8169 lines
312 KiB
JavaScript
8169 lines
312 KiB
JavaScript
/*! elementor-pro - v3.31.0 - 10-08-2025 */
|
|
/******/ (() => { // webpackBootstrap
|
|
/******/ var __webpack_modules__ = ({
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/atoms/indicator-bullet.scss":
|
|
/*!*****************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/atoms/indicator-bullet.scss ***!
|
|
\*****************************************************************************/
|
|
/***/ (() => {
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/atoms/preview-iframe.scss":
|
|
/*!***************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/atoms/preview-iframe.scss ***!
|
|
\***************************************************************************/
|
|
/***/ (() => {
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/molecules/back-button.scss":
|
|
/*!****************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/molecules/back-button.scss ***!
|
|
\****************************************************************************/
|
|
/***/ (() => {
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/molecules/site-template.scss":
|
|
/*!******************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/molecules/site-template.scss ***!
|
|
\******************************************************************************/
|
|
/***/ (() => {
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/pages/add-new.scss":
|
|
/*!********************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/pages/add-new.scss ***!
|
|
\********************************************************************/
|
|
/***/ (() => {
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/pages/conditions/conditions.scss":
|
|
/*!**********************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/pages/conditions/conditions.scss ***!
|
|
\**********************************************************************************/
|
|
/***/ (() => {
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/pages/template-type.scss":
|
|
/*!**************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/pages/template-type.scss ***!
|
|
\**************************************************************************/
|
|
/***/ (() => {
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/site-editor.scss":
|
|
/*!******************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/site-editor.scss ***!
|
|
\******************************************************************/
|
|
/***/ (() => {
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/@reach/router/es/index.js":
|
|
/*!*************************************************!*\
|
|
!*** ../node_modules/@reach/router/es/index.js ***!
|
|
\*************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ Link: () => (/* binding */ Link),
|
|
/* harmony export */ Location: () => (/* binding */ Location),
|
|
/* harmony export */ LocationProvider: () => (/* binding */ LocationProvider),
|
|
/* harmony export */ Match: () => (/* binding */ Match),
|
|
/* harmony export */ Redirect: () => (/* binding */ Redirect),
|
|
/* harmony export */ Router: () => (/* binding */ Router),
|
|
/* harmony export */ ServerLocation: () => (/* binding */ ServerLocation),
|
|
/* harmony export */ createHistory: () => (/* reexport safe */ _lib_history__WEBPACK_IMPORTED_MODULE_5__.createHistory),
|
|
/* harmony export */ createMemorySource: () => (/* reexport safe */ _lib_history__WEBPACK_IMPORTED_MODULE_5__.createMemorySource),
|
|
/* harmony export */ globalHistory: () => (/* reexport safe */ _lib_history__WEBPACK_IMPORTED_MODULE_5__.globalHistory),
|
|
/* harmony export */ isRedirect: () => (/* binding */ isRedirect),
|
|
/* harmony export */ matchPath: () => (/* reexport safe */ _lib_utils__WEBPACK_IMPORTED_MODULE_4__.match),
|
|
/* harmony export */ navigate: () => (/* reexport safe */ _lib_history__WEBPACK_IMPORTED_MODULE_5__.navigate),
|
|
/* harmony export */ redirectTo: () => (/* binding */ redirectTo),
|
|
/* harmony export */ useLocation: () => (/* binding */ useLocation),
|
|
/* harmony export */ useMatch: () => (/* binding */ useMatch),
|
|
/* harmony export */ useNavigate: () => (/* binding */ useNavigate),
|
|
/* harmony export */ useParams: () => (/* binding */ useParams)
|
|
/* harmony export */ });
|
|
/* harmony import */ var react__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! react */ "react");
|
|
/* harmony import */ var react__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(react__WEBPACK_IMPORTED_MODULE_0__);
|
|
/* harmony import */ var prop_types__WEBPACK_IMPORTED_MODULE_6__ = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
/* harmony import */ var prop_types__WEBPACK_IMPORTED_MODULE_6___default = /*#__PURE__*/__webpack_require__.n(prop_types__WEBPACK_IMPORTED_MODULE_6__);
|
|
/* harmony import */ var invariant__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! invariant */ "../node_modules/invariant/browser.js");
|
|
/* harmony import */ var invariant__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(invariant__WEBPACK_IMPORTED_MODULE_1__);
|
|
/* harmony import */ var create_react_context__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! create-react-context */ "../node_modules/@reach/router/node_modules/create-react-context/lib/index.js");
|
|
/* harmony import */ var create_react_context__WEBPACK_IMPORTED_MODULE_2___default = /*#__PURE__*/__webpack_require__.n(create_react_context__WEBPACK_IMPORTED_MODULE_2__);
|
|
/* harmony import */ var react_lifecycles_compat__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! react-lifecycles-compat */ "../node_modules/react-lifecycles-compat/react-lifecycles-compat.es.js");
|
|
/* harmony import */ var _lib_utils__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(/*! ./lib/utils */ "../node_modules/@reach/router/es/lib/utils.js");
|
|
/* harmony import */ var _lib_history__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(/*! ./lib/history */ "../node_modules/@reach/router/es/lib/history.js");
|
|
var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; };
|
|
|
|
function _objectWithoutProperties(obj, keys) { var target = {}; for (var i in obj) { if (keys.indexOf(i) >= 0) continue; if (!Object.prototype.hasOwnProperty.call(obj, i)) continue; target[i] = obj[i]; } return target; }
|
|
|
|
function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }
|
|
|
|
function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; }
|
|
|
|
function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
|
|
|
|
/* eslint-disable jsx-a11y/anchor-has-content */
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
|
|
var createNamedContext = function createNamedContext(name, defaultValue) {
|
|
var Ctx = create_react_context__WEBPACK_IMPORTED_MODULE_2___default()(defaultValue);
|
|
Ctx.displayName = name;
|
|
return Ctx;
|
|
};
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
// Location Context/Provider
|
|
var LocationContext = createNamedContext("Location");
|
|
|
|
// sets up a listener if there isn't one already so apps don't need to be
|
|
// wrapped in some top level provider
|
|
var Location = function Location(_ref) {
|
|
var children = _ref.children;
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
LocationContext.Consumer,
|
|
null,
|
|
function (context) {
|
|
return context ? children(context) : react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
LocationProvider,
|
|
null,
|
|
children
|
|
);
|
|
}
|
|
);
|
|
};
|
|
|
|
var LocationProvider = function (_React$Component) {
|
|
_inherits(LocationProvider, _React$Component);
|
|
|
|
function LocationProvider() {
|
|
var _temp, _this, _ret;
|
|
|
|
_classCallCheck(this, LocationProvider);
|
|
|
|
for (var _len = arguments.length, args = Array(_len), _key = 0; _key < _len; _key++) {
|
|
args[_key] = arguments[_key];
|
|
}
|
|
|
|
return _ret = (_temp = (_this = _possibleConstructorReturn(this, _React$Component.call.apply(_React$Component, [this].concat(args))), _this), _this.state = {
|
|
context: _this.getContext(),
|
|
refs: { unlisten: null }
|
|
}, _temp), _possibleConstructorReturn(_this, _ret);
|
|
}
|
|
|
|
LocationProvider.prototype.getContext = function getContext() {
|
|
var _props$history = this.props.history,
|
|
navigate = _props$history.navigate,
|
|
location = _props$history.location;
|
|
|
|
return { navigate: navigate, location: location };
|
|
};
|
|
|
|
LocationProvider.prototype.componentDidCatch = function componentDidCatch(error, info) {
|
|
if (isRedirect(error)) {
|
|
var _navigate = this.props.history.navigate;
|
|
|
|
_navigate(error.uri, { replace: true });
|
|
} else {
|
|
throw error;
|
|
}
|
|
};
|
|
|
|
LocationProvider.prototype.componentDidUpdate = function componentDidUpdate(prevProps, prevState) {
|
|
if (prevState.context.location !== this.state.context.location) {
|
|
this.props.history._onTransitionComplete();
|
|
}
|
|
};
|
|
|
|
LocationProvider.prototype.componentDidMount = function componentDidMount() {
|
|
var _this2 = this;
|
|
|
|
var refs = this.state.refs,
|
|
history = this.props.history;
|
|
|
|
history._onTransitionComplete();
|
|
refs.unlisten = history.listen(function () {
|
|
Promise.resolve().then(function () {
|
|
// TODO: replace rAF with react deferred update API when it's ready https://github.com/facebook/react/issues/13306
|
|
requestAnimationFrame(function () {
|
|
if (!_this2.unmounted) {
|
|
_this2.setState(function () {
|
|
return { context: _this2.getContext() };
|
|
});
|
|
}
|
|
});
|
|
});
|
|
});
|
|
};
|
|
|
|
LocationProvider.prototype.componentWillUnmount = function componentWillUnmount() {
|
|
var refs = this.state.refs;
|
|
|
|
this.unmounted = true;
|
|
refs.unlisten();
|
|
};
|
|
|
|
LocationProvider.prototype.render = function render() {
|
|
var context = this.state.context,
|
|
children = this.props.children;
|
|
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
LocationContext.Provider,
|
|
{ value: context },
|
|
typeof children === "function" ? children(context) : children || null
|
|
);
|
|
};
|
|
|
|
return LocationProvider;
|
|
}((react__WEBPACK_IMPORTED_MODULE_0___default().Component));
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
|
|
|
|
LocationProvider.defaultProps = {
|
|
history: _lib_history__WEBPACK_IMPORTED_MODULE_5__.globalHistory
|
|
};
|
|
true ? LocationProvider.propTypes = {
|
|
history: (prop_types__WEBPACK_IMPORTED_MODULE_6___default().object).isRequired
|
|
} : 0;
|
|
var ServerLocation = function ServerLocation(_ref2) {
|
|
var url = _ref2.url,
|
|
children = _ref2.children;
|
|
|
|
var searchIndex = url.indexOf("?");
|
|
var searchExists = searchIndex > -1;
|
|
var pathname = void 0;
|
|
var search = "";
|
|
var hash = "";
|
|
|
|
if (searchExists) {
|
|
pathname = url.substring(0, searchIndex);
|
|
search = url.substring(searchIndex);
|
|
} else {
|
|
pathname = url;
|
|
}
|
|
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
LocationContext.Provider,
|
|
{
|
|
value: {
|
|
location: {
|
|
pathname: pathname,
|
|
search: search,
|
|
hash: hash
|
|
},
|
|
navigate: function navigate() {
|
|
throw new Error("You can't call navigate on the server.");
|
|
}
|
|
}
|
|
},
|
|
children
|
|
);
|
|
};
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
// Sets baseuri and basepath for nested routers and links
|
|
var BaseContext = createNamedContext("Base", { baseuri: "/", basepath: "/" });
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
// The main event, welcome to the show everybody.
|
|
var Router = function Router(props) {
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
BaseContext.Consumer,
|
|
null,
|
|
function (baseContext) {
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
Location,
|
|
null,
|
|
function (locationContext) {
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(RouterImpl, _extends({}, baseContext, locationContext, props));
|
|
}
|
|
);
|
|
}
|
|
);
|
|
};
|
|
|
|
var RouterImpl = function (_React$PureComponent) {
|
|
_inherits(RouterImpl, _React$PureComponent);
|
|
|
|
function RouterImpl() {
|
|
_classCallCheck(this, RouterImpl);
|
|
|
|
return _possibleConstructorReturn(this, _React$PureComponent.apply(this, arguments));
|
|
}
|
|
|
|
RouterImpl.prototype.render = function render() {
|
|
var _props = this.props,
|
|
location = _props.location,
|
|
_navigate2 = _props.navigate,
|
|
basepath = _props.basepath,
|
|
primary = _props.primary,
|
|
children = _props.children,
|
|
baseuri = _props.baseuri,
|
|
_props$component = _props.component,
|
|
component = _props$component === undefined ? "div" : _props$component,
|
|
domProps = _objectWithoutProperties(_props, ["location", "navigate", "basepath", "primary", "children", "baseuri", "component"]);
|
|
|
|
var routes = react__WEBPACK_IMPORTED_MODULE_0___default().Children.toArray(children).reduce(function (array, child) {
|
|
var routes = createRoute(basepath)(child);
|
|
return array.concat(routes);
|
|
}, []);
|
|
var pathname = location.pathname;
|
|
|
|
|
|
var match = (0,_lib_utils__WEBPACK_IMPORTED_MODULE_4__.pick)(routes, pathname);
|
|
|
|
if (match) {
|
|
var params = match.params,
|
|
uri = match.uri,
|
|
route = match.route,
|
|
element = match.route.value;
|
|
|
|
// remove the /* from the end for child routes relative paths
|
|
|
|
basepath = route.default ? basepath : route.path.replace(/\*$/, "");
|
|
|
|
var props = _extends({}, params, {
|
|
uri: uri,
|
|
location: location,
|
|
navigate: function navigate(to, options) {
|
|
return _navigate2((0,_lib_utils__WEBPACK_IMPORTED_MODULE_4__.resolve)(to, uri), options);
|
|
}
|
|
});
|
|
|
|
var clone = react__WEBPACK_IMPORTED_MODULE_0___default().cloneElement(element, props, element.props.children ? react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
Router,
|
|
{ location: location, primary: primary },
|
|
element.props.children
|
|
) : undefined);
|
|
|
|
// using 'div' for < 16.3 support
|
|
var FocusWrapper = primary ? FocusHandler : component;
|
|
// don't pass any props to 'div'
|
|
var wrapperProps = primary ? _extends({ uri: uri, location: location, component: component }, domProps) : domProps;
|
|
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
BaseContext.Provider,
|
|
{ value: { baseuri: uri, basepath: basepath } },
|
|
react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
FocusWrapper,
|
|
wrapperProps,
|
|
clone
|
|
)
|
|
);
|
|
} else {
|
|
// Not sure if we want this, would require index routes at every level
|
|
// warning(
|
|
// false,
|
|
// `<Router basepath="${basepath}">\n\nNothing matched:\n\t${
|
|
// location.pathname
|
|
// }\n\nPaths checked: \n\t${routes
|
|
// .map(route => route.path)
|
|
// .join(
|
|
// "\n\t"
|
|
// )}\n\nTo get rid of this warning, add a default NotFound component as child of Router:
|
|
// \n\tlet NotFound = () => <div>Not Found!</div>
|
|
// \n\t<Router>\n\t <NotFound default/>\n\t {/* ... */}\n\t</Router>`
|
|
// );
|
|
return null;
|
|
}
|
|
};
|
|
|
|
return RouterImpl;
|
|
}((react__WEBPACK_IMPORTED_MODULE_0___default().PureComponent));
|
|
|
|
RouterImpl.defaultProps = {
|
|
primary: true
|
|
};
|
|
|
|
|
|
var FocusContext = createNamedContext("Focus");
|
|
|
|
var FocusHandler = function FocusHandler(_ref3) {
|
|
var uri = _ref3.uri,
|
|
location = _ref3.location,
|
|
component = _ref3.component,
|
|
domProps = _objectWithoutProperties(_ref3, ["uri", "location", "component"]);
|
|
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
FocusContext.Consumer,
|
|
null,
|
|
function (requestFocus) {
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(FocusHandlerImpl, _extends({}, domProps, {
|
|
component: component,
|
|
requestFocus: requestFocus,
|
|
uri: uri,
|
|
location: location
|
|
}));
|
|
}
|
|
);
|
|
};
|
|
|
|
// don't focus on initial render
|
|
var initialRender = true;
|
|
var focusHandlerCount = 0;
|
|
|
|
var FocusHandlerImpl = function (_React$Component2) {
|
|
_inherits(FocusHandlerImpl, _React$Component2);
|
|
|
|
function FocusHandlerImpl() {
|
|
var _temp2, _this4, _ret2;
|
|
|
|
_classCallCheck(this, FocusHandlerImpl);
|
|
|
|
for (var _len2 = arguments.length, args = Array(_len2), _key2 = 0; _key2 < _len2; _key2++) {
|
|
args[_key2] = arguments[_key2];
|
|
}
|
|
|
|
return _ret2 = (_temp2 = (_this4 = _possibleConstructorReturn(this, _React$Component2.call.apply(_React$Component2, [this].concat(args))), _this4), _this4.state = {}, _this4.requestFocus = function (node) {
|
|
if (!_this4.state.shouldFocus && node) {
|
|
node.focus();
|
|
}
|
|
}, _temp2), _possibleConstructorReturn(_this4, _ret2);
|
|
}
|
|
|
|
FocusHandlerImpl.getDerivedStateFromProps = function getDerivedStateFromProps(nextProps, prevState) {
|
|
var initial = prevState.uri == null;
|
|
if (initial) {
|
|
return _extends({
|
|
shouldFocus: true
|
|
}, nextProps);
|
|
} else {
|
|
var myURIChanged = nextProps.uri !== prevState.uri;
|
|
var navigatedUpToMe = prevState.location.pathname !== nextProps.location.pathname && nextProps.location.pathname === nextProps.uri;
|
|
return _extends({
|
|
shouldFocus: myURIChanged || navigatedUpToMe
|
|
}, nextProps);
|
|
}
|
|
};
|
|
|
|
FocusHandlerImpl.prototype.componentDidMount = function componentDidMount() {
|
|
focusHandlerCount++;
|
|
this.focus();
|
|
};
|
|
|
|
FocusHandlerImpl.prototype.componentWillUnmount = function componentWillUnmount() {
|
|
focusHandlerCount--;
|
|
if (focusHandlerCount === 0) {
|
|
initialRender = true;
|
|
}
|
|
};
|
|
|
|
FocusHandlerImpl.prototype.componentDidUpdate = function componentDidUpdate(prevProps, prevState) {
|
|
if (prevProps.location !== this.props.location && this.state.shouldFocus) {
|
|
this.focus();
|
|
}
|
|
};
|
|
|
|
FocusHandlerImpl.prototype.focus = function focus() {
|
|
if (false) {}
|
|
|
|
var requestFocus = this.props.requestFocus;
|
|
|
|
|
|
if (requestFocus) {
|
|
requestFocus(this.node);
|
|
} else {
|
|
if (initialRender) {
|
|
initialRender = false;
|
|
} else if (this.node) {
|
|
// React polyfills [autofocus] and it fires earlier than cDM,
|
|
// so we were stealing focus away, this line prevents that.
|
|
if (!this.node.contains(document.activeElement)) {
|
|
this.node.focus();
|
|
}
|
|
}
|
|
}
|
|
};
|
|
|
|
FocusHandlerImpl.prototype.render = function render() {
|
|
var _this5 = this;
|
|
|
|
var _props2 = this.props,
|
|
children = _props2.children,
|
|
style = _props2.style,
|
|
requestFocus = _props2.requestFocus,
|
|
_props2$component = _props2.component,
|
|
Comp = _props2$component === undefined ? "div" : _props2$component,
|
|
uri = _props2.uri,
|
|
location = _props2.location,
|
|
domProps = _objectWithoutProperties(_props2, ["children", "style", "requestFocus", "component", "uri", "location"]);
|
|
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
Comp,
|
|
_extends({
|
|
style: _extends({ outline: "none" }, style),
|
|
tabIndex: "-1",
|
|
ref: function ref(n) {
|
|
return _this5.node = n;
|
|
}
|
|
}, domProps),
|
|
react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
FocusContext.Provider,
|
|
{ value: this.requestFocus },
|
|
this.props.children
|
|
)
|
|
);
|
|
};
|
|
|
|
return FocusHandlerImpl;
|
|
}((react__WEBPACK_IMPORTED_MODULE_0___default().Component));
|
|
|
|
(0,react_lifecycles_compat__WEBPACK_IMPORTED_MODULE_3__.polyfill)(FocusHandlerImpl);
|
|
|
|
var k = function k() {};
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
var forwardRef = (react__WEBPACK_IMPORTED_MODULE_0___default().forwardRef);
|
|
|
|
if (typeof forwardRef === "undefined") {
|
|
forwardRef = function forwardRef(C) {
|
|
return C;
|
|
};
|
|
}
|
|
|
|
var Link = forwardRef(function (_ref4, ref) {
|
|
var innerRef = _ref4.innerRef,
|
|
props = _objectWithoutProperties(_ref4, ["innerRef"]);
|
|
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
BaseContext.Consumer,
|
|
null,
|
|
function (_ref5) {
|
|
var basepath = _ref5.basepath,
|
|
baseuri = _ref5.baseuri;
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
Location,
|
|
null,
|
|
function (_ref6) {
|
|
var location = _ref6.location,
|
|
navigate = _ref6.navigate;
|
|
|
|
var to = props.to,
|
|
state = props.state,
|
|
replace = props.replace,
|
|
_props$getProps = props.getProps,
|
|
getProps = _props$getProps === undefined ? k : _props$getProps,
|
|
anchorProps = _objectWithoutProperties(props, ["to", "state", "replace", "getProps"]);
|
|
|
|
var href = (0,_lib_utils__WEBPACK_IMPORTED_MODULE_4__.resolve)(to, baseuri);
|
|
var encodedHref = encodeURI(href);
|
|
var isCurrent = location.pathname === encodedHref;
|
|
var isPartiallyCurrent = (0,_lib_utils__WEBPACK_IMPORTED_MODULE_4__.startsWith)(location.pathname, encodedHref);
|
|
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement("a", _extends({
|
|
ref: ref || innerRef,
|
|
"aria-current": isCurrent ? "page" : undefined
|
|
}, anchorProps, getProps({ isCurrent: isCurrent, isPartiallyCurrent: isPartiallyCurrent, href: href, location: location }), {
|
|
href: href,
|
|
onClick: function onClick(event) {
|
|
if (anchorProps.onClick) anchorProps.onClick(event);
|
|
if (shouldNavigate(event)) {
|
|
event.preventDefault();
|
|
var shouldReplace = replace;
|
|
if (typeof replace !== "boolean" && isCurrent) {
|
|
var _location$state = _extends({}, location.state),
|
|
key = _location$state.key,
|
|
restState = _objectWithoutProperties(_location$state, ["key"]);
|
|
|
|
shouldReplace = (0,_lib_utils__WEBPACK_IMPORTED_MODULE_4__.shallowCompare)(_extends({}, state), restState);
|
|
}
|
|
navigate(href, {
|
|
state: state,
|
|
replace: shouldReplace
|
|
});
|
|
}
|
|
}
|
|
}));
|
|
}
|
|
);
|
|
}
|
|
);
|
|
});
|
|
|
|
Link.displayName = "Link";
|
|
|
|
true ? Link.propTypes = {
|
|
to: (prop_types__WEBPACK_IMPORTED_MODULE_6___default().string).isRequired
|
|
} : 0;
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
function RedirectRequest(uri) {
|
|
this.uri = uri;
|
|
}
|
|
|
|
var isRedirect = function isRedirect(o) {
|
|
return o instanceof RedirectRequest;
|
|
};
|
|
|
|
var redirectTo = function redirectTo(to) {
|
|
throw new RedirectRequest(to);
|
|
};
|
|
|
|
var RedirectImpl = function (_React$Component3) {
|
|
_inherits(RedirectImpl, _React$Component3);
|
|
|
|
function RedirectImpl() {
|
|
_classCallCheck(this, RedirectImpl);
|
|
|
|
return _possibleConstructorReturn(this, _React$Component3.apply(this, arguments));
|
|
}
|
|
|
|
// Support React < 16 with this hook
|
|
RedirectImpl.prototype.componentDidMount = function componentDidMount() {
|
|
var _props3 = this.props,
|
|
navigate = _props3.navigate,
|
|
to = _props3.to,
|
|
from = _props3.from,
|
|
_props3$replace = _props3.replace,
|
|
replace = _props3$replace === undefined ? true : _props3$replace,
|
|
state = _props3.state,
|
|
noThrow = _props3.noThrow,
|
|
baseuri = _props3.baseuri,
|
|
props = _objectWithoutProperties(_props3, ["navigate", "to", "from", "replace", "state", "noThrow", "baseuri"]);
|
|
|
|
Promise.resolve().then(function () {
|
|
var resolvedTo = (0,_lib_utils__WEBPACK_IMPORTED_MODULE_4__.resolve)(to, baseuri);
|
|
navigate((0,_lib_utils__WEBPACK_IMPORTED_MODULE_4__.insertParams)(resolvedTo, props), { replace: replace, state: state });
|
|
});
|
|
};
|
|
|
|
RedirectImpl.prototype.render = function render() {
|
|
var _props4 = this.props,
|
|
navigate = _props4.navigate,
|
|
to = _props4.to,
|
|
from = _props4.from,
|
|
replace = _props4.replace,
|
|
state = _props4.state,
|
|
noThrow = _props4.noThrow,
|
|
baseuri = _props4.baseuri,
|
|
props = _objectWithoutProperties(_props4, ["navigate", "to", "from", "replace", "state", "noThrow", "baseuri"]);
|
|
|
|
var resolvedTo = (0,_lib_utils__WEBPACK_IMPORTED_MODULE_4__.resolve)(to, baseuri);
|
|
if (!noThrow) redirectTo((0,_lib_utils__WEBPACK_IMPORTED_MODULE_4__.insertParams)(resolvedTo, props));
|
|
return null;
|
|
};
|
|
|
|
return RedirectImpl;
|
|
}((react__WEBPACK_IMPORTED_MODULE_0___default().Component));
|
|
|
|
var Redirect = function Redirect(props) {
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
BaseContext.Consumer,
|
|
null,
|
|
function (_ref7) {
|
|
var baseuri = _ref7.baseuri;
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
Location,
|
|
null,
|
|
function (locationContext) {
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(RedirectImpl, _extends({}, locationContext, { baseuri: baseuri }, props));
|
|
}
|
|
);
|
|
}
|
|
);
|
|
};
|
|
|
|
true ? Redirect.propTypes = {
|
|
from: (prop_types__WEBPACK_IMPORTED_MODULE_6___default().string),
|
|
to: (prop_types__WEBPACK_IMPORTED_MODULE_6___default().string).isRequired
|
|
} : 0;
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
var Match = function Match(_ref8) {
|
|
var path = _ref8.path,
|
|
children = _ref8.children;
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
BaseContext.Consumer,
|
|
null,
|
|
function (_ref9) {
|
|
var baseuri = _ref9.baseuri;
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().createElement(
|
|
Location,
|
|
null,
|
|
function (_ref10) {
|
|
var navigate = _ref10.navigate,
|
|
location = _ref10.location;
|
|
|
|
var resolvedPath = (0,_lib_utils__WEBPACK_IMPORTED_MODULE_4__.resolve)(path, baseuri);
|
|
var result = (0,_lib_utils__WEBPACK_IMPORTED_MODULE_4__.match)(resolvedPath, location.pathname);
|
|
return children({
|
|
navigate: navigate,
|
|
location: location,
|
|
match: result ? _extends({}, result.params, {
|
|
uri: result.uri,
|
|
path: path
|
|
}) : null
|
|
});
|
|
}
|
|
);
|
|
}
|
|
);
|
|
};
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
// Hooks
|
|
|
|
var useLocation = function useLocation() {
|
|
var context = (0,react__WEBPACK_IMPORTED_MODULE_0__.useContext)(LocationContext);
|
|
|
|
if (!context) {
|
|
throw new Error("useLocation hook was used but a LocationContext.Provider was not found in the parent tree. Make sure this is used in a component that is a child of Router");
|
|
}
|
|
|
|
return context.location;
|
|
};
|
|
|
|
var useNavigate = function useNavigate() {
|
|
var context = (0,react__WEBPACK_IMPORTED_MODULE_0__.useContext)(LocationContext);
|
|
|
|
if (!context) {
|
|
throw new Error("useNavigate hook was used but a LocationContext.Provider was not found in the parent tree. Make sure this is used in a component that is a child of Router");
|
|
}
|
|
|
|
return context.navigate;
|
|
};
|
|
|
|
var useParams = function useParams() {
|
|
var context = (0,react__WEBPACK_IMPORTED_MODULE_0__.useContext)(BaseContext);
|
|
|
|
if (!context) {
|
|
throw new Error("useParams hook was used but a LocationContext.Provider was not found in the parent tree. Make sure this is used in a component that is a child of Router");
|
|
}
|
|
|
|
var location = useLocation();
|
|
|
|
var results = (0,_lib_utils__WEBPACK_IMPORTED_MODULE_4__.match)(context.basepath, location.pathname);
|
|
|
|
return results ? results.params : null;
|
|
};
|
|
|
|
var useMatch = function useMatch(path) {
|
|
if (!path) {
|
|
throw new Error("useMatch(path: string) requires an argument of a string to match against");
|
|
}
|
|
var context = (0,react__WEBPACK_IMPORTED_MODULE_0__.useContext)(BaseContext);
|
|
|
|
if (!context) {
|
|
throw new Error("useMatch hook was used but a LocationContext.Provider was not found in the parent tree. Make sure this is used in a component that is a child of Router");
|
|
}
|
|
|
|
var location = useLocation();
|
|
|
|
var resolvedPath = (0,_lib_utils__WEBPACK_IMPORTED_MODULE_4__.resolve)(path, context.baseuri);
|
|
var result = (0,_lib_utils__WEBPACK_IMPORTED_MODULE_4__.match)(resolvedPath, location.pathname);
|
|
return result ? _extends({}, result.params, {
|
|
uri: result.uri,
|
|
path: path
|
|
}) : null;
|
|
};
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
// Junk
|
|
var stripSlashes = function stripSlashes(str) {
|
|
return str.replace(/(^\/+|\/+$)/g, "");
|
|
};
|
|
|
|
var createRoute = function createRoute(basepath) {
|
|
return function (element) {
|
|
if (!element) {
|
|
return null;
|
|
}
|
|
|
|
if (element.type === (react__WEBPACK_IMPORTED_MODULE_0___default().Fragment) && element.props.children) {
|
|
return react__WEBPACK_IMPORTED_MODULE_0___default().Children.map(element.props.children, createRoute(basepath));
|
|
}
|
|
!(element.props.path || element.props.default || element.type === Redirect) ? true ? invariant__WEBPACK_IMPORTED_MODULE_1___default()(false, "<Router>: Children of <Router> must have a `path` or `default` prop, or be a `<Redirect>`. None found on element type `" + element.type + "`") : 0 : void 0;
|
|
|
|
!!(element.type === Redirect && (!element.props.from || !element.props.to)) ? true ? invariant__WEBPACK_IMPORTED_MODULE_1___default()(false, "<Redirect from=\"" + element.props.from + "\" to=\"" + element.props.to + "\"/> requires both \"from\" and \"to\" props when inside a <Router>.") : 0 : void 0;
|
|
|
|
!!(element.type === Redirect && !(0,_lib_utils__WEBPACK_IMPORTED_MODULE_4__.validateRedirect)(element.props.from, element.props.to)) ? true ? invariant__WEBPACK_IMPORTED_MODULE_1___default()(false, "<Redirect from=\"" + element.props.from + " to=\"" + element.props.to + "\"/> has mismatched dynamic segments, ensure both paths have the exact same dynamic segments.") : 0 : void 0;
|
|
|
|
if (element.props.default) {
|
|
return { value: element, default: true };
|
|
}
|
|
|
|
var elementPath = element.type === Redirect ? element.props.from : element.props.path;
|
|
|
|
var path = elementPath === "/" ? basepath : stripSlashes(basepath) + "/" + stripSlashes(elementPath);
|
|
|
|
return {
|
|
value: element,
|
|
default: element.props.default,
|
|
path: element.props.children ? stripSlashes(path) + "/*" : path
|
|
};
|
|
};
|
|
};
|
|
|
|
var shouldNavigate = function shouldNavigate(event) {
|
|
return !event.defaultPrevented && event.button === 0 && !(event.metaKey || event.altKey || event.ctrlKey || event.shiftKey);
|
|
};
|
|
|
|
////////////////////////////////////////////////////////////////////////
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/@reach/router/es/lib/history.js":
|
|
/*!*******************************************************!*\
|
|
!*** ../node_modules/@reach/router/es/lib/history.js ***!
|
|
\*******************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ createHistory: () => (/* binding */ createHistory),
|
|
/* harmony export */ createMemorySource: () => (/* binding */ createMemorySource),
|
|
/* harmony export */ globalHistory: () => (/* binding */ globalHistory),
|
|
/* harmony export */ navigate: () => (/* binding */ navigate)
|
|
/* harmony export */ });
|
|
var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; };
|
|
|
|
var getLocation = function getLocation(source) {
|
|
var _source$location = source.location,
|
|
search = _source$location.search,
|
|
hash = _source$location.hash,
|
|
href = _source$location.href,
|
|
origin = _source$location.origin,
|
|
protocol = _source$location.protocol,
|
|
host = _source$location.host,
|
|
hostname = _source$location.hostname,
|
|
port = _source$location.port;
|
|
var pathname = source.location.pathname;
|
|
|
|
|
|
if (!pathname && href && canUseDOM) {
|
|
var url = new URL(href);
|
|
pathname = url.pathname;
|
|
}
|
|
|
|
return {
|
|
pathname: encodeURI(decodeURI(pathname)),
|
|
search: search,
|
|
hash: hash,
|
|
href: href,
|
|
origin: origin,
|
|
protocol: protocol,
|
|
host: host,
|
|
hostname: hostname,
|
|
port: port,
|
|
state: source.history.state,
|
|
key: source.history.state && source.history.state.key || "initial"
|
|
};
|
|
};
|
|
|
|
var createHistory = function createHistory(source, options) {
|
|
var listeners = [];
|
|
var location = getLocation(source);
|
|
var transitioning = false;
|
|
var resolveTransition = function resolveTransition() {};
|
|
|
|
return {
|
|
get location() {
|
|
return location;
|
|
},
|
|
|
|
get transitioning() {
|
|
return transitioning;
|
|
},
|
|
|
|
_onTransitionComplete: function _onTransitionComplete() {
|
|
transitioning = false;
|
|
resolveTransition();
|
|
},
|
|
listen: function listen(listener) {
|
|
listeners.push(listener);
|
|
|
|
var popstateListener = function popstateListener() {
|
|
location = getLocation(source);
|
|
listener({ location: location, action: "POP" });
|
|
};
|
|
|
|
source.addEventListener("popstate", popstateListener);
|
|
|
|
return function () {
|
|
source.removeEventListener("popstate", popstateListener);
|
|
listeners = listeners.filter(function (fn) {
|
|
return fn !== listener;
|
|
});
|
|
};
|
|
},
|
|
navigate: function navigate(to) {
|
|
var _ref = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {},
|
|
state = _ref.state,
|
|
_ref$replace = _ref.replace,
|
|
replace = _ref$replace === undefined ? false : _ref$replace;
|
|
|
|
if (typeof to === "number") {
|
|
source.history.go(to);
|
|
} else {
|
|
state = _extends({}, state, { key: Date.now() + "" });
|
|
// try...catch iOS Safari limits to 100 pushState calls
|
|
try {
|
|
if (transitioning || replace) {
|
|
source.history.replaceState(state, null, to);
|
|
} else {
|
|
source.history.pushState(state, null, to);
|
|
}
|
|
} catch (e) {
|
|
source.location[replace ? "replace" : "assign"](to);
|
|
}
|
|
}
|
|
|
|
location = getLocation(source);
|
|
transitioning = true;
|
|
var transition = new Promise(function (res) {
|
|
return resolveTransition = res;
|
|
});
|
|
listeners.forEach(function (listener) {
|
|
return listener({ location: location, action: "PUSH" });
|
|
});
|
|
return transition;
|
|
}
|
|
};
|
|
};
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
// Stores history entries in memory for testing or other platforms like Native
|
|
var createMemorySource = function createMemorySource() {
|
|
var initialPath = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : "/";
|
|
|
|
var searchIndex = initialPath.indexOf("?");
|
|
var initialLocation = {
|
|
pathname: searchIndex > -1 ? initialPath.substr(0, searchIndex) : initialPath,
|
|
search: searchIndex > -1 ? initialPath.substr(searchIndex) : ""
|
|
};
|
|
var index = 0;
|
|
var stack = [initialLocation];
|
|
var states = [null];
|
|
|
|
return {
|
|
get location() {
|
|
return stack[index];
|
|
},
|
|
addEventListener: function addEventListener(name, fn) {},
|
|
removeEventListener: function removeEventListener(name, fn) {},
|
|
|
|
history: {
|
|
get entries() {
|
|
return stack;
|
|
},
|
|
get index() {
|
|
return index;
|
|
},
|
|
get state() {
|
|
return states[index];
|
|
},
|
|
pushState: function pushState(state, _, uri) {
|
|
var _uri$split = uri.split("?"),
|
|
pathname = _uri$split[0],
|
|
_uri$split$ = _uri$split[1],
|
|
search = _uri$split$ === undefined ? "" : _uri$split$;
|
|
|
|
index++;
|
|
stack.push({ pathname: pathname, search: search.length ? "?" + search : search });
|
|
states.push(state);
|
|
},
|
|
replaceState: function replaceState(state, _, uri) {
|
|
var _uri$split2 = uri.split("?"),
|
|
pathname = _uri$split2[0],
|
|
_uri$split2$ = _uri$split2[1],
|
|
search = _uri$split2$ === undefined ? "" : _uri$split2$;
|
|
|
|
stack[index] = { pathname: pathname, search: search };
|
|
states[index] = state;
|
|
},
|
|
go: function go(to) {
|
|
var newIndex = index + to;
|
|
|
|
if (newIndex < 0 || newIndex > states.length - 1) {
|
|
return;
|
|
}
|
|
|
|
index = newIndex;
|
|
}
|
|
}
|
|
};
|
|
};
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
// global history - uses window.history as the source if available, otherwise a
|
|
// memory history
|
|
var canUseDOM = !!(typeof window !== "undefined" && window.document && window.document.createElement);
|
|
var getSource = function getSource() {
|
|
return canUseDOM ? window : createMemorySource();
|
|
};
|
|
|
|
var globalHistory = createHistory(getSource());
|
|
var navigate = globalHistory.navigate;
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/@reach/router/es/lib/utils.js":
|
|
/*!*****************************************************!*\
|
|
!*** ../node_modules/@reach/router/es/lib/utils.js ***!
