPlacement(placement) {
+ return ['top', 'bottom'].indexOf(placement) >= 0 ? 'x' : 'y';
+ }
+
+ function within(min, value, max) {
+ return Math.max(min, Math.min(value, max));
+ }
+
+ function getFreshSideObject() {
+ return {
+ top: 0,
+ right: 0,
+ bottom: 0,
+ left: 0
+ };
+ }
+
+ function mergePaddingObject(paddingObject) {
+ return Object.assign(Object.assign({}, getFreshSideObject()), paddingObject);
+ }
+
+ function expandToHashMap(value, keys) {
+ return keys.reduce(function (hashMap, key) {
+ hashMap[key] = value;
+ return hashMap;
+ }, {});
+ }
+
+ function arrow(_ref) {
+ var _state$modifiersData$;
+
+ var state = _ref.state,
+ name = _ref.name;
+ var arrowElement = state.elements.arrow;
+ var popperOffsets = state.modifiersData.popperOffsets;
+ var basePlacement = getBasePlacement(state.placement);
+ var axis = getMainAxisFromPlacement(basePlacement);
+ var isVertical = [left, right].indexOf(basePlacement) >= 0;
+ var len = isVertical ? 'height' : 'width';
+
+ if (!arrowElement || !popperOffsets) {
+ return;
+ }
+
+ var paddingObject = state.modifiersData[name + "#persistent"].padding;
+ var arrowRect = getLayoutRect(arrowElement);
+ var minProp = axis === 'y' ? top : left;
+ var maxProp = axis === 'y' ? bottom : right;
+ var endDiff = state.rects.reference[len] + state.rects.reference[axis] - popperOffsets[axis] - state.rects.popper[len];
+ var startDiff = popperOffsets[axis] - state.rects.reference[axis];
+ var arrowOffsetParent = getOffsetParent(arrowElement);
+ var clientSize = arrowOffsetParent ? axis === 'y' ? arrowOffsetParent.clientHeight || 0 : arrowOffsetParent.clientWidth || 0 : 0;
+ var centerToReference = endDiff / 2 - startDiff / 2; // Make sure the arrow doesn't overflow the popper if the center point is
+ // outside of the popper bounds
+
+ var min = paddingObject[minProp];
+ var max = clientSize - arrowRect[len] - paddingObject[maxProp];
+ var center = clientSize / 2 - arrowRect[len] / 2 + centerToReference;
+ var offset = within(min, center, max); // Prevents breaking syntax highlighting...
+
+ var axisProp = axis;
+ state.modifiersData[name] = (_state$modifiersData$ = {}, _state$modifiersData$[axisProp] = offset, _state$modifiersData$.centerOffset = offset - center, _state$modifiersData$);
+ }
+
+ function effect$1(_ref2) {
+ var state = _ref2.state,
+ options = _ref2.options,
+ name = _ref2.name;
+ var _options$element = options.element,
+ arrowElement = _options$element === void 0 ? '[data-popper-arrow]' : _options$element,
+ _options$padding = options.padding,
+ padding = _options$padding === void 0 ? 0 : _options$padding;
+
+ if (arrowElement == null) {
+ return;
+ } // CSS selector
+
+
+ if (typeof arrowElement === 'string') {
+ arrowElement = state.elements.popper.querySelector(arrowElement);
+
+ if (!arrowElement) {
+ return;
+ }
+ }
+
+ if (!contains(state.elements.popper, arrowElement)) {
+
+ return;
+ }
+
+ state.elements.arrow = arrowElement;
+ state.modifiersData[name + "#persistent"] = {
+ padding: mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements))
+ };
+ } // eslint-disable-next-line import/no-unused-modules
+
+
+ var arrow$1 = {
+ name: 'arrow',
+ enabled: true,
+ phase: 'main',
+ fn: arrow,
+ effect: effect$1,
+ requires: ['popperOffsets'],
+ requiresIfExists: ['preventOverflow']
+ };
+
+ var unsetSides = {
+ top: 'auto',
+ right: 'auto',
+ bottom: 'auto',
+ left: 'auto'
+ }; // Round the offsets to the nearest suitable subpixel based on the DPR.
+ // Zooming can change the DPR, but it seems to report a value that will
+ // cleanly divide the values into the appropriate subpixels.
+
+ function roundOffsets(_ref) {
+ var x = _ref.x,
+ y = _ref.y;
+ var win = window;
+ var dpr = win.devicePixelRatio || 1;
+ return {
+ x: Math.round(x * dpr) / dpr || 0,
+ y: Math.round(y * dpr) / dpr || 0
+ };
+ }
+
+ function mapToStyles(_ref2) {
+ var _Object$assign2;
+
+ var popper = _ref2.popper,
+ popperRect = _ref2.popperRect,
+ placement = _ref2.placement,
+ offsets = _ref2.offsets,
+ position = _ref2.position,
+ gpuAcceleration = _ref2.gpuAcceleration,
+ adaptive = _ref2.adaptive;
+
+ var _roundOffsets = roundOffsets(offsets),
+ x = _roundOffsets.x,
+ y = _roundOffsets.y;
+
+ var hasX = offsets.hasOwnProperty('x');
+ var hasY = offsets.hasOwnProperty('y');
+ var sideX = left;
+ var sideY = top;
+ var win = window;
+
+ if (adaptive) {
+ var offsetParent = getOffsetParent(popper);
+
+ if (offsetParent === getWindow(popper)) {
+ offsetParent = getDocumentElement(popper);
+ } // $FlowFixMe: force type refinement, we compare offsetParent with window above, but Flow doesn't detect it
+
+ /*:: offsetParent = (offsetParent: Element); */
+
+ if (placement === top) {
+ sideY = bottom;
+ y -= offsetParent.clientHeight - popperRect.height;
+ y *= gpuAcceleration ? 1 : -1;
+ }
+
+ if (placement === left) {
+ sideX = right;
+ x -= offsetParent.clientWidth - popperRect.width;
+ x *= gpuAcceleration ? 1 : -1;
+ }
+ }
+
+ var commonStyles = Object.assign({
+ position: position
+ }, adaptive && unsetSides);
+
+ if (gpuAcceleration) {
+ var _Object$assign;
+
+ return Object.assign(Object.assign({}, commonStyles), {}, (_Object$assign = {}, _Object$assign[sideY] = hasY ? '0' : '', _Object$assign[sideX] = hasX ? '0' : '', _Object$assign.transform = (win.devicePixelRatio || 1) < 2 ? "translate(" + x + "px, " + y + "px)" : "translate3d(" + x + "px, " + y + "px, 0)", _Object$assign));
+ }
+
+ return Object.assign(Object.assign({}, commonStyles), {}, (_Object$assign2 = {}, _Object$assign2[sideY] = hasY ? y + "px" : '', _Object$assign2[sideX] = hasX ? x + "px" : '', _Object$assign2.transform = '', _Object$assign2));
+ }
+
+ function computeStyles(_ref3) {
+ var state = _ref3.state,
+ options = _ref3.options;
+ var _options$gpuAccelerat = options.gpuAcceleration,
+ gpuAcceleration = _options$gpuAccelerat === void 0 ? true : _options$gpuAccelerat,
+ _options$adaptive = options.adaptive,
+ adaptive = _options$adaptive === void 0 ? true : _options$adaptive;
+
+ var commonStyles = {
+ placement: getBasePlacement(state.placement),
+ popper: state.elements.popper,
+ popperRect: state.rects.popper,
+ gpuAcceleration: gpuAcceleration
+ };
+
+ if (state.modifiersData.popperOffsets != null) {
+ state.styles.popper = Object.assign(Object.assign({}, state.styles.popper), mapToStyles(Object.assign(Object.assign({}, commonStyles), {}, {
+ offsets: state.modifiersData.popperOffsets,
+ position: state.options.strategy,
+ adaptive: adaptive
+ })));
+ }
+
+ if (state.modifiersData.arrow != null) {
+ state.styles.arrow = Object.assign(Object.assign({}, state.styles.arrow), mapToStyles(Object.assign(Object.assign({}, commonStyles), {}, {
+ offsets: state.modifiersData.arrow,
+ position: 'absolute',
+ adaptive: false
+ })));
+ }
+
+ state.attributes.popper = Object.assign(Object.assign({}, state.attributes.popper), {}, {
+ 'data-popper-placement': state.placement
+ });
+ } // eslint-disable-next-line import/no-unused-modules
+
+
+ var computeStyles$1 = {
+ name: 'computeStyles',
+ enabled: true,
+ phase: 'beforeWrite',
+ fn: computeStyles,
+ data: {}
+ };
+
+ var passive = {
+ passive: true
+ };
+
+ function effect$2(_ref) {
+ var state = _ref.state,
+ instance = _ref.instance,
+ options = _ref.options;
+ var _options$scroll = options.scroll,
+ scroll = _options$scroll === void 0 ? true : _options$scroll,
+ _options$resize = options.resize,
+ resize = _options$resize === void 0 ? true : _options$resize;
+ var window = getWindow(state.elements.popper);
+ var scrollParents = [].concat(state.scrollParents.reference, state.scrollParents.popper);
+
+ if (scroll) {
+ scrollParents.forEach(function (scrollParent) {
+ scrollParent.addEventListener('scroll', instance.update, passive);
+ });
+ }
+
+ if (resize) {
+ window.addEventListener('resize', instance.update, passive);
+ }
+
+ return function () {
+ if (scroll) {
+ scrollParents.forEach(function (scrollParent) {
+ scrollParent.removeEventListener('scroll', instance.update, passive);
+ });
+ }
+
+ if (resize) {
+ window.removeEventListener('resize', instance.update, passive);
+ }
+ };
+ } // eslint-disable-next-line import/no-unused-modules
+
+
+ var eventListeners = {
+ name: 'eventListeners',
+ enabled: true,
+ phase: 'write',
+ fn: function fn() {},
+ effect: effect$2,
+ data: {}
+ };
+
+ var hash = {
+ left: 'right',
+ right: 'left',
+ bottom: 'top',
+ top: 'bottom'
+ };
+ function getOppositePlacement(placement) {
+ return placement.replace(/left|right|bottom|top/g, function (matched) {
+ return hash[matched];
+ });
+ }
+
+ var hash$1 = {
+ start: 'end',
+ end: 'start'
+ };
+ function getOppositeVariationPlacement(placement) {
+ return placement.replace(/start|end/g, function (matched) {
+ return hash$1[matched];
+ });
+ }
+
+ function getBoundingClientRect(element) {
+ var rect = element.getBoundingClientRect();
+ return {
+ width: rect.width,
+ height: rect.height,
+ top: rect.top,
+ right: rect.right,
+ bottom: rect.bottom,
+ left: rect.left,
+ x: rect.left,
+ y: rect.top
+ };
+ }
+
+ function getWindowScroll(node) {
+ var win = getWindow(node);
+ var scrollLeft = win.pageXOffset;
+ var scrollTop = win.pageYOffset;
+ return {
+ scrollLeft: scrollLeft,
+ scrollTop: scrollTop
+ };
+ }
+
+ function getWindowScrollBarX(element) {
+ // If has a CSS width greater than the viewport, then this will be
+ // incorrect for RTL.
+ // Popper 1 is broken in this case and never had a bug report so let's assume
+ // it's not an issue. I don't think anyone ever specifies width on
+ // anyway.
+ // Browsers where the left scrollbar doesn't cause an issue report `0` for
+ // this (e.g. Edge 2019, IE11, Safari)
+ return getBoundingClientRect(getDocumentElement(element)).left + getWindowScroll(element).scrollLeft;
+ }
+
+ function getViewportRect(element) {
+ var win = getWindow(element);
+ var html = getDocumentElement(element);
+ var visualViewport = win.visualViewport;
+ var width = html.clientWidth;
+ var height = html.clientHeight;
+ var x = 0;
+ var y = 0; // NB: This isn't supported on iOS <= 12. If the keyboard is open, the popper
+ // can be obscured underneath it.
+ // Also, `html.clientHeight` adds the bottom bar height in Safari iOS, even
+ // if it isn't open, so if this isn't available, the popper will be detected
+ // to overflow the bottom of the screen too early.
+
+ if (visualViewport) {
+ width = visualViewport.width;
+ height = visualViewport.height; // Uses Layout Viewport (like Chrome; Safari does not currently)
+ // In Chrome, it returns a value very close to 0 (+/-) but contains rounding
+ // errors due to floating point numbers, so we need to check precision.
+ // Safari returns a number <= 0, usually < -1 when pinch-zoomed
+ // Feature detection fails in mobile emulation mode in Chrome.
+ // Math.abs(win.innerWidth / visualViewport.scale - visualViewport.width) <
+ // 0.001
+ // Fallback here: "Not Safari" userAgent
+
+ if (!/^((?!chrome|android).)*safari/i.test(navigator.userAgent)) {
+ x = visualViewport.offsetLeft;
+ y = visualViewport.offsetTop;
+ }
+ }
+
+ return {
+ width: width,
+ height: height,
+ x: x + getWindowScrollBarX(element),
+ y: y
+ };
+ }
+
+ // of the `` and `` rect bounds if horizontally scrollable
+
+ function getDocumentRect(element) {
+ var html = getDocumentElement(element);
+ var winScroll = getWindowScroll(element);
+ var body = element.ownerDocument.body;
+ var width = Math.max(html.scrollWidth, html.clientWidth, body ? body.scrollWidth : 0, body ? body.clientWidth : 0);
+ var height = Math.max(html.scrollHeight, html.clientHeight, body ? body.scrollHeight : 0, body ? body.clientHeight : 0);
+ var x = -winScroll.scrollLeft + getWindowScrollBarX(element);
+ var y = -winScroll.scrollTop;
+
+ if (getComputedStyle(body || html).direction === 'rtl') {
+ x += Math.max(html.clientWidth, body ? body.clientWidth : 0) - width;
+ }
+
+ return {
+ width: width,
+ height: height,
+ x: x,
+ y: y
+ };
+ }
+
+ function isScrollParent(element) {
+ // Firefox wants us to check `-x` and `-y` variations as well
+ var _getComputedStyle = getComputedStyle(element),
+ overflow = _getComputedStyle.overflow,
+ overflowX = _getComputedStyle.overflowX,
+ overflowY = _getComputedStyle.overflowY;
+
+ return /auto|scroll|overlay|hidden/.test(overflow + overflowY + overflowX);
+ }
+
+ function getScrollParent(node) {
+ if (['html', 'body', '#document'].indexOf(getNodeName(node)) >= 0) {
+ // $FlowFixMe: assume body is always available
+ return node.ownerDocument.body;
+ }
+
+ if (isHTMLElement$1(node) && isScrollParent(node)) {
+ return node;
+ }
+
+ return getScrollParent(getParentNode(node));
+ }
+
+ /*
+ given a DOM element, return the list of all scroll parents, up the list of ancesors
+ until we get to the top window object. This list is what we attach scroll listeners
+ to, because if any of these parent elements scroll, we'll need to re-calculate the
+ reference element's position.
+ */
+ function listScrollParents(element, list) {
+ if (list === void 0) {
+ list = [];
+ }
+
+ var scrollParent = getScrollParent(element);
+ var isBody = getNodeName(scrollParent) === 'body';
+ var win = getWindow(scrollParent);
+ var target = isBody ? [win].concat(win.visualViewport || [], isScrollParent(scrollParent) ? scrollParent : []) : scrollParent;
+ var updatedList = list.concat(target);
+ return isBody ? updatedList : // $FlowFixMe: isBody tells us target will be an HTMLElement here
+ updatedList.concat(listScrollParents(getParentNode(target)));
+ }
+
+ function rectToClientRect(rect) {
+ return Object.assign(Object.assign({}, rect), {}, {
+ left: rect.x,
+ top: rect.y,
+ right: rect.x + rect.width,
+ bottom: rect.y + rect.height
+ });
+ }
+
+ function getInnerBoundingClientRect(element) {
+ var rect = getBoundingClientRect(element);
+ rect.top = rect.top + element.clientTop;
+ rect.left = rect.left + element.clientLeft;
+ rect.bottom = rect.top + element.clientHeight;
+ rect.right = rect.left + element.clientWidth;
+ rect.width = element.clientWidth;
+ rect.height = element.clientHeight;
+ rect.x = rect.left;
+ rect.y = rect.top;
+ return rect;
+ }
+
+ function getClientRectFromMixedType(element, clippingParent) {
+ return clippingParent === viewport ? rectToClientRect(getViewportRect(element)) : isHTMLElement$1(clippingParent) ? getInnerBoundingClientRect(clippingParent) : rectToClientRect(getDocumentRect(getDocumentElement(element)));
+ } // A "clipping parent" is an overflowable container with the characteristic of
+ // clipping (or hiding) overflowing elements with a position different from
+ // `initial`
+
+
+ function getClippingParents(element) {
+ var clippingParents = listScrollParents(getParentNode(element));
+ var canEscapeClipping = ['absolute', 'fixed'].indexOf(getComputedStyle(element).position) >= 0;
+ var clipperElement = canEscapeClipping && isHTMLElement$1(element) ? getOffsetParent(element) : element;
+
+ if (!isElement$1(clipperElement)) {
+ return [];
+ } // $FlowFixMe: https://github.com/facebook/flow/issues/1414
+
+
+ return clippingParents.filter(function (clippingParent) {
+ return isElement$1(clippingParent) && contains(clippingParent, clipperElement) && getNodeName(clippingParent) !== 'body';
+ });
+ } // Gets the maximum area that the element is visible in due to any number of
+ // clipping parents
+
+
+ function getClippingRect(element, boundary, rootBoundary) {
+ var mainClippingParents = boundary === 'clippingParents' ? getClippingParents(element) : [].concat(boundary);
+ var clippingParents = [].concat(mainClippingParents, [rootBoundary]);
+ var firstClippingParent = clippingParents[0];
+ var clippingRect = clippingParents.reduce(function (accRect, clippingParent) {
+ var rect = getClientRectFromMixedType(element, clippingParent);
+ accRect.top = Math.max(rect.top, accRect.top);
+ accRect.right = Math.min(rect.right, accRect.right);
+ accRect.bottom = Math.min(rect.bottom, accRect.bottom);
+ accRect.left = Math.max(rect.left, accRect.left);
+ return accRect;
+ }, getClientRectFromMixedType(element, firstClippingParent));
+ clippingRect.width = clippingRect.right - clippingRect.left;
+ clippingRect.height = clippingRect.bottom - clippingRect.top;
+ clippingRect.x = clippingRect.left;
+ clippingRect.y = clippingRect.top;
+ return clippingRect;
+ }
+
+ function getVariation(placement) {
+ return placement.split('-')[1];
+ }
+
+ function computeOffsets(_ref) {
+ var reference = _ref.reference,
+ element = _ref.element,
+ placement = _ref.placement;
+ var basePlacement = placement ? getBasePlacement(placement) : null;
+ var variation = placement ? getVariation(placement) : null;
+ var commonX = reference.x + reference.width / 2 - element.width / 2;
+ var commonY = reference.y + reference.height / 2 - element.height / 2;
+ var offsets;
+
+ switch (basePlacement) {
+ case top:
+ offsets = {
+ x: commonX,
+ y: reference.y - element.height
+ };
+ break;
+
+ case bottom:
+ offsets = {
+ x: commonX,
+ y: reference.y + reference.height
+ };
+ break;
+
+ case right:
+ offsets = {
+ x: reference.x + reference.width,
+ y: commonY
+ };
+ break;
+
+ case left:
+ offsets = {
+ x: reference.x - element.width,
+ y: commonY
+ };
+ break;
+
+ default:
+ offsets = {
+ x: reference.x,
+ y: reference.y
+ };
+ }
+
+ var mainAxis = basePlacement ? getMainAxisFromPlacement(basePlacement) : null;
+
+ if (mainAxis != null) {
+ var len = mainAxis === 'y' ? 'height' : 'width';
+
+ switch (variation) {
+ case start:
+ offsets[mainAxis] = Math.floor(offsets[mainAxis]) - Math.floor(reference[len] / 2 - element[len] / 2);
+ break;
+
+ case end:
+ offsets[mainAxis] = Math.floor(offsets[mainAxis]) + Math.ceil(reference[len] / 2 - element[len] / 2);
+ break;
+ }
+ }
+
+ return offsets;
+ }
+
+ function detectOverflow(state, options) {
+ if (options === void 0) {
+ options = {};
+ }
+
+ var _options = options,
+ _options$placement = _options.placement,
+ placement = _options$placement === void 0 ? state.placement : _options$placement,
+ _options$boundary = _options.boundary,
+ boundary = _options$boundary === void 0 ? clippingParents : _options$boundary,
+ _options$rootBoundary = _options.rootBoundary,
+ rootBoundary = _options$rootBoundary === void 0 ? viewport : _options$rootBoundary,
+ _options$elementConte = _options.elementContext,
+ elementContext = _options$elementConte === void 0 ? popper : _options$elementConte,
+ _options$altBoundary = _options.altBoundary,
+ altBoundary = _options$altBoundary === void 0 ? false : _options$altBoundary,
+ _options$padding = _options.padding,
+ padding = _options$padding === void 0 ? 0 : _options$padding;
+ var paddingObject = mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));
+ var altContext = elementContext === popper ? reference : popper;
+ var referenceElement = state.elements.reference;
+ var popperRect = state.rects.popper;
+ var element = state.elements[altBoundary ? altContext : elementContext];
+ var clippingClientRect = getClippingRect(isElement$1(element) ? element : element.contextElement || getDocumentElement(state.elements.popper), boundary, rootBoundary);
+ var referenceClientRect = getBoundingClientRect(referenceElement);
+ var popperOffsets = computeOffsets({
+ reference: referenceClientRect,
+ element: popperRect,
+ strategy: 'absolute',
+ placement: placement
+ });
+ var popperClientRect = rectToClientRect(Object.assign(Object.assign({}, popperRect), popperOffsets));
+ var elementClientRect = elementContext === popper ? popperClientRect : referenceClientRect; // positive = overflowing the clipping rect
+ // 0 or negative = within the clipping rect
+
+ var overflowOffsets = {
+ top: clippingClientRect.top - elementClientRect.top + paddingObject.top,
+ bottom: elementClientRect.bottom - clippingClientRect.bottom + paddingObject.bottom,
+ left: clippingClientRect.left - elementClientRect.left + paddingObject.left,
+ right: elementClientRect.right - clippingClientRect.right + paddingObject.right
+ };
+ var offsetData = state.modifiersData.offset; // Offsets can be applied only to the popper element
+
+ if (elementContext === popper && offsetData) {
+ var offset = offsetData[placement];
+ Object.keys(overflowOffsets).forEach(function (key) {
+ var multiply = [right, bottom].indexOf(key) >= 0 ? 1 : -1;
+ var axis = [top, bottom].indexOf(key) >= 0 ? 'y' : 'x';
+ overflowOffsets[key] += offset[axis] * multiply;
+ });
+ }
+
+ return overflowOffsets;
+ }
+
+ /*:: type OverflowsMap = { [ComputedPlacement]: number }; */
+ /*;; type OverflowsMap = { [key in ComputedPlacement]: number }; */
+ function computeAutoPlacement(state, options) {
+ if (options === void 0) {
+ options = {};
+ }
+
+ var _options = options,
+ placement = _options.placement,
+ boundary = _options.boundary,
+ rootBoundary = _options.rootBoundary,
+ padding = _options.padding,
+ flipVariations = _options.flipVariations,
+ _options$allowedAutoP = _options.allowedAutoPlacements,
+ allowedAutoPlacements = _options$allowedAutoP === void 0 ? placements : _options$allowedAutoP;
+ var variation = getVariation(placement);
+ var placements$1 = variation ? flipVariations ? variationPlacements : variationPlacements.filter(function (placement) {
+ return getVariation(placement) === variation;
+ }) : basePlacements; // $FlowFixMe
+
+ var allowedPlacements = placements$1.filter(function (placement) {
+ return allowedAutoPlacements.indexOf(placement) >= 0;
+ });
+
+ if (allowedPlacements.length === 0) {
+ allowedPlacements = placements$1;
+ } // $FlowFixMe: Flow seems to have problems with two array unions...
+
+
+ var overflows = allowedPlacements.reduce(function (acc, placement) {
+ acc[placement] = detectOverflow(state, {
+ placement: placement,
+ boundary: boundary,
+ rootBoundary: rootBoundary,
+ padding: padding
+ })[getBasePlacement(placement)];
+ return acc;
+ }, {});
+ return Object.keys(overflows).sort(function (a, b) {
+ return overflows[a] - overflows[b];
+ });
+ }
+
+ function getExpandedFallbackPlacements(placement) {
+ if (getBasePlacement(placement) === auto) {
+ return [];
+ }
+
+ var oppositePlacement = getOppositePlacement(placement);
+ return [getOppositeVariationPlacement(placement), oppositePlacement, getOppositeVariationPlacement(oppositePlacement)];
+ }
+
+ function flip(_ref) {
+ var state = _ref.state,
+ options = _ref.options,
+ name = _ref.name;
+
+ if (state.modifiersData[name]._skip) {
+ return;
+ }
+
+ var _options$mainAxis = options.mainAxis,
+ checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,
+ _options$altAxis = options.altAxis,
+ checkAltAxis = _options$altAxis === void 0 ? true : _options$altAxis,
+ specifiedFallbackPlacements = options.fallbackPlacements,
+ padding = options.padding,
+ boundary = options.boundary,
+ rootBoundary = options.rootBoundary,
+ altBoundary = options.altBoundary,
+ _options$flipVariatio = options.flipVariations,
+ flipVariations = _options$flipVariatio === void 0 ? true : _options$flipVariatio,
+ allowedAutoPlacements = options.allowedAutoPlacements;
+ var preferredPlacement = state.options.placement;
+ var basePlacement = getBasePlacement(preferredPlacement);
+ var isBasePlacement = basePlacement === preferredPlacement;
+ var fallbackPlacements = specifiedFallbackPlacements || (isBasePlacement || !flipVariations ? [getOppositePlacement(preferredPlacement)] : getExpandedFallbackPlacements(preferredPlacement));
+ var placements = [preferredPlacement].concat(fallbackPlacements).reduce(function (acc, placement) {
+ return acc.concat(getBasePlacement(placement) === auto ? computeAutoPlacement(state, {
+ placement: placement,
+ boundary: boundary,
+ rootBoundary: rootBoundary,
+ padding: padding,
+ flipVariations: flipVariations,
+ allowedAutoPlacements: allowedAutoPlacements
+ }) : placement);
+ }, []);
+ var referenceRect = state.rects.reference;
+ var popperRect = state.rects.popper;
+ var checksMap = new Map();
+ var makeFallbackChecks = true;
+ var firstFittingPlacement = placements[0];
+
+ for (var i = 0; i < placements.length; i++) {
+ var placement = placements[i];
+
+ var _basePlacement = getBasePlacement(placement);
+
+ var isStartVariation = getVariation(placement) === start;
+ var isVertical = [top, bottom].indexOf(_basePlacement) >= 0;
+ var len = isVertical ? 'width' : 'height';
+ var overflow = detectOverflow(state, {
+ placement: placement,
+ boundary: boundary,
+ rootBoundary: rootBoundary,
+ altBoundary: altBoundary,
+ padding: padding
+ });
+ var mainVariationSide = isVertical ? isStartVariation ? right : left : isStartVariation ? bottom : top;
+
+ if (referenceRect[len] > popperRect[len]) {
+ mainVariationSide = getOppositePlacement(mainVariationSide);
+ }
+
+ var altVariationSide = getOppositePlacement(mainVariationSide);
+ var checks = [];
+
+ if (checkMainAxis) {
+ checks.push(overflow[_basePlacement] <= 0);
+ }
+
+ if (checkAltAxis) {
+ checks.push(overflow[mainVariationSide] <= 0, overflow[altVariationSide] <= 0);
+ }
+
+ if (checks.every(function (check) {
+ return check;
+ })) {
+ firstFittingPlacement = placement;
+ makeFallbackChecks = false;
+ break;
+ }
+
+ checksMap.set(placement, checks);
+ }
+
+ if (makeFallbackChecks) {
+ // `2` may be desired in some cases – research later
+ var numberOfChecks = flipVariations ? 3 : 1;
+
+ var _loop = function _loop(_i) {
+ var fittingPlacement = placements.find(function (placement) {
+ var checks = checksMap.get(placement);
+
+ if (checks) {
+ return checks.slice(0, _i).every(function (check) {
+ return check;
+ });
+ }
+ });
+
+ if (fittingPlacement) {
+ firstFittingPlacement = fittingPlacement;
+ return "break";
+ }
+ };
+
+ for (var _i = numberOfChecks; _i > 0; _i--) {
+ var _ret = _loop(_i);
+
+ if (_ret === "break") break;
+ }
+ }
+
+ if (state.placement !== firstFittingPlacement) {
+ state.modifiersData[name]._skip = true;
+ state.placement = firstFittingPlacement;
+ state.reset = true;
+ }
+ } // eslint-disable-next-line import/no-unused-modules
+
+
+ var flip$1 = {
+ name: 'flip',
+ enabled: true,
+ phase: 'main',
+ fn: flip,
+ requiresIfExists: ['offset'],
+ data: {
+ _skip: false
+ }
+ };
+
+ function getSideOffsets(overflow, rect, preventedOffsets) {
+ if (preventedOffsets === void 0) {
+ preventedOffsets = {
+ x: 0,
+ y: 0
+ };
+ }
+
+ return {
+ top: overflow.top - rect.height - preventedOffsets.y,
+ right: overflow.right - rect.width + preventedOffsets.x,
+ bottom: overflow.bottom - rect.height + preventedOffsets.y,
+ left: overflow.left - rect.width - preventedOffsets.x
+ };
+ }
+
+ function isAnySideFullyClipped(overflow) {
+ return [top, right, bottom, left].some(function (side) {
+ return overflow[side] >= 0;
+ });
+ }
+
+ function hide(_ref) {
+ var state = _ref.state,
+ name = _ref.name;
+ var referenceRect = state.rects.reference;
+ var popperRect = state.rects.popper;
+ var preventedOffsets = state.modifiersData.preventOverflow;
+ var referenceOverflow = detectOverflow(state, {
+ elementContext: 'reference'
+ });
+ var popperAltOverflow = detectOverflow(state, {
+ altBoundary: true
+ });
+ var referenceClippingOffsets = getSideOffsets(referenceOverflow, referenceRect);
+ var popperEscapeOffsets = getSideOffsets(popperAltOverflow, popperRect, preventedOffsets);
+ var isReferenceHidden = isAnySideFullyClipped(referenceClippingOffsets);
+ var hasPopperEscaped = isAnySideFullyClipped(popperEscapeOffsets);
+ state.modifiersData[name] = {
+ referenceClippingOffsets: referenceClippingOffsets,
+ popperEscapeOffsets: popperEscapeOffsets,
+ isReferenceHidden: isReferenceHidden,
+ hasPopperEscaped: hasPopperEscaped
+ };
+ state.attributes.popper = Object.assign(Object.assign({}, state.attributes.popper), {}, {
+ 'data-popper-reference-hidden': isReferenceHidden,
+ 'data-popper-escaped': hasPopperEscaped
+ });
+ } // eslint-disable-next-line import/no-unused-modules
+
+
+ var hide$1 = {
+ name: 'hide',
+ enabled: true,
+ phase: 'main',
+ requiresIfExists: ['preventOverflow'],
+ fn: hide
+ };
+
+ function distanceAndSkiddingToXY(placement, rects, offset) {
+ var basePlacement = getBasePlacement(placement);
+ var invertDistance = [left, top].indexOf(basePlacement) >= 0 ? -1 : 1;
+
+ var _ref = typeof offset === 'function' ? offset(Object.assign(Object.assign({}, rects), {}, {
+ placement: placement
+ })) : offset,
+ skidding = _ref[0],
+ distance = _ref[1];
+
+ skidding = skidding || 0;
+ distance = (distance || 0) * invertDistance;
+ return [left, right].indexOf(basePlacement) >= 0 ? {
+ x: distance,
+ y: skidding
+ } : {
+ x: skidding,
+ y: distance
+ };
+ }
+
+ function offset(_ref2) {
+ var state = _ref2.state,
+ options = _ref2.options,
+ name = _ref2.name;
+ var _options$offset = options.offset,
+ offset = _options$offset === void 0 ? [0, 0] : _options$offset;
+ var data = placements.reduce(function (acc, placement) {
+ acc[placement] = distanceAndSkiddingToXY(placement, state.rects, offset);
+ return acc;
+ }, {});
+ var _data$state$placement = data[state.placement],
+ x = _data$state$placement.x,
+ y = _data$state$placement.y;
+
+ if (state.modifiersData.popperOffsets != null) {
+ state.modifiersData.popperOffsets.x += x;
+ state.modifiersData.popperOffsets.y += y;
+ }
+
+ state.modifiersData[name] = data;
+ } // eslint-disable-next-line import/no-unused-modules
+
+
+ var offset$1 = {
+ name: 'offset',
+ enabled: true,
+ phase: 'main',
+ requires: ['popperOffsets'],
+ fn: offset
+ };
+
+ function popperOffsets(_ref) {
+ var state = _ref.state,
+ name = _ref.name; // Offsets are the actual position the popper needs to have to be
+ // properly positioned near its reference element
+ // This is the most basic placement, and will be adjusted by
+ // the modifiers in the next step
+
+ state.modifiersData[name] = computeOffsets({
+ reference: state.rects.reference,
+ element: state.rects.popper,
+ strategy: 'absolute',
+ placement: state.placement
+ });
+ } // eslint-disable-next-line import/no-unused-modules
+
+
+ var popperOffsets$1 = {
+ name: 'popperOffsets',
+ enabled: true,
+ phase: 'read',
+ fn: popperOffsets,
+ data: {}
+ };
+
+ function getAltAxis(axis) {
+ return axis === 'x' ? 'y' : 'x';
+ }
+
+ function preventOverflow(_ref) {
+ var state = _ref.state,
+ options = _ref.options,
+ name = _ref.name;
+ var _options$mainAxis = options.mainAxis,
+ checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,
+ _options$altAxis = options.altAxis,
+ checkAltAxis = _options$altAxis === void 0 ? false : _options$altAxis,
+ boundary = options.boundary,
+ rootBoundary = options.rootBoundary,
+ altBoundary = options.altBoundary,
+ padding = options.padding,
+ _options$tether = options.tether,
+ tether = _options$tether === void 0 ? true : _options$tether,
+ _options$tetherOffset = options.tetherOffset,
+ tetherOffset = _options$tetherOffset === void 0 ? 0 : _options$tetherOffset;
+ var overflow = detectOverflow(state, {
+ boundary: boundary,
+ rootBoundary: rootBoundary,
+ padding: padding,
+ altBoundary: altBoundary
+ });
+ var basePlacement = getBasePlacement(state.placement);
+ var variation = getVariation(state.placement);
+ var isBasePlacement = !variation;
+ var mainAxis = getMainAxisFromPlacement(basePlacement);
+ var altAxis = getAltAxis(mainAxis);
+ var popperOffsets = state.modifiersData.popperOffsets;
+ var referenceRect = state.rects.reference;
+ var popperRect = state.rects.popper;
+ var tetherOffsetValue = typeof tetherOffset === 'function' ? tetherOffset(Object.assign(Object.assign({}, state.rects), {}, {
+ placement: state.placement
+ })) : tetherOffset;
+ var data = {
+ x: 0,
+ y: 0
+ };
+
+ if (!popperOffsets) {
+ return;
+ }
+
+ if (checkMainAxis) {
+ var mainSide = mainAxis === 'y' ? top : left;
+ var altSide = mainAxis === 'y' ? bottom : right;
+ var len = mainAxis === 'y' ? 'height' : 'width';
+ var offset = popperOffsets[mainAxis];
+ var min = popperOffsets[mainAxis] + overflow[mainSide];
+ var max = popperOffsets[mainAxis] - overflow[altSide];
+ var additive = tether ? -popperRect[len] / 2 : 0;
+ var minLen = variation === start ? referenceRect[len] : popperRect[len];
+ var maxLen = variation === start ? -popperRect[len] : -referenceRect[len]; // We need to include the arrow in the calculation so the arrow doesn't go
+ // outside the reference bounds
+
+ var arrowElement = state.elements.arrow;
+ var arrowRect = tether && arrowElement ? getLayoutRect(arrowElement) : {
+ width: 0,
+ height: 0
+ };
+ var arrowPaddingObject = state.modifiersData['arrow#persistent'] ? state.modifiersData['arrow#persistent'].padding : getFreshSideObject();
+ var arrowPaddingMin = arrowPaddingObject[mainSide];
+ var arrowPaddingMax = arrowPaddingObject[altSide]; // If the reference length is smaller than the arrow length, we don't want
+ // to include its full size in the calculation. If the reference is small
+ // and near the edge of a boundary, the popper can overflow even if the
+ // reference is not overflowing as well (e.g. virtual elements with no
+ // width or height)
+
+ var arrowLen = within(0, referenceRect[len], arrowRect[len]);
+ var minOffset = isBasePlacement ? referenceRect[len] / 2 - additive - arrowLen - arrowPaddingMin - tetherOffsetValue : minLen - arrowLen - arrowPaddingMin - tetherOffsetValue;
+ var maxOffset = isBasePlacement ? -referenceRect[len] / 2 + additive + arrowLen + arrowPaddingMax + tetherOffsetValue : maxLen + arrowLen + arrowPaddingMax + tetherOffsetValue;
+ var arrowOffsetParent = state.elements.arrow && getOffsetParent(state.elements.arrow);
+ var clientOffset = arrowOffsetParent ? mainAxis === 'y' ? arrowOffsetParent.clientTop || 0 : arrowOffsetParent.clientLeft || 0 : 0;
+ var offsetModifierValue = state.modifiersData.offset ? state.modifiersData.offset[state.placement][mainAxis] : 0;
+ var tetherMin = popperOffsets[mainAxis] + minOffset - offsetModifierValue - clientOffset;
+ var tetherMax = popperOffsets[mainAxis] + maxOffset - offsetModifierValue;
+ var preventedOffset = within(tether ? Math.min(min, tetherMin) : min, offset, tether ? Math.max(max, tetherMax) : max);
+ popperOffsets[mainAxis] = preventedOffset;
+ data[mainAxis] = preventedOffset - offset;
+ }
+
+ if (checkAltAxis) {
+ var _mainSide = mainAxis === 'x' ? top : left;
+
+ var _altSide = mainAxis === 'x' ? bottom : right;
+
+ var _offset = popperOffsets[altAxis];
+
+ var _min = _offset + overflow[_mainSide];
+
+ var _max = _offset - overflow[_altSide];
+
+ var _preventedOffset = within(_min, _offset, _max);
+
+ popperOffsets[altAxis] = _preventedOffset;
+ data[altAxis] = _preventedOffset - _offset;
+ }
+
+ state.modifiersData[name] = data;
+ } // eslint-disable-next-line import/no-unused-modules
+
+
+ var preventOverflow$1 = {
+ name: 'preventOverflow',
+ enabled: true,
+ phase: 'main',
+ fn: preventOverflow,
+ requiresIfExists: ['offset']
+ };
+
+ function getHTMLElementScroll(element) {
+ return {
+ scrollLeft: element.scrollLeft,
+ scrollTop: element.scrollTop
+ };
+ }
+
+ function getNodeScroll(node) {
+ if (node === getWindow(node) || !isHTMLElement$1(node)) {
+ return getWindowScroll(node);
+ } else {
+ return getHTMLElementScroll(node);
+ }
+ }
+
+ // Composite means it takes into account transforms as well as layout.