|
|
\*****************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ insertParams: () => (/* binding */ insertParams),
|
|
/* harmony export */ match: () => (/* binding */ match),
|
|
/* harmony export */ pick: () => (/* binding */ pick),
|
|
/* harmony export */ resolve: () => (/* binding */ resolve),
|
|
/* harmony export */ shallowCompare: () => (/* binding */ shallowCompare),
|
|
/* harmony export */ startsWith: () => (/* binding */ startsWith),
|
|
/* harmony export */ validateRedirect: () => (/* binding */ validateRedirect)
|
|
/* harmony export */ });
|
|
/* harmony import */ var invariant__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! invariant */ "../node_modules/invariant/browser.js");
|
|
/* harmony import */ var invariant__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(invariant__WEBPACK_IMPORTED_MODULE_0__);
|
|
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
// startsWith(string, search) - Check if `string` starts with `search`
|
|
var startsWith = function startsWith(string, search) {
|
|
return string.substr(0, search.length) === search;
|
|
};
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
// pick(routes, uri)
|
|
//
|
|
// Ranks and picks the best route to match. Each segment gets the highest
|
|
// amount of points, then the type of segment gets an additional amount of
|
|
// points where
|
|
//
|
|
// static > dynamic > splat > root
|
|
//
|
|
// This way we don't have to worry about the order of our routes, let the
|
|
// computers do it.
|
|
//
|
|
// A route looks like this
|
|
//
|
|
// { path, default, value }
|
|
//
|
|
// And a returned match looks like:
|
|
//
|
|
// { route, params, uri }
|
|
//
|
|
// I know, I should use TypeScript not comments for these types.
|
|
var pick = function pick(routes, uri) {
|
|
var match = void 0;
|
|
var default_ = void 0;
|
|
|
|
var _uri$split = uri.split("?"),
|
|
uriPathname = _uri$split[0];
|
|
|
|
var uriSegments = segmentize(uriPathname);
|
|
var isRootUri = uriSegments[0] === "";
|
|
var ranked = rankRoutes(routes);
|
|
|
|
for (var i = 0, l = ranked.length; i < l; i++) {
|
|
var missed = false;
|
|
var route = ranked[i].route;
|
|
|
|
if (route.default) {
|
|
default_ = {
|
|
route: route,
|
|
params: {},
|
|
uri: uri
|
|
};
|
|
continue;
|
|
}
|
|
|
|
var routeSegments = segmentize(route.path);
|
|
var params = {};
|
|
var max = Math.max(uriSegments.length, routeSegments.length);
|
|
var index = 0;
|
|
|
|
for (; index < max; index++) {
|
|
var routeSegment = routeSegments[index];
|
|
var uriSegment = uriSegments[index];
|
|
|
|
if (isSplat(routeSegment)) {
|
|
// Hit a splat, just grab the rest, and return a match
|
|
// uri: /files/documents/work
|
|
// route: /files/*
|
|
var param = routeSegment.slice(1) || "*";
|
|
params[param] = uriSegments.slice(index).map(decodeURIComponent).join("/");
|
|
break;
|
|
}
|
|
|
|
if (uriSegment === undefined) {
|
|
// URI is shorter than the route, no match
|
|
// uri: /users
|
|
// route: /users/:userId
|
|
missed = true;
|
|
break;
|
|
}
|
|
|
|
var dynamicMatch = paramRe.exec(routeSegment);
|
|
|
|
if (dynamicMatch && !isRootUri) {
|
|
var matchIsNotReserved = reservedNames.indexOf(dynamicMatch[1]) === -1;
|
|
!matchIsNotReserved ? true ? invariant__WEBPACK_IMPORTED_MODULE_0___default()(false, "<Router> dynamic segment \"" + dynamicMatch[1] + "\" is a reserved name. Please use a different name in path \"" + route.path + "\".") : 0 : void 0;
|
|
var value = decodeURIComponent(uriSegment);
|
|
params[dynamicMatch[1]] = value;
|
|
} else if (routeSegment !== uriSegment) {
|
|
// Current segments don't match, not dynamic, not splat, so no match
|
|
// uri: /users/123/settings
|
|
// route: /users/:id/profile
|
|
missed = true;
|
|
break;
|
|
}
|
|
}
|
|
|
|
if (!missed) {
|
|
match = {
|
|
route: route,
|
|
params: params,
|
|
uri: "/" + uriSegments.slice(0, index).join("/")
|
|
};
|
|
break;
|
|
}
|
|
}
|
|
|
|
return match || default_ || null;
|
|
};
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
// match(path, uri) - Matches just one path to a uri, also lol
|
|
var match = function match(path, uri) {
|
|
return pick([{ path: path }], uri);
|
|
};
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
// resolve(to, basepath)
|
|
//
|
|
// Resolves URIs as though every path is a directory, no files. Relative URIs
|
|
// in the browser can feel awkward because not only can you be "in a directory"
|
|
// you can be "at a file", too. For example
|
|
//
|
|
// browserSpecResolve('foo', '/bar/') => /bar/foo
|
|
// browserSpecResolve('foo', '/bar') => /foo
|
|
//
|
|
// But on the command line of a file system, it's not as complicated, you can't
|
|
// `cd` from a file, only directories. This way, links have to know less about
|
|
// their current path. To go deeper you can do this:
|
|
//
|
|
// <Link to="deeper"/>
|
|
// // instead of
|
|
// <Link to=`{${props.uri}/deeper}`/>
|
|
//
|
|
// Just like `cd`, if you want to go deeper from the command line, you do this:
|
|
//
|
|
// cd deeper
|
|
// # not
|
|
// cd $(pwd)/deeper
|
|
//
|
|
// By treating every path as a directory, linking to relative paths should
|
|
// require less contextual information and (fingers crossed) be more intuitive.
|
|
var resolve = function resolve(to, base) {
|
|
// /foo/bar, /baz/qux => /foo/bar
|
|
if (startsWith(to, "/")) {
|
|
return to;
|
|
}
|
|
|
|
var _to$split = to.split("?"),
|
|
toPathname = _to$split[0],
|
|
toQuery = _to$split[1];
|
|
|
|
var _base$split = base.split("?"),
|
|
basePathname = _base$split[0];
|
|
|
|
var toSegments = segmentize(toPathname);
|
|
var baseSegments = segmentize(basePathname);
|
|
|
|
// ?a=b, /users?b=c => /users?a=b
|
|
if (toSegments[0] === "") {
|
|
return addQuery(basePathname, toQuery);
|
|
}
|
|
|
|
// profile, /users/789 => /users/789/profile
|
|
if (!startsWith(toSegments[0], ".")) {
|
|
var pathname = baseSegments.concat(toSegments).join("/");
|
|
return addQuery((basePathname === "/" ? "" : "/") + pathname, toQuery);
|
|
}
|
|
|
|
// ./ /users/123 => /users/123
|
|
// ../ /users/123 => /users
|
|
// ../.. /users/123 => /
|
|
// ../../one /a/b/c/d => /a/b/one
|
|
// .././one /a/b/c/d => /a/b/c/one
|
|
var allSegments = baseSegments.concat(toSegments);
|
|
var segments = [];
|
|
for (var i = 0, l = allSegments.length; i < l; i++) {
|
|
var segment = allSegments[i];
|
|
if (segment === "..") segments.pop();else if (segment !== ".") segments.push(segment);
|
|
}
|
|
|
|
return addQuery("/" + segments.join("/"), toQuery);
|
|
};
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
// insertParams(path, params)
|
|
|
|
var insertParams = function insertParams(path, params) {
|
|
var _path$split = path.split("?"),
|
|
pathBase = _path$split[0],
|
|
_path$split$ = _path$split[1],
|
|
query = _path$split$ === undefined ? "" : _path$split$;
|
|
|
|
var segments = segmentize(pathBase);
|
|
var constructedPath = "/" + segments.map(function (segment) {
|
|
var match = paramRe.exec(segment);
|
|
return match ? params[match[1]] : segment;
|
|
}).join("/");
|
|
var _params$location = params.location;
|
|
_params$location = _params$location === undefined ? {} : _params$location;
|
|
var _params$location$sear = _params$location.search,
|
|
search = _params$location$sear === undefined ? "" : _params$location$sear;
|
|
|
|
var searchSplit = search.split("?")[1] || "";
|
|
constructedPath = addQuery(constructedPath, query, searchSplit);
|
|
return constructedPath;
|
|
};
|
|
|
|
var validateRedirect = function validateRedirect(from, to) {
|
|
var filter = function filter(segment) {
|
|
return isDynamic(segment);
|
|
};
|
|
var fromString = segmentize(from).filter(filter).sort().join("/");
|
|
var toString = segmentize(to).filter(filter).sort().join("/");
|
|
return fromString === toString;
|
|
};
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
// Junk
|
|
var paramRe = /^:(.+)/;
|
|
|
|
var SEGMENT_POINTS = 4;
|
|
var STATIC_POINTS = 3;
|
|
var DYNAMIC_POINTS = 2;
|
|
var SPLAT_PENALTY = 1;
|
|
var ROOT_POINTS = 1;
|
|
|
|
var isRootSegment = function isRootSegment(segment) {
|
|
return segment === "";
|
|
};
|
|
var isDynamic = function isDynamic(segment) {
|
|
return paramRe.test(segment);
|
|
};
|
|
var isSplat = function isSplat(segment) {
|
|
return segment && segment[0] === "*";
|
|
};
|
|
|
|
var rankRoute = function rankRoute(route, index) {
|
|
var score = route.default ? 0 : segmentize(route.path).reduce(function (score, segment) {
|
|
score += SEGMENT_POINTS;
|
|
if (isRootSegment(segment)) score += ROOT_POINTS;else if (isDynamic(segment)) score += DYNAMIC_POINTS;else if (isSplat(segment)) score -= SEGMENT_POINTS + SPLAT_PENALTY;else score += STATIC_POINTS;
|
|
return score;
|
|
}, 0);
|
|
return { route: route, score: score, index: index };
|
|
};
|
|
|
|
var rankRoutes = function rankRoutes(routes) {
|
|
return routes.map(rankRoute).sort(function (a, b) {
|
|
return a.score < b.score ? 1 : a.score > b.score ? -1 : a.index - b.index;
|
|
});
|
|
};
|
|
|
|
var segmentize = function segmentize(uri) {
|
|
return uri
|
|
// strip starting/ending slashes
|
|
.replace(/(^\/+|\/+$)/g, "").split("/");
|
|
};
|
|
|
|
var addQuery = function addQuery(pathname) {
|
|
for (var _len = arguments.length, query = Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
|
|
query[_key - 1] = arguments[_key];
|
|
}
|
|
|
|
query = query.filter(function (q) {
|
|
return q && q.length > 0;
|
|
});
|
|
return pathname + (query && query.length > 0 ? "?" + query.join("&") : "");
|
|
};
|
|
|
|
var reservedNames = ["uri", "path"];
|
|
|
|
/**
|
|
* Shallow compares two objects.
|
|
* @param {Object} obj1 The first object to compare.
|
|
* @param {Object} obj2 The second object to compare.
|
|
*/
|
|
var shallowCompare = function shallowCompare(obj1, obj2) {
|
|
var obj1Keys = Object.keys(obj1);
|
|
return obj1Keys.length === Object.keys(obj2).length && obj1Keys.every(function (key) {
|
|
return obj2.hasOwnProperty(key) && obj1[key] === obj2[key];
|
|
});
|
|
};
|
|
|
|
////////////////////////////////////////////////////////////////////////////////
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/@reach/router/node_modules/create-react-context/lib/implementation.js":
|
|
/*!*********************************************************************************************!*\
|
|
!*** ../node_modules/@reach/router/node_modules/create-react-context/lib/implementation.js ***!
|
|
\*********************************************************************************************/
|
|
/***/ ((module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
exports.__esModule = true;
|
|
|
|
var _react = __webpack_require__(/*! react */ "react");
|
|
|
|
var _react2 = _interopRequireDefault(_react);
|
|
|
|
var _propTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
var _propTypes2 = _interopRequireDefault(_propTypes);
|
|
|
|
var _gud = __webpack_require__(/*! gud */ "../node_modules/gud/index.js");
|
|
|
|
var _gud2 = _interopRequireDefault(_gud);
|
|
|
|
var _warning = __webpack_require__(/*! warning */ "../node_modules/warning/warning.js");
|
|
|
|
var _warning2 = _interopRequireDefault(_warning);
|
|
|
|
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
|
|
|
function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }
|
|
|
|
function _possibleConstructorReturn(self, call) { if (!self) { throw new ReferenceError("this hasn't been initialised - super() hasn't been called"); } return call && (typeof call === "object" || typeof call === "function") ? call : self; }
|
|
|
|
function _inherits(subClass, superClass) { if (typeof superClass !== "function" && superClass !== null) { throw new TypeError("Super expression must either be null or a function, not " + typeof superClass); } subClass.prototype = Object.create(superClass && superClass.prototype, { constructor: { value: subClass, enumerable: false, writable: true, configurable: true } }); if (superClass) Object.setPrototypeOf ? Object.setPrototypeOf(subClass, superClass) : subClass.__proto__ = superClass; }
|
|
|
|
var MAX_SIGNED_31_BIT_INT = 1073741823;
|
|
|
|
// Inlined Object.is polyfill.
|
|
// https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is
|
|
function objectIs(x, y) {
|
|
if (x === y) {
|
|
return x !== 0 || 1 / x === 1 / y;
|
|
} else {
|
|
return x !== x && y !== y;
|
|
}
|
|
}
|
|
|
|
function createEventEmitter(value) {
|
|
var handlers = [];
|
|
return {
|
|
on: function on(handler) {
|
|
handlers.push(handler);
|
|
},
|
|
off: function off(handler) {
|
|
handlers = handlers.filter(function (h) {
|
|
return h !== handler;
|
|
});
|
|
},
|
|
get: function get() {
|
|
return value;
|
|
},
|
|
set: function set(newValue, changedBits) {
|
|
value = newValue;
|
|
handlers.forEach(function (handler) {
|
|
return handler(value, changedBits);
|
|
});
|
|
}
|
|
};
|
|
}
|
|
|
|
function onlyChild(children) {
|
|
return Array.isArray(children) ? children[0] : children;
|
|
}
|
|
|
|
function createReactContext(defaultValue, calculateChangedBits) {
|
|
var _Provider$childContex, _Consumer$contextType;
|
|
|
|
var contextProp = '__create-react-context-' + (0, _gud2.default)() + '__';
|
|
|
|
var Provider = function (_Component) {
|
|
_inherits(Provider, _Component);
|
|
|
|
function Provider() {
|
|
var _temp, _this, _ret;
|
|
|
|
_classCallCheck(this, Provider);
|
|
|
|
for (var _len = arguments.length, args = Array(_len), _key = 0; _key < _len; _key++) {
|
|
args[_key] = arguments[_key];
|
|
}
|
|
|
|
return _ret = (_temp = (_this = _possibleConstructorReturn(this, _Component.call.apply(_Component, [this].concat(args))), _this), _this.emitter = createEventEmitter(_this.props.value), _temp), _possibleConstructorReturn(_this, _ret);
|
|
}
|
|
|
|
Provider.prototype.getChildContext = function getChildContext() {
|
|
var _ref;
|
|
|
|
return _ref = {}, _ref[contextProp] = this.emitter, _ref;
|
|
};
|
|
|
|
Provider.prototype.componentWillReceiveProps = function componentWillReceiveProps(nextProps) {
|
|
if (this.props.value !== nextProps.value) {
|
|
var oldValue = this.props.value;
|
|
var newValue = nextProps.value;
|
|
var changedBits = void 0;
|
|
|
|
if (objectIs(oldValue, newValue)) {
|
|
changedBits = 0; // No change
|
|
} else {
|
|
changedBits = typeof calculateChangedBits === 'function' ? calculateChangedBits(oldValue, newValue) : MAX_SIGNED_31_BIT_INT;
|
|
if (true) {
|
|
(0, _warning2.default)((changedBits & MAX_SIGNED_31_BIT_INT) === changedBits, 'calculateChangedBits: Expected the return value to be a ' + '31-bit integer. Instead received: %s', changedBits);
|
|
}
|
|
|
|
changedBits |= 0;
|
|
|
|
if (changedBits !== 0) {
|
|
this.emitter.set(nextProps.value, changedBits);
|
|
}
|
|
}
|
|
}
|
|
};
|
|
|
|
Provider.prototype.render = function render() {
|
|
return this.props.children;
|
|
};
|
|
|
|
return Provider;
|
|
}(_react.Component);
|
|
|
|
Provider.childContextTypes = (_Provider$childContex = {}, _Provider$childContex[contextProp] = _propTypes2.default.object.isRequired, _Provider$childContex);
|
|
|
|
var Consumer = function (_Component2) {
|
|
_inherits(Consumer, _Component2);
|
|
|
|
function Consumer() {
|
|
var _temp2, _this2, _ret2;
|
|
|
|
_classCallCheck(this, Consumer);
|
|
|
|
for (var _len2 = arguments.length, args = Array(_len2), _key2 = 0; _key2 < _len2; _key2++) {
|
|
args[_key2] = arguments[_key2];
|
|
}
|
|
|
|
return _ret2 = (_temp2 = (_this2 = _possibleConstructorReturn(this, _Component2.call.apply(_Component2, [this].concat(args))), _this2), _this2.state = {
|
|
value: _this2.getValue()
|
|
}, _this2.onUpdate = function (newValue, changedBits) {
|
|
var observedBits = _this2.observedBits | 0;
|
|
if ((observedBits & changedBits) !== 0) {
|
|
_this2.setState({ value: _this2.getValue() });
|
|
}
|
|
}, _temp2), _possibleConstructorReturn(_this2, _ret2);
|
|
}
|
|
|
|
Consumer.prototype.componentWillReceiveProps = function componentWillReceiveProps(nextProps) {
|
|
var observedBits = nextProps.observedBits;
|
|
|
|
this.observedBits = observedBits === undefined || observedBits === null ? MAX_SIGNED_31_BIT_INT // Subscribe to all changes by default
|
|
: observedBits;
|
|
};
|
|
|
|
Consumer.prototype.componentDidMount = function componentDidMount() {
|
|
if (this.context[contextProp]) {
|
|
this.context[contextProp].on(this.onUpdate);
|
|
}
|
|
var observedBits = this.props.observedBits;
|
|
|
|
this.observedBits = observedBits === undefined || observedBits === null ? MAX_SIGNED_31_BIT_INT // Subscribe to all changes by default
|
|
: observedBits;
|
|
};
|
|
|
|
Consumer.prototype.componentWillUnmount = function componentWillUnmount() {
|
|
if (this.context[contextProp]) {
|
|
this.context[contextProp].off(this.onUpdate);
|
|
}
|
|
};
|
|
|
|
Consumer.prototype.getValue = function getValue() {
|
|
if (this.context[contextProp]) {
|
|
return this.context[contextProp].get();
|
|
} else {
|
|
return defaultValue;
|
|
}
|
|
};
|
|
|
|
Consumer.prototype.render = function render() {
|
|
return onlyChild(this.props.children)(this.state.value);
|
|
};
|
|
|
|
return Consumer;
|
|
}(_react.Component);
|
|
|
|
Consumer.contextTypes = (_Consumer$contextType = {}, _Consumer$contextType[contextProp] = _propTypes2.default.object, _Consumer$contextType);
|
|
|
|
|
|
return {
|
|
Provider: Provider,
|
|
Consumer: Consumer
|
|
};
|
|
}
|
|
|
|
exports["default"] = createReactContext;
|
|
module.exports = exports['default'];
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/@reach/router/node_modules/create-react-context/lib/index.js":
|
|
/*!************************************************************************************!*\
|
|
!*** ../node_modules/@reach/router/node_modules/create-react-context/lib/index.js ***!
|
|
\************************************************************************************/
|
|
/***/ ((module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
exports.__esModule = true;
|
|
|
|
var _react = __webpack_require__(/*! react */ "react");
|
|
|
|
var _react2 = _interopRequireDefault(_react);
|
|
|
|
var _implementation = __webpack_require__(/*! ./implementation */ "../node_modules/@reach/router/node_modules/create-react-context/lib/implementation.js");
|
|
|
|
var _implementation2 = _interopRequireDefault(_implementation);
|
|
|
|
function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; }
|
|
|
|
exports["default"] = _react2.default.createContext || _implementation2.default;
|
|
module.exports = exports['default'];
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/assets/js/hooks/use-feature-lock.js":
|
|
/*!*******************************************************!*\
|
|
!*** ../core/app/assets/js/hooks/use-feature-lock.js ***!
|
|
\*******************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = useFeatureLock;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _connectButton = _interopRequireDefault(__webpack_require__(/*! ../ui/connect-button */ "../core/app/assets/js/ui/connect-button.js"));
|
|
var _utils = __webpack_require__(/*! ../utils */ "../core/app/assets/js/utils.js");
|
|
function useFeatureLock(featureName) {
|
|
const appConfig = elementorAppProConfig[featureName] ?? {},
|
|
isLocked = appConfig.lock?.is_locked ?? false;
|
|
const buttonText = (0, _utils.htmlDecodeTextContent)(appConfig.lock?.button.text);
|
|
const buttonLink = (0, _utils.replaceUtmPlaceholders)(appConfig.lock?.button.url ?? '', appConfig.utms ?? {});
|
|
const ConnectButton = () => /*#__PURE__*/_react.default.createElement(_connectButton.default, {
|
|
text: buttonText,
|
|
url: buttonLink
|
|
});
|
|
return {
|
|
isLocked,
|
|
ConnectButton
|
|
};
|
|
}
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/assets/js/ui/connect-button.js":
|
|
/*!**************************************************!*\
|
|
!*** ../core/app/assets/js/ui/connect-button.js ***!
|
|
\**************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = void 0;
|
|
var _extends2 = _interopRequireDefault(__webpack_require__(/*! @babel/runtime/helpers/extends */ "../node_modules/@babel/runtime/helpers/extends.js"));
|
|
var _react = _interopRequireWildcard(__webpack_require__(/*! react */ "react"));
|
|
var React = _react;
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
var _utils = __webpack_require__(/*! ../utils.js */ "../core/app/assets/js/utils.js");
|
|
function _getRequireWildcardCache(e) { if ("function" != typeof WeakMap) return null; var r = new WeakMap(), t = new WeakMap(); return (_getRequireWildcardCache = function (e) { return e ? t : r; })(e); }
|
|
function _interopRequireWildcard(e, r) { if (!r && e && e.__esModule) return e; if (null === e || "object" != typeof e && "function" != typeof e) return { default: e }; var t = _getRequireWildcardCache(r); if (t && t.has(e)) return t.get(e); var n = { __proto__: null }, a = Object.defineProperty && Object.getOwnPropertyDescriptor; for (var u in e) if ("default" !== u && {}.hasOwnProperty.call(e, u)) { var i = a ? Object.getOwnPropertyDescriptor(e, u) : null; i && (i.get || i.set) ? Object.defineProperty(n, u, i) : n[u] = e[u]; } return n.default = e, t && t.set(e, n), n; }
|
|
const ConnectButton = props => {
|
|
const className = (0, _utils.arrayToClassName)(['e-app-connect-button', props.className]);
|
|
const buttonRef = (0, _react.useRef)(null);
|
|
(0, _react.useEffect)(() => {
|
|
if (!buttonRef.current) {
|
|
return;
|
|
}
|
|
jQuery(buttonRef.current).elementorConnect();
|
|
}, []);
|
|
return /*#__PURE__*/React.createElement(_appUi.Button, (0, _extends2.default)({}, props, {
|
|
elRef: buttonRef,
|
|
className: className
|
|
}));
|
|
};
|
|
ConnectButton.propTypes = {
|
|
..._appUi.Button.propTypes,
|
|
text: PropTypes.string.isRequired,
|
|
url: PropTypes.string.isRequired,
|
|
className: PropTypes.string
|
|
};
|
|
ConnectButton.defaultProps = {
|
|
className: '',
|
|
variant: 'contained',
|
|
size: 'sm',
|
|
color: 'cta',
|
|
target: '_blank',
|
|
rel: 'noopener noreferrer',
|
|
text: __('Connect & Activate', 'elementor-pro')
|
|
};
|
|
var _default = exports["default"] = React.memo(ConnectButton);
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/assets/js/utils.js":
|
|
/*!**************************************!*\
|
|
!*** ../core/app/assets/js/utils.js ***!
|
|
\**************************************/
|
|
/***/ ((__unused_webpack_module, exports) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports.replaceUtmPlaceholders = exports.htmlDecodeTextContent = exports.arrayToClassName = void 0;
|
|
// Copied from Core.
|
|
const arrayToClassName = (array, action) => {
|
|
return array.filter(item => 'object' === typeof item ? Object.entries(item)[0][1] : item).map(item => {
|
|
const value = 'object' === typeof item ? Object.entries(item)[0][0] : item;
|
|
return action ? action(value) : value;
|
|
}).join(' ');
|
|
};
|
|
exports.arrayToClassName = arrayToClassName;
|
|
const htmlDecodeTextContent = input => {
|
|
const doc = new DOMParser().parseFromString(input, 'text/html');
|
|
return doc.documentElement.textContent;
|
|
};
|
|
exports.htmlDecodeTextContent = htmlDecodeTextContent;
|
|
const replaceUtmPlaceholders = function () {
|
|
let link = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : '';
|
|
let utms = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
|
|
if (!link || !utms) {
|
|
return link;
|
|
}
|
|
Object.keys(utms).forEach(key => {
|
|
const match = new RegExp(`%%${key}%%`, 'g');
|
|
link = link.replace(match, utms[key]);
|
|
});
|
|
return link;
|
|
};
|
|
exports.replaceUtmPlaceholders = replaceUtmPlaceholders;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/atoms/indicator-bullet.js":
|
|
/*!***************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/atoms/indicator-bullet.js ***!
|
|
\***************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports.Indicator = void 0;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
__webpack_require__(/*! ./indicator-bullet.scss */ "../core/app/modules/site-editor/assets/js/atoms/indicator-bullet.scss");
|
|
const Indicator = props => {
|
|
let className = 'eps-indicator-bullet';
|
|
if (props.active) {
|
|
className += ` ${className}--active`;
|
|
}
|
|
return /*#__PURE__*/_react.default.createElement("i", {
|
|
className: className
|
|
});
|
|
};
|
|
exports.Indicator = Indicator;
|
|
Indicator.propTypes = {
|
|
active: PropTypes.bool
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/atoms/preview-iframe.js":
|
|
/*!*************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/atoms/preview-iframe.js ***!
|
|
\*************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = PreviewIFrame;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
__webpack_require__(/*! ./preview-iframe.scss */ "../core/app/modules/site-editor/assets/js/atoms/preview-iframe.scss");
|
|
function PreviewIFrame(props) {
|
|
const ref = _react.default.useRef(null),
|
|
previewBreakpoint = 1200,
|
|
[scale, setScale] = _react.default.useState(1),
|
|
[height, setHeight] = _react.default.useState(0);
|
|
|
|
// In order to make sure that the iframe itself show the content in specific viewport,
|
|
// and it should fit to the size of the card, there is a use of css props `scale` and `height`,
|
|
// and another element that wraps the iframe to be the guidelines of the iframe sizes.
|
|
_react.default.useEffect(() => {
|
|
const currentScale = ref.current.clientWidth / previewBreakpoint;
|
|
setScale(currentScale);
|
|
setHeight(ref.current.clientHeight / currentScale);
|
|
}, []);
|
|
return /*#__PURE__*/_react.default.createElement("div", {
|
|
ref: ref,
|
|
className: `site-editor__preview-iframe site-editor__preview-iframe--${props.templateType}`
|
|
}, /*#__PURE__*/_react.default.createElement("iframe", {
|
|
title: "preview",
|
|
src: props.src,
|
|
className: `site-editor__preview-iframe__iframe`,
|
|
style: {
|
|
transform: `scale(${scale})`,
|
|
height,
|
|
width: previewBreakpoint
|
|
}
|
|
}));
|
|
}
|
|
PreviewIFrame.propTypes = {
|
|
src: PropTypes.string.isRequired,
|
|
templateType: PropTypes.string.isRequired
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/context/base-context.js":
|
|
/*!*************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/context/base-context.js ***!
|
|
\*************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var React = __webpack_require__(/*! react */ "react");
|
|
|
|
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = exports.BaseContext = void 0;
|
|
class BaseContext extends React.Component {
|
|
constructor(props) {
|
|
super(props);
|
|
this.state = {
|
|
action: {
|
|
current: null,
|
|
loading: false,
|
|
error: null,
|
|
errorMeta: {}
|
|
},
|
|
updateActionState: this.updateActionState.bind(this),
|
|
resetActionState: this.resetActionState.bind(this)
|
|
};
|
|
}
|
|
executeAction(name, handler) {
|
|
this.updateActionState({
|
|
current: name,
|
|
loading: true,
|
|
error: null,
|
|
errorMeta: {}
|
|
});
|
|
return handler().then(response => {
|
|
this.resetActionState();
|
|
return Promise.resolve(response);
|
|
}).catch(error => {
|
|
this.updateActionState({
|
|
current: name,
|
|
loading: false,
|
|
error: error.message,
|
|
errorMeta: error
|
|
});
|
|
return Promise.reject(error);
|
|
});
|
|
}
|
|
updateActionState(data) {
|
|
return this.setState(prev => ({
|
|
action: {
|
|
...prev.action,
|
|
...data
|
|
}
|
|
}));
|
|
}
|
|
resetActionState() {
|
|
this.updateActionState({
|
|
current: null,
|
|
loading: false,
|
|
error: null,
|
|
errorMeta: {}
|
|
});
|
|
}
|
|
}
|
|
exports.BaseContext = BaseContext;
|
|
var _default = exports["default"] = BaseContext;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/context/conditions.js":
|
|
/*!***********************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/context/conditions.js ***!
|
|
\***********************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = exports.Context = exports.ConditionsProvider = void 0;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _condition = _interopRequireDefault(__webpack_require__(/*! ./models/condition */ "../core/app/modules/site-editor/assets/js/context/models/condition.js"));
|
|
var _conditionsConfig = _interopRequireDefault(__webpack_require__(/*! ./services/conditions-config */ "../core/app/modules/site-editor/assets/js/context/services/conditions-config.js"));
|
|
var _baseContext = _interopRequireDefault(__webpack_require__(/*! ./base-context */ "../core/app/modules/site-editor/assets/js/context/base-context.js"));
|
|
var _commands = __webpack_require__(/*! ../data/commands */ "../core/app/modules/site-editor/assets/js/data/commands/index.js");
|
|
const Context = exports.Context = _react.default.createContext();
|
|
class ConditionsProvider extends _baseContext.default {
|
|
static propTypes = (() => ({
|
|
children: PropTypes.any.isRequired,
|
|
currentTemplate: PropTypes.object.isRequired,
|
|
onConditionsSaved: PropTypes.func.isRequired,
|
|
validateConflicts: PropTypes.bool
|
|
}))();
|
|
static defaultProps = {
|
|
validateConflicts: true
|
|
};
|
|
static actions = {
|
|
FETCH_CONFIG: 'fetch-config',
|
|
SAVE: 'save',
|
|
CHECK_CONFLICTS: 'check-conflicts'
|
|
};
|
|
|
|
/**
|
|
* Holds the conditions config object.
|
|
*
|
|
* @type {ConditionsConfig}
|
|
*/
|
|
conditionsConfig = null;
|
|
|
|
/**
|
|
* ConditionsProvider constructor.
|
|
*
|
|
* @param {any} props
|
|
*/
|
|
constructor(props) {
|
|
super(props);
|
|
this.state = {
|
|
...this.state,
|
|
conditionsFetched: false,
|
|
conditions: {},
|
|
updateConditionItemState: this.updateConditionItemState.bind(this),
|
|
removeConditionItemInState: this.removeConditionItemInState.bind(this),
|
|
createConditionItemInState: this.createConditionItemInState.bind(this),
|
|
findConditionItemInState: this.findConditionItemInState.bind(this),
|
|
saveConditions: this.saveConditions.bind(this)
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Fetch the conditions config, then normalize the conditions and then setup titles for
|
|
* the subIds.
|
|
*/
|
|
componentDidMount() {
|
|
this.executeAction(ConditionsProvider.actions.FETCH_CONFIG, () => _conditionsConfig.default.create()).then(conditionsConfig => this.conditionsConfig = conditionsConfig).then(this.normalizeConditionsState.bind(this)).then(() => {
|
|
this.setSubIdTitles.bind(this);
|
|
this.setState({
|
|
conditionsFetched: true
|
|
});
|
|
});
|
|
}
|
|
componentDidUpdate(prevProps, prevState) {
|
|
if (!prevState.conditionsFetched && this.state.conditionsFetched) {
|
|
this.setSubIdTitles();
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Execute a request to save the template conditions.
|
|
*
|
|
* @return {any} Saved conditions
|
|
*/
|
|
saveConditions() {
|
|
const conditions = Object.values(this.state.conditions).map(condition => condition.forDb());
|
|
return this.executeAction(ConditionsProvider.actions.SAVE, () => $e.data.update(_commands.TemplatesConditions.signature, {
|
|
conditions
|
|
}, {
|
|
id: this.props.currentTemplate.id
|
|
})).then(() => {
|
|
const contextConditions = Object.values(this.state.conditions).map(condition => condition.forContext());
|
|
this.props.onConditionsSaved(this.props.currentTemplate.id, {
|
|
conditions: contextConditions,
|
|
instances: this.conditionsConfig.calculateInstances(Object.values(this.state.conditions)),
|
|
isActive: !!(Object.keys(this.state.conditions).length && 'publish' === this.props.currentTemplate.status)
|
|
});
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Check for conflicts in the server and mark the condition if there
|
|
* is a conflict.
|
|
*
|
|
* @param {any} condition
|
|
*/
|
|
checkConflicts(condition) {
|
|
return this.executeAction(ConditionsProvider.actions.CHECK_CONFLICTS, () => $e.data.get(_commands.TemplatesConditionsConflicts.signature, {
|
|
post_id: this.props.currentTemplate.id,
|
|
condition: condition.clone().toString()
|
|
})).then(response => this.updateConditionItemState(condition.id, {
|
|
conflictErrors: Object.values(response.data)
|
|
}, false));
|
|
}
|
|
|
|
/**
|
|
* Fetching subId titles.
|
|
*
|
|
* @param {any} condition
|
|
* @return {Promise<unknown>} Titles
|
|
*/
|
|
fetchSubIdsTitles(condition) {
|
|
return new Promise(resolve => {
|
|
return elementorCommon.ajax.loadObjects({
|
|
action: 'query_control_value_titles',
|
|
ids: _.isArray(condition.subId) ? condition.subId : [condition.subId],
|
|
data: {
|
|
get_titles: condition.subIdAutocomplete,
|
|
unique_id: elementorCommon.helpers.getUniqueId()
|
|
},
|
|
success(response) {
|
|
resolve(response);
|
|
}
|
|
});
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Get the conditions from the template and normalize it to data structure
|
|
* that the components can work with.
|
|
*/
|
|
normalizeConditionsState() {
|
|
this.updateConditionsState(() => {
|
|
return this.props.currentTemplate.conditions.reduce((current, condition) => {
|
|
const conditionObj = new _condition.default({
|
|
...condition,
|
|
default: this.props.currentTemplate.defaultCondition,
|
|
options: this.conditionsConfig.getOptions(),
|
|
subOptions: this.conditionsConfig.getSubOptions(condition.name),
|
|
subIdAutocomplete: this.conditionsConfig.getSubIdAutocomplete(condition.sub),
|
|
subIdOptions: condition.subId ? [{
|
|
value: condition.subId,
|
|
label: ''
|
|
}] : []
|
|
});
|
|
return {
|
|
...current,
|
|
[conditionObj.id]: conditionObj
|
|
};
|
|
}, {});
|
|
}).then(() => {
|
|
Object.values(this.state.conditions).forEach(condition => this.checkConflicts(condition));
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Set titles to the subIds,
|
|
* for the first render of the component.
|
|
*/
|
|
setSubIdTitles() {
|
|
return Object.values(this.state.conditions).forEach(condition => {
|
|
if (!condition.subId) {
|
|
return;
|
|
}
|
|
return this.fetchSubIdsTitles(condition).then(response => this.updateConditionItemState(condition.id, {
|
|
subIdOptions: [{
|
|
label: Object.values(response)[0],
|
|
value: condition.subId
|
|
}]
|
|
}, false));
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Update state of specific condition item.
|
|
*
|
|
* @param {any} id
|
|
* @param {any} args
|
|
* @param {boolean} shouldCheckConflicts
|
|
*/
|
|
updateConditionItemState(id, args) {
|
|
let shouldCheckConflicts = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : true;
|
|
if (args.name) {
|
|
args.subOptions = this.conditionsConfig.getSubOptions(args.name);
|
|
}
|
|
if (args.sub || args.name) {
|
|
args.subIdAutocomplete = this.conditionsConfig.getSubIdAutocomplete(args.sub);
|
|
|
|
// In case that the condition has been changed, it will set the options of the subId
|
|
// to empty array to let select2 autocomplete handle the options.
|
|
args.subIdOptions = [];
|
|
}
|
|
this.updateConditionsState(prev => {
|
|
const condition = prev[id];
|
|
return {
|
|
...prev,
|
|
[id]: condition.clone().set(args)
|
|
};
|
|
}).then(() => {
|
|
if (shouldCheckConflicts) {
|
|
this.checkConflicts(this.findConditionItemInState(id));
|
|
}
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Remove a condition item from the state.
|
|
*
|
|
* @param {any} id
|
|
*/
|
|
removeConditionItemInState(id) {
|
|
this.updateConditionsState(prev => {
|
|
const newConditions = {
|
|
...prev
|
|
};
|
|
delete newConditions[id];
|
|
return newConditions;
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Add a new condition item into the state.
|
|
*
|
|
* @param {boolean} shouldCheckConflicts
|
|
*/
|
|
createConditionItemInState() {
|
|
let shouldCheckConflicts = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : true;
|
|
const defaultCondition = this.props.currentTemplate.defaultCondition,
|
|
newCondition = new _condition.default({
|
|
name: defaultCondition,
|
|
default: defaultCondition,
|
|
options: this.conditionsConfig.getOptions(),
|
|
subOptions: this.conditionsConfig.getSubOptions(defaultCondition),
|
|
subIdAutocomplete: this.conditionsConfig.getSubIdAutocomplete('')
|
|
});
|
|
this.updateConditionsState(prev => ({
|
|
...prev,
|
|
[newCondition.id]: newCondition
|
|
})).then(() => {
|
|
if (shouldCheckConflicts) {
|
|
this.checkConflicts(newCondition);
|
|
}
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Find a condition item from the conditions state.
|
|
*
|
|
* @param {any} id
|
|
* @return {Condition|null} Condition
|
|
*/
|
|
findConditionItemInState(id) {
|
|
return Object.values(this.state.conditions).find(c => c.id === id);
|
|
}
|
|
|
|
/**
|
|
* Update the whole conditions state.