+
+ function getCompositeRect(elementOrVirtualElement, offsetParent, isFixed) {
+ if (isFixed === void 0) {
+ isFixed = false;
+ }
+
+ var documentElement = getDocumentElement(offsetParent);
+ var rect = getBoundingClientRect(elementOrVirtualElement);
+ var isOffsetParentAnElement = isHTMLElement$1(offsetParent);
+ var scroll = {
+ scrollLeft: 0,
+ scrollTop: 0
+ };
+ var offsets = {
+ x: 0,
+ y: 0
+ };
+
+ if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed) {
+ if (getNodeName(offsetParent) !== 'body' || // https://github.com/popperjs/popper-core/issues/1078
+ isScrollParent(documentElement)) {
+ scroll = getNodeScroll(offsetParent);
+ }
+
+ if (isHTMLElement$1(offsetParent)) {
+ offsets = getBoundingClientRect(offsetParent);
+ offsets.x += offsetParent.clientLeft;
+ offsets.y += offsetParent.clientTop;
+ } else if (documentElement) {
+ offsets.x = getWindowScrollBarX(documentElement);
+ }
+ }
+
+ return {
+ x: rect.left + scroll.scrollLeft - offsets.x,
+ y: rect.top + scroll.scrollTop - offsets.y,
+ width: rect.width,
+ height: rect.height
+ };
+ }
+
+ function order(modifiers) {
+ var map = new Map();
+ var visited = new Set();
+ var result = [];
+ modifiers.forEach(function (modifier) {
+ map.set(modifier.name, modifier);
+ }); // On visiting object, check for its dependencies and visit them recursively
+
+ function sort(modifier) {
+ visited.add(modifier.name);
+ var requires = [].concat(modifier.requires || [], modifier.requiresIfExists || []);
+ requires.forEach(function (dep) {
+ if (!visited.has(dep)) {
+ var depModifier = map.get(dep);
+
+ if (depModifier) {
+ sort(depModifier);
+ }
+ }
+ });
+ result.push(modifier);
+ }
+
+ modifiers.forEach(function (modifier) {
+ if (!visited.has(modifier.name)) {
+ // check for visited object
+ sort(modifier);
+ }
+ });
+ return result;
+ }
+
+ function orderModifiers(modifiers) {
+ // order based on dependencies
+ var orderedModifiers = order(modifiers); // order based on phase
+
+ return modifierPhases.reduce(function (acc, phase) {
+ return acc.concat(orderedModifiers.filter(function (modifier) {
+ return modifier.phase === phase;
+ }));
+ }, []);
+ }
+
+ function debounce(fn) {
+ var pending;
+ return function () {
+ if (!pending) {
+ pending = new Promise(function (resolve) {
+ Promise.resolve().then(function () {
+ pending = undefined;
+ resolve(fn());
+ });
+ });
+ }
+
+ return pending;
+ };
+ }
+
+ function mergeByName(modifiers) {
+ var merged = modifiers.reduce(function (merged, current) {
+ var existing = merged[current.name];
+ merged[current.name] = existing ? Object.assign(Object.assign(Object.assign({}, existing), current), {}, {
+ options: Object.assign(Object.assign({}, existing.options), current.options),
+ data: Object.assign(Object.assign({}, existing.data), current.data)
+ }) : current;
+ return merged;
+ }, {}); // IE11 does not support Object.values
+
+ return Object.keys(merged).map(function (key) {
+ return merged[key];
+ });
+ }
+
+ var DEFAULT_OPTIONS = {
+ placement: 'bottom',
+ modifiers: [],
+ strategy: 'absolute'
+ };
+
+ function areValidElements() {
+ for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
+ args[_key] = arguments[_key];
+ }
+
+ return !args.some(function (element) {
+ return !(element && typeof element.getBoundingClientRect === 'function');
+ });
+ }
+
+ function popperGenerator(generatorOptions) {
+ if (generatorOptions === void 0) {
+ generatorOptions = {};
+ }
+
+ var _generatorOptions = generatorOptions,
+ _generatorOptions$def = _generatorOptions.defaultModifiers,
+ defaultModifiers = _generatorOptions$def === void 0 ? [] : _generatorOptions$def,
+ _generatorOptions$def2 = _generatorOptions.defaultOptions,
+ defaultOptions = _generatorOptions$def2 === void 0 ? DEFAULT_OPTIONS : _generatorOptions$def2;
+ return function createPopper(reference, popper, options) {
+ if (options === void 0) {
+ options = defaultOptions;
+ }
+
+ var state = {
+ placement: 'bottom',
+ orderedModifiers: [],
+ options: Object.assign(Object.assign({}, DEFAULT_OPTIONS), defaultOptions),
+ modifiersData: {},
+ elements: {
+ reference: reference,
+ popper: popper
+ },
+ attributes: {},
+ styles: {}
+ };
+ var effectCleanupFns = [];
+ var isDestroyed = false;
+ var instance = {
+ state: state,
+ setOptions: function setOptions(options) {
+ cleanupModifierEffects();
+ state.options = Object.assign(Object.assign(Object.assign({}, defaultOptions), state.options), options);
+ state.scrollParents = {
+ reference: isElement$1(reference) ? listScrollParents(reference) : reference.contextElement ? listScrollParents(reference.contextElement) : [],
+ popper: listScrollParents(popper)
+ }; // Orders the modifiers based on their dependencies and `phase`
+ // properties
+
+ var orderedModifiers = orderModifiers(mergeByName([].concat(defaultModifiers, state.options.modifiers))); // Strip out disabled modifiers
+
+ state.orderedModifiers = orderedModifiers.filter(function (m) {
+ return m.enabled;
+ }); // Validate the provided modifiers so that the consumer will get warned
+
+ runModifierEffects();
+ return instance.update();
+ },
+ // Sync update – it will always be executed, even if not necessary. This
+ // is useful for low frequency updates where sync behavior simplifies the
+ // logic.
+ // For high frequency updates (e.g. `resize` and `scroll` events), always
+ // prefer the async Popper#update method
+ forceUpdate: function forceUpdate() {
+ if (isDestroyed) {
+ return;
+ }
+
+ var _state$elements = state.elements,
+ reference = _state$elements.reference,
+ popper = _state$elements.popper; // Don't proceed if `reference` or `popper` are not valid elements
+ // anymore
+
+ if (!areValidElements(reference, popper)) {
+
+ return;
+ } // Store the reference and popper rects to be read by modifiers
+
+
+ state.rects = {
+ reference: getCompositeRect(reference, getOffsetParent(popper), state.options.strategy === 'fixed'),
+ popper: getLayoutRect(popper)
+ }; // Modifiers have the ability to reset the current update cycle. The
+ // most common use case for this is the `flip` modifier changing the
+ // placement, which then needs to re-run all the modifiers, because the
+ // logic was previously ran for the previous placement and is therefore
+ // stale/incorrect
+
+ state.reset = false;
+ state.placement = state.options.placement; // On each update cycle, the `modifiersData` property for each modifier
+ // is filled with the initial data specified by the modifier. This means
+ // it doesn't persist and is fresh on each update.
+ // To ensure persistent data, use `${name}#persistent`
+
+ state.orderedModifiers.forEach(function (modifier) {
+ return state.modifiersData[modifier.name] = Object.assign({}, modifier.data);
+ });
+
+ for (var index = 0; index < state.orderedModifiers.length; index++) {
+
+ if (state.reset === true) {
+ state.reset = false;
+ index = -1;
+ continue;
+ }
+
+ var _state$orderedModifie = state.orderedModifiers[index],
+ fn = _state$orderedModifie.fn,
+ _state$orderedModifie2 = _state$orderedModifie.options,
+ _options = _state$orderedModifie2 === void 0 ? {} : _state$orderedModifie2,
+ name = _state$orderedModifie.name;
+
+ if (typeof fn === 'function') {
+ state = fn({
+ state: state,
+ options: _options,
+ name: name,
+ instance: instance
+ }) || state;
+ }
+ }
+ },
+ // Async and optimistically optimized update – it will not be executed if
+ // not necessary (debounced to run at most once-per-tick)
+ update: debounce(function () {
+ return new Promise(function (resolve) {
+ instance.forceUpdate();
+ resolve(state);
+ });
+ }),
+ destroy: function destroy() {
+ cleanupModifierEffects();
+ isDestroyed = true;
+ }
+ };
+
+ if (!areValidElements(reference, popper)) {
+
+ return instance;
+ }
+
+ instance.setOptions(options).then(function (state) {
+ if (!isDestroyed && options.onFirstUpdate) {
+ options.onFirstUpdate(state);
+ }
+ }); // Modifiers have the ability to execute arbitrary code before the first
+ // update cycle runs. They will be executed in the same order as the update
+ // cycle. This is useful when a modifier adds some persistent data that
+ // other modifiers need to use, but the modifier is run after the dependent
+ // one.
+
+ function runModifierEffects() {
+ state.orderedModifiers.forEach(function (_ref3) {
+ var name = _ref3.name,
+ _ref3$options = _ref3.options,
+ options = _ref3$options === void 0 ? {} : _ref3$options,
+ effect = _ref3.effect;
+
+ if (typeof effect === 'function') {
+ var cleanupFn = effect({
+ state: state,
+ name: name,
+ instance: instance,
+ options: options
+ });
+
+ var noopFn = function noopFn() {};
+
+ effectCleanupFns.push(cleanupFn || noopFn);
+ }
+ });
+ }
+
+ function cleanupModifierEffects() {
+ effectCleanupFns.forEach(function (fn) {
+ return fn();
+ });
+ effectCleanupFns = [];
+ }
+
+ return instance;
+ };
+ }
+
+ var defaultModifiers = [eventListeners, popperOffsets$1, computeStyles$1, applyStyles$1, offset$1, flip$1, preventOverflow$1, arrow$1, hide$1];
+ var createPopper = /*#__PURE__*/popperGenerator({
+ defaultModifiers: defaultModifiers
+ }); // eslint-disable-next-line import/no-unused-modules
+
+ function _extends() {
+ _extends = Object.assign || function (target) {
+ for (var i = 1; i < arguments.length; i++) {
+ var source = arguments[i];
+
+ for (var key in source) {
+ if (Object.prototype.hasOwnProperty.call(source, key)) {
+ target[key] = source[key];
+ }
+ }
+ }
+
+ return target;
+ };
+
+ return _extends.apply(this, arguments);
+ }
+
+ function _getCenteredStylePopperModifier() {
+ return [{
+ name: 'applyStyles',
+
+ fn({
+ state
+ }) {
+ Object.keys(state.elements).forEach(name => {
+ if (name !== 'popper') {
+ return;
+ }
+
+ const style = {
+ position: 'fixed',
+ left: '50%',
+ top: '50%',
+ transform: 'translate(-50%, -50%)'
+ };
+ const attributes = state.attributes[name] || {};
+ const element = state.elements[name];
+ Object.assign(element.style, style);
+ Object.keys(attributes).forEach(name => {
+ const value = attributes[name];
+
+ if (value === false) {
+ element.removeAttribute(name);
+ } else {
+ element.setAttribute(name, value === true ? '' : value);
+ }
+ });
+ });
+ }
+
+ }, {
+ name: 'computeStyles',
+ options: {
+ adaptive: false
+ }
+ }];
+ }
+ /**
+ * Generates the array of options for a tooltip that doesn't have a
+ * target element in the DOM -- and thus is positioned in the center
+ * of the view
+ *
+ * @param {Step} step The step instance
+ * @return {Object} The final Popper options object
+ */
+
+ function makeCenteredPopper(step) {
+ const centeredStylePopperModifier = _getCenteredStylePopperModifier();
+
+ let popperOptions = {
+ placement: 'top',
+ strategy: 'fixed',
+ modifiers: [{
+ name: 'focusAfterRender',
+ enabled: true,
+ phase: 'afterWrite',
+
+ fn() {
+ setTimeout(() => {
+ if (step.el) {
+ step.el.focus();
+ }
+ }, 300);
+ }
+
+ }]
+ };
+ popperOptions = _extends({}, popperOptions, {
+ modifiers: Array.from(new Set([...popperOptions.modifiers, ...centeredStylePopperModifier]))
+ });
+ return popperOptions;
+ }
+
+ /**
+ * Ensure class prefix ends in `-`
+ * @param {string} prefix The prefix to prepend to the class names generated by nano-css
+ * @return {string} The prefix ending in `-`
+ */
+ function normalizePrefix(prefix) {
+ if (!isString(prefix) || prefix === '') {
+ return '';
+ }
+
+ return prefix.charAt(prefix.length - 1) !== '-' ? `${prefix}-` : prefix;
+ }
+ /**
+ * Checks if options.attachTo.element is a string, and if so, tries to find the element
+ * @param {Step} step The step instance
+ * @returns {{element, on}}
+ * `element` is a qualified HTML Element
+ * `on` is a string position value
+ */
+ function parseAttachTo(step) {
+ const options = step.options.attachTo || {};
+ const returnOpts = Object.assign({}, options);
+
+ if (isString(options.element)) {
+ // Can't override the element in user opts reference because we can't
+ // guarantee that the element will exist in the future.
+ try {
+ returnOpts.element = document.querySelector(options.element);
+ } catch (e) {// TODO
+ }
+
+ if (!returnOpts.element) {
+ console.error(`The element for this Shepherd step was not found ${options.element}`);
+ }
+ }
+
+ return returnOpts;
+ }
+ /**
+ * Determines options for the tooltip and initializes
+ * `step.tooltip` as a Popper instance.
+ * @param {Step} step The step instance
+ */
+ function setupTooltip(step) {
+ if (step.tooltip) {
+ step.tooltip.destroy();
+ }
+
+ const attachToOptions = parseAttachTo(step);
+ let target = attachToOptions.element;
+ const popperOptions = getPopperOptions(attachToOptions, step);
+
+ if (step.isCentered()) {
+ target = document.body;
+ const content = step.shepherdElementComponent.getElement();
+ content.classList.add('shepherd-centered');
+ }
+
+ step.tooltip = createPopper(target, step.el, popperOptions);
+ step.target = attachToOptions.element;
+ return popperOptions;
+ }
+ /**
+ * Create a unique id for steps, tours, modals, etc
+ * @return {string}
+ */
+ function uuid() {
+ let d = Date.now();
+ return 'xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx'.replace(/[xy]/g, c => {
+ const r = (d + Math.random() * 16) % 16 | 0;
+ d = Math.floor(d / 16);
+ return (c == 'x' ? r : r & 0x3 | 0x8).toString(16);
+ });
+ }
+ /**
+ * Gets the `Popper` options from a set of base `attachTo` options
+ * @param attachToOptions
+ * @param {Step} step The step instance
+ * @return {Object}
+ * @private
+ */
+ function getPopperOptions(attachToOptions, step) {
+ let popperOptions = {
+ modifiers: [{
+ name: 'preventOverflow',
+ options: {
+ altAxis: true
+ }
+ }, {
+ name: 'focusAfterRender',
+ enabled: true,
+ phase: 'afterWrite',
+
+ fn() {
+ setTimeout(() => {
+ if (step.el) {
+ step.el.focus();
+ }
+ }, 300);
+ }
+
+ }],
+ strategy: 'absolute'
+ };
+
+ if (step.isCentered()) {
+ popperOptions = makeCenteredPopper(step);
+ } else {
+ popperOptions.placement = attachToOptions.on;
+ }
+
+ const defaultStepOptions = step.tour && step.tour.options && step.tour.options.defaultStepOptions;
+
+ if (defaultStepOptions) {
+ popperOptions = _mergeModifiers(defaultStepOptions, popperOptions);
+ }
+
+ popperOptions = _mergeModifiers(step.options, popperOptions);
+ return popperOptions;
+ }
+
+ function _mergeModifiers(stepOptions, popperOptions) {
+ if (stepOptions.popperOptions) {
+ let mergedPopperOptions = Object.assign({}, popperOptions, stepOptions.popperOptions);
+
+ if (stepOptions.popperOptions.modifiers && stepOptions.popperOptions.modifiers.length > 0) {
+ const names = stepOptions.popperOptions.modifiers.map(mod => mod.name);
+ const filteredModifiers = popperOptions.modifiers.filter(mod => !names.includes(mod.name));
+ mergedPopperOptions.modifiers = Array.from(new Set([...filteredModifiers, ...stepOptions.popperOptions.modifiers]));
+ }
+
+ return mergedPopperOptions;
+ }
+
+ return popperOptions;
+ }
+
+ function noop() {}
+
+ function assign(tar, src) {
+ // @ts-ignore
+ for (const k in src) tar[k] = src[k];
+
+ return tar;
+ }
+
+ function run(fn) {
+ return fn();
+ }
+
+ function blank_object() {
+ return Object.create(null);
+ }
+
+ function run_all(fns) {
+ fns.forEach(run);
+ }
+
+ function is_function(thing) {
+ return typeof thing === 'function';
+ }
+
+ function safe_not_equal(a, b) {
+ return a != a ? b == b : a !== b || a && typeof a === 'object' || typeof a === 'function';
+ }
+
+ function is_empty(obj) {
+ return Object.keys(obj).length === 0;
+ }
+
+ function append(target, node) {
+ target.appendChild(node);
+ }
+
+ function insert(target, node, anchor) {
+ target.insertBefore(node, anchor || null);
+ }
+
+ function detach(node) {
+ node.parentNode.removeChild(node);
+ }
+
+ function destroy_each(iterations, detaching) {
+ for (let i = 0; i < iterations.length; i += 1) {
+ if (iterations[i]) iterations[i].d(detaching);
+ }
+ }
+
+ function element(name) {
+ return document.createElement(name);
+ }
+
+ function svg_element(name) {
+ return document.createElementNS('http://www.w3.org/2000/svg', name);
+ }
+
+ function text(data) {
+ return document.createTextNode(data);
+ }
+
+ function space() {
+ return text(' ');
+ }
+
+ function empty() {
+ return text('');
+ }
+
+ function listen(node, event, handler, options) {
+ node.addEventListener(event, handler, options);
+ return () => node.removeEventListener(event, handler, options);
+ }
+
+ function attr(node, attribute, value) {
+ if (value == null) node.removeAttribute(attribute);else if (node.getAttribute(attribute) !== value) node.setAttribute(attribute, value);
+ }
+
+ function set_attributes(node, attributes) {
+ // @ts-ignore
+ const descriptors = Object.getOwnPropertyDescriptors(node.__proto__);
+
+ for (const key in attributes) {
+ if (attributes[key] == null) {
+ node.removeAttribute(key);
+ } else if (key === 'style') {
+ node.style.cssText = attributes[key];
+ } else if (key === '__value') {
+ node.value = node[key] = attributes[key];
+ } else if (descriptors[key] && descriptors[key].set) {
+ node[key] = attributes[key];
+ } else {
+ attr(node, key, attributes[key]);
+ }
+ }
+ }
+
+ function children(element) {
+ return Array.from(element.childNodes);
+ }
+
+ function toggle_class(element, name, toggle) {
+ element.classList[toggle ? 'add' : 'remove'](name);
+ }
+
+ let current_component;
+
+ function set_current_component(component) {
+ current_component = component;
+ }
+
+ function get_current_component() {
+ if (!current_component) throw new Error('Function called outside component initialization');
+ return current_component;
+ }
+
+ function onMount(fn) {
+ get_current_component().$$.on_mount.push(fn);
+ }
+
+ function afterUpdate(fn) {
+ get_current_component().$$.after_update.push(fn);
+ }
+
+ const dirty_components = [];
+ const binding_callbacks = [];
+ const render_callbacks = [];
+ const flush_callbacks = [];
+ const resolved_promise = Promise.resolve();
+ let update_scheduled = false;
+
+ function schedule_update() {
+ if (!update_scheduled) {
+ update_scheduled = true;
+ resolved_promise.then(flush);
+ }
+ }
+
+ function add_render_callback(fn) {
+ render_callbacks.push(fn);
+ }
+
+ let flushing = false;
+ const seen_callbacks = new Set();
+
+ function flush() {
+ if (flushing) return;
+ flushing = true;
+
+ do {
+ // first, call beforeUpdate functions
+ // and update components
+ for (let i = 0; i < dirty_components.length; i += 1) {
+ const component = dirty_components[i];
+ set_current_component(component);
+ update(component.$$);
+ }
+
+ set_current_component(null);
+ dirty_components.length = 0;
+
+ while (binding_callbacks.length) binding_callbacks.pop()(); // then, once components are updated, call
+ // afterUpdate functions. This may cause
+ // subsequent updates...