|
|
*
|
|
* @param {Function} callback
|
|
* @return {Promise<undefined>} Conditions state
|
|
*/
|
|
updateConditionsState(callback) {
|
|
return new Promise(resolve => this.setState(prev => ({
|
|
conditions: callback(prev.conditions)
|
|
}), resolve));
|
|
}
|
|
|
|
/**
|
|
* Renders the provider.
|
|
*
|
|
* @return {any} Element
|
|
*/
|
|
render() {
|
|
if (this.state.action.current === ConditionsProvider.actions.FETCH_CONFIG) {
|
|
if (this.state.error) {
|
|
return /*#__PURE__*/_react.default.createElement("h3", null, __('Error:', 'elementor-pro'), " ", this.state.error);
|
|
}
|
|
if (this.state.loading) {
|
|
return /*#__PURE__*/_react.default.createElement("h3", null, __('Loading', 'elementor-pro'), "...");
|
|
}
|
|
}
|
|
return /*#__PURE__*/_react.default.createElement(Context.Provider, {
|
|
value: this.state
|
|
}, this.props.children);
|
|
}
|
|
}
|
|
exports.ConditionsProvider = ConditionsProvider;
|
|
var _default = exports["default"] = ConditionsProvider;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/context/models/condition.js":
|
|
/*!*****************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/context/models/condition.js ***!
|
|
\*****************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = void 0;
|
|
__webpack_require__(/*! core-js/modules/es.array.includes.js */ "../node_modules/core-js/modules/es.array.includes.js");
|
|
class Condition {
|
|
id = (() => elementorCommon.helpers.getUniqueId())();
|
|
default = '';
|
|
type = 'include';
|
|
name = '';
|
|
sub = '';
|
|
subId = '';
|
|
options = [];
|
|
subOptions = [];
|
|
subIdAutocomplete = [];
|
|
subIdOptions = [];
|
|
conflictErrors = [];
|
|
constructor(args) {
|
|
this.set(args);
|
|
}
|
|
set(args) {
|
|
Object.assign(this, args);
|
|
return this;
|
|
}
|
|
clone() {
|
|
return Object.assign(new Condition(), this);
|
|
}
|
|
remove(keys) {
|
|
if (!Array.isArray(keys)) {
|
|
keys = [keys];
|
|
}
|
|
keys.forEach(key => {
|
|
delete this[key];
|
|
});
|
|
return this;
|
|
}
|
|
only(keys) {
|
|
if (!Array.isArray(keys)) {
|
|
keys = [keys];
|
|
}
|
|
const keysToRemove = Object.keys(this).filter(conditionKey => !keys.includes(conditionKey));
|
|
this.remove(keysToRemove);
|
|
return this;
|
|
}
|
|
toJson() {
|
|
return JSON.stringify(this);
|
|
}
|
|
toString() {
|
|
return this.forDb().filter(item => item).join('/');
|
|
}
|
|
forDb() {
|
|
return [this.type, this.name, this.sub, this.subId];
|
|
}
|
|
forContext() {
|
|
return {
|
|
type: this.type,
|
|
name: this.name,
|
|
sub: this.sub,
|
|
subId: this.subId
|
|
};
|
|
}
|
|
}
|
|
exports["default"] = Condition;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/context/services/conditions-config.js":
|
|
/*!***************************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/context/services/conditions-config.js ***!
|
|
\***************************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
|
|
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = exports.ConditionsConfig = void 0;
|
|
var _commands = __webpack_require__(/*! ../../data/commands */ "../core/app/modules/site-editor/assets/js/data/commands/index.js");
|
|
class ConditionsConfig {
|
|
static instance;
|
|
config = null;
|
|
constructor(config) {
|
|
this.config = config;
|
|
}
|
|
|
|
/**
|
|
* @return {Promise<ConditionsConfig>} Conditions config
|
|
*/
|
|
static create() {
|
|
if (ConditionsConfig.instance) {
|
|
return Promise.resolve(ConditionsConfig.instance);
|
|
}
|
|
return $e.data.get(_commands.ConditionsConfig.signature, {}, {
|
|
refresh: true
|
|
}).then(response => {
|
|
ConditionsConfig.instance = new ConditionsConfig(response.data);
|
|
return ConditionsConfig.instance;
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Get main options for condition name.
|
|
*
|
|
* @return {Array} Condition options
|
|
*/
|
|
getOptions() {
|
|
return this.getSubOptions('general', true).map(_ref => {
|
|
let {
|
|
label,
|
|
value
|
|
} = _ref;
|
|
return {
|
|
label,
|
|
value
|
|
};
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Get the sub options for the select.
|
|
*
|
|
* @param {string} itemName
|
|
* @param {boolean} isSubItem
|
|
* @return {Array} Sub options
|
|
*/
|
|
getSubOptions(itemName) {
|
|
let isSubItem = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;
|
|
const config = this.config[itemName];
|
|
if (!config) {
|
|
return [];
|
|
}
|
|
return [{
|
|
label: config.all_label,
|
|
value: isSubItem ? itemName : ''
|
|
}, ...config.sub_conditions.map(subName => {
|
|
const subConfig = this.config[subName];
|
|
return {
|
|
label: subConfig.label,
|
|
value: subName,
|
|
children: subConfig.sub_conditions.length ? this.getSubOptions(subName, true) : null
|
|
};
|
|
})];
|
|
}
|
|
|
|
/**
|
|
* Get the autocomplete property from the conditions config
|
|
*
|
|
* @param {string} sub
|
|
* @return {{}|any} Conditions autocomplete
|
|
*/
|
|
getSubIdAutocomplete(sub) {
|
|
const config = this.config[sub];
|
|
if (!config || !('object' === typeof config.controls)) {
|
|
return {};
|
|
}
|
|
const controls = Object.values(config.controls);
|
|
if (!controls?.[0]?.autocomplete) {
|
|
return {};
|
|
}
|
|
return controls[0].autocomplete;
|
|
}
|
|
|
|
/**
|
|
* Calculate instances from the conditions.
|
|
*
|
|
* @param {Array} conditions
|
|
* @return {Object} Conditions Instances
|
|
*/
|
|
calculateInstances(conditions) {
|
|
let instances = conditions.reduce((current, condition) => {
|
|
if ('exclude' === condition.type) {
|
|
return current;
|
|
}
|
|
const key = condition.sub || condition.name,
|
|
config = this.config[key];
|
|
if (!config) {
|
|
return current;
|
|
}
|
|
const instanceLabel = condition.subId ? `${config.label} #${condition.subId}` : config.all_label;
|
|
return {
|
|
...current,
|
|
[key]: instanceLabel
|
|
};
|
|
}, {});
|
|
if (0 === Object.keys(instances).length) {
|
|
instances = [__('No instances', 'elementor-pro')];
|
|
}
|
|
return instances;
|
|
}
|
|
}
|
|
exports.ConditionsConfig = ConditionsConfig;
|
|
var _default = exports["default"] = ConditionsConfig;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/context/templates.js":
|
|
/*!**********************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/context/templates.js ***!
|
|
\**********************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = exports.TemplatesProvider = exports.Context = void 0;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _baseContext = _interopRequireDefault(__webpack_require__(/*! ./base-context */ "../core/app/modules/site-editor/assets/js/context/base-context.js"));
|
|
var _commands = __webpack_require__(/*! ../data/commands */ "../core/app/modules/site-editor/assets/js/data/commands/index.js");
|
|
var _component = _interopRequireDefault(__webpack_require__(/*! ../data/component */ "../core/app/modules/site-editor/assets/js/data/component.js"));
|
|
const Context = exports.Context = _react.default.createContext();
|
|
class TemplatesProvider extends _baseContext.default {
|
|
static propTypes = (() => ({
|
|
children: PropTypes.object.isRequired
|
|
}))();
|
|
static actions = {
|
|
FETCH: 'fetch',
|
|
DELETE: 'delete',
|
|
UPDATE: 'update',
|
|
IMPORT: 'import'
|
|
};
|
|
constructor(props) {
|
|
super(props);
|
|
this.state = {
|
|
...this.state,
|
|
action: {
|
|
...this.state.action,
|
|
current: TemplatesProvider.actions.FETCH,
|
|
loading: true
|
|
},
|
|
templates: {},
|
|
updateTemplateItemState: this.updateTemplateItemState.bind(this),
|
|
findTemplateItemInState: this.findTemplateItemInState.bind(this),
|
|
fetchTemplates: this.fetchTemplates.bind(this),
|
|
deleteTemplate: this.deleteTemplate.bind(this),
|
|
updateTemplate: this.updateTemplate.bind(this),
|
|
importTemplates: this.importTemplates.bind(this)
|
|
};
|
|
}
|
|
componentDidMount() {
|
|
this.fetchTemplates();
|
|
}
|
|
importTemplates(_ref) {
|
|
let {
|
|
fileName,
|
|
fileData
|
|
} = _ref;
|
|
return this.executeAction(TemplatesProvider.actions.IMPORT, () => $e.data.create(_commands.Templates.signature, {
|
|
fileName,
|
|
fileData
|
|
})).then(response => {
|
|
this.updateTemplatesState(prev => ({
|
|
...prev,
|
|
...Object.values(response.data).reduce((current, template) => {
|
|
if (!template.supportsSiteEditor) {
|
|
return current;
|
|
}
|
|
return {
|
|
...current,
|
|
[template.id]: template
|
|
};
|
|
}, {})
|
|
}));
|
|
return response;
|
|
});
|
|
}
|
|
deleteTemplate(id) {
|
|
return this.executeAction(TemplatesProvider.actions.DELETE, () => $e.data.delete(_commands.Templates.signature, {
|
|
id
|
|
})).then(() => {
|
|
this.updateTemplatesState(prev => {
|
|
const newTemplates = {
|
|
...prev
|
|
};
|
|
delete newTemplates[id];
|
|
return newTemplates;
|
|
});
|
|
});
|
|
}
|
|
updateTemplate(id, args) {
|
|
return this.executeAction(TemplatesProvider.actions.UPDATE, () => $e.data.update(_commands.Templates.signature, args, {
|
|
id
|
|
})).then(response => {
|
|
this.updateTemplateItemState(id, response.data);
|
|
});
|
|
}
|
|
fetchTemplates() {
|
|
return this.executeAction(TemplatesProvider.actions.FETCH, () => $e.data.get(_commands.Templates.signature, {}, {
|
|
refresh: true
|
|
})).then(response => {
|
|
this.updateTemplatesState(() => Object.values(response.data).reduce((current, template) => ({
|
|
...current,
|
|
[template.id]: template
|
|
}), {}), false);
|
|
});
|
|
}
|
|
updateTemplateItemState(id, args) {
|
|
return this.updateTemplatesState(prev => {
|
|
const template = {
|
|
...prev[id],
|
|
...args
|
|
};
|
|
return {
|
|
...prev,
|
|
[id]: template
|
|
};
|
|
});
|
|
}
|
|
updateTemplatesState(callback) {
|
|
let clearCache = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : true;
|
|
if (clearCache) {
|
|
$e.data.deleteCache($e.components.get(_component.default.namespace), _commands.Templates.signature);
|
|
}
|
|
return this.setState(prev => {
|
|
return {
|
|
templates: callback(prev.templates)
|
|
};
|
|
});
|
|
}
|
|
findTemplateItemInState(id) {
|
|
return this.state.templates[id];
|
|
}
|
|
render() {
|
|
if (this.state.action.current === TemplatesProvider.actions.FETCH) {
|
|
if (this.state.action.error) {
|
|
return /*#__PURE__*/_react.default.createElement("h3", null, __('Error:', 'elementor-pro'), " ", this.state.action.error);
|
|
}
|
|
if (this.state.action.loading) {
|
|
return /*#__PURE__*/_react.default.createElement("h3", null, __('Loading', 'elementor-pro'), "...");
|
|
}
|
|
}
|
|
return /*#__PURE__*/_react.default.createElement(Context.Provider, {
|
|
value: this.state
|
|
}, this.props.children);
|
|
}
|
|
}
|
|
exports.TemplatesProvider = TemplatesProvider;
|
|
var _default = exports["default"] = TemplatesProvider;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/data/commands/conditions-config.js":
|
|
/*!************************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/data/commands/conditions-config.js ***!
|
|
\************************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = exports.ConditionsConfig = void 0;
|
|
class ConditionsConfig extends $e.modules.CommandData {
|
|
static signature = 'site-editor/conditions-config';
|
|
static getEndpointFormat() {
|
|
return 'site-editor/conditions-config/{id}';
|
|
}
|
|
}
|
|
exports.ConditionsConfig = ConditionsConfig;
|
|
var _default = exports["default"] = ConditionsConfig;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/data/commands/index.js":
|
|
/*!************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/data/commands/index.js ***!
|
|
\************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
Object.defineProperty(exports, "ConditionsConfig", ({
|
|
enumerable: true,
|
|
get: function () {
|
|
return _conditionsConfig.ConditionsConfig;
|
|
}
|
|
}));
|
|
Object.defineProperty(exports, "Templates", ({
|
|
enumerable: true,
|
|
get: function () {
|
|
return _templates.Templates;
|
|
}
|
|
}));
|
|
Object.defineProperty(exports, "TemplatesConditions", ({
|
|
enumerable: true,
|
|
get: function () {
|
|
return _templatesConditions.TemplatesConditions;
|
|
}
|
|
}));
|
|
Object.defineProperty(exports, "TemplatesConditionsConflicts", ({
|
|
enumerable: true,
|
|
get: function () {
|
|
return _templatesConditionsConflicts.TemplatesConditionsConflicts;
|
|
}
|
|
}));
|
|
var _templates = __webpack_require__(/*! ./templates */ "../core/app/modules/site-editor/assets/js/data/commands/templates.js");
|
|
var _conditionsConfig = __webpack_require__(/*! ./conditions-config */ "../core/app/modules/site-editor/assets/js/data/commands/conditions-config.js");
|
|
var _templatesConditions = __webpack_require__(/*! ./templates-conditions */ "../core/app/modules/site-editor/assets/js/data/commands/templates-conditions.js");
|
|
var _templatesConditionsConflicts = __webpack_require__(/*! ./templates-conditions-conflicts */ "../core/app/modules/site-editor/assets/js/data/commands/templates-conditions-conflicts.js");
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/data/commands/templates-conditions-conflicts.js":
|
|
/*!*************************************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/data/commands/templates-conditions-conflicts.js ***!
|
|
\*************************************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = exports.TemplatesConditionsConflicts = void 0;
|
|
class TemplatesConditionsConflicts extends $e.modules.CommandData {
|
|
static signature = 'site-editor/templates-conditions-conflicts';
|
|
static getEndpointFormat() {
|
|
return `${TemplatesConditionsConflicts.signature}/{id}`;
|
|
}
|
|
}
|
|
exports.TemplatesConditionsConflicts = TemplatesConditionsConflicts;
|
|
var _default = exports["default"] = TemplatesConditionsConflicts;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/data/commands/templates-conditions.js":
|
|
/*!***************************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/data/commands/templates-conditions.js ***!
|
|
\***************************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = exports.TemplatesConditions = void 0;
|
|
class TemplatesConditions extends $e.modules.CommandData {
|
|
static signature = 'site-editor/templates-conditions';
|
|
static getEndpointFormat() {
|
|
return 'site-editor/templates-conditions/{id}';
|
|
}
|
|
}
|
|
exports.TemplatesConditions = TemplatesConditions;
|
|
var _default = exports["default"] = TemplatesConditions;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/data/commands/templates.js":
|
|
/*!****************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/data/commands/templates.js ***!
|
|
\****************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = exports.Templates = void 0;
|
|
class Templates extends $e.modules.CommandData {
|
|
static signature = 'site-editor/templates';
|
|
static getEndpointFormat() {
|
|
return 'site-editor/templates/{id}';
|
|
}
|
|
}
|
|
exports.Templates = Templates;
|
|
var _default = exports["default"] = Templates;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/data/component.js":
|
|
/*!*******************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/data/component.js ***!
|
|
\*******************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = void 0;
|
|
var dataCommands = _interopRequireWildcard(__webpack_require__(/*! ./commands */ "../core/app/modules/site-editor/assets/js/data/commands/index.js"));
|
|
function _getRequireWildcardCache(e) { if ("function" != typeof WeakMap) return null; var r = new WeakMap(), t = new WeakMap(); return (_getRequireWildcardCache = function (e) { return e ? t : r; })(e); }
|
|
function _interopRequireWildcard(e, r) { if (!r && e && e.__esModule) return e; if (null === e || "object" != typeof e && "function" != typeof e) return { default: e }; var t = _getRequireWildcardCache(r); if (t && t.has(e)) return t.get(e); var n = { __proto__: null }, a = Object.defineProperty && Object.getOwnPropertyDescriptor; for (var u in e) if ("default" !== u && {}.hasOwnProperty.call(e, u)) { var i = a ? Object.getOwnPropertyDescriptor(e, u) : null; i && (i.get || i.set) ? Object.defineProperty(n, u, i) : n[u] = e[u]; } return n.default = e, t && t.set(e, n), n; }
|
|
class Component extends $e.modules.ComponentBase {
|
|
static namespace = 'site-editor';
|
|
getNamespace() {
|
|
return this.constructor.namespace;
|
|
}
|
|
defaultData() {
|
|
return this.importCommands(dataCommands);
|
|
}
|
|
}
|
|
exports["default"] = Component;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/hooks/use-templates-screenshot.js":
|
|
/*!***********************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/hooks/use-templates-screenshot.js ***!
|
|
\***********************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var React = __webpack_require__(/*! react */ "react");
|
|
|
|
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = useTemplatesScreenshot;
|
|
var _templates = __webpack_require__(/*! ../context/templates */ "../core/app/modules/site-editor/assets/js/context/templates.js");
|
|
var _useScreenshot = _interopRequireWildcard(__webpack_require__(/*! modules/screenshots/app/assets/js/hooks/use-screenshot */ "../modules/screenshots/app/assets/js/hooks/use-screenshot.js"));
|
|
function _getRequireWildcardCache(e) { if ("function" != typeof WeakMap) return null; var r = new WeakMap(), t = new WeakMap(); return (_getRequireWildcardCache = function (e) { return e ? t : r; })(e); }
|
|
function _interopRequireWildcard(e, r) { if (!r && e && e.__esModule) return e; if (null === e || "object" != typeof e && "function" != typeof e) return { default: e }; var t = _getRequireWildcardCache(r); if (t && t.has(e)) return t.get(e); var n = { __proto__: null }, a = Object.defineProperty && Object.getOwnPropertyDescriptor; for (var u in e) if ("default" !== u && {}.hasOwnProperty.call(e, u)) { var i = a ? Object.getOwnPropertyDescriptor(e, u) : null; i && (i.get || i.set) ? Object.defineProperty(n, u, i) : n[u] = e[u]; } return n.default = e, t && t.set(e, n), n; }
|
|
/**
|
|
* Wrapper function that was made to take screenshots specific for template.
|
|
* it will capture a screenshot and update the templates context with the new screenshot.
|
|
*
|
|
* @param {any} templateType
|
|
*/
|
|
function useTemplatesScreenshot() {
|
|
let templateType = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : null;
|
|
const {
|
|
updateTemplateItemState,
|
|
templates
|
|
} = React.useContext(_templates.Context);
|
|
const templatesForScreenshot = Object.values(templates).filter(template => shouldScreenshotTemplate(template, templateType));
|
|
|
|
// Start to capture screenshots.
|
|
const screenshot = (0, _useScreenshot.default)(templatesForScreenshot);
|
|
|
|
// Update the thumbnail url when screenshot created.
|
|
React.useEffect(() => {
|
|
screenshot.posts.filter(post => post.status === _useScreenshot.SCREENSHOT_STATUS_SUCCEED).forEach(post => updateTemplateItemState(post.id, {
|
|
thumbnail: post.imageUrl
|
|
}));
|
|
}, [screenshot.succeed]);
|
|
|
|
// Update the screenshot url that was failed.
|
|
// When the user will hit the route on the second time it will avoid trying to take another screenshot.
|
|
React.useEffect(() => {
|
|
screenshot.posts.filter(post => post.status === _useScreenshot.SCREENSHOT_STATUS_FAILED).forEach(post => updateTemplateItemState(post.id, {
|
|
screenshot_url: null
|
|
}));
|
|
}, [screenshot.failed]);
|
|
return screenshot;
|
|
}
|
|
|
|
/**
|
|
* Filter handler.
|
|
* will remove all the drafts and private and also will filter by template type if exists.
|
|
*
|
|
* @param {any} template
|
|
* @param {any} templateType
|
|
* @return {boolean} should screenshot template
|
|
*/
|
|
function shouldScreenshotTemplate(template) {
|
|
let templateType = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : null;
|
|
if (templateType) {
|
|
return false;
|
|
}
|
|
return 'publish' === template.status && !template.thumbnail && template.screenshot_url;
|
|
}
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/molecules/back-button.js":
|
|
/*!**************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/molecules/back-button.js ***!
|
|
\**************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = BackButton;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
__webpack_require__(/*! ./back-button.scss */ "../core/app/modules/site-editor/assets/js/molecules/back-button.scss");
|
|
function BackButton(props) {
|
|
return /*#__PURE__*/_react.default.createElement("div", {
|
|
className: "back-button-wrapper"
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Button, {
|
|
className: "eps-back-button",
|
|
text: __('Back', 'elementor-pro'),
|
|
icon: "eicon-chevron-left",
|
|
onClick: props.onClick
|
|
}));
|
|
}
|
|
BackButton.propTypes = {
|
|
onClick: PropTypes.func
|
|
};
|
|
BackButton.defaultProps = {
|
|
onClick: () => history.back()
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/molecules/site-template-body.js":
|
|
/*!*********************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/molecules/site-template-body.js ***!
|
|
\*********************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports.SiteTemplateBody = void 0;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
var _siteTemplateThumbnail = _interopRequireDefault(__webpack_require__(/*! ./site-template-thumbnail */ "../core/app/modules/site-editor/assets/js/molecules/site-template-thumbnail.js"));
|
|
var _previewIframe = _interopRequireDefault(__webpack_require__(/*! ../atoms/preview-iframe */ "../core/app/modules/site-editor/assets/js/atoms/preview-iframe.js"));
|
|
const SiteTemplateBody = props => {
|
|
return /*#__PURE__*/_react.default.createElement(_appUi.CardBody, null, props.extended ? /*#__PURE__*/_react.default.createElement(_previewIframe.default, {
|
|
src: props.previewUrl,
|
|
templateType: props.type
|
|
}) : /*#__PURE__*/_react.default.createElement(_siteTemplateThumbnail.default, {
|
|
id: props.id,
|
|
title: props.title,
|
|
type: props.type,
|
|
thumbnail: props.thumbnail,
|
|
placeholder: props.placeholderUrl
|
|
}));
|
|
};
|
|
exports.SiteTemplateBody = SiteTemplateBody;
|
|
SiteTemplateBody.propTypes = {
|
|
extended: PropTypes.bool,
|
|
id: PropTypes.number,
|
|
title: PropTypes.string,
|
|
thumbnail: PropTypes.string,
|
|
placeholderUrl: PropTypes.string,
|
|
type: PropTypes.string,
|
|
previewUrl: PropTypes.string
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/molecules/site-template-footer.js":
|
|
/*!***********************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/molecules/site-template-footer.js ***!
|
|
\***********************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports.SiteTemplateFooter = void 0;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
const SiteTemplateFooter = props => {
|
|
const instances = Object.values(props.instances).join(', ');
|
|
return /*#__PURE__*/_react.default.createElement(_appUi.CardFooter, null, /*#__PURE__*/_react.default.createElement("div", {
|
|
className: "e-site-template__instances"
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Icon, {
|
|
className: "eicon-flow"
|
|
}), /*#__PURE__*/_react.default.createElement(_appUi.Text, {
|
|
tag: "span",
|
|
variant: "sm"
|
|
}, /*#__PURE__*/_react.default.createElement("b", null, __('Instances', 'elementor-pro'), ":")), /*#__PURE__*/_react.default.createElement(_appUi.Text, {
|
|
className: "e-site-template__instances-list",
|
|
tag: "span",
|
|
variant: "xxs"
|
|
}, " ", instances), /*#__PURE__*/_react.default.createElement(_appUi.Button, {
|
|
text: __('Edit Conditions', 'elementor-pro'),
|
|
className: "e-site-template__edit-conditions",
|
|
url: `/site-editor/conditions/${props.id}`
|
|
})));
|
|
};
|
|
exports.SiteTemplateFooter = SiteTemplateFooter;
|
|
SiteTemplateFooter.propTypes = {
|
|
id: PropTypes.number.isRequired,
|
|
instances: PropTypes.any
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/molecules/site-template-header.js":
|
|
/*!***********************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/molecules/site-template-header.js ***!
|
|
\***********************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports.SiteTemplateHeader = void 0;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
var _dialogsAndButtons = _interopRequireDefault(__webpack_require__(/*! ../part-actions/dialogs-and-buttons */ "../core/app/modules/site-editor/assets/js/part-actions/dialogs-and-buttons.js"));
|
|
var _indicatorBullet = __webpack_require__(/*! ../atoms/indicator-bullet */ "../core/app/modules/site-editor/assets/js/atoms/indicator-bullet.js");
|
|
const SiteTemplateHeader = props => {
|
|
const status = props.status && 'publish' !== props.status ? ` (${props.status})` : '',
|
|
title = props.title + status,
|
|
ActionButtons = () => /*#__PURE__*/_react.default.createElement(_react.default.Fragment, null, /*#__PURE__*/_react.default.createElement(_appUi.Button, {
|
|
text: __('Edit', 'elementor-pro'),
|
|
icon: "eicon-edit",
|
|
className: "e-site-template__edit-btn",
|
|
size: "sm",
|
|
url: props.editURL
|
|
}), /*#__PURE__*/_react.default.createElement(_dialogsAndButtons.default, props)),
|
|
MetaDataIcon = innerProps => /*#__PURE__*/_react.default.createElement(_appUi.Text, {
|
|
tag: "span",
|
|
className: "e-site-template__meta-data"
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Icon, {
|
|
className: innerProps.icon
|
|
}), innerProps.content),
|
|
MetaData = () => /*#__PURE__*/_react.default.createElement(_react.default.Fragment, null, /*#__PURE__*/_react.default.createElement(MetaDataIcon, {
|
|
icon: "eicon-user-circle-o",
|
|
content: props.author
|
|
}), /*#__PURE__*/_react.default.createElement(MetaDataIcon, {
|
|
icon: "eicon-clock-o",
|
|
content: props.modifiedDate
|
|
})),
|
|
IndicatorDot = props.showInstances ? /*#__PURE__*/_react.default.createElement(_indicatorBullet.Indicator, {
|
|
active: props.isActive
|
|
}) : '';
|
|
return /*#__PURE__*/_react.default.createElement(_appUi.CardHeader, null, IndicatorDot, /*#__PURE__*/_react.default.createElement(_appUi.Heading, {
|
|
tag: "h1",
|
|
title: title,
|
|
variant: "text-sm",
|
|
className: "eps-card__headline"
|
|
}, title), props.extended && /*#__PURE__*/_react.default.createElement(MetaData, null), props.extended && /*#__PURE__*/_react.default.createElement(ActionButtons, null));
|
|
};
|
|
exports.SiteTemplateHeader = SiteTemplateHeader;
|
|
SiteTemplateHeader.propTypes = {
|
|
isActive: PropTypes.bool,
|
|
author: PropTypes.string,
|
|
editURL: PropTypes.string,
|
|
extended: PropTypes.bool,
|
|
modifiedDate: PropTypes.string,
|
|
status: PropTypes.string,
|
|
title: PropTypes.string,
|
|
showInstances: PropTypes.bool
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/molecules/site-template-thumbnail.js":
|
|
/*!**************************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/molecules/site-template-thumbnail.js ***!
|
|
\**************************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = SiteTemplateThumbnail;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
function SiteTemplateThumbnail(props) {
|
|
return /*#__PURE__*/_react.default.createElement(_appUi.CardImage, {
|
|
alt: props.title,
|
|
src: props.thumbnail || props.placeholder,
|
|
className: !props.thumbnail ? 'e-site-template__placeholder' : ''
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.CardOverlay, {
|
|
className: "e-site-template__overlay-preview"
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Button, {
|
|
className: "e-site-template__overlay-preview-button",
|
|
text: __('Preview', 'elementor-pro'),
|
|
icon: "eicon-preview-medium",
|
|
url: `/site-editor/templates/${props.type}/${props.id}`
|
|
})));
|
|
}
|
|
SiteTemplateThumbnail.propTypes = {
|
|
id: PropTypes.number,
|
|
title: PropTypes.string,
|
|
type: PropTypes.string,
|
|
thumbnail: PropTypes.string,
|
|
placeholder: PropTypes.string
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/molecules/site-template.js":
|
|
/*!****************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/molecules/site-template.js ***!
|
|
\****************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = SiteTemplate;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
__webpack_require__(/*! core-js/modules/es.array.push.js */ "../node_modules/core-js/modules/es.array.push.js");
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
var _siteTemplateHeader = __webpack_require__(/*! ./site-template-header */ "../core/app/modules/site-editor/assets/js/molecules/site-template-header.js");
|
|
var _siteTemplateBody = __webpack_require__(/*! ./site-template-body */ "../core/app/modules/site-editor/assets/js/molecules/site-template-body.js");
|
|
var _siteTemplateFooter = __webpack_require__(/*! ./site-template-footer */ "../core/app/modules/site-editor/assets/js/molecules/site-template-footer.js");
|
|
__webpack_require__(/*! ./site-template.scss */ "../core/app/modules/site-editor/assets/js/molecules/site-template.scss");
|
|
function SiteTemplate(props) {
|
|
const baseClassName = 'e-site-template',
|
|
classes = [baseClassName],
|
|
ref = _react.default.useRef(null);
|
|
_react.default.useEffect(() => {
|
|
if (!props.isSelected) {
|
|
return;
|
|
}
|
|
ref.current.scrollIntoView({
|
|
behavior: 'smooth',
|
|
block: 'start'
|
|
});
|
|
}, [props.isSelected]);
|
|
if (props.extended) {
|
|
classes.push(`${baseClassName}--extended`);
|
|
}
|
|
if (props.aspectRatio) {
|
|
classes.push(`${baseClassName}--${props.aspectRatio}`);
|
|
}
|
|
const CardFooter = props.extended && props.showInstances ? /*#__PURE__*/_react.default.createElement(_siteTemplateFooter.SiteTemplateFooter, props) : '';
|
|
return /*#__PURE__*/_react.default.createElement(_appUi.Card, {
|
|
className: classes.join(' '),
|
|
ref: ref
|
|
}, /*#__PURE__*/_react.default.createElement(_siteTemplateHeader.SiteTemplateHeader, props), /*#__PURE__*/_react.default.createElement(_siteTemplateBody.SiteTemplateBody, props), CardFooter);
|
|
}
|
|
SiteTemplate.propTypes = {
|
|
aspectRatio: PropTypes.string,
|
|
className: PropTypes.string,
|
|
extended: PropTypes.bool,
|
|
id: PropTypes.number.isRequired,
|
|
isActive: PropTypes.bool.isRequired,
|
|
status: PropTypes.string,
|
|
thumbnail: PropTypes.string.isRequired,
|
|
title: PropTypes.string.isRequired,
|
|
isSelected: PropTypes.bool,
|
|
type: PropTypes.string.isRequired,
|
|
showInstances: PropTypes.bool
|
|
};
|
|
SiteTemplate.defaultProps = {
|
|
isSelected: false
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/organisms/site-templates.js":
|
|
/*!*****************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/organisms/site-templates.js ***!
|
|
\*****************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = SiteTemplates;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _extends2 = _interopRequireDefault(__webpack_require__(/*! @babel/runtime/helpers/extends */ "../node_modules/@babel/runtime/helpers/extends.js"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
var _siteTemplate = _interopRequireDefault(__webpack_require__(/*! ../molecules/site-template */ "../core/app/modules/site-editor/assets/js/molecules/site-template.js"));
|
|
var _dialogsAndButtons = __webpack_require__(/*! ../part-actions/dialogs-and-buttons */ "../core/app/modules/site-editor/assets/js/part-actions/dialogs-and-buttons.js");
|
|
var _templates = __webpack_require__(/*! ../context/templates */ "../core/app/modules/site-editor/assets/js/context/templates.js");
|
|
var _useTemplatesScreenshot = _interopRequireDefault(__webpack_require__(/*! ../hooks/use-templates-screenshot */ "../core/app/modules/site-editor/assets/js/hooks/use-templates-screenshot.js"));
|
|
function SiteTemplates(props) {
|
|
const {
|
|
templates: contextTemplates,
|
|
action,
|
|
resetActionState
|
|
} = _react.default.useContext(_templates.Context);
|
|
let gridColumns, templates;
|
|
|
|
// Make the templates object a memorize value, will re run again only if
|
|
// templates has been changed, also sort the templates by `isActive`.
|
|
templates = _react.default.useMemo(() => {
|
|
return Object.values(contextTemplates).sort((a, b) => {
|
|
// This sort make sure to show first the active templates, second the
|
|
// inactive templates that are not draft, and then the drafts,
|
|
// in each category it sorts it inside by date.
|
|
|
|
if (!b.isActive && !a.isActive) {
|
|
if ('draft' === b.status && 'draft' === a.status || 'draft' !== b.status && 'draft' !== a.status) {
|
|
return b.date < a.date ? 1 : -1;
|
|
}
|
|
return 'draft' === a.status ? 1 : -1;
|
|
}
|
|
if (b.isActive && a.isActive) {
|
|
return b.date < a.date ? 1 : -1;
|
|
}
|
|
return b.isActive ? 1 : -1;
|
|
});
|
|
}, [contextTemplates]);
|
|
|
|
// Start to capture screenshots.
|
|
(0, _useTemplatesScreenshot.default)(props.type);
|
|
const siteTemplateConfig = {};
|
|
if (props.type) {
|
|
templates = templates.filter(item => item.type === props.type);
|
|
siteTemplateConfig.extended = true;
|
|
siteTemplateConfig.type = props.type;
|
|
switch (props.type) {
|
|
case 'header':
|
|
case 'footer':
|
|
gridColumns = 1;
|
|
siteTemplateConfig.aspectRatio = 'wide';
|
|
break;
|
|
default:
|
|
gridColumns = 2;
|
|
}
|
|
}
|
|
if (!templates || !templates.length) {
|
|
return /*#__PURE__*/_react.default.createElement("h3", null, __('No Templates found. Want to create one?', 'elementor-pro'), "...");
|
|
}
|
|
return /*#__PURE__*/_react.default.createElement("section", {
|
|
className: "e-site-editor__site-templates"
|
|
}, /*#__PURE__*/_react.default.createElement(_dialogsAndButtons.PartActionsDialogs, null), action.error && /*#__PURE__*/_react.default.createElement(_appUi.Dialog, {
|
|
text: action.error,
|
|
dismissButtonText: __('Go Back', 'elementor-pro'),
|
|
dismissButtonOnClick: resetActionState,
|
|
approveButtonText: __('Learn More', 'elementor-pro'),
|
|
approveButtonColor: "link",
|
|
approveButtonUrl: "https://go.elementor.com/app-theme-builder-template-load-issue",
|
|
approveButtonTarget: "_target"
|
|
}), /*#__PURE__*/_react.default.createElement(_appUi.CssGrid, {
|
|
columns: gridColumns,
|
|
spacing: 24,
|
|
colMinWidth: 200
|
|
}, templates.map(item => /*#__PURE__*/_react.default.createElement(_siteTemplate.default, (0, _extends2.default)({
|
|
key: item.id
|
|
}, item, siteTemplateConfig, {
|
|
isSelected: parseInt(props.id) === item.id
|
|
})))));
|
|
}
|
|
SiteTemplates.propTypes = {
|
|
type: PropTypes.string,
|
|
id: PropTypes.string
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/pages/add-new.js":
|
|
/*!******************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/pages/add-new.js ***!
|
|
\******************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = AddNew;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
var _siteEditor = __webpack_require__(/*! @elementor/site-editor */ "@elementor/site-editor");
|
|
__webpack_require__(/*! ./add-new.scss */ "../core/app/modules/site-editor/assets/js/pages/add-new.scss");
|
|
var _templates = __webpack_require__(/*! ../context/templates */ "../core/app/modules/site-editor/assets/js/context/templates.js");
|
|
var _backButton = _interopRequireDefault(__webpack_require__(/*! ../molecules/back-button */ "../core/app/modules/site-editor/assets/js/molecules/back-button.js"));
|
|
var _useFeatureLock = _interopRequireDefault(__webpack_require__(/*! elementor-pro-app/hooks/use-feature-lock */ "../core/app/assets/js/hooks/use-feature-lock.js"));
|
|
function AddNew() {
|
|
const {
|
|
templates
|
|
} = _react.default.useContext(_templates.Context),
|
|
hasTemplates = 1 <= Object.keys(templates).length;
|
|
const {
|
|
isLocked,
|
|
ConnectButton
|
|
} = (0, _useFeatureLock.default)('site-editor');
|
|
|
|
/**
|
|
* An hover element for each site part.
|
|
*
|
|
* @param {any} props
|
|
*/
|
|
const HoverElement = props => {
|
|
if (isLocked) {
|
|
return /*#__PURE__*/_react.default.createElement(_appUi.CardOverlay, {
|
|
className: "e-site-editor__promotion-overlay"
|
|
}, /*#__PURE__*/_react.default.createElement("div", {
|
|
className: "e-site-editor__promotion-overlay__link"
|
|
}, /*#__PURE__*/_react.default.createElement("i", {
|
|
className: "e-site-editor__promotion-overlay__icon eicon-lock"
|
|
})));
|
|
}
|
|
return /*#__PURE__*/_react.default.createElement("a", {
|
|
href: props.urls.create,
|
|
className: "eps-card__image-overlay eps-add-new__overlay"
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.AddNewButton, {
|
|
hideText: true
|
|
}));
|
|
};
|
|
HoverElement.propTypes = {
|
|
urls: PropTypes.object.isRequired
|
|
};
|
|
return /*#__PURE__*/_react.default.createElement("section", {
|
|
className: "e-site-editor__add-new"
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Grid, {
|
|
container: true,
|
|
direction: "column",
|
|
className: "e-site-editor__header"
|
|
}, hasTemplates && /*#__PURE__*/_react.default.createElement(_appUi.Grid, {
|
|
item: true
|
|
}, /*#__PURE__*/_react.default.createElement(_backButton.default, null)), /*#__PURE__*/_react.default.createElement(_appUi.Grid, {
|
|
item: true,
|
|
container: true,
|
|
justify: "space-between",
|
|
alignItems: "start"
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Heading, {
|
|
variant: "h1"
|
|
}, __('Start customizing every part of your site', 'elementor-pro')), isLocked && /*#__PURE__*/_react.default.createElement(ConnectButton, null))), /*#__PURE__*/_react.default.createElement(_siteEditor.SiteParts, {
|
|
hoverElement: HoverElement
|
|
}));
|
|
}
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/pages/conditions/condition-button-portal.js":
|
|
/*!*********************************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/pages/conditions/condition-button-portal.js ***!