+
+
+ for (let i = 0; i < render_callbacks.length; i += 1) {
+ const callback = render_callbacks[i];
+
+ if (!seen_callbacks.has(callback)) {
+ // ...so guard against infinite loops
+ seen_callbacks.add(callback);
+ callback();
+ }
+ }
+
+ render_callbacks.length = 0;
+ } while (dirty_components.length);
+
+ while (flush_callbacks.length) {
+ flush_callbacks.pop()();
+ }
+
+ update_scheduled = false;
+ flushing = false;
+ seen_callbacks.clear();
+ }
+
+ function update($$) {
+ if ($$.fragment !== null) {
+ $$.update();
+ run_all($$.before_update);
+ const dirty = $$.dirty;
+ $$.dirty = [-1];
+ $$.fragment && $$.fragment.p($$.ctx, dirty);
+ $$.after_update.forEach(add_render_callback);
+ }
+ }
+
+ const outroing = new Set();
+ let outros;
+
+ function group_outros() {
+ outros = {
+ r: 0,
+ c: [],
+ p: outros // parent group
+
+ };
+ }
+
+ function check_outros() {
+ if (!outros.r) {
+ run_all(outros.c);
+ }
+
+ outros = outros.p;
+ }
+
+ function transition_in(block, local) {
+ if (block && block.i) {
+ outroing.delete(block);
+ block.i(local);
+ }
+ }
+
+ function transition_out(block, local, detach, callback) {
+ if (block && block.o) {
+ if (outroing.has(block)) return;
+ outroing.add(block);
+ outros.c.push(() => {
+ outroing.delete(block);
+
+ if (callback) {
+ if (detach) block.d(1);
+ callback();
+ }
+ });
+ block.o(local);
+ }
+ }
+
+ function get_spread_update(levels, updates) {
+ const update = {};
+ const to_null_out = {};
+ const accounted_for = {
+ $$scope: 1
+ };
+ let i = levels.length;
+
+ while (i--) {
+ const o = levels[i];
+ const n = updates[i];
+
+ if (n) {
+ for (const key in o) {
+ if (!(key in n)) to_null_out[key] = 1;
+ }
+
+ for (const key in n) {
+ if (!accounted_for[key]) {
+ update[key] = n[key];
+ accounted_for[key] = 1;
+ }
+ }
+
+ levels[i] = n;
+ } else {
+ for (const key in o) {
+ accounted_for[key] = 1;
+ }
+ }
+ }
+
+ for (const key in to_null_out) {
+ if (!(key in update)) update[key] = undefined;
+ }
+
+ return update;
+ }
+
+ function create_component(block) {
+ block && block.c();
+ }
+
+ function mount_component(component, target, anchor) {
+ const {
+ fragment,
+ on_mount,
+ on_destroy,
+ after_update
+ } = component.$$;
+ fragment && fragment.m(target, anchor); // onMount happens before the initial afterUpdate
+
+ add_render_callback(() => {
+ const new_on_destroy = on_mount.map(run).filter(is_function);
+
+ if (on_destroy) {
+ on_destroy.push(...new_on_destroy);
+ } else {
+ // Edge case - component was destroyed immediately,
+ // most likely as a result of a binding initialising
+ run_all(new_on_destroy);
+ }
+
+ component.$$.on_mount = [];
+ });
+ after_update.forEach(add_render_callback);
+ }
+
+ function destroy_component(component, detaching) {
+ const $$ = component.$$;
+
+ if ($$.fragment !== null) {
+ run_all($$.on_destroy);
+ $$.fragment && $$.fragment.d(detaching); // TODO null out other refs, including component.$$ (but need to
+ // preserve final state?)
+
+ $$.on_destroy = $$.fragment = null;
+ $$.ctx = [];
+ }
+ }
+
+ function make_dirty(component, i) {
+ if (component.$$.dirty[0] === -1) {
+ dirty_components.push(component);
+ schedule_update();
+ component.$$.dirty.fill(0);
+ }
+
+ component.$$.dirty[i / 31 | 0] |= 1 << i % 31;
+ }
+
+ function init(component, options, instance, create_fragment, not_equal, props, dirty = [-1]) {
+ const parent_component = current_component;
+ set_current_component(component);
+ const prop_values = options.props || {};
+ const $$ = component.$$ = {
+ fragment: null,
+ ctx: null,
+ // state
+ props,
+ update: noop,
+ not_equal,
+ bound: blank_object(),
+ // lifecycle
+ on_mount: [],
+ on_destroy: [],
+ before_update: [],
+ after_update: [],
+ context: new Map(parent_component ? parent_component.$$.context : []),
+ // everything else
+ callbacks: blank_object(),
+ dirty,
+ skip_bound: false
+ };
+ let ready = false;
+ $$.ctx = instance ? instance(component, prop_values, (i, ret, ...rest) => {
+ const value = rest.length ? rest[0] : ret;
+
+ if ($$.ctx && not_equal($$.ctx[i], $$.ctx[i] = value)) {
+ if (!$$.skip_bound && $$.bound[i]) $$.bound[i](value);
+ if (ready) make_dirty(component, i);
+ }
+
+ return ret;
+ }) : [];
+ $$.update();
+ ready = true;
+ run_all($$.before_update); // `false` as a special case of no DOM component
+
+ $$.fragment = create_fragment ? create_fragment($$.ctx) : false;
+
+ if (options.target) {
+ if (options.hydrate) {
+ const nodes = children(options.target); // eslint-disable-next-line @typescript-eslint/no-non-null-assertion
+
+ $$.fragment && $$.fragment.l(nodes);
+ nodes.forEach(detach);
+ } else {
+ // eslint-disable-next-line @typescript-eslint/no-non-null-assertion
+ $$.fragment && $$.fragment.c();
+ }
+
+ if (options.intro) transition_in(component.$$.fragment);
+ mount_component(component, options.target, options.anchor);
+ flush();
+ }
+
+ set_current_component(parent_component);
+ }
+ /**
+ * Base class for Svelte components. Used when dev=false.
+ */
+
+ class SvelteComponent {
+ $destroy() {
+ destroy_component(this, 1);
+ this.$destroy = noop;
+ }
+
+ $on(type, callback) {
+ const callbacks = this.$$.callbacks[type] || (this.$$.callbacks[type] = []);
+ callbacks.push(callback);
+ return () => {
+ const index = callbacks.indexOf(callback);
+ if (index !== -1) callbacks.splice(index, 1);
+ };
+ }
+
+ $set($$props) {
+ if (this.$$set && !is_empty($$props)) {
+ this.$$.skip_bound = true;
+ this.$$set($$props);
+ this.$$.skip_bound = false;
+ }
+ }
+
+ }
+
+ /* src/js/components/shepherd-button.svelte generated by Svelte v3.31.0 */
+ function create_fragment(ctx) {
+ let button;
+ let button_aria_label_value;
+ let button_class_value;
+ let mounted;
+ let dispose;
+ return {
+ c() {
+ button = element("button");
+ attr(button, "aria-label", button_aria_label_value =
+ /*label*/
+ ctx[3] ?
+ /*label*/
+ ctx[3] : null);
+ attr(button, "class", button_class_value = `${
+ /*classes*/
+ ctx[1] || ""} shepherd-button ${
+ /*secondary*/
+ ctx[4] ? "shepherd-button-secondary" : ""}`);
+ button.disabled =
+ /*disabled*/
+ ctx[2];
+ attr(button, "tabindex", "0");
+ },
+
+ m(target, anchor) {
+ insert(target, button, anchor);
+ button.innerHTML =
+ /*text*/
+ ctx[5];
+
+ if (!mounted) {
+ dispose = listen(button, "click", function () {
+ if (is_function(
+ /*action*/
+ ctx[0]))
+ /*action*/
+ ctx[0].apply(this, arguments);
+ });
+ mounted = true;
+ }
+ },
+
+ p(new_ctx, [dirty]) {
+ ctx = new_ctx;
+ if (dirty &
+ /*text*/
+ 32) button.innerHTML =
+ /*text*/
+ ctx[5];
+
+ if (dirty &
+ /*label*/
+ 8 && button_aria_label_value !== (button_aria_label_value =
+ /*label*/
+ ctx[3] ?
+ /*label*/
+ ctx[3] : null)) {
+ attr(button, "aria-label", button_aria_label_value);
+ }
+
+ if (dirty &
+ /*classes, secondary*/
+ 18 && button_class_value !== (button_class_value = `${
+ /*classes*/
+ ctx[1] || ""} shepherd-button ${
+ /*secondary*/
+ ctx[4] ? "shepherd-button-secondary" : ""}`)) {
+ attr(button, "class", button_class_value);
+ }
+
+ if (dirty &
+ /*disabled*/
+ 4) {
+ button.disabled =
+ /*disabled*/
+ ctx[2];
+ }
+ },
+
+ i: noop,
+ o: noop,
+
+ d(detaching) {
+ if (detaching) detach(button);
+ mounted = false;
+ dispose();
+ }
+
+ };
+ }
+
+ function instance($$self, $$props, $$invalidate) {
+ let {
+ config
+ } = $$props,
+ {
+ step
+ } = $$props;
+ let action, classes, disabled, label, secondary, text;
+
+ function getDisabled(disabled) {
+ if (isFunction(disabled)) {
+ return disabled = disabled.call(step);
+ }
+
+ return disabled;
+ }
+
+ $$self.$$set = $$props => {
+ if ("config" in $$props) $$invalidate(6, config = $$props.config);
+ if ("step" in $$props) $$invalidate(7, step = $$props.step);
+ };
+
+ $$self.$$.update = () => {
+ if ($$self.$$.dirty &
+ /*config, step*/
+ 192) {
+ {
+ $$invalidate(0, action = config.action ? config.action.bind(step.tour) : null);
+ $$invalidate(1, classes = config.classes);
+ $$invalidate(2, disabled = config.disabled ? getDisabled(config.disabled) : false);
+ $$invalidate(3, label = config.label);
+ $$invalidate(4, secondary = config.secondary);
+ $$invalidate(5, text = config.text);
+ }
+ }
+ };
+
+ return [action, classes, disabled, label, secondary, text, config, step];
+ }
+
+ class Shepherd_button extends SvelteComponent {
+ constructor(options) {
+ super();
+ init(this, options, instance, create_fragment, safe_not_equal, {
+ config: 6,
+ step: 7
+ });
+ }
+
+ }
+
+ /* src/js/components/shepherd-footer.svelte generated by Svelte v3.31.0 */
+ function get_each_context(ctx, list, i) {
+ const child_ctx = ctx.slice();
+ child_ctx[2] = list[i];
+ return child_ctx;
+ } // (24:4) {#if buttons}
+
+
+ function create_if_block(ctx) {
+ let each_1_anchor;
+ let current;
+ let each_value =
+ /*buttons*/
+ ctx[1];
+ let each_blocks = [];
+
+ for (let i = 0; i < each_value.length; i += 1) {
+ each_blocks[i] = create_each_block(get_each_context(ctx, each_value, i));
+ }
+
+ const out = i => transition_out(each_blocks[i], 1, 1, () => {
+ each_blocks[i] = null;
+ });
+
+ return {
+ c() {
+ for (let i = 0; i < each_blocks.length; i += 1) {
+ each_blocks[i].c();
+ }
+
+ each_1_anchor = empty();
+ },
+
+ m(target, anchor) {
+ for (let i = 0; i < each_blocks.length; i += 1) {
+ each_blocks[i].m(target, anchor);
+ }
+
+ insert(target, each_1_anchor, anchor);
+ current = true;
+ },
+
+ p(ctx, dirty) {
+ if (dirty &
+ /*buttons, step*/
+ 3) {
+ each_value =
+ /*buttons*/
+ ctx[1];
+ let i;
+
+ for (i = 0; i < each_value.length; i += 1) {
+ const child_ctx = get_each_context(ctx, each_value, i);
+
+ if (each_blocks[i]) {
+ each_blocks[i].p(child_ctx, dirty);
+ transition_in(each_blocks[i], 1);
+ } else {
+ each_blocks[i] = create_each_block(child_ctx);
+ each_blocks[i].c();
+ transition_in(each_blocks[i], 1);
+ each_blocks[i].m(each_1_anchor.parentNode, each_1_anchor);
+ }
+ }
+
+ group_outros();
+
+ for (i = each_value.length; i < each_blocks.length; i += 1) {
+ out(i);
+ }
+
+ check_outros();
+ }
+ },
+
+ i(local) {
+ if (current) return;
+
+ for (let i = 0; i < each_value.length; i += 1) {
+ transition_in(each_blocks[i]);
+ }
+
+ current = true;
+ },
+
+ o(local) {
+ each_blocks = each_blocks.filter(Boolean);
+
+ for (let i = 0; i < each_blocks.length; i += 1) {
+ transition_out(each_blocks[i]);
+ }
+
+ current = false;
+ },
+
+ d(detaching) {
+ destroy_each(each_blocks, detaching);
+ if (detaching) detach(each_1_anchor);
+ }
+
+ };
+ } // (25:8) {#each buttons as config}
+
+
+ function create_each_block(ctx) {
+ let shepherdbutton;
+ let current;
+ shepherdbutton = new Shepherd_button({
+ props: {
+ config:
+ /*config*/
+ ctx[2],
+ step:
+ /*step*/
+ ctx[0]
+ }
+ });
+ return {
+ c() {
+ create_component(shepherdbutton.$$.fragment);
+ },
+
+ m(target, anchor) {
+ mount_component(shepherdbutton, target, anchor);
+ current = true;
+ },
+
+ p(ctx, dirty) {
+ const shepherdbutton_changes = {};
+ if (dirty &
+ /*buttons*/
+ 2) shepherdbutton_changes.config =
+ /*config*/
+ ctx[2];
+ if (dirty &
+ /*step*/
+ 1) shepherdbutton_changes.step =
+ /*step*/
+ ctx[0];
+ shepherdbutton.$set(shepherdbutton_changes);
+ },
+
+ i(local) {
+ if (current) return;
+ transition_in(shepherdbutton.$$.fragment, local);
+ current = true;
+ },
+
+ o(local) {
+ transition_out(shepherdbutton.$$.fragment, local);
+ current = false;
+ },
+
+ d(detaching) {
+ destroy_component(shepherdbutton, detaching);
+ }
+
+ };
+ }
+
+ function create_fragment$1(ctx) {
+ let footer;
+ let current;
+ let if_block =
+ /*buttons*/
+ ctx[1] && create_if_block(ctx);
+ return {
+ c() {
+ footer = element("footer");
+ if (if_block) if_block.c();
+ attr(footer, "class", "shepherd-footer");
+ },
+
+ m(target, anchor) {
+ insert(target, footer, anchor);
+ if (if_block) if_block.m(footer, null);
+ current = true;
+ },
+
+ p(ctx, [dirty]) {
+ if (
+ /*buttons*/
+ ctx[1]) {
+ if (if_block) {
+ if_block.p(ctx, dirty);
+
+ if (dirty &
+ /*buttons*/
+ 2) {
+ transition_in(if_block, 1);
+ }
+ } else {
+ if_block = create_if_block(ctx);
+ if_block.c();
+ transition_in(if_block, 1);
+ if_block.m(footer, null);
+ }
+ } else if (if_block) {
+ group_outros();
+ transition_out(if_block, 1, 1, () => {
+ if_block = null;
+ });
+ check_outros();
+ }
+ },
+
+ i(local) {
+ if (current) return;
+ transition_in(if_block);
+ current = true;
+ },
+
+ o(local) {
+ transition_out(if_block);
+ current = false;
+ },
+
+ d(detaching) {
+ if (detaching) detach(footer);
+ if (if_block) if_block.d();
+ }
+
+ };
+ }
+
+ function instance$1($$self, $$props, $$invalidate) {
+ let {
+ step
+ } = $$props;
+
+ $$self.$$set = $$props => {
+ if ("step" in $$props) $$invalidate(0, step = $$props.step);
+ };
+
+ let buttons;
+
+ $$self.$$.update = () => {
+ if ($$self.$$.dirty &
+ /*step*/
+ 1) {
+ $$invalidate(1, buttons = step.options.buttons);
+ }
+ };
+
+ return [step, buttons];
+ }
+
+ class Shepherd_footer extends SvelteComponent {
+ constructor(options) {
+ super();
+ init(this, options, instance$1, create_fragment$1, safe_not_equal, {
+ step: 0
+ });
+ }
+
+ }
+
+ /* src/js/components/shepherd-cancel-icon.svelte generated by Svelte v3.31.0 */
+ function create_fragment$2(ctx) {
+ let button;
+ let span;
+ let button_aria_label_value;
+ let mounted;
+ let dispose;
+ return {
+ c() {
+ button = element("button");
+ span = element("span");
+ span.textContent = "×";
+ attr(span, "aria-hidden", "true");
+ attr(button, "aria-label", button_aria_label_value =
+ /*cancelIcon*/
+ ctx[0].label ?
+ /*cancelIcon*/
+ ctx[0].label : "Close Tour");
+ attr(button, "class", "shepherd-cancel-icon");
+ attr(button, "type", "button");
+ },
+
+ m(target, anchor) {
+ insert(target, button, anchor);
+ append(button, span);
+
+ if (!mounted) {
+ dispose = listen(button, "click",
+ /*handleCancelClick*/
+ ctx[1]);
+ mounted = true;
+ }
+ },
+
+ p(ctx, [dirty]) {
+ if (dirty &
+ /*cancelIcon*/
+ 1 && button_aria_label_value !== (button_aria_label_value =
+ /*cancelIcon*/
+ ctx[0].label ?
+ /*cancelIcon*/
+ ctx[0].label : "Close Tour")) {
+ attr(button, "aria-label", button_aria_label_value);
+ }
+ },
+
+ i: noop,
+ o: noop,
+
+ d(detaching) {
+ if (detaching) detach(button);
+ mounted = false;
+ dispose();
+ }
+
+ };
+ }
+
+ function instance$2($$self, $$props, $$invalidate) {
+ let {
+ cancelIcon
+ } = $$props,
+ {
+ step
+ } = $$props;
+ /**
+ * Add a click listener to the cancel link that cancels the tour
+ */
+ const handleCancelClick = e => {
+ e.preventDefault();
+ step.cancel();
+ };
+
+ $$self.$$set = $$props => {
+ if ("cancelIcon" in $$props) $$invalidate(0, cancelIcon = $$props.cancelIcon);
+ if ("step" in $$props) $$invalidate(2, step = $$props.step);
+ };
+
+ return [cancelIcon, handleCancelClick, step];
+ }
+
+ class Shepherd_cancel_icon extends SvelteComponent {
+ constructor(options) {
+ super();
+ init(this, options, instance$2, create_fragment$2, safe_not_equal, {
+ cancelIcon: 0,
+ step: 2
+ });
+ }
+
+ }
+
+ /* src/js/components/shepherd-title.svelte generated by Svelte v3.31.0 */
+ function create_fragment$3(ctx) {
+ let h3;
+ return {
+ c() {
+ h3 = element("h3");
+ attr(h3, "id",
+ /*labelId*/
+ ctx[1]);
+ attr(h3, "class", "shepherd-title");
+ },
+
+ m(target, anchor) {
+ insert(target, h3, anchor);
+ /*h3_binding*/
+ ctx[3](h3);
+ },
+
+ p(ctx, [dirty]) {
+ if (dirty &
+ /*labelId*/
+ 2) {
+ attr(h3, "id",
+ /*labelId*/
+ ctx[1]);
+ }
+ },
+
+ i: noop,
+ o: noop,
+
+ d(detaching) {
+ if (detaching) detach(h3);
+ /*h3_binding*/
+ ctx[3](null);
+ }
+
+ };
+ }
+
+ function instance$3($$self, $$props, $$invalidate) {
+ let {
+ labelId
+ } = $$props,
+ {
+ element
+ } = $$props,
+ {
+ title
+ } = $$props;
+ afterUpdate(() => {
+ if (isFunction(title)) {
+ $$invalidate(2, title = title());
+ }
+
+ $$invalidate(0, element.innerHTML = title, element);
+ });
+
+ function h3_binding($$value) {
+ binding_callbacks[$$value ? "unshift" : "push"](() => {
+ element = $$value;
+ $$invalidate(0, element);
+ });
+ }
+
+ $$self.$$set = $$props => {
+ if ("labelId" in $$props) $$invalidate(1, labelId = $$props.labelId);
+ if ("element" in $$props) $$invalidate(0, element = $$props.element);
+ if ("title" in $$props) $$invalidate(2, title = $$props.title);
+ };
+
+ return [element, labelId, title, h3_binding];
+ }
+
+ class Shepherd_title extends SvelteComponent {
+ constructor(options) {
+ super();
+ init(this, options, instance$3, create_fragment$3, safe_not_equal, {
+ labelId: 1,
+ element: 0,
+ title: 2
+ });
+ }
+
+ }
+
+ /* src/js/components/shepherd-header.svelte generated by Svelte v3.31.0 */
+ function create_if_block_1(ctx) {
+ let shepherdtitle;
+ let current;
+ shepherdtitle = new Shepherd_title({
+ props: {
+ labelId:
+ /*labelId*/
+ ctx[0],
+ title:
+ /*title*/
+ ctx[2]
+ }
+ });
+ return {
+ c() {
+ create_component(shepherdtitle.$$.fragment);
+ },
+
+ m(target, anchor) {
+ mount_component(shepherdtitle, target, anchor);
+ current = true;
+ },
+
+ p(ctx, dirty) {
+ const shepherdtitle_changes = {};
+ if (dirty &
+ /*labelId*/
+ 1) shepherdtitle_changes.labelId =
+ /*labelId*/
+ ctx[0];
+ if (dirty &
+ /*title*/
+ 4) shepherdtitle_changes.title =
+ /*title*/
+ ctx[2];
+ shepherdtitle.$set(shepherdtitle_changes);
+ },
+
+ i(local) {
+ if (current) return;
+ transition_in(shepherdtitle.$$.fragment, local);
+ current = true;
+ },
+
+ o(local) {
+ transition_out(shepherdtitle.$$.fragment, local);
+ current = false;
+ },
+
+ d(detaching) {
+ destroy_component(shepherdtitle, detaching);
+ }
+
+ };
+ } // (39:4) {#if cancelIcon && cancelIcon.enabled}
+
+
+ function create_if_block$1(ctx) {
+ let shepherdcancelicon;
+ let current;
+ shepherdcancelicon = new Shepherd_cancel_icon({
+ props: {
+ cancelIcon:
+ /*cancelIcon*/
+ ctx[3],
+ step:
+ /*step*/
+ ctx[1]
+ }
+ });
+ return {
+ c() {
+ create_component(shepherdcancelicon.$$.fragment);
+ },
+
+ m(target, anchor) {
+ mount_component(shepherdcancelicon, target, anchor);
+ current = true;
+ },
+
+ p(ctx, dirty) {
+ const shepherdcancelicon_changes = {};
+ if (dirty &
+ /*cancelIcon*/
+ 8) shepherdcancelicon_changes.cancelIcon =
+ /*cancelIcon*/
+ ctx[3];
+ if (dirty &
+ /*step*/
+ 2) shepherdcancelicon_changes.step =
+ /*step*/
+ ctx[1];
+ shepherdcancelicon.$set(shepherdcancelicon_changes);
+ },
+
+ i(local) {
+ if (current) return;
+ transition_in(shepherdcancelicon.$$.fragment, local);
+ current = true;
+ },
+
+ o(local) {
+ transition_out(shepherdcancelicon.$$.fragment, local);
+ current = false;
+ },
+
+ d(detaching) {
+ destroy_component(shepherdcancelicon, detaching);
+ }
+
+ };
+ }
+
+ function create_fragment$4(ctx) {
+ let header;
+ let t;
+ let current;
+ let if_block0 =
+ /*title*/
+ ctx[2] && create_if_block_1(ctx);
+ let if_block1 =
+ /*cancelIcon*/
+ ctx[3] &&
+ /*cancelIcon*/
+ ctx[3].enabled && create_if_block$1(ctx);
+ return {
+ c() {
+ header = element("header");
+ if (if_block0) if_block0.c();
+ t = space();
+ if (if_block1) if_block1.c();
+ attr(header, "class", "shepherd-header");
+ },
+
+ m(target, anchor) {
+ insert(target, header, anchor);
+ if (if_block0) if_block0.m(header, null);
+ append(header, t);
+ if (if_block1) if_block1.m(header, null);
+ current = true;
+ },
+
+ p(ctx, [dirty]) {
+ if (
+ /*title*/
+ ctx[2]) {
+ if (if_block0) {
+ if_block0.p(ctx, dirty);
+
+ if (dirty &
+ /*title*/
+ 4) {
+ transition_in(if_block0, 1);
+ }
+ } else {
+ if_block0 = create_if_block_1(ctx);
+ if_block0.c();
+ transition_in(if_block0, 1);
+ if_block0.m(header, t);
+ }
+ } else if (if_block0) {
+ group_outros();
+ transition_out(if_block0, 1, 1, () => {
+ if_block0 = null;
+ });
+ check_outros();
+ }
+
+ if (
+ /*cancelIcon*/
+ ctx[3] &&
+ /*cancelIcon*/
+ ctx[3].enabled) {
+ if (if_block1) {
+ if_block1.p(ctx, dirty);
+
+ if (dirty &
+ /*cancelIcon*/
+ 8) {
+ transition_in(if_block1, 1);
+ }
+ } else {
+ if_block1 = create_if_block$1(ctx);
+ if_block1.c();
+ transition_in(if_block1, 1);
+ if_block1.m(header, null);
+ }
+ } else if (if_block1) {
+ group_outros();
+ transition_out(if_block1, 1, 1, () => {
+ if_block1 = null;
+ });
+ check_outros();
+ }
+ },
+
+ i(local) {
+ if (current) return;
+ transition_in(if_block0);
+ transition_in(if_block1);
+ current = true;
+ },
+
+ o(local) {
+ transition_out(if_block0);
+ transition_out(if_block1);
+ current = false;
+ },
+
+ d(detaching) {
+ if (detaching) detach(header);
+ if (if_block0) if_block0.d();
+ if (if_block1) if_block1.d();
+ }
+
+ };
+ }
+
+ function instance$4($$self, $$props, $$invalidate) {
+ let {
+ labelId
+ } = $$props,
+ {
+ step
+ } = $$props;
+ let title, cancelIcon;
+
+ $$self.$$set = $$props => {
+ if ("labelId" in $$props) $$invalidate(0, labelId = $$props.labelId);
+ if ("step" in $$props) $$invalidate(1, step = $$props.step);
+ };
+
+ $$self.$$.update = () => {
+ if ($$self.$$.dirty &
+ /*step*/
+ 2) {
+ {
+ $$invalidate(2, title = step.options.title);
+ $$invalidate(3, cancelIcon = step.options.cancelIcon);
+ }
+ }
+ };
+
+ return [labelId, step, title, cancelIcon];
+ }
+
+ class Shepherd_header extends SvelteComponent {
+ constructor(options) {
+ super();
+ init(this, options, instance$4, create_fragment$4, safe_not_equal, {
+ labelId: 0,
+ step: 1
+ });
+ }
+
+ }
+
+ /* src/js/components/shepherd-text.svelte generated by Svelte v3.31.0 */
+ function create_fragment$5(ctx) {
+ let div;
+ return {
+ c() {
+ div = element("div");
+ attr(div, "class", "shepherd-text");
+ attr(div, "id",
+ /*descriptionId*/
+ ctx[1]);
+ },
+
+ m(target, anchor) {
+ insert(target, div, anchor);
+ /*div_binding*/
+ ctx[3](div);
+ },
+
+ p(ctx, [dirty]) {
+ if (dirty &
+ /*descriptionId*/
+ 2) {
+ attr(div, "id",
+ /*descriptionId*/
+ ctx[1]);
+ }
+ },
+
+ i: noop,
+ o: noop,
+
+ d(detaching) {
+ if (detaching) detach(div);
+ /*div_binding*/
+ ctx[3](null);
+ }
+
+ };
+ }
+
+ function instance$5($$self, $$props, $$invalidate) {
+ let {
+ descriptionId
+ } = $$props,
+ {
+ element
+ } = $$props,
+ {
+ step
+ } = $$props;
+ afterUpdate(() => {
+ let {
+ text
+ } = step.options;
+
+ if (isFunction(text)) {
+ text = text.call(step);
+ }
+
+ if (isHTMLElement(text)) {
+ element.appendChild(text);
+ } else {
+ $$invalidate(0, element.innerHTML = text, element);
+ }
+ });
+
+ function div_binding($$value) {
+ binding_callbacks[$$value ? "unshift" : "push"](() => {
+ element = $$value;
+ $$invalidate(0, element);
+ });
+ }
+
+ $$self.$$set = $$props => {
+ if ("descriptionId" in $$props) $$invalidate(1, descriptionId = $$props.descriptionId);
+ if ("element" in $$props) $$invalidate(0, element = $$props.element);
+ if ("step" in $$props) $$invalidate(2, step = $$props.step);
+ };
+
+ return [element, descriptionId, step, div_binding];
+ }
+
+ class Shepherd_text extends SvelteComponent {
+ constructor(options) {
+ super();
+ init(this, options, instance$5, create_fragment$5, safe_not_equal, {
+ descriptionId: 1,
+ element: 0,
+ step: 2
+ });
+ }
+
+ }
+
+ /* src/js/components/shepherd-content.svelte generated by Svelte v3.31.0 */
+ function create_if_block_2(ctx) {
+ let shepherdheader;
+ let current;
+ shepherdheader = new Shepherd_header({
+ props: {
+ labelId:
+ /*labelId*/
+ ctx[1],
+ step:
+ /*step*/
+ ctx[2]
+ }
+ });
+ return {
+ c() {
+ create_component(shepherdheader.$$.fragment);
+ },
+
+ m(target, anchor) {
+ mount_component(shepherdheader, target, anchor);
+ current = true;
+ },
+
+ p(ctx, dirty) {
+ const shepherdheader_changes = {};
+ if (dirty &
+ /*labelId*/
+ 2) shepherdheader_changes.labelId =
+ /*labelId*/
+ ctx[1];
+ if (dirty &
+ /*step*/
+ 4) shepherdheader_changes.step =
+ /*step*/
+ ctx[2];
+ shepherdheader.$set(shepherdheader_changes);
+ },
+
+ i(local) {
+ if (current) return;
+ transition_in(shepherdheader.$$.fragment, local);
+ current = true;
+ },
+
+ o(local) {
+ transition_out(shepherdheader.$$.fragment, local);
+ current = false;
+ },
+
+ d(detaching) {
+ destroy_component(shepherdheader, detaching);
+ }
+
+ };
+ } // (28:2) {#if !isUndefined(step.options.text)}
+
+
+ function create_if_block_1$1(ctx) {
+ let shepherdtext;
+ let current;
+ shepherdtext = new Shepherd_text({
+ props: {
+ descriptionId:
+ /*descriptionId*/
+ ctx[0],
+ step:
+ /*step*/
+ ctx[2]
+ }
+ });
+ return {
+ c() {
+ create_component(shepherdtext.$$.fragment);
+ },
+
+ m(target, anchor) {
+ mount_component(shepherdtext, target, anchor);
+ current = true;
+ },
+
+ p(ctx, dirty) {
+ const shepherdtext_changes = {};
+ if (dirty &
+ /*descriptionId*/
+ 1) shepherdtext_changes.descriptionId =
+ /*descriptionId*/
+ ctx[0];
+ if (dirty &
+ /*step*/
+ 4) shepherdtext_changes.step =
+ /*step*/
+ ctx[2];
+ shepherdtext.$set(shepherdtext_changes);
+ },
+
+ i(local) {
+ if (current) return;
+ transition_in(shepherdtext.$$.fragment, local);
+ current = true;
+ },
+
+ o(local) {
+ transition_out(shepherdtext.$$.fragment, local);
+ current = false;
+ },
+
+ d(detaching) {
+ destroy_component(shepherdtext, detaching);
+ }
+
+ };
+ } // (35:2) {#if Array.isArray(step.options.buttons) && step.options.buttons.length}
+
+
+ function create_if_block$2(ctx) {
+ let shepherdfooter;
+ let current;
+ shepherdfooter = new Shepherd_footer({
+ props: {
+ step:
+ /*step*/
+ ctx[2]
+ }
+ });
+ return {
+ c() {
+ create_component(shepherdfooter.$$.fragment);
+ },
+
+ m(target, anchor) {
+ mount_component(shepherdfooter, target, anchor);
+ current = true;
+ },
+
+ p(ctx, dirty) {
+ const shepherdfooter_changes = {};
+ if (dirty &
+ /*step*/
+ 4) shepherdfooter_changes.step =
+ /*step*/
+ ctx[2];
+ shepherdfooter.$set(shepherdfooter_changes);
+ },
+
+ i(local) {
+ if (current) return;
+ transition_in(shepherdfooter.$$.fragment, local);
+ current = true;
+ },
+
+ o(local) {
+ transition_out(shepherdfooter.$$.fragment, local);
+ current = false;
+ },
+
+ d(detaching) {
+ destroy_component(shepherdfooter, detaching);
+ }
+
+ };
+ }
+
+ function create_fragment$6(ctx) {
+ let div;
+ let show_if_2 = !isUndefined(
+ /*step*/
+ ctx[2].options.title) ||
+ /*step*/
+ ctx[2].options.cancelIcon &&
+ /*step*/
+ ctx[2].options.cancelIcon.enabled;
+ let t0;
+ let show_if_1 = !isUndefined(
+ /*step*/
+ ctx[2].options.text);
+ let t1;
+ let show_if = Array.isArray(
+ /*step*/
+ ctx[2].options.buttons) &&
+ /*step*/
+ ctx[2].options.buttons.length;
+ let current;
+ let if_block0 = show_if_2 && create_if_block_2(ctx);
+ let if_block1 = show_if_1 && create_if_block_1$1(ctx);
+ let if_block2 = show_if && create_if_block$2(ctx);
+ return {
+ c() {
+ div = element("div");
+ if (if_block0) if_block0.c();
+ t0 = space();
+ if (if_block1) if_block1.c();
+ t1 = space();
+ if (if_block2) if_block2.c();
+ attr(div, "class", "shepherd-content");
+ },
+
+ m(target, anchor) {
+ insert(target, div, anchor);
+ if (if_block0) if_block0.m(div, null);
+ append(div, t0);
+ if (if_block1) if_block1.m(div, null);
+ append(div, t1);
+ if (if_block2) if_block2.m(div, null);
+ current = true;
+ },
+
+ p(ctx, [dirty]) {
+ if (dirty &
+ /*step*/
+ 4) show_if_2 = !isUndefined(
+ /*step*/
+ ctx[2].options.title) ||
+ /*step*/
+ ctx[2].options.cancelIcon &&
+ /*step*/
+ ctx[2].options.cancelIcon.enabled;
+
+ if (show_if_2) {
+ if (if_block0) {
+ if_block0.p(ctx, dirty);
+
+ if (dirty &
+ /*step*/
+ 4) {
+ transition_in(if_block0, 1);
+ }
+ } else {
+ if_block0 = create_if_block_2(ctx);
+ if_block0.c();
+ transition_in(if_block0, 1);
+ if_block0.m(div, t0);
+ }
+ } else if (if_block0) {
+ group_outros();
+ transition_out(if_block0, 1, 1, () => {
+ if_block0 = null;
+ });
+ check_outros();
+ }
+
+ if (dirty &
+ /*step*/
+ 4) show_if_1 = !isUndefined(
+ /*step*/
+ ctx[2].options.text);
+
+ if (show_if_1) {
+ if (if_block1) {
+ if_block1.p(ctx, dirty);
+
+ if (dirty &
+ /*step*/
+ 4) {
+ transition_in(if_block1, 1);
+ }
+ } else {
+ if_block1 = create_if_block_1$1(ctx);
+ if_block1.c();
+ transition_in(if_block1, 1);
+ if_block1.m(div, t1);
+ }
+ } else if (if_block1) {
+ group_outros();
+ transition_out(if_block1, 1, 1, () => {
+ if_block1 = null;
+ });
+ check_outros();
+ }
+
+ if (dirty &
+ /*step*/
+ 4) show_if = Array.isArray(
+ /*step*/
+ ctx[2].options.buttons) &&
+ /*step*/
+ ctx[2].options.buttons.length;
+
+ if (show_if) {
+ if (if_block2) {
+ if_block2.p(ctx, dirty);
+
+ if (dirty &
+ /*step*/
+ 4) {
+ transition_in(if_block2, 1);
+ }
+ } else {
+ if_block2 = create_if_block$2(ctx);
+ if_block2.c();
+ transition_in(if_block2, 1);
+ if_block2.m(div, null);
+ }
+ } else if (if_block2) {
+ group_outros();
+ transition_out(if_block2, 1, 1, () => {
+ if_block2 = null;
+ });
+ check_outros();
+ }
+ },
+
+ i(local) {
+ if (current) return;
+ transition_in(if_block0);
+ transition_in(if_block1);
+ transition_in(if_block2);
+ current = true;
+ },
+
+ o(local) {
+ transition_out(if_block0);
+ transition_out(if_block1);
+ transition_out(if_block2);
+ current = false;
+ },
+
+ d(detaching) {
+ if (detaching) detach(div);
+ if (if_block0) if_block0.d();
+ if (if_block1) if_block1.d();
+ if (if_block2) if_block2.d();
+ }
+
+ };
+ }
+
+ function instance$6($$self, $$props, $$invalidate) {
+ let {
+ descriptionId
+ } = $$props,
+ {
+ labelId
+ } = $$props,
+ {
+ step
+ } = $$props;
+
+ $$self.$$set = $$props => {
+ if ("descriptionId" in $$props) $$invalidate(0, descriptionId = $$props.descriptionId);
+ if ("labelId" in $$props) $$invalidate(1, labelId = $$props.labelId);
+ if ("step" in $$props) $$invalidate(2, step = $$props.step);
+ };
+
+ return [descriptionId, labelId, step];
+ }
+
+ class Shepherd_content extends SvelteComponent {
+ constructor(options) {
+ super();
+ init(this, options, instance$6, create_fragment$6, safe_not_equal, {
+ descriptionId: 0,
+ labelId: 1,
+ step: 2
+ });
+ }
+
+ }
+
+ /* src/js/components/shepherd-element.svelte generated by Svelte v3.31.0 */
+ function create_if_block$3(ctx) {
+ let div;
+ return {
+ c() {
+ div = element("div");
+ attr(div, "class", "shepherd-arrow");
+ attr(div, "data-popper-arrow", "");
+ },
+
+ m(target, anchor) {
+ insert(target, div, anchor);
+ },
+
+ d(detaching) {
+ if (detaching) detach(div);
+ }
+
+ };
+ }
+
+ function create_fragment$7(ctx) {
+ let div;
+ let t;
+ let shepherdcontent;
+ let div_aria_describedby_value;
+ let div_aria_labelledby_value;
+ let current;
+ let mounted;
+ let dispose;
+ let if_block =
+ /*step*/
+ ctx[4].options.arrow &&
+ /*step*/
+ ctx[4].options.attachTo &&
+ /*step*/
+ ctx[4].options.attachTo.element &&
+ /*step*/
+ ctx[4].options.attachTo.on && create_if_block$3();
+ shepherdcontent = new Shepherd_content({
+ props: {
+ descriptionId:
+ /*descriptionId*/
+ ctx[2],
+ labelId:
+ /*labelId*/
+ ctx[3],
+ step:
+ /*step*/
+ ctx[4]
+ }
+ });
+ let div_levels = [{
+ "aria-describedby": div_aria_describedby_value = !isUndefined(
+ /*step*/
+ ctx[4].options.text) ?