|
|
\*********************************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = void 0;
|
|
var _reactDom = __webpack_require__(/*! react-dom */ "react-dom");
|
|
var _react = __webpack_require__(/*! react */ "react");
|
|
var PropTypes = _interopRequireWildcard(__webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js"));
|
|
function _getRequireWildcardCache(e) { if ("function" != typeof WeakMap) return null; var r = new WeakMap(), t = new WeakMap(); return (_getRequireWildcardCache = function (e) { return e ? t : r; })(e); }
|
|
function _interopRequireWildcard(e, r) { if (!r && e && e.__esModule) return e; if (null === e || "object" != typeof e && "function" != typeof e) return { default: e }; var t = _getRequireWildcardCache(r); if (t && t.has(e)) return t.get(e); var n = { __proto__: null }, a = Object.defineProperty && Object.getOwnPropertyDescriptor; for (var u in e) if ("default" !== u && {}.hasOwnProperty.call(e, u)) { var i = a ? Object.getOwnPropertyDescriptor(e, u) : null; i && (i.get || i.set) ? Object.defineProperty(n, u, i) : n[u] = e[u]; } return n.default = e, t && t.set(e, n), n; }
|
|
const ConditionButtonPortal = props => {
|
|
const [shouldCreatePortal, setShouldCreatePortal] = (0, _react.useState)(false),
|
|
portalRoot = document.getElementById('portal-root');
|
|
(0, _react.useEffect)(() => {
|
|
setShouldCreatePortal(!!portalRoot);
|
|
}, [portalRoot]);
|
|
return shouldCreatePortal ? (0, _reactDom.createPortal)(props.children, portalRoot) : null;
|
|
};
|
|
ConditionButtonPortal.propTypes = {
|
|
children: PropTypes.oneOfType([PropTypes.node, PropTypes.string])
|
|
};
|
|
var _default = exports["default"] = ConditionButtonPortal;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/pages/conditions/condition-conflicts.js":
|
|
/*!*****************************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/pages/conditions/condition-conflicts.js ***!
|
|
\*****************************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var sprintf = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["sprintf"];
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = ConditionConflicts;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
function ConditionConflicts(props) {
|
|
if (!props.conflicts.length) {
|
|
return '';
|
|
}
|
|
const conflictLinks = props.conflicts.map(conflict => {
|
|
return /*#__PURE__*/_react.default.createElement(_appUi.Button, {
|
|
key: conflict.template_id,
|
|
target: "_blank",
|
|
url: conflict.edit_url,
|
|
text: conflict.template_title
|
|
});
|
|
});
|
|
return /*#__PURE__*/_react.default.createElement(_appUi.Text, {
|
|
className: "e-site-editor-conditions__conflict",
|
|
variant: "sm"
|
|
}, sprintf(/* Translators: %s: a list of conflicted templates */
|
|
__('We noticed that you already applied %s with the same condition.', 'elementor-pro'), conflictLinks), /*#__PURE__*/_react.default.createElement("br", null), __("To continue, set different conditions for each so they don't conflict.", 'elementor-pro'));
|
|
}
|
|
ConditionConflicts.propTypes = {
|
|
conflicts: PropTypes.array.isRequired
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/pages/conditions/condition-name.js":
|
|
/*!************************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/pages/conditions/condition-name.js ***!
|
|
\************************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = ConditionName;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
function ConditionName(props) {
|
|
// Hide for template types that has another default, like single & archive.
|
|
if ('general' !== props.default) {
|
|
return '';
|
|
}
|
|
const onChange = e => props.updateConditions(props.id, {
|
|
name: e.target.value,
|
|
sub: '',
|
|
subId: ''
|
|
});
|
|
return /*#__PURE__*/_react.default.createElement("div", {
|
|
className: "e-site-editor-conditions__input-wrapper"
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Select, {
|
|
options: props.options,
|
|
value: props.name,
|
|
onChange: onChange
|
|
}));
|
|
}
|
|
ConditionName.propTypes = {
|
|
updateConditions: PropTypes.func.isRequired,
|
|
id: PropTypes.string.isRequired,
|
|
name: PropTypes.string.isRequired,
|
|
options: PropTypes.array.isRequired,
|
|
default: PropTypes.string.isRequired
|
|
};
|
|
ConditionName.defaultProps = {
|
|
name: ''
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/pages/conditions/condition-sub-id.js":
|
|
/*!**************************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/pages/conditions/condition-sub-id.js ***!
|
|
\**************************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = ConditionSubId;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
/**
|
|
* Main component.
|
|
*
|
|
* @param {any} props
|
|
* @return {any} Element
|
|
* @class
|
|
*/
|
|
function ConditionSubId(props) {
|
|
const settings = _react.default.useMemo(() => Object.keys(props.subIdAutocomplete).length ? getSettings(props.subIdAutocomplete) : null, [props.subIdAutocomplete]);
|
|
if (!props.sub || !settings) {
|
|
return '';
|
|
}
|
|
const onChange = e => props.updateConditions(props.id, {
|
|
subId: e.target.value
|
|
});
|
|
return /*#__PURE__*/_react.default.createElement("div", {
|
|
className: "e-site-editor-conditions__input-wrapper"
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Select2, {
|
|
onChange: onChange,
|
|
value: props.subId,
|
|
settings: settings,
|
|
options: props.subIdOptions
|
|
}));
|
|
}
|
|
|
|
/**
|
|
* Get settings for the select2 base on the autocomplete settings,
|
|
* that passes as a prop
|
|
*
|
|
* @param {any} autocomplete
|
|
* @return {Object} Settings
|
|
*/
|
|
function getSettings(autocomplete) {
|
|
return {
|
|
allowClear: false,
|
|
placeholder: __('All', 'elementor-pro'),
|
|
dir: elementorCommon.config.isRTL ? 'rtl' : 'ltr',
|
|
ajax: {
|
|
transport(params, success, failure) {
|
|
return elementorCommon.ajax.addRequest('pro_panel_posts_control_filter_autocomplete', {
|
|
data: {
|
|
q: params.data.q,
|
|
autocomplete
|
|
},
|
|
success,
|
|
error: failure
|
|
});
|
|
},
|
|
data(params) {
|
|
return {
|
|
q: params.term,
|
|
page: params.page
|
|
};
|
|
},
|
|
cache: true
|
|
},
|
|
escapeMarkup(markup) {
|
|
return markup;
|
|
},
|
|
minimumInputLength: 1
|
|
};
|
|
}
|
|
ConditionSubId.propTypes = {
|
|
subIdAutocomplete: PropTypes.object,
|
|
id: PropTypes.string.isRequired,
|
|
sub: PropTypes.string,
|
|
subId: PropTypes.string,
|
|
updateConditions: PropTypes.func,
|
|
subIdOptions: PropTypes.array
|
|
};
|
|
ConditionSubId.defaultProps = {
|
|
subId: '',
|
|
subIdOptions: []
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/pages/conditions/condition-sub.js":
|
|
/*!***********************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/pages/conditions/condition-sub.js ***!
|
|
\***********************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = ConditionSub;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
function ConditionSub(props) {
|
|
if ('general' === props.name || !props.subOptions.length) {
|
|
return '';
|
|
}
|
|
const onChange = e => props.updateConditions(props.id, {
|
|
sub: e.target.value,
|
|
subId: ''
|
|
});
|
|
return /*#__PURE__*/_react.default.createElement("div", {
|
|
className: "e-site-editor-conditions__input-wrapper"
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Select, {
|
|
options: props.subOptions,
|
|
value: props.sub,
|
|
onChange: onChange
|
|
}));
|
|
}
|
|
ConditionSub.propTypes = {
|
|
updateConditions: PropTypes.func.isRequired,
|
|
id: PropTypes.string.isRequired,
|
|
name: PropTypes.string.isRequired,
|
|
sub: PropTypes.string.isRequired,
|
|
subOptions: PropTypes.array.isRequired
|
|
};
|
|
ConditionSub.defaultProps = {
|
|
sub: '',
|
|
subOptions: {}
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/pages/conditions/condition-type.js":
|
|
/*!************************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/pages/conditions/condition-type.js ***!
|
|
\************************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = ConditionType;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
function ConditionType(props) {
|
|
const wrapperRef = _react.default.createRef();
|
|
const options = [{
|
|
label: __('Include', 'elementor-pro'),
|
|
value: 'include'
|
|
}, {
|
|
label: __('Exclude', 'elementor-pro'),
|
|
value: 'exclude'
|
|
}];
|
|
const onChange = e => {
|
|
props.updateConditions(props.id, {
|
|
type: e.target.value
|
|
});
|
|
};
|
|
_react.default.useEffect(() => {
|
|
wrapperRef.current.setAttribute('data-elementor-condition-type', props.type);
|
|
});
|
|
return /*#__PURE__*/_react.default.createElement("div", {
|
|
className: "e-site-editor-conditions__input-wrapper e-site-editor-conditions__input-wrapper--condition-type",
|
|
ref: wrapperRef
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Select, {
|
|
options: options,
|
|
value: props.type,
|
|
onChange: onChange
|
|
}));
|
|
}
|
|
ConditionType.propTypes = {
|
|
updateConditions: PropTypes.func.isRequired,
|
|
id: PropTypes.string.isRequired,
|
|
type: PropTypes.string.isRequired
|
|
};
|
|
ConditionType.defaultProps = {
|
|
type: ''
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/pages/conditions/conditions-rows.js":
|
|
/*!*************************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/pages/conditions/conditions-rows.js ***!
|
|
\*************************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = ConditionsRows;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _extends2 = _interopRequireDefault(__webpack_require__(/*! @babel/runtime/helpers/extends */ "../node_modules/@babel/runtime/helpers/extends.js"));
|
|
var _conditions = __webpack_require__(/*! ../../context/conditions */ "../core/app/modules/site-editor/assets/js/context/conditions.js");
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
var _conditionType = _interopRequireDefault(__webpack_require__(/*! ./condition-type */ "../core/app/modules/site-editor/assets/js/pages/conditions/condition-type.js"));
|
|
var _conditionName = _interopRequireDefault(__webpack_require__(/*! ./condition-name */ "../core/app/modules/site-editor/assets/js/pages/conditions/condition-name.js"));
|
|
var _conditionSub = _interopRequireDefault(__webpack_require__(/*! ./condition-sub */ "../core/app/modules/site-editor/assets/js/pages/conditions/condition-sub.js"));
|
|
var _conditionSubId = _interopRequireDefault(__webpack_require__(/*! ./condition-sub-id */ "../core/app/modules/site-editor/assets/js/pages/conditions/condition-sub-id.js"));
|
|
var _conditionConflicts = _interopRequireDefault(__webpack_require__(/*! ./condition-conflicts */ "../core/app/modules/site-editor/assets/js/pages/conditions/condition-conflicts.js"));
|
|
var _conditionButtonPortal = _interopRequireDefault(__webpack_require__(/*! ./condition-button-portal */ "../core/app/modules/site-editor/assets/js/pages/conditions/condition-button-portal.js"));
|
|
function ConditionsRows(props) {
|
|
const {
|
|
conditions,
|
|
createConditionItemInState: create,
|
|
updateConditionItemState: update,
|
|
removeConditionItemInState: remove,
|
|
saveConditions: save,
|
|
action,
|
|
resetActionState
|
|
} = _react.default.useContext(_conditions.Context);
|
|
const rows = Object.values(conditions).map(condition => /*#__PURE__*/_react.default.createElement("div", {
|
|
key: condition.id
|
|
}, /*#__PURE__*/_react.default.createElement("div", {
|
|
className: "e-site-editor-conditions__row"
|
|
}, /*#__PURE__*/_react.default.createElement("div", {
|
|
className: `e-site-editor-conditions__row-controls ${condition.conflictErrors.length && 'e-site-editor-conditions__row-controls--error'}`
|
|
}, /*#__PURE__*/_react.default.createElement(_conditionType.default, (0, _extends2.default)({}, condition, {
|
|
updateConditions: update
|
|
})), /*#__PURE__*/_react.default.createElement("div", {
|
|
className: "e-site-editor-conditions__row-controls-inner"
|
|
}, /*#__PURE__*/_react.default.createElement(_conditionName.default, (0, _extends2.default)({}, condition, {
|
|
updateConditions: update
|
|
})), /*#__PURE__*/_react.default.createElement(_conditionSub.default, (0, _extends2.default)({}, condition, {
|
|
updateConditions: update
|
|
})), /*#__PURE__*/_react.default.createElement(_conditionSubId.default, (0, _extends2.default)({}, condition, {
|
|
updateConditions: update
|
|
})))), /*#__PURE__*/_react.default.createElement(_appUi.Button, {
|
|
className: "e-site-editor-conditions__remove-condition",
|
|
text: __('Delete', 'elementor-pro'),
|
|
icon: "eicon-close",
|
|
hideText: true,
|
|
onClick: () => remove(condition.id)
|
|
})), /*#__PURE__*/_react.default.createElement(_conditionConflicts.default, {
|
|
conflicts: condition.conflictErrors
|
|
})));
|
|
const SaveButton = () => {
|
|
return /*#__PURE__*/_react.default.createElement(_appUi.Button, {
|
|
variant: "contained",
|
|
color: "primary",
|
|
size: "lg",
|
|
hideText: isSaving,
|
|
icon: isSaving ? 'eicon-loading eicon-animation-spin' : '',
|
|
text: __('Save & Close', 'elementor-pro'),
|
|
onClick: () => save().then(props.onAfterSave)
|
|
});
|
|
};
|
|
const isSaving = action.current === _conditions.ConditionsProvider.actions.SAVE && action.loading;
|
|
return /*#__PURE__*/_react.default.createElement(_react.default.Fragment, null, action.error && /*#__PURE__*/_react.default.createElement(_appUi.Dialog, {
|
|
text: action.error,
|
|
dismissButtonText: __('Go Back', 'elementor-pro'),
|
|
dismissButtonOnClick: resetActionState,
|
|
approveButtonText: __('Learn More', 'elementor-pro'),
|
|
approveButtonColor: "link",
|
|
approveButtonUrl: "https://go.elementor.com/app-theme-builder-conditions-load-issue",
|
|
approveButtonTarget: "_target"
|
|
}), /*#__PURE__*/_react.default.createElement("div", {
|
|
className: "e-site-editor-conditions__rows"
|
|
}, rows), /*#__PURE__*/_react.default.createElement("div", {
|
|
className: "e-site-editor-conditions__add-button-container"
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Button, {
|
|
className: "e-site-editor-conditions__add-button",
|
|
variant: "contained",
|
|
size: "lg",
|
|
text: __('Add Condition', 'elementor-pro'),
|
|
onClick: create
|
|
})), /*#__PURE__*/_react.default.createElement("div", {
|
|
className: "e-site-editor-conditions__footer"
|
|
}, props?.loadPortal ? /*#__PURE__*/_react.default.createElement(_conditionButtonPortal.default, null, /*#__PURE__*/_react.default.createElement(SaveButton, null)) : /*#__PURE__*/_react.default.createElement(SaveButton, null)));
|
|
}
|
|
ConditionsRows.propTypes = {
|
|
onAfterSave: PropTypes.func,
|
|
loadPortal: PropTypes.bool
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/pages/conditions/conditions.js":
|
|
/*!********************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/pages/conditions/conditions.js ***!
|
|
\********************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = Conditions;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
var _conditions = _interopRequireDefault(__webpack_require__(/*! ../../context/conditions */ "../core/app/modules/site-editor/assets/js/context/conditions.js"));
|
|
var _templates = __webpack_require__(/*! ../../context/templates */ "../core/app/modules/site-editor/assets/js/context/templates.js");
|
|
var _conditionsRows = _interopRequireDefault(__webpack_require__(/*! ./conditions-rows */ "../core/app/modules/site-editor/assets/js/pages/conditions/conditions-rows.js"));
|
|
__webpack_require__(/*! ./conditions.scss */ "../core/app/modules/site-editor/assets/js/pages/conditions/conditions.scss");
|
|
var _backButton = _interopRequireDefault(__webpack_require__(/*! ../../molecules/back-button */ "../core/app/modules/site-editor/assets/js/molecules/back-button.js"));
|
|
function Conditions(props) {
|
|
const {
|
|
findTemplateItemInState,
|
|
updateTemplateItemState
|
|
} = _react.default.useContext(_templates.Context),
|
|
template = findTemplateItemInState(parseInt(props.id));
|
|
if (!template) {
|
|
return /*#__PURE__*/_react.default.createElement("div", null, __('Not Found', 'elementor-pro'));
|
|
}
|
|
return /*#__PURE__*/_react.default.createElement("section", {
|
|
className: "e-site-editor-conditions"
|
|
}, /*#__PURE__*/_react.default.createElement(_backButton.default, null), /*#__PURE__*/_react.default.createElement("div", {
|
|
className: "e-site-editor-conditions__header"
|
|
}, /*#__PURE__*/_react.default.createElement("img", {
|
|
className: "e-site-editor-conditions__header-image",
|
|
src: `${elementorAppProConfig.baseUrl}/modules/theme-builder/assets/images/conditions-tab.svg`,
|
|
alt: __('Import template', 'elementor-pro')
|
|
}), /*#__PURE__*/_react.default.createElement(_appUi.Heading, {
|
|
variant: "h1",
|
|
tag: "h1"
|
|
}, __('Where do you want to display your template?', 'elementor-pro')), /*#__PURE__*/_react.default.createElement(_appUi.Text, {
|
|
variant: "p"
|
|
}, __('Set the conditions that determine where your template is used throughout your site.', 'elementor-pro'), /*#__PURE__*/_react.default.createElement("br", null), __('For example, choose \'Entire Site\' to display the template across your site.', 'elementor-pro'))), /*#__PURE__*/_react.default.createElement(_conditions.default, {
|
|
currentTemplate: template,
|
|
onConditionsSaved: updateTemplateItemState
|
|
}, /*#__PURE__*/_react.default.createElement(_conditionsRows.default, {
|
|
onAfterSave: () => history.back(),
|
|
loadPortal: true
|
|
})));
|
|
}
|
|
Conditions.propTypes = {
|
|
id: PropTypes.string
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/pages/import.js":
|
|
/*!*****************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/pages/import.js ***!
|
|
\*****************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = Import;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
var _templates = __webpack_require__(/*! ../context/templates */ "../core/app/modules/site-editor/assets/js/context/templates.js");
|
|
var _backButton = _interopRequireDefault(__webpack_require__(/*! ../molecules/back-button */ "../core/app/modules/site-editor/assets/js/molecules/back-button.js"));
|
|
var _hooks = __webpack_require__(/*! @elementor/hooks */ "@elementor/hooks");
|
|
// The hook `useConfirmAction` comes from the core plugin, so it is possible that it is not available.
|
|
const useConfirmActionFallback = _ref => {
|
|
let {
|
|
action
|
|
} = _ref;
|
|
return {
|
|
runAction: action,
|
|
dialog: {
|
|
isOpen: false
|
|
}
|
|
};
|
|
};
|
|
const useConfirmAction = _hooks.useConfirmAction ?? useConfirmActionFallback;
|
|
function Import() {
|
|
const {
|
|
importTemplates,
|
|
action,
|
|
resetActionState
|
|
} = _react.default.useContext(_templates.Context),
|
|
[importedTemplate, setImportedTemplate] = _react.default.useState(null),
|
|
isImport = action.current === _templates.TemplatesProvider.actions.IMPORT,
|
|
isUploading = isImport && action.loading,
|
|
hasError = isImport && action.error;
|
|
const upload = _react.default.useCallback(file => {
|
|
if (isUploading) {
|
|
return;
|
|
}
|
|
readFile(file).then(fileData => importTemplates({
|
|
fileName: file.name,
|
|
fileData
|
|
})).then(response => {
|
|
// For now it show a dialog for the first template ONLY!
|
|
setImportedTemplate(response.data[0]);
|
|
});
|
|
}, []);
|
|
const {
|
|
runAction: uploadFile,
|
|
dialog,
|
|
checkbox
|
|
} = useConfirmAction({
|
|
doNotShowAgainKey: 'upload_json_warning_generic_message',
|
|
action: upload
|
|
});
|
|
return /*#__PURE__*/_react.default.createElement("section", {
|
|
className: "site-editor__import"
|
|
}, importedTemplate && /*#__PURE__*/_react.default.createElement(_appUi.Dialog, {
|
|
title: __('Your template was imported', 'elementor-pro'),
|
|
approveButtonText: __('Preview', 'elementor-pro'),
|
|
approveButtonUrl: importedTemplate.url,
|
|
approveButtonTarget: "_blank",
|
|
dismissButtonText: __('Edit', 'elementor-pro'),
|
|
dismissButtonUrl: importedTemplate.editURL,
|
|
dismissButtonTarget: "_top",
|
|
onClose: () => setImportedTemplate(null)
|
|
}), hasError && /*#__PURE__*/_react.default.createElement(_appUi.Dialog, {
|
|
title: action.error,
|
|
approveButtonText: __('Learn More', 'elementor-pro'),
|
|
approveButtonUrl: "https://go.elementor.com/app-theme-builder-import-issue",
|
|
approveButtonTarget: "_blank",
|
|
approveButtonColor: "link",
|
|
dismissButtonText: __('Go Back', 'elementor-pro'),
|
|
dismissButtonOnClick: resetActionState,
|
|
onClose: resetActionState
|
|
}), dialog.isOpen && /*#__PURE__*/_react.default.createElement(_appUi.Dialog, {
|
|
title: __('Warning: JSON or ZIP files may be unsafe', 'elementor-pro'),
|
|
text: __('Uploading JSON or ZIP files from unknown sources can be harmful and put your site at risk. For maximum safety, upload only JSON or ZIP files from trusted sources.', 'elementor-pro'),
|
|
approveButtonColor: "link",
|
|
approveButtonText: __('Continue', 'elementor-pro'),
|
|
approveButtonOnClick: dialog.approve,
|
|
dismissButtonText: __('Cancel', 'elementor-pro'),
|
|
dismissButtonOnClick: dialog.dismiss,
|
|
onClose: dialog.dismiss
|
|
}, /*#__PURE__*/_react.default.createElement("label", {
|
|
htmlFor: "do-not-show-upload-json-warning-again",
|
|
style: {
|
|
display: 'flex',
|
|
alignItems: 'center',
|
|
gap: '5px'
|
|
}
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Checkbox, {
|
|
id: "do-not-show-upload-json-warning-again",
|
|
type: "checkbox",
|
|
value: checkbox.isChecked,
|
|
onChange: event => checkbox.setIsChecked(!!event.target.checked)
|
|
}), __('Do not show this message again', 'elementor-pro'))), /*#__PURE__*/_react.default.createElement(_backButton.default, null), /*#__PURE__*/_react.default.createElement(_appUi.DropZone, {
|
|
heading: __('Import Template To Your Library', 'elementor-pro'),
|
|
text: __('Drag & Drop your .JSON or .zip template file', 'elementor-pro'),
|
|
secondaryText: __('or', 'elementor-pro'),
|
|
onFileSelect: uploadFile,
|
|
isLoading: isUploading,
|
|
filetypes: ['zip', 'json']
|
|
}));
|
|
}
|
|
function readFile(file) {
|
|
return new Promise(resolve => {
|
|
const fileReader = new FileReader();
|
|
fileReader.readAsDataURL(file);
|
|
fileReader.onload = event => {
|
|
// Replace the mime type that prepended to the base64 with empty string and return a
|
|
// resolved promise only with the base64 string.
|
|
resolve(event.target.result.replace(/^[^,]+,/, ''));
|
|
};
|
|
});
|
|
}
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/pages/template-type.js":
|
|
/*!************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/pages/template-type.js ***!
|
|
\************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = TemplateType;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _siteEditor = __webpack_require__(/*! @elementor/site-editor */ "@elementor/site-editor");
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
var _siteTemplates = _interopRequireDefault(__webpack_require__(/*! ../organisms/site-templates */ "../core/app/modules/site-editor/assets/js/organisms/site-templates.js"));
|
|
var _useFeatureLock = _interopRequireDefault(__webpack_require__(/*! elementor-pro-app/hooks/use-feature-lock */ "../core/app/assets/js/hooks/use-feature-lock.js"));
|
|
__webpack_require__(/*! ./template-type.scss */ "../core/app/modules/site-editor/assets/js/pages/template-type.scss");
|
|
function TemplateType(props) {
|
|
const {
|
|
templateTypes
|
|
} = _react.default.useContext(_siteEditor.TemplateTypesContext),
|
|
currentType = templateTypes.find(item => item.type === props.type),
|
|
{
|
|
isLocked,
|
|
ConnectButton
|
|
} = (0, _useFeatureLock.default)('site-editor');
|
|
if (!currentType) {
|
|
return /*#__PURE__*/_react.default.createElement(_appUi.NotFound, null);
|
|
}
|
|
return /*#__PURE__*/_react.default.createElement("section", {
|
|
className: `e-site-editor__templates e-site-editor__templates--type-${props.type}`
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Grid, {
|
|
className: "page-header",
|
|
container: true,
|
|
justify: "space-between"
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Heading, {
|
|
variant: "h1"
|
|
}, currentType.page_title), isLocked ? /*#__PURE__*/_react.default.createElement(ConnectButton, null) : /*#__PURE__*/_react.default.createElement(_appUi.AddNewButton, {
|
|
url: currentType.urls.create,
|
|
text: __('Add New', 'elementor-pro')
|
|
})), /*#__PURE__*/_react.default.createElement("hr", {
|
|
className: "eps-separator"
|
|
}), /*#__PURE__*/_react.default.createElement(_siteTemplates.default, {
|
|
type: currentType.type,
|
|
id: props.id
|
|
}));
|
|
}
|
|
TemplateType.propTypes = {
|
|
type: PropTypes.string,
|
|
page_title: PropTypes.string,
|
|
id: PropTypes.string
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/pages/templates.js":
|
|
/*!********************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/pages/templates.js ***!
|
|
\********************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = Templates;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _siteTemplates = _interopRequireDefault(__webpack_require__(/*! ../organisms/site-templates */ "../core/app/modules/site-editor/assets/js/organisms/site-templates.js"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
var _useFeatureLock = _interopRequireDefault(__webpack_require__(/*! elementor-pro-app/hooks/use-feature-lock */ "../core/app/assets/js/hooks/use-feature-lock.js"));
|
|
function Templates() {
|
|
const {
|
|
isLocked,
|
|
ConnectButton
|
|
} = (0, _useFeatureLock.default)('site-editor');
|
|
return /*#__PURE__*/_react.default.createElement("section", {
|
|
className: "e-site-editor__site-templates"
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Grid, {
|
|
container: true,
|
|
justify: "space-between",
|
|
alignItems: "start",
|
|
className: "page-header"
|
|
}, /*#__PURE__*/_react.default.createElement("h1", null, __('Your Site\'s Global Parts', 'elementor-pro')), isLocked ? /*#__PURE__*/_react.default.createElement(ConnectButton, null) : /*#__PURE__*/_react.default.createElement(_appUi.AddNewButton, {
|
|
url: "/site-editor/add-new"
|
|
})), /*#__PURE__*/_react.default.createElement("hr", {
|
|
className: "eps-separator"
|
|
}), /*#__PURE__*/_react.default.createElement(_siteTemplates.default, null));
|
|
}
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/part-actions/dialog-delete.js":
|
|
/*!*******************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/part-actions/dialog-delete.js ***!
|
|
\*******************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = DialogDelete;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
var _templates = __webpack_require__(/*! ../context/templates */ "../core/app/modules/site-editor/assets/js/context/templates.js");
|
|
function DialogDelete(props) {
|
|
const {
|
|
deleteTemplate,
|
|
findTemplateItemInState
|
|
} = _react.default.useContext(_templates.Context);
|
|
const closeDialog = shouldUpdate => {
|
|
props.setId(null);
|
|
if (shouldUpdate) {
|
|
deleteTemplate(props.id);
|
|
}
|
|
};
|
|
if (!props.id) {
|
|
return '';
|
|
}
|
|
const template = findTemplateItemInState(props.id);
|
|
return /*#__PURE__*/_react.default.createElement(_appUi.Dialog, {
|
|
title: __('Move Item To Trash', 'elementor-pro'),
|
|
text: __('Are you sure you want to move this item to trash:', 'elementor-pro') + ` "${template.title}"`,
|
|
onSubmit: () => closeDialog(true),
|
|
approveButtonText: __('Move to Trash', 'elementor-pro'),
|
|
approveButtonOnClick: () => closeDialog(true),
|
|
approveButtonColor: "danger",
|
|
dismissButtonText: __('Cancel', 'elementor-pro'),
|
|
dismissButtonOnClick: () => closeDialog(),
|
|
onClose: () => closeDialog()
|
|
});
|
|
}
|
|
DialogDelete.propTypes = {
|
|
id: PropTypes.number,
|
|
setId: PropTypes.func.isRequired
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/part-actions/dialog-rename.js":
|
|
/*!*******************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/part-actions/dialog-rename.js ***!
|
|
\*******************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = DialogRename;
|
|
var _react = _interopRequireWildcard(__webpack_require__(/*! react */ "react"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
var _templates = __webpack_require__(/*! ../context/templates */ "../core/app/modules/site-editor/assets/js/context/templates.js");
|
|
function _getRequireWildcardCache(e) { if ("function" != typeof WeakMap) return null; var r = new WeakMap(), t = new WeakMap(); return (_getRequireWildcardCache = function (e) { return e ? t : r; })(e); }
|
|
function _interopRequireWildcard(e, r) { if (!r && e && e.__esModule) return e; if (null === e || "object" != typeof e && "function" != typeof e) return { default: e }; var t = _getRequireWildcardCache(r); if (t && t.has(e)) return t.get(e); var n = { __proto__: null }, a = Object.defineProperty && Object.getOwnPropertyDescriptor; for (var u in e) if ("default" !== u && {}.hasOwnProperty.call(e, u)) { var i = a ? Object.getOwnPropertyDescriptor(e, u) : null; i && (i.get || i.set) ? Object.defineProperty(n, u, i) : n[u] = e[u]; } return n.default = e, t && t.set(e, n), n; }
|
|
function DialogRename(props) {
|
|
const {
|
|
findTemplateItemInState,
|
|
updateTemplate
|
|
} = _react.default.useContext(_templates.Context),
|
|
template = findTemplateItemInState(props.id);
|
|
const [title, setTitle] = _react.default.useState('');
|
|
(0, _react.useEffect)(() => {
|
|
// The "title" state should be updated if the template title changed.
|
|
if (template) {
|
|
setTitle(template.title);
|
|
}
|
|
}, [template]);
|
|
const closeDialog = shouldUpdate => {
|
|
props.setId(null);
|
|
if (shouldUpdate) {
|
|
updateTemplate(props.id, {
|
|
post_title: title
|
|
});
|
|
}
|
|
};
|
|
if (!props.id) {
|
|
return '';
|
|
}
|
|
return /*#__PURE__*/_react.default.createElement(_appUi.Dialog, {
|
|
title: __('Rename Site Part', 'elementor-pro'),
|
|
approveButtonText: __('Change', 'elementor-pro'),
|
|
onSubmit: () => closeDialog(true),
|
|
approveButtonOnClick: () => closeDialog(true),
|
|
approveButtonColor: "primary",
|
|
dismissButtonText: __('Cancel', 'elementor-pro'),
|
|
dismissButtonOnClick: () => closeDialog(),
|
|
onClose: () => closeDialog()
|
|
}, /*#__PURE__*/_react.default.createElement("input", {
|
|
type: "text",
|
|
className: "eps-input eps-input-text eps-input--block"
|
|
// eslint-disable-next-line jsx-a11y/no-autofocus
|
|
,
|
|
autoFocus: true,
|
|
value: title,
|
|
onChange: e => setTitle(e.target.value)
|
|
}));
|
|
}
|
|
DialogRename.propTypes = {
|
|
id: PropTypes.number,
|
|
setId: PropTypes.func.isRequired
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/part-actions/dialogs-and-buttons.js":
|
|
/*!*************************************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/part-actions/dialogs-and-buttons.js ***!
|
|
\*************************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
/* provided dependency */ var PropTypes = __webpack_require__(/*! prop-types */ "../node_modules/prop-types/index.js");
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports.PartActionsDialogs = PartActionsDialogs;
|
|
exports["default"] = PartActionsButtons;
|
|
exports.handlers = void 0;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _dialogRename = _interopRequireDefault(__webpack_require__(/*! ./dialog-rename */ "../core/app/modules/site-editor/assets/js/part-actions/dialog-rename.js"));
|
|
var _dialogDelete = _interopRequireDefault(__webpack_require__(/*! ./dialog-delete */ "../core/app/modules/site-editor/assets/js/part-actions/dialog-delete.js"));
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
const handlers = exports.handlers = {
|
|
rename: null,
|
|
delete: null
|
|
};
|
|
|
|
// TODO: Think about refactor to portals: https://reactjs.org/docs/portals.html
|
|
function PartActionsDialogs() {
|
|
const [DialogRenameId, setDialogRenameId] = _react.default.useState(null);
|
|
const [DialogDeleteId, setDialogDeleteId] = _react.default.useState(null);
|
|
handlers.rename = setDialogRenameId;
|
|
handlers.delete = setDialogDeleteId;
|
|
return /*#__PURE__*/_react.default.createElement(_react.default.Fragment, null, /*#__PURE__*/_react.default.createElement(_dialogRename.default, {
|
|
id: DialogRenameId,
|
|
setId: setDialogRenameId
|
|
}), /*#__PURE__*/_react.default.createElement(_dialogDelete.default, {
|
|
id: DialogDeleteId,
|
|
setId: setDialogDeleteId
|
|
}));
|
|
}
|
|
function PartActionsButtons(props) {
|
|
const [showMenu, setShowMenu] = _react.default.useState(false);
|
|
let SiteTemplatePopover = '';
|
|
if (showMenu) {
|
|
SiteTemplatePopover = /*#__PURE__*/_react.default.createElement(_appUi.Popover, {
|
|
closeFunction: () => setShowMenu(!showMenu)
|
|
}, /*#__PURE__*/_react.default.createElement("li", null, /*#__PURE__*/_react.default.createElement(_appUi.Button, {
|
|
className: "eps-popover__item",
|
|
icon: "eicon-sign-out",
|
|
text: __('Export', 'elementor-pro'),
|
|
url: props.exportLink
|
|
})), /*#__PURE__*/_react.default.createElement("li", null, /*#__PURE__*/_react.default.createElement(_appUi.Button, {
|
|
className: "eps-popover__item eps-popover__item--danger",
|
|
icon: "eicon-trash-o",
|
|
text: __('Trash', 'elementor-pro'),
|
|
onClick: () => handlers.delete(props.id)
|
|
})), /*#__PURE__*/_react.default.createElement("li", null, /*#__PURE__*/_react.default.createElement(_appUi.Button, {
|
|
className: "eps-popover__item",
|
|
icon: "eicon-edit",
|
|
text: __('Rename', 'elementor-pro'),
|
|
onClick: () => handlers.rename(props.id)
|
|
})));
|
|
}
|
|
return /*#__PURE__*/_react.default.createElement("div", {
|
|
className: "eps-popover__container"
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Button, {
|
|
text: __('Toggle', 'elementor-pro'),
|
|
hideText: true,
|
|
icon: "eicon-ellipsis-h",
|
|
size: "lg",
|
|
onClick: () => setShowMenu(!showMenu)
|
|
}), SiteTemplatePopover);
|
|
}
|
|
PartActionsButtons.propTypes = {
|
|
id: PropTypes.number.isRequired,
|
|
exportLink: PropTypes.string.isRequired
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../core/app/modules/site-editor/assets/js/site-editor.js":
|
|
/*!****************************************************************!*\
|
|
!*** ../core/app/modules/site-editor/assets/js/site-editor.js ***!
|
|
\****************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var __ = __webpack_require__(/*! @wordpress/i18n */ "@wordpress/i18n")["__"];
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports["default"] = void 0;
|
|
var _react = _interopRequireDefault(__webpack_require__(/*! react */ "react"));
|
|
var _router = __webpack_require__(/*! @reach/router */ "../node_modules/@reach/router/es/index.js");
|
|
var _templates = _interopRequireDefault(__webpack_require__(/*! ./pages/templates */ "../core/app/modules/site-editor/assets/js/pages/templates.js"));
|
|
var _templateType = _interopRequireDefault(__webpack_require__(/*! ./pages/template-type */ "../core/app/modules/site-editor/assets/js/pages/template-type.js"));
|
|
var _addNew = _interopRequireDefault(__webpack_require__(/*! ./pages/add-new */ "../core/app/modules/site-editor/assets/js/pages/add-new.js"));
|
|
var _conditions = _interopRequireDefault(__webpack_require__(/*! ./pages/conditions/conditions */ "../core/app/modules/site-editor/assets/js/pages/conditions/conditions.js"));
|
|
var _import = _interopRequireDefault(__webpack_require__(/*! ./pages/import */ "../core/app/modules/site-editor/assets/js/pages/import.js"));
|
|
var _templates2 = _interopRequireWildcard(__webpack_require__(/*! ./context/templates */ "../core/app/modules/site-editor/assets/js/context/templates.js"));
|
|
var _siteEditor = __webpack_require__(/*! @elementor/site-editor */ "@elementor/site-editor");
|
|
var _appUi = __webpack_require__(/*! @elementor/app-ui */ "@elementor/app-ui");
|
|
var _router2 = _interopRequireDefault(__webpack_require__(/*! @elementor/router */ "@elementor/router"));
|
|
var _component = _interopRequireDefault(__webpack_require__(/*! ./data/component */ "../core/app/modules/site-editor/assets/js/data/component.js"));
|
|
var _useFeatureLock = _interopRequireDefault(__webpack_require__(/*! elementor-pro-app/hooks/use-feature-lock */ "../core/app/assets/js/hooks/use-feature-lock.js"));
|
|
__webpack_require__(/*! ./site-editor.scss */ "../core/app/modules/site-editor/assets/js/site-editor.scss");
|
|
function _getRequireWildcardCache(e) { if ("function" != typeof WeakMap) return null; var r = new WeakMap(), t = new WeakMap(); return (_getRequireWildcardCache = function (e) { return e ? t : r; })(e); }
|
|
function _interopRequireWildcard(e, r) { if (!r && e && e.__esModule) return e; if (null === e || "object" != typeof e && "function" != typeof e) return { default: e }; var t = _getRequireWildcardCache(r); if (t && t.has(e)) return t.get(e); var n = { __proto__: null }, a = Object.defineProperty && Object.getOwnPropertyDescriptor; for (var u in e) if ("default" !== u && {}.hasOwnProperty.call(e, u)) { var i = a ? Object.getOwnPropertyDescriptor(e, u) : null; i && (i.get || i.set) ? Object.defineProperty(n, u, i) : n[u] = e[u]; } return n.default = e, t && t.set(e, n), n; }
|
|
function SiteEditor() {
|
|
const {
|
|
isLocked
|
|
} = (0, _useFeatureLock.default)('site-editor');
|
|
const basePath = 'site-editor';
|
|
const headerButtons = [{
|
|
id: 'import',
|
|
text: __('import', 'elementor-pro'),
|
|
hideText: true,
|
|
icon: 'eicon-upload-circle-o',
|
|
onClick: () => _router2.default.appHistory.navigate(basePath + '/import')
|
|
}];
|
|
|
|
// Remove Core cache.
|
|
elementorCommon.ajax.invalidateCache({
|
|
unique_id: 'app_site_editor_template_types'
|
|
});
|
|
const SiteEditorDefault = () => {
|
|
const {
|
|
templates
|
|
} = _react.default.useContext(_templates2.Context);
|
|
if (Object.keys(templates).length) {
|
|
return /*#__PURE__*/_react.default.createElement(_router.Redirect, {
|
|
from: '/',
|
|
to: '/' + basePath + '/templates',
|
|
noThrow: true
|
|
});
|
|
}
|
|
return /*#__PURE__*/_react.default.createElement(_router.Redirect, {
|
|
from: '/',
|
|
to: '/' + basePath + '/add-new',
|
|
noThrow: true
|
|
});
|
|
};
|
|
return /*#__PURE__*/_react.default.createElement(_appUi.ErrorBoundary, {
|
|
title: __('Theme Builder could not be loaded', 'elementor-pro'),
|
|
learnMoreUrl: "https://go.elementor.com/app-theme-builder-load-issue"
|
|
}, /*#__PURE__*/_react.default.createElement(_siteEditor.Layout, {
|
|
allPartsButton: /*#__PURE__*/_react.default.createElement(_siteEditor.AllPartsButton, {
|
|
url: '/' + basePath
|
|
}),
|
|
headerButtons: headerButtons,
|
|
titleRedirectRoute: '/' + basePath,
|
|
promotion: isLocked
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Grid, {
|
|
container: true,
|
|
className: "e-site-editor__content_container"
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Grid, {
|
|
item: true,
|
|
className: "e-site-editor__content_container_main"
|
|
}, /*#__PURE__*/_react.default.createElement(_templates2.default, null, /*#__PURE__*/_react.default.createElement(_router.LocationProvider, {
|
|
history: _router2.default.appHistory
|
|
}, /*#__PURE__*/_react.default.createElement(_router.Router, null, /*#__PURE__*/_react.default.createElement(SiteEditorDefault, {
|
|
path: basePath
|
|
}), /*#__PURE__*/_react.default.createElement(_templates.default, {
|
|
path: basePath + '/templates'
|
|
}), /*#__PURE__*/_react.default.createElement(_templateType.default, {
|
|
path: basePath + '/templates/:type/*id'
|
|
}), /*#__PURE__*/_react.default.createElement(_addNew.default, {
|
|
path: basePath + '/add-new'
|
|
}), /*#__PURE__*/_react.default.createElement(_conditions.default, {
|
|
path: basePath + '/conditions/:id'
|
|
}), /*#__PURE__*/_react.default.createElement(_import.default, {
|
|
path: basePath + '/import'
|
|
}), /*#__PURE__*/_react.default.createElement(_siteEditor.NotFound, {
|
|
default: true
|
|
}))))), /*#__PURE__*/_react.default.createElement(_appUi.Grid, {
|
|
container: true,
|
|
justify: "space-between",
|
|
className: "e-site-editor__content_container_secondary"
|
|
}, /*#__PURE__*/_react.default.createElement(_appUi.Button, {
|
|
text: __('Switch to table view', 'elementor-pro'),
|
|
url: elementorAppProConfig['site-editor']?.urls?.legacy_view
|
|
}), window.location.href.indexOf('conditions') !== -1 && /*#__PURE__*/_react.default.createElement("div", {
|
|
id: "portal-root"
|
|
})))));
|
|
}
|
|
class Module {
|
|
constructor() {
|
|
elementorCommon.debug.addURLToWatch('elementor-pro/assets');
|
|
$e.components.register(new _component.default());
|
|
_router2.default.addRoute({
|
|
path: '/site-editor/*',
|
|
component: SiteEditor
|
|
});
|
|
}
|
|
}
|
|
exports["default"] = Module;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../modules/screenshots/app/assets/js/hooks/use-screenshot.js":
|
|
/*!********************************************************************!*\
|
|
!*** ../modules/screenshots/app/assets/js/hooks/use-screenshot.js ***!
|
|
\********************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/* provided dependency */ var React = __webpack_require__(/*! react */ "react");
|
|
|
|
|
|
Object.defineProperty(exports, "__esModule", ({
|
|
value: true
|
|
}));
|
|
exports.SCREENSHOT_STATUS_SUCCEED = exports.SCREENSHOT_STATUS_QUEUE = exports.SCREENSHOT_STATUS_IN_PROGRESS = exports.SCREENSHOT_STATUS_FAILED = void 0;
|
|
exports["default"] = useScreenshot;
|
|
const {
|
|
useState,
|
|
useEffect,
|
|
useMemo,
|
|
useCallback
|
|
} = React;
|
|
const SCREENSHOT_STATUS_QUEUE = exports.SCREENSHOT_STATUS_QUEUE = 'queue';
|
|
const SCREENSHOT_STATUS_IN_PROGRESS = exports.SCREENSHOT_STATUS_IN_PROGRESS = 'in-progress';
|
|
const SCREENSHOT_STATUS_SUCCEED = exports.SCREENSHOT_STATUS_SUCCEED = 'succeed';
|
|
const SCREENSHOT_STATUS_FAILED = exports.SCREENSHOT_STATUS_FAILED = 'failed';
|
|
|
|
/**
|
|
* Default options for the hook function
|
|
*
|
|
* @type {{numberOfScreenshotInParallel: number}}
|
|
*/
|
|
const defaultOptions = {
|
|
numberOfScreenshotInParallel: 1
|
|
};
|
|
|
|
/**
|
|
* Filter the posts by status.
|
|
*
|
|
* @param {Array} posts
|
|
* @param {string} status
|
|
* @return {Array} Filtered posts
|
|
*/
|
|
function filterPostByStatus(posts, status) {
|
|
return posts.filter(item => status === item.status);
|
|
}
|
|
|
|
/**
|
|
* Receive the initial posts and normalize it
|
|
* to an array that the hook can work with.
|
|
*
|
|
* @param {Array} posts
|
|
*/
|
|
function normalizeInitialPosts(posts) {
|
|
return posts.map(post => ({
|
|
id: post.id,
|
|
screenshot_url: post.screenshot_url,
|
|
status: 'queue',
|
|
iframe: null,
|
|
imageUrl: null
|
|
}));
|
|
}
|
|
|
|
/**
|
|
* Find the post id inside the posts array, update it with the attrs,
|
|
* and make sure to return the whole posts array.
|
|
*
|
|
* @param {Array} posts
|
|
* @param {number} id
|
|
* @param {Object} attrs
|
|
* @return {Array} Posts array
|
|
*/
|
|
function updatePostsAttrs(posts, id) {
|
|
let attrs = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {};
|
|
return posts.map(post => {
|
|
if (post.id !== id) {
|
|
return post;
|
|
}
|
|
return {
|
|
...post,
|
|
...attrs
|
|
};
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Creates an IFrame that will create the screenshot.
|
|
*
|
|
* @param {Object} post
|
|
* @return {HTMLIFrameElement} iframe
|
|
*/
|
|
function createScreenshotIframe(post) {
|
|
const iframe = document.createElement('iframe');
|
|
iframe.src = post.screenshot_url;
|
|
iframe.width = '1200';
|
|
iframe.style = 'visibility: hidden;';
|
|
document.body.appendChild(iframe);
|
|
return iframe;
|
|
}
|
|
|
|
/**
|
|
* Returns a callback, that will be bind to the iframe message event.
|
|
*
|
|
* @param {Array} inProgressPosts
|
|
* @param {Function} setPosts
|
|
*/
|
|
function useIFrameMessageListener(inProgressPosts, setPosts) {
|
|
return useCallback(message => {
|
|
const {
|
|
data
|
|
} = message;
|
|
if (!data.name || data.name !== 'capture-screenshot-done') {
|
|
return;
|
|
}
|
|
const post = inProgressPosts.find(item => item.id === parseInt(data.id));
|
|
if (!post) {
|
|
return;
|
|
}
|
|
post.iframe.remove();
|
|
setPosts(prevState => updatePostsAttrs(prevState, post.id, {
|
|
status: data.success ? SCREENSHOT_STATUS_SUCCEED : SCREENSHOT_STATUS_FAILED,
|
|
imageUrl: data.imageUrl
|
|
}));
|
|
}, [inProgressPosts]);
|
|
}
|
|
|
|
/**
|
|
* Will create a screenshot based on the posts that was passed to it.
|
|
*
|
|
* @param {Array} initialPosts
|
|
* @param {number} numberOfScreenshotInParallel
|
|
* @return {{inProgress: Array, succeed: Array, failed: Array, posts: Array, queue: Array}} An array of posts, queue, inProgress, succeed, failed
|
|
*/
|
|
function useScreenshot(initialPosts) {
|
|
let {
|
|
numberOfScreenshotInParallel
|
|
} = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : defaultOptions;
|
|
const [posts, setPosts] = useState([]);
|
|
|
|
// Holds some kind of computed value of the `posts` state,
|
|
// it is been created mostly for convenient workflow and little bit performance optimization.
|
|
const queue = useMemo(() => filterPostByStatus(posts, SCREENSHOT_STATUS_QUEUE), [posts]);
|
|
const inProgress = useMemo(() => filterPostByStatus(posts, SCREENSHOT_STATUS_IN_PROGRESS), [posts]);
|
|
const succeed = useMemo(() => filterPostByStatus(posts, SCREENSHOT_STATUS_SUCCEED), [posts]);
|
|
const failed = useMemo(() => filterPostByStatus(posts, SCREENSHOT_STATUS_FAILED), [posts]);
|
|
|
|
// Will run every initialPosts change, make the diff between the local state
|
|
// and initialPosts and creates a new local state.
|
|
useEffect(() => {
|
|
const postsDiff = initialPosts.filter(initialPost => !posts.find(statePost => statePost.id === initialPost.id));
|
|
if (!postsDiff.length) {
|
|
return;
|
|
}
|
|
setPosts(prev => [...prev, ...normalizeInitialPosts(postsDiff)]);
|
|
}, [initialPosts]);
|
|
|
|
// Holds the useCallback that will be used to listen to the screenshot iframe events.
|
|
const iframeMessageListener = useIFrameMessageListener(inProgress, setPosts);
|
|
|
|
// Listens to the screenshot iframe events
|
|
// eventually will remove the iframe and set the post status to succeed or failed.
|
|
useEffect(() => {
|
|
window.addEventListener('message', iframeMessageListener, false);
|
|
return () => {
|
|
window.removeEventListener('message', iframeMessageListener);
|
|
};
|
|
}, [iframeMessageListener]);
|
|
|
|
// Runs every time `posts` state change (all most every event in this hook will trigger change to `posts`),
|
|
// this logic response for setting status of the process to DONE if needed + taking the next post and start
|
|
// to capture a screenshot.
|
|
useEffect(() => {
|
|
if (0 === queue.length || inProgress.length >= numberOfScreenshotInParallel) {
|
|
return;
|
|
}
|
|
const [nextPost] = queue;
|
|
const iframe = createScreenshotIframe(nextPost);
|
|
setPosts(prevState => updatePostsAttrs(prevState, nextPost.id, {
|
|
status: SCREENSHOT_STATUS_IN_PROGRESS,
|
|
iframe
|
|
}));
|
|
}, [posts]);
|
|
return {
|
|
posts,
|
|
queue,
|
|
inProgress,
|
|
succeed,
|
|
failed
|
|
};
|
|
}
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/gud/index.js":
|
|
/*!************************************!*\
|
|
!*** ../node_modules/gud/index.js ***!
|
|
\************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
// @flow
|
|
|
|
|
|
var key = '__global_unique_id__';
|
|
|
|
module.exports = function() {
|
|
return __webpack_require__.g[key] = (__webpack_require__.g[key] || 0) + 1;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/invariant/browser.js":
|
|
/*!********************************************!*\
|
|
!*** ../node_modules/invariant/browser.js ***!
|
|
\********************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
/**
|
|
* Copyright (c) 2013-present, Facebook, Inc.
|
|
*
|
|
* This source code is licensed under the MIT license found in the
|
|
* LICENSE file in the root directory of this source tree.
|
|
*/
|
|
|
|
|
|
|
|
/**
|
|
* Use invariant() to assert state which your program assumes to be true.
|
|
*
|
|
* Provide sprintf-style format (only %s is supported) and arguments
|
|
* to provide information about what broke and what you were
|
|
* expecting.
|
|
*
|
|
* The invariant message will be stripped in production, but the invariant
|
|
* will remain to ensure logic does not differ in production.
|
|
*/
|
|
|
|
var invariant = function(condition, format, a, b, c, d, e, f) {
|
|
if (true) {
|
|
if (format === undefined) {
|
|
throw new Error('invariant requires an error message argument');
|
|
}
|
|
}
|
|
|
|
if (!condition) {
|
|
var error;
|
|
if (format === undefined) {
|
|
error = new Error(
|
|
'Minified exception occurred; use the non-minified dev environment ' +
|
|
'for the full error message and additional helpful warnings.'
|
|
);
|
|
} else {
|
|
var args = [a, b, c, d, e, f];
|
|
var argIndex = 0;
|
|
error = new Error(
|
|
format.replace(/%s/g, function() { return args[argIndex++]; })
|
|
);
|
|
error.name = 'Invariant Violation';
|
|
}
|
|
|
|
error.framesToPop = 1; // we don't care about invariant's own frame
|
|
throw error;
|
|
}
|
|
};
|
|
|
|
module.exports = invariant;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/object-assign/index.js":
|
|
/*!**********************************************!*\
|
|
!*** ../node_modules/object-assign/index.js ***!
|
|
\**********************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
/*
|
|
object-assign
|
|
(c) Sindre Sorhus
|
|
@license MIT
|
|
*/
|
|
|
|
|
|
/* eslint-disable no-unused-vars */
|
|
var getOwnPropertySymbols = Object.getOwnPropertySymbols;
|
|
var hasOwnProperty = Object.prototype.hasOwnProperty;
|
|
var propIsEnumerable = Object.prototype.propertyIsEnumerable;
|
|
|
|
function toObject(val) {
|
|
if (val === null || val === undefined) {
|
|
throw new TypeError('Object.assign cannot be called with null or undefined');
|
|
}
|
|
|
|
return Object(val);
|
|
}
|
|
|
|
function shouldUseNative() {
|
|
try {
|
|
if (!Object.assign) {
|
|
return false;
|
|
}
|
|
|
|
// Detect buggy property enumeration order in older V8 versions.
|
|
|
|
// https://bugs.chromium.org/p/v8/issues/detail?id=4118
|
|
var test1 = new String('abc'); // eslint-disable-line no-new-wrappers
|
|
test1[5] = 'de';
|
|
if (Object.getOwnPropertyNames(test1)[0] === '5') {
|
|
return false;
|
|
}
|
|
|
|
// https://bugs.chromium.org/p/v8/issues/detail?id=3056
|
|
var test2 = {};
|
|
for (var i = 0; i < 10; i++) {
|
|
test2['_' + String.fromCharCode(i)] = i;
|
|
}
|
|
var order2 = Object.getOwnPropertyNames(test2).map(function (n) {
|
|
return test2[n];
|
|
});
|
|
if (order2.join('') !== '0123456789') {
|
|
return false;
|
|
}
|
|
|
|
// https://bugs.chromium.org/p/v8/issues/detail?id=3056
|
|
var test3 = {};
|
|
'abcdefghijklmnopqrst'.split('').forEach(function (letter) {
|
|
test3[letter] = letter;
|
|
});
|
|
if (Object.keys(Object.assign({}, test3)).join('') !==
|
|
'abcdefghijklmnopqrst') {
|
|
return false;
|
|
}
|
|
|
|
return true;
|
|
} catch (err) {
|
|
// We don't expect any of the above to throw, but better to be safe.
|
|
return false;
|
|
}
|
|
}
|
|
|
|
module.exports = shouldUseNative() ? Object.assign : function (target, source) {
|
|
var from;
|
|
var to = toObject(target);
|
|
var symbols;
|
|
|
|
for (var s = 1; s < arguments.length; s++) {
|
|
from = Object(arguments[s]);
|
|
|
|
for (var key in from) {
|
|
if (hasOwnProperty.call(from, key)) {
|
|
to[key] = from[key];
|
|
}
|
|
}
|
|
|
|
if (getOwnPropertySymbols) {
|
|
symbols = getOwnPropertySymbols(from);
|
|
for (var i = 0; i < symbols.length; i++) {
|
|
if (propIsEnumerable.call(from, symbols[i])) {
|
|
to[symbols[i]] = from[symbols[i]];
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
return to;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/prop-types/checkPropTypes.js":
|
|
/*!****************************************************!*\
|
|
!*** ../node_modules/prop-types/checkPropTypes.js ***!
|
|
\****************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/**
|
|
* Copyright (c) 2013-present, Facebook, Inc.
|
|
*
|
|
* This source code is licensed under the MIT license found in the
|
|
* LICENSE file in the root directory of this source tree.
|
|
*/
|
|
|
|
|
|
|
|
var printWarning = function() {};
|
|
|
|
if (true) {
|
|
var ReactPropTypesSecret = __webpack_require__(/*! ./lib/ReactPropTypesSecret */ "../node_modules/prop-types/lib/ReactPropTypesSecret.js");
|
|
var loggedTypeFailures = {};
|
|
var has = __webpack_require__(/*! ./lib/has */ "../node_modules/prop-types/lib/has.js");
|
|
|
|
printWarning = function(text) {
|
|
var message = 'Warning: ' + text;
|
|
if (typeof console !== 'undefined') {
|
|
console.error(message);
|
|
}
|
|
try {
|
|
// --- Welcome to debugging React ---
|
|
// This error was thrown as a convenience so that you can use this stack
|
|
// to find the callsite that caused this warning to fire.
|
|
throw new Error(message);
|
|
} catch (x) { /**/ }
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Assert that the values match with the type specs.
|
|
* Error messages are memorized and will only be shown once.
|
|
*
|
|
* @param {object} typeSpecs Map of name to a ReactPropType
|
|
* @param {object} values Runtime values that need to be type-checked
|
|
* @param {string} location e.g. "prop", "context", "child context"
|
|
* @param {string} componentName Name of the component for error messages.
|
|
* @param {?Function} getStack Returns the component stack.
|
|
* @private
|
|
*/
|
|
function checkPropTypes(typeSpecs, values, location, componentName, getStack) {
|
|
if (true) {
|
|
for (var typeSpecName in typeSpecs) {
|
|
if (has(typeSpecs, typeSpecName)) {
|
|
var error;
|
|
// Prop type validation may throw. In case they do, we don't want to
|
|
// fail the render phase where it didn't fail before. So we log it.
|
|
// After these have been cleaned up, we'll let them throw.
|
|
try {
|
|
// This is intentionally an invariant that gets caught. It's the same
|
|
// behavior as without this statement except with a better message.
|
|
if (typeof typeSpecs[typeSpecName] !== 'function') {
|
|
var err = Error(
|
|
(componentName || 'React class') + ': ' + location + ' type `' + typeSpecName + '` is invalid; ' +
|
|
'it must be a function, usually from the `prop-types` package, but received `' + typeof typeSpecs[typeSpecName] + '`.' +
|
|
'This often happens because of typos such as `PropTypes.function` instead of `PropTypes.func`.'
|
|
);
|
|
err.name = 'Invariant Violation';
|
|
throw err;
|
|
}
|
|
error = typeSpecs[typeSpecName](values, typeSpecName, componentName, location, null, ReactPropTypesSecret);
|
|
} catch (ex) {
|
|
error = ex;
|
|
}
|
|
if (error && !(error instanceof Error)) {
|
|
printWarning(
|
|
(componentName || 'React class') + ': type specification of ' +
|
|
location + ' `' + typeSpecName + '` is invalid; the type checker ' +
|
|
'function must return `null` or an `Error` but returned a ' + typeof error + '. ' +
|
|
'You may have forgotten to pass an argument to the type checker ' +
|
|
'creator (arrayOf, instanceOf, objectOf, oneOf, oneOfType, and ' +
|
|
'shape all require an argument).'
|
|
);
|
|
}
|
|
if (error instanceof Error && !(error.message in loggedTypeFailures)) {
|
|
// Only monitor this failure once because there tends to be a lot of the
|
|
// same error.
|
|
loggedTypeFailures[error.message] = true;
|
|
|
|
var stack = getStack ? getStack() : '';
|
|
|
|
printWarning(
|
|
'Failed ' + location + ' type: ' + error.message + (stack != null ? stack : '')
|
|
);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Resets warning cache when testing.
|
|
*
|
|
* @private
|
|
*/
|
|
checkPropTypes.resetWarningCache = function() {
|
|
if (true) {
|
|
loggedTypeFailures = {};
|
|
}
|
|
}
|
|
|
|
module.exports = checkPropTypes;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/prop-types/factoryWithTypeCheckers.js":
|
|
/*!*************************************************************!*\
|
|
!*** ../node_modules/prop-types/factoryWithTypeCheckers.js ***!
|
|
\*************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
/**
|
|
* Copyright (c) 2013-present, Facebook, Inc.
|
|
*
|
|
* This source code is licensed under the MIT license found in the
|
|
* LICENSE file in the root directory of this source tree.
|
|
*/
|
|
|
|
|
|
|
|
var ReactIs = __webpack_require__(/*! react-is */ "../node_modules/prop-types/node_modules/react-is/index.js");
|
|
var assign = __webpack_require__(/*! object-assign */ "../node_modules/object-assign/index.js");
|
|
|
|
var ReactPropTypesSecret = __webpack_require__(/*! ./lib/ReactPropTypesSecret */ "../node_modules/prop-types/lib/ReactPropTypesSecret.js");
|
|
var has = __webpack_require__(/*! ./lib/has */ "../node_modules/prop-types/lib/has.js");
|
|
var checkPropTypes = __webpack_require__(/*! ./checkPropTypes */ "../node_modules/prop-types/checkPropTypes.js");
|
|
|
|
var printWarning = function() {};
|
|
|
|
if (true) {
|
|
printWarning = function(text) {
|
|
var message = 'Warning: ' + text;
|
|
if (typeof console !== 'undefined') {
|
|
console.error(message);
|
|
}
|
|
try {
|
|
// --- Welcome to debugging React ---
|
|
// This error was thrown as a convenience so that you can use this stack
|
|
// to find the callsite that caused this warning to fire.
|
|
throw new Error(message);
|
|
} catch (x) {}
|
|
};
|
|
}
|
|
|
|
function emptyFunctionThatReturnsNull() {
|
|
return null;
|
|
}
|
|
|
|
module.exports = function(isValidElement, throwOnDirectAccess) {
|
|
/* global Symbol */
|
|
var ITERATOR_SYMBOL = typeof Symbol === 'function' && Symbol.iterator;
|
|
var FAUX_ITERATOR_SYMBOL = '@@iterator'; // Before Symbol spec.
|
|
|
|
/**
|
|
* Returns the iterator method function contained on the iterable object.
|
|
*
|
|
* Be sure to invoke the function with the iterable as context:
|
|
*
|
|
* var iteratorFn = getIteratorFn(myIterable);
|
|
* if (iteratorFn) {
|
|
* var iterator = iteratorFn.call(myIterable);
|
|
* ...
|
|
* }
|
|
*
|
|
* @param {?object} maybeIterable
|
|
* @return {?function}
|
|
*/
|
|
function getIteratorFn(maybeIterable) {
|
|
var iteratorFn = maybeIterable && (ITERATOR_SYMBOL && maybeIterable[ITERATOR_SYMBOL] || maybeIterable[FAUX_ITERATOR_SYMBOL]);
|
|
if (typeof iteratorFn === 'function') {
|
|
return iteratorFn;
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Collection of methods that allow declaration and validation of props that are
|
|
* supplied to React components. Example usage:
|
|
*
|
|
* var Props = require('ReactPropTypes');
|
|
* var MyArticle = React.createClass({
|
|
* propTypes: {
|
|
* // An optional string prop named "description".
|
|
* description: Props.string,
|
|
*
|
|
* // A required enum prop named "category".
|
|
* category: Props.oneOf(['News','Photos']).isRequired,
|
|
*
|
|
* // A prop named "dialog" that requires an instance of Dialog.
|
|
* dialog: Props.instanceOf(Dialog).isRequired
|
|
* },
|
|
* render: function() { ... }
|
|
* });
|
|
*
|
|
* A more formal specification of how these methods are used:
|
|
*
|
|
* type := array|bool|func|object|number|string|oneOf([...])|instanceOf(...)
|
|
* decl := ReactPropTypes.{type}(.isRequired)?
|
|
*
|
|
* Each and every declaration produces a function with the same signature. This
|
|
* allows the creation of custom validation functions. For example:
|
|
*
|
|
* var MyLink = React.createClass({
|
|
* propTypes: {
|
|
* // An optional string or URI prop named "href".
|
|
* href: function(props, propName, componentName) {
|
|
* var propValue = props[propName];
|
|
* if (propValue != null && typeof propValue !== 'string' &&
|
|
* !(propValue instanceof URI)) {
|
|
* return new Error(
|
|
* 'Expected a string or an URI for ' + propName + ' in ' +
|
|
* componentName
|
|
* );
|
|
* }
|
|
* }
|
|
* },
|
|
* render: function() {...}
|
|
* });
|
|
*
|
|
* @internal
|
|
*/
|
|
|
|
var ANONYMOUS = '<<anonymous>>';
|
|
|
|
// Important!
|
|
// Keep this list in sync with production version in `./factoryWithThrowingShims.js`.
|
|
var ReactPropTypes = {
|
|
array: createPrimitiveTypeChecker('array'),
|
|
bigint: createPrimitiveTypeChecker('bigint'),
|
|
bool: createPrimitiveTypeChecker('boolean'),
|
|
func: createPrimitiveTypeChecker('function'),
|
|
number: createPrimitiveTypeChecker('number'),
|
|
object: createPrimitiveTypeChecker('object'),
|
|
string: createPrimitiveTypeChecker('string'),
|
|
symbol: createPrimitiveTypeChecker('symbol'),
|
|
|
|
any: createAnyTypeChecker(),
|
|
arrayOf: createArrayOfTypeChecker,
|
|
element: createElementTypeChecker(),
|
|
elementType: createElementTypeTypeChecker(),
|
|
instanceOf: createInstanceTypeChecker,
|
|
node: createNodeChecker(),
|
|
objectOf: createObjectOfTypeChecker,
|
|
oneOf: createEnumTypeChecker,
|
|
oneOfType: createUnionTypeChecker,
|
|
shape: createShapeTypeChecker,
|
|
exact: createStrictShapeTypeChecker,
|
|
};
|
|
|
|
/**
|
|
* inlined Object.is polyfill to avoid requiring consumers ship their own
|
|
* https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Object/is
|
|
*/
|
|
/*eslint-disable no-self-compare*/
|
|
function is(x, y) {
|
|
// SameValue algorithm
|
|
if (x === y) {
|
|
// Steps 1-5, 7-10
|
|
// Steps 6.b-6.e: +0 != -0
|
|
return x !== 0 || 1 / x === 1 / y;
|
|
} else {
|
|
// Step 6.a: NaN == NaN
|
|
return x !== x && y !== y;
|
|
}
|
|
}
|
|
/*eslint-enable no-self-compare*/
|
|
|
|
/**
|
|
* We use an Error-like object for backward compatibility as people may call
|
|
* PropTypes directly and inspect their output. However, we don't use real
|
|
* Errors anymore. We don't inspect their stack anyway, and creating them
|
|
* is prohibitively expensive if they are created too often, such as what
|
|
* happens in oneOfType() for any type before the one that matched.
|
|
*/
|
|
function PropTypeError(message, data) {
|
|
this.message = message;
|
|
this.data = data && typeof data === 'object' ? data: {};
|
|
this.stack = '';
|
|
}
|
|
// Make `instanceof Error` still work for returned errors.
|
|
PropTypeError.prototype = Error.prototype;
|
|
|
|
function createChainableTypeChecker(validate) {
|
|
if (true) {
|
|
var manualPropTypeCallCache = {};
|
|
var manualPropTypeWarningCount = 0;
|
|
}
|
|
function checkType(isRequired, props, propName, componentName, location, propFullName, secret) {
|
|
componentName = componentName || ANONYMOUS;
|
|
propFullName = propFullName || propName;
|
|
|
|
if (secret !== ReactPropTypesSecret) {
|
|
if (throwOnDirectAccess) {
|
|
// New behavior only for users of `prop-types` package
|
|
var err = new Error(
|
|
'Calling PropTypes validators directly is not supported by the `prop-types` package. ' +
|
|
'Use `PropTypes.checkPropTypes()` to call them. ' +
|
|
'Read more at http://fb.me/use-check-prop-types'
|
|
);
|
|
err.name = 'Invariant Violation';
|
|
throw err;
|
|
} else if ( true && typeof console !== 'undefined') {
|
|
// Old behavior for people using React.PropTypes
|
|
var cacheKey = componentName + ':' + propName;
|
|
if (
|
|
!manualPropTypeCallCache[cacheKey] &&
|
|
// Avoid spamming the console because they are often not actionable except for lib authors
|
|
manualPropTypeWarningCount < 3
|
|
) {
|
|
printWarning(
|
|
'You are manually calling a React.PropTypes validation ' +
|
|
'function for the `' + propFullName + '` prop on `' + componentName + '`. This is deprecated ' +
|
|
'and will throw in the standalone `prop-types` package. ' +
|
|
'You may be seeing this warning due to a third-party PropTypes ' +
|
|
'library. See https://fb.me/react-warning-dont-call-proptypes ' + 'for details.'
|
|
);
|
|
manualPropTypeCallCache[cacheKey] = true;
|
|
manualPropTypeWarningCount++;
|
|
}
|
|
}
|
|
}
|
|
if (props[propName] == null) {
|
|
if (isRequired) {
|
|
if (props[propName] === null) {
|
|
return new PropTypeError('The ' + location + ' `' + propFullName + '` is marked as required ' + ('in `' + componentName + '`, but its value is `null`.'));
|
|
}
|
|
return new PropTypeError('The ' + location + ' `' + propFullName + '` is marked as required in ' + ('`' + componentName + '`, but its value is `undefined`.'));
|
|
}
|
|
return null;
|
|
} else {
|
|
return validate(props, propName, componentName, location, propFullName);
|
|
}
|
|
}
|
|
|
|
var chainedCheckType = checkType.bind(null, false);
|
|
chainedCheckType.isRequired = checkType.bind(null, true);
|
|
|
|
return chainedCheckType;
|
|
}
|
|
|
|
function createPrimitiveTypeChecker(expectedType) {
|
|
function validate(props, propName, componentName, location, propFullName, secret) {
|
|
var propValue = props[propName];
|
|
var propType = getPropType(propValue);
|
|
if (propType !== expectedType) {
|
|
// `propValue` being instance of, say, date/regexp, pass the 'object'
|
|
// check, but we can offer a more precise error message here rather than
|
|
// 'of type `object`'.
|
|
var preciseType = getPreciseType(propValue);
|
|
|
|
return new PropTypeError(
|
|
'Invalid ' + location + ' `' + propFullName + '` of type ' + ('`' + preciseType + '` supplied to `' + componentName + '`, expected ') + ('`' + expectedType + '`.'),
|
|
{expectedType: expectedType}
|
|
);
|
|
}
|
|
return null;
|
|
}
|
|
return createChainableTypeChecker(validate);
|
|
}
|
|
|
|
function createAnyTypeChecker() {
|
|
return createChainableTypeChecker(emptyFunctionThatReturnsNull);
|
|
}
|
|
|
|
function createArrayOfTypeChecker(typeChecker) {
|
|
function validate(props, propName, componentName, location, propFullName) {
|
|
if (typeof typeChecker !== 'function') {
|
|
return new PropTypeError('Property `' + propFullName + '` of component `' + componentName + '` has invalid PropType notation inside arrayOf.');
|
|
}
|
|
var propValue = props[propName];
|
|
if (!Array.isArray(propValue)) {
|
|
var propType = getPropType(propValue);
|
|
return new PropTypeError('Invalid ' + location + ' `' + propFullName + '` of type ' + ('`' + propType + '` supplied to `' + componentName + '`, expected an array.'));
|
|
}
|
|
for (var i = 0; i < propValue.length; i++) {
|
|
var error = typeChecker(propValue, i, componentName, location, propFullName + '[' + i + ']', ReactPropTypesSecret);
|
|
if (error instanceof Error) {
|
|
return error;
|
|
}
|
|
}
|
|
return null;
|
|
}
|
|
return createChainableTypeChecker(validate);
|
|
}
|
|
|
|
function createElementTypeChecker() {
|
|
function validate(props, propName, componentName, location, propFullName) {
|
|
var propValue = props[propName];
|
|
if (!isValidElement(propValue)) {
|
|
var propType = getPropType(propValue);
|
|
return new PropTypeError('Invalid ' + location + ' `' + propFullName + '` of type ' + ('`' + propType + '` supplied to `' + componentName + '`, expected a single ReactElement.'));
|
|
}
|
|
return null;
|
|
}
|
|
return createChainableTypeChecker(validate);
|
|
}
|
|
|
|
function createElementTypeTypeChecker() {
|
|
function validate(props, propName, componentName, location, propFullName) {
|
|
var propValue = props[propName];
|
|
if (!ReactIs.isValidElementType(propValue)) {
|
|
var propType = getPropType(propValue);
|
|
return new PropTypeError('Invalid ' + location + ' `' + propFullName + '` of type ' + ('`' + propType + '` supplied to `' + componentName + '`, expected a single ReactElement type.'));
|
|
}
|
|
return null;
|
|
}
|
|
return createChainableTypeChecker(validate);
|
|
}
|
|
|
|
function createInstanceTypeChecker(expectedClass) {
|
|
function validate(props, propName, componentName, location, propFullName) {
|
|
if (!(props[propName] instanceof expectedClass)) {
|
|
var expectedClassName = expectedClass.name || ANONYMOUS;
|
|
var actualClassName = getClassName(props[propName]);
|
|
return new PropTypeError('Invalid ' + location + ' `' + propFullName + '` of type ' + ('`' + actualClassName + '` supplied to `' + componentName + '`, expected ') + ('instance of `' + expectedClassName + '`.'));
|
|
}
|
|
return null;
|
|
}
|
|
return createChainableTypeChecker(validate);
|
|
}
|
|
|
|
function createEnumTypeChecker(expectedValues) {
|
|
if (!Array.isArray(expectedValues)) {
|
|
if (true) {
|
|
if (arguments.length > 1) {
|
|
printWarning(
|
|
'Invalid arguments supplied to oneOf, expected an array, got ' + arguments.length + ' arguments. ' +
|
|
'A common mistake is to write oneOf(x, y, z) instead of oneOf([x, y, z]).'
|
|
);
|
|
} else {
|
|
printWarning('Invalid argument supplied to oneOf, expected an array.');
|
|
}
|
|
}
|
|
return emptyFunctionThatReturnsNull;
|
|
}
|
|
|
|
function validate(props, propName, componentName, location, propFullName) {
|
|
var propValue = props[propName];
|
|
for (var i = 0; i < expectedValues.length; i++) {
|
|
if (is(propValue, expectedValues[i])) {
|
|
return null;
|
|
}
|
|
}
|
|
|
|
var valuesString = JSON.stringify(expectedValues, function replacer(key, value) {
|
|
var type = getPreciseType(value);
|
|
if (type === 'symbol') {
|
|
return String(value);
|
|
}
|
|
return value;
|
|
});
|
|
return new PropTypeError('Invalid ' + location + ' `' + propFullName + '` of value `' + String(propValue) + '` ' + ('supplied to `' + componentName + '`, expected one of ' + valuesString + '.'));
|
|
}
|
|
return createChainableTypeChecker(validate);
|
|
}
|
|
|
|
function createObjectOfTypeChecker(typeChecker) {
|
|
function validate(props, propName, componentName, location, propFullName) {
|
|
if (typeof typeChecker !== 'function') {
|
|
return new PropTypeError('Property `' + propFullName + '` of component `' + componentName + '` has invalid PropType notation inside objectOf.');
|
|
}
|
|
var propValue = props[propName];
|
|
var propType = getPropType(propValue);
|
|
if (propType !== 'object') {
|
|
return new PropTypeError('Invalid ' + location + ' `' + propFullName + '` of type ' + ('`' + propType + '` supplied to `' + componentName + '`, expected an object.'));
|
|
}
|
|
for (var key in propValue) {
|
|
if (has(propValue, key)) {
|
|
var error = typeChecker(propValue, key, componentName, location, propFullName + '.' + key, ReactPropTypesSecret);
|
|
if (error instanceof Error) {
|
|
return error;
|
|
}
|
|
}
|
|
}
|
|
return null;
|
|
}
|
|
return createChainableTypeChecker(validate);
|
|
}
|
|
|
|
function createUnionTypeChecker(arrayOfTypeCheckers) {
|
|
if (!Array.isArray(arrayOfTypeCheckers)) {
|
|
true ? printWarning('Invalid argument supplied to oneOfType, expected an instance of array.') : 0;
|
|
return emptyFunctionThatReturnsNull;
|
|
}
|
|
|
|
for (var i = 0; i < arrayOfTypeCheckers.length; i++) {
|
|
var checker = arrayOfTypeCheckers[i];
|
|
if (typeof checker !== 'function') {
|
|
printWarning(
|
|
'Invalid argument supplied to oneOfType. Expected an array of check functions, but ' +
|
|
'received ' + getPostfixForTypeWarning(checker) + ' at index ' + i + '.'