+ /*descriptionId*/
+ ctx[2] : null
+ }, {
+ "aria-labelledby": div_aria_labelledby_value =
+ /*step*/
+ ctx[4].options.title ?
+ /*labelId*/
+ ctx[3] : null
+ },
+ /*dataStepId*/
+ ctx[1], {
+ role: "dialog"
+ }, {
+ tabindex: "0"
+ }];
+ let div_data = {};
+
+ for (let i = 0; i < div_levels.length; i += 1) {
+ div_data = assign(div_data, div_levels[i]);
+ }
+
+ return {
+ c() {
+ div = element("div");
+ if (if_block) if_block.c();
+ t = space();
+ create_component(shepherdcontent.$$.fragment);
+ set_attributes(div, div_data);
+ toggle_class(div, "shepherd-has-cancel-icon",
+ /*hasCancelIcon*/
+ ctx[5]);
+ toggle_class(div, "shepherd-has-title",
+ /*hasTitle*/
+ ctx[6]);
+ toggle_class(div, "shepherd-element", true);
+ },
+
+ m(target, anchor) {
+ insert(target, div, anchor);
+ if (if_block) if_block.m(div, null);
+ append(div, t);
+ mount_component(shepherdcontent, div, null);
+ /*div_binding*/
+ ctx[13](div);
+ current = true;
+
+ if (!mounted) {
+ dispose = listen(div, "keydown",
+ /*handleKeyDown*/
+ ctx[7]);
+ mounted = true;
+ }
+ },
+
+ p(ctx, [dirty]) {
+ if (
+ /*step*/
+ ctx[4].options.arrow &&
+ /*step*/
+ ctx[4].options.attachTo &&
+ /*step*/
+ ctx[4].options.attachTo.element &&
+ /*step*/
+ ctx[4].options.attachTo.on) {
+ if (if_block) ; else {
+ if_block = create_if_block$3();
+ if_block.c();
+ if_block.m(div, t);
+ }
+ } else if (if_block) {
+ if_block.d(1);
+ if_block = null;
+ }
+
+ const shepherdcontent_changes = {};
+ if (dirty &
+ /*descriptionId*/
+ 4) shepherdcontent_changes.descriptionId =
+ /*descriptionId*/
+ ctx[2];
+ if (dirty &
+ /*labelId*/
+ 8) shepherdcontent_changes.labelId =
+ /*labelId*/
+ ctx[3];
+ if (dirty &
+ /*step*/
+ 16) shepherdcontent_changes.step =
+ /*step*/
+ ctx[4];
+ shepherdcontent.$set(shepherdcontent_changes);
+ set_attributes(div, div_data = get_spread_update(div_levels, [(!current || dirty &
+ /*step, descriptionId*/
+ 20 && div_aria_describedby_value !== (div_aria_describedby_value = !isUndefined(
+ /*step*/
+ ctx[4].options.text) ?
+ /*descriptionId*/
+ ctx[2] : null)) && {
+ "aria-describedby": div_aria_describedby_value
+ }, (!current || dirty &
+ /*step, labelId*/
+ 24 && div_aria_labelledby_value !== (div_aria_labelledby_value =
+ /*step*/
+ ctx[4].options.title ?
+ /*labelId*/
+ ctx[3] : null)) && {
+ "aria-labelledby": div_aria_labelledby_value
+ }, dirty &
+ /*dataStepId*/
+ 2 &&
+ /*dataStepId*/
+ ctx[1], {
+ role: "dialog"
+ }, {
+ tabindex: "0"
+ }]));
+ toggle_class(div, "shepherd-has-cancel-icon",
+ /*hasCancelIcon*/
+ ctx[5]);
+ toggle_class(div, "shepherd-has-title",
+ /*hasTitle*/
+ ctx[6]);
+ toggle_class(div, "shepherd-element", true);
+ },
+
+ i(local) {
+ if (current) return;
+ transition_in(shepherdcontent.$$.fragment, local);
+ current = true;
+ },
+
+ o(local) {
+ transition_out(shepherdcontent.$$.fragment, local);
+ current = false;
+ },
+
+ d(detaching) {
+ if (detaching) detach(div);
+ if (if_block) if_block.d();
+ destroy_component(shepherdcontent);
+ /*div_binding*/
+ ctx[13](null);
+ mounted = false;
+ dispose();
+ }
+
+ };
+ }
+
+ const KEY_TAB = 9;
+ const KEY_ESC = 27;
+ const LEFT_ARROW = 37;
+ const RIGHT_ARROW = 39;
+
+ function getClassesArray(classes) {
+ return classes.split(" ").filter(className => !!className.length);
+ }
+
+ function instance$7($$self, $$props, $$invalidate) {
+ let {
+ classPrefix
+ } = $$props,
+ {
+ element
+ } = $$props,
+ {
+ descriptionId
+ } = $$props,
+ {
+ firstFocusableElement
+ } = $$props,
+ {
+ focusableElements
+ } = $$props,
+ {
+ labelId
+ } = $$props,
+ {
+ lastFocusableElement
+ } = $$props,
+ {
+ step
+ } = $$props,
+ {
+ dataStepId
+ } = $$props;
+ let hasCancelIcon, hasTitle, classes;
+
+ const getElement = () => element;
+
+ onMount(() => {
+ // Get all elements that are focusable
+ $$invalidate(1, dataStepId = {
+ [`data-${classPrefix}shepherd-step-id`]: step.id
+ });
+ $$invalidate(9, focusableElements = element.querySelectorAll("a[href], area[href], input:not([disabled]), select:not([disabled]), textarea:not([disabled]), button:not([disabled]), [tabindex=\"0\"]"));
+ $$invalidate(8, firstFocusableElement = focusableElements[0]);
+ $$invalidate(10, lastFocusableElement = focusableElements[focusableElements.length - 1]);
+ });
+ afterUpdate(() => {
+ if (classes !== step.options.classes) {
+ updateDynamicClasses();
+ }
+ });
+
+ function updateDynamicClasses() {
+ removeClasses(classes);
+ classes = step.options.classes;
+ addClasses(classes);
+ }
+
+ function removeClasses(classes) {
+ if (isString(classes)) {
+ const oldClasses = getClassesArray(classes);
+
+ if (oldClasses.length) {
+ element.classList.remove(...oldClasses);
+ }
+ }
+ }
+
+ function addClasses(classes) {
+ if (isString(classes)) {
+ const newClasses = getClassesArray(classes);
+
+ if (newClasses.length) {
+ element.classList.add(...newClasses);
+ }
+ }
+ }
+ /**
+ * Setup keydown events to allow closing the modal with ESC
+ *
+ * Borrowed from this great post! https://bitsofco.de/accessible-modal-dialog/
+ *
+ * @private
+ */
+
+ const handleKeyDown = e => {
+ const {
+ tour
+ } = step;
+
+ switch (e.keyCode) {
+ case KEY_TAB:
+ if (focusableElements.length === 0) {
+ e.preventDefault();
+ break;
+ } // Backward tab
+
+
+ if (e.shiftKey) {
+ if (document.activeElement === firstFocusableElement || document.activeElement.classList.contains("shepherd-element")) {
+ e.preventDefault();
+ lastFocusableElement.focus();
+ }
+ } else {
+ if (document.activeElement === lastFocusableElement) {
+ e.preventDefault();
+ firstFocusableElement.focus();
+ }
+ }
+
+ break;
+
+ case KEY_ESC:
+ if (tour.options.exitOnEsc) {
+ step.cancel();
+ }
+
+ break;
+
+ case LEFT_ARROW:
+ if (tour.options.keyboardNavigation) {
+ tour.back();
+ }
+
+ break;
+
+ case RIGHT_ARROW:
+ if (tour.options.keyboardNavigation) {
+ tour.next();
+ }
+
+ break;
+ }
+ };
+
+ function div_binding($$value) {
+ binding_callbacks[$$value ? "unshift" : "push"](() => {
+ element = $$value;
+ $$invalidate(0, element);
+ });
+ }
+
+ $$self.$$set = $$props => {
+ if ("classPrefix" in $$props) $$invalidate(11, classPrefix = $$props.classPrefix);
+ if ("element" in $$props) $$invalidate(0, element = $$props.element);
+ if ("descriptionId" in $$props) $$invalidate(2, descriptionId = $$props.descriptionId);
+ if ("firstFocusableElement" in $$props) $$invalidate(8, firstFocusableElement = $$props.firstFocusableElement);
+ if ("focusableElements" in $$props) $$invalidate(9, focusableElements = $$props.focusableElements);
+ if ("labelId" in $$props) $$invalidate(3, labelId = $$props.labelId);
+ if ("lastFocusableElement" in $$props) $$invalidate(10, lastFocusableElement = $$props.lastFocusableElement);
+ if ("step" in $$props) $$invalidate(4, step = $$props.step);
+ if ("dataStepId" in $$props) $$invalidate(1, dataStepId = $$props.dataStepId);
+ };
+
+ $$self.$$.update = () => {
+ if ($$self.$$.dirty &
+ /*step*/
+ 16) {
+ {
+ $$invalidate(5, hasCancelIcon = step.options && step.options.cancelIcon && step.options.cancelIcon.enabled);
+ $$invalidate(6, hasTitle = step.options && step.options.title);
+ }
+ }
+ };
+
+ return [element, dataStepId, descriptionId, labelId, step, hasCancelIcon, hasTitle, handleKeyDown, firstFocusableElement, focusableElements, lastFocusableElement, classPrefix, getElement, div_binding];
+ }
+
+ class Shepherd_element extends SvelteComponent {
+ constructor(options) {
+ super();
+ init(this, options, instance$7, create_fragment$7, safe_not_equal, {
+ classPrefix: 11,
+ element: 0,
+ descriptionId: 2,
+ firstFocusableElement: 8,
+ focusableElements: 9,
+ labelId: 3,
+ lastFocusableElement: 10,
+ step: 4,
+ dataStepId: 1,
+ getElement: 12
+ });
+ }
+
+ get getElement() {
+ return this.$$.ctx[12];
+ }
+
+ }
+
+ function createCommonjsModule(fn, module) {
+ return module = { exports: {} }, fn(module, module.exports), module.exports;
+ }
+
+ var smoothscroll = createCommonjsModule(function (module, exports) {
+ /* smoothscroll v0.4.4 - 2019 - Dustan Kasten, Jeremias Menichelli - MIT License */
+ (function () {
+
+ function polyfill() {
+ // aliases
+ var w = window;
+ var d = document; // return if scroll behavior is supported and polyfill is not forced
+
+ if ('scrollBehavior' in d.documentElement.style && w.__forceSmoothScrollPolyfill__ !== true) {
+ return;
+ } // globals
+
+
+ var Element = w.HTMLElement || w.Element;
+ var SCROLL_TIME = 468; // object gathering original scroll methods
+
+ var original = {
+ scroll: w.scroll || w.scrollTo,
+ scrollBy: w.scrollBy,
+ elementScroll: Element.prototype.scroll || scrollElement,
+ scrollIntoView: Element.prototype.scrollIntoView
+ }; // define timing method
+
+ var now = w.performance && w.performance.now ? w.performance.now.bind(w.performance) : Date.now;
+ /**
+ * indicates if a the current browser is made by Microsoft
+ * @method isMicrosoftBrowser
+ * @param {String} userAgent
+ * @returns {Boolean}
+ */
+ function isMicrosoftBrowser(userAgent) {
+ var userAgentPatterns = ['MSIE ', 'Trident/', 'Edge/'];
+ return new RegExp(userAgentPatterns.join('|')).test(userAgent);
+ }
+ /*
+ * IE has rounding bug rounding down clientHeight and clientWidth and
+ * rounding up scrollHeight and scrollWidth causing false positives
+ * on hasScrollableSpace
+ */
+
+ var ROUNDING_TOLERANCE = isMicrosoftBrowser(w.navigator.userAgent) ? 1 : 0;
+ /**
+ * changes scroll position inside an element
+ * @method scrollElement
+ * @param {Number} x
+ * @param {Number} y
+ * @returns {undefined}
+ */
+ function scrollElement(x, y) {
+ this.scrollLeft = x;
+ this.scrollTop = y;
+ }
+ /**
+ * returns result of applying ease math function to a number
+ * @method ease
+ * @param {Number} k
+ * @returns {Number}
+ */
+
+ function ease(k) {
+ return 0.5 * (1 - Math.cos(Math.PI * k));
+ }
+ /**
+ * indicates if a smooth behavior should be applied
+ * @method shouldBailOut
+ * @param {Number|Object} firstArg
+ * @returns {Boolean}
+ */
+
+ function shouldBailOut(firstArg) {
+ if (firstArg === null || typeof firstArg !== 'object' || firstArg.behavior === undefined || firstArg.behavior === 'auto' || firstArg.behavior === 'instant') {
+ // first argument is not an object/null
+ // or behavior is auto, instant or undefined
+ return true;
+ }
+
+ if (typeof firstArg === 'object' && firstArg.behavior === 'smooth') {
+ // first argument is an object and behavior is smooth
+ return false;
+ } // throw error when behavior is not supported
+
+
+ throw new TypeError('behavior member of ScrollOptions ' + firstArg.behavior + ' is not a valid value for enumeration ScrollBehavior.');
+ }
+ /**
+ * indicates if an element has scrollable space in the provided axis
+ * @method hasScrollableSpace
+ * @param {Node} el
+ * @param {String} axis
+ * @returns {Boolean}
+ */
+
+ function hasScrollableSpace(el, axis) {
+ if (axis === 'Y') {
+ return el.clientHeight + ROUNDING_TOLERANCE < el.scrollHeight;
+ }
+
+ if (axis === 'X') {
+ return el.clientWidth + ROUNDING_TOLERANCE < el.scrollWidth;
+ }
+ }
+ /**
+ * indicates if an element has a scrollable overflow property in the axis
+ * @method canOverflow
+ * @param {Node} el
+ * @param {String} axis
+ * @returns {Boolean}
+ */
+
+ function canOverflow(el, axis) {
+ var overflowValue = w.getComputedStyle(el, null)['overflow' + axis];
+ return overflowValue === 'auto' || overflowValue === 'scroll';
+ }
+ /**
+ * indicates if an element can be scrolled in either axis
+ * @method isScrollable
+ * @param {Node} el
+ * @param {String} axis
+ * @returns {Boolean}
+ */
+
+ function isScrollable(el) {
+ var isScrollableY = hasScrollableSpace(el, 'Y') && canOverflow(el, 'Y');
+ var isScrollableX = hasScrollableSpace(el, 'X') && canOverflow(el, 'X');
+ return isScrollableY || isScrollableX;
+ }
+ /**
+ * finds scrollable parent of an element
+ * @method findScrollableParent
+ * @param {Node} el
+ * @returns {Node} el
+ */
+
+ function findScrollableParent(el) {
+ while (el !== d.body && isScrollable(el) === false) {
+ el = el.parentNode || el.host;
+ }
+
+ return el;
+ }
+ /**
+ * self invoked function that, given a context, steps through scrolling
+ * @method step
+ * @param {Object} context
+ * @returns {undefined}
+ */
+
+ function step(context) {
+ var time = now();
+ var value;
+ var currentX;
+ var currentY;
+ var elapsed = (time - context.startTime) / SCROLL_TIME; // avoid elapsed times higher than one
+
+ elapsed = elapsed > 1 ? 1 : elapsed; // apply easing to elapsed time
+
+ value = ease(elapsed);
+ currentX = context.startX + (context.x - context.startX) * value;
+ currentY = context.startY + (context.y - context.startY) * value;
+ context.method.call(context.scrollable, currentX, currentY); // scroll more if we have not reached our destination
+
+ if (currentX !== context.x || currentY !== context.y) {
+ w.requestAnimationFrame(step.bind(w, context));
+ }
+ }
+ /**
+ * scrolls window or element with a smooth behavior
+ * @method smoothScroll
+ * @param {Object|Node} el
+ * @param {Number} x
+ * @param {Number} y
+ * @returns {undefined}
+ */
+
+ function smoothScroll(el, x, y) {
+ var scrollable;
+ var startX;
+ var startY;
+ var method;
+ var startTime = now(); // define scroll context
+
+ if (el === d.body) {
+ scrollable = w;
+ startX = w.scrollX || w.pageXOffset;
+ startY = w.scrollY || w.pageYOffset;
+ method = original.scroll;
+ } else {
+ scrollable = el;
+ startX = el.scrollLeft;
+ startY = el.scrollTop;
+ method = scrollElement;
+ } // scroll looping over a frame
+
+
+ step({
+ scrollable: scrollable,
+ method: method,
+ startTime: startTime,
+ startX: startX,
+ startY: startY,
+ x: x,
+ y: y
+ });
+ } // ORIGINAL METHODS OVERRIDES
+ // w.scroll and w.scrollTo
+
+
+ w.scroll = w.scrollTo = function () {
+ // avoid action when no arguments are passed
+ if (arguments[0] === undefined) {
+ return;
+ } // avoid smooth behavior if not required
+
+
+ if (shouldBailOut(arguments[0]) === true) {
+ original.scroll.call(w, arguments[0].left !== undefined ? arguments[0].left : typeof arguments[0] !== 'object' ? arguments[0] : w.scrollX || w.pageXOffset, // use top prop, second argument if present or fallback to scrollY
+ arguments[0].top !== undefined ? arguments[0].top : arguments[1] !== undefined ? arguments[1] : w.scrollY || w.pageYOffset);
+ return;
+ } // LET THE SMOOTHNESS BEGIN!