|
|
);
|
|
return emptyFunctionThatReturnsNull;
|
|
}
|
|
}
|
|
|
|
function validate(props, propName, componentName, location, propFullName) {
|
|
var expectedTypes = [];
|
|
for (var i = 0; i < arrayOfTypeCheckers.length; i++) {
|
|
var checker = arrayOfTypeCheckers[i];
|
|
var checkerResult = checker(props, propName, componentName, location, propFullName, ReactPropTypesSecret);
|
|
if (checkerResult == null) {
|
|
return null;
|
|
}
|
|
if (checkerResult.data && has(checkerResult.data, 'expectedType')) {
|
|
expectedTypes.push(checkerResult.data.expectedType);
|
|
}
|
|
}
|
|
var expectedTypesMessage = (expectedTypes.length > 0) ? ', expected one of type [' + expectedTypes.join(', ') + ']': '';
|
|
return new PropTypeError('Invalid ' + location + ' `' + propFullName + '` supplied to ' + ('`' + componentName + '`' + expectedTypesMessage + '.'));
|
|
}
|
|
return createChainableTypeChecker(validate);
|
|
}
|
|
|
|
function createNodeChecker() {
|
|
function validate(props, propName, componentName, location, propFullName) {
|
|
if (!isNode(props[propName])) {
|
|
return new PropTypeError('Invalid ' + location + ' `' + propFullName + '` supplied to ' + ('`' + componentName + '`, expected a ReactNode.'));
|
|
}
|
|
return null;
|
|
}
|
|
return createChainableTypeChecker(validate);
|
|
}
|
|
|
|
function invalidValidatorError(componentName, location, propFullName, key, type) {
|
|
return new PropTypeError(
|
|
(componentName || 'React class') + ': ' + location + ' type `' + propFullName + '.' + key + '` is invalid; ' +
|
|
'it must be a function, usually from the `prop-types` package, but received `' + type + '`.'
|
|
);
|
|
}
|
|
|
|
function createShapeTypeChecker(shapeTypes) {
|
|
function validate(props, propName, componentName, location, propFullName) {
|
|
var propValue = props[propName];
|
|
var propType = getPropType(propValue);
|
|
if (propType !== 'object') {
|
|
return new PropTypeError('Invalid ' + location + ' `' + propFullName + '` of type `' + propType + '` ' + ('supplied to `' + componentName + '`, expected `object`.'));
|
|
}
|
|
for (var key in shapeTypes) {
|
|
var checker = shapeTypes[key];
|
|
if (typeof checker !== 'function') {
|
|
return invalidValidatorError(componentName, location, propFullName, key, getPreciseType(checker));
|
|
}
|
|
var error = checker(propValue, key, componentName, location, propFullName + '.' + key, ReactPropTypesSecret);
|
|
if (error) {
|
|
return error;
|
|
}
|
|
}
|
|
return null;
|
|
}
|
|
return createChainableTypeChecker(validate);
|
|
}
|
|
|
|
function createStrictShapeTypeChecker(shapeTypes) {
|
|
function validate(props, propName, componentName, location, propFullName) {
|
|
var propValue = props[propName];
|
|
var propType = getPropType(propValue);
|
|
if (propType !== 'object') {
|
|
return new PropTypeError('Invalid ' + location + ' `' + propFullName + '` of type `' + propType + '` ' + ('supplied to `' + componentName + '`, expected `object`.'));
|
|
}
|
|
// We need to check all keys in case some are required but missing from props.
|
|
var allKeys = assign({}, props[propName], shapeTypes);
|
|
for (var key in allKeys) {
|
|
var checker = shapeTypes[key];
|
|
if (has(shapeTypes, key) && typeof checker !== 'function') {
|
|
return invalidValidatorError(componentName, location, propFullName, key, getPreciseType(checker));
|
|
}
|
|
if (!checker) {
|
|
return new PropTypeError(
|
|
'Invalid ' + location + ' `' + propFullName + '` key `' + key + '` supplied to `' + componentName + '`.' +
|
|
'\nBad object: ' + JSON.stringify(props[propName], null, ' ') +
|
|
'\nValid keys: ' + JSON.stringify(Object.keys(shapeTypes), null, ' ')
|
|
);
|
|
}
|
|
var error = checker(propValue, key, componentName, location, propFullName + '.' + key, ReactPropTypesSecret);
|
|
if (error) {
|
|
return error;
|
|
}
|
|
}
|
|
return null;
|
|
}
|
|
|
|
return createChainableTypeChecker(validate);
|
|
}
|
|
|
|
function isNode(propValue) {
|
|
switch (typeof propValue) {
|
|
case 'number':
|
|
case 'string':
|
|
case 'undefined':
|
|
return true;
|
|
case 'boolean':
|
|
return !propValue;
|
|
case 'object':
|
|
if (Array.isArray(propValue)) {
|
|
return propValue.every(isNode);
|
|
}
|
|
if (propValue === null || isValidElement(propValue)) {
|
|
return true;
|
|
}
|
|
|
|
var iteratorFn = getIteratorFn(propValue);
|
|
if (iteratorFn) {
|
|
var iterator = iteratorFn.call(propValue);
|
|
var step;
|
|
if (iteratorFn !== propValue.entries) {
|
|
while (!(step = iterator.next()).done) {
|
|
if (!isNode(step.value)) {
|
|
return false;
|
|
}
|
|
}
|
|
} else {
|
|
// Iterator will provide entry [k,v] tuples rather than values.
|
|
while (!(step = iterator.next()).done) {
|
|
var entry = step.value;
|
|
if (entry) {
|
|
if (!isNode(entry[1])) {
|
|
return false;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} else {
|
|
return false;
|
|
}
|
|
|
|
return true;
|
|
default:
|
|
return false;
|
|
}
|
|
}
|
|
|
|
function isSymbol(propType, propValue) {
|
|
// Native Symbol.
|
|
if (propType === 'symbol') {
|
|
return true;
|
|
}
|
|
|
|
// falsy value can't be a Symbol
|
|
if (!propValue) {
|
|
return false;
|
|
}
|
|
|
|
// 19.4.3.5 Symbol.prototype[@@toStringTag] === 'Symbol'
|
|
if (propValue['@@toStringTag'] === 'Symbol') {
|
|
return true;
|
|
}
|
|
|
|
// Fallback for non-spec compliant Symbols which are polyfilled.
|
|
if (typeof Symbol === 'function' && propValue instanceof Symbol) {
|
|
return true;
|
|
}
|
|
|
|
return false;
|
|
}
|
|
|
|
// Equivalent of `typeof` but with special handling for array and regexp.
|
|
function getPropType(propValue) {
|
|
var propType = typeof propValue;
|
|
if (Array.isArray(propValue)) {
|
|
return 'array';
|
|
}
|
|
if (propValue instanceof RegExp) {
|
|
// Old webkits (at least until Android 4.0) return 'function' rather than
|
|
// 'object' for typeof a RegExp. We'll normalize this here so that /bla/
|
|
// passes PropTypes.object.
|
|
return 'object';
|
|
}
|
|
if (isSymbol(propType, propValue)) {
|
|
return 'symbol';
|
|
}
|
|
return propType;
|
|
}
|
|
|
|
// This handles more types than `getPropType`. Only used for error messages.
|
|
// See `createPrimitiveTypeChecker`.
|
|
function getPreciseType(propValue) {
|
|
if (typeof propValue === 'undefined' || propValue === null) {
|
|
return '' + propValue;
|
|
}
|
|
var propType = getPropType(propValue);
|
|
if (propType === 'object') {
|
|
if (propValue instanceof Date) {
|
|
return 'date';
|
|
} else if (propValue instanceof RegExp) {
|
|
return 'regexp';
|
|
}
|
|
}
|
|
return propType;
|
|
}
|
|
|
|
// Returns a string that is postfixed to a warning about an invalid type.
|
|
// For example, "undefined" or "of type array"
|
|
function getPostfixForTypeWarning(value) {
|
|
var type = getPreciseType(value);
|
|
switch (type) {
|
|
case 'array':
|
|
case 'object':
|
|
return 'an ' + type;
|
|
case 'boolean':
|
|
case 'date':
|
|
case 'regexp':
|
|
return 'a ' + type;
|
|
default:
|
|
return type;
|
|
}
|
|
}
|
|
|
|
// Returns class name of the object, if any.
|
|
function getClassName(propValue) {
|
|
if (!propValue.constructor || !propValue.constructor.name) {
|
|
return ANONYMOUS;
|
|
}
|
|
return propValue.constructor.name;
|
|
}
|
|
|
|
ReactPropTypes.checkPropTypes = checkPropTypes;
|
|
ReactPropTypes.resetWarningCache = checkPropTypes.resetWarningCache;
|
|
ReactPropTypes.PropTypes = ReactPropTypes;
|
|
|
|
return ReactPropTypes;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/prop-types/index.js":
|
|
/*!*******************************************!*\
|
|
!*** ../node_modules/prop-types/index.js ***!
|
|
\*******************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
/**
|
|
* Copyright (c) 2013-present, Facebook, Inc.
|
|
*
|
|
* This source code is licensed under the MIT license found in the
|
|
* LICENSE file in the root directory of this source tree.
|
|
*/
|
|
|
|
if (true) {
|
|
var ReactIs = __webpack_require__(/*! react-is */ "../node_modules/prop-types/node_modules/react-is/index.js");
|
|
|
|
// By explicitly using `prop-types` you are opting into new development behavior.
|
|
// http://fb.me/prop-types-in-prod
|
|
var throwOnDirectAccess = true;
|
|
module.exports = __webpack_require__(/*! ./factoryWithTypeCheckers */ "../node_modules/prop-types/factoryWithTypeCheckers.js")(ReactIs.isElement, throwOnDirectAccess);
|
|
} else {}
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/prop-types/lib/ReactPropTypesSecret.js":
|
|
/*!**************************************************************!*\
|
|
!*** ../node_modules/prop-types/lib/ReactPropTypesSecret.js ***!
|
|
\**************************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
/**
|
|
* Copyright (c) 2013-present, Facebook, Inc.
|
|
*
|
|
* This source code is licensed under the MIT license found in the
|
|
* LICENSE file in the root directory of this source tree.
|
|
*/
|
|
|
|
|
|
|
|
var ReactPropTypesSecret = 'SECRET_DO_NOT_PASS_THIS_OR_YOU_WILL_BE_FIRED';
|
|
|
|
module.exports = ReactPropTypesSecret;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/prop-types/lib/has.js":
|
|
/*!*********************************************!*\
|
|
!*** ../node_modules/prop-types/lib/has.js ***!
|
|
\*********************************************/
|
|
/***/ ((module) => {
|
|
|
|
module.exports = Function.call.bind(Object.prototype.hasOwnProperty);
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/prop-types/node_modules/react-is/cjs/react-is.development.js":
|
|
/*!************************************************************************************!*\
|
|
!*** ../node_modules/prop-types/node_modules/react-is/cjs/react-is.development.js ***!
|
|
\************************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports) => {
|
|
|
|
"use strict";
|
|
/** @license React v16.13.1
|
|
* react-is.development.js
|
|
*
|
|
* Copyright (c) Facebook, Inc. and its affiliates.
|
|
*
|
|
* This source code is licensed under the MIT license found in the
|
|
* LICENSE file in the root directory of this source tree.
|
|
*/
|
|
|
|
|
|
|
|
|
|
|
|
if (true) {
|
|
(function() {
|
|
'use strict';
|
|
|
|
// The Symbol used to tag the ReactElement-like types. If there is no native Symbol
|
|
// nor polyfill, then a plain number is used for performance.
|
|
var hasSymbol = typeof Symbol === 'function' && Symbol.for;
|
|
var REACT_ELEMENT_TYPE = hasSymbol ? Symbol.for('react.element') : 0xeac7;
|
|
var REACT_PORTAL_TYPE = hasSymbol ? Symbol.for('react.portal') : 0xeaca;
|
|
var REACT_FRAGMENT_TYPE = hasSymbol ? Symbol.for('react.fragment') : 0xeacb;
|
|
var REACT_STRICT_MODE_TYPE = hasSymbol ? Symbol.for('react.strict_mode') : 0xeacc;
|
|
var REACT_PROFILER_TYPE = hasSymbol ? Symbol.for('react.profiler') : 0xead2;
|
|
var REACT_PROVIDER_TYPE = hasSymbol ? Symbol.for('react.provider') : 0xeacd;
|
|
var REACT_CONTEXT_TYPE = hasSymbol ? Symbol.for('react.context') : 0xeace; // TODO: We don't use AsyncMode or ConcurrentMode anymore. They were temporary
|
|
// (unstable) APIs that have been removed. Can we remove the symbols?
|
|
|
|
var REACT_ASYNC_MODE_TYPE = hasSymbol ? Symbol.for('react.async_mode') : 0xeacf;
|
|
var REACT_CONCURRENT_MODE_TYPE = hasSymbol ? Symbol.for('react.concurrent_mode') : 0xeacf;
|
|
var REACT_FORWARD_REF_TYPE = hasSymbol ? Symbol.for('react.forward_ref') : 0xead0;
|
|
var REACT_SUSPENSE_TYPE = hasSymbol ? Symbol.for('react.suspense') : 0xead1;
|
|
var REACT_SUSPENSE_LIST_TYPE = hasSymbol ? Symbol.for('react.suspense_list') : 0xead8;
|
|
var REACT_MEMO_TYPE = hasSymbol ? Symbol.for('react.memo') : 0xead3;
|
|
var REACT_LAZY_TYPE = hasSymbol ? Symbol.for('react.lazy') : 0xead4;
|
|
var REACT_BLOCK_TYPE = hasSymbol ? Symbol.for('react.block') : 0xead9;
|
|
var REACT_FUNDAMENTAL_TYPE = hasSymbol ? Symbol.for('react.fundamental') : 0xead5;
|
|
var REACT_RESPONDER_TYPE = hasSymbol ? Symbol.for('react.responder') : 0xead6;
|
|
var REACT_SCOPE_TYPE = hasSymbol ? Symbol.for('react.scope') : 0xead7;
|
|
|
|
function isValidElementType(type) {
|
|
return typeof type === 'string' || typeof type === 'function' || // Note: its typeof might be other than 'symbol' or 'number' if it's a polyfill.
|
|
type === REACT_FRAGMENT_TYPE || type === REACT_CONCURRENT_MODE_TYPE || type === REACT_PROFILER_TYPE || type === REACT_STRICT_MODE_TYPE || type === REACT_SUSPENSE_TYPE || type === REACT_SUSPENSE_LIST_TYPE || typeof type === 'object' && type !== null && (type.$$typeof === REACT_LAZY_TYPE || type.$$typeof === REACT_MEMO_TYPE || type.$$typeof === REACT_PROVIDER_TYPE || type.$$typeof === REACT_CONTEXT_TYPE || type.$$typeof === REACT_FORWARD_REF_TYPE || type.$$typeof === REACT_FUNDAMENTAL_TYPE || type.$$typeof === REACT_RESPONDER_TYPE || type.$$typeof === REACT_SCOPE_TYPE || type.$$typeof === REACT_BLOCK_TYPE);
|
|
}
|
|
|
|
function typeOf(object) {
|
|
if (typeof object === 'object' && object !== null) {
|
|
var $$typeof = object.$$typeof;
|
|
|
|
switch ($$typeof) {
|
|
case REACT_ELEMENT_TYPE:
|
|
var type = object.type;
|
|
|
|
switch (type) {
|
|
case REACT_ASYNC_MODE_TYPE:
|
|
case REACT_CONCURRENT_MODE_TYPE:
|
|
case REACT_FRAGMENT_TYPE:
|
|
case REACT_PROFILER_TYPE:
|
|
case REACT_STRICT_MODE_TYPE:
|
|
case REACT_SUSPENSE_TYPE:
|
|
return type;
|
|
|
|
default:
|
|
var $$typeofType = type && type.$$typeof;
|
|
|
|
switch ($$typeofType) {
|
|
case REACT_CONTEXT_TYPE:
|
|
case REACT_FORWARD_REF_TYPE:
|
|
case REACT_LAZY_TYPE:
|
|
case REACT_MEMO_TYPE:
|
|
case REACT_PROVIDER_TYPE:
|
|
return $$typeofType;
|
|
|
|
default:
|
|
return $$typeof;
|
|
}
|
|
|
|
}
|
|
|
|
case REACT_PORTAL_TYPE:
|
|
return $$typeof;
|
|
}
|
|
}
|
|
|
|
return undefined;
|
|
} // AsyncMode is deprecated along with isAsyncMode
|
|
|
|
var AsyncMode = REACT_ASYNC_MODE_TYPE;
|
|
var ConcurrentMode = REACT_CONCURRENT_MODE_TYPE;
|
|
var ContextConsumer = REACT_CONTEXT_TYPE;
|
|
var ContextProvider = REACT_PROVIDER_TYPE;
|
|
var Element = REACT_ELEMENT_TYPE;
|
|
var ForwardRef = REACT_FORWARD_REF_TYPE;
|
|
var Fragment = REACT_FRAGMENT_TYPE;
|
|
var Lazy = REACT_LAZY_TYPE;
|
|
var Memo = REACT_MEMO_TYPE;
|
|
var Portal = REACT_PORTAL_TYPE;
|
|
var Profiler = REACT_PROFILER_TYPE;
|
|
var StrictMode = REACT_STRICT_MODE_TYPE;
|
|
var Suspense = REACT_SUSPENSE_TYPE;
|
|
var hasWarnedAboutDeprecatedIsAsyncMode = false; // AsyncMode should be deprecated
|
|
|
|
function isAsyncMode(object) {
|
|
{
|
|
if (!hasWarnedAboutDeprecatedIsAsyncMode) {
|
|
hasWarnedAboutDeprecatedIsAsyncMode = true; // Using console['warn'] to evade Babel and ESLint
|
|
|
|
console['warn']('The ReactIs.isAsyncMode() alias has been deprecated, ' + 'and will be removed in React 17+. Update your code to use ' + 'ReactIs.isConcurrentMode() instead. It has the exact same API.');
|
|
}
|
|
}
|
|
|
|
return isConcurrentMode(object) || typeOf(object) === REACT_ASYNC_MODE_TYPE;
|
|
}
|
|
function isConcurrentMode(object) {
|
|
return typeOf(object) === REACT_CONCURRENT_MODE_TYPE;
|
|
}
|
|
function isContextConsumer(object) {
|
|
return typeOf(object) === REACT_CONTEXT_TYPE;
|
|
}
|
|
function isContextProvider(object) {
|
|
return typeOf(object) === REACT_PROVIDER_TYPE;
|
|
}
|
|
function isElement(object) {
|
|
return typeof object === 'object' && object !== null && object.$$typeof === REACT_ELEMENT_TYPE;
|
|
}
|
|
function isForwardRef(object) {
|
|
return typeOf(object) === REACT_FORWARD_REF_TYPE;
|
|
}
|
|
function isFragment(object) {
|
|
return typeOf(object) === REACT_FRAGMENT_TYPE;
|
|
}
|
|
function isLazy(object) {
|
|
return typeOf(object) === REACT_LAZY_TYPE;
|
|
}
|
|
function isMemo(object) {
|
|
return typeOf(object) === REACT_MEMO_TYPE;
|
|
}
|
|
function isPortal(object) {
|
|
return typeOf(object) === REACT_PORTAL_TYPE;
|
|
}
|
|
function isProfiler(object) {
|
|
return typeOf(object) === REACT_PROFILER_TYPE;
|
|
}
|
|
function isStrictMode(object) {
|
|
return typeOf(object) === REACT_STRICT_MODE_TYPE;
|
|
}
|
|
function isSuspense(object) {
|
|
return typeOf(object) === REACT_SUSPENSE_TYPE;
|
|
}
|
|
|
|
exports.AsyncMode = AsyncMode;
|
|
exports.ConcurrentMode = ConcurrentMode;
|
|
exports.ContextConsumer = ContextConsumer;
|
|
exports.ContextProvider = ContextProvider;
|
|
exports.Element = Element;
|
|
exports.ForwardRef = ForwardRef;
|
|
exports.Fragment = Fragment;
|
|
exports.Lazy = Lazy;
|
|
exports.Memo = Memo;
|
|
exports.Portal = Portal;
|
|
exports.Profiler = Profiler;
|
|
exports.StrictMode = StrictMode;
|
|
exports.Suspense = Suspense;
|
|
exports.isAsyncMode = isAsyncMode;
|
|
exports.isConcurrentMode = isConcurrentMode;
|
|
exports.isContextConsumer = isContextConsumer;
|
|
exports.isContextProvider = isContextProvider;
|
|
exports.isElement = isElement;
|
|
exports.isForwardRef = isForwardRef;
|
|
exports.isFragment = isFragment;
|
|
exports.isLazy = isLazy;
|
|
exports.isMemo = isMemo;
|
|
exports.isPortal = isPortal;
|
|
exports.isProfiler = isProfiler;
|
|
exports.isStrictMode = isStrictMode;
|
|
exports.isSuspense = isSuspense;
|
|
exports.isValidElementType = isValidElementType;
|
|
exports.typeOf = typeOf;
|
|
})();
|
|
}
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/prop-types/node_modules/react-is/index.js":
|
|
/*!*****************************************************************!*\
|
|
!*** ../node_modules/prop-types/node_modules/react-is/index.js ***!
|
|
\*****************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
|
|
if (false) {} else {
|
|
module.exports = __webpack_require__(/*! ./cjs/react-is.development.js */ "../node_modules/prop-types/node_modules/react-is/cjs/react-is.development.js");
|
|
}
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/react-lifecycles-compat/react-lifecycles-compat.es.js":
|
|
/*!*****************************************************************************!*\
|
|
!*** ../node_modules/react-lifecycles-compat/react-lifecycles-compat.es.js ***!
|
|
\*****************************************************************************/
|
|
/***/ ((__unused_webpack_module, __webpack_exports__, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
__webpack_require__.r(__webpack_exports__);
|
|
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
|
|
/* harmony export */ polyfill: () => (/* binding */ polyfill)
|
|
/* harmony export */ });
|
|
/**
|
|
* Copyright (c) 2013-present, Facebook, Inc.
|
|
*
|
|
* This source code is licensed under the MIT license found in the
|
|
* LICENSE file in the root directory of this source tree.
|
|
*/
|
|
|
|
function componentWillMount() {
|
|
// Call this.constructor.gDSFP to support sub-classes.
|
|
var state = this.constructor.getDerivedStateFromProps(this.props, this.state);
|
|
if (state !== null && state !== undefined) {
|
|
this.setState(state);
|
|
}
|
|
}
|
|
|
|
function componentWillReceiveProps(nextProps) {
|
|
// Call this.constructor.gDSFP to support sub-classes.
|
|
// Use the setState() updater to ensure state isn't stale in certain edge cases.
|
|
function updater(prevState) {
|
|
var state = this.constructor.getDerivedStateFromProps(nextProps, prevState);
|
|
return state !== null && state !== undefined ? state : null;
|
|
}
|
|
// Binding "this" is important for shallow renderer support.
|
|
this.setState(updater.bind(this));
|
|
}
|
|
|
|
function componentWillUpdate(nextProps, nextState) {
|
|
try {
|
|
var prevProps = this.props;
|
|
var prevState = this.state;
|
|
this.props = nextProps;
|
|
this.state = nextState;
|
|
this.__reactInternalSnapshotFlag = true;
|
|
this.__reactInternalSnapshot = this.getSnapshotBeforeUpdate(
|
|
prevProps,
|
|
prevState
|
|
);
|
|
} finally {
|
|
this.props = prevProps;
|
|
this.state = prevState;
|
|
}
|
|
}
|
|
|
|
// React may warn about cWM/cWRP/cWU methods being deprecated.
|
|
// Add a flag to suppress these warnings for this special case.
|
|
componentWillMount.__suppressDeprecationWarning = true;
|
|
componentWillReceiveProps.__suppressDeprecationWarning = true;
|
|
componentWillUpdate.__suppressDeprecationWarning = true;
|
|
|
|
function polyfill(Component) {
|
|
var prototype = Component.prototype;
|
|
|
|
if (!prototype || !prototype.isReactComponent) {
|
|
throw new Error('Can only polyfill class components');
|
|
}
|
|
|
|
if (
|
|
typeof Component.getDerivedStateFromProps !== 'function' &&
|
|
typeof prototype.getSnapshotBeforeUpdate !== 'function'
|
|
) {
|
|
return Component;
|
|
}
|
|
|
|
// If new component APIs are defined, "unsafe" lifecycles won't be called.
|
|
// Error if any of these lifecycles are present,
|
|
// Because they would work differently between older and newer (16.3+) versions of React.
|
|
var foundWillMountName = null;
|
|
var foundWillReceivePropsName = null;
|
|
var foundWillUpdateName = null;
|
|
if (typeof prototype.componentWillMount === 'function') {
|
|
foundWillMountName = 'componentWillMount';
|
|
} else if (typeof prototype.UNSAFE_componentWillMount === 'function') {
|
|
foundWillMountName = 'UNSAFE_componentWillMount';
|
|
}
|
|
if (typeof prototype.componentWillReceiveProps === 'function') {
|
|
foundWillReceivePropsName = 'componentWillReceiveProps';
|
|
} else if (typeof prototype.UNSAFE_componentWillReceiveProps === 'function') {
|
|
foundWillReceivePropsName = 'UNSAFE_componentWillReceiveProps';
|
|
}
|
|
if (typeof prototype.componentWillUpdate === 'function') {
|
|
foundWillUpdateName = 'componentWillUpdate';
|
|
} else if (typeof prototype.UNSAFE_componentWillUpdate === 'function') {
|
|
foundWillUpdateName = 'UNSAFE_componentWillUpdate';
|
|
}
|
|
if (
|
|
foundWillMountName !== null ||
|
|
foundWillReceivePropsName !== null ||
|
|
foundWillUpdateName !== null
|
|
) {
|
|
var componentName = Component.displayName || Component.name;
|
|
var newApiName =
|
|
typeof Component.getDerivedStateFromProps === 'function'
|
|
? 'getDerivedStateFromProps()'
|
|
: 'getSnapshotBeforeUpdate()';
|
|
|
|
throw Error(
|
|
'Unsafe legacy lifecycles will not be called for components using new component APIs.\n\n' +
|
|
componentName +
|
|
' uses ' +
|
|
newApiName +
|
|
' but also contains the following legacy lifecycles:' +
|
|
(foundWillMountName !== null ? '\n ' + foundWillMountName : '') +
|
|
(foundWillReceivePropsName !== null
|
|
? '\n ' + foundWillReceivePropsName
|
|
: '') +
|
|
(foundWillUpdateName !== null ? '\n ' + foundWillUpdateName : '') +
|
|
'\n\nThe above lifecycles should be removed. Learn more about this warning here:\n' +
|
|
'https://fb.me/react-async-component-lifecycle-hooks'
|
|
);
|
|
}
|
|
|
|
// React <= 16.2 does not support static getDerivedStateFromProps.
|
|
// As a workaround, use cWM and cWRP to invoke the new static lifecycle.
|
|
// Newer versions of React will ignore these lifecycles if gDSFP exists.
|
|
if (typeof Component.getDerivedStateFromProps === 'function') {
|
|
prototype.componentWillMount = componentWillMount;
|
|
prototype.componentWillReceiveProps = componentWillReceiveProps;
|
|
}
|
|
|
|
// React <= 16.2 does not support getSnapshotBeforeUpdate.
|
|
// As a workaround, use cWU to invoke the new lifecycle.
|
|
// Newer versions of React will ignore that lifecycle if gSBU exists.
|
|
if (typeof prototype.getSnapshotBeforeUpdate === 'function') {
|
|
if (typeof prototype.componentDidUpdate !== 'function') {
|
|
throw new Error(
|
|
'Cannot polyfill getSnapshotBeforeUpdate() for components that do not define componentDidUpdate() on the prototype'
|
|
);
|
|
}
|
|
|
|
prototype.componentWillUpdate = componentWillUpdate;
|
|
|
|
var componentDidUpdate = prototype.componentDidUpdate;
|
|
|
|
prototype.componentDidUpdate = function componentDidUpdatePolyfill(
|
|
prevProps,
|
|
prevState,
|
|
maybeSnapshot
|
|
) {
|
|
// 16.3+ will not execute our will-update method;
|
|
// It will pass a snapshot value to did-update though.
|
|
// Older versions will require our polyfilled will-update value.
|
|
// We need to handle both cases, but can't just check for the presence of "maybeSnapshot",
|
|
// Because for <= 15.x versions this might be a "prevContext" object.
|
|
// We also can't just check "__reactInternalSnapshot",
|
|
// Because get-snapshot might return a falsy value.
|
|
// So check for the explicit __reactInternalSnapshotFlag flag to determine behavior.
|
|
var snapshot = this.__reactInternalSnapshotFlag
|
|
? this.__reactInternalSnapshot
|
|
: maybeSnapshot;
|
|
|
|
componentDidUpdate.call(this, prevProps, prevState, snapshot);
|
|
};
|
|
}
|
|
|
|
return Component;
|
|
}
|
|
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/warning/warning.js":
|
|
/*!******************************************!*\
|
|
!*** ../node_modules/warning/warning.js ***!
|
|
\******************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
/**
|
|
* Copyright (c) 2014-present, Facebook, Inc.
|
|
*
|
|
* This source code is licensed under the MIT license found in the
|
|
* LICENSE file in the root directory of this source tree.
|
|
*/
|
|
|
|
|
|
|
|
/**
|
|
* Similar to invariant but only logs a warning if the condition is not met.
|
|
* This can be used to log issues in development environments in critical
|
|
* paths. Removing the logging code for production environments will keep the
|
|
* same logic and follow the same code paths.
|
|
*/
|
|
|
|
var __DEV__ = "development" !== 'production';
|
|
|
|
var warning = function() {};
|
|
|
|
if (__DEV__) {
|
|
var printWarning = function printWarning(format, args) {
|
|
var len = arguments.length;
|
|
args = new Array(len > 1 ? len - 1 : 0);
|
|
for (var key = 1; key < len; key++) {
|
|
args[key - 1] = arguments[key];
|
|
}
|
|
var argIndex = 0;
|
|
var message = 'Warning: ' +
|
|
format.replace(/%s/g, function() {
|
|
return args[argIndex++];
|
|
});
|
|
if (typeof console !== 'undefined') {
|
|
console.error(message);
|
|
}
|
|
try {
|
|
// --- Welcome to debugging React ---
|
|
// This error was thrown as a convenience so that you can use this stack
|
|
// to find the callsite that caused this warning to fire.
|
|
throw new Error(message);
|
|
} catch (x) {}
|
|
}
|
|
|
|
warning = function(condition, format, args) {
|
|
var len = arguments.length;
|
|
args = new Array(len > 2 ? len - 2 : 0);
|
|
for (var key = 2; key < len; key++) {
|
|
args[key - 2] = arguments[key];
|
|
}
|
|
if (format === undefined) {
|
|
throw new Error(
|
|
'`warning(condition, format, ...args)` requires a warning ' +
|
|
'message argument'
|
|
);
|
|
}
|
|
if (!condition) {
|
|
printWarning.apply(null, [format].concat(args));
|
|
}
|
|
};
|
|
}
|
|
|
|
module.exports = warning;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "react":
|
|
/*!************************!*\
|
|
!*** external "React" ***!
|
|
\************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
module.exports = React;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "react-dom":
|
|
/*!***************************!*\
|
|
!*** external "ReactDOM" ***!
|
|
\***************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
module.exports = ReactDOM;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "@elementor/app-ui":
|
|
/*!*********************************************!*\
|
|
!*** external "elementorAppPackages.appUi" ***!
|
|
\*********************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
module.exports = elementorAppPackages.appUi;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "@elementor/hooks":
|
|
/*!*********************************************!*\
|
|
!*** external "elementorAppPackages.hooks" ***!
|
|
\*********************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
module.exports = elementorAppPackages.hooks;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "@elementor/router":
|
|
/*!**********************************************!*\
|
|
!*** external "elementorAppPackages.router" ***!
|
|
\**********************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
module.exports = elementorAppPackages.router;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "@elementor/site-editor":
|
|
/*!**************************************************!*\
|
|
!*** external "elementorAppPackages.siteEditor" ***!
|
|
\**************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
module.exports = elementorAppPackages.siteEditor;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "@wordpress/i18n":
|
|
/*!**************************!*\
|
|
!*** external "wp.i18n" ***!
|
|
\**************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
module.exports = wp.i18n;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/@babel/runtime/helpers/extends.js":
|
|
/*!*********************************************************!*\
|
|
!*** ../node_modules/@babel/runtime/helpers/extends.js ***!
|
|
\*********************************************************/
|
|
/***/ ((module) => {
|
|
|
|
function _extends() {
|
|
return module.exports = _extends = Object.assign ? Object.assign.bind() : function (n) {
|
|
for (var e = 1; e < arguments.length; e++) {
|
|
var t = arguments[e];
|
|
for (var r in t) ({}).hasOwnProperty.call(t, r) && (n[r] = t[r]);
|
|
}
|
|
return n;
|
|
}, module.exports.__esModule = true, module.exports["default"] = module.exports, _extends.apply(null, arguments);
|
|
}
|
|
module.exports = _extends, module.exports.__esModule = true, module.exports["default"] = module.exports;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js":
|
|
/*!***********************************************************************!*\
|
|
!*** ../node_modules/@babel/runtime/helpers/interopRequireDefault.js ***!
|
|
\***********************************************************************/
|
|
/***/ ((module) => {
|
|
|
|
function _interopRequireDefault(e) {
|
|
return e && e.__esModule ? e : {
|
|
"default": e
|
|
};
|
|
}
|
|
module.exports = _interopRequireDefault, module.exports.__esModule = true, module.exports["default"] = module.exports;
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/a-callable.js":
|
|
/*!*******************************************************!*\
|
|
!*** ../node_modules/core-js/internals/a-callable.js ***!
|
|
\*******************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var isCallable = __webpack_require__(/*! ../internals/is-callable */ "../node_modules/core-js/internals/is-callable.js");
|
|
var tryToString = __webpack_require__(/*! ../internals/try-to-string */ "../node_modules/core-js/internals/try-to-string.js");
|
|
|
|
var $TypeError = TypeError;
|
|
|
|
// `Assert: IsCallable(argument) is true`
|
|
module.exports = function (argument) {
|
|
if (isCallable(argument)) return argument;
|
|
throw new $TypeError(tryToString(argument) + ' is not a function');
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/add-to-unscopables.js":
|
|
/*!***************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/add-to-unscopables.js ***!
|
|
\***************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var wellKnownSymbol = __webpack_require__(/*! ../internals/well-known-symbol */ "../node_modules/core-js/internals/well-known-symbol.js");
|
|
var create = __webpack_require__(/*! ../internals/object-create */ "../node_modules/core-js/internals/object-create.js");
|
|
var defineProperty = (__webpack_require__(/*! ../internals/object-define-property */ "../node_modules/core-js/internals/object-define-property.js").f);
|
|
|
|
var UNSCOPABLES = wellKnownSymbol('unscopables');
|
|
var ArrayPrototype = Array.prototype;
|
|
|
|
// Array.prototype[@@unscopables]
|
|
// https://tc39.es/ecma262/#sec-array.prototype-@@unscopables
|
|
if (ArrayPrototype[UNSCOPABLES] === undefined) {
|
|
defineProperty(ArrayPrototype, UNSCOPABLES, {
|
|
configurable: true,
|
|
value: create(null)
|
|
});
|
|
}
|
|
|
|
// add a key to Array.prototype[@@unscopables]
|
|
module.exports = function (key) {
|
|
ArrayPrototype[UNSCOPABLES][key] = true;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/an-object.js":
|
|
/*!******************************************************!*\
|
|
!*** ../node_modules/core-js/internals/an-object.js ***!
|
|
\******************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var isObject = __webpack_require__(/*! ../internals/is-object */ "../node_modules/core-js/internals/is-object.js");
|
|
|
|
var $String = String;
|
|
var $TypeError = TypeError;
|
|
|
|
// `Assert: Type(argument) is Object`
|
|
module.exports = function (argument) {
|
|
if (isObject(argument)) return argument;
|
|
throw new $TypeError($String(argument) + ' is not an object');
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/array-includes.js":
|
|
/*!***********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/array-includes.js ***!
|
|
\***********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var toIndexedObject = __webpack_require__(/*! ../internals/to-indexed-object */ "../node_modules/core-js/internals/to-indexed-object.js");
|
|
var toAbsoluteIndex = __webpack_require__(/*! ../internals/to-absolute-index */ "../node_modules/core-js/internals/to-absolute-index.js");
|
|
var lengthOfArrayLike = __webpack_require__(/*! ../internals/length-of-array-like */ "../node_modules/core-js/internals/length-of-array-like.js");
|
|
|
|
// `Array.prototype.{ indexOf, includes }` methods implementation
|
|
var createMethod = function (IS_INCLUDES) {
|
|
return function ($this, el, fromIndex) {
|
|
var O = toIndexedObject($this);
|
|
var length = lengthOfArrayLike(O);
|
|
if (length === 0) return !IS_INCLUDES && -1;
|
|
var index = toAbsoluteIndex(fromIndex, length);
|
|
var value;
|
|
// Array#includes uses SameValueZero equality algorithm
|
|
// eslint-disable-next-line no-self-compare -- NaN check
|
|
if (IS_INCLUDES && el !== el) while (length > index) {
|
|
value = O[index++];
|
|
// eslint-disable-next-line no-self-compare -- NaN check
|
|
if (value !== value) return true;
|
|
// Array#indexOf ignores holes, Array#includes - not
|
|
} else for (;length > index; index++) {
|
|
if ((IS_INCLUDES || index in O) && O[index] === el) return IS_INCLUDES || index || 0;
|
|
} return !IS_INCLUDES && -1;
|
|
};
|
|
};
|
|
|
|
module.exports = {
|
|
// `Array.prototype.includes` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.includes
|
|
includes: createMethod(true),
|
|
// `Array.prototype.indexOf` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.indexof
|
|
indexOf: createMethod(false)
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/array-set-length.js":
|
|
/*!*************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/array-set-length.js ***!