+
+
+ smoothScroll.call(w, d.body, arguments[0].left !== undefined ? ~~arguments[0].left : w.scrollX || w.pageXOffset, arguments[0].top !== undefined ? ~~arguments[0].top : w.scrollY || w.pageYOffset);
+ }; // w.scrollBy
+
+
+ w.scrollBy = function () {
+ // avoid action when no arguments are passed
+ if (arguments[0] === undefined) {
+ return;
+ } // avoid smooth behavior if not required
+
+
+ if (shouldBailOut(arguments[0])) {
+ original.scrollBy.call(w, arguments[0].left !== undefined ? arguments[0].left : typeof arguments[0] !== 'object' ? arguments[0] : 0, arguments[0].top !== undefined ? arguments[0].top : arguments[1] !== undefined ? arguments[1] : 0);
+ return;
+ } // LET THE SMOOTHNESS BEGIN!
+
+
+ smoothScroll.call(w, d.body, ~~arguments[0].left + (w.scrollX || w.pageXOffset), ~~arguments[0].top + (w.scrollY || w.pageYOffset));
+ }; // Element.prototype.scroll and Element.prototype.scrollTo
+
+
+ Element.prototype.scroll = Element.prototype.scrollTo = function () {
+ // avoid action when no arguments are passed
+ if (arguments[0] === undefined) {
+ return;
+ } // avoid smooth behavior if not required
+
+
+ if (shouldBailOut(arguments[0]) === true) {
+ // if one number is passed, throw error to match Firefox implementation
+ if (typeof arguments[0] === 'number' && arguments[1] === undefined) {
+ throw new SyntaxError('Value could not be converted');
+ }
+
+ original.elementScroll.call(this, // use left prop, first number argument or fallback to scrollLeft
+ arguments[0].left !== undefined ? ~~arguments[0].left : typeof arguments[0] !== 'object' ? ~~arguments[0] : this.scrollLeft, // use top prop, second argument or fallback to scrollTop
+ arguments[0].top !== undefined ? ~~arguments[0].top : arguments[1] !== undefined ? ~~arguments[1] : this.scrollTop);
+ return;
+ }
+
+ var left = arguments[0].left;
+ var top = arguments[0].top; // LET THE SMOOTHNESS BEGIN!
+
+ smoothScroll.call(this, this, typeof left === 'undefined' ? this.scrollLeft : ~~left, typeof top === 'undefined' ? this.scrollTop : ~~top);
+ }; // Element.prototype.scrollBy
+
+
+ Element.prototype.scrollBy = function () {
+ // avoid action when no arguments are passed
+ if (arguments[0] === undefined) {
+ return;
+ } // avoid smooth behavior if not required
+
+
+ if (shouldBailOut(arguments[0]) === true) {
+ original.elementScroll.call(this, arguments[0].left !== undefined ? ~~arguments[0].left + this.scrollLeft : ~~arguments[0] + this.scrollLeft, arguments[0].top !== undefined ? ~~arguments[0].top + this.scrollTop : ~~arguments[1] + this.scrollTop);
+ return;
+ }
+
+ this.scroll({
+ left: ~~arguments[0].left + this.scrollLeft,
+ top: ~~arguments[0].top + this.scrollTop,
+ behavior: arguments[0].behavior
+ });
+ }; // Element.prototype.scrollIntoView
+
+
+ Element.prototype.scrollIntoView = function () {
+ // avoid smooth behavior if not required
+ if (shouldBailOut(arguments[0]) === true) {
+ original.scrollIntoView.call(this, arguments[0] === undefined ? true : arguments[0]);
+ return;
+ } // LET THE SMOOTHNESS BEGIN!
+
+
+ var scrollableParent = findScrollableParent(this);
+ var parentRects = scrollableParent.getBoundingClientRect();
+ var clientRects = this.getBoundingClientRect();
+
+ if (scrollableParent !== d.body) {
+ // reveal element inside parent
+ smoothScroll.call(this, scrollableParent, scrollableParent.scrollLeft + clientRects.left - parentRects.left, scrollableParent.scrollTop + clientRects.top - parentRects.top); // reveal parent in viewport unless is fixed
+
+ if (w.getComputedStyle(scrollableParent).position !== 'fixed') {
+ w.scrollBy({
+ left: parentRects.left,
+ top: parentRects.top,
+ behavior: 'smooth'
+ });
+ }
+ } else {
+ // reveal element in viewport
+ w.scrollBy({
+ left: clientRects.left,
+ top: clientRects.top,
+ behavior: 'smooth'
+ });
+ }
+ };
+ }
+
+ {
+ // commonjs
+ module.exports = {
+ polyfill: polyfill
+ };
+ }
+ })();
+ });
+ var smoothscroll_1 = smoothscroll.polyfill;
+
+ smoothscroll.polyfill();
+ /**
+ * A class representing steps to be added to a tour.
+ * @extends {Evented}
+ */
+ class Step extends Evented {
+ /**
+ * Create a step
+ * @param {Tour} tour The tour for the step
+ * @param {object} options The options for the step
+ * @param {boolean} options.arrow Whether to display the arrow for the tooltip or not. Defaults to `true`.
+ * @param {object} options.attachTo The element the step should be attached to on the page.
+ * An object with properties `element` and `on`.
+ *
+ * ```js
+ * const step = new Step(tour, {
+ * attachTo: { element: '.some .selector-path', on: 'left' },
+ * ...moreOptions
+ * });
+ * ```
+ *
+ * If you don’t specify an attachTo the element will appear in the middle of the screen.
+ * If you omit the `on` portion of `attachTo`, the element will still be highlighted, but the tooltip will appear
+ * in the middle of the screen, without an arrow pointing to the target.
+ * @param {HTMLElement|string} options.attachTo.element An element selector string or a DOM element.
+ * @param {string} options.attachTo.on The optional direction to place the Popper tooltip relative to the element.
+ * - Possible string values: 'auto', 'auto-start', 'auto-end', 'top', 'top-start', 'top-end', 'bottom', 'bottom-start', 'bottom-end', 'right', 'right-start', 'right-end', 'left', 'left-start', 'left-end'
+ * @param {Object} options.advanceOn An action on the page which should advance shepherd to the next step.
+ * It should be an object with a string `selector` and an `event` name
+ * ```js
+ * const step = new Step(tour, {
+ * advanceOn: { selector: '.some .selector-path', event: 'click' },
+ * ...moreOptions
+ * });
+ * ```
+ * `event` doesn’t have to be an event inside the tour, it can be any event fired on any element on the page.
+ * You can also always manually advance the Tour by calling `myTour.next()`.
+ * @param {function} options.beforeShowPromise A function that returns a promise.
+ * When the promise resolves, the rest of the `show` code for the step will execute.
+ * @param {Object[]} options.buttons An array of buttons to add to the step. These will be rendered in a
+ * footer below the main body text.
+ * @param {function} options.buttons.button.action A function executed when the button is clicked on.
+ * It is automatically bound to the `tour` the step is associated with, so things like `this.next` will
+ * work inside the action.
+ * You can use action to skip steps or navigate to specific steps, with something like:
+ * ```js
+ * action() {
+ * return this.show('some_step_name');
+ * }
+ * ```
+ * @param {string} options.buttons.button.classes Extra classes to apply to the ``
+ * @param {boolean} options.buttons.button.disabled Should the button be disabled?
+ * @param {string} options.buttons.button.label The aria-label text of the button
+ * @param {boolean} options.buttons.button.secondary If true, a shepherd-button-secondary class is applied to the button
+ * @param {string} options.buttons.button.text The HTML text of the button
+ * @param {boolean} options.canClickTarget A boolean, that when set to false, will set `pointer-events: none` on the target
+ * @param {object} options.cancelIcon Options for the cancel icon
+ * @param {boolean} options.cancelIcon.enabled Should a cancel “✕” be shown in the header of the step?
+ * @param {string} options.cancelIcon.label The label to add for `aria-label`
+ * @param {string} options.classes A string of extra classes to add to the step's content element.
+ * @param {string} options.highlightClass An extra class to apply to the `attachTo` element when it is
+ * highlighted (that is, when its step is active). You can then target that selector in your CSS.
+ * @param {string} options.id The string to use as the `id` for the step.
+ * @param {number} options.modalOverlayOpeningPadding An amount of padding to add around the modal overlay opening
+ * @param {number} options.modalOverlayOpeningRadius An amount of border radius to add around the modal overlay opening
+ * @param {object} options.popperOptions Extra options to pass to Popper
+ * @param {boolean|Object} options.scrollTo Should the element be scrolled to when this step is shown? If true, uses the default `scrollIntoView`,
+ * if an object, passes that object as the params to `scrollIntoView` i.e. `{behavior: 'smooth', block: 'center'}`
+ * @param {function} options.scrollToHandler A function that lets you override the default scrollTo behavior and
+ * define a custom action to do the scrolling, and possibly other logic.
+ * @param {function} options.showOn A function that, when it returns `true`, will show the step.
+ * If it returns false, the step will be skipped.
+ * @param {string} options.text The text in the body of the step. It can be one of three types:
+ * ```
+ * - HTML string
+ * - `HTMLElement` object
+ * - `Function` to be executed when the step is built. It must return one the two options above.
+ * ```
+ * @param {string} options.title The step's title. It becomes an `h3` at the top of the step. It can be one of two types:
+ * ```
+ * - HTML string
+ * - `Function` to be executed when the step is built. It must return HTML string.
+ * ```
+ * @param {object} options.when You can define `show`, `hide`, etc events inside `when`. For example:
+ * ```js
+ * when: {
+ * show: function() {
+ * window.scrollTo(0, 0);
+ * }
+ * }
+ * ```
+ * @return {Step} The newly created Step instance
+ */
+ constructor(tour, options = {}) {
+ super(tour, options);
+ this.tour = tour;
+ this.classPrefix = this.tour.options ? normalizePrefix(this.tour.options.classPrefix) : '';
+ this.styles = tour.styles;
+ autoBind(this);
+
+ this._setOptions(options);
+
+ return this;
+ }
+ /**
+ * Cancel the tour
+ * Triggers the `cancel` event
+ */
+
+ cancel() {
+ this.tour.cancel();
+ this.trigger('cancel');
+ }
+ /**
+ * Complete the tour
+ * Triggers the `complete` event
+ */
+
+ complete() {
+ this.tour.complete();
+ this.trigger('complete');
+ }
+ /**
+ * Remove the step, delete the step's element, and destroy the Popper instance for the step.
+ * Triggers `destroy` event
+ */
+
+ destroy() {
+ if (this.tooltip) {
+ this.tooltip.destroy();
+ this.tooltip = null;
+ }
+
+ if (isHTMLElement(this.el) && this.el.parentNode) {
+ this.el.parentNode.removeChild(this.el);
+ this.el = null;
+ }
+
+ this._updateStepTargetOnHide();
+
+ this.trigger('destroy');
+ }
+ /**
+ * Returns the tour for the step
+ * @return {Tour} The tour instance
+ */
+
+ getTour() {
+ return this.tour;
+ }
+ /**
+ * Hide the step
+ */
+
+ hide() {
+ this.tour.modal.hide();
+ this.trigger('before-hide');
+
+ if (this.el) {
+ this.el.hidden = true;
+ }
+
+ this._updateStepTargetOnHide();
+
+ this.trigger('hide');
+ }
+ /**
+ * Checks if the step should be centered or not
+ * @return {boolean} True if the step is centered
+ */
+
+ isCentered() {
+ const attachToOptions = parseAttachTo(this);
+ return !attachToOptions.element || !attachToOptions.on;
+ }
+ /**
+ * Check if the step is open and visible
+ * @return {boolean} True if the step is open and visible
+ */
+
+ isOpen() {
+ return Boolean(this.el && !this.el.hidden);
+ }
+ /**
+ * Wraps `_show` and ensures `beforeShowPromise` resolves before calling show
+ * @return {*|Promise}
+ */
+
+ show() {
+ if (isFunction(this.options.beforeShowPromise)) {
+ const beforeShowPromise = this.options.beforeShowPromise();
+
+ if (!isUndefined(beforeShowPromise)) {
+ return beforeShowPromise.then(() => this._show());
+ }
+ }
+
+ this._show();
+ }
+ /**
+ * Updates the options of the step.
+ *
+ * @param {Object} options The options for the step
+ */
+
+ updateStepOptions(options) {
+ Object.assign(this.options, options);
+
+ if (this.shepherdElementComponent) {
+ this.shepherdElementComponent.$set({
+ step: this
+ });
+ }
+ }
+ /**
+ * Returns the element for the step
+ * @return {HTMLElement|null|undefined} The element instance. undefined if it has never been shown, null if it has been destroyed
+ */
+
+ getElement() {
+ return this.el;
+ }
+ /**
+ * Returns the target for the step
+ * @return {HTMLElement|null|undefined} The element instance. undefined if it has never been shown, null if query string has not been found
+ */
+
+ getTarget() {
+ return this.target;
+ }
+ /**
+ * Creates Shepherd element for step based on options
+ *
+ * @return {Element} The DOM element for the step tooltip
+ * @private
+ */
+
+ _createTooltipContent() {
+ const descriptionId = `${this.id}-description`;
+ const labelId = `${this.id}-label`;
+ this.shepherdElementComponent = new Shepherd_element({
+ target: this.tour.options.stepsContainer || document.body,
+ props: {
+ classPrefix: this.classPrefix,
+ descriptionId,
+ labelId,
+ step: this,
+ styles: this.styles
+ }
+ });
+ return this.shepherdElementComponent.getElement();
+ }
+ /**
+ * If a custom scrollToHandler is defined, call that, otherwise do the generic
+ * scrollIntoView call.
+ *
+ * @param {boolean|Object} scrollToOptions If true, uses the default `scrollIntoView`,
+ * if an object, passes that object as the params to `scrollIntoView` i.e. `{ behavior: 'smooth', block: 'center' }`
+ * @private
+ */
+
+ _scrollTo(scrollToOptions) {
+ const {
+ element
+ } = parseAttachTo(this);
+
+ if (isFunction(this.options.scrollToHandler)) {
+ this.options.scrollToHandler(element);
+ } else if (isElement(element) && typeof element.scrollIntoView === 'function') {
+ element.scrollIntoView(scrollToOptions);
+ }
+ }
+ /**
+ * _getClassOptions gets all possible classes for the step
+ * @param {Object} stepOptions The step specific options
+ * @returns {String} unique string from array of classes
+ * @private
+ */
+
+ _getClassOptions(stepOptions) {
+ const defaultStepOptions = this.tour && this.tour.options && this.tour.options.defaultStepOptions;
+ const stepClasses = stepOptions.classes ? stepOptions.classes : '';
+ const defaultStepOptionsClasses = defaultStepOptions && defaultStepOptions.classes ? defaultStepOptions.classes : '';
+ const allClasses = [...stepClasses.split(' '), ...defaultStepOptionsClasses.split(' ')];
+ const uniqClasses = new Set(allClasses);
+ return Array.from(uniqClasses).join(' ').trim();
+ }
+ /**
+ * Sets the options for the step, maps `when` to events, sets up buttons
+ * @param {Object} options The options for the step
+ * @private
+ */
+
+ _setOptions(options = {}) {
+ let tourOptions = this.tour && this.tour.options && this.tour.options.defaultStepOptions;
+ tourOptions = cjs({}, tourOptions || {});
+ this.options = Object.assign({
+ arrow: true
+ }, tourOptions, options);
+ const {
+ when
+ } = this.options;
+ this.options.classes = this._getClassOptions(options);
+ this.destroy();
+ this.id = this.options.id || `step-${uuid()}`;
+
+ if (when) {
+ Object.keys(when).forEach(event => {
+ this.on(event, when[event], this);
+ });
+ }
+ }
+ /**
+ * Create the element and set up the Popper instance
+ * @private
+ */
+
+ _setupElements() {
+ if (!isUndefined(this.el)) {
+ this.destroy();
+ }
+
+ this.el = this._createTooltipContent();
+
+ if (this.options.advanceOn) {
+ bindAdvance(this);
+ }
+
+ setupTooltip(this);
+ }
+ /**
+ * Triggers `before-show`, generates the tooltip DOM content,
+ * sets up a Popper instance for the tooltip, then triggers `show`.
+ * @private
+ */
+
+ _show() {
+ this.trigger('before-show');
+
+ this._setupElements();
+
+ if (!this.tour.modal) {
+ this.tour._setupModal();
+ }
+
+ this.tour.modal.setupForStep(this);
+
+ this._styleTargetElementForStep(this);
+
+ this.el.hidden = false; // start scrolling to target before showing the step
+
+ if (this.options.scrollTo) {
+ setTimeout(() => {
+ this._scrollTo(this.options.scrollTo);
+ });
+ }
+
+ this.el.hidden = false;
+ const content = this.shepherdElementComponent.getElement();
+ const target = this.target || document.body;
+ target.classList.add(`${this.classPrefix}shepherd-enabled`);
+ target.classList.add(`${this.classPrefix}shepherd-target`);
+ content.classList.add('shepherd-enabled');
+ this.trigger('show');
+ }
+ /**
+ * Modulates the styles of the passed step's target element, based on the step's options and
+ * the tour's `modal` option, to visually emphasize the element
+ *
+ * @param step The step object that attaches to the element
+ * @private
+ */
+
+ _styleTargetElementForStep(step) {
+ const targetElement = step.target;
+
+ if (!targetElement) {
+ return;
+ }
+
+ if (step.options.highlightClass) {
+ targetElement.classList.add(step.options.highlightClass);
+ }
+
+ if (step.options.canClickTarget === false) {
+ targetElement.classList.add('shepherd-target-click-disabled');
+ }
+ }
+ /**
+ * When a step is hidden, remove the highlightClass and 'shepherd-enabled'
+ * and 'shepherd-target' classes
+ * @private
+ */
+
+ _updateStepTargetOnHide() {
+ const target = this.target || document.body;
+
+ if (this.options.highlightClass) {
+ target.classList.remove(this.options.highlightClass);
+ }
+
+ target.classList.remove('shepherd-target-click-disabled', `${this.classPrefix}shepherd-enabled`, `${this.classPrefix}shepherd-target`);
+ }
+
+ }
+
+ /**
+ * Cleanup the steps and set pointerEvents back to 'auto'
+ * @param tour The tour object
+ */
+ function cleanupSteps(tour) {
+ if (tour) {
+ const {
+ steps
+ } = tour;
+ steps.forEach(step => {
+ if (step.options && step.options.canClickTarget === false && step.options.attachTo) {
+ if (step.target instanceof HTMLElement) {
+ step.target.classList.remove('shepherd-target-click-disabled');
+ }
+ }
+ });
+ }
+ }
+
+ /**
+ * Generates the svg path data for a rounded rectangle overlay
+ * @param {Object} dimension - Dimensions of rectangle.