|
|
\*************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var DESCRIPTORS = __webpack_require__(/*! ../internals/descriptors */ "../node_modules/core-js/internals/descriptors.js");
|
|
var isArray = __webpack_require__(/*! ../internals/is-array */ "../node_modules/core-js/internals/is-array.js");
|
|
|
|
var $TypeError = TypeError;
|
|
// eslint-disable-next-line es/no-object-getownpropertydescriptor -- safe
|
|
var getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor;
|
|
|
|
// Safari < 13 does not throw an error in this case
|
|
var SILENT_ON_NON_WRITABLE_LENGTH_SET = DESCRIPTORS && !function () {
|
|
// makes no sense without proper strict mode support
|
|
if (this !== undefined) return true;
|
|
try {
|
|
// eslint-disable-next-line es/no-object-defineproperty -- safe
|
|
Object.defineProperty([], 'length', { writable: false }).length = 1;
|
|
} catch (error) {
|
|
return error instanceof TypeError;
|
|
}
|
|
}();
|
|
|
|
module.exports = SILENT_ON_NON_WRITABLE_LENGTH_SET ? function (O, length) {
|
|
if (isArray(O) && !getOwnPropertyDescriptor(O, 'length').writable) {
|
|
throw new $TypeError('Cannot set read only .length');
|
|
} return O.length = length;
|
|
} : function (O, length) {
|
|
return O.length = length;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/classof-raw.js":
|
|
/*!********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/classof-raw.js ***!
|
|
\********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var uncurryThis = __webpack_require__(/*! ../internals/function-uncurry-this */ "../node_modules/core-js/internals/function-uncurry-this.js");
|
|
|
|
var toString = uncurryThis({}.toString);
|
|
var stringSlice = uncurryThis(''.slice);
|
|
|
|
module.exports = function (it) {
|
|
return stringSlice(toString(it), 8, -1);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/copy-constructor-properties.js":
|
|
/*!************************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/copy-constructor-properties.js ***!
|
|
\************************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var hasOwn = __webpack_require__(/*! ../internals/has-own-property */ "../node_modules/core-js/internals/has-own-property.js");
|
|
var ownKeys = __webpack_require__(/*! ../internals/own-keys */ "../node_modules/core-js/internals/own-keys.js");
|
|
var getOwnPropertyDescriptorModule = __webpack_require__(/*! ../internals/object-get-own-property-descriptor */ "../node_modules/core-js/internals/object-get-own-property-descriptor.js");
|
|
var definePropertyModule = __webpack_require__(/*! ../internals/object-define-property */ "../node_modules/core-js/internals/object-define-property.js");
|
|
|
|
module.exports = function (target, source, exceptions) {
|
|
var keys = ownKeys(source);
|
|
var defineProperty = definePropertyModule.f;
|
|
var getOwnPropertyDescriptor = getOwnPropertyDescriptorModule.f;
|
|
for (var i = 0; i < keys.length; i++) {
|
|
var key = keys[i];
|
|
if (!hasOwn(target, key) && !(exceptions && hasOwn(exceptions, key))) {
|
|
defineProperty(target, key, getOwnPropertyDescriptor(source, key));
|
|
}
|
|
}
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/create-non-enumerable-property.js":
|
|
/*!***************************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/create-non-enumerable-property.js ***!
|
|
\***************************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var DESCRIPTORS = __webpack_require__(/*! ../internals/descriptors */ "../node_modules/core-js/internals/descriptors.js");
|
|
var definePropertyModule = __webpack_require__(/*! ../internals/object-define-property */ "../node_modules/core-js/internals/object-define-property.js");
|
|
var createPropertyDescriptor = __webpack_require__(/*! ../internals/create-property-descriptor */ "../node_modules/core-js/internals/create-property-descriptor.js");
|
|
|
|
module.exports = DESCRIPTORS ? function (object, key, value) {
|
|
return definePropertyModule.f(object, key, createPropertyDescriptor(1, value));
|
|
} : function (object, key, value) {
|
|
object[key] = value;
|
|
return object;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/create-property-descriptor.js":
|
|
/*!***********************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/create-property-descriptor.js ***!
|
|
\***********************************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
module.exports = function (bitmap, value) {
|
|
return {
|
|
enumerable: !(bitmap & 1),
|
|
configurable: !(bitmap & 2),
|
|
writable: !(bitmap & 4),
|
|
value: value
|
|
};
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/define-built-in.js":
|
|
/*!************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/define-built-in.js ***!
|
|
\************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var isCallable = __webpack_require__(/*! ../internals/is-callable */ "../node_modules/core-js/internals/is-callable.js");
|
|
var definePropertyModule = __webpack_require__(/*! ../internals/object-define-property */ "../node_modules/core-js/internals/object-define-property.js");
|
|
var makeBuiltIn = __webpack_require__(/*! ../internals/make-built-in */ "../node_modules/core-js/internals/make-built-in.js");
|
|
var defineGlobalProperty = __webpack_require__(/*! ../internals/define-global-property */ "../node_modules/core-js/internals/define-global-property.js");
|
|
|
|
module.exports = function (O, key, value, options) {
|
|
if (!options) options = {};
|
|
var simple = options.enumerable;
|
|
var name = options.name !== undefined ? options.name : key;
|
|
if (isCallable(value)) makeBuiltIn(value, name, options);
|
|
if (options.global) {
|
|
if (simple) O[key] = value;
|
|
else defineGlobalProperty(key, value);
|
|
} else {
|
|
try {
|
|
if (!options.unsafe) delete O[key];
|
|
else if (O[key]) simple = true;
|
|
} catch (error) { /* empty */ }
|
|
if (simple) O[key] = value;
|
|
else definePropertyModule.f(O, key, {
|
|
value: value,
|
|
enumerable: false,
|
|
configurable: !options.nonConfigurable,
|
|
writable: !options.nonWritable
|
|
});
|
|
} return O;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/define-global-property.js":
|
|
/*!*******************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/define-global-property.js ***!
|
|
\*******************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var globalThis = __webpack_require__(/*! ../internals/global-this */ "../node_modules/core-js/internals/global-this.js");
|
|
|
|
// eslint-disable-next-line es/no-object-defineproperty -- safe
|
|
var defineProperty = Object.defineProperty;
|
|
|
|
module.exports = function (key, value) {
|
|
try {
|
|
defineProperty(globalThis, key, { value: value, configurable: true, writable: true });
|
|
} catch (error) {
|
|
globalThis[key] = value;
|
|
} return value;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/descriptors.js":
|
|
/*!********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/descriptors.js ***!
|
|
\********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var fails = __webpack_require__(/*! ../internals/fails */ "../node_modules/core-js/internals/fails.js");
|
|
|
|
// Detect IE8's incomplete defineProperty implementation
|
|
module.exports = !fails(function () {
|
|
// eslint-disable-next-line es/no-object-defineproperty -- required for testing
|
|
return Object.defineProperty({}, 1, { get: function () { return 7; } })[1] !== 7;
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/document-create-element.js":
|
|
/*!********************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/document-create-element.js ***!
|
|
\********************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var globalThis = __webpack_require__(/*! ../internals/global-this */ "../node_modules/core-js/internals/global-this.js");
|
|
var isObject = __webpack_require__(/*! ../internals/is-object */ "../node_modules/core-js/internals/is-object.js");
|
|
|
|
var document = globalThis.document;
|
|
// typeof document.createElement is 'object' in old IE
|
|
var EXISTS = isObject(document) && isObject(document.createElement);
|
|
|
|
module.exports = function (it) {
|
|
return EXISTS ? document.createElement(it) : {};
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/does-not-exceed-safe-integer.js":
|
|
/*!*************************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/does-not-exceed-safe-integer.js ***!
|
|
\*************************************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
var $TypeError = TypeError;
|
|
var MAX_SAFE_INTEGER = 0x1FFFFFFFFFFFFF; // 2 ** 53 - 1 == 9007199254740991
|
|
|
|
module.exports = function (it) {
|
|
if (it > MAX_SAFE_INTEGER) throw $TypeError('Maximum allowed index exceeded');
|
|
return it;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/enum-bug-keys.js":
|
|
/*!**********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/enum-bug-keys.js ***!
|
|
\**********************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
// IE8- don't enum bug keys
|
|
module.exports = [
|
|
'constructor',
|
|
'hasOwnProperty',
|
|
'isPrototypeOf',
|
|
'propertyIsEnumerable',
|
|
'toLocaleString',
|
|
'toString',
|
|
'valueOf'
|
|
];
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/environment-user-agent.js":
|
|
/*!*******************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/environment-user-agent.js ***!
|
|
\*******************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var globalThis = __webpack_require__(/*! ../internals/global-this */ "../node_modules/core-js/internals/global-this.js");
|
|
|
|
var navigator = globalThis.navigator;
|
|
var userAgent = navigator && navigator.userAgent;
|
|
|
|
module.exports = userAgent ? String(userAgent) : '';
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/environment-v8-version.js":
|
|
/*!*******************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/environment-v8-version.js ***!
|
|
\*******************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var globalThis = __webpack_require__(/*! ../internals/global-this */ "../node_modules/core-js/internals/global-this.js");
|
|
var userAgent = __webpack_require__(/*! ../internals/environment-user-agent */ "../node_modules/core-js/internals/environment-user-agent.js");
|
|
|
|
var process = globalThis.process;
|
|
var Deno = globalThis.Deno;
|
|
var versions = process && process.versions || Deno && Deno.version;
|
|
var v8 = versions && versions.v8;
|
|
var match, version;
|
|
|
|
if (v8) {
|
|
match = v8.split('.');
|
|
// in old Chrome, versions of V8 isn't V8 = Chrome / 10
|
|
// but their correct versions are not interesting for us
|
|
version = match[0] > 0 && match[0] < 4 ? 1 : +(match[0] + match[1]);
|
|
}
|
|
|
|
// BrowserFS NodeJS `process` polyfill incorrectly set `.v8` to `0.0`
|
|
// so check `userAgent` even if `.v8` exists, but 0
|
|
if (!version && userAgent) {
|
|
match = userAgent.match(/Edge\/(\d+)/);
|
|
if (!match || match[1] >= 74) {
|
|
match = userAgent.match(/Chrome\/(\d+)/);
|
|
if (match) version = +match[1];
|
|
}
|
|
}
|
|
|
|
module.exports = version;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/export.js":
|
|
/*!***************************************************!*\
|
|
!*** ../node_modules/core-js/internals/export.js ***!
|
|
\***************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var globalThis = __webpack_require__(/*! ../internals/global-this */ "../node_modules/core-js/internals/global-this.js");
|
|
var getOwnPropertyDescriptor = (__webpack_require__(/*! ../internals/object-get-own-property-descriptor */ "../node_modules/core-js/internals/object-get-own-property-descriptor.js").f);
|
|
var createNonEnumerableProperty = __webpack_require__(/*! ../internals/create-non-enumerable-property */ "../node_modules/core-js/internals/create-non-enumerable-property.js");
|
|
var defineBuiltIn = __webpack_require__(/*! ../internals/define-built-in */ "../node_modules/core-js/internals/define-built-in.js");
|
|
var defineGlobalProperty = __webpack_require__(/*! ../internals/define-global-property */ "../node_modules/core-js/internals/define-global-property.js");
|
|
var copyConstructorProperties = __webpack_require__(/*! ../internals/copy-constructor-properties */ "../node_modules/core-js/internals/copy-constructor-properties.js");
|
|
var isForced = __webpack_require__(/*! ../internals/is-forced */ "../node_modules/core-js/internals/is-forced.js");
|
|
|
|
/*
|
|
options.target - name of the target object
|
|
options.global - target is the global object
|
|
options.stat - export as static methods of target
|
|
options.proto - export as prototype methods of target
|
|
options.real - real prototype method for the `pure` version
|
|
options.forced - export even if the native feature is available
|
|
options.bind - bind methods to the target, required for the `pure` version
|
|
options.wrap - wrap constructors to preventing global pollution, required for the `pure` version
|
|
options.unsafe - use the simple assignment of property instead of delete + defineProperty
|
|
options.sham - add a flag to not completely full polyfills
|
|
options.enumerable - export as enumerable property
|
|
options.dontCallGetSet - prevent calling a getter on target
|
|
options.name - the .name of the function if it does not match the key
|
|
*/
|
|
module.exports = function (options, source) {
|
|
var TARGET = options.target;
|
|
var GLOBAL = options.global;
|
|
var STATIC = options.stat;
|
|
var FORCED, target, key, targetProperty, sourceProperty, descriptor;
|
|
if (GLOBAL) {
|
|
target = globalThis;
|
|
} else if (STATIC) {
|
|
target = globalThis[TARGET] || defineGlobalProperty(TARGET, {});
|
|
} else {
|
|
target = globalThis[TARGET] && globalThis[TARGET].prototype;
|
|
}
|
|
if (target) for (key in source) {
|
|
sourceProperty = source[key];
|
|
if (options.dontCallGetSet) {
|
|
descriptor = getOwnPropertyDescriptor(target, key);
|
|
targetProperty = descriptor && descriptor.value;
|
|
} else targetProperty = target[key];
|
|
FORCED = isForced(GLOBAL ? key : TARGET + (STATIC ? '.' : '#') + key, options.forced);
|
|
// contained in target
|
|
if (!FORCED && targetProperty !== undefined) {
|
|
if (typeof sourceProperty == typeof targetProperty) continue;
|
|
copyConstructorProperties(sourceProperty, targetProperty);
|
|
}
|
|
// add a flag to not completely full polyfills
|
|
if (options.sham || (targetProperty && targetProperty.sham)) {
|
|
createNonEnumerableProperty(sourceProperty, 'sham', true);
|
|
}
|
|
defineBuiltIn(target, key, sourceProperty, options);
|
|
}
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/fails.js":
|
|
/*!**************************************************!*\
|
|
!*** ../node_modules/core-js/internals/fails.js ***!
|
|
\**************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
module.exports = function (exec) {
|
|
try {
|
|
return !!exec();
|
|
} catch (error) {
|
|
return true;
|
|
}
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/function-bind-native.js":
|
|
/*!*****************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/function-bind-native.js ***!
|
|
\*****************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var fails = __webpack_require__(/*! ../internals/fails */ "../node_modules/core-js/internals/fails.js");
|
|
|
|
module.exports = !fails(function () {
|
|
// eslint-disable-next-line es/no-function-prototype-bind -- safe
|
|
var test = (function () { /* empty */ }).bind();
|
|
// eslint-disable-next-line no-prototype-builtins -- safe
|
|
return typeof test != 'function' || test.hasOwnProperty('prototype');
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/function-call.js":
|
|
/*!**********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/function-call.js ***!
|
|
\**********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var NATIVE_BIND = __webpack_require__(/*! ../internals/function-bind-native */ "../node_modules/core-js/internals/function-bind-native.js");
|
|
|
|
var call = Function.prototype.call;
|
|
|
|
module.exports = NATIVE_BIND ? call.bind(call) : function () {
|
|
return call.apply(call, arguments);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/function-name.js":
|
|
/*!**********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/function-name.js ***!
|
|
\**********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var DESCRIPTORS = __webpack_require__(/*! ../internals/descriptors */ "../node_modules/core-js/internals/descriptors.js");
|
|
var hasOwn = __webpack_require__(/*! ../internals/has-own-property */ "../node_modules/core-js/internals/has-own-property.js");
|
|
|
|
var FunctionPrototype = Function.prototype;
|
|
// eslint-disable-next-line es/no-object-getownpropertydescriptor -- safe
|
|
var getDescriptor = DESCRIPTORS && Object.getOwnPropertyDescriptor;
|
|
|
|
var EXISTS = hasOwn(FunctionPrototype, 'name');
|
|
// additional protection from minified / mangled / dropped function names
|
|
var PROPER = EXISTS && (function something() { /* empty */ }).name === 'something';
|
|
var CONFIGURABLE = EXISTS && (!DESCRIPTORS || (DESCRIPTORS && getDescriptor(FunctionPrototype, 'name').configurable));
|
|
|
|
module.exports = {
|
|
EXISTS: EXISTS,
|
|
PROPER: PROPER,
|
|
CONFIGURABLE: CONFIGURABLE
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/function-uncurry-this.js":
|
|
/*!******************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/function-uncurry-this.js ***!
|
|
\******************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var NATIVE_BIND = __webpack_require__(/*! ../internals/function-bind-native */ "../node_modules/core-js/internals/function-bind-native.js");
|
|
|
|
var FunctionPrototype = Function.prototype;
|
|
var call = FunctionPrototype.call;
|
|
var uncurryThisWithBind = NATIVE_BIND && FunctionPrototype.bind.bind(call, call);
|
|
|
|
module.exports = NATIVE_BIND ? uncurryThisWithBind : function (fn) {
|
|
return function () {
|
|
return call.apply(fn, arguments);
|
|
};
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/get-built-in.js":
|
|
/*!*********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/get-built-in.js ***!
|
|
\*********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var globalThis = __webpack_require__(/*! ../internals/global-this */ "../node_modules/core-js/internals/global-this.js");
|
|
var isCallable = __webpack_require__(/*! ../internals/is-callable */ "../node_modules/core-js/internals/is-callable.js");
|
|
|
|
var aFunction = function (argument) {
|
|
return isCallable(argument) ? argument : undefined;
|
|
};
|
|
|
|
module.exports = function (namespace, method) {
|
|
return arguments.length < 2 ? aFunction(globalThis[namespace]) : globalThis[namespace] && globalThis[namespace][method];
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/get-method.js":
|
|
/*!*******************************************************!*\
|
|
!*** ../node_modules/core-js/internals/get-method.js ***!
|
|
\*******************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var aCallable = __webpack_require__(/*! ../internals/a-callable */ "../node_modules/core-js/internals/a-callable.js");
|
|
var isNullOrUndefined = __webpack_require__(/*! ../internals/is-null-or-undefined */ "../node_modules/core-js/internals/is-null-or-undefined.js");
|
|
|
|
// `GetMethod` abstract operation
|
|
// https://tc39.es/ecma262/#sec-getmethod
|
|
module.exports = function (V, P) {
|
|
var func = V[P];
|
|
return isNullOrUndefined(func) ? undefined : aCallable(func);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/global-this.js":
|
|
/*!********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/global-this.js ***!
|
|
\********************************************************/
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var check = function (it) {
|
|
return it && it.Math === Math && it;
|
|
};
|
|
|
|
// https://github.com/zloirock/core-js/issues/86#issuecomment-115759028
|
|
module.exports =
|
|
// eslint-disable-next-line es/no-global-this -- safe
|
|
check(typeof globalThis == 'object' && globalThis) ||
|
|
check(typeof window == 'object' && window) ||
|
|
// eslint-disable-next-line no-restricted-globals -- safe
|
|
check(typeof self == 'object' && self) ||
|
|
check(typeof __webpack_require__.g == 'object' && __webpack_require__.g) ||
|
|
check(typeof this == 'object' && this) ||
|
|
// eslint-disable-next-line no-new-func -- fallback
|
|
(function () { return this; })() || Function('return this')();
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/has-own-property.js":
|
|
/*!*************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/has-own-property.js ***!
|
|
\*************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var uncurryThis = __webpack_require__(/*! ../internals/function-uncurry-this */ "../node_modules/core-js/internals/function-uncurry-this.js");
|
|
var toObject = __webpack_require__(/*! ../internals/to-object */ "../node_modules/core-js/internals/to-object.js");
|
|
|
|
var hasOwnProperty = uncurryThis({}.hasOwnProperty);
|
|
|
|
// `HasOwnProperty` abstract operation
|
|
// https://tc39.es/ecma262/#sec-hasownproperty
|
|
// eslint-disable-next-line es/no-object-hasown -- safe
|
|
module.exports = Object.hasOwn || function hasOwn(it, key) {
|
|
return hasOwnProperty(toObject(it), key);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/hidden-keys.js":
|
|
/*!********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/hidden-keys.js ***!
|
|
\********************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
module.exports = {};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/html.js":
|
|
/*!*************************************************!*\
|
|
!*** ../node_modules/core-js/internals/html.js ***!
|
|
\*************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var getBuiltIn = __webpack_require__(/*! ../internals/get-built-in */ "../node_modules/core-js/internals/get-built-in.js");
|
|
|
|
module.exports = getBuiltIn('document', 'documentElement');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/ie8-dom-define.js":
|
|
/*!***********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/ie8-dom-define.js ***!
|
|
\***********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var DESCRIPTORS = __webpack_require__(/*! ../internals/descriptors */ "../node_modules/core-js/internals/descriptors.js");
|
|
var fails = __webpack_require__(/*! ../internals/fails */ "../node_modules/core-js/internals/fails.js");
|
|
var createElement = __webpack_require__(/*! ../internals/document-create-element */ "../node_modules/core-js/internals/document-create-element.js");
|
|
|
|
// Thanks to IE8 for its funny defineProperty
|
|
module.exports = !DESCRIPTORS && !fails(function () {
|
|
// eslint-disable-next-line es/no-object-defineproperty -- required for testing
|
|
return Object.defineProperty(createElement('div'), 'a', {
|
|
get: function () { return 7; }
|
|
}).a !== 7;
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/indexed-object.js":
|
|
/*!***********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/indexed-object.js ***!
|
|
\***********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var uncurryThis = __webpack_require__(/*! ../internals/function-uncurry-this */ "../node_modules/core-js/internals/function-uncurry-this.js");
|
|
var fails = __webpack_require__(/*! ../internals/fails */ "../node_modules/core-js/internals/fails.js");
|
|
var classof = __webpack_require__(/*! ../internals/classof-raw */ "../node_modules/core-js/internals/classof-raw.js");
|
|
|
|
var $Object = Object;
|
|
var split = uncurryThis(''.split);
|
|
|
|
// fallback for non-array-like ES3 and non-enumerable old V8 strings
|
|
module.exports = fails(function () {
|
|
// throws an error in rhino, see https://github.com/mozilla/rhino/issues/346
|
|
// eslint-disable-next-line no-prototype-builtins -- safe
|
|
return !$Object('z').propertyIsEnumerable(0);
|
|
}) ? function (it) {
|
|
return classof(it) === 'String' ? split(it, '') : $Object(it);
|
|
} : $Object;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/inspect-source.js":
|
|
/*!***********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/inspect-source.js ***!
|
|
\***********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var uncurryThis = __webpack_require__(/*! ../internals/function-uncurry-this */ "../node_modules/core-js/internals/function-uncurry-this.js");
|
|
var isCallable = __webpack_require__(/*! ../internals/is-callable */ "../node_modules/core-js/internals/is-callable.js");
|
|
var store = __webpack_require__(/*! ../internals/shared-store */ "../node_modules/core-js/internals/shared-store.js");
|
|
|
|
var functionToString = uncurryThis(Function.toString);
|
|
|
|
// this helper broken in `core-js@3.4.1-3.4.4`, so we can't use `shared` helper
|
|
if (!isCallable(store.inspectSource)) {
|
|
store.inspectSource = function (it) {
|
|
return functionToString(it);
|
|
};
|
|
}
|
|
|
|
module.exports = store.inspectSource;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/internal-state.js":
|
|
/*!***********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/internal-state.js ***!
|
|
\***********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var NATIVE_WEAK_MAP = __webpack_require__(/*! ../internals/weak-map-basic-detection */ "../node_modules/core-js/internals/weak-map-basic-detection.js");
|
|
var globalThis = __webpack_require__(/*! ../internals/global-this */ "../node_modules/core-js/internals/global-this.js");
|
|
var isObject = __webpack_require__(/*! ../internals/is-object */ "../node_modules/core-js/internals/is-object.js");
|
|
var createNonEnumerableProperty = __webpack_require__(/*! ../internals/create-non-enumerable-property */ "../node_modules/core-js/internals/create-non-enumerable-property.js");
|
|
var hasOwn = __webpack_require__(/*! ../internals/has-own-property */ "../node_modules/core-js/internals/has-own-property.js");
|
|
var shared = __webpack_require__(/*! ../internals/shared-store */ "../node_modules/core-js/internals/shared-store.js");
|
|
var sharedKey = __webpack_require__(/*! ../internals/shared-key */ "../node_modules/core-js/internals/shared-key.js");
|
|
var hiddenKeys = __webpack_require__(/*! ../internals/hidden-keys */ "../node_modules/core-js/internals/hidden-keys.js");
|
|
|
|
var OBJECT_ALREADY_INITIALIZED = 'Object already initialized';
|
|
var TypeError = globalThis.TypeError;
|
|
var WeakMap = globalThis.WeakMap;
|
|
var set, get, has;
|
|
|
|
var enforce = function (it) {
|
|
return has(it) ? get(it) : set(it, {});
|
|
};
|
|
|
|
var getterFor = function (TYPE) {
|
|
return function (it) {
|
|
var state;
|
|
if (!isObject(it) || (state = get(it)).type !== TYPE) {
|
|
throw new TypeError('Incompatible receiver, ' + TYPE + ' required');
|
|
} return state;
|
|
};
|
|
};
|
|
|
|
if (NATIVE_WEAK_MAP || shared.state) {
|
|
var store = shared.state || (shared.state = new WeakMap());
|
|
/* eslint-disable no-self-assign -- prototype methods protection */
|
|
store.get = store.get;
|
|
store.has = store.has;
|
|
store.set = store.set;
|
|
/* eslint-enable no-self-assign -- prototype methods protection */
|
|
set = function (it, metadata) {
|
|
if (store.has(it)) throw new TypeError(OBJECT_ALREADY_INITIALIZED);
|
|
metadata.facade = it;
|
|
store.set(it, metadata);
|
|
return metadata;
|
|
};
|
|
get = function (it) {
|
|
return store.get(it) || {};
|
|
};
|
|
has = function (it) {
|
|
return store.has(it);
|
|
};
|
|
} else {
|
|
var STATE = sharedKey('state');
|
|
hiddenKeys[STATE] = true;
|
|
set = function (it, metadata) {
|
|
if (hasOwn(it, STATE)) throw new TypeError(OBJECT_ALREADY_INITIALIZED);
|
|
metadata.facade = it;
|
|
createNonEnumerableProperty(it, STATE, metadata);
|
|
return metadata;
|
|
};
|
|
get = function (it) {
|
|
return hasOwn(it, STATE) ? it[STATE] : {};
|
|
};
|
|
has = function (it) {
|
|
return hasOwn(it, STATE);
|
|
};
|
|
}
|
|
|
|
module.exports = {
|
|
set: set,
|
|
get: get,
|
|
has: has,
|
|
enforce: enforce,
|
|
getterFor: getterFor
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/is-array.js":
|
|
/*!*****************************************************!*\
|
|
!*** ../node_modules/core-js/internals/is-array.js ***!
|
|
\*****************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var classof = __webpack_require__(/*! ../internals/classof-raw */ "../node_modules/core-js/internals/classof-raw.js");
|
|
|
|
// `IsArray` abstract operation
|
|
// https://tc39.es/ecma262/#sec-isarray
|
|
// eslint-disable-next-line es/no-array-isarray -- safe
|
|
module.exports = Array.isArray || function isArray(argument) {
|
|
return classof(argument) === 'Array';
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/is-callable.js":
|
|
/*!********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/is-callable.js ***!
|
|
\********************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
// https://tc39.es/ecma262/#sec-IsHTMLDDA-internal-slot
|
|
var documentAll = typeof document == 'object' && document.all;
|
|
|
|
// `IsCallable` abstract operation
|
|
// https://tc39.es/ecma262/#sec-iscallable
|
|
// eslint-disable-next-line unicorn/no-typeof-undefined -- required for testing
|
|
module.exports = typeof documentAll == 'undefined' && documentAll !== undefined ? function (argument) {
|
|
return typeof argument == 'function' || argument === documentAll;
|
|
} : function (argument) {
|
|
return typeof argument == 'function';
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/is-forced.js":
|
|
/*!******************************************************!*\
|
|
!*** ../node_modules/core-js/internals/is-forced.js ***!
|
|
\******************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var fails = __webpack_require__(/*! ../internals/fails */ "../node_modules/core-js/internals/fails.js");
|
|
var isCallable = __webpack_require__(/*! ../internals/is-callable */ "../node_modules/core-js/internals/is-callable.js");
|
|
|
|
var replacement = /#|\.prototype\./;
|
|
|
|
var isForced = function (feature, detection) {
|
|
var value = data[normalize(feature)];
|
|
return value === POLYFILL ? true
|
|
: value === NATIVE ? false
|
|
: isCallable(detection) ? fails(detection)
|
|
: !!detection;
|
|
};
|
|
|
|
var normalize = isForced.normalize = function (string) {
|
|
return String(string).replace(replacement, '.').toLowerCase();
|
|
};
|
|
|
|
var data = isForced.data = {};
|
|
var NATIVE = isForced.NATIVE = 'N';
|
|
var POLYFILL = isForced.POLYFILL = 'P';
|
|
|
|
module.exports = isForced;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/is-null-or-undefined.js":
|
|
/*!*****************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/is-null-or-undefined.js ***!
|
|
\*****************************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
// we can't use just `it == null` since of `document.all` special case
|
|
// https://tc39.es/ecma262/#sec-IsHTMLDDA-internal-slot-aec
|
|
module.exports = function (it) {
|
|
return it === null || it === undefined;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/is-object.js":
|
|
/*!******************************************************!*\
|
|
!*** ../node_modules/core-js/internals/is-object.js ***!
|
|
\******************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var isCallable = __webpack_require__(/*! ../internals/is-callable */ "../node_modules/core-js/internals/is-callable.js");
|
|
|
|
module.exports = function (it) {
|
|
return typeof it == 'object' ? it !== null : isCallable(it);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/is-pure.js":
|
|
/*!****************************************************!*\
|
|
!*** ../node_modules/core-js/internals/is-pure.js ***!
|
|
\****************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
module.exports = false;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/is-symbol.js":
|
|
/*!******************************************************!*\
|
|
!*** ../node_modules/core-js/internals/is-symbol.js ***!
|
|
\******************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var getBuiltIn = __webpack_require__(/*! ../internals/get-built-in */ "../node_modules/core-js/internals/get-built-in.js");
|
|
var isCallable = __webpack_require__(/*! ../internals/is-callable */ "../node_modules/core-js/internals/is-callable.js");
|
|
var isPrototypeOf = __webpack_require__(/*! ../internals/object-is-prototype-of */ "../node_modules/core-js/internals/object-is-prototype-of.js");
|
|
var USE_SYMBOL_AS_UID = __webpack_require__(/*! ../internals/use-symbol-as-uid */ "../node_modules/core-js/internals/use-symbol-as-uid.js");
|
|
|
|
var $Object = Object;
|
|
|
|
module.exports = USE_SYMBOL_AS_UID ? function (it) {
|
|
return typeof it == 'symbol';
|
|
} : function (it) {
|
|
var $Symbol = getBuiltIn('Symbol');
|
|
return isCallable($Symbol) && isPrototypeOf($Symbol.prototype, $Object(it));
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/length-of-array-like.js":
|
|
/*!*****************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/length-of-array-like.js ***!
|
|
\*****************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var toLength = __webpack_require__(/*! ../internals/to-length */ "../node_modules/core-js/internals/to-length.js");
|
|
|
|
// `LengthOfArrayLike` abstract operation
|
|
// https://tc39.es/ecma262/#sec-lengthofarraylike
|
|
module.exports = function (obj) {
|
|
return toLength(obj.length);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/make-built-in.js":
|
|
/*!**********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/make-built-in.js ***!
|
|
\**********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var uncurryThis = __webpack_require__(/*! ../internals/function-uncurry-this */ "../node_modules/core-js/internals/function-uncurry-this.js");
|
|
var fails = __webpack_require__(/*! ../internals/fails */ "../node_modules/core-js/internals/fails.js");
|
|
var isCallable = __webpack_require__(/*! ../internals/is-callable */ "../node_modules/core-js/internals/is-callable.js");
|
|
var hasOwn = __webpack_require__(/*! ../internals/has-own-property */ "../node_modules/core-js/internals/has-own-property.js");
|
|
var DESCRIPTORS = __webpack_require__(/*! ../internals/descriptors */ "../node_modules/core-js/internals/descriptors.js");
|
|
var CONFIGURABLE_FUNCTION_NAME = (__webpack_require__(/*! ../internals/function-name */ "../node_modules/core-js/internals/function-name.js").CONFIGURABLE);
|
|
var inspectSource = __webpack_require__(/*! ../internals/inspect-source */ "../node_modules/core-js/internals/inspect-source.js");
|
|
var InternalStateModule = __webpack_require__(/*! ../internals/internal-state */ "../node_modules/core-js/internals/internal-state.js");
|
|
|
|
var enforceInternalState = InternalStateModule.enforce;
|
|
var getInternalState = InternalStateModule.get;
|
|
var $String = String;
|
|
// eslint-disable-next-line es/no-object-defineproperty -- safe
|
|
var defineProperty = Object.defineProperty;
|
|
var stringSlice = uncurryThis(''.slice);
|
|
var replace = uncurryThis(''.replace);
|
|
var join = uncurryThis([].join);
|
|
|
|
var CONFIGURABLE_LENGTH = DESCRIPTORS && !fails(function () {
|
|
return defineProperty(function () { /* empty */ }, 'length', { value: 8 }).length !== 8;
|
|
});
|
|
|
|
var TEMPLATE = String(String).split('String');
|
|
|
|
var makeBuiltIn = module.exports = function (value, name, options) {
|
|
if (stringSlice($String(name), 0, 7) === 'Symbol(') {
|
|
name = '[' + replace($String(name), /^Symbol\(([^)]*)\).*$/, '$1') + ']';
|
|
}
|
|
if (options && options.getter) name = 'get ' + name;
|
|
if (options && options.setter) name = 'set ' + name;
|
|
if (!hasOwn(value, 'name') || (CONFIGURABLE_FUNCTION_NAME && value.name !== name)) {
|
|
if (DESCRIPTORS) defineProperty(value, 'name', { value: name, configurable: true });
|
|
else value.name = name;
|
|
}
|
|
if (CONFIGURABLE_LENGTH && options && hasOwn(options, 'arity') && value.length !== options.arity) {
|
|
defineProperty(value, 'length', { value: options.arity });
|
|
}
|
|
try {
|
|
if (options && hasOwn(options, 'constructor') && options.constructor) {
|
|
if (DESCRIPTORS) defineProperty(value, 'prototype', { writable: false });
|
|
// in V8 ~ Chrome 53, prototypes of some methods, like `Array.prototype.values`, are non-writable
|
|
} else if (value.prototype) value.prototype = undefined;
|
|
} catch (error) { /* empty */ }
|
|
var state = enforceInternalState(value);
|
|
if (!hasOwn(state, 'source')) {
|
|
state.source = join(TEMPLATE, typeof name == 'string' ? name : '');
|
|
} return value;
|
|
};
|
|
|
|
// add fake Function#toString for correct work wrapped methods / constructors with methods like LoDash isNative
|
|
// eslint-disable-next-line no-extend-native -- required
|
|
Function.prototype.toString = makeBuiltIn(function toString() {
|
|
return isCallable(this) && getInternalState(this).source || inspectSource(this);
|
|
}, 'toString');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/math-trunc.js":
|
|
/*!*******************************************************!*\
|
|
!*** ../node_modules/core-js/internals/math-trunc.js ***!
|
|
\*******************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
var ceil = Math.ceil;
|
|
var floor = Math.floor;
|
|
|
|
// `Math.trunc` method
|
|
// https://tc39.es/ecma262/#sec-math.trunc
|
|
// eslint-disable-next-line es/no-math-trunc -- safe
|
|
module.exports = Math.trunc || function trunc(x) {
|
|
var n = +x;
|
|
return (n > 0 ? floor : ceil)(n);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/object-create.js":
|
|
/*!**********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/object-create.js ***!
|
|
\**********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
/* global ActiveXObject -- old IE, WSH */
|
|
var anObject = __webpack_require__(/*! ../internals/an-object */ "../node_modules/core-js/internals/an-object.js");
|
|
var definePropertiesModule = __webpack_require__(/*! ../internals/object-define-properties */ "../node_modules/core-js/internals/object-define-properties.js");
|
|
var enumBugKeys = __webpack_require__(/*! ../internals/enum-bug-keys */ "../node_modules/core-js/internals/enum-bug-keys.js");
|
|
var hiddenKeys = __webpack_require__(/*! ../internals/hidden-keys */ "../node_modules/core-js/internals/hidden-keys.js");
|
|
var html = __webpack_require__(/*! ../internals/html */ "../node_modules/core-js/internals/html.js");
|
|
var documentCreateElement = __webpack_require__(/*! ../internals/document-create-element */ "../node_modules/core-js/internals/document-create-element.js");
|
|
var sharedKey = __webpack_require__(/*! ../internals/shared-key */ "../node_modules/core-js/internals/shared-key.js");
|
|
|
|
var GT = '>';
|
|
var LT = '<';
|
|
var PROTOTYPE = 'prototype';
|
|
var SCRIPT = 'script';
|
|
var IE_PROTO = sharedKey('IE_PROTO');
|
|
|
|
var EmptyConstructor = function () { /* empty */ };
|
|
|
|
var scriptTag = function (content) {
|
|
return LT + SCRIPT + GT + content + LT + '/' + SCRIPT + GT;
|
|
};
|
|
|
|
// Create object with fake `null` prototype: use ActiveX Object with cleared prototype
|
|
var NullProtoObjectViaActiveX = function (activeXDocument) {
|
|
activeXDocument.write(scriptTag(''));
|
|
activeXDocument.close();
|
|
var temp = activeXDocument.parentWindow.Object;
|
|
// eslint-disable-next-line no-useless-assignment -- avoid memory leak
|
|
activeXDocument = null;
|
|
return temp;
|
|
};
|
|
|
|
// Create object with fake `null` prototype: use iframe Object with cleared prototype
|
|
var NullProtoObjectViaIFrame = function () {
|
|
// Thrash, waste and sodomy: IE GC bug
|
|
var iframe = documentCreateElement('iframe');
|
|
var JS = 'java' + SCRIPT + ':';
|
|
var iframeDocument;
|
|
iframe.style.display = 'none';
|
|
html.appendChild(iframe);
|
|
// https://github.com/zloirock/core-js/issues/475
|
|
iframe.src = String(JS);
|
|
iframeDocument = iframe.contentWindow.document;
|
|
iframeDocument.open();
|
|
iframeDocument.write(scriptTag('document.F=Object'));
|
|
iframeDocument.close();
|
|
return iframeDocument.F;
|
|
};
|
|
|
|
// Check for document.domain and active x support
|
|
// No need to use active x approach when document.domain is not set
|
|
// see https://github.com/es-shims/es5-shim/issues/150
|
|
// variation of https://github.com/kitcambridge/es5-shim/commit/4f738ac066346
|
|
// avoid IE GC bug
|
|
var activeXDocument;
|
|
var NullProtoObject = function () {
|
|
try {
|
|
activeXDocument = new ActiveXObject('htmlfile');
|
|
} catch (error) { /* ignore */ }
|
|
NullProtoObject = typeof document != 'undefined'
|
|
? document.domain && activeXDocument
|
|
? NullProtoObjectViaActiveX(activeXDocument) // old IE
|
|
: NullProtoObjectViaIFrame()
|
|
: NullProtoObjectViaActiveX(activeXDocument); // WSH
|
|
var length = enumBugKeys.length;
|
|
while (length--) delete NullProtoObject[PROTOTYPE][enumBugKeys[length]];
|
|
return NullProtoObject();
|
|
};
|
|
|
|
hiddenKeys[IE_PROTO] = true;
|
|
|
|
// `Object.create` method
|
|
// https://tc39.es/ecma262/#sec-object.create
|
|
// eslint-disable-next-line es/no-object-create -- safe
|
|
module.exports = Object.create || function create(O, Properties) {
|
|
var result;
|
|
if (O !== null) {
|
|
EmptyConstructor[PROTOTYPE] = anObject(O);
|
|
result = new EmptyConstructor();
|
|
EmptyConstructor[PROTOTYPE] = null;
|
|
// add "__proto__" for Object.getPrototypeOf polyfill
|
|
result[IE_PROTO] = O;
|
|
} else result = NullProtoObject();
|
|
return Properties === undefined ? result : definePropertiesModule.f(result, Properties);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/object-define-properties.js":
|
|
/*!*********************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/object-define-properties.js ***!