+ * @param {number} width - Width.
+ * @param {number} height - Height.
+ * @param {number} [x=0] - Offset from top left corner in x axis. default 0.
+ * @param {number} [y=0] - Offset from top left corner in y axis. default 0.
+ * @param {number} [r=0] - Corner Radius. Keep this smaller than half of width or height.
+ * @returns {string} - Rounded rectangle overlay path data.
+ */
+ function makeOverlayPath({
+ width,
+ height,
+ x = 0,
+ y = 0,
+ r = 0
+ }) {
+ const {
+ innerWidth: w,
+ innerHeight: h
+ } = window;
+ return `M${w},${h}\
+H0\
+V0\
+H${w}\
+V${h}\
+Z\
+M${x + r},${y}\
+a${r},${r},0,0,0-${r},${r}\
+V${height + y - r}\
+a${r},${r},0,0,0,${r},${r}\
+H${width + x - r}\
+a${r},${r},0,0,0,${r}-${r}\
+V${y + r}\
+a${r},${r},0,0,0-${r}-${r}\
+Z`;
+ }
+
+ /* src/js/components/shepherd-modal.svelte generated by Svelte v3.31.0 */
+ function create_fragment$8(ctx) {
+ let svg;
+ let path;
+ let svg_class_value;
+ let mounted;
+ let dispose;
+ return {
+ c() {
+ svg = svg_element("svg");
+ path = svg_element("path");
+ attr(path, "d",
+ /*pathDefinition*/
+ ctx[2]);
+ attr(svg, "class", svg_class_value = `${
+ /*modalIsVisible*/
+ ctx[1] ? "shepherd-modal-is-visible" : ""} shepherd-modal-overlay-container`);
+ },
+
+ m(target, anchor) {
+ insert(target, svg, anchor);
+ append(svg, path);
+ /*svg_binding*/
+ ctx[11](svg);
+
+ if (!mounted) {
+ dispose = listen(svg, "touchmove",
+ /*_preventModalOverlayTouch*/
+ ctx[3]);
+ mounted = true;
+ }
+ },
+
+ p(ctx, [dirty]) {
+ if (dirty &
+ /*pathDefinition*/
+ 4) {
+ attr(path, "d",
+ /*pathDefinition*/
+ ctx[2]);
+ }
+
+ if (dirty &
+ /*modalIsVisible*/
+ 2 && svg_class_value !== (svg_class_value = `${
+ /*modalIsVisible*/
+ ctx[1] ? "shepherd-modal-is-visible" : ""} shepherd-modal-overlay-container`)) {
+ attr(svg, "class", svg_class_value);
+ }
+ },
+
+ i: noop,
+ o: noop,
+
+ d(detaching) {
+ if (detaching) detach(svg);
+ /*svg_binding*/
+ ctx[11](null);
+ mounted = false;
+ dispose();
+ }
+
+ };
+ }
+
+ function _getScrollParent(element) {
+ if (!element) {
+ return null;
+ }
+
+ const isHtmlElement = element instanceof HTMLElement;
+ const overflowY = isHtmlElement && window.getComputedStyle(element).overflowY;
+ const isScrollable = overflowY !== "hidden" && overflowY !== "visible";
+
+ if (isScrollable && element.scrollHeight >= element.clientHeight) {
+ return element;
+ }
+
+ return _getScrollParent(element.parentElement);
+ }
+ /**
+ * Get the visible height of the target element relative to its scrollParent.
+ * If there is no scroll parent, the height of the element is returned.
+ *
+ * @param {HTMLElement} element The target element
+ * @param {HTMLElement} [scrollParent] The scrollable parent element
+ * @returns {{y: number, height: number}}
+ * @private
+ */
+
+ function _getVisibleHeight(element, scrollParent) {
+ const elementRect = element.getBoundingClientRect();
+ let top = elementRect.y || elementRect.top;
+ let bottom = elementRect.bottom || top + elementRect.height;
+
+ if (scrollParent) {
+ const scrollRect = scrollParent.getBoundingClientRect();
+ const scrollTop = scrollRect.y || scrollRect.top;
+ const scrollBottom = scrollRect.bottom || scrollTop + scrollRect.height;
+ top = Math.max(top, scrollTop);
+ bottom = Math.min(bottom, scrollBottom);
+ }
+
+ const height = Math.max(bottom - top, 0); // Default to 0 if height is negative
+
+ return {
+ y: top,
+ height
+ };
+ }
+
+ function instance$8($$self, $$props, $$invalidate) {
+ let {
+ element
+ } = $$props,
+ {
+ openingProperties
+ } = $$props;
+ const guid = uuid();
+ let modalIsVisible = false;
+ let rafId = undefined;
+ let pathDefinition;
+ closeModalOpening();
+
+ const getElement = () => element;
+
+ function closeModalOpening() {
+ $$invalidate(4, openingProperties = {
+ width: 0,
+ height: 0,
+ x: 0,
+ y: 0,
+ r: 0
+ });
+ }
+
+ function hide() {
+ $$invalidate(1, modalIsVisible = false); // Ensure we cleanup all event listeners when we hide the modal
+
+ _cleanupStepEventListeners();
+ }
+
+ function positionModalOpening(targetElement, scrollParent, modalOverlayOpeningPadding = 0, modalOverlayOpeningRadius = 0) {
+ if (targetElement.getBoundingClientRect) {
+ const {
+ y,
+ height
+ } = _getVisibleHeight(targetElement, scrollParent);
+
+ const {
+ x,
+ width,
+ left
+ } = targetElement.getBoundingClientRect(); // getBoundingClientRect is not consistent. Some browsers use x and y, while others use left and top
+
+ $$invalidate(4, openingProperties = {
+ width: width + modalOverlayOpeningPadding * 2,
+ height: height + modalOverlayOpeningPadding * 2,
+ x: (x || left) - modalOverlayOpeningPadding,
+ y: y - modalOverlayOpeningPadding,
+ r: modalOverlayOpeningRadius
+ });
+ }
+ }
+
+ function setupForStep(step) {
+ // Ensure we move listeners from the previous step, before we setup new ones
+ _cleanupStepEventListeners();
+
+ if (step.tour.options.useModalOverlay) {
+ _styleForStep(step);
+
+ show();
+ } else {
+ hide();
+ }
+ }
+
+ function show() {
+ $$invalidate(1, modalIsVisible = true);
+ }
+
+ const _preventModalBodyTouch = e => {
+ e.preventDefault();
+ };
+
+ const _preventModalOverlayTouch = e => {
+ e.stopPropagation();
+ };
+ /**
+ * Add touchmove event listener
+ * @private
+ */
+
+ function _addStepEventListeners() {
+ // Prevents window from moving on touch.
+ window.addEventListener("touchmove", _preventModalBodyTouch, {
+ passive: false
+ });
+ }
+ /**
+ * Cancel the requestAnimationFrame loop and remove touchmove event listeners
+ * @private
+ */
+
+ function _cleanupStepEventListeners() {
+ if (rafId) {
+ cancelAnimationFrame(rafId);
+ rafId = undefined;
+ }
+
+ window.removeEventListener("touchmove", _preventModalBodyTouch, {
+ passive: false
+ });
+ }
+ /**
+ * Style the modal for the step
+ * @param {Step} step The step to style the opening for
+ * @private
+ */
+
+ function _styleForStep(step) {
+ const {
+ modalOverlayOpeningPadding,
+ modalOverlayOpeningRadius
+ } = step.options;
+
+ if (step.target) {
+ const scrollParent = _getScrollParent(step.target); // Setup recursive function to call requestAnimationFrame to update the modal opening position
+
+
+ const rafLoop = () => {
+ rafId = undefined;
+ positionModalOpening(step.target, scrollParent, modalOverlayOpeningPadding, modalOverlayOpeningRadius);
+ rafId = requestAnimationFrame(rafLoop);
+ };
+
+ rafLoop();
+
+ _addStepEventListeners();
+ } else {
+ closeModalOpening();
+ }
+ }
+
+ function svg_binding($$value) {
+ binding_callbacks[$$value ? "unshift" : "push"](() => {
+ element = $$value;
+ $$invalidate(0, element);
+ });
+ }
+
+ $$self.$$set = $$props => {
+ if ("element" in $$props) $$invalidate(0, element = $$props.element);
+ if ("openingProperties" in $$props) $$invalidate(4, openingProperties = $$props.openingProperties);
+ };
+
+ $$self.$$.update = () => {
+ if ($$self.$$.dirty &
+ /*openingProperties*/
+ 16) {
+ $$invalidate(2, pathDefinition = makeOverlayPath(openingProperties));
+ }
+ };
+
+ return [element, modalIsVisible, pathDefinition, _preventModalOverlayTouch, openingProperties, getElement, closeModalOpening, hide, positionModalOpening, setupForStep, show, svg_binding];
+ }
+
+ class Shepherd_modal extends SvelteComponent {
+ constructor(options) {
+ super();
+ init(this, options, instance$8, create_fragment$8, safe_not_equal, {
+ element: 0,
+ openingProperties: 4,
+ getElement: 5,
+ closeModalOpening: 6,
+ hide: 7,
+ positionModalOpening: 8,
+ setupForStep: 9,
+ show: 10
+ });
+ }
+
+ get getElement() {
+ return this.$$.ctx[5];
+ }
+
+ get closeModalOpening() {
+ return this.$$.ctx[6];
+ }
+
+ get hide() {
+ return this.$$.ctx[7];
+ }
+
+ get positionModalOpening() {
+ return this.$$.ctx[8];
+ }
+
+ get setupForStep() {
+ return this.$$.ctx[9];
+ }
+
+ get show() {
+ return this.$$.ctx[10];
+ }
+
+ }
+
+ const Shepherd = new Evented();
+ /**
+ * Class representing the site tour
+ * @extends {Evented}
+ */
+ class Tour extends Evented {
+ /**
+ * @param {Object} options The options for the tour
+ * @param {boolean} options.confirmCancel If true, will issue a `window.confirm` before cancelling
+ * @param {string} options.confirmCancelMessage The message to display in the confirm dialog
+ * @param {string} options.classPrefix The prefix to add to the `shepherd-enabled` and `shepherd-target` class names as well as the `data-shepherd-step-id`.
+ * @param {Object} options.defaultStepOptions Default options for Steps ({@link Step#constructor}), created through `addStep`
+ * @param {boolean} options.exitOnEsc Exiting the tour with the escape key will be enabled unless this is explicitly
+ * set to false.
+ * @param {boolean} options.keyboardNavigation Navigating the tour via left and right arrow keys will be enabled
+ * unless this is explicitly set to false.
+ * @param {HTMLElement} options.stepsContainer An optional container element for the steps.
+ * If not set, the steps will be appended to `document.body`.
+ * @param {HTMLElement} options.modalContainer An optional container element for the modal.
+ * If not set, the modal will be appended to `document.body`.
+ * @param {object[] | Step[]} options.steps An array of step options objects or Step instances to initialize the tour with
+ * @param {string} options.tourName An optional "name" for the tour. This will be appended to the the tour's
+ * dynamically generated `id` property -- which is also set on the `body` element as the `data-shepherd-active-tour` attribute
+ * whenever the tour becomes active.
+ * @param {boolean} options.useModalOverlay Whether or not steps should be placed above a darkened
+ * modal overlay. If true, the overlay will create an opening around the target element so that it
+ * can remain interactive
+ * @returns {Tour}
+ */
+ constructor(options = {}) {
+ super(options);
+ autoBind(this);
+ const defaultTourOptions = {
+ exitOnEsc: true,
+ keyboardNavigation: true
+ };
+ this.options = Object.assign({}, defaultTourOptions, options);
+ this.classPrefix = normalizePrefix(this.options.classPrefix);
+ this.steps = [];
+ this.addSteps(this.options.steps); // Pass these events onto the global Shepherd object
+
+ const events = ['active', 'cancel', 'complete', 'inactive', 'show', 'start'];
+ events.map(event => {
+ (e => {
+ this.on(e, opts => {
+ opts = opts || {};
+ opts.tour = this;
+ Shepherd.trigger(e, opts);
+ });
+ })(event);
+ });
+
+ this._setTourID();
+
+ return this;
+ }
+ /**
+ * Adds a new step to the tour
+ * @param {Object|Step} options An object containing step options or a Step instance
+ * @param {number} index The optional index to insert the step at. If undefined, the step
+ * is added to the end of the array.
+ * @return {Step} The newly added step
+ */
+
+ addStep(options, index) {
+ let step = options;
+
+ if (!(step instanceof Step)) {
+ step = new Step(this, step);
+ } else {
+ step.tour = this;
+ }
+
+ if (!isUndefined(index)) {
+ this.steps.splice(index, 0, step);
+ } else {
+ this.steps.push(step);
+ }
+
+ return step;
+ }
+ /**
+ * Add multiple steps to the tour
+ * @param {Array
+ ![CodePen](data:image/svg+xml;utf8,<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 138 26"><path fill="none" stroke="black" stroke-width="2.3" stroke-linecap="round" stroke-linejoin="round" d="M15 8a7 7 0 100 10m7-8.7L33 2l11 7.3v7.4L33 24l-11-7.3zm0 0l11 7.4 11-7.4m0 7.4L33 9.3l-11 7.4M33 2v7.3m0 7.4V24M52 6h5a7 7 0 010 14h-5zm28 0h-9v14h9m-9-7h6m11 1h6a4 4 0 000-8h-6v14m26-14h-9v14h9m-9-7h6m11 7V6l11 14V6"/></svg>)
+ ' d='M81.3,57.6L18.7,3.1c-1.9-1.8-4.5-3-7.3-3.1C5.2-0.2,0.2,4.6,0,10.7c-0.1,4.3,2.3,8.1,5.8,10l70.4,43.7c0.1,0.1,0.2,0.1,0.3,0.2c2.1,1.1,4.6,0.4,5.8-1.6C83.4,61.2,82.9,58.9,81.3,57.6z'/%3E%3ClinearGradient id='SVGID_2_' gradientUnits='userSpaceOnUse' x1='28.3538' y1='119.6551' x2='139.5938' y2='60.2551'%3E%3Cstop offset='0' stop-color='%23FFE42E'/%3E%3Cstop offset='1' stop-color='%23ED417C'/%3E%3C/linearGradient%3E%3Cpath fill='url(%23SVGID_2_)' d='M142.7,66.3c-0.3-8.6-7.6-15.3-16.2-14.9c-2.7,0.1-5.3,0.9-7.5,2.2l-88,50.1c0,0-0.1,0-0.1,0.1c-3,1.2-5,4.2-4.9,7.6c0.2,4.4,3.8,7.8,8.2,7.6c1,0,2-0.3,2.9-0.7l95.9-37c0,0,0.1,0,0.2-0.1C138.9,78.8,142.9,73,142.7,66.3z'/%3E%3ClinearGradient id='SVGID_3_' gradientUnits='userSpaceOnUse' x1='31.6974' y1='114.3816' x2='72.0174' y2='55.3416'%3E%3Cstop offset='0' stop-color='%23FFE42E'/%3E%3Cstop offset='1' stop-color='%23F05922'/%3E%3C/linearGradient%3E%3Cpath fill='url(%23SVGID_3_)' d='M71.8,64c1.1-2.1,0.3-4.7-1.8-5.7c-1.9-1-4.2-0.4-5.4,1.3l-37.1,47.1c0,0,0,0.1-0.1,0.2c-1.8,2.7-1.8,6.3,0.3,9c2.6,3.5,7.5,4.2,11,1.7c1-0.8,1.8-1.8,2.4-2.8l30.5-50.2C71.6,64.3,71.7,64.1,71.8,64z'/%3E%3Crect x='45.5' y='35.7' width='51' height='51'/%3E%3Crect x='49.9' y='77.1' fill='%23fff' width='19.1' height='3.2'/%3E%3Cpath fill='%23fff' d='M49.7,49.1l1.5-1.4c0.4,0.5,0.8,0.8,1.3,0.8c0.6,0,0.9-0.4,0.9-1.2V42h2.3v5.3c0,1-0.3,1.8-0.8,2.3c-0.5,0.5-1.3,0.8-2.3,0.8C51.2,50.5,50.3,49.9,49.7,49.1z'/%3E%3Cpath fill='%23fff' d='M56.3,42h6.7V44h-4.4v1.3h4v1.8h-4v1.3H63v2h-6.7V42z'/%3E%3Cpath fill='%23fff' d='M66,44.1h-2.5v-2h7.3v2h-2.5v6.3H66V44.1z'/%3E%3Cpath fill='%23fff' d='M49.9,52.3h4.3c1,0,1.8,0.3,2.3,0.7c0.3,0.3,0.5,0.8,0.5,1.4v0c0,1-0.5,1.5-1.3,1.9c1,0.3,1.7,0.9,1.7,2v0c0,1.4-1.2,2.3-3.1,2.3h-4.3V52.3z M54.7,54.9c0-0.5-0.4-0.7-1-0.7h-1.5v1.5h1.4C54.3,55.6,54.7,55.4,54.7,54.9L54.7,54.9z M53.9,57.2h-1.8v1.5h1.8c0.7,0,1.1-0.3,1.1-0.8v0C55,57.5,54.7,57.2,53.9,57.2z'/%3E%3Cpath fill='%23fff' d='M57.7,52.3h3.9c1.3,0,2.2,0.3,2.7,0.9c0.5,0.5,0.7,1.1,0.7,1.9v0c0,1.3-0.7,2.1-1.7,2.6l2,2.9h-2.6L61,58.1h-1v2.5h-2.3V52.3z M61.5,56.3c0.8,0,1.2-0.4,1.2-1v0c0-0.7-0.5-1-1.2-1H60v2H61.5z'/%3E%3Cpath fill='%23fff' d='M67.8,52.2H70l3.5,8.4h-2.5l-0.6-1.5h-3.2l-0.6,1.5h-2.4L67.8,52.2z M69.8,57.3L68.9,55l-0.9,2.4H69.8z'/%3E%3Cpath fill='%23fff' d='M73.8,52.3h2.3v8.3h-2.3V52.3z'/%3E%3Cpath fill='%23fff' d='M76.7,52.3h2.2l3.4,4.4v-4.4h2.3v8.3h-2L79,56.1v4.6h-2.3V52.3z'/%3E%3Cpath fill='%23fff' d='M84.7,59.4l1.3-1.5c0.8,0.7,1.7,1,2.7,1c0.6,0,1-0.2,1-0.6v0c0-0.4-0.3-0.5-1.4-0.8c-1.8-0.4-3.1-0.9-3.1-2.6v0c0-1.5,1.2-2.7,3.2-2.7c1.4,0,2.5,0.4,3.4,1.1l-1.2,1.6c-0.8-0.5-1.6-0.8-2.3-0.8c-0.6,0-0.8,0.2-0.8,0.5v0c0,0.4,0.3,0.5,1.4,0.8c1.9,0.4,3.1,1,3.1,2.6v0c0,1.7-1.3,2.7-3.4,2.7C87.1,60.8,85.7,60.3,84.7,59.4z'/%3E%3C/svg%3E%0A)
+ 