|
|
\*********************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var DESCRIPTORS = __webpack_require__(/*! ../internals/descriptors */ "../node_modules/core-js/internals/descriptors.js");
|
|
var V8_PROTOTYPE_DEFINE_BUG = __webpack_require__(/*! ../internals/v8-prototype-define-bug */ "../node_modules/core-js/internals/v8-prototype-define-bug.js");
|
|
var definePropertyModule = __webpack_require__(/*! ../internals/object-define-property */ "../node_modules/core-js/internals/object-define-property.js");
|
|
var anObject = __webpack_require__(/*! ../internals/an-object */ "../node_modules/core-js/internals/an-object.js");
|
|
var toIndexedObject = __webpack_require__(/*! ../internals/to-indexed-object */ "../node_modules/core-js/internals/to-indexed-object.js");
|
|
var objectKeys = __webpack_require__(/*! ../internals/object-keys */ "../node_modules/core-js/internals/object-keys.js");
|
|
|
|
// `Object.defineProperties` method
|
|
// https://tc39.es/ecma262/#sec-object.defineproperties
|
|
// eslint-disable-next-line es/no-object-defineproperties -- safe
|
|
exports.f = DESCRIPTORS && !V8_PROTOTYPE_DEFINE_BUG ? Object.defineProperties : function defineProperties(O, Properties) {
|
|
anObject(O);
|
|
var props = toIndexedObject(Properties);
|
|
var keys = objectKeys(Properties);
|
|
var length = keys.length;
|
|
var index = 0;
|
|
var key;
|
|
while (length > index) definePropertyModule.f(O, key = keys[index++], props[key]);
|
|
return O;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/object-define-property.js":
|
|
/*!*******************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/object-define-property.js ***!
|
|
\*******************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var DESCRIPTORS = __webpack_require__(/*! ../internals/descriptors */ "../node_modules/core-js/internals/descriptors.js");
|
|
var IE8_DOM_DEFINE = __webpack_require__(/*! ../internals/ie8-dom-define */ "../node_modules/core-js/internals/ie8-dom-define.js");
|
|
var V8_PROTOTYPE_DEFINE_BUG = __webpack_require__(/*! ../internals/v8-prototype-define-bug */ "../node_modules/core-js/internals/v8-prototype-define-bug.js");
|
|
var anObject = __webpack_require__(/*! ../internals/an-object */ "../node_modules/core-js/internals/an-object.js");
|
|
var toPropertyKey = __webpack_require__(/*! ../internals/to-property-key */ "../node_modules/core-js/internals/to-property-key.js");
|
|
|
|
var $TypeError = TypeError;
|
|
// eslint-disable-next-line es/no-object-defineproperty -- safe
|
|
var $defineProperty = Object.defineProperty;
|
|
// eslint-disable-next-line es/no-object-getownpropertydescriptor -- safe
|
|
var $getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor;
|
|
var ENUMERABLE = 'enumerable';
|
|
var CONFIGURABLE = 'configurable';
|
|
var WRITABLE = 'writable';
|
|
|
|
// `Object.defineProperty` method
|
|
// https://tc39.es/ecma262/#sec-object.defineproperty
|
|
exports.f = DESCRIPTORS ? V8_PROTOTYPE_DEFINE_BUG ? function defineProperty(O, P, Attributes) {
|
|
anObject(O);
|
|
P = toPropertyKey(P);
|
|
anObject(Attributes);
|
|
if (typeof O === 'function' && P === 'prototype' && 'value' in Attributes && WRITABLE in Attributes && !Attributes[WRITABLE]) {
|
|
var current = $getOwnPropertyDescriptor(O, P);
|
|
if (current && current[WRITABLE]) {
|
|
O[P] = Attributes.value;
|
|
Attributes = {
|
|
configurable: CONFIGURABLE in Attributes ? Attributes[CONFIGURABLE] : current[CONFIGURABLE],
|
|
enumerable: ENUMERABLE in Attributes ? Attributes[ENUMERABLE] : current[ENUMERABLE],
|
|
writable: false
|
|
};
|
|
}
|
|
} return $defineProperty(O, P, Attributes);
|
|
} : $defineProperty : function defineProperty(O, P, Attributes) {
|
|
anObject(O);
|
|
P = toPropertyKey(P);
|
|
anObject(Attributes);
|
|
if (IE8_DOM_DEFINE) try {
|
|
return $defineProperty(O, P, Attributes);
|
|
} catch (error) { /* empty */ }
|
|
if ('get' in Attributes || 'set' in Attributes) throw new $TypeError('Accessors not supported');
|
|
if ('value' in Attributes) O[P] = Attributes.value;
|
|
return O;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/object-get-own-property-descriptor.js":
|
|
/*!*******************************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/object-get-own-property-descriptor.js ***!
|
|
\*******************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var DESCRIPTORS = __webpack_require__(/*! ../internals/descriptors */ "../node_modules/core-js/internals/descriptors.js");
|
|
var call = __webpack_require__(/*! ../internals/function-call */ "../node_modules/core-js/internals/function-call.js");
|
|
var propertyIsEnumerableModule = __webpack_require__(/*! ../internals/object-property-is-enumerable */ "../node_modules/core-js/internals/object-property-is-enumerable.js");
|
|
var createPropertyDescriptor = __webpack_require__(/*! ../internals/create-property-descriptor */ "../node_modules/core-js/internals/create-property-descriptor.js");
|
|
var toIndexedObject = __webpack_require__(/*! ../internals/to-indexed-object */ "../node_modules/core-js/internals/to-indexed-object.js");
|
|
var toPropertyKey = __webpack_require__(/*! ../internals/to-property-key */ "../node_modules/core-js/internals/to-property-key.js");
|
|
var hasOwn = __webpack_require__(/*! ../internals/has-own-property */ "../node_modules/core-js/internals/has-own-property.js");
|
|
var IE8_DOM_DEFINE = __webpack_require__(/*! ../internals/ie8-dom-define */ "../node_modules/core-js/internals/ie8-dom-define.js");
|
|
|
|
// eslint-disable-next-line es/no-object-getownpropertydescriptor -- safe
|
|
var $getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor;
|
|
|
|
// `Object.getOwnPropertyDescriptor` method
|
|
// https://tc39.es/ecma262/#sec-object.getownpropertydescriptor
|
|
exports.f = DESCRIPTORS ? $getOwnPropertyDescriptor : function getOwnPropertyDescriptor(O, P) {
|
|
O = toIndexedObject(O);
|
|
P = toPropertyKey(P);
|
|
if (IE8_DOM_DEFINE) try {
|
|
return $getOwnPropertyDescriptor(O, P);
|
|
} catch (error) { /* empty */ }
|
|
if (hasOwn(O, P)) return createPropertyDescriptor(!call(propertyIsEnumerableModule.f, O, P), O[P]);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/object-get-own-property-names.js":
|
|
/*!**************************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/object-get-own-property-names.js ***!
|
|
\**************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var internalObjectKeys = __webpack_require__(/*! ../internals/object-keys-internal */ "../node_modules/core-js/internals/object-keys-internal.js");
|
|
var enumBugKeys = __webpack_require__(/*! ../internals/enum-bug-keys */ "../node_modules/core-js/internals/enum-bug-keys.js");
|
|
|
|
var hiddenKeys = enumBugKeys.concat('length', 'prototype');
|
|
|
|
// `Object.getOwnPropertyNames` method
|
|
// https://tc39.es/ecma262/#sec-object.getownpropertynames
|
|
// eslint-disable-next-line es/no-object-getownpropertynames -- safe
|
|
exports.f = Object.getOwnPropertyNames || function getOwnPropertyNames(O) {
|
|
return internalObjectKeys(O, hiddenKeys);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/object-get-own-property-symbols.js":
|
|
/*!****************************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/object-get-own-property-symbols.js ***!
|
|
\****************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports) => {
|
|
|
|
"use strict";
|
|
|
|
// eslint-disable-next-line es/no-object-getownpropertysymbols -- safe
|
|
exports.f = Object.getOwnPropertySymbols;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/object-is-prototype-of.js":
|
|
/*!*******************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/object-is-prototype-of.js ***!
|
|
\*******************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var uncurryThis = __webpack_require__(/*! ../internals/function-uncurry-this */ "../node_modules/core-js/internals/function-uncurry-this.js");
|
|
|
|
module.exports = uncurryThis({}.isPrototypeOf);
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/object-keys-internal.js":
|
|
/*!*****************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/object-keys-internal.js ***!
|
|
\*****************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var uncurryThis = __webpack_require__(/*! ../internals/function-uncurry-this */ "../node_modules/core-js/internals/function-uncurry-this.js");
|
|
var hasOwn = __webpack_require__(/*! ../internals/has-own-property */ "../node_modules/core-js/internals/has-own-property.js");
|
|
var toIndexedObject = __webpack_require__(/*! ../internals/to-indexed-object */ "../node_modules/core-js/internals/to-indexed-object.js");
|
|
var indexOf = (__webpack_require__(/*! ../internals/array-includes */ "../node_modules/core-js/internals/array-includes.js").indexOf);
|
|
var hiddenKeys = __webpack_require__(/*! ../internals/hidden-keys */ "../node_modules/core-js/internals/hidden-keys.js");
|
|
|
|
var push = uncurryThis([].push);
|
|
|
|
module.exports = function (object, names) {
|
|
var O = toIndexedObject(object);
|
|
var i = 0;
|
|
var result = [];
|
|
var key;
|
|
for (key in O) !hasOwn(hiddenKeys, key) && hasOwn(O, key) && push(result, key);
|
|
// Don't enum bug & hidden keys
|
|
while (names.length > i) if (hasOwn(O, key = names[i++])) {
|
|
~indexOf(result, key) || push(result, key);
|
|
}
|
|
return result;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/object-keys.js":
|
|
/*!********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/object-keys.js ***!
|
|
\********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var internalObjectKeys = __webpack_require__(/*! ../internals/object-keys-internal */ "../node_modules/core-js/internals/object-keys-internal.js");
|
|
var enumBugKeys = __webpack_require__(/*! ../internals/enum-bug-keys */ "../node_modules/core-js/internals/enum-bug-keys.js");
|
|
|
|
// `Object.keys` method
|
|
// https://tc39.es/ecma262/#sec-object.keys
|
|
// eslint-disable-next-line es/no-object-keys -- safe
|
|
module.exports = Object.keys || function keys(O) {
|
|
return internalObjectKeys(O, enumBugKeys);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/object-property-is-enumerable.js":
|
|
/*!**************************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/object-property-is-enumerable.js ***!
|
|
\**************************************************************************/
|
|
/***/ ((__unused_webpack_module, exports) => {
|
|
|
|
"use strict";
|
|
|
|
var $propertyIsEnumerable = {}.propertyIsEnumerable;
|
|
// eslint-disable-next-line es/no-object-getownpropertydescriptor -- safe
|
|
var getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor;
|
|
|
|
// Nashorn ~ JDK8 bug
|
|
var NASHORN_BUG = getOwnPropertyDescriptor && !$propertyIsEnumerable.call({ 1: 2 }, 1);
|
|
|
|
// `Object.prototype.propertyIsEnumerable` method implementation
|
|
// https://tc39.es/ecma262/#sec-object.prototype.propertyisenumerable
|
|
exports.f = NASHORN_BUG ? function propertyIsEnumerable(V) {
|
|
var descriptor = getOwnPropertyDescriptor(this, V);
|
|
return !!descriptor && descriptor.enumerable;
|
|
} : $propertyIsEnumerable;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/ordinary-to-primitive.js":
|
|
/*!******************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/ordinary-to-primitive.js ***!
|
|
\******************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var call = __webpack_require__(/*! ../internals/function-call */ "../node_modules/core-js/internals/function-call.js");
|
|
var isCallable = __webpack_require__(/*! ../internals/is-callable */ "../node_modules/core-js/internals/is-callable.js");
|
|
var isObject = __webpack_require__(/*! ../internals/is-object */ "../node_modules/core-js/internals/is-object.js");
|
|
|
|
var $TypeError = TypeError;
|
|
|
|
// `OrdinaryToPrimitive` abstract operation
|
|
// https://tc39.es/ecma262/#sec-ordinarytoprimitive
|
|
module.exports = function (input, pref) {
|
|
var fn, val;
|
|
if (pref === 'string' && isCallable(fn = input.toString) && !isObject(val = call(fn, input))) return val;
|
|
if (isCallable(fn = input.valueOf) && !isObject(val = call(fn, input))) return val;
|
|
if (pref !== 'string' && isCallable(fn = input.toString) && !isObject(val = call(fn, input))) return val;
|
|
throw new $TypeError("Can't convert object to primitive value");
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/own-keys.js":
|
|
/*!*****************************************************!*\
|
|
!*** ../node_modules/core-js/internals/own-keys.js ***!
|
|
\*****************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var getBuiltIn = __webpack_require__(/*! ../internals/get-built-in */ "../node_modules/core-js/internals/get-built-in.js");
|
|
var uncurryThis = __webpack_require__(/*! ../internals/function-uncurry-this */ "../node_modules/core-js/internals/function-uncurry-this.js");
|
|
var getOwnPropertyNamesModule = __webpack_require__(/*! ../internals/object-get-own-property-names */ "../node_modules/core-js/internals/object-get-own-property-names.js");
|
|
var getOwnPropertySymbolsModule = __webpack_require__(/*! ../internals/object-get-own-property-symbols */ "../node_modules/core-js/internals/object-get-own-property-symbols.js");
|
|
var anObject = __webpack_require__(/*! ../internals/an-object */ "../node_modules/core-js/internals/an-object.js");
|
|
|
|
var concat = uncurryThis([].concat);
|
|
|
|
// all object keys, includes non-enumerable and symbols
|
|
module.exports = getBuiltIn('Reflect', 'ownKeys') || function ownKeys(it) {
|
|
var keys = getOwnPropertyNamesModule.f(anObject(it));
|
|
var getOwnPropertySymbols = getOwnPropertySymbolsModule.f;
|
|
return getOwnPropertySymbols ? concat(keys, getOwnPropertySymbols(it)) : keys;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/require-object-coercible.js":
|
|
/*!*********************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/require-object-coercible.js ***!
|
|
\*********************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var isNullOrUndefined = __webpack_require__(/*! ../internals/is-null-or-undefined */ "../node_modules/core-js/internals/is-null-or-undefined.js");
|
|
|
|
var $TypeError = TypeError;
|
|
|
|
// `RequireObjectCoercible` abstract operation
|
|
// https://tc39.es/ecma262/#sec-requireobjectcoercible
|
|
module.exports = function (it) {
|
|
if (isNullOrUndefined(it)) throw new $TypeError("Can't call method on " + it);
|
|
return it;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/shared-key.js":
|
|
/*!*******************************************************!*\
|
|
!*** ../node_modules/core-js/internals/shared-key.js ***!
|
|
\*******************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var shared = __webpack_require__(/*! ../internals/shared */ "../node_modules/core-js/internals/shared.js");
|
|
var uid = __webpack_require__(/*! ../internals/uid */ "../node_modules/core-js/internals/uid.js");
|
|
|
|
var keys = shared('keys');
|
|
|
|
module.exports = function (key) {
|
|
return keys[key] || (keys[key] = uid(key));
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/shared-store.js":
|
|
/*!*********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/shared-store.js ***!
|
|
\*********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var IS_PURE = __webpack_require__(/*! ../internals/is-pure */ "../node_modules/core-js/internals/is-pure.js");
|
|
var globalThis = __webpack_require__(/*! ../internals/global-this */ "../node_modules/core-js/internals/global-this.js");
|
|
var defineGlobalProperty = __webpack_require__(/*! ../internals/define-global-property */ "../node_modules/core-js/internals/define-global-property.js");
|
|
|
|
var SHARED = '__core-js_shared__';
|
|
var store = module.exports = globalThis[SHARED] || defineGlobalProperty(SHARED, {});
|
|
|
|
(store.versions || (store.versions = [])).push({
|
|
version: '3.38.1',
|
|
mode: IS_PURE ? 'pure' : 'global',
|
|
copyright: '© 2014-2024 Denis Pushkarev (zloirock.ru)',
|
|
license: 'https://github.com/zloirock/core-js/blob/v3.38.1/LICENSE',
|
|
source: 'https://github.com/zloirock/core-js'
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/shared.js":
|
|
/*!***************************************************!*\
|
|
!*** ../node_modules/core-js/internals/shared.js ***!
|
|
\***************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var store = __webpack_require__(/*! ../internals/shared-store */ "../node_modules/core-js/internals/shared-store.js");
|
|
|
|
module.exports = function (key, value) {
|
|
return store[key] || (store[key] = value || {});
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/symbol-constructor-detection.js":
|
|
/*!*************************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/symbol-constructor-detection.js ***!
|
|
\*************************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
/* eslint-disable es/no-symbol -- required for testing */
|
|
var V8_VERSION = __webpack_require__(/*! ../internals/environment-v8-version */ "../node_modules/core-js/internals/environment-v8-version.js");
|
|
var fails = __webpack_require__(/*! ../internals/fails */ "../node_modules/core-js/internals/fails.js");
|
|
var globalThis = __webpack_require__(/*! ../internals/global-this */ "../node_modules/core-js/internals/global-this.js");
|
|
|
|
var $String = globalThis.String;
|
|
|
|
// eslint-disable-next-line es/no-object-getownpropertysymbols -- required for testing
|
|
module.exports = !!Object.getOwnPropertySymbols && !fails(function () {
|
|
var symbol = Symbol('symbol detection');
|
|
// Chrome 38 Symbol has incorrect toString conversion
|
|
// `get-own-property-symbols` polyfill symbols converted to object are not Symbol instances
|
|
// nb: Do not call `String` directly to avoid this being optimized out to `symbol+''` which will,
|
|
// of course, fail.
|
|
return !$String(symbol) || !(Object(symbol) instanceof Symbol) ||
|
|
// Chrome 38-40 symbols are not inherited from DOM collections prototypes to instances
|
|
!Symbol.sham && V8_VERSION && V8_VERSION < 41;
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/to-absolute-index.js":
|
|
/*!**************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/to-absolute-index.js ***!
|
|
\**************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var toIntegerOrInfinity = __webpack_require__(/*! ../internals/to-integer-or-infinity */ "../node_modules/core-js/internals/to-integer-or-infinity.js");
|
|
|
|
var max = Math.max;
|
|
var min = Math.min;
|
|
|
|
// Helper for a popular repeating case of the spec:
|
|
// Let integer be ? ToInteger(index).
|
|
// If integer < 0, let result be max((length + integer), 0); else let result be min(integer, length).
|
|
module.exports = function (index, length) {
|
|
var integer = toIntegerOrInfinity(index);
|
|
return integer < 0 ? max(integer + length, 0) : min(integer, length);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/to-indexed-object.js":
|
|
/*!**************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/to-indexed-object.js ***!
|
|
\**************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
// toObject with fallback for non-array-like ES3 strings
|
|
var IndexedObject = __webpack_require__(/*! ../internals/indexed-object */ "../node_modules/core-js/internals/indexed-object.js");
|
|
var requireObjectCoercible = __webpack_require__(/*! ../internals/require-object-coercible */ "../node_modules/core-js/internals/require-object-coercible.js");
|
|
|
|
module.exports = function (it) {
|
|
return IndexedObject(requireObjectCoercible(it));
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/to-integer-or-infinity.js":
|
|
/*!*******************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/to-integer-or-infinity.js ***!
|
|
\*******************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var trunc = __webpack_require__(/*! ../internals/math-trunc */ "../node_modules/core-js/internals/math-trunc.js");
|
|
|
|
// `ToIntegerOrInfinity` abstract operation
|
|
// https://tc39.es/ecma262/#sec-tointegerorinfinity
|
|
module.exports = function (argument) {
|
|
var number = +argument;
|
|
// eslint-disable-next-line no-self-compare -- NaN check
|
|
return number !== number || number === 0 ? 0 : trunc(number);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/to-length.js":
|
|
/*!******************************************************!*\
|
|
!*** ../node_modules/core-js/internals/to-length.js ***!
|
|
\******************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var toIntegerOrInfinity = __webpack_require__(/*! ../internals/to-integer-or-infinity */ "../node_modules/core-js/internals/to-integer-or-infinity.js");
|
|
|
|
var min = Math.min;
|
|
|
|
// `ToLength` abstract operation
|
|
// https://tc39.es/ecma262/#sec-tolength
|
|
module.exports = function (argument) {
|
|
var len = toIntegerOrInfinity(argument);
|
|
return len > 0 ? min(len, 0x1FFFFFFFFFFFFF) : 0; // 2 ** 53 - 1 == 9007199254740991
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/to-object.js":
|
|
/*!******************************************************!*\
|
|
!*** ../node_modules/core-js/internals/to-object.js ***!
|
|
\******************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var requireObjectCoercible = __webpack_require__(/*! ../internals/require-object-coercible */ "../node_modules/core-js/internals/require-object-coercible.js");
|
|
|
|
var $Object = Object;
|
|
|
|
// `ToObject` abstract operation
|
|
// https://tc39.es/ecma262/#sec-toobject
|
|
module.exports = function (argument) {
|
|
return $Object(requireObjectCoercible(argument));
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/to-primitive.js":
|
|
/*!*********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/to-primitive.js ***!
|
|
\*********************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var call = __webpack_require__(/*! ../internals/function-call */ "../node_modules/core-js/internals/function-call.js");
|
|
var isObject = __webpack_require__(/*! ../internals/is-object */ "../node_modules/core-js/internals/is-object.js");
|
|
var isSymbol = __webpack_require__(/*! ../internals/is-symbol */ "../node_modules/core-js/internals/is-symbol.js");
|
|
var getMethod = __webpack_require__(/*! ../internals/get-method */ "../node_modules/core-js/internals/get-method.js");
|
|
var ordinaryToPrimitive = __webpack_require__(/*! ../internals/ordinary-to-primitive */ "../node_modules/core-js/internals/ordinary-to-primitive.js");
|
|
var wellKnownSymbol = __webpack_require__(/*! ../internals/well-known-symbol */ "../node_modules/core-js/internals/well-known-symbol.js");
|
|
|
|
var $TypeError = TypeError;
|
|
var TO_PRIMITIVE = wellKnownSymbol('toPrimitive');
|
|
|
|
// `ToPrimitive` abstract operation
|
|
// https://tc39.es/ecma262/#sec-toprimitive
|
|
module.exports = function (input, pref) {
|
|
if (!isObject(input) || isSymbol(input)) return input;
|
|
var exoticToPrim = getMethod(input, TO_PRIMITIVE);
|
|
var result;
|
|
if (exoticToPrim) {
|
|
if (pref === undefined) pref = 'default';
|
|
result = call(exoticToPrim, input, pref);
|
|
if (!isObject(result) || isSymbol(result)) return result;
|
|
throw new $TypeError("Can't convert object to primitive value");
|
|
}
|
|
if (pref === undefined) pref = 'number';
|
|
return ordinaryToPrimitive(input, pref);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/to-property-key.js":
|
|
/*!************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/to-property-key.js ***!
|
|
\************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var toPrimitive = __webpack_require__(/*! ../internals/to-primitive */ "../node_modules/core-js/internals/to-primitive.js");
|
|
var isSymbol = __webpack_require__(/*! ../internals/is-symbol */ "../node_modules/core-js/internals/is-symbol.js");
|
|
|
|
// `ToPropertyKey` abstract operation
|
|
// https://tc39.es/ecma262/#sec-topropertykey
|
|
module.exports = function (argument) {
|
|
var key = toPrimitive(argument, 'string');
|
|
return isSymbol(key) ? key : key + '';
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/try-to-string.js":
|
|
/*!**********************************************************!*\
|
|
!*** ../node_modules/core-js/internals/try-to-string.js ***!
|
|
\**********************************************************/
|
|
/***/ ((module) => {
|
|
|
|
"use strict";
|
|
|
|
var $String = String;
|
|
|
|
module.exports = function (argument) {
|
|
try {
|
|
return $String(argument);
|
|
} catch (error) {
|
|
return 'Object';
|
|
}
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/uid.js":
|
|
/*!************************************************!*\
|
|
!*** ../node_modules/core-js/internals/uid.js ***!
|
|
\************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var uncurryThis = __webpack_require__(/*! ../internals/function-uncurry-this */ "../node_modules/core-js/internals/function-uncurry-this.js");
|
|
|
|
var id = 0;
|
|
var postfix = Math.random();
|
|
var toString = uncurryThis(1.0.toString);
|
|
|
|
module.exports = function (key) {
|
|
return 'Symbol(' + (key === undefined ? '' : key) + ')_' + toString(++id + postfix, 36);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/use-symbol-as-uid.js":
|
|
/*!**************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/use-symbol-as-uid.js ***!
|
|
\**************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
/* eslint-disable es/no-symbol -- required for testing */
|
|
var NATIVE_SYMBOL = __webpack_require__(/*! ../internals/symbol-constructor-detection */ "../node_modules/core-js/internals/symbol-constructor-detection.js");
|
|
|
|
module.exports = NATIVE_SYMBOL
|
|
&& !Symbol.sham
|
|
&& typeof Symbol.iterator == 'symbol';
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/v8-prototype-define-bug.js":
|
|
/*!********************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/v8-prototype-define-bug.js ***!
|
|
\********************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var DESCRIPTORS = __webpack_require__(/*! ../internals/descriptors */ "../node_modules/core-js/internals/descriptors.js");
|
|
var fails = __webpack_require__(/*! ../internals/fails */ "../node_modules/core-js/internals/fails.js");
|
|
|
|
// V8 ~ Chrome 36-
|
|
// https://bugs.chromium.org/p/v8/issues/detail?id=3334
|
|
module.exports = DESCRIPTORS && fails(function () {
|
|
// eslint-disable-next-line es/no-object-defineproperty -- required for testing
|
|
return Object.defineProperty(function () { /* empty */ }, 'prototype', {
|
|
value: 42,
|
|
writable: false
|
|
}).prototype !== 42;
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/weak-map-basic-detection.js":
|
|
/*!*********************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/weak-map-basic-detection.js ***!
|
|
\*********************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var globalThis = __webpack_require__(/*! ../internals/global-this */ "../node_modules/core-js/internals/global-this.js");
|
|
var isCallable = __webpack_require__(/*! ../internals/is-callable */ "../node_modules/core-js/internals/is-callable.js");
|
|
|
|
var WeakMap = globalThis.WeakMap;
|
|
|
|
module.exports = isCallable(WeakMap) && /native code/.test(String(WeakMap));
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/internals/well-known-symbol.js":
|
|
/*!**************************************************************!*\
|
|
!*** ../node_modules/core-js/internals/well-known-symbol.js ***!
|
|
\**************************************************************/
|
|
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var globalThis = __webpack_require__(/*! ../internals/global-this */ "../node_modules/core-js/internals/global-this.js");
|
|
var shared = __webpack_require__(/*! ../internals/shared */ "../node_modules/core-js/internals/shared.js");
|
|
var hasOwn = __webpack_require__(/*! ../internals/has-own-property */ "../node_modules/core-js/internals/has-own-property.js");
|
|
var uid = __webpack_require__(/*! ../internals/uid */ "../node_modules/core-js/internals/uid.js");
|
|
var NATIVE_SYMBOL = __webpack_require__(/*! ../internals/symbol-constructor-detection */ "../node_modules/core-js/internals/symbol-constructor-detection.js");
|
|
var USE_SYMBOL_AS_UID = __webpack_require__(/*! ../internals/use-symbol-as-uid */ "../node_modules/core-js/internals/use-symbol-as-uid.js");
|
|
|
|
var Symbol = globalThis.Symbol;
|
|
var WellKnownSymbolsStore = shared('wks');
|
|
var createWellKnownSymbol = USE_SYMBOL_AS_UID ? Symbol['for'] || Symbol : Symbol && Symbol.withoutSetter || uid;
|
|
|
|
module.exports = function (name) {
|
|
if (!hasOwn(WellKnownSymbolsStore, name)) {
|
|
WellKnownSymbolsStore[name] = NATIVE_SYMBOL && hasOwn(Symbol, name)
|
|
? Symbol[name]
|
|
: createWellKnownSymbol('Symbol.' + name);
|
|
} return WellKnownSymbolsStore[name];
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/modules/es.array.includes.js":
|
|
/*!************************************************************!*\
|
|
!*** ../node_modules/core-js/modules/es.array.includes.js ***!
|
|
\************************************************************/
|
|
/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var $ = __webpack_require__(/*! ../internals/export */ "../node_modules/core-js/internals/export.js");
|
|
var $includes = (__webpack_require__(/*! ../internals/array-includes */ "../node_modules/core-js/internals/array-includes.js").includes);
|
|
var fails = __webpack_require__(/*! ../internals/fails */ "../node_modules/core-js/internals/fails.js");
|
|
var addToUnscopables = __webpack_require__(/*! ../internals/add-to-unscopables */ "../node_modules/core-js/internals/add-to-unscopables.js");
|
|
|
|
// FF99+ bug
|
|
var BROKEN_ON_SPARSE = fails(function () {
|
|
// eslint-disable-next-line es/no-array-prototype-includes -- detection
|
|
return !Array(1).includes();
|
|
});
|
|
|
|
// `Array.prototype.includes` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.includes
|
|
$({ target: 'Array', proto: true, forced: BROKEN_ON_SPARSE }, {
|
|
includes: function includes(el /* , fromIndex = 0 */) {
|
|
return $includes(this, el, arguments.length > 1 ? arguments[1] : undefined);
|
|
}
|
|
});
|
|
|
|
// https://tc39.es/ecma262/#sec-array.prototype-@@unscopables
|
|
addToUnscopables('includes');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ "../node_modules/core-js/modules/es.array.push.js":
|
|
/*!********************************************************!*\
|
|
!*** ../node_modules/core-js/modules/es.array.push.js ***!
|
|
\********************************************************/
|
|
/***/ ((__unused_webpack_module, __unused_webpack_exports, __webpack_require__) => {
|
|
|
|
"use strict";
|
|
|
|
var $ = __webpack_require__(/*! ../internals/export */ "../node_modules/core-js/internals/export.js");
|
|
var toObject = __webpack_require__(/*! ../internals/to-object */ "../node_modules/core-js/internals/to-object.js");
|
|
var lengthOfArrayLike = __webpack_require__(/*! ../internals/length-of-array-like */ "../node_modules/core-js/internals/length-of-array-like.js");
|
|
var setArrayLength = __webpack_require__(/*! ../internals/array-set-length */ "../node_modules/core-js/internals/array-set-length.js");
|
|
var doesNotExceedSafeInteger = __webpack_require__(/*! ../internals/does-not-exceed-safe-integer */ "../node_modules/core-js/internals/does-not-exceed-safe-integer.js");
|
|
var fails = __webpack_require__(/*! ../internals/fails */ "../node_modules/core-js/internals/fails.js");
|
|
|
|
var INCORRECT_TO_LENGTH = fails(function () {
|
|
return [].push.call({ length: 0x100000000 }, 1) !== 4294967297;
|
|
});
|
|
|
|
// V8 <= 121 and Safari <= 15.4; FF < 23 throws InternalError
|
|
// https://bugs.chromium.org/p/v8/issues/detail?id=12681
|
|
var properErrorOnNonWritableLength = function () {
|
|
try {
|
|
// eslint-disable-next-line es/no-object-defineproperty -- safe
|
|
Object.defineProperty([], 'length', { writable: false }).push();
|
|
} catch (error) {
|
|
return error instanceof TypeError;
|
|
}
|
|
};
|
|
|
|
var FORCED = INCORRECT_TO_LENGTH || !properErrorOnNonWritableLength();
|
|
|
|
// `Array.prototype.push` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.push
|
|
$({ target: 'Array', proto: true, arity: 1, forced: FORCED }, {
|
|
// eslint-disable-next-line no-unused-vars -- required for `.length`
|
|
push: function push(item) {
|
|
var O = toObject(this);
|
|
var len = lengthOfArrayLike(O);
|
|
var argCount = arguments.length;
|
|
doesNotExceedSafeInteger(len + argCount);
|
|
for (var i = 0; i < argCount; i++) {
|
|
O[len] = arguments[i];
|
|
len++;
|
|
}
|
|
setArrayLength(O, len);
|
|
return len;
|
|
}
|
|
});
|
|
|
|
|
|
/***/ })
|
|
|
|
/******/ });
|
|
/************************************************************************/
|
|
/******/ // The module cache
|
|
/******/ var __webpack_module_cache__ = {};
|
|
/******/
|
|
/******/ // The require function
|
|
/******/ function __webpack_require__(moduleId) {
|
|
/******/ // Check if module is in cache
|
|
/******/ var cachedModule = __webpack_module_cache__[moduleId];
|
|
/******/ if (cachedModule !== undefined) {
|
|
/******/ return cachedModule.exports;
|
|
/******/ }
|
|
/******/ // Create a new module (and put it into the cache)
|
|
/******/ var module = __webpack_module_cache__[moduleId] = {
|
|
/******/ // no module.id needed
|
|
/******/ // no module.loaded needed
|
|
/******/ exports: {}
|
|
/******/ };
|
|
/******/
|
|
/******/ // Execute the module function
|
|
/******/ __webpack_modules__[moduleId].call(module.exports, module, module.exports, __webpack_require__);
|
|
/******/
|
|
/******/ // Return the exports of the module
|
|
/******/ return module.exports;
|
|
/******/ }
|
|
/******/
|
|
/************************************************************************/
|
|
/******/ /* webpack/runtime/compat get default export */
|
|
/******/ (() => {
|
|
/******/ // getDefaultExport function for compatibility with non-harmony modules
|
|
/******/ __webpack_require__.n = (module) => {
|
|
/******/ var getter = module && module.__esModule ?
|
|
/******/ () => (module['default']) :
|
|
/******/ () => (module);
|
|
/******/ __webpack_require__.d(getter, { a: getter });
|
|
/******/ return getter;
|
|
/******/ };
|
|
/******/ })();
|
|
/******/
|
|
/******/ /* webpack/runtime/define property getters */
|
|
/******/ (() => {
|
|
/******/ // define getter functions for harmony exports
|
|
/******/ __webpack_require__.d = (exports, definition) => {
|
|
/******/ for(var key in definition) {
|
|
/******/ if(__webpack_require__.o(definition, key) && !__webpack_require__.o(exports, key)) {
|
|
/******/ Object.defineProperty(exports, key, { enumerable: true, get: definition[key] });
|
|
/******/ }
|
|
/******/ }
|
|
/******/ };
|
|
/******/ })();
|
|
/******/
|
|
/******/ /* webpack/runtime/global */
|
|
/******/ (() => {
|
|
/******/ __webpack_require__.g = (function() {
|
|
/******/ if (typeof globalThis === 'object') return globalThis;
|
|
/******/ try {
|
|
/******/ return this || new Function('return this')();
|
|
/******/ } catch (e) {
|
|
/******/ if (typeof window === 'object') return window;
|
|
/******/ }
|
|
/******/ })();
|
|
/******/ })();
|
|
/******/
|
|
/******/ /* webpack/runtime/hasOwnProperty shorthand */
|
|
/******/ (() => {
|
|
/******/ __webpack_require__.o = (obj, prop) => (Object.prototype.hasOwnProperty.call(obj, prop))
|
|
/******/ })();
|
|
/******/
|
|
/******/ /* webpack/runtime/make namespace object */
|
|
/******/ (() => {
|
|
/******/ // define __esModule on exports
|
|
/******/ __webpack_require__.r = (exports) => {
|
|
/******/ if(typeof Symbol !== 'undefined' && Symbol.toStringTag) {
|
|
/******/ Object.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });
|
|
/******/ }
|
|
/******/ Object.defineProperty(exports, '__esModule', { value: true });
|
|
/******/ };
|
|
/******/ })();
|
|
/******/
|
|
/************************************************************************/
|
|
var __webpack_exports__ = {};
|
|
// This entry need to be wrapped in an IIFE because it need to be in strict mode.
|
|
(() => {
|
|
"use strict";
|
|
/*!**************************************!*\
|
|
!*** ../core/app/assets/js/index.js ***!
|
|
\**************************************/
|
|
|
|
|
|
var _interopRequireDefault = __webpack_require__(/*! @babel/runtime/helpers/interopRequireDefault */ "../node_modules/@babel/runtime/helpers/interopRequireDefault.js");
|
|
var _siteEditor = _interopRequireDefault(__webpack_require__(/*! ../../modules/site-editor/assets/js/site-editor */ "../core/app/modules/site-editor/assets/js/site-editor.js"));
|
|
new _siteEditor.default();
|
|
})();
|
|
|
|
/******/ })()
|
|
;
|
|
//# sourceMappingURL=app.js.map
|